Compare commits

...

60 Commits

Author SHA1 Message Date
Felix Linker
2eed1bc85b Add time to deplete armour/shields 2021-05-15 20:21:00 +02:00
Felix Linker
3469af10b6 Update ShipPicker 2021-05-15 15:23:36 +02:00
Felix Linker
629ba35bc5 Update engagement range and slider 2021-05-15 14:58:10 +02:00
Felix Linker
e453ff73b7 Migrate changes to slot-representation 2021-05-14 10:22:28 +02:00
Felix Linker
c73ce1c234 Fix: don't cast mount symbol in available modules to string 2021-05-10 21:13:02 +02:00
Felix Linker
00d3a93b91 Re-design shipyard page
Closes #577
2021-05-09 20:09:15 +02:00
Felix Linker
d4e612cb61 Display module selection for alloys correctly
Closes #579
2021-05-09 18:42:37 +02:00
Felix Linker
c07cfc6e70 Don't round integers 2021-02-01 22:52:04 +01:00
Felix Linker
c4c6d32a5d Skip properties that do not apply to a module in blueprint tooltip 2021-02-01 22:41:41 +01:00
Felix Linker
a65bb06754 Implement tooltips for experimental effects 2021-02-01 22:40:01 +01:00
Felix Linker
23548e7c5c Remove redundant code 2021-02-01 22:14:22 +01:00
Felix Linker
74e6f54e19 Improve blueprint tooltips 2021-02-01 22:10:09 +01:00
Felix Linker
a46f8f97f6 Show blueprint grade in ascending order 2021-02-01 22:02:37 +01:00
Felix Linker
44dbdb1703 Don't show mass twice and allow to disable showing mass 2021-02-01 21:56:35 +01:00
Felix Linker
187c5dae4a Implement blueprint tooltips 2021-01-10 22:57:33 +01:00
Felix Linker
07d324a3fa Add key to property header in ModificationsMenu 2021-01-10 22:02:00 +01:00
Felix Linker
5c63afd96c Add stats mapper to show certain synthetic props in ModificationsMenu 2021-01-10 22:01:21 +01:00
Felix Linker
53c40ac9c4 Fix indentation 2021-01-10 21:59:22 +01:00
Felix Linker
a180cbfdd4 Fix: showProp is not required in <Modification> 2021-01-10 21:58:35 +01:00
Felix Linker
fc1524a943 Support non-percent modifiers 2021-01-03 12:32:01 +01:00
Felix Linker
c3747e4e5e Add toggle for properties in overview 2021-01-03 10:17:10 +01:00
Felix Linker
ab153981c9 Rework Modifictaions(Menu) 2021-01-02 10:59:58 +01:00
Felix Linker
a970e052c1 Update react-number-editor
Mitigates a bug where non-rounded numbers were shown to the user.
2021-01-02 10:55:16 +01:00
Felix Linker
df7e264a02 Use package-lock.json
Otherwise `npm audit` does not work.
2021-01-02 10:54:44 +01:00
Felix Linker
cdcda004f3 Implement units in modifications menu 2020-12-31 18:54:36 +01:00
Felix Linker
20e448fc0a Optimize constructors 2020-12-29 16:39:18 +01:00
Felix Linker
436e626c42 Group module selection by category 2020-12-29 16:37:28 +01:00
Felix Linker
3dd4675a0b Hide searchbar for core internal modules 2020-12-29 16:36:43 +01:00
Felix Linker
d3766d9e17 Migrate ed-forge API change 2020-12-29 13:18:57 +01:00
Felix Linker
d987c08ac8 Ship summary key for ship type is id 2020-12-29 12:23:23 +01:00
Felix Linker
f865ef6c6c Fix retrofit cost 2020-11-01 19:54:48 +01:00
Felix Linker
f2b7daac82 MovementProfile code includes pips for re-render on state change 2020-11-01 18:29:04 +01:00
Felix Linker
832bc488b6 Fix excluding modules from costs 2020-11-01 18:25:28 +01:00
Felix Linker
f513166d6c Rework boost button 2020-11-01 17:56:33 +01:00
Felix Linker
61fd0eb991 Rework profiles section 2020-11-01 16:01:53 +01:00
Felix Linker
1e51e7d4a6 Rework WeaponDamageChart 2020-11-01 15:58:28 +01:00
Felix Linker
4943d36bb8 Rework FSD profile 2020-11-01 02:59:37 +01:00
Felix Linker
9271d1fa09 Rework Movement graph 2020-11-01 02:32:52 +01:00
Felix Linker
8a09d94dfa Rework EngineProfile 2020-11-01 02:19:59 +01:00
Felix Linker
c44925dd62 Show normal speed in summary 2020-10-31 13:03:10 +01:00
Felix Linker
d006bbcb0f Handle no shield 2020-10-31 13:02:51 +01:00
Felix Linker
14453f6b80 Rework defence tab 2020-10-24 17:47:17 +02:00
felixlinker
8c267150a9 Rework Offence tab 2020-08-13 20:20:22 +02:00
felixlinker
ed60a78be0 Priority groups are zero indexed 2020-08-09 19:00:57 +02:00
felixlinker
82142b0cb1 Use Module.setEnabled in Power Management table 2020-08-09 19:00:45 +02:00
felixlinker
d8949fedb2 Rework PIP menu 2020-08-09 18:39:39 +02:00
felixlinker
cf72bd11a8 Replace manual bind(this) calls with auto-bind 2020-08-09 17:41:15 +02:00
Felix Linker
16ef7ea389 Rework cost section 2020-04-30 14:25:07 +02:00
Felix Linker
ff455e349e Implement coding standards 2020-04-16 15:22:07 +02:00
Felix Linker
ba9e7f1a32 Add code props variable as ship hash to update changes 2020-04-16 15:12:38 +02:00
Felix Linker
904498b20c Make power stats working 2020-04-15 19:59:50 +02:00
Felix Linker
409be7374c Make outfitting page working 2020-04-10 13:19:53 +02:00
Felix Linker
00c525e6ab Update shipyard-page to ed-forge 2020-04-10 12:50:56 +02:00
felixlinker
a2f52c03a1 Move hardpoint class for module selection into leaves of HTML tree 2019-10-10 18:18:18 +02:00
felixlinker
037df6b166 Remove InternalSlot component 2019-10-10 16:42:14 +02:00
felixlinker
90ab5b4b0a Remove component HardpointSlot 2019-10-10 16:30:51 +02:00
felixlinker
7bbfa8c43f Remove component StandardSlot 2019-10-10 16:11:54 +02:00
felixlinker
2fbcd158cc Rewrite ModificationsMenu 2019-10-10 16:06:41 +02:00
felixlinker
33c201800e Rewrite AvailableModulesMenu.jsx 2019-10-08 22:53:31 +02:00
Felix Linker
9797a8d781 First steps towards ed-forge rewrite 2019-10-08 15:02:16 +02:00
59 changed files with 28247 additions and 5310 deletions

1
.gitignore vendored
View File

@@ -10,4 +10,3 @@ env
.project .project
.vscode/ .vscode/
docs/ docs/
package-lock.json

1
.npmrc
View File

@@ -1 +0,0 @@
package-lock=false

25347
package-lock.json generated Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -123,11 +123,13 @@
"sideEffects": false, "sideEffects": false,
"dependencies": { "dependencies": {
"@babel/polyfill": "^7.0.0", "@babel/polyfill": "^7.0.0",
"auto-bind": "^2.1.1",
"browserify-zlib-next": "^1.0.1", "browserify-zlib-next": "^1.0.1",
"classnames": "^2.2.6", "classnames": "^2.2.6",
"coriolis-data": "../coriolis-data", "coriolis-data": "../coriolis-data",
"d3": "^5.7.0", "d3": "^5.7.0",
"detect-browser": "^3.0.1", "detect-browser": "^3.0.1",
"ed-forge": "github:EDCD/ed-forge",
"fbemitter": "^2.1.1", "fbemitter": "^2.1.1",
"lodash": "^4.17.11", "lodash": "^4.17.11",
"lz-string": "^1.4.4", "lz-string": "^1.4.4",
@@ -138,7 +140,7 @@
"react-extras": "^0.7.1", "react-extras": "^0.7.1",
"react-fuzzy": "^0.5.2", "react-fuzzy": "^0.5.2",
"react-ga": "^2.5.3", "react-ga": "^2.5.3",
"react-number-editor": "Athanasius/react-number-editor.git#miggy", "react-number-editor": "^4.0.3",
"recharts": "^1.2.0", "recharts": "^1.2.0",
"register-service-worker": "^1.5.2", "register-service-worker": "^1.5.2",
"superagent": "^3.8.3" "superagent": "^3.8.3"

View File

@@ -5,16 +5,14 @@ import { register } from 'register-service-worker';
import { EventEmitter } from 'fbemitter'; import { EventEmitter } from 'fbemitter';
import { getLanguage } from './i18n/Language'; import { getLanguage } from './i18n/Language';
import Persist from './stores/Persist'; import Persist from './stores/Persist';
import { Ship } from 'ed-forge';
import Announcement from './components/Announcement'; import Announcement from './components/Announcement';
import Header from './components/Header'; import Header from './components/Header';
import Tooltip from './components/Tooltip'; import Tooltip from './components/Tooltip';
import ModalExport from './components/ModalExport';
import ModalHelp from './components/ModalHelp'; import ModalHelp from './components/ModalHelp';
import ModalImport from './components/ModalImport'; import ModalImport from './components/ModalImport';
import ModalPermalink from './components/ModalPermalink'; import ModalPermalink from './components/ModalPermalink';
import * as CompanionApiUtils from './utils/CompanionApiUtils';
import * as JournalUtils from './utils/JournalUtils';
import AboutPage from './pages/AboutPage'; import AboutPage from './pages/AboutPage';
import NotFoundPage from './pages/NotFoundPage'; import NotFoundPage from './pages/NotFoundPage';
import OutfittingPage from './pages/OutfittingPage'; import OutfittingPage from './pages/OutfittingPage';
@@ -22,7 +20,6 @@ import ComparisonPage from './pages/ComparisonPage';
import ShipyardPage from './pages/ShipyardPage'; import ShipyardPage from './pages/ShipyardPage';
import ErrorDetails from './pages/ErrorDetails'; import ErrorDetails from './pages/ErrorDetails';
const zlib = require('pako');
const request = require('superagent'); const request = require('superagent');
/** /**
@@ -61,7 +58,6 @@ export default class Coriolis extends React.Component {
this._onLanguageChange = this._onLanguageChange.bind(this); this._onLanguageChange = this._onLanguageChange.bind(this);
this._onSizeRatioChange = this._onSizeRatioChange.bind(this); this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
this._keyDown = this._keyDown.bind(this); this._keyDown = this._keyDown.bind(this);
this._importBuild = this._importBuild.bind(this);
this.emitter = new EventEmitter(); this.emitter = new EventEmitter();
this.state = { this.state = {
@@ -93,19 +89,10 @@ export default class Coriolis extends React.Component {
_importBuild(r) { _importBuild(r) {
try { try {
// Need to decode and gunzip the data, then build the ship // Need to decode and gunzip the data, then build the ship
const data = zlib.inflate(new Buffer(r.params.data, 'base64'), { to: 'string' }); let ship = new Ship(r.params.data);
const json = JSON.parse(data); r.params.ship = ship.getShipType();
console.info('Ship import data: '); r.params.code = ship.compress();
console.info(json); this._setPage(OutfittingPage, r);
let ship;
if (json && json.modules) {
ship = CompanionApiUtils.shipFromJson(json);
} else if (json && json.Modules) {
ship = JournalUtils.shipFromLoadoutJSON(json);
}
r.params.ship = ship.id;
r.params.code = ship.toString();
this._setPage(OutfittingPage, r)
} catch (err) { } catch (err) {
this._onError('Failed to import ship', r.path, 0, 0, err); this._onError('Failed to import ship', r.path, 0, 0, err);
} }

View File

@@ -6,7 +6,6 @@ import { autoBind } from 'react-extras';
* Announcement component * Announcement component
*/ */
export default class Announcement extends React.Component { export default class Announcement extends React.Component {
static propTypes = { static propTypes = {
text: PropTypes.string text: PropTypes.string
}; };
@@ -27,5 +26,4 @@ export default class Announcement extends React.Component {
render() { render() {
return <div className="announcement" >{this.props.text}</div>; return <div className="announcement" >{this.props.text}</div>;
} }
} }

View File

@@ -1,120 +1,20 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import FuzzySearch from 'react-fuzzy'; import FuzzySearch from 'react-fuzzy';
import { getModuleInfo } from 'ed-forge/lib/data/items';
import { groupBy, mapValues, sortBy } from 'lodash';
import autoBind from 'auto-bind';
const PRESS_THRESHOLD = 500; // mouse/touch down threshold const PRESS_THRESHOLD = 500; // mouse/touch down threshold
/* const MOUNT_MAP = {
* Categorisation of module groups fixed: <MountFixed className={'lg'} />,
*/ gimbal: <MountGimballed className={'lg'} />,
const GRPCAT = { turret: <MountTurret className={'lg'} />,
'sg': 'shields',
'bsg': 'shields',
'psg': 'shields',
'scb': 'shields',
'cc': 'limpet controllers',
'fx': 'limpet controllers',
'hb': 'limpet controllers',
'pc': 'limpet controllers',
'rpl': 'limpet controllers',
'pce': 'passenger cabins',
'pci': 'passenger cabins',
'pcm': 'passenger cabins',
'pcq': 'passenger cabins',
'fh': 'hangars',
'pv': 'hangars',
'fs': 'fuel',
'ft': 'fuel',
'hr': 'structural reinforcement',
'mrp': 'structural reinforcement',
'bl': 'lasers',
'pl': 'lasers',
'ul': 'lasers',
'ml': 'lasers',
'c': 'projectiles',
'mc': 'projectiles',
'axmc': 'experimental',
'fc': 'projectiles',
'rfl': 'experimental',
'pa': 'projectiles',
'rg': 'projectiles',
'mr': 'ordnance',
'axmr': 'experimental',
'rcpl': 'experimental',
'dtl': 'experimental',
'tbsc': 'experimental',
'tbem': 'experimental',
'tbrfl': 'experimental',
'mahr': 'experimental',
'rsl': 'experimental',
'tp': 'ordnance',
'nl': 'ordnance',
'sc': 'scanners',
'ss': 'scanners',
// Utilities
'cs': 'scanners',
'kw': 'scanners',
'ws': 'scanners',
'xs': 'scanners',
'ch': 'defence',
'po': 'defence',
'ec': 'defence',
'sfn': 'defence',
// Guardian
'gpp': 'guardian',
'gpc': 'guardian',
'gsrp': 'guardian',
'ggc': 'guardian',
'gfsb': 'guardian',
'gmrp': 'guardian',
'gsc': 'guardian',
'ghrp': 'guardian',
// Mining
'scl': 'mining',
'pwa': 'mining',
'sdm': 'mining',
// Assists
'dc': 'flight assists',
'sua': 'flight assists',
};
// Order here is the order in which items will be shown in the modules menu
const CATEGORIES = {
// Internals
'am': ['am'],
'cr': ['cr'],
'fi': ['fi'],
'fuel': ['ft', 'fs'],
'hangars': ['fh', 'pv'],
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl'],
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
'rf': ['rf'],
'shields': ['sg', 'bsg', 'psg', 'scb'],
'structural reinforcement': ['hr', 'mrp'],
'flight assists': ['dc', 'sua'],
// Hardpoints
'lasers': ['pl', 'ul', 'bl'],
'projectiles': ['mc', 'c', 'fc', 'pa', 'rg'],
'ordnance': ['mr', 'tp', 'nl'],
// Utilities
'sb': ['sb'],
'hs': ['hs'],
'defence': ['ch', 'po', 'ec'],
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
// Experimental
'experimental': ['axmc', 'axmr', 'rfl', 'tbrfl', 'tbsc', 'tbem', 'xs', 'sfn', 'rcpl', 'dtl', 'rsl', 'mahr',],
// Guardian
'guardian': ['gpp', 'gpd', 'gpc', 'ggc', 'gsrp', 'gfsb', 'ghrp', 'gmrp', 'gsc'],
'mining': ['ml', 'scl', 'pwa', 'sdm', 'abl'],
}; };
/** /**
@@ -122,15 +22,11 @@ const CATEGORIES = {
*/ */
export default class AvailableModulesMenu extends TranslatedComponent { export default class AvailableModulesMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
diffDetails: PropTypes.func, diffDetails: PropTypes.func,
hideSearch: PropTypes.bool,
m: PropTypes.object, m: PropTypes.object,
ship: PropTypes.object.isRequired,
warning: PropTypes.func, warning: PropTypes.func,
firstSlotId: PropTypes.string,
lastSlotId: PropTypes.string,
activeSlotId: PropTypes.string,
slotDiv: PropTypes.object slotDiv: PropTypes.object
}; };
@@ -141,10 +37,8 @@ export default class AvailableModulesMenu extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this._hideDiff = this._hideDiff.bind(this); autoBind(this);
this._showSearch = this._showSearch.bind(this);
this.state = this._initState(props, context); this.state = this._initState(props, context);
this.slotItems = [];// Array to hold <li> refs.
} }
/** /**
@@ -154,164 +48,103 @@ export default class AvailableModulesMenu extends TranslatedComponent {
* @return {Object} list: Array of React Components, currentGroup Component if any * @return {Object} list: Array of React Components, currentGroup Component if any
*/ */
_initState(props, context) { _initState(props, context) {
let translate = context.language.translate; const { translate } = context.language;
let { m, warning, onSelect, modules, ship } = props; const { m } = props;
let list, currentGroup; const list = [], fuzzy = [];
let currentGroup;
let buildGroup = this._buildGroup.bind( const modules = m.getApplicableItems().map(getModuleInfo);
this, const groups = mapValues(
ship, groupBy(modules, (info) => info.meta.group),
translate, (infos) => groupBy(infos, (info) => info.meta.type),
m,
warning,
(m, event) => {
this._hideDiff(event);
onSelect(m);
}
); );
let fuzzy = []; // Build categories sorted by translated category name
if (modules instanceof Array) { const groupKeys = sortBy(Object.keys(groups), translate);
list = buildGroup(modules[0].grp, modules); for (const group of groupKeys) {
} else { const groupName = translate(group);
list = []; if (groupKeys.length > 1) {
// At present time slots with grouped options (Hardpoints and Internal) can be empty list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>);
if (m) {
let emptyId = 'empty';
if (this.firstSlotId == null) this.firstSlotId = emptyId;
let keyDown = this._keyDown.bind(this, onSelect);
list.push(<div className='empty-c upp' key={emptyId} data-id={emptyId} onClick={onSelect.bind(null, null)}
onKeyDown={keyDown} tabIndex="0"
ref={slotItem => this.slotItems[emptyId] = slotItem}>{translate('empty')}</div>);
} }
// Need to regroup the modules by our own categorisation const categories = groups[group];
let catmodules = {}; const categoryKeys = sortBy(Object.keys(categories), translate);
// Pre-create to preserve ordering for (const category of categoryKeys) {
for (let cat in CATEGORIES) { const categoryName = translate(category);
catmodules[cat] = []; const infos = categories[category];
if (categoryKeys.length > 1) {
list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>);
} }
for (let g in modules) { list.push(
const moduleCategory = GRPCAT[g] || g; this._buildGroup(
const existing = catmodules[moduleCategory] || []; m,
catmodules[moduleCategory] = existing.concat(modules[g]); category,
} infos,
),
for (let category in catmodules) { );
let categoryHeader = false; fuzzy.push(
// Order through CATEGORIES if present ...infos.map((info) => {
const categories = CATEGORIES[category] || [category]; const { meta } = info;
if (categories && categories.length) { const mount = meta.mount ? ' ' + translate(meta.mount) : '';
for (let n in categories) { return {
const grp = categories[n]; grp: groupName,
// We now have the group and the category. We might not have any modules, though... cat: categoryName,
if (modules[grp]) { m: info.proto.Item,
// Decide if we need a category header as well as a group header name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
if (categories.length === 1) { };
// Show category header instead of group header }),
if (m && grp == m.grp) { );
list.push(<div ref={(elem) => this.groupElem = elem} key={category}
className={'select-category upp'}>{translate(category)}</div>);
} else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
}
} else {
// Show category header as well as group header
if (!categoryHeader) {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
categoryHeader = true;
}
if (m && grp == m.grp) {
list.push(<div ref={(elem) => this.groupElem = elem} key={grp}
className={'select-group cap'}>{translate(grp)}</div>);
} else {
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
} }
} }
list.push(buildGroup(grp, modules[grp])); return { list, currentGroup, fuzzy, trackingFocus: false };
for (const i of modules[grp]) {
let mount = '';
if (i.mount === 'F') {
mount = 'Fixed';
} else if (i.mount === 'G') {
mount = 'Gimballed';
} else if (i.mount === 'T') {
mount = 'Turreted';
}
const fuzz = { grp, m: i, name: `${i.class}${i.rating}${mount ? ' ' + mount : ''} ${translate(grp)}` };
fuzzy.push(fuzz);
}
}
}
}
}
}
let trackingFocus = false;
return { list, currentGroup, fuzzy, trackingFocus };
} }
/** /**
* Generate React Components for Module Group * Generate React Components for Module Group
* @param {Ship} ship Ship the selection is for
* @param {Function} translate Translate function
* @param {Object} mountedModule Mounted Module * @param {Object} mountedModule Mounted Module
* @param {Function} warningFunc Warning function * @param {String} category Category key
* @param {function} onSelect Select/Mount callback
* @param {string} grp Group name
* @param {Array} modules Available modules * @param {Array} modules Available modules
* @return {React.Component} Available Module Group contents * @return {React.Component} Available Module Group contents
*/ */
_buildGroup(ship, translate, mountedModule, warningFunc, onSelect, grp, modules) { _buildGroup(mountedModule, category, modules) {
let prevClass = null, prevRating = null, prevName; const { warning } = this.props;
let elems = []; const ship = mountedModule.getShip();
const classMapping = groupBy(modules, (info) => info.meta.class);
const sortedModules = modules.sort(this._moduleOrder); const itemsPerClass = Math.max(
...Object.values(classMapping).map((l) => l.length),
);
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
// Nested array of <li> elements; will be flattened before being rendered.
// Each sub-array represents one row in the final view.
const elems = [[]];
// Calculate the number of items per class. Used so we don't have long lists with only a few items in each row // Reverse sort for descending order of module class
const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => { for (const clazz of Object.keys(classMapping).sort().reverse()) {
count[cls] = ++count[cls] || 1; for (let info of sortBy(
return count; classMapping[clazz],
}, {}); (info) => info.meta.mount || info.meta.rating,
const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key])); )) {
const { meta } = info;
const { Item } = info.proto;
let itemsOnThisRow = 0; // Can only be true if shieldgenmaximalmass is defined, i.e. this
for (let i = 0; i < sortedModules.length; i++) { // module must be a shield generator
let m = sortedModules[i]; let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass');
let mount = null; if (meta.experimental && !mountedModule.readMeta('experimental')) {
let disabled = false; disabled =
prevName = m.name; 4 <=
if (ModuleUtils.isShieldGenerator(m.grp)) { ship.getHardpoints().filter((m) => m.readMeta('experimental'))
// Shield generators care about maximum hull mass .length;
disabled = ship.hullMass > m.maxmass;
// If the mounted module is experimental as well, we can replace it so
// the maximum does not apply
} else if (m.experimental && (!mountedModule || !mountedModule.experimental)) {
disabled = 4 <= ship.hardpoints.filter(o => o.m && o.m.experimental).length;
} }
let active = mountedModule && mountedModule.id === m.id;
let classes = cn(m.name ? 'lc' : 'c', {
warning: !disabled && warningFunc && warningFunc(m),
active,
disabled
});
let eventHandlers;
if (disabled) {
eventHandlers = {
onKeyDown: this._keyDown.bind(this, null),
onKeyUp: this._keyUp.bind(this, null)
// Default event handlers for objects that are disabled
let eventHandlers = {};
if (!disabled) {
const showDiff = this._showDiff.bind(this, mountedModule, info);
const select = (event) => {
this._hideDiff(event);
this.props.onSelect(Item);
}; };
} else {
/**
* Get the ids of the first and last <li> elements in the <ul> that are focusable (i.e. are not active or disabled)
* Will be used to keep focus inside the <ul> on Tab and Shift-Tab while it is visible
*/
if (this.firstSlotId == null) this.firstSlotId = sortedModules[i].id;
if (active) this.activeSlotId = sortedModules[i].id;
this.lastSlotId = sortedModules[i].id;
let showDiff = this._showDiff.bind(this, mountedModule, m);
let select = onSelect.bind(null, m);
eventHandlers = { eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff), onMouseEnter: this._over.bind(this, showDiff),
@@ -319,67 +152,67 @@ export default class AvailableModulesMenu extends TranslatedComponent {
onTouchEnd: this._touchEnd.bind(this, select), onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff, onMouseLeave: this._hideDiff,
onClick: select, onClick: select,
onKeyDown: this._keyDown.bind(this, select),
onKeyUp: this._keyUp.bind(this, select)
}; };
} }
switch (m.mount) { const mountSymbol = MOUNT_MAP[meta.mount];
case 'F': const li = (
mount = <MountFixed className={'lg'}/>; <li key={Item} data-id={Item}
break; ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
case 'G': className={cn(meta.type === 'armour' ? 'lc' : 'c', {
mount = <MountGimballed className={'lg'}/>; warning: !disabled && warning && warning(info),
break; active: mountedModule.getItem() === Item,
case 'T': disabled,
mount = <MountTurret className={'lg'}/>; hardpoint: mountSymbol,
break; })}
} {...eventHandlers}
if (m.name && m.name === prevName) { >{mountSymbol}{meta.type === 'armour' ? Item : `${meta.class}${meta.rating}`}</li>
// elems.push(<br key={'b' + m.grp + i} />);
itemsOnThisRow = 0;
}
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
elems.push(<br key={'b' + m.grp + i}/>);
itemsOnThisRow = 0;
}
let tbIdx = (classes.indexOf('disabled') < 0) ? 0 : undefined;
elems.push(
<li key={m.id} data-id={m.id} className={classes} {...eventHandlers} tabIndex={tbIdx}
ref={slotItem => this.slotItems[m.id] = slotItem}>
{mount}
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
</li>
); );
itemsOnThisRow++; const tail = elems.pop();
prevClass = m.class; let newTail = [tail];
prevRating = m.rating; if (tail.length < itemsPerRow) {
prevName = m.name; // If the row has not grown too long, the new <li> element can be
// added to the row itself
tail.push(li);
} else {
// Otherwise, the last row gets a line break element added and this
// item is put into a new row
tail.push(<br key={elems.length}/>);
newTail.push([li]);
} }
return <ul key={'modules' + grp}>{elems}</ul>; elems.push(...newTail);
}
}
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>;
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @param {Object} mm The module mounet currently * @param {Object} mountedModule The module mounted currently
* @param {Object} m The hovered module * @param {Object} hoveringModule The hovered module
* @param {DOMRect} rect DOMRect for target element * @param {DOMRect} rect DOMRect for target element
*/ */
_showDiff(mm, m, rect) { _showDiff(mountedModule, hoveringModule, rect) {
if (this.props.diffDetails) { if (this.props.diffDetails) {
this.touchTimeout = null; this.touchTimeout = null;
this.context.tooltip(this.props.diffDetails(m, mm), rect); // TODO:
// this.context.tooltip(
// this.props.diffDetails(hoveringModule, mountedModule),
// rect,
// );
} }
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @returns {React.Component} Search component if available
*/ */
_showSearch() { _showSearch() {
if (this.props.modules instanceof Array) { if (this.props.hideSearch) {
return; return;
} }
return ( return (
@@ -442,41 +275,6 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this._hideDiff(); this._hideDiff();
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {Function} select Select module callback
* @param {SyntheticEvent} event Event
*/
_keyDown(select, event) {
let className = event.currentTarget.attributes['class'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
select();
return;
}
let elemId = event.currentTarget.attributes['data-id'].value;
if (className.indexOf('disabled') < 0 && event.key == 'Tab') {
if (event.shiftKey && elemId == this.firstSlotId) {
event.preventDefault();
this.slotItems[this.lastSlotId].focus();
return;
}
if (!event.shiftKey && elemId == this.lastSlotId) {
event.preventDefault();
this.slotItems[this.firstSlotId].focus();
return;
}
}
}
/**
* Key Up
* @param {Function} select Select module callback
* @param {SytheticEvent} event Event
*/
_keyUp(select, event) {
// nothing here yet
}
/** /**
* Hide diff tooltip * Hide diff tooltip
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -487,60 +285,12 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this.context.tooltip(); this.context.tooltip();
} }
/**
* Order two modules suitably for display in module selection
* @param {Object} a the first module
* @param {Object} b the second module
* @return {int} -1 if the first module should go first, 1 if the second module should go first
*/
_moduleOrder(a, b) {
// Named modules go last
if (!a.name && b.name) {
return -1;
}
if (a.name && !b.name) {
return 1;
}
// Class ordered from highest (8) to lowest (1)
if (a.class < b.class) {
return 1;
}
if (a.class > b.class) {
return -1;
}
// Mount type, if applicable
if (a.mount && b.mount && a.mount !== b.mount) {
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
return -1;
} else {
return 1;
}
}
// Rating ordered from highest (A) to lowest (E)
if (a.rating < b.rating) {
return -1;
}
if (a.rating > b.rating) {
return 1;
}
// Do not attempt to order by name at this point, as that mucks up the order of armour
return 0;
}
/** /**
* Scroll to mounted (if it exists) module group on mount * Scroll to mounted (if it exists) module group on mount
*/ */
componentDidMount() { componentDidMount() {
if (this.groupElem) { // Scroll to currently selected group if (this.activeSlotRef) {
this.node.scrollTop = this.groupElem.offsetTop; this.activeSlotRef.focus();
}
/**
* Set focus on active or first slot element, if applicable.
*/
if (this.slotItems[this.activeSlotId]) {
this.slotItems[this.activeSlotId].focus();
} else if (this.slotItems[this.firstSlotId]) {
this.slotItems[this.firstSlotId].focus();
} }
} }

View File

@@ -1,6 +1,7 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
/** /**
* Boost displays a boost button that toggles bosot * Boost displays a boost button that toggles bosot
@@ -8,8 +9,6 @@ import TranslatedComponent from './TranslatedComponent';
*/ */
export default class Boost extends TranslatedComponent { export default class Boost extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
onChange: PropTypes.func.isRequired onChange: PropTypes.func.isRequired
}; };
@@ -19,12 +18,9 @@ export default class Boost extends TranslatedComponent {
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
const { ship, boost } = props; autoBind(this);
this._keyDown = this._keyDown.bind(this);
this._toggleBoost = this._toggleBoost.bind(this);
} }
/** /**
@@ -70,13 +66,12 @@ export default class Boost extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { ship, boost } = this.props;
// TODO disable if ship cannot boost
return ( return (
<span id='boost'> <span id='boost'>
<button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button> <button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}>
{translate('boost')}
</button>
</span> </span>
); );
} }

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Cargo slider * Cargo slider
@@ -21,8 +22,7 @@ export default class Cargo extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._cargoChange = this._cargoChange.bind(this);
} }
/** /**

View File

@@ -1,13 +1,14 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import Ship from '../shipyard/Ship'; import { Factory, Ship } from 'ed-forge';
import { Insurance } from '../shipyard/Constants'; import { Insurance } from '../shipyard/Constants';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShoppingIcon } from '../components/SvgIcons'; import { ShoppingIcon } from './SvgIcons';
import autoBind from 'auto-bind';
import { assign, differenceBy, sortBy, reverse } from 'lodash';
import { FUEL_CAPACITY } from 'ed-forge/lib/ship-stats';
/** /**
* Cost Section * Cost Section
@@ -16,7 +17,7 @@ export default class CostSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
buildName: PropTypes.string buildName: PropTypes.string,
}; };
/** /**
@@ -25,71 +26,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._costsTab = this._costsTab.bind(this); autoBind(this);
this._sortCost = this._sortCost.bind(this);
this._sortAmmo = this._sortAmmo.bind(this);
this._sortRetrofit = this._sortRetrofit.bind(this);
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
this._eddbShoppingList = this._eddbShoppingList.bind(this);
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
const { ship, buildName } = props;
this.shipType = ship.getShipType();
this.state = { this.state = {
retrofitShip, retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null,
retrofitName, shipDiscount: Persist.getShipDiscount(),
shipDiscount, moduleDiscount: Persist.getModuleDiscount(),
moduleDiscount,
insurance: Insurance[Persist.getInsurance()], insurance: Insurance[Persist.getInsurance()],
tab: Persist.getCostTab(), tab: Persist.getCostTab(),
buildOptions: Persist.getBuildsNamesFor(props.ship.id), buildOptions: Persist.getBuildsNamesFor(ship.getShipType()),
ammoPredicate: 'cr', predicate: 'cr',
ammoDesc: true, desc: true,
costPredicate: 'cr', excluded: {},
costDesc: true,
retroPredicate: 'cr',
retroDesc: true
}; };
} }
/** /**
* Create a ship instance to base/reference retrofit changes from * Create a ship instance to base/reference retrofit changes from
* @param {string} shipId Ship Id
* @param {string} name Build name
* @param {Ship} retrofitShip Existing retrofit ship
* @return {Ship} Retrofit ship * @return {Ship} Retrofit ship
*/ */
_buildRetrofitShip(shipId, name, retrofitShip) { _buildRetrofitShip() {
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults const { retrofitName } = this.state;
if (Persist.hasBuild(this.shipType, retrofitName)) {
if (!retrofitShip) { // Don't create a new instance unless needed return new Ship(Persist.getBuild(this.shipType, retrofitName));
retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
}
if (Persist.hasBuild(shipId, name)) {
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
} else { } else {
retrofitShip.buildWith(data.defaults); // Populate with default components return Factory.newShip(this.shipType);
} }
return retrofitShip;
}
/**
* Get the default retrofit build name if it exists
* @param {string} shipId Ship Id
* @param {string} name Build name
* @return {string} Build name or null
*/
_defaultRetrofitName(shipId, name) {
return Persist.hasBuild(shipId, name) ? name : null;
} }
/** /**
@@ -107,9 +71,6 @@ export default class CostSection extends TranslatedComponent {
_onDiscountChanged() { _onDiscountChanged() {
let shipDiscount = Persist.getShipDiscount(); let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount(); let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this.setState({ shipDiscount, moduleDiscount }); this.setState({ shipDiscount, moduleDiscount });
} }
@@ -126,156 +87,33 @@ export default class CostSection extends TranslatedComponent {
* @param {SyntheticEvent} event Build name to base the retrofit ship on * @param {SyntheticEvent} event Build name to base the retrofit ship on
*/ */
_onBaseRetrofitChange(event) { _onBaseRetrofitChange(event) {
let retrofitName = event.target.value; this.setState({ retrofitName: event.target.value });
let ship = this.props.ship;
if (retrofitName) {
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
} else {
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
}
this._updateRetrofit(ship, this.state.retrofitShip);
this.setState({ retrofitName });
} }
/** /**
* On builds changed check to see if the retrofit ship needs * Toggle item cost inclusion
* to be updated * @param {String} key Key of the row to toggle
*/ */
_onBuildsChanged() { _toggleExcluded(key) {
let update = false; let { excluded } = this.state;
let ship = this.props.ship; excluded = assign({}, excluded);
let { retrofitName, retrofitShip } = this.state; const slotExcluded = excluded[key];
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
if(!Persist.hasBuild(ship.id, retrofitName)) { this.setState({ excluded });
retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
this.setState({ retrofitName: null });
update = true;
} else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
update = true;
}
if (update) { // Update retrofit comparison
this._updateRetrofit(ship, retrofitShip);
}
// Update list of retrofit base build options
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
} }
/** /**
* Toggle item cost inclusion in overall total * Set list sort predicate
* @param {Object} item Cost item * @param {string} newPredicate sort predicate
*/ */
_toggleCost(item) { _sortBy(newPredicate) {
this.props.ship.setCostIncluded(item, !item.incCost); let { predicate, desc } = this.state;
this.forceUpdate();
if (newPredicate == predicate) {
desc = !desc;
} }
/** this.setState({ predicate: newPredicate, desc });
* Toggle item cost inclusion in retrofit total
* @param {Object} item Cost item
*/
_toggleRetrofitCost(item) {
let retrofitTotal = this.state.retrofitTotal;
item.retroItem.incCost = !item.retroItem.incCost;
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
this.setState({ retrofitTotal });
}
/**
* Set cost list sort predicate
* @param {string} predicate sort predicate
*/
_sortCostBy(predicate) {
let { costPredicate, costDesc } = this.state;
if (costPredicate == predicate) {
costDesc = !costDesc;
}
this.setState({ costPredicate: predicate, costDesc });
}
/**
* Sort cost list
* @param {Ship} ship Ship instance
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortCost(ship, predicate, desc) {
let costList = ship.costList;
let translate = this.context.language.translate;
if (predicate == 'm') {
costList.sort(slotComparator(translate, null, desc));
} else {
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
}
}
/**
* Set ammo list sort predicate
* @param {string} predicate sort predicate
*/
_sortAmmoBy(predicate) {
let { ammoPredicate, ammoDesc } = this.state;
if (ammoPredicate == predicate) {
ammoDesc = !ammoDesc;
}
this.setState({ ammoPredicate: predicate, ammoDesc });
}
/**
* Sort ammo cost list
* @param {Array} ammoCosts Ammo cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortAmmo(ammoCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'm') {
ammoCosts.sort(slotComparator(translate, null, desc));
} else {
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
}
}
/**
* Set retrofit list sort predicate
* @param {string} predicate sort predicate
*/
_sortRetrofitBy(predicate) {
let { retroPredicate, retroDesc } = this.state;
if (retroPredicate == predicate) {
retroDesc = !retroDesc;
}
this.setState({ retroPredicate: predicate, retroDesc });
}
/**
* Sort retrofit cost list
* @param {Array} retrofitCosts Retrofit cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortRetrofit(retrofitCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'cr') {
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
} else {
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
}
if (!desc) {
retrofitCosts.reverse();
}
} }
/** /**
@@ -284,18 +122,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
_costsTab() { _costsTab() {
let { ship } = this.props; let { ship } = this.props;
let { shipDiscount, moduleDiscount, insurance } = this.state; let {
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
} = this.state;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let rows = []; let rows = [];
for (let i = 0, l = ship.costList.length; i < l; i++) { let modules = sortBy(
let item = ship.costList[i]; ship.getModules(),
if (item.m && item.m.cost) { (predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost'))
let toggle = this._toggleCost.bind(this, item); );
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}> if (desc) {
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td> reverse(modules);
<td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td> }
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
let totalCost = 0;
for (let module of modules) {
const cost = module.readMeta('cost');
const slot = module.getSlot();
if (cost) {
let toggle = this._toggleExcluded.bind(this, slot);
const disabled = excluded[slot];
if (!disabled) {
totalCost += cost;
}
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
</tr>); </tr>);
} }
} }
@@ -304,23 +158,23 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%', borderCollapse: 'collapse' }}> <table style={{ width: '100%', borderCollapse: 'collapse' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>
{translate('module')} {translate('module')}
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} -${formats.pct(shipDiscount)}]`}</u> : null} {shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} -${formats.pct(shipDiscount)}]`}</u> : null}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
<th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl' >{translate('total')}</td> <td colSpan='2' className='lbl' >{translate('total')}</td>
<td className='val'>{formats.int(ship.totalCost)}{units.CR}</td> <td className='val'>{formats.int(totalCost)}{units.CR}</td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl'>{translate('insurance')}</td> <td colSpan='2' className='lbl'>{translate('insurance')}</td>
<td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td> <td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -331,14 +185,63 @@ export default class CostSection extends TranslatedComponent {
* Open up a window for EDDB with a shopping list of our retrofit components * Open up a window for EDDB with a shopping list of our retrofit components
*/ */
_eddbShoppingList() { _eddbShoppingList() {
const { retrofitCosts } = this.state; const {} = this.state;
const { ship } = this.props; const { ship } = this.props;
// Provide unique list of non-PP module EDDB IDs to buy // Provide unique list of non-PP module EDDB IDs to buy
const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i); // const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
// Open up the relevant URL // Open up the relevant URL
window.open('https://eddb.io/station?m=' + modIds.join(',')); // TODO:
// window.open('https://eddb.io/station?m=' + modIds.join(','));
}
/**
*
*/
_retrofitInfo() {
const { ship } = this.props;
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
const retrofitShip = this._buildRetrofitShip();
const currentModules = ship.getModules();
const oldModules = retrofitShip.getModules();
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
let modules = [];
let totalCost = 0;
const addModule = (m, costFactor) => {
const key = `${m.getItem()}@${m.getSlot()}`;
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
modules.push({
key, cost,
rating: m.getClassRating(),
item: m.readMeta('type'),
});
if (!excluded[key]) {
totalCost += cost;
}
};
for (let m of buyModules) {
addModule(m, 1);
}
for (let m of sellModules) {
addModule(m, -1);
}
let _sortF = undefined;
switch (predicate) {
case 'cr': _sortF = (o) => o.cost; break;
case 'm':
default: _sortF = (o) => o.item; break;
};
modules = sortBy(modules, _sortF);
if (desc) {
reverse(modules);
}
return [totalCost, modules];
} }
/** /**
@@ -346,59 +249,52 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_retrofitTab() { _retrofitTab() {
let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state; let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state;
const { termtip, tooltip } = this.context; const { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let int = formats.int; let int = formats.int;
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
for (let opt of this.state.buildOptions) {
options.push(<option key={opt} value={opt}>{opt}</option>);
}
if (retrofitCosts.length) {
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
let item = retrofitCosts[i];
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
</tr>);
}
} else {
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
}
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
return <div> return <div>
<div className='scroll-x'> <div className='scroll-x'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
{translate('net cost')} {translate('net cost')}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {retrofitInfo.length ?
retrofitInfo.map((info) => (
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
onClick={() => this._toggleExcluded(info.key)}>
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
<td className='le ptr shorten cap'>{translate(info.item)}</td>
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
{int(info.cost)}{units.CR}
</td>
</tr>
)) : (
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
)}
<tr className='ri'> <tr className='ri'>
<td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td> <td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
<td colSpan='3' className='lbl' >{translate('cost')}</td> <td className='lbl' >{translate('cost')}</td>
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}> <td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
{int(retrofitTotal)}{units.CR} {int(retrofitTotal)}{units.CR}
</td> </td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td> <td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td>
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td> <td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td>
<td className='val' style={{ borderLeft:'none', padding: 0 }}> <td className='val' style={{ borderLeft:'none', padding: 0 }}>
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}> <select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
{options} <option key='stock' value=''>{translate('Stock')}</option>
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
</select> </select>
</td> </td>
</tr> </tr>
@@ -408,63 +304,50 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/** /**
* Update retrofit costs *
* @param {Ship} ship Ship instance * @param {*} modules
* @param {Ship} retrofitShip Retrofit Ship instance
*/ */
_updateRetrofit(ship, retrofitShip) { _ammoInfo() {
let retrofitCosts = []; const { ship } = this.props;
let retrofitTotal = 0, i, l, item; const { desc, predicate } = this.state;
if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) { let info = [{
item = { key: 'fuel',
buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating, item: 'Fuel',
buyId: ship.bulkheads.m.eddbID, qty: ship.get(FUEL_CAPACITY),
buyPp: ship.bulkheads.m.pp, unitCost: 50,
buyName: ship.bulkheads.m.name, cost: 50 * ship.get(FUEL_CAPACITY),
sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating, }];
sellName: retrofitShip.bulkheads.m.name, for (let m of ship.getModules()) {
netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost, const rebuilds = m.get('bays') * m.get('rebuildsperbay');
retroItem: retrofitShip.bulkheads const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds;
}; if (ammo) {
retrofitCosts.push(item); const unitCost = m.readMeta('ammocost');
if (retrofitShip.bulkheads.incCost) { info.push({
retrofitTotal += item.netCost; key: `restock_${m.getSlot()}`,
rating: m.getClassRating(),
item: m.readMeta('type'),
qty: ammo,
unitCost, cost: unitCost * ammo,
});
} }
} }
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) { let _sortF = undefined;
let retroSlotGroup = retrofitShip[g]; switch (predicate) {
let slotGroup = ship[g]; case 'cr': _sortF = (o) => o.cost; break;
for (i = 0, l = slotGroup.length; i < l; i++) { case 'qty': _sortF = (o) => o.qty; break;
const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null; case 'cost': _sortF = (o) => o.unitCost; break;
const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null; case 'm':
if (modId != retroModId) { default: _sortF = (o) => o.item;
item = { netCost: 0, retroItem: retroSlotGroup[i] };
if (slotGroup[i].m) {
item.buyId = slotGroup[i].m.eddbID,
item.buyPp = slotGroup[i].m.pp,
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
item.netCost = slotGroup[i].discountedCost;
}
if (retroSlotGroup[i].m) {
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
item.netCost -= retroSlotGroup[i].discountedCost;
}
retrofitCosts.push(item);
if (retroSlotGroup[i].incCost) {
retrofitTotal += item.netCost;
}
}
} }
info = sortBy(info, _sortF);
if (desc) {
reverse(info);
} }
this.setState({ retrofitCosts, retrofitTotal }); return info;
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
} }
/** /**
@@ -472,20 +355,24 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_ammoTab() { _ammoTab() {
let { ammoTotal, ammoCosts } = this.state; const { excluded } = this.state;
let { translate, formats, units } = this.context.language; const { translate, formats, units } = this.context.language;
let int = formats.int; const int = formats.int;
let rows = []; const rows = [];
for (let i = 0, l = ammoCosts.length; i < l; i++) { const ammoInfo = this._ammoInfo();
let item = ammoCosts[i]; let total = 0;
rows.push(<tr key={i} className='highlight'> for (let i of ammoInfo) {
<td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td> const disabled = excluded[i.key];
<td className='le shorten cap'>{slotName(translate, item)}</td> rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)}
<td className='ri'>{int(item.max)}</td> className={cn('highlight', { disabled })}>
<td className='ri'>{int(item.cost)}{units.CR}</td> <td style={{ width: '1em' }}>{i.rating}</td>
<td className='ri'>{int(item.total)}{units.CR}</td> <td className='le shorten cap'>{translate(i.item)}</td>
<td className='ri'>{int(i.qty)}</td>
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
<td className='ri'>{int(i.cost)}{units.CR}</td>
</tr>); </tr>);
total += disabled ? 0 : i.cost;
} }
return <div> return <div>
@@ -493,17 +380,17 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th>
<th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl' >{translate('total')}</td> <td colSpan='4' className='lbl' >{translate('total')}</td>
<td className='val'>{int(ammoTotal)}{units.CR}</td> <td className='val'>{int(total)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -511,103 +398,6 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/**
* Recalculate all ammo costs
* @param {Ship} ship Ship instance
*/
_updateAmmoCosts(ship) {
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
let slotGroup = ship[g];
for (let i = 0, l = slotGroup.length; i < l; i++) {
if (slotGroup[i].m) {
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
q = 0;
switch (slotGroup[i].m.grp) {
case 'fs': // Skip fuel calculation if scoop present
scoop = true;
break;
case 'scb':
q = slotGroup[i].m.getAmmo() + 1;
break;
case 'am':
q = slotGroup[i].m.getAmmo();
break;
case 'pv':
srvs += slotGroup[i].m.getBays();
break;
case 'fx': case 'hb': case 'cc': case 'pc':
limpets = ship.cargoCapacity;
break;
default:
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
}
// Calculate ammo costs only if a cost is specified
if (slotGroup[i].m.ammocost > 0) {
item = {
m: slotGroup[i].m,
max: q,
cost: slotGroup[i].m.ammocost,
total: q * slotGroup[i].m.ammocost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Add fighters
if (slotGroup[i].m.grp === 'fh') {
item = {
m: slotGroup[i].m,
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
cost: slotGroup[i].m.fightercost,
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
}
}
}
// Limpets if controllers exist and cargo space available
if (limpets > 0) {
item = {
m: { name: 'limpets', class: '', rating: '' },
max: ship.cargoCapacity,
cost: 101,
total: ship.cargoCapacity * 101
};
ammoCosts.push(item);
ammoTotal += item.total;
}
if (srvs > 0) {
item = {
m: { name: 'SRVs', class: '', rating: '' },
max: srvs,
cost: 1030,
total: srvs * 1030
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Calculate refuel costs if no scoop present
if (!scoop) {
item = {
m: { name: 'fuel', class: '', rating: '' },
max: ship.fuelCapacity,
cost: 50,
total: ship.fuelCapacity * 50
};
ammoCosts.push(item);
ammoTotal += item.total;
}
this.setState({ ammoTotal, ammoCosts });
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
}
/** /**
* Add listeners on mount and update costs * Add listeners on mount and update costs
*/ */
@@ -615,64 +405,7 @@ export default class CostSection extends TranslatedComponent {
this.listeners = [ this.listeners = [
Persist.addListener('discounts', this._onDiscountChanged.bind(this)), Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)), Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
]; ];
this._updateAmmoCosts(this.props.ship);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this._sortCost(this.props.ship);
}
/**
* Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context
*/
componentWillReceiveProps(nextProps, nextContext) {
let retrofitShip = this.state.retrofitShip;
if (nextProps.ship != this.props.ship) { // Ship has changed
let nextId = nextProps.ship.id;
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
this.setState({
retrofitShip,
retrofitName,
buildOptions: Persist.getBuildsNamesFor(nextId)
});
}
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
this._updateAmmoCosts(nextProps.ship);
this._updateRetrofit(nextProps.ship, retrofitShip);
this._sortCost(nextProps.ship);
}
}
/**
* Sort lists before render
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
let state = this.state;
switch (nextState.tab) {
case 'ammo':
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
}
break;
case 'retrofit':
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
}
break;
default:
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
}
}
} }
/** /**

View File

@@ -4,6 +4,8 @@ import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import VerticalBarChart from './VerticalBarChart'; import VerticalBarChart from './VerticalBarChart';
import autoBind from 'auto-bind';
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/ship-stats';
/** /**
* Defence information * Defence information
@@ -15,12 +17,10 @@ import VerticalBarChart from './VerticalBarChart';
*/ */
export default class Defence extends TranslatedComponent { export default class Defence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.object.isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
sys: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired
}; };
/** /**
@@ -29,22 +29,7 @@ export default class Defence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
this.state = { shield, armour, shielddamage, armourdamage };
}
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
this.setState({ shield, armour, shielddamage, armourdamage });
}
return true;
} }
/** /**
@@ -52,187 +37,104 @@ export default class Defence extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { opponent, sys, opponentWep } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { shield, armour, shielddamage, armourdamage } = this.state;
const pd = opponent.standard[4].m; const shields = ship.get(SHIELD_METRICS);
const shieldSourcesData = []; // Data for pie chart (absolute MJ)
const effectiveShieldData = []; const shieldSourcesData = [
const shieldDamageTakenData = []; 'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs',
const shieldSourcesTt = []; ].map((key) => { return { label: key, value: Math.round(shields[key]) }; });
const shieldDamageTakenAbsoluteTt = [];
const shieldDamageTakenExplosiveTt = [];
const shieldDamageTakenKineticTt = [];
const shieldDamageTakenThermalTt = [];
const effectiveShieldAbsoluteTt = [];
const effectiveShieldExplosiveTt = [];
const effectiveShieldKineticTt = [];
const effectiveShieldThermalTt = [];
let maxEffectiveShield = 0;
if (shield.total) {
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
shieldSourcesData.push({ value: Math.round(shield.addition), label: translate('shield addition') });
if (shield.generator > 0) { // Data for tooltip
shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); const shieldSourcesTt = shieldSourcesData.map((o) => {
effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); let { label, value } = o;
effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); return <div key={label}>
effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); {translate(label)} {formats.int(value)}{units.MJ}
effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); </div>;
if (shield.boosters > 0) { });
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
}
if (shield.cells > 0) { // Shield resistances
shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const shieldDamageTakenData = [
effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); 'absolute', 'explosive', 'kinetic', 'thermal',
effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); ].map((label) => {
effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const dmgMult = shields[label];
effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
} (label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
});
// Add effective shield from resistances // Effective MJ
const rawMj = shield.generator + shield.boosters + shield.cells; const effectiveShieldData = [
const explosiveMj = rawMj / (shield.explosive.base) - rawMj; 'absolute', 'explosive', 'kinetic', 'thermal'
if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>); ].map((label) => {
const kineticMj = rawMj / (shield.kinetic.base) - rawMj; const dmgMult = shields[label];
if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>); const raw = shields.withSCBs;
const thermalMj = rawMj / (shield.thermal.base) - rawMj; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>); (label) => <div key={label}>
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
</div>
);
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
});
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
// Add effective shield from power distributor SYS pips const armour = ship.get(ARMOUR_METRICS);
if (shield.absolute.sys != 1) { const moduleProtection = ship.get(MODULE_PROTECTION_METRICS);
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.total - rawMj)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.total - rawMj / shield.explosive.base)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.total - rawMj / shield.kinetic.base)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.total - rawMj / shield.thermal.base)}{units.MJ}</div>);
}
}
shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>); // Data for pie chart (absolute HP)
shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>); const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map(
shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>); (key) => { return { label: key, value: Math.round(armour[key]) }; }
);
shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>); // Data for tooltip
shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>); const armourSourcesTt = armourSourcesData.map((o) => {
shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>); let { label, value } = o;
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
});
shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>); // Armour resistances
shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>); const armourDamageTakenData = [
shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal', 'caustic',
].map((label) => {
const dmgMult = armour[label];
const tooltip = ['byAlloys', 'byHRPs'].map(
(label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
});
shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>); // Effective HP
shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>); const effectiveArmourData = [
shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal'
].map((label) => {
const effectiveAbsoluteShield = shield.total / shield.absolute.total; const dmgMult = armour[label];
effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt }); const raw = armour.armour;
const effectiveExplosiveShield = shield.total / shield.explosive.total; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt }); (label) => <div key={label}>
const effectiveKineticShield = shield.total / shield.kinetic.total; {translate(label)} {formats.int(raw * dmgMult[label])}
effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt }); </div>
const effectiveThermalShield = shield.total / shield.thermal.total; );
effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt }); return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip };
});
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
}
const armourSourcesData = [];
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
const armourSourcesTt = [];
const effectiveArmourAbsoluteTt = [];
const effectiveArmourExplosiveTt = [];
const effectiveArmourKineticTt = [];
const effectiveArmourThermalTt = [];
const effectiveArmourCausticTt = [];
if (armour.bulkheads > 0) {
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
if (armour.reinforcement > 0) {
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
}
}
const rawArmour = armour.bulkheads + armour.reinforcement;
const armourDamageTakenTt = [];
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
const armourDamageTakenExplosiveTt = [];
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
if (armour.explosive.total != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.explosive.total - rawArmour)}</div>);
const armourDamageTakenKineticTt = [];
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
if (armour.kinetic.total != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.kinetic.total - rawArmour)}</div>);
const armourDamageTakenThermalTt = [];
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.thermal.total - rawArmour)}</div>);
const armourDamageTakenCausticTt = [];
armourDamageTakenCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.caustic.bulkheads)}</div>);
armourDamageTakenCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.caustic.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourCausticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.caustic.total - rawArmour)}</div>);
const effectiveArmourData = [];
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
const effectiveKineticArmour = armour.total / armour.kinetic.total;
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
const effectiveThermalArmour = armour.total / armour.thermal.total;
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
const effectiveCausticArmour = armour.total / armour.caustic.total;
effectiveArmourData.push({ value: Math.round(effectiveCausticArmour), label: translate('caustic'), tooltip: effectiveArmourCausticTt });
const armourDamageTakenData = [];
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
armourDamageTakenData.push({ value: Math.round(armour.caustic.total * 100), label: translate('caustic'), tooltip: armourDamageTakenCausticTt });
return ( return (
<span id='defence'> <span id='defence'>
{shield.total ? <span> {shields.withSCBs ? <span>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('shield metrics')}</h2> <h2>{translate('shield metrics')}</h2>
<br/> <br/>
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2> <h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
@@ -250,11 +152,11 @@ export default class Defence extends TranslatedComponent {
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('armour metrics')}</h2> <h2>{translate('armour metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2> <h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2>
<br/> <br/>
</div> </div>
<div className='group quarter'> <div className='group quarter'>

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import { moduleReduce } from 'ed-forge/lib/helper';
/** /**
* Engagement range slider * Engagement range slider
@@ -21,35 +22,18 @@ export default class EngagementRange extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
const { ship } = props;
const maxRange = Math.round(this._calcMaxRange(ship));
this.state = { this.state = {
maxRange maxRange: moduleReduce(
this.props.ship.getHardpoints(),
'maximumrange',
true,
// Don't use plain `Math.max` because callback will be passed four args
(a, v) => Math.max(a, v),
1000,
),
}; };
} }
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/** /**
* Update range * Update range
* @param {number} rangeLevel percentage level from 0 to 1 * @param {number} rangeLevel percentage level from 0 to 1
@@ -61,7 +45,9 @@ export default class EngagementRange extends TranslatedComponent {
const range = Math.round(rangeLevel * maxRange); const range = Math.round(rangeLevel * maxRange);
if (range !== this.props.engagementRange) { if (range !== this.props.engagementRange) {
this.props.onChange(range); const { onChange, ship } = this.props;
ship.setEngagementRange(range);
onChange(range);
} }
} }
@@ -70,8 +56,8 @@ export default class EngagementRange extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language, onWindowResize, sizeRatio } = this.context;
const { formats, translate, units } = language; const { formats, translate } = language;
const { engagementRange } = this.props; const { engagementRange } = this.props;
const { maxRange } = this.state; const { maxRange } = this.state;

View File

@@ -2,98 +2,58 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/stats/SpeedProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* Engine profile for a given ship * Engine profile for a given ship
*/ */
export default class EngineProfile extends TranslatedComponent { export default class EngineProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
}
return true;
}
/**
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
* @param {Object} ship The ship
* @param {Object} eng The number of pips to ENG
* @param {Object} boost If boost is enabled
* @param {Object} mass The mass at which to calculate the top speed
* @return {number} The maximum speed
*/
calcMaxSpeed(ship, eng, boost, mass) {
// Obtain the top speed
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
}
/** /**
* Render engine profile * Render engine profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, eng, fuel, boost } = this.props; const { code, ship, pips, boost } = this.props;
// Calculate bounds for our line chart // Calculate bounds for our line chart
const thrusters = ship.standard[1].m; const minMass = ship.readProp('hullmass');
const minMass = ship.calcLowestPossibleMass({ th: thrusters }); const maxMass = ship.getThrusters().get('enginemaximalmass');
const maxMass = thrusters.getMaxMass(); const baseSpeed = ship.readProp('speed');
const mass = ship.unladenMass + fuel + cargo; const baseBoost = getBoostMultiplier(ship);
const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false); const cb = (eng, boost, mass) => {
const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true); const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5];
// Add a mark at our current mass return baseSpeed * (boost ? baseBoost : 1) * mult;
const mark = Math.min(mass, maxMass); };
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother // This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minSpeed} yMin={cb(0, false, maxMass)}
yMax={maxSpeed} yMax={cb(4, true, minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum speed')} yLabel={translate('maximum speed')}
yUnit={translate('m/s')} yUnit={translate('m/s')}
func={this.state.calcMaxSpeedFunc} func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)}
points={1000} points={1000}
code={code} // Encode boost in code to re-render on state change
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
aspect={0.7} aspect={0.7}
/> />
); );

View File

@@ -3,46 +3,21 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import { calculateJumpRange } from 'ed-forge/lib/stats/JumpRangeProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* FSD profile for a given ship * FSD profile for a given ship
*/ */
export default class FSDProfile extends TranslatedComponent { export default class FSDProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
}
return true;
}
/** /**
* Calculate the maximum range for this ship across its applicable mass * Calculate the maximum range for this ship across its applicable mass
* @param {Object} ship The ship * @param {Object} ship The ship
@@ -60,36 +35,27 @@ export default class FSDProfile extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, fuel } = this.props; const { code, ship } = this.props;
// Calculate bounds for our line chart - use thruster info for X
const thrusters = ship.standard[1].m;
const fsd = ship.standard[2].m;
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
const maxMass = thrusters.getMaxMass();
const mass = ship.unladenMass + fuel + cargo;
const minRange = 0;
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump(), ship);
// Add a mark at our current mass
const mark = Math.min(mass, maxMass);
const code = ship.name + ship.toString() + '.' + fuel;
const minMass = ship.readProp('hullmass');
const maxMass = ship.getThrusters().get('enginemaximalmass');
const mass = ship.get(LADEN_MASS);
const cb = (mass) => calculateJumpRange(ship, mass, Infinity, true);
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minRange} yMin={0}
yMax={maxRange} yMax={cb(minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(mass, maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum range')} yLabel={translate('maximum range')}
yUnit={translate('LY')} yUnit={translate('LY')}
func={this.state.calcMaxRangeFunc} func={cb}
points={200} points={200}
code={code} code={code}
aspect={0.7} aspect={0.7}

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Fuel slider * Fuel slider
@@ -21,8 +22,7 @@ export default class Fuel extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._fuelChange = this._fuelChange.bind(this);
} }
/** /**

View File

@@ -1,151 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import {
DamageAbsolute,
DamageKinetic,
DamageThermal,
DamageExplosive,
MountFixed,
MountGimballed,
MountTurret,
ListModifications,
Modified
} from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Hardpoint / Utility Slot
*/
export default class HardpointSlot extends Slot {
/**
* Get the CSS class name for the slot.
* @return {string} CSS Class name
*/
_getClassNames() {
return this.props.maxClass > 0 ? 'hardpoint' : null;
}
/**
* Get the label for the slot
* @param {Function} translate Translate function
* @return {string} Label
*/
_getMaxClassLabel(translate) {
return translate(['U', 'S', 'M', 'L', 'H'][this.props.maxClass]);
}
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
let { drag, drop } = this.props;
let { termtip, tooltip } = this.context;
let validMods = Modifications.modules[m.grp].modifications || [];
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')}
onMouseOut={tooltip.bind(null, null)}><MountFixed/></span> : ''}
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')}
onMouseOut={tooltip.bind(null, null)}><MountGimballed/></span> : ''}
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')}
onMouseOut={tooltip.bind(null, null)}><MountTurret/></span> : ''}
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')}
onMouseOut={tooltip.bind(null, null)}><DamageKinetic/></span> : ''}
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')}
onMouseOut={tooltip.bind(null, null)}><DamageThermal/></span> : ''}
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')}
onMouseOut={tooltip.bind(null, null)}><DamageExplosive/></span> : ''}
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')}
onMouseOut={tooltip.bind(null, null)}><DamageAbsolute/></span> : ''}
{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r'
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}><Modified/></span> : null}
</div>
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
</div>
<div className={'cb'}>
{m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} {m.getClip() ?
<span>({formats.round1(m.getSDps())})</span> : null}</div> : null}
{m.getDamage() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getDamage() ? 'shotdmg' : 'shotdmg')}
onMouseOut={tooltip.bind(null, null)}>{translate('shotdmg')}: {formats.round1(m.getDamage())}</div> : null}
{m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')}
onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} {m.getClip() ?
<span>({formats.round1(m.getEps() * m.getSustainedFactor())}{u.MW})</span> : null}</div> : null}
{m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')}
onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} {m.getClip() ?
<span>({formats.round1(m.getHps() * m.getSustainedFactor())})</span> : null}</div> : null}
{m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null}
{m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')}
onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null}
{m.getRange() ? <div
className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null}
{m.getScanTime() ? <div
className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null}
{m.getFalloff() ? <div
className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null}
{m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null}
{m.getAmmo() ? <div
className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null}
{m.getReload() ? <div className={'l'}>{translate('wep_reload')}: {formats.round(m.getReload())}{u.s}</div> : null}
{m.getShotSpeed() ? <div
className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null}
{m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null}
{m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null}
{m.getScanAngle() ? <div className={'l'}>{translate('scan angle')}: {formats.f2(m.getScanAngle())}°</div> : null}
{m.getScanRange() ? <div className={'l'}>{translate('scan range')}: {formats.int(m.getScanRange())}{u.m}</div> : null}
{m.getMaxAngle() ? <div className={'l'}>{translate('max angle')}: {formats.f2(m.getMaxAngle())}°</div> : null}
{showModuleResistances && m.getExplosiveResistance() ? <div
className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null}
{showModuleResistances && m.getKineticResistance() ? <div
className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null}
{showModuleResistances && m.getThermalResistance() ? <div
className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null}
{m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null}
{m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={modButton => this.modButton = modButton}>
<button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}>
<ListModifications/></button>
</div> : null}
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,42 +1,29 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Hardpoint slot section * Hardpoint slot section
*/ */
export default class HardpointSlotSection extends SlotSection { export default class HardpointSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'hardpoints', 'hardpoints'); super(props, 'hardpoints');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'nl-F';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; // TODO:
this.props.ship.emptyWeapons(); // this.props.ship.emptyWeapons();
this.props.onChange();
this._close(); this._close();
} }
@@ -47,9 +34,8 @@ export default class HardpointSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fill(group, mount, event) { _fill(group, mount, event) {
this.selectedRefId = group + '-' + mount; // TODO:
this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt')); // this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
this.props.onChange();
this._close(); this._close();
} }
@@ -65,33 +51,25 @@ export default class HardpointSlotSection extends SlotSection {
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let slots = []; let slots = [];
let hardpoints = ship.hardpoints;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getHardpoints(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass) { key={h.object.Slot}
slots.push(<HardpointSlot maxClass={h.getSize()}
key={i} currentMenu={currentMenu}
maxClass={h.maxClass}
availableModules={() => availableModules.getHps(h.maxClass)}
onOpen={this._openMenu.bind(this, h)}
onSelect={this._selectModule.bind(this, h)}
onChange={this.props.onChange}
selected={currentMenu == h}
drag={this._drag.bind(this, h)} drag={this._drag.bind(this, h)}
dragOver={this._dragOverSlot.bind(this, h)} dragOver={this._dragOverSlot.bind(this, h)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)} dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship} m={h}
m={h.m}
enabled={h.enabled ? true : false} enabled={h.enabled ? true : false}
propsToShow={propsToShow}
onPropToggle={onPropToggle}
/>); />);
} }
}
return slots; return slots;
} }
@@ -101,68 +79,68 @@ export default class HardpointSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _fill = this._fill; let _fill = this._fill;
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex="0" onClick={this._empty} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('pl')}</div> <div className='select-group cap'>{translate('pl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('ul')}</div> <div className='select-group cap'>{translate('ul')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('bl')}</div> <div className='select-group cap'>{translate('bl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('mc')}</div> <div className='select-group cap'>{translate('mc')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('c')}</div> <div className='select-group cap'>{translate('c')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('fc')}</div> <div className='select-group cap'>{translate('fc')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('pa')}</div> <div className='select-group cap'>{translate('pa')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'pa', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pa-F'] = smRef}>{translate('pa')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'pa', 'F')}>{translate('pa')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rg')}</div> <div className='select-group cap'>{translate('rg')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'rg', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rg-F'] = smRef}>{translate('rg')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'rg', 'F')}>{translate('rg')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('nl')}</div> <div className='select-group cap'>{translate('nl')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'nl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['nl-F'] = smRef}>{translate('nl')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'nl', 'F')}>{translate('nl')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rfl')}</div> <div className='select-group cap'>{translate('rfl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -56,7 +56,6 @@ function selectAll(e) {
* Coriolis App Header section / menus * Coriolis App Header section / menus
*/ */
export default class Header extends TranslatedComponent { export default class Header extends TranslatedComponent {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
@@ -639,5 +638,4 @@ export default class Header extends TranslatedComponent {
</header> </header>
); );
} }
} }

View File

@@ -1,98 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Internal Slot
*/
export default class InternalSlot extends Slot {
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = m.class + m.rating;
let { drag, drop, ship } = this.props;
let { termtip, tooltip } = this.context;
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
let mass = m.getMass() || m.cargo || m.fuel || 0;
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
<div className={'r'}>{formats.round(mass)}{u.T}</div>
</div>
<div className={'cb'}>
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs}&nbsp;&nbsp;&nbsp;{translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
{ m.grp === 'gsrp' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.grp === 'gfsb' ? <div className={'l'}>{translate('jump addition')}: {formats.f1(m.getJumpBoost())}{u.LY}</div> : null }
{ m.grp === 'gs' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
{ m.rangeLS === null ? <div className={'l'}>{u.Ls}</div> : null }
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ showModuleResistances && m.getCausticResistance() ? <div className='l'>{translate('causres')}: {formats.pct(m.getCausticResistance())}</div> : null }
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,52 +1,30 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import InternalSlot from './InternalSlot'; import Slot from './Slot';
import * as ModuleUtils from '../shipyard/ModuleUtils'; import * as ModuleUtils from '../shipyard/ModuleUtils';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions'; import { canMount } from '../utils/SlotFunctions';
import autoBind from 'auto-bind';
/** /**
* Internal slot section * Internal slot section
*/ */
export default class InternalSlotSection extends SlotSection { export default class InternalSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'internal', 'optional internal'); super(props, 'optional internal');
this._empty = this._empty.bind(this); autoBind(this);
this._fillWithCargo = this._fillWithCargo.bind(this);
this._fillWithCells = this._fillWithCells.bind(this);
this._fillWithArmor = this._fillWithArmor.bind(this);
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = this.sectionRefArr['pcq'] ? 'pcq' : 'pcm';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; // TODO:
this.props.ship.emptyInternal(); // this.props.ship.emptyInternal();
this.props.onChange();
this._close(); this._close();
} }
@@ -55,7 +33,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCargo(event) { _fillWithCargo(event) {
this.selectedRefId = 'cargo';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -63,7 +40,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E')); ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -72,7 +48,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFuelTanks(event) { _fillWithFuelTanks(event) {
this.selectedRefId = 'ft';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -80,7 +55,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C')); ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -89,7 +63,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithLuxuryCabins(event) { _fillWithLuxuryCabins(event) {
this.selectedRefId = 'pcq';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -97,7 +70,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -106,7 +78,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFirstClassCabins(event) { _fillWithFirstClassCabins(event) {
this.selectedRefId = 'pcm';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -114,7 +85,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -123,7 +93,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithBusinessClassCabins(event) { _fillWithBusinessClassCabins(event) {
this.selectedRefId = 'pci';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -131,7 +100,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -140,7 +108,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithEconomyClassCabins(event) { _fillWithEconomyClassCabins(event) {
this.selectedRefId = 'pce';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -148,7 +115,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -157,7 +123,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCells(event) { _fillWithCells(event) {
this.selectedRefId = 'scb';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
let chargeCap = 0; // Capacity of single activation let chargeCap = 0; // Capacity of single activation
@@ -168,7 +133,6 @@ export default class InternalSlotSection extends SlotSection {
chargeCap += slot.m.recharge; chargeCap += slot.m.recharge;
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -177,7 +141,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithArmor(event) { _fillWithArmor(event) {
this.selectedRefId = 'hr';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -185,7 +148,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -194,7 +156,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithModuleReinforcementPackages(event) { _fillWithModuleReinforcementPackages(event) {
this.selectedRefId = 'mrp';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -202,7 +163,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -219,31 +179,20 @@ export default class InternalSlotSection extends SlotSection {
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { currentMenu, ship } = this.props; let { currentMenu, ship, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let { internal, fuelCapacity } = ship;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = internal.length; i < l; i++) { for (const m of ship.getInternals(undefined, true)) {
let s = internal[i]; slots.push(<Slot
key={m.object.Slot}
slots.push(<InternalSlot currentMenu={currentMenu}
key={i} m={m}
maxClass={s.maxClass} drag={this._drag.bind(this, m)}
availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)} dragOver={this._dragOverSlot.bind(this, m)}
onOpen={this._openMenu.bind(this,s)}
onChange={this.props.onChange}
onSelect={this._selectModule.bind(this, s)}
selected={currentMenu == s}
eligible={s.eligible}
m={s.m}
drag={this._drag.bind(this, s)}
dragOver={this._dragOverSlot.bind(this, s)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(s, originSlot, targetSlot)} dropClass={this._dropClass(m, originSlot, targetSlot)}
fuel={fuelCapacity} propsToShow={propsToShow}
ship={ship} onPropToggle={onPropToggle}
enabled={s.enabled ? true : false}
/>); />);
} }
@@ -256,22 +205,23 @@ export default class InternalSlotSection extends SlotSection {
* @param {Function} ship The ship * @param {Function} ship The ship
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate, ship) { _getSectionMenu() {
const { ship } = this.props;
const { translate } = this.context.language;
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCargo} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['cargo'] = smRef}>{translate('cargo')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCells} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['scb'] = smRef}>{translate('scb')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithArmor} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hr'] = smRef}>{translate('hr')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mrp'] = smRef}>{translate('mrp')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ft'] = smRef}>{translate('ft')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pce'] = smRef}>{translate('pce')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pci'] = smRef}>{translate('pci')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown} ref={smRef => this.sectionRefArr['pcm'] = smRef}>{translate('pcm')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li>
{ ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pcq'] = smRef}>{translate('pcq')}</li> : ''} { ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -3,6 +3,7 @@ import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 }; const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
@@ -10,7 +11,6 @@ const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
* Line Chart * Line Chart
*/ */
export default class LineChart extends TranslatedComponent { export default class LineChart extends TranslatedComponent {
static defaultProps = { static defaultProps = {
code: '', code: '',
xMin: 0, xMin: 0,
@@ -45,13 +45,7 @@ export default class LineChart extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateSeries = this._updateSeries.bind(this);
this._tooltip = this._tooltip.bind(this);
this._showTip = this._showTip.bind(this);
this._hideTip = this._hideTip.bind(this);
this._moveTip = this._moveTip.bind(this);
const series = props.series; const series = props.series;

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Link wrapper component * Link wrapper component
*/ */
export default class Link extends React.Component { export default class Link extends React.Component {
static propTypes = { static propTypes = {
children: PropTypes.any, children: PropTypes.any,
href: PropTypes.string.isRequired, href: PropTypes.string.isRequired,
@@ -56,5 +55,4 @@ export default class Link extends React.Component {
render() { render() {
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>; return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
} }
} }

View File

@@ -9,7 +9,6 @@ import Persist from '../stores/Persist';
* Permalink modal * Permalink modal
*/ */
export default class ModalBatchOrbis extends TranslatedComponent { export default class ModalBatchOrbis extends TranslatedComponent {
static propTypes = { static propTypes = {
ships: PropTypes.any.isRequired ships: PropTypes.any.isRequired
}; };

View File

@@ -21,7 +21,6 @@ function buildComparator(a, b) {
* Compare builds modal * Compare builds modal
*/ */
export default class ModalCompare extends TranslatedComponent { export default class ModalCompare extends TranslatedComponent {
static propTypes = { static propTypes = {
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
builds: PropTypes.array builds: PropTypes.array
@@ -105,8 +104,8 @@ export default class ModalCompare extends TranslatedComponent {
let selectedBuilds = usedBuilds.map((build, i) => let selectedBuilds = usedBuilds.map((build, i) =>
<tr key={i} onClick={this._removeBuild.bind(this, i)}> <tr key={i} onClick={this._removeBuild.bind(this, i)}>
<td className='tl'>{build.name}</td>< <td className='tl'>{build.name}</td>
td className='tl'>{build.buildName}</td> <td className='tl'>{build.buildName}</td>
</tr> </tr>
); );

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Export Modal * Export Modal
*/ */
export default class ModalExport extends TranslatedComponent { export default class ModalExport extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string, title: PropTypes.string,
generator: PropTypes.func, generator: PropTypes.func,

View File

@@ -7,19 +7,10 @@ import TranslatedComponent from './TranslatedComponent';
* Help Modal * Help Modal
*/ */
export default class ModalHelp extends TranslatedComponent { export default class ModalHelp extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string title: PropTypes.string
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render the modal * Render the modal
* @return {React.Component} Modal Content * @return {React.Component} Modal Content

View File

@@ -85,8 +85,6 @@ function detailedJsonToBuild(detailedBuild) {
* Import Modal * Import Modal
*/ */
export default class ModalImport extends TranslatedComponent { export default class ModalImport extends TranslatedComponent {
static propTypes = { static propTypes = {
builds: PropTypes.object, // Optional: Import object builds: PropTypes.object, // Optional: Import object
}; };

View File

@@ -8,7 +8,6 @@ import Persist from '../stores/Persist';
* Permalink modal * Permalink modal
*/ */
export default class ModalOrbis extends TranslatedComponent { export default class ModalOrbis extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.any.isRequired ship: PropTypes.any.isRequired
}; };

View File

@@ -7,7 +7,6 @@ import ShortenUrl from '../utils/ShortenUrl';
* Permalink modal * Permalink modal
*/ */
export default class ModalPermalink extends TranslatedComponent { export default class ModalPermalink extends TranslatedComponent {
static propTypes = { static propTypes = {
url: PropTypes.string.isRequired url: PropTypes.string.isRequired
}; };

View File

@@ -8,7 +8,6 @@ import Persist from '../stores/Persist';
* Permalink modal * Permalink modal
*/ */
export default class ModalShoppingList extends TranslatedComponent { export default class ModalShoppingList extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired ship: PropTypes.object.isRequired
}; };

View File

@@ -3,131 +3,106 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import NumberEditor from 'react-number-editor'; import NumberEditor from 'react-number-editor';
import { isChangeValueBeneficial } from '../utils/BlueprintFunctions'; import { Module } from 'ed-forge';
import { Modifications } from 'coriolis-data/dist';
/** /**
* Modification * Modification
*/ */
export default class Modification extends TranslatedComponent { export default class Modification extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, highlight: PropTypes.bool,
m: PropTypes.object.isRequired, m: PropTypes.instanceOf(Module).isRequired,
name: PropTypes.string.isRequired, property: PropTypes.string.isRequired,
value: PropTypes.number.isRequired, onSet: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired, showProp: PropTypes.object,
onKeyDown: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modItems: PropTypes.array.isRequired,
handleModChange: PropTypes.func.isRequired
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
this.state = {}; const { m, property, showProp } = props;
this.state.value = props.value; const { beneficial, unit, value } = m.getFormatted(property, true);
this.state = { beneficial, unit, value, showProp };
} }
/** /**
* Update modification given a value. * Notify listeners that a new value has been entered and commited.
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
* in a value by hand
*/
_updateValue(value) {
this.setState({ value });
let reCast = String(Number(value));
if (reCast.endsWith(value) || reCast.startsWith(value)) {
let { m, name, ship } = this.props;
value = Math.max(Math.min(value, 50000), -50000);
ship.setModification(m, name, value, true, true);
}
}
/**
* Triggered when a key is pressed down with focus on the number editor.
* @param {SyntheticEvent} event Key down event
*/
_keyDown(event) {
if (event.key == 'Enter') {
this._updateFinished();
}
this.props.onKeyDown(event);
}
/**
* Triggered when an update to slider value is finished i.e. when losing focus
*
* pnellesen (24/05/2018): added value check below - this should prevent experimental effects from being recalculated
* with each onBlur event, even when no change has actually been made to the field.
*/ */
_updateFinished() { _updateFinished() {
if (this.props.value != this.state.value) { const { onSet, m, property } = this.props;
this.props.handleModChange(true); const { inputValue } = this.state;
this.props.onChange(); const numValue = Number(inputValue);
if (!isNaN(numValue) && this.state.value !== numValue) {
onSet(property, numValue);
const { beneficial, unit, value } = m.getFormatted(property, true);
this.setState({ beneficial, unit, value });
} }
} }
_toggleProperty() {
const { onPropToggle, property } = this.props;
const showProp = !this.state.showProp;
// TODO: defer until menu closed
onPropToggle(property, showProp);
this.setState({ showProp });
}
/** /**
* Render the modification * Render the modification
* @return {React.Component} modification * @return {React.Component} modification
*/ */
render() { render() {
let { translate, formats, units } = this.context.language; const { formats } = this.context.language;
let { m, name } = this.props; const { highlight, m, property } = this.props;
let modValue = m.getChange(name); const { beneficial, unit, value, inputValue, showProp } = this.state;
let isOverwrite = Modifications.modifications[name].method === 'overwrite';
if (name === 'damagedist') { // Some features only apply to specific modules; these features will be
// We don't show damage distribution // undefined on items that do not belong to the same class. Filter these
// features here
if (value === undefined) {
return null; return null;
} }
let inputClassNames = { const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property);
'cb': true,
'greyed-out': !this.props.highlight
};
return ( return (
<div onBlur={this._updateFinished.bind(this)} key={name}
className={cn('cb', 'modification-container')}
ref={ modItem => this.props.modItems[name] = modItem }>
<span className={'cb'}>{translate(name, m.grp)}</span>
<span className={'header-adjuster'}></span>
<table style={{ width: '100%' }}>
<tbody>
<tr> <tr>
<td className={'input-container'}> <td>
<span> <span>
{this.props.editable ? <input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/>
<NumberEditor className={cn(inputClassNames)} value={this.state.value} </span>
decimals={2} style={{ textAlign: 'right' }} step={0.01} </td>
stepModifier={1} onKeyDown={this._keyDown.bind(this)} <td className="input-container">
onValueChange={this._updateValue.bind(this)} /> : <span>
<input type="text" value={formats.f2(this.state.value)} <NumberEditor value={inputValue || value} stepModifier={1}
disabled className={cn('number-editor', 'greyed-out')} decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }}
style={{ textAlign: 'right', cursor: 'inherit' }}/> className={cn('cb', { 'greyed-out': !highlight })}
onKeyDown={(event) => {
if (event.key == 'Enter') {
this._updateFinished();
event.stopPropagation();
} }
<span className={'unit-container'}> }}
{units[m.getStoredUnitFor(name)]} onValueChange={(inputValue) => {
</span> if (inputValue.length <= 15) {
this.setState({ inputValue });
}
}} />
</span> </span>
</td> </td>
<td style={{ textAlign: 'center' }} className={ <td style={{ textAlign: 'left' }}>
modValue ? <span className="unit-container">{unit}</span>
isChangeValueBeneficial(name, modValue) ? 'secondary' : 'warning' :
''
}>
{formats.f2(modValue / 100) || 0}{isOverwrite ? '' : '%'}
</td> </td>
<td style={{ textAlign: 'center' }}
className={cn({
secondary: beneficial,
warning: beneficial === false,
})}
>{formats.f2(modifierValue)}{modifierUnit || ''}</td>
</tr> </tr>
</tbody>
</table>
</div>
); );
} }
} }

View File

@@ -1,34 +1,27 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as _ from 'lodash'; import { chain, flatMap, keys } from 'lodash';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { Modifications } from 'coriolis-data/dist';
import Modification from './Modification'; import Modification from './Modification';
import { import {
getBlueprint,
blueprintTooltip, blueprintTooltip,
setPercent,
getPercent,
setRandom,
specialToolTip specialToolTip
} from '../utils/BlueprintFunctions'; } from '../utils/BlueprintFunctions';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
const MODIFICATIONS_COMPARATOR = (mod1, mod2) => { import { getModuleInfo } from 'ed-forge/lib/data/items';
return mod1.props.name.localeCompare(mod2.props.name); import { SHOW } from '../shipyard/StatsMapping';
};
/** /**
* Modifications menu * Modifications menu
*/ */
export default class ModificationsMenu extends TranslatedComponent { export default class ModificationsMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, className: PropTypes.string,
m: PropTypes.object.isRequired, m: PropTypes.object.isRequired,
marker: PropTypes.string.isRequired, propsToShow: PropTypes.object.isRequired,
onChange: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modButton:PropTypes.object
}; };
/** /**
@@ -41,122 +34,58 @@ export default class ModificationsMenu extends TranslatedComponent {
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this); this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this); this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
this._rollFifty = this._rollFifty.bind(this); this.selectedModRef = null;
this._rollRandom = this._rollRandom.bind(this); this.selectedSpecialRef = null;
this._rollBest = this._rollBest.bind(this);
this._rollWorst = this._rollWorst.bind(this);
this._reset = this._reset.bind(this);
this._keyDown = this._keyDown.bind(this);
this.modItems = [];// Array to hold various element refs (<li>, <div>, <ul>, etc.)
this.firstModId = null;
this.firstBPLabel = null;// First item in mod menu
this.lastModId = null;
this.selectedModId = null;
this.selectedSpecialId = null;
this.lastNeId = null;// Last number editor id. Used to set focus to last number editor when shift-tab pressed on first element in mod menu.
this.modValDidChange = false; // used to determine if component update was caused by change in modification value.
this._handleModChange = this._handleModChange.bind(this);
const { m } = props;
this.state = { this.state = {
blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name), blueprintProgress: m.getBlueprintProgress(),
blueprintMenuOpened: !m.getBlueprint(),
specialMenuOpened: false specialMenuOpened: false
}; };
} }
/** /**
* Render the blueprints * Render the blueprints
* @param {Object} props React component properties
* @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderBlueprints(props, context) { _renderBlueprints() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const { translate } = language;
const blueprints = [];
for (const blueprintName in Modifications.modules[m.grp].blueprints) { const blueprints = m.getApplicableBlueprints().map(blueprint => {
const blueprint = getBlueprint(blueprintName, m); const info = getBlueprintInfo(blueprint);
let blueprintGrades = []; let blueprintGrades = keys(info.features).map(grade => {
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
// Grade is a string in the JSON so make it a number // Grade is a string in the JSON so make it a number
grade = Number(grade); grade = Number(grade);
const classes = cn('c', { const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade;
active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade const key = blueprint + ':' + grade;
return <li key={key} data-id={key} className={cn('c', { active })}
style={{ width: '2em' }}
onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))}
onMouseOut={tooltip.bind(null, null)}
onClick={() => {
m.setBlueprint(blueprint, grade, 1);
this.setState({
blueprintMenuOpened: false,
specialMenuOpened: true,
});
}}
ref={active ? (ref) => { this.selectedModRef = ref; } : undefined}
>{grade}</li>;
}); });
const close = this._blueprintSelected.bind(this, blueprintName, grade);
const key = blueprintName + ':' + grade;
const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp);
if (classes.indexOf('active') >= 0) this.selectedModId = key;
blueprintGrades.unshift(<li key={key} tabIndex="0" data-id={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close} onKeyDown={this._keyDown} ref={modItem => this.modItems[key] = modItem}>{grade}</li>);
}
if (blueprintGrades) {
const thisLen = blueprintGrades.length;
if (this.firstModId == null) this.firstModId = blueprintGrades[0].key;
this.lastModId = blueprintGrades[thisLen - 1].key;
blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>);
blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>);
}
}
return blueprints;
}
/** return [
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc <div key={'div' + blueprint} className={'select-group cap'}>
* @param {SyntheticEvent} event Event {translate(blueprint)}
* </div>,
*/ <ul key={'ul' + blueprint}>{blueprintGrades}</ul>
_keyDown(event) { ];
let className = null; });
let elemId = null;
if (event.currentTarget.attributes['class']) className = event.currentTarget.attributes['class'].value;
if (event.currentTarget.attributes['data-id']) elemId = event.currentTarget.attributes['data-id'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) { return flatMap(blueprints);
event.stopPropagation();
if (elemId != null) {
this.modItems[elemId].click();
} else {
event.currentTarget.click();
} }
return;
}
if (event.key == 'Tab') {
// Shift-Tab
if(event.shiftKey) {
if (elemId == this.firstModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.lastModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null && this.lastNeId != null && this.modItems[this.lastNeId] != null) {
// shift-tab on first element in modifications menu. set focus to last number editor field if open
event.preventDefault();
this.modItems[this.lastNeId].lastChild.focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null) {
// shift-tab on button-inline-menu with no number editor
event.preventDefault();
event.currentTarget.parentElement.lastElementChild.focus();
}
} else {
if (elemId == this.lastModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.firstModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.nextSibling == null && event.currentTarget.nodeName != 'TD') {
// Experimental menu
event.preventDefault();
event.currentTarget.parentElement.firstElementChild.focus();
return;
} else if (event.currentTarget.className == 'cb' && event.currentTarget.parentElement.nextSibling == null) {
event.preventDefault();
this.modItems[this.firstBPLabel].focus();
}
}
}
}
/** /**
* Render the specials * Render the specials
@@ -164,204 +93,118 @@ export default class ModificationsMenu extends TranslatedComponent {
* @param {Object} context React component context * @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderSpecials(props, context) { _renderSpecials() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const specials = [];
const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials'; const applied = m.getExperimental();
if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) { const experimentals = [];
const close = this._specialSelected.bind(this, null); for (const experimental of m.getApplicableExperimentals()) {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } data-id={ 'none' } onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems['none'] = modItem}>{translate('PHRASE_NO_SPECIAL')}</div>); const active = experimental === applied;
for (const specialName of Modifications.modules[m.grp][specialsId]) { let specialTt = specialToolTip(language, m, experimental);
if (Modifications.specials[specialName].name.search('Legacy') >= 0) { experimentals.push(
continue; <div key={experimental} data-id={experimental}
style={{ cursor: 'pointer' }}
className={cn('button-inline-menu', { active })}
onClick={this._specialSelected(experimental)}
ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
onMouseOver={termtip.bind(null, specialTt)}
onMouseOut={tooltip.bind(null, null)}
>{translate(experimental)}</div>
);
} }
const classes = cn('button-inline-menu', {
active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName if (experimentals.length) {
}); experimentals.unshift(
if (classes.indexOf('active') >= 0) this.selectedSpecialId = specialName; <div style={{ cursor: 'pointer', fontWeight: 'bold' }}
const close = this._specialSelected.bind(this, specialName); className="button-inline-menu warning" key="none" data-id="none"
if (m.blueprint && m.blueprint.name) { // Setting the special effect to undefined clears it
let tmp = {}; onClick={this._specialSelected(undefined)}
if (m.blueprint.special) { ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
tmp = m.blueprint.special; >{translate('PHRASE_NO_SPECIAL')}</div>
} else { );
tmp = undefined;
} }
m.blueprint.special = Modifications.specials[specialName];
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName); return experimentals;
m.blueprint.special = tmp;
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
} else {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName }onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
} }
/**
* Create a modification component
*/
_mkModification(property, highlight) {
const { translate } = this.context.language;
const { m, propsToShow, onPropToggle } = this.props;
let onSet = m.set.bind(m);
// Show resistance instead of effectiveness
const mapped = SHOW[property];
if (mapped) {
property = mapped.as;
onSet = mapped.setter.bind(undefined, m);
} }
}
return specials; return [
<tr key={`th-${property}`}>
<th colSpan="4">
<span className="cb">{translate(property)}</span>
</th>
</tr>,
<Modification key={property} m={m} property={property}
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
onPropToggle={onPropToggle} />
];
} }
/** /**
* Render the modifications * Render the modifications
* @param {Object} props React Component properties * @return {Array} Array of React Components
* @return {Object} list: Array of React Components
*/ */
_renderModifications(props) { _renderModifications() {
const { m, onChange, ship } = props; const { m } = this.props;
const modifiableModifications = [];
const modifications = [];
for (const modName of Modifications.modules[m.grp].modifications) {
if (!Modifications.modifications[modName].hidden) {
const key = modName + (m.getModValue(modName) / 100 || 0);
const editable = modName !== 'fallofffromrange';
const highlight = m.blueprint.grades[m.blueprint.grade].features[modName];
this.lastNeId = modName;
(editable && highlight ? modifiableModifications : modifications).push(
<Modification key={ key } ship={ ship } m={ m } highlight={highlight}
value={m.getPretty(modName) || 0} modItems={this.modItems}
onChange={onChange} onKeyDown={this._keyDown} name={modName}
editable={editable} handleModChange = {this._handleModChange} />
);
}
}
modifiableModifications.sort(MODIFICATIONS_COMPARATOR); const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[
modifications.sort(MODIFICATIONS_COMPARATOR); m.getBlueprintGrade()
return modifiableModifications.concat(modifications); ];
const blueprintModifications = chain(keys(blueprintFeatures))
.map((feature) => this._mkModification(feature, true))
.filter(([_, mod]) => Boolean(mod))
.flatMap()
.value();
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
.filter((prop) => !blueprintFeatures[prop])
.map((prop) => this._mkModification(prop, false))
.flatMap()
.value();
return blueprintModifications.concat(moduleModifications);
} }
/** /**
* Toggle the blueprints menu * Toggle the blueprints menu
*/ */
_toggleBlueprintsMenu() { _toggleBlueprintsMenu() {
const blueprintMenuOpened = !this.state.blueprintMenuOpened; this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened });
this.setState({ blueprintMenuOpened });
}
/**
* Activated when a blueprint is selected
* @param {int} fdname The Frontier name of the blueprint
* @param {int} grade The grade of the selected blueprint
*/
_blueprintSelected(fdname, grade) {
this.context.tooltip(null);
const { m, ship } = this.props;
const blueprint = getBlueprint(fdname, m);
blueprint.grade = grade;
ship.setModuleBlueprint(m, blueprint);
setPercent(ship, m, 100);
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
this.props.onChange();
} }
/** /**
* Toggle the specials menu * Toggle the specials menu
*/ */
_toggleSpecialsMenu() { _toggleSpecialsMenu() {
const specialMenuOpened = !this.state.specialMenuOpened; this.setState({ specialMenuOpened: !this.state.specialMenuOpened });
this.setState({ specialMenuOpened });
} }
/** /**
* Activated when a special is selected * Creates a callback for when a special effect is being selected
* @param {int} special The name of the selected special * @param {string} special The name of the selected special
* @returns {function} Callback
*/ */
_specialSelected(special) { _specialSelected(special) {
this.context.tooltip(null); return () => {
const { m, ship } = this.props; const { m } = this.props;
m.setExperimental(special);
if (special === null) {
ship.clearModuleSpecial(m);
} else {
ship.setModuleSpecial(m, Modifications.specials[special]);
}
this.setState({ specialMenuOpened: false }); this.setState({ specialMenuOpened: false });
this.props.onChange(); };
}
/**
* Provide a '50%' roll within the information we have
*/
_rollFifty() {
const { m, ship } = this.props;
setPercent(ship, m, 50);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a random roll within the information we have
*/
_rollRandom() {
const { m, ship } = this.props;
setRandom(ship, m);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'best' roll within the information we have
*/
_rollBest() {
const { m, ship } = this.props;
setPercent(ship, m, 100);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'worst' roll within the information we have
*/
_rollWorst() {
const { m, ship } = this.props;
setPercent(ship, m, 0);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Reset modification information
*/
_reset() {
const { m, ship } = this.props;
ship.clearModifications(m);
ship.clearModuleBlueprint(m);
this.selectedModId = null;
this.selectedSpecialId = null;
this.props.onChange();
}
/**
* set mod did change boolean
* @param {boolean} b Boolean to determine if a change has been made to a module
*/
_handleModChange(b) {
this.modValDidChange = b;
}
/**
* Set focus on first element in modifications menu
* after it first mounts
*/
componentDidMount() {
let firstEleCn = this.modItems['modMainDiv'].children.length > 0 ? this.modItems['modMainDiv'].children[0].className : null;
if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
} else {
this.modItems['modMainDiv'].firstElementChild.focus();
}
} }
/** /**
@@ -370,33 +213,13 @@ export default class ModificationsMenu extends TranslatedComponent {
* in a modification * in a modification
*/ */
componentDidUpdate() { componentDidUpdate() {
if (!this.modValDidChange) { if (this.selectedModRef) {
if (this.modItems['modMainDiv'].children.length > 0) { this.selectedModRef.focus();
if (this.modItems[this.selectedModId]) {
this.modItems[this.selectedModId].focus();
return; return;
} else if (this.modItems[this.selectedSpecialId]) { } else if (this.selectedSpecialRef) {
this.modItems[this.selectedSpecialId].focus(); this.selectedSpecialRef.focus();
return; return;
} }
let firstEleCn = this.modItems['modMainDiv'].children[0].className;
if (firstEleCn.indexOf('button-inline-menu') >= 0) {
this.modItems['modMainDiv'].firstElementChild.focus();
} else if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
}
}
} else {
this._handleModChange(false);// Need to reset if component update due to value change
}
}
/**
* set focus to the modification menu icon after mod menu is unmounted.
*/
componentWillUnmount() {
if (this.props.modButton) {
this.props.modButton.focus();
}
} }
/** /**
@@ -407,90 +230,155 @@ export default class ModificationsMenu extends TranslatedComponent {
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const { m } = this.props; const { m } = this.props;
const { blueprintMenuOpened, specialMenuOpened } = this.state; const {
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
} = this.state;
const _toggleBlueprintsMenu = this._toggleBlueprintsMenu; const appliedBlueprint = m.getBlueprint();
const _toggleSpecialsMenu = this._toggleSpecialsMenu; const appliedGrade = m.getBlueprintGrade();
const _rollFull = this._rollBest; const appliedExperimental = m.getExperimental();
const _rollWorst = this._rollWorst;
const _rollFifty = this._rollFifty;
const _rollRandom = this._rollRandom;
const _reset = this._reset;
let blueprintLabel; let renderComponents = [];
let haveBlueprint = false; switch (true) {
let blueprintTt; case !appliedBlueprint || blueprintMenuOpened:
let blueprintCv; renderComponents = this._renderBlueprints();
// TODO: Fix this to actually find the correct blueprint. break;
if (!m.blueprint || !m.blueprint.name || !m.blueprint.fdname || !Modifications.modules[m.grp].blueprints || !Modifications.modules[m.grp].blueprints[m.blueprint.fdname]) { case specialMenuOpened:
this.props.ship.clearModuleBlueprint(m); renderComponents = this._renderSpecials();
this.props.ship.clearModuleSpecial(m); break;
} default:
if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade]) { // Since the first case didn't apply, there is a blueprint applied so
blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade; // we render the modifications
haveBlueprint = true; let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade);
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade].engineers, m.grp);
blueprintCv = getPercent(m);
}
let specialLabel; renderComponents.push(
let specialTt; <div style={{ cursor: 'pointer' }} key="blueprintsMenu"
if (m.blueprint && m.blueprint.special) { className="section-menu button-inline-menu"
specialLabel = m.blueprint.special.name; onMouseOver={termtip.bind(null, blueprintTt)}
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname); onMouseOut={tooltip.bind(null, null)}
} else { onClick={this._toggleBlueprintsMenu}
specialLabel = translate('PHRASE_SELECT_SPECIAL');
}
const specials = this._renderSpecials(this.props, this.context);
/**
* pnellesen - 05/28/2018 - added additional checks for specials.length below to ensure menus
* display correctly in cases where there are no specials (ex: AFMUs.)
*/
const showBlueprintsMenu = blueprintMenuOpened;
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened;
const showSpecialsMenu = specialMenuOpened && specials.length;
const showRolls = haveBlueprint && !blueprintMenuOpened && (!specialMenuOpened || !specials.length);
const showReset = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
const showMods = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
if (haveBlueprint) {
this.firstBPLabel = blueprintLabel;
} else {
this.firstBPLabel = 'selectBP';
}
return (
<div
className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation() }
onContextMenu={stopCtxPropagation}
ref={modItem => this.modItems['modMainDiv'] = modItem}
> >
{ showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ? {translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{blueprintLabel}</div> : </div>
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> } );
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
{ showSpecial & !showSpecialsMenu ? <div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu} onKeyDown={ this._keyDown }>{specialLabel}</div> : null }
{ showSpecialsMenu ? specials : null }
{ showReset ? <div tabIndex="0" className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
{ showRolls ?
if (m.getApplicableExperimentals().length) {
let specialLabel = translate('PHRASE_SELECT_SPECIAL');
let specialTt;
if (appliedExperimental) {
specialLabel = appliedExperimental;
specialTt = specialToolTip(language, m, appliedExperimental);
}
renderComponents.push(
<div className="section-menu button-inline-menu"
style={{ cursor: 'pointer' }}
onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
onMouseOut={specialTt ? tooltip.bind(null, null) : null}
onClick={this._toggleSpecialsMenu}
>{specialLabel}</div>
);
}
renderComponents.push(
<div
className="section-menu button-inline-menu warning"
style={{ cursor: 'pointer' }}
onClick={() => {
m.resetEngineering();
this.selectedModRef = null;
this.selectedSpecialRef = null;
tooltip(null);
this.setState({
blueprintMenuOpened: true,
blueprintProgress: undefined,
});
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
onMouseOut={tooltip.bind(null, null)}
>{translate('reset')}</div>,
<table style={{ width: '100%', backgroundColor: 'transparent' }}> <table style={{ width: '100%', backgroundColor: 'transparent' }}>
<tbody> <tbody>
{ showRolls ?
<tr> <tr>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: false }) }> { translate('mroll') }: </td> <td
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 }) } style={{ cursor: 'pointer' }} onClick={_rollWorst} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td> className={cn(
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td> 'section-menu button-inline-menu',
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td> { active: false },
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td> )}
</tr> : null } >{translate('mroll')}:</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0);
this.setState({ blueprintProgress: 0 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('0%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0.5 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0.5);
this.setState({ blueprintProgress: 0.5 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
onMouseOut={tooltip.bind(null, null)}
>{translate('50%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 1 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(1);
this.setState({ blueprintProgress: 1 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('100%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress % 0.5 !== 0 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
const blueprintProgress = Math.random();
m.setBlueprintProgress(blueprintProgress);
this.setState({ blueprintProgress });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
onMouseOut={tooltip.bind(null, null)}
>{translate('random')}</td>
</tr>
</tbody> </tbody>
</table> : null } </table>,
{ showMods ? <hr /> : null } <hr />,
{ showMods ? <span
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} > onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
{ this._renderModifications(this.props) } onMouseOut={tooltip.bind(null, null)}
</span> : null } >
<table style={{ width: '100%' }}>
<tbody>
{this._renderModifications()}
</tbody>
</table>
</span>
);
}
return (
<div className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation}
>
{renderComponents}
</div> </div>
); );
} }

View File

@@ -1,36 +1,28 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShipProps } from 'ed-forge';
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
/** /**
* Movement * Movement
*/ */
export default class Movement extends TranslatedComponent { export default class Movement extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
fuel: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render movement * Render movement
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, boost, eng, cargo, fuel } = this.props; const { ship, boost } = this.props;
const { language } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { formats } = language;
return ( return (
<span id='movement'> <span id='movement'>
@@ -57,14 +49,10 @@ export default class Movement extends TranslatedComponent {
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/> <path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/> <path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
{/* Speed */} <text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text>
<text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text> <text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text>
{/* Pitch */} <text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text>
<text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text> <text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text>
{/* Roll */}
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
{/* Yaw */}
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
</svg> </svg>
</span>); </span>);
} }

View File

@@ -3,101 +3,36 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import { nameComparator } from '../utils/SlotFunctions';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { DAMAGE_METRICS } from 'ed-forge/lib/ship-stats';
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
/** /**
* Generates an internationalization friendly weapon comparator that will * Turns an object into a tooltip.
* sort by specified property (if provided) then by name/group, class, rating * @param {function} translate Translate function
* @param {function} translate Translation function * @param {object} o Map to make the tooltip from
* @param {function} propComparator Optional property comparator * @returns {React.Component} Tooltip
* @param {boolean} desc Use descending order
* @return {function} Comparator function for names
*/ */
export function weaponComparator(translate, propComparator, desc) { function objToTooltip(translate, o) {
return (a, b) => { return toPairs(o)
if (!desc) { // Flip A and B if ascending order .filter(([k, v]) => Boolean(v))
let t = a; .map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>);
a = b;
b = t;
}
// If a property comparator is provided use it first
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
if (diff) {
return diff;
}
// Property matches so sort by name / group, then class, rating
if (a.name === b.name && a.grp === b.grp) {
if(a.class == b.class) {
return a.rating > b.rating ? 1 : -1;
}
return a.class - b.class;
}
return nameComparator(translate, a, b);
};
}
/**
* Creates a tooltip that shows damage by type.
* @param {function} translate Translation function
* @param {Object} formats Object that holds format functions
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
* @returns {Array} Tooltip
*/
function getSDpsTooltip(translate, formats, sdpsObject) {
return Object.keys(sdpsObject).filter(key => sdpsObject[key])
.map(key => {
return (
<div key={key}>
{translate(key) + ' ' + formats.f1(sdpsObject[key])}
</div>
);
});
} }
/** /**
* Returns a data object used by {@link PieChart} that shows damage by type. * Returns a data object used by {@link PieChart} that shows damage by type.
* @param {function} translate Translation function * @param {function} translate Translation function
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type * @param {Calc.SDps} o Object that holds sdps split up by type
* @returns {Object} Data object * @returns {Object} Data object
*/ */
function getSDpsData(translate, sdpsObject) { function objToPie(translate, o) {
return Object.keys(sdpsObject).map(key => { return toPairs(o).map(([k, value]) => {
return { return { label: translate(k), value };
value: Math.round(sdpsObject[key]),
label: translate(key)
};
}); });
} }
/**
* Adds all damage of `add` onto `addOn`.
* @param {Calc.SDps} addOn Object that holds sdps split up by type (will be mutated)
* @param {Calc.SDps} add Object that holds sdps split up by type
*/
function addSDps(addOn, add) {
Object.keys(addOn).map(k => addOn[k] += (add[k] ? add[k] : 0));
}
/**
* Calculates the overall sdps of an sdps object.
* @param {Calc.SDps} sdpsObject Object that holds sdps spluit up by type
*/
function sumSDps(sdpsObject) {
if (sdpsObject.total) {
return sdpsObject.total;
}
return Object.keys(sdpsObject).reduce(
(acc, k) => acc + (sdpsObject[k] ? sdpsObject[k] : 0),
0
);
}
/** /**
* Offence information * Offence information
* Offence information consists of four panels: * Offence information consists of four panels:
@@ -108,12 +43,10 @@ function sumSDps(sdpsObject) {
*/ */
export default class Offence extends TranslatedComponent { export default class Offence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.instanceOf(Ship).isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired
}; };
/** /**
@@ -122,146 +55,234 @@ export default class Offence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._sort = this._sort.bind(this);
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
this.state = { this.state = {
predicate: 'n', predicate: 'classRating',
desc: true, desc: true,
damage
}; };
} }
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
this.setState({ damage });
}
return true;
}
/** /**
* Set the sort order and sort * Set the sort order and sort
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
let desc = this.state.desc; let desc = predicate == this.state.predicate ? !this.state.desc : true;
if (predicate == this.state.predicate) {
desc = !desc;
} else {
desc = true;
}
this._sort(predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/**
* Sorts the weapon list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort order descending
*/
_sort(predicate, desc) {
let comp = weaponComparator.bind(null, this.context.language.translate);
switch (predicate) {
case 'n': comp = comp(null, desc); break;
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
}
this.state.damage.sort(comp);
}
/** /**
* Render offence * Render offence
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, opponent, wep, engagementrange } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { damage } = this.state;
const sortOrder = this._sortOrder; const sortOrder = this._sortOrder;
const pd = ship.standard[4].m; const {
drained, sustained, rangeMultiplier, hardnessMultiplier, timeToDrain
} = ship.getMetrics(DAMAGE_METRICS);
const portions = {
Absolute: sustained.types.abs,
Explosive: sustained.types.expl,
Kinetic: sustained.types.kin,
Thermic: sustained.types.therm,
};
const opponentShields = Calc.shieldMetrics(opponent, 4); const oppShield = ship.getOpponent().getShield();
const opponentArmour = Calc.armourMetrics(opponent); const shieldMults = {
Absolute: 1,
Explosive: oppShield.explosive.damageMultiplier,
Kinetic: oppShield.kinetic.damageMultiplier,
Thermic: oppShield.thermal.damageMultiplier,
};
const timeToDrain = Calc.timeToDrainWep(ship, wep); const oppArmour = ship.getOpponent().getArmour();
const armourMults = {
Absolute: 1,
Explosive: oppArmour.explosive.damageMultiplier,
Kinetic: oppArmour.kinetic.damageMultiplier,
Thermic: oppArmour.thermal.damageMultiplier,
};
const weapons = sortBy(ship.getHardpoints(), (m) => m.get('distributordraw'));
let rows = weapons.map((weapon) => {
const sdps = weapon.get('sustaineddamagepersecond');
const byRange = weapon.getRangeEffectiveness();
const weaponPortions = {
Absolute: weapon.get('absolutedamageportion'),
Explosive: weapon.get('explosivedamageportion'),
Kinetic: weapon.get('kineticdamageportion'),
Thermic: weapon.get('thermicdamageportion'),
};
const baseSdpsTooltip = objToTooltip(
translate,
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
);
let totalSEps = 0; const bySys = oppShield.absolute.bySys;
let totalSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; const shieldResEfts = mergeWith(
let shieldsSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; clone(weaponPortions),
let armourSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; shieldMults,
(objV, srcV) => objV * srcV
);
const byShieldRes = sum(values(shieldResEfts));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(
shieldResEfts,
(mult) => formats.f1(byRange * mult * bySys * sdps),
),
);
const shieldsEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byShieldRes),
'power distributor': formats.pct1(bySys),
},
);
const shieldEft = byRange * byShieldRes * bySys;
const rows = []; const byHardness = weapon.getArmourEffectiveness();
for (let i = 0; i < damage.length; i++) { const armourResEfts = mergeWith(
const weapon = damage[i]; clone(weaponPortions),
armourMults,
(objV, srcV) => objV * srcV,
);
const byArmourRes = sum(values(armourResEfts));
const armourSdpsTooltip = objToTooltip(
translate,
mapValues(
armourResEfts,
(mult) => formats.f1(byRange * mult * byHardness * sdps)
),
);
const armourEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byArmourRes),
hardness: formats.pct1(byHardness),
},
);
const armourEft = byRange * byArmourRes * byHardness;
totalSEps += weapon.seps; const bp = weapon.getBlueprint();
addSDps(totalSDpsObject, weapon.sdps.base); const grade = weapon.getBlueprintGrade();
addSDps(shieldsSDpsObject, weapon.sdps.shields); const exp = weapon.getExperimental();
addSDps(armourSDpsObject, weapon.sdps.armour); let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`;
if (exp) {
bpTitle += `, ${translate(exp)}`;
}
return {
slot: weapon.getSlot(),
mount: weapon.mount,
classRating: weapon.getClassRating(),
type: weapon.readMeta('type'),
bpTitle: bp ? ` (${bpTitle})` : null,
sdps,
baseSdpsTooltip,
shieldSdps: sdps * shieldEft,
shieldEft,
shieldsSdpsTooltip,
shieldsEftTooltip,
armourSdps: sdps * armourEft,
armourEft,
armourSdpsTooltip,
armourEftTooltip,
};
});
const baseSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.base); const { predicate, desc } = this.state;
rows = sortBy(rows, (row) => row[predicate]);
const effectivenessShieldsTooltipDetails = []; if (desc) {
effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>); reverse(rows);
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>);
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>);
const effectiveShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
const effectivenessArmourTooltipDetails = [];
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>);
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>);
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>);
const effectiveArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
rows.push(
<tr key={weapon.id}>
<td className='ri'>
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{weapon.classRating} {translate(weapon.name)}
{weapon.engineering ? ' (' + weapon.engineering + ')' : null }
</td>
<td className='ri'><span onMouseOver={termtip.bind(null, baseSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.base.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
</tr>);
} }
const totalSDps = sumSDps(totalSDpsObject); const sdpsTooltip = objToTooltip(
const totalSDpsTooltipDetails = getSDpsTooltip(translate, formats, totalSDpsObject); translate,
const totalSDpsData = getSDpsData(translate, totalSDpsObject); mapValues(portions, (p) => formats.f1(sustained.dps * p)),
);
const sdpsPie = objToPie(
translate,
mapValues(portions, (p) => Math.round(sustained.dps * p)),
);
const totalShieldsSDps = sumSDps(shieldsSDpsObject); const shieldSdpsSrcs = mergeWith(
const totalShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, shieldsSDpsObject); clone(portions),
const shieldsSDpsData = getSDpsData(translate, shieldsSDpsObject); shieldMults,
(objV, srcV) => sustained.dps * oppShield.absolute.bySys *
rangeMultiplier * objV * srcV,
);
const shieldsSdps = sum(values(shieldSdpsSrcs));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
);
const shieldsSdpsPie = objToPie(
translate,
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
);
const totalArmourSDps = sumSDps(armourSDpsObject); const armourSdpsSrcs = mergeWith(
const totalArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, armourSDpsObject); clone(portions),
const armourSDpsData = getSDpsData(translate, armourSDpsObject); armourMults,
(objV, srcV) => sustained.dps * hardnessMultiplier * rangeMultiplier *
objV * srcV,
);
const armourSdps = sum(values(armourSdpsSrcs));
const totalArmourSDpsTooltipDetails = objToTooltip(
translate,
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
);
const armourSDpsData = objToPie(
translate,
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
);
const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); const drainedPortions = {
const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); Absolute: drained.types.abs,
Explosive: drained.types.expl,
Kinetic: drained.types.kin,
Thermic: drained.types.therm,
};
// How much damage do we deal, before the capacitor is empty?
const armourLeft = oppArmour.armour - (timeToDrain * armourSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteArmour;
if (armourLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
armourMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier *
hardnessMultiplier;
timeToDepleteArmour = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (armourLeft / effectiveDrainedDps);
} else {
timeToDepleteArmour = oppArmour.armour / armourSdps;
}
// How much damage do we deal, before the capacitor is empty?
const shieldsLeft = oppShield.withSCBs - (timeToDrain * shieldsSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteShields;
if (shieldsLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
shieldMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier;
timeToDepleteShields = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (shieldsLeft / effectiveDrainedDps);
} else {
timeToDepleteShields = oppShield.withSCBs / shieldsSdps;
}
return ( return (
<span id='offence'> <span id='offence'>
@@ -269,28 +290,75 @@ export default class Offence extends TranslatedComponent {
<table> <table>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th> <th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th>
<th colSpan='1'>{translate('overall')}</th> <th colSpan='1'>{translate('overall')}</th>
<th colSpan='2'>{translate('opponent\'s shields')}</th> <th colSpan='2'>{translate('opponent\'s shields')}</th>
<th colSpan='2'>{translate('opponent\'s armour')}</th> <th colSpan='2'>{translate('opponent\'s armour')}</th>
</tr> </tr>
<tr> <tr>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th> <th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')}
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')}
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows.map((row) => (
<tr key={row.slot}>
<td className='ri'>
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{row.classRating} {translate(row.type)}
{row.bpTitle}
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.sdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.shieldSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.shieldEft)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.armourSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.armourEft)}</span></td>
</tr>
))}
{rows.length > 0 && {rows.length > 0 &&
<tr> <tr>
<td></td> <td></td>
<td className='ri'><span onMouseOver={termtip.bind(null, totalSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalSDps)}</span></td> <td className='ri'>
<td className='ri'><span onMouseOver={termtip.bind(null, totalShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalShieldsSDps)}</span></td> <span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(sustained.dps)}
</span>
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(shieldsSdps)}
</span>
</td>
<td></td> <td></td>
<td className='ri'><span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalArmourSDps)}</span></td> <td className='ri'>
<span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(armourSdps)}
</span>
</td>
<td></td> <td></td>
</tr> </tr>
} }
@@ -299,22 +367,51 @@ export default class Offence extends TranslatedComponent {
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('offence metrics')}</h2> <h2>{translate('offence metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))}
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2> onMouseOut={tooltip.bind(null, null)}>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2> {translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2> {timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2> </h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
{formats.f1(shieldsSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
{formats.f1(armourSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}
</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('overall damage')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))}
<PieChart data={totalSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('overall damage')}
</h2>
<PieChart data={sdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))}
<PieChart data={shieldsSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('shield damage sources')}
</h2>
<PieChart data={shieldsSdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('armour damage sources')}
</h2>
<PieChart data={armourSDpsData} /> <PieChart data={armourSDpsData} />
</div> </div>
</span>); </span>);

View File

@@ -11,29 +11,24 @@ import Movement from './Movement';
import Offence from './Offence'; import Offence from './Offence';
import Defence from './Defence'; import Defence from './Defence';
import WeaponDamageChart from './WeaponDamageChart'; import WeaponDamageChart from './WeaponDamageChart';
import Pips from '../components/Pips';
import Boost from '../components/Boost';
import Fuel from '../components/Fuel';
import Cargo from '../components/Cargo';
import ShipPicker from '../components/ShipPicker';
import EngagementRange from '../components/EngagementRange';
import autoBind from 'auto-bind';
import { ShipProps } from 'ed-forge';
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
/** /**
* Outfitting subpages * Outfitting subpages
*/ */
export default class OutfittingSubpages extends TranslatedComponent { export default class OutfittingSubpages extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired,
buildName: PropTypes.string, buildName: PropTypes.string,
sys: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired,
opponent: PropTypes.object.isRequired,
opponentBuild: PropTypes.string,
opponentSys: PropTypes.number.isRequired,
opponentEng: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired,
}; };
/** /**
@@ -42,13 +37,17 @@ export default class OutfittingSubpages extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._powerTab = this._powerTab.bind(this); autoBind(this);
this._profilesTab = this._profilesTab.bind(this);
this._offenceTab = this._offenceTab.bind(this);
this._defenceTab = this._defenceTab.bind(this);
this.props.ship.setOpponent(this.props.ship);
this.state = { this.state = {
boost: false,
cargo: props.ship.get(CARGO_CAPACITY),
fuel: props.ship.get(FUEL_CAPACITY),
pips: props.ship.getDistributorSettingsObject(),
tab: Persist.getOutfittingTab() || 'power', tab: Persist.getOutfittingTab() || 'power',
engagementRange: 1000,
opponent: this.props.ship,
}; };
} }
@@ -57,128 +56,114 @@ export default class OutfittingSubpages extends TranslatedComponent {
* @param {string} tab Tab name * @param {string} tab Tab name
*/ */
_showTab(tab) { _showTab(tab) {
Persist.setOutfittingTab(tab);
this.setState({ tab }); this.setState({ tab });
} }
/**
* Render the power tab
* @return {React.Component} Tab contents
*/
_powerTab() {
let { ship, buildName, code, onChange } = this.props;
Persist.setOutfittingTab('power');
const powerMarker = `${ship.toString()}`;
const costMarker = `${ship.toString().split('.')[0]}`;
return <div>
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
<CostSection ship={ship} buildName={buildName} code={costMarker} />
</div>;
}
/**
* Render the profiles tab
* @return {React.Component} Tab contents
*/
_profilesTab() {
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
const { translate } = this.context.language;
let realBoost = boost && ship.canBoost(cargo, fuel);
Persist.setOutfittingTab('profiles');
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
return <div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
</div>
</div>;
}
/**
* Render the offence tab
* @return {React.Component} Tab contents
*/
_offenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
Persist.setOutfittingTab('offence');
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
return <div>
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
</div>;
}
/**
* Render the defence tab
* @return {React.Component} Tab contents
*/
_defenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
Persist.setOutfittingTab('defence');
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
return <div>
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
</div>;
}
/** /**
* Render the section * Render the section
* @return {React.Component} Contents * @return {React.Component} Contents
*/ */
render() { render() {
const tab = this.state.tab; const { buildName, code, ship } = this.props;
const translate = this.context.language.translate; const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state;
let tabSection; const { translate } = this.context.language;
switch (tab) {
case 'power': tabSection = this._powerTab(); break;
case 'profiles': tabSection = this._profilesTab(); break;
case 'offence': tabSection = this._offenceTab(); break;
case 'defence': tabSection = this._defenceTab(); break;
}
const cargoCapacity = ship.get(CARGO_CAPACITY);
const showCargoSlider = cargoCapacity > 0;
return ( return (
<div>
{/* Control of ship and opponent */}
<div className="group quarter">
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
{translate('ship control')}
</h2>
<Boost boost={boost} onChange={(boost) => this.setState({ boost })} />
</div>
<div className="group quarter">
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
{translate('opponent')}
</h2>
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
</div>
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
onChange={(fuel) => this.setState({ fuel })} />
</div>
{showCargoSlider ?
<div className="group quarter">
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
onChange={(cargo) => this.setState({ cargo })} />
</div> : null}
<div className="group half">
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
</div>
<div className="group half">
<EngagementRange ship={ship} engagementRange={engagementRange}
onChange={(engagementRange) => this.setState({ engagementRange })} />
</div>
<div className='group full' style={{ minHeight: '1000px' }}> <div className='group full' style={{ minHeight: '1000px' }}>
<table className='tabs'> <table className='tabs'>
{/* Select tab section */}
<thead> <thead>
<tr> <tr>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th> <th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th> onClick={this._showTab.bind(this, 'power')}>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th> {translate('power and costs')}
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('tab_defence')}</th> </th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
onClick={this._showTab.bind(this, 'profiles')}>
{translate('profiles')}</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
onClick={this._showTab.bind(this, 'offence')}>
{translate('offence')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
onClick={this._showTab.bind(this, 'defence')}>
{translate('tab_defence')}
</th>
</tr> </tr>
</thead> </thead>
</table> </table>
{tabSection} {/* Show selected tab */}
{tab == 'power' ?
<div>
<PowerManagement ship={ship} code={code} />
<CostSection ship={ship} buildName={buildName} code={code} />
</div> : null}
{tab == 'profiles' ?
<div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement code={code} ship={ship} boost={boost} pips={pips} />
</div>
<div className='group third'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
</div>
<div className='group third'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
</div>
</div> : null}
{tab == 'offence' ?
<div>
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
{tab == 'defence' ?
<div>
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
</div>
</div> </div>
); );
} }

View File

@@ -10,7 +10,6 @@ const LABEL_COLOUR = '#000000';
* A pie chart * A pie chart
*/ */
export default class PieChart extends Component { export default class PieChart extends Component {
static propTypes = { static propTypes = {
data : PropTypes.array.isRequired data : PropTypes.array.isRequired
}; };

View File

@@ -3,6 +3,7 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Pip } from './SvgIcons'; import { Pip } from './SvgIcons';
import { autoBind } from 'react-extras'; import { autoBind } from 'react-extras';
import { Ship } from 'ed-forge';
/** /**
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area. * Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
@@ -10,13 +11,9 @@ import { autoBind } from 'react-extras';
*/ */
export default class Pips extends TranslatedComponent { export default class Pips extends TranslatedComponent {
static propTypes = { static propTypes = {
sys: PropTypes.number.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
wep: PropTypes.number.isRequired, onChange: PropTypes.func.isRequired,
mcSys: PropTypes.number.isRequired,
mcEng: PropTypes.number.isRequired,
mcWep: PropTypes.number.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -27,6 +24,12 @@ export default class Pips extends TranslatedComponent {
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); autoBind(this);
const { ship } = props;
this._incSys = this._change(ship.incSys);
this._incEng = this._change(ship.incEng);
this._incWep = this._change(ship.incWep);
this._reset = this._change(ship.pipsReset);
} }
/** /**
@@ -71,153 +74,42 @@ export default class Pips extends TranslatedComponent {
} }
/** /**
* Reset the capacitor * Creates a function that handles pip assignment and call `onChance`.
*/ * @param {String} cb Callback that handles the actual pip assignment
_reset(isMc) {
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
if (isMc) {
if (mcSys || mcEng || mcWep) {
sys -= mcSys;
eng -= mcEng;
wep -= mcWep;
this.props.onChange(sys, eng, wep, 0, 0, 0);
}
} else if (sys != 2 || eng != 2 || wep != 2) {
sys = eng = wep = 2;
this.props.onChange(sys + mcSys, eng + mcEng, wep + mcWep, mcSys, mcEng, mcWep);
}
}
/**
* Increment the SYS capacitor
*/
_incSys() {
this._inc('sys', false);
}
/**
* Increment the ENG capacitor
*/
_incEng() {
this._inc('eng', false);
}
/**
* Increment the WEP capacitor
*/
_incWep() {
this._inc('wep', false);
}
_wrapMcClick(key) {
return (event) => {
event.stopPropagation();
event.preventDefault();
if (key == 'rst') {
this._reset(true);
} else {
this._inc(key, true);
}
};
}
/**
* Increases a given capacitor
* @param {String} key Pip name to increase (one of 'sys', 'eng', 'wep')
* @param {Boolean} isMc True when increase is by multi crew * @param {Boolean} isMc True when increase is by multi crew
* @returns {Function} Function that handles pip assigment
*/ */
_inc(key, isMc) { _change(cb, isMc) {
if (!['sys', 'eng', 'wep'].includes(key)) { return () => {
return; cb(isMc);
} this.props.onChange(this.props.ship.getDistributorSettingsObject());
};
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
let mc = key == 'sys' ? mcSys : (key == 'eng' ? mcEng : mcWep);
let pips = this.props[key] - mc;
let other1 = key == 'sys' ? eng - mcEng : sys - mcSys;
let other2 = key == 'wep' ? eng - mcEng : wep - mcWep;
const required = Math.min(1, 4 - mc - pips);
if (isMc) {
// We can only set full pips in multi-crew also we can only set two pips
if (required > 0.5 && mcSys + mcEng + mcWep < 2) {
if (key == 'sys') {
mcSys += 1;
} else if (key == 'eng') {
mcEng += 1;
} else {
mcWep += 1;
}
}
} else if (required > 0) {
if (required == 0.5) {
// Take from whichever is larger
if (other1 > other2) {
other1 -= 0.5;
} else {
other2 -= 0.5;
}
pips += 0.5;
} else {
// Required is 1 - take from both if possible
if (other1 == 0) {
other2 -= 1;
} else if (other2 == 0) {
other1 -= 1;
} else {
other1 -= 0.5;
other2 -= 0.5;
}
pips += 1;
}
}
sys = mcSys + (key == 'sys' ? pips : other1);
eng = mcEng + (key == 'eng' ? pips : (key == 'sys' ? other1 : other2));
wep = mcWep + (key == 'wep' ? pips : other2);
this.props.onChange(sys, eng, wep, mcSys, mcEng, mcWep);
} }
/** /**
* Set up the rendering for pips * Set up the rendering for pips
* @param {Number} sys the SYS pips
* @param {Number} eng the ENG pips
* @param {Number} wep the WEP pips
* @param {Number} mcSys SYS pips from multi-crew
* @param {Number} mcEng ENG pips from multi-crew
* @param {Number} mcWep WEP pips from multi-crew
* @returns {Object} Object containing the rendering for the pips * @returns {Object} Object containing the rendering for the pips
*/ */
_renderPips(sys, eng, wep, mcSys, mcEng, mcWep) { _renderPips() {
const pipsSvg = { const pipsSvg = {
SYS: [], Sys: [],
ENG: [], Eng: [],
WEP: [], Wep: [],
}; };
// Multi-crew pipsSettings actually are included in the overall pip count therefore for (let k in this.props.pips) {
// we can consider [0, sys - mcSys] as normal pipsSettings whilst [sys - mcSys, sys] let { base, mc } = this.props.pips[k];
// are the multi-crew pipsSettings in what follows. for (let i = 0; i < Math.floor(base); i++) {
pipsSvg[k].push(<Pip key={i} className='full' />);
let pipsSettings = {
SYS: [sys, mcSys],
ENG: [eng, mcEng],
WEP: [wep, mcWep],
};
for (let pipName in pipsSettings) {
let [pips, mcPips] = pipsSettings[pipName];
for (let i = 0; i < Math.floor(pips - mcPips); i++) {
pipsSvg[pipName].push(<Pip key={i} className='full' />);
} }
if (pips > Math.floor(pips)) { if (base > Math.floor(base)) {
pipsSvg[pipName].push(<Pip className='half' key={'half'} />); pipsSvg[k].push(<Pip className='half' key={'half'} />);
} }
for (let i = pips - mcPips; i < Math.floor(pips); i++) { for (let i = 0; i < mc; i++) {
pipsSvg[pipName].push(<Pip key={i} className='mc' />); pipsSvg[k].push(<Pip key={base + i} className='mc' />);
} }
for (let i = Math.floor(pips + 0.5); i < 4; i++) { for (let i = Math.ceil(base + mc); i < 4; i++) {
pipsSvg[pipName].push(<Pip className='empty' key={i} />); pipsSvg[k].push(<Pip className='empty' key={i} />);
} }
} }
@@ -229,11 +121,10 @@ export default class Pips extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { tooltip, termtip } = this.context; const { ship } = this.props;
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
const pipsSvg = this._renderPips(sys, eng, wep, mcSys, mcEng, mcWep); const pipsSvg = this._renderPips();
return ( return (
<span id='pips'> <span id='pips'>
<table> <table>
@@ -241,38 +132,40 @@ export default class Pips extends TranslatedComponent {
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={() => this._inc('eng')} <td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td>
onContextMenu={this._wrapMcClick('eng')}>{pipsSvg['ENG']}</td>
<td>&nbsp;</td> <td>&nbsp;</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td>
onContextMenu={this._wrapMcClick('sys')}>{pipsSvg['SYS']}</td> <td className='clickable' onClick={this._incEng}>
<td className='clickable' onClick={this._incEng} {translate('ENG')}
onContextMenu={this._wrapMcClick('eng')}>{translate('ENG')}</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td>
onContextMenu={this._wrapMcClick('wep')}>{pipsSvg['WEP']}</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>
onContextMenu={this._wrapMcClick('sys')}>{translate('SYS')}</td> {translate('SYS')}
<td className='clickable' onClick={this._reset.bind(this, false)}> </td>
<td className='clickable' onClick={this._reset}>
{translate('RST')} {translate('RST')}
</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>
onContextMenu={this._wrapMcClick('wep')}>{translate('WEP')}</td> {translate('WEP')}
</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td className='clickable' onClick={this._change(ship.incSys, true)}>
<td className='clickable secondary' onClick={this._wrapMcClick('rst')} <Pip className='mc' />
onMouseEnter={termtip.bind(null, 'PHRASE_MULTI_CREW_CAPACITOR_POINTS')} </td>
onMouseLeave={tooltip.bind(null, null)}> <td className='clickable' onClick={this._change(ship.incEng, true)}>
{translate('RST')} <Pip className='mc' />
</td>
<td className='clickable' onClick={this._change(ship.incWep, true)}>
<Pip className='mc' />
</td> </td>
<td>&nbsp;</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -4,27 +4,25 @@ import * as d3 from 'd3';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { Ship } from 'ed-forge';
import { POWER_METRICS } from 'ed-forge/lib/ship-stats';
import autoBind from 'auto-bind';
/** /**
* Round to avoid floating point precision errors * Get the band-class.
* @param {Boolean} selected Band selected * @param {Boolean} selected Band selected
* @param {number} sum Band power sum * @param {Number} relDraw Relative amount of power drawn by this band and
* @param {number} avail Total available power * all prior
* @return {string} CSS Class name * @return {string} CSS Class name
*/ */
function getClass(selected, sum, avail) { function getClass(selected, relDraw) {
return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary'; if (selected) {
return 'secondary';
} else if (relDraw >= 1) {
return 'warning';
} else {
return 'primary';
} }
/**
* Get the # label for a Priority band
* @param {number} val Priority Band Watt value
* @param {number} index Priority Band index
* @param {Function} wattScale Watt Scale function
* @return {number} label / text
*/
function bandText(val, index, wattScale) {
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
} }
/** /**
@@ -33,10 +31,9 @@ function bandText(val, index, wattScale) {
*/ */
export default class PowerBands extends TranslatedComponent { export default class PowerBands extends TranslatedComponent {
static propTypes = { static propTypes = {
bands: PropTypes.array.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
available: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
width: PropTypes.number.isRequired, width: PropTypes.number.isRequired,
code: PropTypes.string,
}; };
/** /**
@@ -46,20 +43,16 @@ export default class PowerBands extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this.wattScale = d3.scaleLinear(); this.wattScale = d3.scaleLinear();
this.pctScale = d3.scaleLinear().domain([0, 1]); this.pctScale = d3.scaleLinear().domain([0, 1]);
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2); this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct); this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateScales = this._updateScales.bind(this);
this._selectNone = this._selectNone.bind(this);
this._hidetip = () => this.context.tooltip(); this._hidetip = () => this.context.tooltip();
let maxBand = props.bands[props.bands.length - 1]; this.profile = props.ship.getMetrics(POWER_METRICS);
this.state = { this.state = {
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
ret: {}, ret: {},
dep: {} dep: {}
}; };
@@ -83,8 +76,6 @@ export default class PowerBands extends TranslatedComponent {
let mRight = Math.round(140 * scale); let mRight = Math.round(140 * scale);
let innerWidth = props.width - mLeft - mRight; let innerWidth = props.width - mLeft - mRight;
this._updateScales(innerWidth, this.state.maxPwr, props.available);
this.setState({ this.setState({
barHeight, barHeight,
innerHeight, innerHeight,
@@ -140,41 +131,67 @@ export default class PowerBands extends TranslatedComponent {
this.setState({ dep: Object.assign({}, dep) }); this.setState({ dep: Object.assign({}, dep) });
} }
/**
* Update scale
* @param {number} innerWidth SVG innerwidth
* @param {number} maxPwr Maximum power level MJ (deployed or available)
* @param {number} available Available power MJ
*/
_updateScales(innerWidth, maxPwr, available) {
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
}
/** /**
* Update state based on property and context changes * Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties * @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context * @param {Object} nextContext Incoming/Next context
*/ */
componentWillReceiveProps(nextProps, nextContext) { componentWillReceiveProps(nextProps, nextContext) {
let { innerWidth, maxPwr } = this.state;
let { language, sizeRatio } = this.context; let { language, sizeRatio } = this.context;
let maxBand = nextProps.bands[nextProps.bands.length - 1];
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
if (language !== nextContext.language) { if (language !== nextContext.language) {
this.wattAxis.tickFormat(nextContext.language.formats.r2); this.wattAxis.tickFormat(nextContext.language.formats.r2);
this.pctAxis.tickFormat(nextContext.language.formats.rPct); this.pctAxis.tickFormat(nextContext.language.formats.rPct);
} }
if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
this.setState({ maxPwr: nextMaxPwr });
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateDimensions(nextProps, nextContext.sizeRatio); this._updateDimensions(nextProps, nextContext.sizeRatio);
} }
} }
/**
* Assemble bands for relative consumption array.
* @param {Number[]} consumed Array of relative-consumption numbers
* @param {object} selected Object mapping selected bands to 1
* @param {Number} yOffset Offset in y-direction of the bar
* @param {Function} onClick onClick callback
* @returns {React.Component} Bands
*/
_consumedToBands(consumed, selected, yOffset, onClick) {
const { state, wattScale } = this;
const bands = [];
let consumesPrev = 0;
for (let i = 0; i < consumed.length; i++) {
consumesPrev = consumed[i - 1] || consumesPrev;
const consumes = consumed[i];
if (!consumes) {
continue;
}
bands.push(<rect
key={'b' + i}
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
height={state.barHeight}
x={wattScale(consumesPrev)}
y={yOffset + 1}
onClick={onClick.bind(this, i)}
className={getClass(selected[i], consumes)}
/>);
bands.push(<text
key={'t' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
y={yOffset + (state.barHeight / 2)}
onClick={onClick.bind(this, i)}
className='primary-bg'>{i + 1}</text>
);
}
return bands;
}
/** /**
* Render the power bands * Render the power bands
* @return {React.Component} Power bands * @return {React.Component} Power bands
@@ -184,78 +201,27 @@ export default class PowerBands extends TranslatedComponent {
return null; return null;
} }
let { wattScale, pctScale, context, props, state } = this; let { pctScale, context, props, state } = this;
let { translate, formats } = context.language; let { translate, formats } = context.language;
let { f2, pct1 } = formats; // wattFmt, pctFmt let { f2, pct1 } = formats; // wattFmt, pctFmt
let { available, bands } = props; let { ship } = props;
let { innerWidth, ret, dep } = state; let { innerWidth, ret, dep, barHeight } = state;
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
let deployed = []; let {
let retracted = []; consumed, generated, relativeConsumed, relativeConsumedRetracted
} = ship.getMetrics(POWER_METRICS);
let maxPwr = Math.max(consumed, generated);
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
let depSum = relativeConsumed[relativeConsumed.length - 1];
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
let retSelected = Object.keys(ret).length > 0; let retSelected = Object.keys(ret).length > 0;
let depSelected = Object.keys(dep).length > 0; let depSelected = Object.keys(dep).length > 0;
let retSum = 0;
let depSum = 0;
for (let i = 0; i < bands.length; i++) {
let b = bands[i];
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
if (b.retracted > 0) {
let retLbl = bandText(b.retracted, i, wattScale);
retracted.push(<rect
key={'rB' + i}
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
y={1}
onClick={this._selectRet.bind(this, i)}
className={getClass(ret[i], b.retractedSum, available)}
/>);
if (retLbl) {
retracted.push(<text
key={'rT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
y={state.retY}
onClick={this._selectRet.bind(this, i)}
className='primary-bg'>{retLbl}</text>
);
}
}
if (b.retracted > 0 || b.deployed > 0) {
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
deployed.push(<rect
key={'dB' + i}
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
y={state.barHeight + 1}
onClick={this._selectDep.bind(this, i)}
className={getClass(dep[i], b.deployedSum, available)}
/>);
if (depLbl) {
deployed.push(<text
key={'dT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
y={state.depY}
onClick={this._selectDep.bind(this, i)}
className='primary-bg'>{depLbl}</text>
);
}
}
}
return ( return (
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}> <svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
@@ -271,8 +237,8 @@ export default class PowerBands extends TranslatedComponent {
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} /> <line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text> <text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text> <text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text>
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text>
</g> </g>
</svg> </svg>
); );

View File

@@ -3,24 +3,49 @@ import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import PowerBands from './PowerBands'; import PowerBands from './PowerBands';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import { Power, NoPower } from './SvgIcons'; import { Power, NoPower } from './SvgIcons';
import autoBind from 'auto-bind';
import { Ship, Module } from 'ed-forge';
const POWER = [ /**
null, * Makes a comparison based on the order `false < undefined < true` (fut) and
null, * maps it to `[-1, 0, 1]`.
<NoPower className='icon warning' />, * @param {boolean} a Bool or undefined
<Power className='secondary-disabled' /> * @param {boolean} b Bool or undefined
]; * @returns {number} Comparison
*/
function futComp(a, b) {
switch (a) {
case false: return (b === false ? 0 : 1);
// The next else-expression maps false to -1 and true to 1
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
case true: return (b === true ? 0 : -1);
}
}
/**
* Get the enabled-icon.
* @param {boolean} enabled Is the module enabled?
* @returns {React.Component} Enabled icon.
*/
function getPowerIcon(enabled) {
if (enabled === undefined) {
return null;
}
if (enabled) {
return <Power className='secondary-disabled' />;
} else {
return <NoPower className='icon warning' />;
}
}
/** /**
* Power Management Section * Power Management Section
*/ */
export default class PowerManagement extends TranslatedComponent { export default class PowerManagement extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -29,19 +54,17 @@ export default class PowerManagement extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._renderPowerRows = this._renderPowerRows.bind(this); autoBind(this);
this._updateWidth = this._updateWidth.bind(this);
this._sort = this._sort.bind(this);
this.state = { this.state = {
predicate: 'pwr', predicate: 'pwr',
desc: false, desc: true,
width: 0 width: 0
}; };
} }
/** /**
* Set the sort order and sort * Set the sort order
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
@@ -53,50 +76,51 @@ export default class PowerManagement extends TranslatedComponent {
desc = true; desc = true;
} }
this._sort(this.props.ship, predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/** /**
* Sorts the power list * Sorts the power list
* @param {Ship} ship Ship instance * @param {Module[]} modules Modules to sort
* @param {string} predicate Sort predicate * @returns {Module[]} Sorted modules
* @param {Boolean} desc Sort order descending
*/ */
_sort(ship, predicate, desc) { _sortAndFilter(modules) {
let powerList = ship.powerList; modules = modules.filter((m) => m.get('powerdraw') >= 0);
let comp = slotComparator.bind(null, this.context.language.translate); let { translate } = this.context.language;
const { predicate, desc } = this.state;
let comp;
switch (predicate) { switch (predicate) {
case 'n': comp = comp(null, desc); break; case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare(
case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break; translate(b.readMeta('type'))
case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break; ); break;
case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break; // case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break; case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break;
case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break; case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break;
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
} }
modules.sort(comp);
powerList.sort(comp); if (desc) {
modules.reverse();
}
return modules;
} }
/** /**
* Update slot priority * Creates a callback that changes the power priority for the given module
* @param {Object} slot Slot model * based on the given delta.
* @param {number} inc increment / decrement * @param {Module} m Module to set the priority for
* @param {Number} delta Delta to set
* @returns {Function} Callback
*/ */
_priority(slot, inc) { _prioCb(m, delta) {
if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) { return () => {
this.props.onChange(); const prio = m.getPowerPriority();
const newPrio = Math.max(0, prio + delta);
if (0 <= newPrio) {
m.setPowerPriority(newPrio);
} }
} };
/**
* Toggle slot active/inactive
* @param {Object} slot Slot model
*/
_toggleEnabled(slot) {
this.props.ship.setSlotEnabled(slot, !slot.enabled);
this.props.onChange();
} }
/** /**
@@ -110,37 +134,36 @@ export default class PowerManagement extends TranslatedComponent {
_renderPowerRows(ship, translate, pwr, pct) { _renderPowerRows(ship, translate, pwr, pct) {
let powerRows = []; let powerRows = [];
for (let i = 0, l = ship.powerList.length; i < l; i++) { let modules = this._sortAndFilter(ship.getModules());
let slot = ship.powerList[i]; for (let m of modules) {
if (slot.m && slot.m.getPowerUsage() > 0) {
let m = slot.m;
let toggleEnabled = this._toggleEnabled.bind(this, slot);
let retractedElem = null, deployedElem = null; let retractedElem = null, deployedElem = null;
const flipEnabled = () => m.setEnabled();
if (slot.enabled) { if (m.isEnabled()) {
retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>; let powered = m.isPowered();
deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>; retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
} else { } else {
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>; retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
} }
powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}> const slot = m.getSlot();
<td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td> powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}>
<td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td> <td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td>
<td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td> <td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td>
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
<td> <td>
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>&#9658;</span> <span className='flip ptr btn' onClick={this._prioCb(m, -1)}>&#9658;</span>
{' ' + (slot.priority + 1) + ' '} {' ' + (m.getPowerPriority() + 1) + ' '}
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>&#9658;</span> <span className='ptr btn' onClick={this._prioCb(m, 1)}>&#9658;</span>
</td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u>
</td> </td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
{retractedElem} {retractedElem}
{deployedElem} {deployedElem}
</tr>); </tr>);
} }
}
return powerRows; return powerRows;
} }
@@ -155,7 +178,6 @@ export default class PowerManagement extends TranslatedComponent {
* Add listeners when about to mount and sort power list * Add listeners when about to mount and sort power list
*/ */
componentWillMount() { componentWillMount() {
this._sort(this.props.ship, this.state.predicate, this.state.desc);
this.resizeListener = this.context.onWindowResize(this._updateWidth); this.resizeListener = this.context.onWindowResize(this._updateWidth);
} }
@@ -166,17 +188,6 @@ export default class PowerManagement extends TranslatedComponent {
this._updateWidth(); this._updateWidth();
} }
/**
* Sort power list if the ship instance has changed
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
if (this.props.ship != nextProps.ship) {
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
}
}
/** /**
* Remove listeners on unmount * Remove listeners on unmount
*/ */
@@ -191,39 +202,38 @@ export default class PowerManagement extends TranslatedComponent {
render() { render() {
let { ship, code } = this.props; let { ship, code } = this.props;
let { translate, formats } = this.context.language; let { translate, formats } = this.context.language;
let pwr = formats.f2; let pp = ship.getPowerPlant();
let pp = ship.standard[0].m;
let sortOrder = this._sortOrder;
return ( return (
<div ref={node => this.node = node} className='group half' id='componentPriority'> <div ref={node => this.node = node} className='group half' id='componentPriority'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th> {/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */}
<th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th> <th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th>
<th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th> <th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{pp.class + pp.rating}</td> <td>{String(pp.getClass()) + pp.getRating()}</td>
<td className='le shorten cap' >{translate('pp')}</td> <td className='le shorten cap' >{translate('pp')}</td>
<td><u >{translate('SYS')}</u></td>
<td>1</td> <td>1</td>
<td className='ri'>{pwr(pp.getPowerGeneration())}</td> <td className='ri'>{formats.f2(pp.get('powercapacity'))}</td>
<td className='ri'><u>100%</u></td> <td className='ri'><u>100%</u></td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
<tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr> <tr><td style={{ lineHeight:0 }} colSpan='8'>
{this._renderPowerRows(ship, translate, pwr, formats.pct1)} <hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} />
</td></tr>
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
</tbody> </tbody>
</table> </table>
<PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} /> <PowerBands width={this.state.width} ship={ship} code={code} />
</div> </div>
); );
} }

View File

@@ -1,10 +1,12 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Ships } from 'coriolis-data/dist';
import { Rocket } from './SvgIcons'; import { Rocket } from './SvgIcons';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import cn from 'classnames'; import cn from 'classnames';
import { Factory, Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { isEqual } from 'lodash';
/** /**
* Ship picker * Ship picker
@@ -13,40 +15,49 @@ import cn from 'classnames';
export default class ShipPicker extends TranslatedComponent { export default class ShipPicker extends TranslatedComponent {
static propTypes = { static propTypes = {
onChange: PropTypes.func.isRequired, onChange: PropTypes.func.isRequired,
ship: PropTypes.string.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
build: PropTypes.string
}; };
static defaultProps = {
ship: 'eagle'
}
/** /**
* constructor * constructor
* @param {object} props Properties react * @param {object} props Properties react
* @param {object} context react context * @param {object} context react context
*/ */
constructor(props, context) { // eslint-disable-line constructor(props, context) {
super(props); super(props);
autoBind(this);
this.shipOrder = Object.keys(Ships).sort(); this.state = {
this._toggleMenu = this._toggleMenu.bind(this); menuOpen: false,
this._closeMenu = this._closeMenu.bind(this); opponent: {
self: true,
this.state = { menuOpen: false }; type: props.ship.getShipType(),
stock: false,
id: undefined,
},
};
} }
/** /**
* Update ship * Update ship
* @param {object} ship the ship * @param {boolean} self True to compare with ship itself
* @param {string} build the build, if present * @param {object} type The ship type
* @param {boolean} stock True to compare with a stock version of given type
* @param {string} id The build's stored ID
*/ */
_shipChange(ship, build) { _shipChange(self, type, stock = false, id = null) {
this._closeMenu(); const opponent = { self, type, stock, id };
if (isEqual(opponent, this.state.opponent)) {
// Ensure that the ship has changed this.setState({ menuOpen: false });
if (ship !== this.props.ship || build !== this.props.build) { } else {
this.props.onChange(ship, build); const { onChange } = this.props;
if (self) {
onChange(this.props.ship);
} else if (stock) {
onChange(Factory.newShip(type));
} else {
onChange(new Ship(Persist.getBuild(type, id)));
}
this.setState({ menuOpen: false, opponent });
} }
} }
@@ -55,26 +66,41 @@ export default class ShipPicker extends TranslatedComponent {
* @returns {object} the picker menu * @returns {object} the picker menu
*/ */
_renderPickerMenu() { _renderPickerMenu() {
const { ship, build } = this.props; const { menuOpen } = this.state;
const _shipChange = this._shipChange; if (!menuOpen) {
const builds = Persist.getBuilds(); return null;
const buildList = [];
for (let shipId of this.shipOrder) {
const shipBuilds = [];
// Add stock build
const stockSelected = (ship == shipId && !build);
shipBuilds.push(<li key={shipId} className={ cn({ 'selected': stockSelected })} onClick={_shipChange.bind(this, shipId, null)}>Stock</li>);
if (builds[shipId]) {
let buildNameOrder = Object.keys(builds[shipId]).sort();
for (let buildName of buildNameOrder) {
const buildSelected = ship === shipId && build === buildName;
shipBuilds.push(<li key={shipId + '-' + buildName} className={ cn({ 'selected': buildSelected })} onClick={_shipChange.bind(this, shipId, buildName)}>{buildName}</li>);
}
}
buildList.push(<ul key={shipId} className='block'>{Ships[shipId].properties.name}{shipBuilds}</ul>);
} }
return buildList; const { translate } = this.context.language;
const { self, type, stock, id } = this.state.opponent;
return <div className='menu-list' onClick={(e) => e.stopPropagation()}>
<div className='quad'>
{Factory.getAllShipTypes().sort().map((shipType) =>
<ul key={shipType} className='block'>
{translate(shipType)}
{/* Add stock build */}
<li key={shipType}
onClick={this._shipChange.bind(this, false, shipType, true)}
className={cn({ selected: stock && type === shipType })}>
{translate('stock')}
</li>
{Persist.getBuildsNamesFor(shipType).sort().map((storedId) =>
<li key={`${shipType}-${storedId}`}
onClick={this._shipChange.bind(this, false, shipType, false, storedId)}
className={ cn({ selected: type === shipType && id === storedId })}>
{storedId}
</li>)}
{/* Add ship itself */}
{(this.props.ship.getShipType() === shipType ?
<li key='self'
onClick={this._shipChange.bind(this, true, shipType)}
className={cn({ selected: self })}>
{translate('THIS_SHIP')}
</li> :
null)}
</ul>)}
</div>
</div>;
} }
/** /**
@@ -85,41 +111,36 @@ export default class ShipPicker extends TranslatedComponent {
this.setState({ menuOpen: !menuOpen }); this.setState({ menuOpen: !menuOpen });
} }
/**
* Close the menu
*/
_closeMenu() {
const { menuOpen } = this.state;
if (menuOpen) {
this._toggleMenu();
}
}
/** /**
* Render picker * Render picker
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { translate } = this.context.language;
const { formats, translate, units } = language; const { ship } = this.props;
const { ship, build } = this.props;
const { menuOpen } = this.state; const { menuOpen } = this.state;
const { self, type, stock, id } = this.state.opponent;
let label;
if (self) {
label = translate('THIS_SHIP');
} else if (stock) {
label = translate('stock');
} else {
label = id;
}
const shipString = ship + ': ' + (build ? build : translate('stock'));
return ( return (
<div className='shippicker' onClick={ (e) => e.stopPropagation() }> <div className='shippicker' onClick={ (e) => e.stopPropagation() }>
<div className='menu'> <div className='menu'>
<div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}> <div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}>
<span><Rocket className='warning' /></span> <span><Rocket className='warning' /></span>
<span className='menu-item-label'>{shipString}</span> <span className='menu-item-label'>
{`${translate(type)}: ${label}`}
</span>
</div> </div>
{ menuOpen ?
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
<div className='quad'>
{this._renderPickerMenu()} {this._renderPickerMenu()}
</div> </div>
</div> : null }
</div>
</div> </div>
); );
} }

View File

@@ -1,21 +1,24 @@
import autoBind from 'auto-bind';
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { Warning } from './SvgIcons'; import { Warning } from './SvgIcons';
import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
const {
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, MAXIMUM_MASS,
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
} = ShipProps;
/** /**
* Ship Summary Table / Stats * Ship Summary Table / Stats
*/ */
export default class ShipSummaryTable extends TranslatedComponent { export default class ShipSummaryTable extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired,
pips: PropTypes.object.isRequired
}; };
/** /**
@@ -24,7 +27,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this.didContextChange = this.didContextChange.bind(this); autoBind(this);
this.state = { this.state = {
shieldColour: 'blue' shieldColour: 'blue'
}; };
@@ -35,44 +38,54 @@ export default class ShipSummaryTable extends TranslatedComponent {
* @return {React.Component} Summary table * @return {React.Component} Summary table
*/ */
render() { render() {
const { ship, cargo, fuel, pips } = this.props; const { ship } = this.props;
let { language, tooltip, termtip } = this.context; let { language, tooltip, termtip } = this.context;
let translate = language.translate; let translate = language.translate;
let u = language.units; let u = language.units;
let formats = language.formats; let formats = language.formats;
let { time, int, round, f1, f2 } = formats; let { time, int, f1, f2 } = formats;
let hide = tooltip.bind(null, null); let hide = tooltip.bind(null, null);
const shieldGenerator = ship.findInternalByGroup('sg') || ship.findInternalByGroup('psg');
const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator }); const speed = ship.get(SPEED);
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL'; const shipBoost = ship.get(BOOST_SPEED);
const timeToDrain = Calc.timeToDrainWep(ship, 4); const canThrust = 0 < speed;
const canThrust = ship.canThrust(cargo, ship.fuelCapacity); const canBoost = canThrust && !isNaN(shipBoost);
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canJump = ship.getSlotStatus(ship.standard[2]) == 3;
const sgMetrics = Calc.shieldMetrics(ship, pips.sys); const sgMetrics = ship.get(SHIELD_METRICS);
const shipBoost = canBoost ? Calc.calcBoost(ship) : 'No Boost'; const armourMetrics = ship.get(ARMOUR_METRICS);
const restingHeat = Math.sqrt(((ship.standard[0].m.pgen * ship.standard[0].m.eff) / ship.heatCapacity) / 0.2); const damageMetrics = ship.get(DAMAGE_METRICS);
const armourMetrics = Calc.armourMetrics(ship); const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
const timeToDrain = damageMetrics.timeToDrain[8];
const shieldGenerator = ship.getShieldGenerator();
const sgClassNames = cn({
warning: shieldGenerator && !shieldGenerator.isEnabled(),
muted: !shieldGenerator,
});
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined;
let shieldColour = 'blue'; let shieldColour = 'blue';
if (shieldGenerator && shieldGenerator.m.grp === 'psg') { switch (sgType) {
shieldColour = 'green'; case 'biweaveshieldgen': shieldColour = 'purple'; break;
} else if (shieldGenerator && shieldGenerator.m.grp === 'bsg') { case 'prismaticshieldgen': shieldColour = 'green'; break;
shieldColour = 'purple';
} }
this.state = { this.state = { shieldColour };
shieldColour
}; const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS);
// TODO:
const canJump = true;
return <div id='summary'> return <div id='summary'>
<div style={{display: "table", width: "100%"}}> <div style={{ display: 'table', width: '100%' }}>
<div style={{display: "table-row"}}> <div style={{ display: 'table-row' }}>
<table className={'summaryTable'}> <table className={'summaryTable'}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
<th colSpan={5} className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('jump range')}</th> <th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRange == 0 }) }>{translate('jump range')}</th>
<th rowSpan={2}>{translate('shield')}</th> <th rowSpan={2}>{translate('shield')}</th>
<th rowSpan={2}>{translate('integrity')}</th> <th rowSpan={2}>{translate('integrity')}</th>
<th rowSpan={2}>{translate('DPS')}</th> <th rowSpan={2}>{translate('DPS')}</th>
@@ -90,11 +103,11 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2}>{translate('resting heat (Beta)')}</th> <th rowSpan={2}>{translate('resting heat (Beta)')}</th>
</tr> </tr>
<tr> <tr>
<th className={ cn({ 'lft': true, 'bg-warning-disabled': !canJump }) }>{translate('max')}</th> <th className="lft">{translate('max')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('laden')}</th> <th>{translate('laden')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total unladen')}</th> <th>{translate('total unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total laden')}</th> <th>{translate('total laden')}</th>
<th className='lft'>{translate('hull')}</th> <th className='lft'>{translate('hull')}</th>
<th>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th>{translate('laden')}</th> <th>{translate('laden')}</th>
@@ -102,30 +115,87 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })}
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{ f2(Calc.jumpRange(ship.unladenMass + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump(), ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> >{canThrust ?
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <span>{int(speed)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })}
<td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td> >{canBoost ?
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td> <span>{int(shipBoost)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
<span>{f2(jumpRangeMetrics.jumpRange)}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0 <Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
<span>{f2(jumpRangeMetrics.totalRange)}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td className={sgClassNames}
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
onMouseLeave={hide}
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
onMouseLeave={hide}
>{int(armourMetrics.armour)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.dps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.eps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
onMouseLeave={hide}
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
{/* <td>{f1(ship.totalHps)}</td> */} {/* <td>{f1(ship.totalHps)}</td> */}
<td>{round(ship.cargoCapacity)}{u.T}</td> <td>{ship.get(CARGO_CAPACITY)}{u.T}</td>
<td>{ship.passengerCapacity}</td> <td>{ship.get(PASSENGER_CAPACITY)}</td>
<td>{round(ship.fuelCapacity)}{u.T}</td> <td>{ship.get(FUEL_CAPACITY)}{u.T}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td> >{ship.readProp('hullmass')}{u.T}</td>
<td>{int(ship.hardness)}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })}
<td>{ship.crew}</td> onMouseLeave={hide}
<td>{ship.masslock}</td> >{int(ship.get(UNLADEN_MASS))}{u.T}</td>
<td>{shipBoost !== 'No Boost' ? formats.time(shipBoost) : 'No Boost'}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })}
<td>{formats.pct(restingHeat)}</td> onMouseLeave={hide}
>{int(ship.get(MAXIMUM_MASS))}{u.T}</td>
<td>{int(ship.readProp('hardness'))}</td>
<td>{ship.readMeta('crew')}</td>
<td>{ship.readProp('masslock')}</td>
{/* TODO: boost intervall */}
<td>{NaN}</td>
{/* TODO: resting heat */}
<td>{NaN}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -154,19 +224,19 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(shieldGenerator && shieldGenerator.m.grp || 'No Shield')}</td> <td>{translate(sgType || 'No Shield')}</td>
<td>{formats.pct1(ship.shieldExplRes)}</td> <td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldKinRes)}</td> <td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldThermRes)}</td> <td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td>
<td></td> <td></td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary / sgMetrics.explosive.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.kinetic.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.thermal.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td>
<td></td> <td></td>
<td>{sgMetrics && sgMetrics.recover === Math.Inf ? translate('Never') : formats.time(sgMetrics.recover)}</td> <td>{formats.time(sgMetrics.recover) || translate('Never')}</td>
<td>{sgMetrics && sgMetrics.recharge === Math.Inf ? translate('Never') : formats.time(sgMetrics.recharge)}</td> <td>{formats.time(sgMetrics.recharge) || translate('Never')}</td>
</tr> </tr>
</tbody> </tbody>
<thead> <thead>
@@ -193,19 +263,18 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(ship && ship.bulkheads && ship.bulkheads.m && ship.bulkheads.m.name || 'No Armour')}</td> <td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td>
<td>{formats.pct1(ship.hullExplRes)}</td> <td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullKinRes)}</td> <td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullThermRes)}</td> <td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullCausRes)}</td> <td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.total)}</td> <td>{int(armourMetrics.armour)}</td>
<td>{int(armourMetrics.total / armourMetrics.explosive.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.kinetic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td>
<td>{int(armourMetrics.total / armourMetrics.thermal.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.caustic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.modulearmour)}</td> <td>{int(moduleProtectionMetrics.moduleArmour)}</td>
<td>{int(armourMetrics.moduleprotection * 100) + '%'}</td> <td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -1,5 +1,6 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import autoBind from 'auto-bind';
const MARGIN_LR = 8; // Left/ Right margin const MARGIN_LR = 8; // Left/ Right margin
@@ -7,7 +8,6 @@ const MARGIN_LR = 8; // Left/ Right margin
* Horizontal Slider * Horizontal Slider
*/ */
export default class Slider extends React.Component { export default class Slider extends React.Component {
static defaultProps = { static defaultProps = {
axis: false, axis: false,
min: 0, min: 0,
@@ -32,16 +32,7 @@ export default class Slider extends React.Component {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._down = this._down.bind(this); autoBind(this);
this._move = this._move.bind(this);
this._up = this._up.bind(this);
this._keyup = this._keyup.bind(this);
this._keydown = this._keydown.bind(this);
this._touchstart = this._touchstart.bind(this);
this._touchend = this._touchend.bind(this);
this._updatePercent = this._updatePercent.bind(this);
this._updateDimensions = this._updateDimensions.bind(this);
this.state = { width: 0 }; this.state = { width: 0 };
} }
@@ -55,7 +46,6 @@ export default class Slider extends React.Component {
this.left = rect.left; this.left = rect.left;
this.width = rect.width; this.width = rect.width;
this._move(event); this._move(event);
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
} }
/** /**
@@ -75,70 +65,11 @@ export default class Slider extends React.Component {
* @param {Event} event DOM Event * @param {Event} event DOM Event
*/ */
_up(event) { _up(event) {
this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer);
event.preventDefault(); event.preventDefault();
this.left = null; this.left = null;
this.width = null; this.width = null;
} }
/**
* Key up handler for keyboard.
* display the number field then set focus to it
* when "Enter" key is pressed
* @param {Event} event Keyboard event
*/
_keyup(event) {
switch (event.key) {
case 'Enter':
event.preventDefault();
this.sliderInputBox._setDisplay('block');
return;
default:
return;
}
}
/**
* Key down handler
* increment slider position by +/- 1 when right/left arrow key is pressed or held
* @param {Event} event Keyboard even
*/
_keydown(event) {
let newVal = this.props.percent * this.props.max;
switch (event.key) {
case 'ArrowRight':
newVal += 1;
if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
return;
case 'ArrowLeft':
newVal -= 1;
if (newVal >= 0) this.props.onChange(newVal / this.props.max);
return;
default:
return;
}
}
/**
* Touch start handler
* @param {Event} event DOM Event
*
*/
_touchstart(event) {
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
}
/**
* Touch end handler
* @param {Event} event DOM Event
*
*/
_touchend(event) {
this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer);
}
/** /**
* Determine if the user is still dragging * Determine if the user is still dragging
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -213,7 +144,7 @@ export default class Slider extends React.Component {
let width = outerWidth - (margin * 2); let width = outerWidth - (margin * 2);
let pctPos = width * this.props.percent; let pctPos = width * this.props.percent;
return <div><svg return <div><svg
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0"> onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} style={style} ref={node => this.node = node} tabIndex="0">
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' /> <rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' /> <rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} /> <circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
@@ -224,163 +155,6 @@ export default class Slider extends React.Component {
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text> <text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
</g>} </g>}
</svg> </svg>
<TextInputBox ref={(tb) => this.sliderInputBox = tb}
onChange={this.props.onChange}
percent={this.props.percent}
axisUnit={this.props.axisUnit}
scale={this.props.scale}
max={this.props.max}
/>
</div>; </div>;
} }
} }
/**
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
**/
class TextInputBox extends React.Component {
static propTypes = {
axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value
percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number
};
/**
* Determine if the user is still dragging
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this._handleFocus = this._handleFocus.bind(this);
this._handleBlur = this._handleBlur.bind(this);
this._handleChange = this._handleChange.bind(this);
this._keyup = this._keyup.bind(this);
this.state = this._getInitialState();
}
/**
* Update input value if slider changes will change props/state
* @param {Object} nextProps React Component properites
* @param {Object} nextState React Component state values
*/
componentWillReceiveProps(nextProps, nextState) {
let nextValue = nextProps.percent * nextProps.max;
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
this.setState({ inputValue: nextValue });
}
}
/**
* Update slider textbox visibility/values if changes are made to slider
* @param {Object} prevProps React Component properites
* @param {Object} prevState React Component state values
*/
componentDidUpdate(prevProps, prevState) {
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
}
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
// they chose a different module
this.setState({ inputValue: this.props.max });
}
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
this.props.onChange(this.state.inputValue / this.props.max);
}
}
/**
* Set initial state for the textbox.
* We may want to rethink this to
* try and make it a stateless component
* @returns {object} React state object with initial values set
*/
_getInitialState() {
return {
divStyle: { display:'none' },
inputStyle: { width:'4em' },
labelStyle: { marginLeft: '.1em' },
maxLength:5,
size:5,
min:0,
tabIndex:-1,
type:'number',
readOnly: true,
inputValue: this.props.percent * this.props.max
};
}
/**
*
* @param {string} val block or none
*/
_setDisplay(val) {
this.setState({
divStyle: { display:val }
});
}
/**
* Update the input value
* when textbox gets focus
*/
_handleFocus() {
this.setState({
inputValue:this._getValue()
});
}
/**
* Update inputValue when textbox loses focus
*/
_handleBlur() {
this._setDisplay('none');
if (this.state.inputValue !== '') {
this.props.onChange(this.state.inputValue / this.props.max);
} else {
this.setState({
inputValue: this.props.percent * this.props.max
});
}
}
/**
* Get the value in the text box
* @returns {number} inputValue Value of the input box
*/
_getValue() {
return this.state.inputValue;
}
/**
* Update and set limits on input box
* values depending on what user
* has selected
*
* @param {SyntheticEvent} event ReactJs onChange event
*/
_handleChange(event) {
if (event.target.value < 0) {
this.setState({ inputValue: 0 });
} else if (event.target.value <= this.props.max) {
this.setState({ inputValue: event.target.value });
} else {
this.setState({ inputValue: this.props.max });
}
}
/**
* Key up handler for input field.
* If user hits Enter key, blur/close the input field
* @param {Event} event Keyboard event
*/
_keyup(event) {
switch (event.key) {
case 'Enter':
this.sliderVal.blur();
return;
default:
return;
}
}
/**
* Get the value in the text box
* @return {React.Component} Text Input component for Slider
*/
render() {
let { axisUnit, onChange, percent, scale } = this.props;
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
}
}

View File

@@ -2,30 +2,38 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { ListModifications, Modified } from './SvgIcons';
import AvailableModulesMenu from './AvailableModulesMenu'; import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu'; import ModificationsMenu from './ModificationsMenu';
import { diffDetails } from '../utils/SlotFunctions'; import { diffDetails } from '../utils/SlotFunctions';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
import { Module } from 'ed-forge';
import { TYPES } from 'ed-forge/lib/data/slots';
import autoBind from 'auto-bind';
import { toPairs } from 'lodash';
const HARDPOINT_SLOT_LABELS = {
1: 'S',
2: 'M',
3: 'L',
4: 'H',
};
/** /**
* Abstract Slot * Abstract Slot
*/ */
export default class Slot extends TranslatedComponent { export default class Slot extends TranslatedComponent {
static propTypes = { static propTypes = {
availableModules: PropTypes.func.isRequired, currentMenu: PropTypes.any,
onSelect: PropTypes.func.isRequired, hideSearch: PropTypes.bool,
onOpen: PropTypes.func.isRequired, m: PropTypes.instanceOf(Module),
maxClass: PropTypes.number.isRequired,
selected: PropTypes.bool,
m: PropTypes.object,
enabled: PropTypes.bool.isRequired,
ship: PropTypes.object.isRequired,
eligible: PropTypes.object,
warning: PropTypes.func, warning: PropTypes.func,
drag: PropTypes.func, drag: PropTypes.func,
drop: PropTypes.func, drop: PropTypes.func,
dropClass: PropTypes.string dropClass: PropTypes.string,
propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
@@ -34,25 +42,122 @@ export default class Slot extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._modificationsSelected = false; this.state = { menuIndex: 0 };
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
this._keyDown = this._keyDown.bind(this);
this.slotDiv = null;
} }
// Must be implemented by subclasses: /**
// _getSlotDetails() * Opens a menu while setting state.
* @param {Object} newMenuIndex New menu index
* @param {Event} event Event object
*/
_openMenu(newMenuIndex, event) {
const slotName = this.props.m.getSlot();
if (
this.props.currentMenu === slotName &&
newMenuIndex === this.state.menuIndex
) {
this.context.closeMenu();
} {
this.setState({ menuIndex: newMenuIndex });
this.context.openMenu(slotName);
}
// If we don't stop event propagation, the underlying divs also might
// get clicked which would open up other menus
event.stopPropagation();
}
/** /**
* Get the CSS class name for the slot. Can/should be overriden * Generate the slot contents
* as necessary. * @return {React.Component} Slot contents
* @return {string} CSS Class name
*/ */
_getClassNames() { _getSlotDetails() {
const { m, propsToShow } = this.props;
let { termtip, tooltip, language } = this.context;
const { translate, units, formats } = language;
if (m.isEmpty()) {
return <div className="empty">
{translate(
m.isOnSlot(TYPES.MILITARY) ? 'emptyrestricted' : 'empty'
)}
</div>;
} else {
let classRating = m.getClassRating();
let { drag, drop } = this.props;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
const blueprint = m.getBlueprint();
const experimental = m.getExperimental();
const grade = m.getBlueprintGrade();
if (blueprint) {
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
if (experimental) {
modTT += `, ${translate(experimental)}`;
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(language, m)}
</div>
);
}
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
return (
<div
className={cn('details', { disabled: !m.isEnabled() })}
draggable="true"
onDragStart={drag}
onDragEnd={drop}
>
<div className={'cb'}>
<div className={'l'}>
{classRating} {translate(m.readMeta('type'))}
{blueprint && (
<span
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}
>
<Modified />
</span>
)}
</div>
{propsToShow.mass ?
<div className={'r'}>
{formats.round(mass)}
{units.T}
</div> : null}
</div>
<div className={'cb'}>
{toPairs(propsToShow).sort().map(([prop, show]) => {
const { unit, value } = m.getFormatted(prop, true);
// Don't show mass again; it's already shown on the top right
// corner of a slot
if (!show || isNaN(value) || prop == 'mass') {
return null; return null;
} else {
return (<div className='l'>
{translate(prop)}: {formats.round(value)}{unit}
</div>);
}
})}
{(m.getApplicableBlueprints() || []).length > 0 ? (
<div className="r">
<button onClick={this._openMenu.bind(this, 1)}
onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, translate('modifications'))}
onMouseOut={tooltip.bind(null, null)}
>
<ListModifications />
</button>
</div>
) : null}
</div>
</div>
);
}
} }
/** /**
@@ -61,7 +166,19 @@ export default class Slot extends TranslatedComponent {
* @return {string} label * @return {string} label
*/ */
_getMaxClassLabel() { _getMaxClassLabel() {
return this.props.maxClass; const { m } = this.props;
let size = m.getSize();
switch (true) {
case m.getSlot() === 'armour':
return '';
case size === 0:
// This can also happen for armour but that case was handled above
return 'U';
case m.isOnSlot(TYPES.HARDPOINT):
return HARDPOINT_SLOT_LABELS[size];
default:
return size;
}
} }
/** /**
@@ -71,25 +188,15 @@ export default class Slot extends TranslatedComponent {
_contextMenu(event) { _contextMenu(event) {
event.stopPropagation(); event.stopPropagation();
event.preventDefault(); event.preventDefault();
this.props.onSelect(null,null); const { m } = this.props;
m.reset();
if (this.props.currentMenu === m.getSlot()) {
this.context.closeMenu();
} else {
this.forceUpdate();
}
} }
/** Key Down handler
* @param {SyntheticEvent} event Event
* ToDo: see if this can be moved up
* we do more or less the same thing
* in every section when Enter key is pressed
* on a focusable item
*
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/** /**
* Render the slot * Render the slot
* @return {React.Component} The slot * @return {React.Component} The slot
@@ -97,64 +204,42 @@ export default class Slot extends TranslatedComponent {
render() { render() {
let language = this.context.language; let language = this.context.language;
let translate = language.translate; let translate = language.translate;
let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props; let {
let slotDetails, modificationsMarker, menu; currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow,
onPropToggle,
if (!selected) { } = this.props;
// If not selected then sure that modifications flag is unset const { menuIndex } = this.state;
this._modificationsSelected = false;
}
if (m) {
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
modificationsMarker = JSON.stringify(m);
} else {
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
modificationsMarker = '';
}
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className={this._getClassNames()}
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className={this._getClassNames()}
modules={availableModules()}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
// TODO: implement touch dragging // TODO: implement touch dragging
const selected = currentMenu === m.getSlot();
return ( return (
<div className={cn('slot', dropClass, { selected })} onClick={onOpen} onKeyDown={this._keyDown} onContextMenu={this._contextMenu} onDragOver={dragOver} tabIndex="0" ref={slotDiv => this.slotDiv = slotDiv}> <div
<div className='details-container'> className={cn('slot', dropClass, { selected })}
<div className='sz'>{this._getMaxClassLabel(translate)}</div> onContextMenu={this._contextMenu}
{slotDetails} onDragOver={dragOver} tabIndex="0"
onClick={this._openMenu.bind(this, 0)}
>
<div className={cn(
'details-container',
{ warning: warning && warning(m) },
)}>
<div className="sz">{this._getMaxClassLabel(translate)}</div>
{this._getSlotDetails()}
</div> </div>
{menu} {selected && menuIndex === 0 &&
<AvailableModulesMenu
m={m} hideSearch={hideSearch}
onSelect={(item) => {
m.setItem(item);
this.context.closeMenu();
}}
warning={warning}
// diffDetails={diffDetails.bind(ship, this.context.language)}
/>}
{selected && menuIndex === 1 &&
<ModificationsMenu m={m} propsToShow={propsToShow}
onPropToggle={onPropToggle} />}
</div> </div>
); );
} }
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
} }

View File

@@ -5,47 +5,33 @@ import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions'; import { canMount } from '../utils/SlotFunctions';
import { Equalizer } from '../components/SvgIcons'; import { Equalizer } from '../components/SvgIcons';
import cn from 'classnames'; import cn from 'classnames';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
const browser = require('detect-browser'); const browser = require('detect-browser');
/** /**
* Abstract Slot Section * Abstract Slot Section
*/ */
export default class SlotSection extends TranslatedComponent { export default class SlotSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship),
onChange: PropTypes.func.isRequired,
onCargoChange: PropTypes.func.isRequired,
onFuelChange: PropTypes.func.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
togglePwr: PropTypes.func, togglePwr: PropTypes.func,
sectionMenuRefs: PropTypes.object propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
* @param {string} sectionId Section DOM Id
* @param {string} sectionName Section name * @param {string} sectionName Section name
*/ */
constructor(props, context, sectionId, sectionName) { constructor(props, sectionName) {
super(props); super(props);
this.sectionId = sectionId; autoBind(this);
this.sectionName = sectionName;
this.ssHeadRef = null; this.sectionName = sectionName;
this.sectionRefArr = this.props.sectionMenuRefs[this.sectionId] = [];
this.sectionRefArr['selectedRef'] = null;
this._getSlots = this._getSlots.bind(this);
this._selectModule = this._selectModule.bind(this);
this._getSectionMenu = this._getSectionMenu.bind(this);
this._contextMenu = this._contextMenu.bind(this);
this._drop = this._drop.bind(this);
this._dragOverNone = this._dragOverNone.bind(this);
this._close = this._close.bind(this);
this._keyDown = this._keyDown.bind(this);
this._handleSectionFocus = this._handleSectionFocus.bind(this);
this.state = {}; this.state = {};
} }
@@ -55,82 +41,6 @@ export default class SlotSection extends TranslatedComponent {
// _contextMenu() // _contextMenu()
// componentDidUpdate(prevProps) // componentDidUpdate(prevProps)
/**
* TODO: May either need to send the function to be triggered when Enter key is pressed, or else
* may need a separate keyDown handler for each subclass (StandardSlotSection, HardpointSlotSection, etc.)
* ex: _keyDown(_keyDownfn, event)
*
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
event.stopPropagation();
if (event.currentTarget.nodeName === 'H1') {
this._openMenu(this.sectionName, event);
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
if (event.shiftKey) {
if ((event.currentTarget === this.sectionRefArr[this.firstRefId]) && this.sectionRefArr[this.lastRefId]) {
event.preventDefault();
this.sectionRefArr[this.lastRefId].focus();
}
} else {
if ((event.currentTarget === this.sectionRefArr[this.lastRefId]) && this.sectionRefArr[this.firstRefId]) {
event.preventDefault();
this.sectionRefArr[this.firstRefId].focus();
}
}
}
}
/**
* Set focus on appropriate Slot Section Menu element
* @param {Object} focusPrevProps prevProps for componentDidUpdate() from ...SlotSection.jsx
* @param {String} firstRef id of the first ref in ...SlotSection.jsx
* @param {String} lastRef id of the last ref in ...SlotSection.jsx
*
*/
_handleSectionFocus(focusPrevProps, firstRef, lastRef) {
if (this.selectedRefId !== null && this.sectionRefArr[this.selectedRefId]) {
// set focus on the previously selected option for the currently open section menu
this.sectionRefArr[this.selectedRefId].focus();
} else if (this.sectionRefArr[firstRef] && this.sectionRefArr[firstRef] != null) {
// set focus on the first option in the currently open section menu if none have been selected previously
this.sectionRefArr[firstRef].focus();
} else if (this.props.currentMenu == null && focusPrevProps.currentMenu == this.sectionName && this.sectionRefArr['ssHeadRef']) {
// set focus on the section menu header when section menu is closed
this.sectionRefArr['ssHeadRef'].focus();
}
}
/**
* Open a menu
* @param {string} menu Menu name
* @param {SyntheticEvent} event Event
*/
_openMenu(menu, event) {
event.preventDefault();
event.stopPropagation();
if (this.props.currentMenu === menu) {
menu = null;
}
this.context.openMenu(menu);
}
/**
* Mount/Use the specified module in the slot
* @param {Object} slot Slot
* @param {Object} m Selected module
*/
_selectModule(slot, m) {
this.props.ship.use(slot, m, false);
this.props.onChange();
this._close();
}
/** /**
* Slot Drag Handler * Slot Drag Handler
* @param {object} originSlot Origin slot model * @param {object} originSlot Origin slot model
@@ -207,7 +117,6 @@ export default class SlotSection extends TranslatedComponent {
// Copy power info // Copy power info
targetSlot.enabled = originSlot.enabled; targetSlot.enabled = originSlot.enabled;
targetSlot.priority = originSlot.priority; targetSlot.priority = originSlot.priority;
this.props.onChange();
} }
} else { } else {
// Store power info // Store power info
@@ -236,7 +145,6 @@ export default class SlotSection extends TranslatedComponent {
targetSlot.enabled = targetEnabled; targetSlot.enabled = targetEnabled;
targetSlot.priority = targetPriority; targetSlot.priority = targetPriority;
} }
this.props.onChange();
this.props.ship this.props.ship
.updatePowerGenerated() .updatePowerGenerated()
.updatePowerUsed() .updatePowerUsed()
@@ -282,6 +190,17 @@ export default class SlotSection extends TranslatedComponent {
return 'ineligible'; // Cannot be dropped / invalid drop slot return 'ineligible'; // Cannot be dropped / invalid drop slot
} }
_open(newMenu, event) {
event.preventDefault();
event.stopPropagation();
const { currentMenu } = this.props;
if (currentMenu === newMenu) {
this.context.closeMenu();
} else {
this.context.openMenu(newMenu);
}
}
/** /**
* Close current menu * Close current menu
*/ */
@@ -298,14 +217,13 @@ export default class SlotSection extends TranslatedComponent {
render() { render() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let sectionMenuOpened = this.props.currentMenu === this.sectionName; let sectionMenuOpened = this.props.currentMenu === this.sectionName;
let open = this._openMenu.bind(this, this.sectionName);
let ctx = wrapCtxMenu(this._contextMenu);
return ( return (
<div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}> <div className="group" onDragLeave={this._dragOverNone}>
<div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}> <div className={cn('section-menu', { selected: sectionMenuOpened })}
<h1 tabIndex="0" onKeyDown={this._keyDown} ref={ssHead => this.sectionRefArr['ssHeadRef'] = ssHead}>{translate(this.sectionName)} <Equalizer/></h1> onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}>
{sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null } <h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1>
{sectionMenuOpened && this._getSectionMenu()}
</div> </div>
{this._getSlots()} {this._getSlots()}
</div> </div>

View File

@@ -1,162 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
import cn from 'classnames';
import Persist from '../stores/Persist';
import TranslatedComponent from './TranslatedComponent';
import { diffDetails } from '../utils/SlotFunctions';
import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Standard Slot
*/
export default class StandardSlot extends TranslatedComponent {
static propTypes = {
slot: PropTypes.object,
modules: PropTypes.array.isRequired,
onSelect: PropTypes.func.isRequired,
onOpen: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired,
ship: PropTypes.object.isRequired,
selected: PropTypes.bool,
warning: PropTypes.func,
};
/**
* Construct the slot
* @param {object} props Object properties
*/
constructor(props) {
super(props);
this._modificationsSelected = false;
this._keyDown = this._keyDown.bind(this);
this.modButton = null;
this.slotDiv = null;
}
/**
* Handle Enter key
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/**
* Render the slot
* @return {React.Component} Slot component
*/
render() {
let { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language;
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
let m = slot.m;
let classRating = m.class + m.rating;
let menu;
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
if (m && m.name && m.name === 'Guardian Hybrid Power Plant') {
validMods = [];
}
if (m && m.name && m.name === 'Guardian Power Distributor') {
validMods = [];
}
let showModuleResistances = Persist.showModuleResistances();
let mass = m.getMass() || m.cargo || m.fuel || 0;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
if (!selected) {
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
const modificationsMarker = JSON.stringify(m);
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className='standard'
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className='standard'
modules={modules}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
return (
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onKeyDown={this._keyDown} onContextMenu={stopCtxPropagation} tabIndex="0" ref={ slotDiv => this.slotDiv = slotDiv }>
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
<div>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
<div className={'r'}>{formats.round(mass)}{units.T}</div>
<div/>
<div className={'cb'}>
{ m.getMinMass() ? <div className='l'>{translate('minimum mass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
{ m.getOptMass() ? <div className='l'>{translate('optimal mass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
{ m.getMaxMass() ? <div className='l'>{translate('max mass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
{ m.getOptMul() ? <div className='l'>{translate('optimal multiplier')}: {formats.rPct(m.getOptMul())}</div> : null }
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>
</div>
{menu}
</div>
);
}
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
}

View File

@@ -1,46 +1,33 @@
import React from 'react'; import React from 'react';
import cn from 'classnames'; import cn from 'classnames';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import StandardSlot from './StandardSlot'; import Slot from './Slot';
import Module from '../shipyard/Module'; import Module from '../shipyard/Module';
import * as ShipRoles from '../shipyard/ShipRoles'; import * as ShipRoles from '../shipyard/ShipRoles';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import autoBind from 'auto-bind';
import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions';
import { ShipProps } from 'ed-forge';
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
/** /**
* Standard Slot section * Standard Slot section
*/ */
export default class StandardSlotSection extends SlotSection { export default class StandardSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'standard', 'core internal'); super(props, 'core internal');
this._optimizeStandard = this._optimizeStandard.bind(this); autoBind(this);
this._selectBulkhead = this._selectBulkhead.bind(this);
this.selectedRefId = null;
this.firstRefId = 'maxjump';
this.lastRefId = 'racer';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Use the lightest/optimal available standard modules * Use the lightest/optimal available standard modules
*/ */
_optimizeStandard() { _optimizeStandard() {
this.selectedRefId = 'maxjump';
this.props.ship.useLightestStandard(); this.props.ship.useLightestStandard();
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -50,12 +37,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames * @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
*/ */
_multiPurpose(shielded, bulkheadIndex) { _multiPurpose(shielded, bulkheadIndex) {
this.selectedRefId = 'multipurpose';
if (bulkheadIndex === 2) this.selectedRefId = 'combat';
ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex); ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -64,11 +46,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} shielded True if shield generator should be included * @param {Boolean} shielded True if shield generator should be included
*/ */
_optimizeCargo(shielded) { _optimizeCargo(shielded) {
this.selectedRefId = 'trader';
ShipRoles.trader(this.props.ship, shielded); ShipRoles.trader(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -77,11 +55,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} shielded True if shield generator should be included * @param {Boolean} shielded True if shield generator should be included
*/ */
_optimizeMiner(shielded) { _optimizeMiner(shielded) {
this.selectedRefId = 'miner';
ShipRoles.miner(this.props.ship, shielded); ShipRoles.miner(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -90,12 +64,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included * @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
*/ */
_optimizeExplorer(planetary) { _optimizeExplorer(planetary) {
this.selectedRefId = 'explorer';
if (planetary) this.selectedRefId = 'planetary';
ShipRoles.explorer(this.props.ship, planetary); ShipRoles.explorer(this.props.ship, planetary);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -103,22 +72,7 @@ export default class StandardSlotSection extends SlotSection {
* Racer role * Racer role
*/ */
_optimizeRacer() { _optimizeRacer() {
this.selectedRefId = 'racer';
ShipRoles.racer(this.props.ship); ShipRoles.racer(this.props.ship);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Use the specified bulkhead
* @param {Object} bulkhead Bulkhead module details
*/
_selectBulkhead(bulkhead) {
this.props.ship.useBulkhead(bulkhead.index);
this.context.tooltip();
this.props.onChange();
this._close(); this._close();
} }
@@ -129,113 +83,48 @@ export default class StandardSlotSection extends SlotSection {
this._optimizeStandard(); this._optimizeStandard();
} }
/**
* Creates a new slot for a given module.
* @param {Module} m Module to create the slot for
* @param {function} warning Warning callback
* @return {React.Component} Slot component
*/
_mkSlot(m, warning) {
const { currentMenu, propsToShow, onPropToggle } = this.props;
return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true}
currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle}
/>;
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu, cargo, fuel } = this.props; const { ship } = this.props;
let slots = new Array(8); const fsd = ship.getFSD();
let open = this._openMenu; return [
let select = this._selectModule; this._mkSlot(ship.getAlloys()),
let st = ship.standard; this._mkSlot(
let avail = ship.getAvailableModules().standard; ship.getPowerPlant(),
let bh = ship.bulkheads; (m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR),
),
slots[0] = <StandardSlot this._mkSlot(
key='bh' ship.getThrusters(),
slot={bh} (m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS),
modules={ship.getAvailableModules().bulkheads} ),
onOpen={open.bind(this, bh)} this._mkSlot(fsd),
onSelect={this._selectBulkhead} this._mkSlot(
selected={currentMenu == bh} ship.getPowerDistributor(),
onChange={this.props.onChange} (m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'),
ship={ship} ),
/>; this._mkSlot(ship.getLifeSupport()),
this._mkSlot(ship.getSensors()),
slots[1] = <StandardSlot this._mkSlot(
key='pp' ship.getCoreFuelTank(),
slot={st[0]} (m) => moduleGet(m, 'fuel') < fsd.get('maxfuel')
modules={avail[0]} ),
onOpen={open.bind(this, st[0])} ];
onSelect={select.bind(this, st[0])}
selected={currentMenu == st[0]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
/>;
slots[2] = <StandardSlot
key='th'
slot={st[1]}
modules={avail[1]}
onOpen={open.bind(this, st[1])}
onSelect={select.bind(this, st[1])}
selected={currentMenu == st[1]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
/>;
slots[3] = <StandardSlot
key='fsd'
slot={st[2]}
modules={avail[2]}
onOpen={open.bind(this, st[2])}
onSelect={select.bind(this, st[2])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[2]}
/>;
slots[4] = <StandardSlot
key='ls'
slot={st[3]}
modules={avail[3]}
onOpen={open.bind(this, st[3])}
onSelect={select.bind(this, st[3])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[3]}
/>;
slots[5] = <StandardSlot
key='pd'
slot={st[4]}
modules={avail[4]}
onOpen={open.bind(this, st[4])}
onSelect={select.bind(this, st[4])}
selected={currentMenu == st[4]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getEnginesCapacity() <= ship.boostEnergy : m.engcap <= ship.boostEnergy}
/>;
slots[6] = <StandardSlot
key='ss'
slot={st[5]}
modules={avail[5]}
onOpen={open.bind(this, st[5])}
onSelect={select.bind(this, st[5])}
selected={currentMenu == st[5]}
onChange={this.props.onChange}
ship={ship}
/>;
slots[7] = <StandardSlot
key='ft'
slot={st[6]}
modules={avail[6]}
onOpen={open.bind(this, st[6])}
onSelect={select.bind(this, st[6])}
selected={currentMenu == st[6]}
onChange={this.props.onChange}
ship={ship}
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
/>;
return slots;
} }
/** /**
@@ -243,23 +132,22 @@ export default class StandardSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
let planetaryDisabled = this.props.ship.internal.length < 4; const { translate } = this.context.language;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._optimizeStandard} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['maxjump'] = smRef}>{translate('Maximize Jump Range')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeStandard}>{translate('Maximize Jump Range')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('roles')}</div> <div className='select-group cap'>{translate('roles')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['multipurpose'] = smRef}>{translate('Multi-purpose')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)}>{translate('Multi-purpose')}</li>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['combat'] = smRef}>{translate('Combat')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)}>{translate('Combat')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['trader'] = smRef}>{translate('Trader')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)}>{translate('Trader')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['explorer'] = smRef}>{translate('Explorer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)}>{translate('Explorer')}</li>
<li className={cn('lc', { disabled: planetaryDisabled })} tabIndex={planetaryDisabled ? '' : '0'} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['planetary'] = smRef}>{translate('Planetary Explorer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, true)}>{translate('Planetary Explorer')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['miner'] = smRef}>{translate('Miner')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)}>{translate('Miner')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['racer'] = smRef}>{translate('Racer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)}>{translate('Racer')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Document Root Tooltip * Document Root Tooltip
*/ */
export default class Tooltip extends TranslatedComponent { export default class Tooltip extends TranslatedComponent {
static propTypes = { static propTypes = {
rect: PropTypes.object.isRequired, rect: PropTypes.object.isRequired,
options: PropTypes.object options: PropTypes.object
@@ -127,5 +126,4 @@ export default class Tooltip extends TranslatedComponent {
</div> </div>
</div>; </div>;
} }
} }

View File

@@ -6,7 +6,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract Translated Component * Abstract Translated Component
*/ */
export default class TranslatedComponent extends React.Component { export default class TranslatedComponent extends React.Component {
static contextTypes = { static contextTypes = {
language: PropTypes.object.isRequired, language: PropTypes.object.isRequired,
sizeRatio: PropTypes.number.isRequired, sizeRatio: PropTypes.number.isRequired,

View File

@@ -1,7 +1,8 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Utility Slot Section * Utility Slot Section
@@ -10,28 +11,16 @@ export default class UtilitySlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'utility', 'utility mounts'); super(props, 'utility mounts');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'po';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all utility slots and close the menu * Empty all utility slots and close the menu
*/ */
_empty() { _empty() {
this.selectedRefId = this.firstRefId;
this.props.ship.emptyUtility(); this.props.ship.emptyUtility();
this.props.onChange(); this.props.onChange();
this._close(); this._close();
@@ -45,9 +34,6 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Synthetic} event Event * @param {Synthetic} event Event
*/ */
_use(group, rating, name, event) { _use(group, rating, name, event) {
this.selectedRefId = group;
if (rating !== null) this.selectedRefId += '-' + rating;
this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt')); this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt'));
this.props.onChange(); this.props.onChange();
this._close(); this._close();
@@ -66,32 +52,25 @@ export default class UtilitySlotSection extends SlotSection {
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let hardpoints = ship.hardpoints;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getUtilities(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass === 0) { key={h.object.Slot}
slots.push(<HardpointSlot maxClass={h.getSize()}
key={i}
maxClass={h.maxClass}
availableModules={() => availableModules.getHps(h.maxClass)}
onOpen={this._openMenu.bind(this,h)}
onSelect={this._selectModule.bind(this, h)}
onChange={this.props.onChange} onChange={this.props.onChange}
selected={currentMenu == h} currentMenu={currentMenu}
drag={this._drag.bind(this, h)} drag={this._drag.bind(this, h)}
dragOver={this._dragOverSlot.bind(this, h)} dragOver={this._dragOverSlot.bind(this, h)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)} dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship} m={h}
m={h.m}
enabled={h.enabled ? true : false} enabled={h.enabled ? true : false}
propsToShow={propsToShow}
onPropToggle={onPropToggle}
/>); />);
} }
}
return slots; return slots;
} }
@@ -101,33 +80,34 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _use = this._use; let _use = this._use;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('sb')}</div> <div className='select-group cap'>{translate('sb')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-A'] = smRef}>A</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)}>A</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-B'] = smRef}>B</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)}>B</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-C'] = smRef}>C</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)}>C</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-D'] = smRef}>D</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)}>D</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-E'] = smRef}>E</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)}>E</li>
</ul> </ul>
<div className='select-group cap'>{translate('hs')}</div> <div className='select-group cap'>{translate('hs')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hs'] = smRef}>{translate('Heat Sink Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')}>{translate('Heat Sink Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('ch')}</div> <div className='select-group cap'>{translate('ch')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ch'] = smRef}>{translate('Chaff Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')}>{translate('Chaff Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('po')}</div> <div className='select-group cap'>{translate('po')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['po'] = smRef}>{translate('Point Defence')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')}>{translate('Point Defence')}</li>
</ul> </ul>
</div>; </div>;
} }

View File

@@ -3,193 +3,99 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import { moduleReduce } from 'ed-forge/lib/helper';
import { chain, keys, mapValues, values } from 'lodash';
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777']; const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
const PORTION_MAPPINGS = {
'absolute': 'absolutedamageportion',
'explosive': 'explosivedamageportion',
'kinetic': 'kineticdamageportion',
'thermal': 'thermicdamageportion',
};
const MULTS = keys(PORTION_MAPPINGS);
// TODO: help with this in ed-forge
/**
* .
* @param {Object} opponentDefence .
* @returns {Object} .
*/
function defenceToMults(opponentDefence) {
return chain(opponentDefence)
.pick(MULTS)
.mapKeys((v, k) => PORTION_MAPPINGS[k])
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
.value();
}
/** /**
* Weapon damage chart * Weapon damage chart
*/ */
export default class WeaponDamageChart extends TranslatedComponent { export default class WeaponDamageChart extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponentDefence: PropTypes.object.isRequired,
hull: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
}
/**
* Set the initial weapons state
*/
componentWillMount() {
const weaponNames = this._weaponNames(this.props.ship, this.context);
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
const opponentArmour = Calc.armourMetrics(this.props.opponent);
const maxRange = this._calcMaxRange(this.props.ship);
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
}
/**
* Set the updated weapons state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
const maxRange = this._calcMaxRange(nextProps.ship);
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
this.setState({ weaponNames,
opponentShields,
opponentArmour,
maxRange,
maxDps,
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
});
}
return true;
}
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000; // Minimum
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/**
* Calculate the maximum sustained single-weapon DPS for this ship
* @param {Object} ship The ship
* @param {Object} opponent The opponent ship
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @return {number} The maximum sustained single-weapon DPS
*/
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
// Additional information to allow effectiveness calculations
let maxSDps = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
if (thisSDps > maxSDps) {
maxSDps = thisSDps;
}
}
}
return maxSDps;
}
/**
* Obtain the weapon names for this ship
* @param {Object} ship The ship
* @param {Object} context The context
* @return {array} The weapon names
*/
_weaponNames(ship, context) {
const translate = context.language.translate;
let names = [];
let num = 1;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
let engineering;
if (m.blueprint && m.blueprint.name) {
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id) {
engineering += ', ' + translate(m.blueprint.special.name);
}
}
if (engineering) {
name = name + ' (' + engineering + ')';
}
names.push(name);
}
}
return names;
}
/**
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
* @param {Object} ship The ship
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
* @param {Object} opponent The target
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
* @param {Object} engagementRange The engagement range
* @return {array} The array of weapon DPS
*/
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
let results = {};
let weaponNum = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
}
}
return results;
}
/** /**
* Render damage dealt * Render damage dealt
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { maxRange } = this.state; const { code, ship, opponentDefence, engagementRange } = this.props;
const { ship, opponent, engagementRange } = this.props;
const sortOrder = this._sortOrder; const hardpoints = ship.getHardpoints();
const onCollapseExpand = this._onCollapseExpand; const hardpointsMap = chain(hardpoints)
.map((m) => [m.getSlot(), m])
const code = `${ship.toString()}:${opponent.toString()}`; .fromPairs()
.value();
const mults = defenceToMults(opponentDefence);
const cb = (range) => {
return mapValues(
hardpointsMap,
(m) => {
const sdps = m.get('sustaineddamagepersecond', true);
const resistanceMul = chain(mults)
.toPairs()
.map((pair) => {
const [k, mul] = pair;
return m.get(k, true) * mul;
})
.sum()
.value();
const falloff = m.get('damagefalloffrange', true);
const rangeMul = Math.min(1, Math.max(0,
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
));
return sdps * resistanceMul * rangeMul;
}
);
};
return ( return (
<div> <div>
<LineChart <LineChart
xMax={maxRange} xMin={0}
yMax={this.state.maxDps} xMax={moduleReduce(
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
)}
yMin={0}
// Factor in highest damage multiplier to get a safe upper bound
yMax={Math.max(1, ...values(mults)) * moduleReduce(
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
)}
xLabel={translate('range')} xLabel={translate('range')}
xUnit={translate('m')} xUnit={translate('m')}
yLabel={translate('sdps')} yLabel={translate('sustaineddamagepersecond')}
series={this.state.weaponNames} series={hardpoints.map((m) => m.getSlot())}
xMark={this.props.engagementRange} xMark={engagementRange}
colors={DAMAGE_DEALT_COLORS} colors={DAMAGE_DEALT_COLORS}
func={this.state.calcSDpsFunc} func={cb}
points={200} points={200}
code={code} code={code}
/> />

View File

@@ -5,7 +5,6 @@ import PropTypes from 'prop-types';
* Unexpected Error page / block * Unexpected Error page / block
*/ */
export default class ErrorDetails extends React.Component { export default class ErrorDetails extends React.Component {
static contextTypes = { static contextTypes = {
route: PropTypes.object.isRequired, route: PropTypes.object.isRequired,
language: PropTypes.object.isRequired language: PropTypes.object.isRequired

View File

@@ -6,7 +6,8 @@ import Page from './Page';
import Router from '../Router'; import Router from '../Router';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import * as Utils from '../utils/UtilityFunctions'; import * as Utils from '../utils/UtilityFunctions';
import Ship from '../shipyard/Ship'; import { Factory, Ship } from 'ed-forge';
import { STATE_EVENT, OBJECT_EVENT } from 'ed-forge/lib/Ship';
import * as _ from 'lodash'; import * as _ from 'lodash';
import { toDetailedBuild } from '../shipyard/Serializer'; import { toDetailedBuild } from '../shipyard/Serializer';
import { outfitURL } from '../utils/UrlGenerators'; import { outfitURL } from '../utils/UrlGenerators';
@@ -38,16 +39,77 @@ import ModalExport from '../components/ModalExport';
import ModalPermalink from '../components/ModalPermalink'; import ModalPermalink from '../components/ModalPermalink';
import ModalShoppingList from '../components/ModalShoppingList'; import ModalShoppingList from '../components/ModalShoppingList';
import ModalOrbis from '../components/ModalOrbis'; import ModalOrbis from '../components/ModalOrbis';
import autoBind from 'auto-bind';
import { assign } from 'lodash';
/** const SHOW_BY_DEFAULT = {
* Document Title Generator 'cabincapacity': true,
* @param {String} shipName Ship Name 'causticresistance': true,
* @param {String} buildName Build Name 'explosiveresistance': true,
* @return {String} Document title 'kineticresistance': true,
*/ 'thermicresistance': true,
function getTitle(shipName, buildName) { 'heatefficiency': true,
return buildName ? buildName : shipName; 'powercapacity': true,
} 'integrity': true,
'engineminimalmass': true,
'engineoptimalmass': true,
'enginemaximalmass': true,
'engineoptperformance': true,
'fsdoptimalmass': true,
'maxfuel': true,
'dronelifetime': true,
'weaponscapacity': true,
'weaponsrecharge': true,
'systemscapacity': true,
'systemsrecharge': true,
'enginescapacity': true,
'enginesrecharge': true,
'range': true,
'shieldgenmaximalmass': true,
'shieldgenminimalmass': true,
'shieldgenoptimalmass': true,
'brokenregenrate': true,
'regenrate': true,
'shieldgenstrength': true,
'ammomaximum': true,
'afmrepaircapacity': true,
'fsdinterdictorfacinglimit': true,
'fuelscooprate': true,
'bays': true,
'rebuildsperbay': true,
'maximumrange': true,
'maxactivedrones': true,
'refinerybins': true,
'shieldbankduration': true,
'shieldbankspinup': true,
'shieldbankreinforcement': true,
'defencemodifierhealthaddition': true,
'protection': true,
'dronehackingtime': true,
'defencemodifiershieldaddition': true,
'jumpboost': true,
'damagepersecond': true,
'damage': true,
'energypersecond': true,
'heatpersecond': true,
'sustaineddamagepersecond': true,
'damageperenergy': true,
'rateoffire': true,
'maximumrange': true,
'damagefalloffrange': true,
'armourpenetration': true,
'sustainedenergypersecond': true,
'sustainedheatpersecond': true,
'ammoclipsize': true,
'ammomaximum': true,
'reloadtime': true,
'shotspeed': true,
'defencemodifiershieldmultiplier': true,
'scannerrange': true,
'scannertimetoscan': true,
'maxangle': true,
'mass': true,
};
/** /**
* The Outfitting Page * The Outfitting Page
@@ -60,17 +122,8 @@ export default class OutfittingPage extends Page {
*/ */
constructor(props, context) { constructor(props, context) {
super(props, context); super(props, context);
// window.Perf = Perf; autoBind(this);
this.state = this._initState(props, context); this.state = this._initState(props, context);
this._keyDown = this._keyDown.bind(this);
this._exportBuild = this._exportBuild.bind(this);
this._pipsUpdated = this._pipsUpdated.bind(this);
this._boostUpdated = this._boostUpdated.bind(this);
this._cargoUpdated = this._cargoUpdated.bind(this);
this._fuelUpdated = this._fuelUpdated.bind(this);
this._opponentUpdated = this._opponentUpdated.bind(this);
this._engagementRangeUpdated = this._engagementRangeUpdated.bind(this);
this._sectionMenuRefs = {};
} }
/** /**
@@ -82,68 +135,36 @@ export default class OutfittingPage extends Page {
_initState(props, context) { _initState(props, context) {
let params = context.route.params; let params = context.route.params;
let shipId = params.ship; let shipId = params.ship;
let code = params.code;
let buildName = params.bn; let buildName = params.bn;
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults
let savedCode = Persist.getBuild(shipId, buildName); let savedCode = Persist.getBuild(shipId, buildName);
if (!data) { let code = params.code || savedCode;
return { error: { message: 'Ship not found: ' + shipId } }; // Create a new Ship instance
} const ship = code ? new Ship(code) : Factory.newShip(shipId);
let ship = new Ship(shipId, data.properties, data.slots); // Create a new Ship instance ship.on(STATE_EVENT, this._shipUpdated);
if (code) { ship.on(OBJECT_EVENT, this._shipUpdated);
ship.buildFrom(code); // Populate modules from serialized 'code' URL param
} else {
ship.buildWith(data.defaults); // Populate with default components
}
this._getTitle = getTitle.bind(this, data.properties.name);
// Obtain ship control from code
const {
sys,
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
opponentSys,
opponentEng,
opponentWep,
engagementRange
} = this._obtainControlFromCode(ship, code);
return { return {
error: null, error: null,
title: this._getTitle(buildName),
costTab: Persist.getCostTab() || 'costs', costTab: Persist.getCostTab() || 'costs',
buildName, buildName,
newBuildName: buildName, newBuildName: buildName,
shipId,
ship, ship,
code, code: ship.compress(),
savedCode, savedCode,
sys, propsToShow: assign({}, SHOW_BY_DEFAULT),
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
opponentSys,
opponentEng,
opponentWep,
engagementRange
}; };
} }
/**
* Get this pages title for the browser.
* @returns {string} Page title
*/
_getTitle() {
const { buildName } = this.state;
const { translate } = this.context.language;
return buildName || translate(this.ship.getShipType());
}
/** /**
* Handle build name change and update state * Handle build name change and update state
* @param {SyntheticEvent} event React Event * @param {SyntheticEvent} event React Event
@@ -153,10 +174,12 @@ export default class OutfittingPage extends Page {
newBuildName: event.target.value newBuildName: event.target.value
}; };
if (Persist.hasBuild(this.state.shipId, stateChanges.newBuildName)) { const { ship } = this.state;
const shipId = ship.getShipType();
if (Persist.hasBuild(shipId, stateChanges.newBuildName)) {
stateChanges.savedCode = Persist.getBuild( stateChanges.savedCode = Persist.getBuild(
this.state.shipId, shipId,
stateChanges.newBuildName stateChanges.newBuildName,
); );
} else { } else {
stateChanges.savedCode = null; stateChanges.savedCode = null;
@@ -168,170 +191,13 @@ export default class OutfittingPage extends Page {
/** /**
* Update the control part of the route * Update the control part of the route
*/ */
_updateRouteOnControlChange() { _updateRoute() {
const { ship, shipId, buildName } = this.state; const { ship } = this.state;
const code = this._fullCode(ship); const code = ship.compress();
this._updateRoute(shipId, buildName, code); this._setRoute();
this.setState({ code }); this.setState({ code });
} }
/**
* Provide a full code for this ship, including any additions due to the outfitting page
* @param {Object} ship the ship
* @param {number} fuel the fuel carried by the ship (if different from that in state)
* @param {number} cargo the cargo carried by the ship (if different from that in state)
* @returns {string} the code for this ship
*/
_fullCode(ship, fuel, cargo) {
return `${ship.toString()}.${LZString.compressToBase64(
this._controlCode(fuel, cargo)
)}`;
}
/**
* Obtain the control information from the build code
* @param {Object} ship The ship
* @param {string} code The build code
* @returns {Object} The control information
*/
_obtainControlFromCode(ship, code) {
// Defaults
let sys = 2;
let eng = 2;
let wep = 2;
let mcSys = 0;
let mcEng = 0;
let mcWep = 0;
let boost = false;
let fuel = ship.fuelCapacity;
let cargo = ship.cargoCapacity;
let opponent = new Ship(
'eagle',
Ships['eagle'].properties,
Ships['eagle'].slots
).buildWith(Ships['eagle'].defaults);
let opponentSys = 2;
let opponentEng = 2;
let opponentWep = 2;
let opponentBuild;
let engagementRange = 1000;
// Obtain updates from code, if available
if (code) {
const parts = code.split('.');
if (parts.length >= 5) {
// We have control information in the code
const control = LZString.decompressFromBase64(
Utils.fromUrlSafe(parts[4])
).split('/');
sys = parseFloat(control[0]);
eng = parseFloat(control[1]);
wep = parseFloat(control[2]);
if (sys + eng + wep > 6) {
sys = eng = wep = 2;
}
boost = control[3] == 1 ? true : false;
fuel = parseFloat(control[4]) || fuel;
cargo = parseInt(control[5]) || cargo;
if (control[6]) {
const shipId = control[6];
opponent = new Ship(
shipId,
Ships[shipId].properties,
Ships[shipId].slots
);
if (control[7] && Persist.getBuild(shipId, control[7])) {
// Ship is a particular build
const opponentCode = Persist.getBuild(shipId, control[7]);
opponent.buildFrom(opponentCode);
opponentBuild = control[7];
if (opponentBuild) {
// Obtain opponent's sys/eng/wep pips from their code
const opponentParts = opponentCode.split('.');
if (opponentParts.length >= 5) {
const opponentControl = LZString.decompressFromBase64(
Utils.fromUrlSafe(opponentParts[4])
).split('/');
opponentSys = parseFloat(opponentControl[0]) || opponentSys;
opponentEng = parseFloat(opponentControl[1]) || opponentEng;
opponentWep = parseFloat(opponentControl[2]) || opponentWep;
}
}
} else {
// Ship is a stock build
opponent.buildWith(Ships[shipId].defaults);
}
}
engagementRange = parseInt(control[8]) || engagementRange;
// Multi-crew pips were introduced later on so assign default values
// because those values might not be present.
mcSys = parseInt(control[9]) || mcSys;
mcEng = parseInt(control[10]) || mcEng;
mcWep = parseInt(control[11]) || mcWep;
}
}
return {
sys,
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
opponentSys,
opponentEng,
opponentWep,
engagementRange
};
}
/**
* Triggered when pips have been updated. Multi-crew pips are already included
* in sys, eng and wep but mcSys, mcEng and mcWep make clear where each pip
* comes from.
* @param {number} sys SYS pips
* @param {number} eng ENG pips
* @param {number} wep WEP pips
* @param {number} mcSys SYS pips from multi-crew
* @param {number} mcEng ENG pips from multi-crew
* @param {number} mcWep WEP pips from multi-crew
*/
_pipsUpdated(sys, eng, wep, mcSys, mcEng, mcWep) {
this.setState({ sys, eng, wep, mcSys, mcEng, mcWep }, () =>
this._updateRouteOnControlChange()
);
}
/**
* Triggered when boost has been updated
* @param {boolean} boost true if boosting
*/
_boostUpdated(boost) {
this.setState({ boost }, () => this._updateRouteOnControlChange());
}
/**
* Triggered when fuel has been updated
* @param {number} fuel the amount of fuel, in T
*/
_fuelUpdated(fuel) {
this.setState({ fuel }, () => this._updateRouteOnControlChange());
}
/**
* Triggered when cargo has been updated
* @param {number} cargo the amount of cargo, in T
*/
_cargoUpdated(cargo) {
this.setState({ cargo }, () => this._updateRouteOnControlChange());
}
/** /**
* Triggered when engagement range has been updated * Triggered when engagement range has been updated
* @param {number} engagementRange the engagement range, in m * @param {number} engagementRange the engagement range, in m
@@ -387,47 +253,35 @@ export default class OutfittingPage extends Page {
opponentEng, opponentEng,
opponentWep opponentWep
}, },
() => this._updateRouteOnControlChange() () => this._updateRoute()
); );
} }
/** _propToShowToggled(propertyName, newStatus) {
* Set the control code for this outfitting page const { propsToShow } = this.state;
* @param {number} fuel the fuel carried by the ship (if different from that in state) if (newStatus === propsToShow[propertyName]) {
* @param {number} cargo the cargo carried by the ship (if different from that in state) return;
* @returns {string} The control code }
*/ if (newStatus) {
_controlCode(fuel, cargo) { propsToShow[propertyName] = true;
const { } else {
sys, delete propsToShow[propertyName];
eng, }
wep, this.setState({ propsToShow: assign({}, propsToShow) });
mcSys,
mcEng,
mcWep,
boost,
opponent,
opponentBuild,
engagementRange
} = this.state;
const code = `${sys}/${eng}/${wep}/${boost ? 1 : 0}/${fuel ||
this.state.fuel}/${cargo || this.state.cargo}/${opponent.id}/${
opponentBuild ? opponentBuild : ''
}/${engagementRange}/${mcSys}/${mcEng}/${mcWep}`;
return code;
} }
/** /**
* Save the current build * Save the current build
*/ */
_saveBuild() { _saveBuild() {
const { ship, buildName, newBuildName, shipId } = this.state; const { ship, buildName, newBuildName } = this.state;
const shipId = ship.getShipType();
// If this is a stock ship the code won't be set, so ensure that we have it // If this is a stock ship the code won't be set, so ensure that we have it
const code = this.state.code || ship.toString(); const code = this.state.code || ship.compress();
Persist.saveBuild(shipId, newBuildName, code); Persist.saveBuild(shipId, newBuildName, code);
this._updateRoute(shipId, newBuildName, code); this._setRoute();
let opponent, opponentBuild, opponentSys, opponentEng, opponentWep; let opponent, opponentBuild, opponentSys, opponentEng, opponentWep;
if ( if (
@@ -460,7 +314,6 @@ export default class OutfittingPage extends Page {
opponentSys, opponentSys,
opponentEng, opponentEng,
opponentWep, opponentWep,
title: this._getTitle(newBuildName)
}); });
} }
@@ -468,11 +321,12 @@ export default class OutfittingPage extends Page {
* Rename the current build * Rename the current build
*/ */
_renameBuild() { _renameBuild() {
const { code, buildName, newBuildName, shipId, ship } = this.state; const { code, buildName, newBuildName, ship } = this.state;
const shipId = ship.getShipType();
if (buildName != newBuildName && newBuildName.length) { if (buildName != newBuildName && newBuildName.length) {
Persist.deleteBuild(shipId, buildName); Persist.deleteBuild(shipId, buildName);
Persist.saveBuild(shipId, newBuildName, code); Persist.saveBuild(shipId, newBuildName, code);
this._updateRoute(shipId, newBuildName, code); this._setRoute();
this.setState({ this.setState({
buildName: newBuildName, buildName: newBuildName,
code, code,
@@ -493,50 +347,19 @@ export default class OutfittingPage extends Page {
* Reset build to Stock/Factory defaults * Reset build to Stock/Factory defaults
*/ */
_resetBuild() { _resetBuild() {
const { ship, shipId, buildName } = this.state; let { ship } = this.state;
// Rebuild ship // Rebuild ship
ship.buildWith(Ships[shipId].defaults); ship = Factory.newShip(ship.getShipType());
// Reset controls
const code = ship.toString();
const {
sys,
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
engagementRange
} = this._obtainControlFromCode(ship, code);
// Update state, and refresh the ship // Update state, and refresh the ship
this.setState( this.setState({ ship, code: undefined }, () => this._setRoute());
{
sys,
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
engagementRange
},
() => this._updateRoute(shipId, buildName, code)
);
} }
/** /**
* Delete the build * Delete the build
*/ */
_deleteBuild() { _deleteBuild() {
const { shipId, buildName } = this.state; const { ship, buildName } = this.state;
const shipId = ship.getShipType();
Persist.deleteBuild(shipId, buildName); Persist.deleteBuild(shipId, buildName);
let opponentBuild; let opponentBuild;
@@ -549,7 +372,7 @@ export default class OutfittingPage extends Page {
} else { } else {
opponentBuild = this.state.opponentBuild; opponentBuild = this.state.opponentBuild;
} }
Router.go(outfitURL(this.state.shipId)); Router.go(outfitURL(shipId));
this.setState({ opponentBuild }); this.setState({ opponentBuild });
} }
@@ -573,43 +396,12 @@ export default class OutfittingPage extends Page {
* Called when the code for the ship has been updated, to synchronise the rest of the data * Called when the code for the ship has been updated, to synchronise the rest of the data
*/ */
_codeUpdated() { _codeUpdated() {
const { code, ship, shipId, buildName } = this.state; const { ship, code, buildName } = this.state;
const shipId = ship.getShipType();
// Rebuild ship from the code
this.state.ship.buildFrom(code);
// Obtain controls from the code
const {
sys,
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
engagementRange
} = this._obtainControlFromCode(ship, code);
// Update state, and refresh the route when complete
this.setState( this.setState(
{ { ship: new Ship(code), },
sys, () => this._setRoute(),
eng,
wep,
mcSys,
mcEng,
mcWep,
boost,
fuel,
cargo,
opponent,
opponentBuild,
engagementRange
},
() => this._updateRoute(shipId, buildName, code)
); );
} }
@@ -617,23 +409,11 @@ export default class OutfittingPage extends Page {
* Called when the ship has been updated, to set the code and then update accordingly * Called when the ship has been updated, to set the code and then update accordingly
*/ */
_shipUpdated() { _shipUpdated() {
let { ship, shipId, buildName, cargo, fuel } = this.state; let { ship } = this.state;
if (cargo > ship.cargoCapacity) { const code = ship.compress();
cargo = ship.cargoCapacity;
}
if (fuel > ship.fuelCapacity) {
fuel = ship.fuelCapacity;
}
const code = this._fullCode(ship, fuel, cargo);
// Only update the state if this really has been updated // Only update the state if this really has been updated
if ( if (this.state.code != code) {
this.state.code != code || this.setState({ code }, () => this._setRoute());
this.state.cargo != cargo ||
this.state.fuel != fuel
) {
this.setState({ code, cargo, fuel }, () =>
this._updateRoute(shipId, buildName, code)
);
} }
} }
@@ -643,8 +423,9 @@ export default class OutfittingPage extends Page {
* @param {string} buildName Current build name * @param {string} buildName Current build name
* @param {string} code Serialized ship 'code' * @param {string} code Serialized ship 'code'
*/ */
_updateRoute(shipId, buildName, code) { _setRoute() {
Router.replace(outfitURL(shipId, code, buildName)); const { ship, code, buildName } = this.state;
Router.replace(outfitURL(ship.getShipType(), code, buildName));
} }
/** /**
@@ -747,123 +528,93 @@ export default class OutfittingPage extends Page {
*/ */
renderPage() { renderPage() {
let state = this.state, let state = this.state,
{ language, termtip, tooltip, sizeRatio, onWindowResize } = this.context, { language, termtip, tooltip, sizeRatio } = this.context,
{ translate, units, formats } = language, { translate } = language,
{ {
ship, ship,
code, code,
savedCode, savedCode,
buildName, buildName,
newBuildName, newBuildName,
sys, // opponent,
eng, // opponentBuild,
wep, // opponentSys,
mcSys, // opponentEng,
mcEng, // opponentWep,
mcWep, // engagementRange
boost,
fuel,
cargo,
opponent,
opponentBuild,
opponentSys,
opponentEng,
opponentWep,
engagementRange
} = state, } = state,
hide = tooltip.bind(null, null), hide = tooltip.bind(null, null),
menu = this.props.currentMenu, menu = this.props.currentMenu,
shipUpdated = this._shipUpdated,
canSave = (newBuildName || buildName) && code !== savedCode, canSave = (newBuildName || buildName) && code !== savedCode,
canRename = buildName && newBuildName && buildName != newBuildName, canRename = buildName && newBuildName && buildName != newBuildName,
canReload = savedCode && canSave; canReload = savedCode && canSave;
// Code can be blank for a default loadout. Prefix it with the ship name to ensure that changes in default ships is picked up // const requirements = Ships[ship.id].requirements;
code = ship.name + (code || ''); // let requirementElements = [];
// /**
// * Render the requirements for a ship / etc
// * @param {string} className Class names
// * @param {string} textKey The key for translating
// * @param {String} tooltipTextKey Tooltip key
// */
// function renderRequirement(className, textKey, tooltipTextKey) {
// if (textKey.startsWith('empire') || textKey.startsWith('federation')) {
// requirementElements.push(
// <div
// key={textKey}
// className={className}
// onMouseEnter={termtip.bind(null, tooltipTextKey)}
// onMouseLeave={hide}
// >
// <a
// href={
// textKey.startsWith('empire') ?
// 'http://elite-dangerous.wikia.com/wiki/Empire/Ranks' :
// 'http://elite-dangerous.wikia.com/wiki/Federation/Ranks'
// }
// target="_blank"
// rel="noopener"
// >
// {translate(textKey)}
// </a>
// </div>
// );
// } else {
// requirementElements.push(
// <div
// key={textKey}
// className={className}
// onMouseEnter={termtip.bind(null, tooltipTextKey)}
// onMouseLeave={hide}
// >
// {translate(textKey)}
// </div>
// );
// }
// }
// Markers are used to propagate state changes without requiring a deep comparison of the ship, as that takes a long time // if (requirements) {
const _sStr = ship.getStandardString(); // requirements.federationRank &&
const _iStr = ship.getInternalString(); // renderRequirement(
const _hStr = ship.getHardpointsString(); // 'federation',
const _pStr = `${ship.getPowerEnabledString()}${ship.getPowerPrioritiesString()}`; // 'federation rank ' + requirements.federationRank,
const _mStr = ship.getModificationsString(); // 'federation rank required'
// );
const standardSlotMarker = `${ship.name}${_sStr}${_pStr}${_mStr}${ // requirements.empireRank &&
ship.ladenMass // renderRequirement(
}${cargo}${fuel}`; // 'empire',
const internalSlotMarker = `${ship.name}${_iStr}${_pStr}${_mStr}`; // 'empire rank ' + requirements.empireRank,
const hardpointsSlotMarker = `${ship.name}${_hStr}${_pStr}${_mStr}`; // 'empire rank required'
const boostMarker = `${ship.canBoost(cargo, fuel)}`; // );
const shipSummaryMarker = `${ // requirements.horizons &&
ship.name // renderRequirement('horizons', 'horizons', 'horizons required');
}${_sStr}${_iStr}${_hStr}${_pStr}${_mStr}${ship.ladenMass}${cargo}${fuel}`; // requirements.horizonsEarlyAdoption &&
// renderRequirement(
const requirements = Ships[ship.id].requirements; // 'horizons',
let requirementElements = []; // 'horizons early adoption',
/** // 'horizons early adoption required'
* Render the requirements for a ship / etc // );
* @param {string} className Class names // }
* @param {string} textKey The key for translating
* @param {String} tooltipTextKey Tooltip key
*/
function renderRequirement(className, textKey, tooltipTextKey) {
if (textKey.startsWith('empire') || textKey.startsWith('federation')) {
requirementElements.push(
<div
key={textKey}
className={className}
onMouseEnter={termtip.bind(null, tooltipTextKey)}
onMouseLeave={hide}
>
<a
href={
textKey.startsWith('empire') ?
'http://elite-dangerous.wikia.com/wiki/Empire/Ranks' :
'http://elite-dangerous.wikia.com/wiki/Federation/Ranks'
}
target="_blank"
rel="noopener"
>
{translate(textKey)}
</a>
</div>
);
} else {
requirementElements.push(
<div
key={textKey}
className={className}
onMouseEnter={termtip.bind(null, tooltipTextKey)}
onMouseLeave={hide}
>
{translate(textKey)}
</div>
);
}
}
if (requirements) {
requirements.federationRank &&
renderRequirement(
'federation',
'federation rank ' + requirements.federationRank,
'federation rank required'
);
requirements.empireRank &&
renderRequirement(
'empire',
'empire rank ' + requirements.empireRank,
'empire rank required'
);
requirements.horizons &&
renderRequirement('horizons', 'horizons', 'horizons required');
requirements.horizonsEarlyAdoption &&
renderRequirement(
'horizons',
'horizons early adoption',
'horizons early adoption required'
);
}
return ( return (
<div <div
@@ -872,8 +623,8 @@ export default class OutfittingPage extends Page {
style={{ fontSize: sizeRatio * 0.9 + 'em' }} style={{ fontSize: sizeRatio * 0.9 + 'em' }}
> >
<div id="overview"> <div id="overview">
<h1>{ship.name}</h1> <h1>{ship.getShipType()}</h1>
<div id="requirements">{requirementElements}</div> {/* <div id="requirements">{requirementElements}</div> */}
<div id="build"> <div id="build">
<input <input
value={newBuildName || ''} value={newBuildName || ''}
@@ -933,7 +684,7 @@ export default class OutfittingPage extends Page {
<Download className="lg" /> <Download className="lg" />
</button> </button>
<button <button
onClick={this._eddbShoppingList} // onClick={this._eddbShoppingList}
onMouseOver={termtip.bind(null, 'PHRASE_SHOPPING_LIST')} onMouseOver={termtip.bind(null, 'PHRASE_SHOPPING_LIST')}
onMouseOut={hide} onMouseOut={hide}
> >
@@ -954,7 +705,7 @@ export default class OutfittingPage extends Page {
<OrbisIcon className="lg" /> <OrbisIcon className="lg" />
</button> </button>
<button <button
onClick={this._genShoppingList} // onClick={this._genShoppingList}
onMouseOver={termtip.bind(null, 'PHRASE_SHOPPING_MATS')} onMouseOver={termtip.bind(null, 'PHRASE_SHOPPING_MATS')}
onMouseOut={hide} onMouseOut={hide}
> >
@@ -964,58 +715,18 @@ export default class OutfittingPage extends Page {
</div> </div>
{/* Main tables */} {/* Main tables */}
<ShipSummaryTable <ShipSummaryTable ship={ship} code={code} />
ship={ship} <StandardSlotSection ship={ship} code={code} currentMenu={menu}
fuel={fuel} propsToShow={propsToShow} onPropToggle={this._propToShowToggled} />
cargo={cargo} <InternalSlotSection ship={ship} code={code} currentMenu={menu}
marker={shipSummaryMarker} propsToShow={propsToShow} onPropToggle={this._propToShowToggled} />
pips={{ <HardpointSlotSection ship={ship} code={code} currentMenu={menu}
sys: this.state.sys, propsToShow={propsToShow} onPropToggle={this._propToShowToggled} />
wep: this.state.wep, <UtilitySlotSection ship={ship} code={code} currentMenu={menu}
eng: this.state.eng propsToShow={propsToShow} onPropToggle={this._propToShowToggled} />
}}
/>
<StandardSlotSection
ship={ship}
fuel={fuel}
cargo={cargo}
code={standardSlotMarker}
onChange={shipUpdated}
onCargoChange={this._cargoUpdated}
onFuelChange={this._fuelUpdated}
currentMenu={menu}
sectionMenuRefs={this._sectionMenuRefs}
/>
<InternalSlotSection
ship={ship}
code={internalSlotMarker}
onChange={shipUpdated}
onCargoChange={this._cargoUpdated}
onFuelChange={this._fuelUpdated}
currentMenu={menu}
sectionMenuRefs={this._sectionMenuRefs}
/>
<HardpointSlotSection
ship={ship}
code={hardpointsSlotMarker}
onChange={shipUpdated}
onCargoChange={this._cargoUpdated}
onFuelChange={this._fuelUpdated}
currentMenu={menu}
sectionMenuRefs={this._sectionMenuRefs}
/>
<UtilitySlotSection
ship={ship}
code={hardpointsSlotMarker}
onChange={shipUpdated}
onCargoChange={this._cargoUpdated}
onFuelChange={this._fuelUpdated}
currentMenu={menu}
sectionMenuRefs={this._sectionMenuRefs}
/>
{/* Control of ship and opponent */} {/* Control of ship and opponent */}
<div className="group quarter"> {/* <div className="group quarter">
<div className="group half"> <div className="group half">
<h2 style={{ verticalAlign: 'middle', textAlign: 'left' }}> <h2 style={{ verticalAlign: 'middle', textAlign: 'left' }}>
{translate('ship control')} {translate('ship control')}
@@ -1044,7 +755,6 @@ export default class OutfittingPage extends Page {
<div className="group quarter"> <div className="group quarter">
<Fuel <Fuel
fuelCapacity={ship.fuelCapacity} fuelCapacity={ship.fuelCapacity}
fuel={fuel}
onChange={this._fuelUpdated} onChange={this._fuelUpdated}
/> />
</div> </div>
@@ -1052,7 +762,6 @@ export default class OutfittingPage extends Page {
{ship.cargoCapacity > 0 ? ( {ship.cargoCapacity > 0 ? (
<Cargo <Cargo
cargoCapacity={ship.cargoCapacity} cargoCapacity={ship.cargoCapacity}
cargo={cargo}
onChange={this._cargoUpdated} onChange={this._cargoUpdated}
/> />
) : null} ) : null}
@@ -1077,10 +786,10 @@ export default class OutfittingPage extends Page {
engagementRange={engagementRange} engagementRange={engagementRange}
onChange={this._engagementRangeUpdated} onChange={this._engagementRangeUpdated}
/> />
</div> </div> */}
{/* Tabbed subpages */} {/* Tabbed subpages */}
<OutfittingSubpages {/* <OutfittingSubpages
ship={ship} ship={ship}
code={code} code={code}
buildName={buildName} buildName={buildName}
@@ -1097,7 +806,7 @@ export default class OutfittingPage extends Page {
opponentSys={opponentSys} opponentSys={opponentSys}
opponentEng={opponentEng} opponentEng={opponentEng}
opponentWep={opponentWep} opponentWep={opponentWep}
/> /> */}
</div> </div>
); );
} }

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract/Base Page * Abstract/Base Page
*/ */
export default class Page extends React.Component { export default class Page extends React.Component {
static contextTypes = { static contextTypes = {
closeMenu: PropTypes.func.isRequired, closeMenu: PropTypes.func.isRequired,
hideModal: PropTypes.func.isRequired, hideModal: PropTypes.func.isRequired,
@@ -84,5 +83,4 @@ export default class Page extends React.Component {
} }
return this.renderPage(); return this.renderPage();
} }
} }

View File

@@ -1,102 +1,81 @@
import React from 'react'; import React from 'react';
import Page from './Page'; import Page from './Page';
import { Ships } from 'coriolis-data/dist';
import cn from 'classnames'; import cn from 'classnames';
import Ship from '../shipyard/Ship'; import { Factory } from 'ed-forge';
import * as ModuleUtils from '../shipyard/ModuleUtils'; import { JUMP_METRICS } from 'ed-forge/lib/ship-stats';
import { SizeMap } from '../shipyard/Constants'; import { SizeMap } from '../shipyard/Constants';
import Link from '../components/Link'; import Link from '../components/Link';
/**
* Counts the hardpoints by class/size
* @param {Object} slot Hardpoint Slot model
*/
function countHp(slot) {
this.hp[slot.maxClass]++;
this.hpCount++;
}
/**
* Counts the internal slots and aggregated properties
* @param {Object} slot Internal Slots
*/
function countInt(slot) {
let crEligible = !slot.eligible || slot.eligible.cr;
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
this.intCount++;
this.maxCargo += crEligible ?
ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo :
0;
// if no eligiblity, then assume pce
let passSlotType = null;
let passSlotRating = null;
if (!slot.eligible || slot.eligible.pce) {
passSlotType = 'pce';
passSlotRating = 'E';
} else if (slot.eligible.pci) {
passSlotType = 'pci';
passSlotRating = 'D';
} else if (slot.eligible.pcm) {
passSlotType = 'pcm';
passSlotRating = 'C';
} else if (slot.eligible.pcq) {
passSlotType = 'pcq';
passSlotRating = 'B';
}
let passengerBay = passSlotType ?
ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) :
null;
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
}
/** /**
* Generate Ship summary and aggregated properties * Generate Ship summary and aggregated properties
* @param {String} shipId Ship Id * @param {String} shipId Ship Id
* @param {Object} shipData Ship Default Data
* @return {Object} Ship summary and aggregated properties * @return {Object} Ship summary and aggregated properties
*/ */
function shipSummary(shipId, shipData) { function shipSummary(shipId) {
// Build Ship
let ship = Factory.newShip(shipId);
let coreSizes = ship.readMeta('coreSizes');
let { jumpRange, totalRange } = ship.getMetrics(JUMP_METRICS);
let summary = { let summary = {
agility: ship.readProp('pitch') + ship.readProp('yaw') + ship.readProp('roll'),
baseArmour: ship.readProp('basearmour'),
baseShieldStrength: ship.readProp('baseshieldstrength'),
boost: ship.readProp('boost'),
class: ship.readMeta('class'),
crew: ship.readMeta('crew'),
id: shipId, id: shipId,
hardness: ship.readProp('hardness'),
hpCount: 0, hpCount: 0,
hullMass: ship.readProp('hullmass'),
intCount: 0, intCount: 0,
beta: shipData.beta, masslock: ship.readProp('masslock'),
maxCargo: 0,
maxPassengers: 0,
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8 int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
standard: shipData.slots.standard, jumpRange,
agility: pitch: ship.readProp('pitch'),
shipData.properties.pitch + retailCost: ship.readMeta('retailCost'),
shipData.properties.yaw + roll: ship.readProp('roll'),
shipData.properties.roll speed: ship.readProp('speed'),
standard: [
'powerplant',
'mainengines',
'frameshiftdrive',
'lifesupport',
'powerdistributor',
'radar',
'fueltank'
].map(k => coreSizes[k]),
totalRange,
yaw: ship.readProp('yaw'),
}; };
Object.assign(summary, shipData.properties);
let ship = new Ship(shipId, shipData.properties, shipData.slots);
// Build Ship // Count Hardpoints by class
ship.buildWith(shipData.defaults); // Populate with stock/default components ship.getHardpoints(undefined, true).forEach(hardpoint => {
ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class summary.hp[hardpoint.getSize()]++;
ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class summary.hpCount++;
summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost });
ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range // Count Internal Compartments by class
summary.maxJumpRange = ship.unladenRange; // Record Jump Range let maxCargo = 0, maxPassengers = 0;
ship.getInternals(undefined, true).forEach(internal => {
const size = String(internal.getSize());
summary.int[size]++;
summary.intCount++;
// Best thrusters // Try cargo racks
let th; try {
if (ship.standard[1].maxClass === 3) { internal.setItem('cargorack', size);
th = 'tz'; maxCargo += internal.get('cargo');
} else if (ship.standard[1].maxClass === 2) { } catch {}
th = 'u0'; // Try economy cabins
} else { try {
th = ship.standard[1].maxClass + 'A'; internal.setItem('passengercabins', size < '6' ? size : '6', '1');
} maxPassengers += internal.get('cabincapacity');
} catch {}
});
ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters summary.maxCargo = maxCargo;
summary.topSpeed = ship.topSpeed; summary.maxPassengers = maxPassengers;
summary.topBoost = ship.topBoost;
summary.baseArmour = ship.armour;
return summary; return summary;
} }
@@ -117,14 +96,14 @@ export default class ShipyardPage extends Page {
if (!ShipyardPage.cachedShipSummaries) { if (!ShipyardPage.cachedShipSummaries) {
ShipyardPage.cachedShipSummaries = []; ShipyardPage.cachedShipSummaries = [];
for (let s in Ships) { for (let s of Factory.getAllShipTypes()) {
ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s])); ShipyardPage.cachedShipSummaries.push(shipSummary(s));
} }
} }
this.state = { this.state = {
title: 'Coriolis EDCD Edition - Shipyard', title: 'Coriolis EDCD Edition - Shipyard',
shipPredicate: 'name', shipPredicate: 'id',
shipDesc: true, shipDesc: true,
shipSummaries: ShipyardPage.cachedShipSummaries, shipSummaries: ShipyardPage.cachedShipSummaries,
compare: {}, compare: {},
@@ -157,7 +136,7 @@ export default class ShipyardPage extends Page {
* @private * @private
*/ */
_toggleGroupCompared() { _toggleGroupCompared() {
this.setState({groupCompared: !this.state.groupCompared}) this.setState({ groupCompared: !this.state.groupCompared });
} }
/** /**
@@ -205,21 +184,22 @@ export default class ShipyardPage extends Page {
onMouseEnter={noTouch && this._highlightShip.bind(this, s.id)} onMouseEnter={noTouch && this._highlightShip.bind(this, s.id)}
onClick={() => this._toggleCompare(s.id)} onClick={() => this._toggleCompare(s.id)}
> >
<td className="ri">{s.manufacturer}</td>
<td className="ri">{fInt(s.retailCost)}</td> <td className="ri">{fInt(s.retailCost)}</td>
<td className="ri cap">{translate(SizeMap[s.class])}</td> <td className="ri cap">{translate(SizeMap[s.class])}</td>
<td className="ri">{fInt(s.crew)}</td> <td className="ri">{fInt(s.crew)}</td>
<td className="ri">{s.masslock}</td> <td className="ri">{s.masslock}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.hullMass)}</td> <td className="ri">{fInt(s.hullMass)}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.speed)}</td> <td className="ri">{fInt(s.speed)}</td>
<td className="ri">{fInt(s.boost)}</td> <td className="ri">{fInt(s.boost)}</td>
<td className="ri">{fInt(s.pitch)}</td>
<td className="ri">{fInt(s.yaw)}</td>
<td className="ri">{fInt(s.roll)}</td>
<td className="ri">{fRound(s.jumpRange)}</td>
<td className="ri">{fRound(s.totalRange)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.baseArmour)}</td> <td className="ri">{fInt(s.baseArmour)}</td>
<td className="ri">{fInt(s.baseShieldStrength)}</td> <td className="ri">{fInt(s.baseShieldStrength)}</td>
<td className="ri">{fInt(s.topSpeed)}</td>
<td className="ri">{fInt(s.topBoost)}</td>
<td className="ri">{fRound(s.maxJumpRange)}</td>
<td className="ri">{fInt(s.maxCargo)}</td> <td className="ri">{fInt(s.maxCargo)}</td>
<td className="ri">{fInt(s.maxPassengers)}</td> <td className="ri">{fInt(s.maxPassengers)}</td>
<td className="cn">{s.standard[0]}</td> <td className="cn">{s.standard[0]}</td>
@@ -255,7 +235,6 @@ export default class ShipyardPage extends Page {
let { translate, formats, units } = language; let { translate, formats, units } = language;
let hide = this.context.tooltip.bind(null, null); let hide = this.context.tooltip.bind(null, null);
let fInt = formats.int; let fInt = formats.int;
let fRound = formats.round;
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state; let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
let sortShips = (predicate, index) => let sortShips = (predicate, index) =>
this._sortShips.bind(this, predicate, index); this._sortShips.bind(this, predicate, index);
@@ -299,7 +278,7 @@ export default class ShipyardPage extends Page {
} }
if (valA == valB) { if (valA == valB) {
if (a.name > b.name) { if (a.id > b.id) {
return 1; return 1;
} else { } else {
return -1; return -1;
@@ -335,7 +314,7 @@ export default class ShipyardPage extends Page {
onClick={() => this._toggleCompare(s.id)} onClick={() => this._toggleCompare(s.id)}
> >
<td className="le"> <td className="le">
<Link href={'/outfit/' + s.id}>{s.name} {s.beta === true ? '(Beta)' : null}</Link> <Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link>
</td> </td>
</tr> </tr>
); );
@@ -352,7 +331,7 @@ export default class ShipyardPage extends Page {
<th className="le rgt">&nbsp;</th> <th className="le rgt">&nbsp;</th>
</tr> </tr>
<tr className="main"> <tr className="main">
<th className="sortable le rgt" onClick={sortShips('name')}> <th className="sortable le rgt" onClick={sortShips('id')}>
{translate('ship')} {translate('ship')}
</th> </th>
</tr> </tr>
@@ -368,110 +347,87 @@ export default class ShipyardPage extends Page {
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table"> <table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead> <thead>
<tr className="main"> <tr className="main">
<th {/* First all headers that spread out over three rows */}
rowSpan={3} {/* cost placeholder */}
className="sortable"
onClick={sortShips('manufacturer')}
>
{translate('manufacturer')}
</th>
<th>&nbsp;</th> <th>&nbsp;</th>
<th <th rowSpan={3} className="sortable" onClick={sortShips('class')}>
rowSpan={3}
className="sortable"
onClick={sortShips('class')}
>
{translate('size')} {translate('size')}
</th> </th>
<th <th rowSpan={3} className="sortable" onClick={sortShips('crew')}>
rowSpan={3}
className="sortable"
onClick={sortShips('crew')}
>
{translate('crew')} {translate('crew')}
</th> </th>
<th <th rowSpan={3} className="sortable"
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')} onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide} onMouseLeave={hide} onClick={sortShips('masslock')}>
onClick={sortShips('masslock')}
>
{translate('MLF')} {translate('MLF')}
</th> </th>
<th {/* hull mass placeholder */}
rowSpan={3} <th>&nbsp;</th>
className="sortable" <th colSpan={6}>{translate('agility')}</th>
onClick={sortShips('agility')} <th colSpan={2}>{translate('travel')}</th>
> <th colSpan={3}>{translate('defence')}</th>
{translate('agility')} {/* cargo placeholder */}
</th> <th>&nbsp;</th>
<th {/* pax placeholder */}
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide}
onClick={sortShips('hardness')}
>
{translate('hrd')}
</th>
<th>&nbsp;</th> <th>&nbsp;</th>
<th colSpan={4}>{translate('base')}</th>
<th colSpan={5}>{translate('max')}</th>
<th className="lft" colSpan={7} /> <th className="lft" colSpan={7} />
<th className="lft" colSpan={5} /> <th className="lft" colSpan={5} />
<th className="lft" colSpan={8} /> <th className="lft" colSpan={8} />
</tr> </tr>
<tr> <tr>
<th {/* Now all headers in a second-row */}
className="sortable lft" <th className="sortable lft" onClick={sortShips('retailCost')}>
onClick={sortShips('retailCost')}
>
{translate('cost')} {translate('cost')}
</th> </th>
<th className="sortable lft" onClick={sortShips('hullMass')}> <th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')} {translate('hull')}
</th> </th>
<th className="sortable lft" onClick={sortShips('speed')}> <th className="sortable lft" onClick={sortShips('agility')}>
{translate('rating')}
</th>
<th className="sortable" onClick={sortShips('speed')}>
{translate('speed')} {translate('speed')}
</th> </th>
<th className="sortable" onClick={sortShips('boost')}> <th className="sortable" onClick={sortShips('boost')}>
{translate('boost')} {translate('boost')}
</th> </th>
<th className="sortable" onClick={sortShips('pitch')}>
{translate('pitch')}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{translate('yaw')}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{translate('roll')}
</th>
<th className="sortable lft" onClick={sortShips('jumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{translate('range')}
</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide} onClick={sortShips('hardness')}>
{translate('hrd')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}> <th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')} {translate('armour')}
</th> </th>
<th <th className="sortable" onClick={sortShips('baseShieldStrength')}>
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{translate('shields')} {translate('shields')}
</th> </th>
<th className="sortable lft" onClick={sortShips('topSpeed')}> <th className="sortable lft" onClick={sortShips('maxCargo')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{translate('cargo')} {translate('cargo')}
</th> </th>
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')} <th className="sortable lft" onClick={sortShips('maxPassengers')}
onMouseLeave={hide}> onMouseEnter={termtip.bind(null, 'passenger capacity')} onMouseLeave={hide}>
{translate('pax')} {translate('pax')}
</th> </th>
<th className="lft" colSpan={7}> <th className="lft" colSpan={7}>
{translate('core module classes')} {translate('core module classes')}
</th> </th>
<th <th colSpan={5} className="sortable lft" onClick={sortShips('hpCount')}>
colSpan={5}
className="sortable lft"
onClick={sortShips('hpCount')}
>
{translate('hardpoints')} {translate('hardpoints')}
</th> </th>
<th <th
@@ -483,6 +439,7 @@ export default class ShipyardPage extends Page {
</th> </th>
</tr> </tr>
<tr> <tr>
{/* Third row headers, i.e., units */}
<th <th
className="sortable lft" className="sortable lft"
onClick={sortShips('retailCost')} onClick={sortShips('retailCost')}
@@ -492,12 +449,31 @@ export default class ShipyardPage extends Page {
<th className="sortable lft" onClick={sortShips('hullMass')}> <th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T} {units.T}
</th> </th>
<th className="sortable lft" onClick={sortShips('speed')}> {/* agility rating placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable" onClick={sortShips('speed')}>
{units['m/s']} {units['m/s']}
</th> </th>
<th className="sortable" onClick={sortShips('boost')}> <th className="sortable" onClick={sortShips('boost')}>
{units['m/s']} {units['m/s']}
</th> </th>
<th className="sortable" onClick={sortShips('pitch')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{units['°/s']}
</th>
<th className="sortable lft" onClick={sortShips('jumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{units.LY}
</th>
<th className="lft">&nbsp;</th>
{/* armour placeholder */}
<th>&nbsp;</th> <th>&nbsp;</th>
<th <th
className="sortable" className="sortable"
@@ -505,73 +481,37 @@ export default class ShipyardPage extends Page {
> >
{units.MJ} {units.MJ}
</th> </th>
<th className="sortable lft" onClick={sortShips('topSpeed')}> <th className="sortable lft" onClick={sortShips('maxCargo')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{units.T} {units.T}
</th> </th>
<th>&nbsp;</th> {/* pax placeholder */}
<th <th className="lft">&nbsp;</th>
className="sortable lft" <th className="sortable lft" onMouseEnter={termtip.bind(null, 'power plant')}
onMouseEnter={termtip.bind(null, 'power plant')} onMouseLeave={hide} onClick={sortShips('standard', 0)}>
onMouseLeave={hide}
onClick={sortShips('standard', 0)}
>
{'pp'} {'pp'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'thrusters')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 1)}>
onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide}
onClick={sortShips('standard', 1)}
>
{'th'} {'th'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'frame shift drive')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 2)}>
onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide}
onClick={sortShips('standard', 2)}
>
{'fsd'} {'fsd'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'life support')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 3)}>
onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide}
onClick={sortShips('standard', 3)}
>
{'ls'} {'ls'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'power distriubtor')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 4)}>
onMouseEnter={termtip.bind(null, 'power distriubtor')}
onMouseLeave={hide}
onClick={sortShips('standard', 4)}
>
{'pd'} {'pd'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'sensors')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 5)}>
onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide}
onClick={sortShips('standard', 5)}
>
{'s'} {'s'}
</th> </th>
<th <th className="sortable" onMouseEnter={termtip.bind(null, 'fuel tank')}
className="sortable" onMouseLeave={hide} onClick={sortShips('standard', 6)}>
onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide}
onClick={sortShips('standard', 6)}
>
{'ft'} {'ft'}
</th> </th>
<th className="sortable lft" onClick={sortShips('hp', 1)}> <th className="sortable lft" onClick={sortShips('hp', 1)}>

View File

@@ -0,0 +1,33 @@
import { Module } from 'ed-forge';
/**
* Sets a resistance value of a module as
* @param {Module} module Module to set the property
* @param {string} prop Property name; must end with 'resistance'
* @param {number} val Resistance value to set
*/
function setterResToEff(module, prop, val) {
module.set(
prop.replace('resistance', 'effectiveness'),
1 - val / 100,
);
}
export const SHOW = {
causticeffectiveness: {
as: 'causticresistance',
setter: setterResToEff,
},
explosiveeffectiveness: {
as: 'explosiveresistance',
setter: setterResToEff,
},
kineticeffectiveness: {
as: 'kineticresistance',
setter: setterResToEff,
},
thermiceffectiveness: {
as: 'thermicresistance',
setter: setterResToEff,
},
};

View File

@@ -1,61 +1,43 @@
import React from 'react'; import React from 'react';
import { Modifications } from 'coriolis-data/dist'; import { Modifications } from 'coriolis-data/dist';
import { STATS_FORMATTING } from '../shipyard/StatsFormatting'; import { Module } from 'ed-forge';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
import { entries, keys, uniq } from 'lodash';
/** /**
* Generate a tooltip with details of a blueprint's specials * Generate a tooltip with details of a blueprint's specials
* @param {Object} translate The translate object * @param {Object} language The translate object
* @param {Object} blueprint The blueprint at the required grade * @param {Module} m The module to compare with
* @param {string} grp The group of the module
* @param {Object} m The module to compare with
* @param {string} specialName The name of the special * @param {string} specialName The name of the special
* @returns {Object} The react components * @returns {Object} The react components
*/ */
export function specialToolTip(translate, blueprint, grp, m, specialName) { export function specialToolTip(language, m, specialName) {
const effects = []; const { formats, translate } = language;
if (!blueprint || !blueprint.features) {
return undefined;
}
if (m) {
// We also add in any benefits from specials that aren't covered above
if (m.blueprint) {
for (const feature in Modifications.modifierActions[specialName]) {
// if (!blueprint.features[feature] && !m.mods.feature) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature) - m.getModValue(feature, true);
if (featureDef.type === 'percentage') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature + '_specialTT'}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'}
style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
}
return ( return (
<div> <div>
<table width='100%'> <table width='100%'>
<tbody> <tbody>
{effects} {entries(getExperimentalInfo(specialName).features).map(
([prop, feats]) => {
const { max, only } = feats;
if (only && !m.getItem().match(only)) {
return null;
}
const { value, unit, beneficial } = m.getModifierFormatted(prop);
// If the product of value and min/max is positive, both values
// point into the same direction, i.e. positive/negative.
const specialBeneficial = (value * max) > 0 === beneficial;
return <tr key={prop + '_specialTT'}>
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
<td>&nbsp;</td>
<td className={specialBeneficial ? 'secondary' : 'warning'}
style={{ textAlign: 'right' }}>{formats.round(max * 100)}{unit}</td>
<td>&nbsp;</td>
</tr>;
}
)}
</tbody> </tbody>
</table> </table>
</div> </div>
@@ -63,154 +45,23 @@ export function specialToolTip(translate, blueprint, grp, m, specialName) {
} }
/** /**
* Generate a tooltip with details of a blueprint's effects * Generate a tooltip with details and preview of a blueprint's effects
* @param {Object} translate The translate object * @param {Object} language The language object
* @param {Object} blueprint The blueprint at the required grade * @param {Module} m The module to compare with
* @param {Array} engineers The engineers supplying this blueprint * @param {string} previewBP Blueprint to preview
* @param {string} grp The group of the module * @param {number} previewGrade Grade to preview
* @param {Object} m The module to compare with
* @returns {Object} The react components * @returns {Object} The react components
*/ */
export function blueprintTooltip(translate, blueprint, engineers, grp, m) { export function blueprintTooltip(language, m, previewBP, previewGrade) {
const effects = []; const { translate, formats } = language;
if (!blueprint || !blueprint.features) { const blueprint = previewBP || m.getBlueprint();
return undefined; const grade = previewGrade || m.getBlueprintGrade();
} if (!blueprint) {
for (const feature in blueprint.features) { return null;
const featureIsBeneficial = isBeneficial(feature, blueprint.features[feature]);
const featureDef = Modifications.modifications[feature];
if (!featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let lowerBound = blueprint.features[feature][0];
let upperBound = blueprint.features[feature][1];
if (featureDef.type === 'percentage') {
lowerBound = Math.round(lowerBound * 1000) / 10;
upperBound = Math.round(upperBound * 1000) / 10;
}
const lowerIsBeneficial = isValueBeneficial(feature, lowerBound);
const upperIsBeneficial = isValueBeneficial(feature, upperBound);
if (m) {
// We have a module - add in the current value
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
</tr>
);
} else {
// We do not have a module, no value
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
</tr>
);
}
}
}
if (m) {
// Because we have a module add in any benefits that aren't part of the primary blueprint
for (const feature in m.mods) {
if (!blueprint.features[feature]) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
} }
// We also add in any benefits from specials that aren't covered above const bpFeatures = getBlueprintInfo(blueprint).features[grade];
if (m.blueprint && m.blueprint.special) { const features = uniq(m.getModifiedProperties().concat(keys(bpFeatures)));
for (const feature in Modifications.modifierActions[m.blueprint.special.edname]) {
if (!blueprint.features[feature] && !m.mods.feature) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
}
}
let components;
if (!m) {
components = [];
for (const component in blueprint.components) {
components.push(
<tr key={component}>
<td style={{ textAlign: 'left' }}>{translate(component)}</td>
<td style={{ textAlign: 'right' }}>{blueprint.components[component]}</td>
</tr>
);
}
}
let engineersList;
if (engineers) {
engineersList = [];
for (const engineer of engineers) {
engineersList.push(
<tr key={engineer}>
<td style={{ textAlign: 'left' }}>{engineer}</td>
</tr>
);
}
}
return ( return (
<div> <div>
@@ -219,87 +70,45 @@ export function blueprintTooltip(translate, blueprint, engineers, grp, m) {
<tr> <tr>
<td>{translate('feature')}</td> <td>{translate('feature')}</td>
<td>{translate('worst')}</td> <td>{translate('worst')}</td>
{m ? <td>{translate('current')}</td> : null } <td>{translate('current')}</td>
<td>{translate('best')}</td> <td>{translate('best')}</td>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{effects} {features.map((prop) => {
const { min, max, only } = bpFeatures[prop] || {};
// Skip this property if it doesn't apply to this module
if (only && !m.getItem().match(only)) {
return null;
}
const { value, unit, beneficial } = m.getModifierFormatted(prop);
if (!bpFeatures[prop] && !value) {
// Can happen for exported synthetics
return null;
}
// If the product of value and min/max is positive, both values
// point into the same direction, i.e. positive/negative.
const minBeneficial = (value * min) > 0 === beneficial;
const maxBeneficial = (value * max) > 0 === beneficial;
return (<tr key={prop}>
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
<td className={!min ? '' : minBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
{!isNaN(min) && formats.round(min * 100)}{!isNaN(min) && unit}
</td>
<td className={!value ? '' : beneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
{formats.round(value || 0)}{unit}
</td>
<td className={!max ? '' : maxBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
{!isNaN(max) && formats.round(max * 100)}{!isNaN(max) && unit}
</td>
</tr>);
})}
</tbody> </tbody>
</table> </table>
{ components ? <table width='100%'>
<thead>
<tr>
<td>{translate('component')}</td>
<td>{translate('amount')}</td>
</tr>
</thead>
<tbody>
{components}
</tbody>
</table> : null }
{ engineersList ? <table width='100%'>
<thead>
<tr>
<td>{translate('engineers')}</td>
</tr>
</thead>
<tbody>
{engineersList}
</tbody>
</table> : null }
</div> </div>
); );
} }
/**
* Is this blueprint feature beneficial?
* @param {string} feature The name of the feature
* @param {array} values The value of the feature
* @returns {boolean} True if this feature is beneficial
*/
export function isBeneficial(feature, values) {
const fact = (values[0] < 0 || (values[0] === 0 && values[1] < 0));
if (Modifications.modifications[feature].higherbetter) {
return !fact;
} else {
return fact;
}
}
/**
* Is this feature value beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature
* @returns {boolean} True if this value is beneficial
*/
export function isValueBeneficial(feature, value) {
if (Modifications.modifications[feature].higherbetter) {
return value > 0;
} else {
return value < 0;
}
}
/**
* Is the change as shown beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature as percentage change
* @returns True if the value is beneficial
*/
export function isChangeValueBeneficial(feature, value) {
let changeHigherBetter = STATS_FORMATTING[feature].higherbetter;
if (changeHigherBetter === undefined) {
return isValueBeneficial(feature, value);
}
if (changeHigherBetter) {
return value > 0;
} else {
return value < 0;
}
}
/** /**
* Get a blueprint with a given name and an optional module * Get a blueprint with a given name and an optional module
* @param {string} name The name of the blueprint * @param {string} name The name of the blueprint
@@ -316,120 +125,3 @@ export function getBlueprint(name, module) {
const blueprint = JSON.parse(JSON.stringify(found)); const blueprint = JSON.parse(JSON.stringify(found));
return blueprint; return blueprint;
} }
/**
* Provide 'percent' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
* @param {Number} percent The percent to set values to of full.
*/
export function setPercent(ship, m, percent) {
ship.clearModifications(m);
// Pick given value as multiplier
const mult = percent / 100;
const features = m.blueprint.grades[m.blueprint.grade].features;
for (const featureName in features) {
let value;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
} else {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
} else {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
}
}
_setValue(ship, m, featureName, value);
}
}
/**
* Provide 'random' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
*/
export function setRandom(ship, m) {
// Pick a single value for our randomness
setPercent(ship, m, Math.random() * 100);
}
/**
* Set a modification feature value
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
* @param {string} featureName The feature being set
* @param {number} value The value being set for the feature
*/
function _setValue(ship, m, featureName, value) {
if (Modifications.modifications[featureName].type == 'percentage') {
ship.setModification(m, featureName, value * 10000);
} else if (Modifications.modifications[featureName].type == 'numeric') {
ship.setModification(m, featureName, value * 100);
} else {
ship.setModification(m, featureName, value);
}
}
/**
* Provide 'percent' primary query
* @param {Object} m The module for which to perform the query
* @returns {Number} percent The percentage indicator of current applied values.
*/
export function getPercent(m) {
let result = null;
const features = m.blueprint.grades[m.blueprint.grade].features;
for (const featureName in features) {
if (features[featureName][0] === features[featureName][1]) {
continue;
}
let value = _getValue(m, featureName);
let mult;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
} else {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
} else {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
}
}
if (result && result != mult) {
return null;
} else if (result != mult) {
result = mult;
}
}
return result;
}
/**
* Query a feature value
* @param {Object} m The module for which to perform the query
* @param {string} featureName The feature being queried
* @returns {number} The value of the modification as a %
*/
function _getValue(m, featureName) {
if (Modifications.modifications[featureName].type == 'percentage') {
return m.getModValue(featureName, true) / 10000;
} else if (Modifications.modifications[featureName].type == 'numeric') {
return m.getModValue(featureName, true) / 100;
} else {
return m.getModValue(featureName, true);
}
}

View File

@@ -1,3 +1,4 @@
import { Module } from 'ed-forge';
/** /**
* Wraps the callback/context menu handler such that the default * Wraps the callback/context menu handler such that the default
@@ -83,3 +84,18 @@ export function isEmpty(obj) {
} }
return true; return true;
}; };
/**
* Fetches a property from either a Module or a moduleInfo object
* @param {Object} m Either a Module or a moduleInfo object
* @param {string} property Property name
* @returns {number} Property value
*/
export function moduleGet(m, property) {
if (m instanceof Module) {
return m.get(property);
} else {
// Assume its a moduleInfo object
return m.props[property];
}
}

View File

@@ -170,11 +170,8 @@ select {
list-style: none; list-style: none;
} }
&.hardpoint { .hardpoint {
.c {
width: 4.5em; width: 4.5em;
padding: 0.1em 0.2em; padding: 0.1em 0.2em;
} }
} }
}