Compare commits

..

55 Commits

Author SHA1 Message Date
Felix Linker
00d3a93b91 Re-design shipyard page
Closes #577
2021-05-09 20:09:15 +02:00
Felix Linker
d4e612cb61 Display module selection for alloys correctly
Closes #579
2021-05-09 18:42:37 +02:00
Felix Linker
c07cfc6e70 Don't round integers 2021-02-01 22:52:04 +01:00
Felix Linker
c4c6d32a5d Skip properties that do not apply to a module in blueprint tooltip 2021-02-01 22:41:41 +01:00
Felix Linker
a65bb06754 Implement tooltips for experimental effects 2021-02-01 22:40:01 +01:00
Felix Linker
23548e7c5c Remove redundant code 2021-02-01 22:14:22 +01:00
Felix Linker
74e6f54e19 Improve blueprint tooltips 2021-02-01 22:10:09 +01:00
Felix Linker
a46f8f97f6 Show blueprint grade in ascending order 2021-02-01 22:02:37 +01:00
Felix Linker
44dbdb1703 Don't show mass twice and allow to disable showing mass 2021-02-01 21:56:35 +01:00
Felix Linker
187c5dae4a Implement blueprint tooltips 2021-01-10 22:57:33 +01:00
Felix Linker
07d324a3fa Add key to property header in ModificationsMenu 2021-01-10 22:02:00 +01:00
Felix Linker
5c63afd96c Add stats mapper to show certain synthetic props in ModificationsMenu 2021-01-10 22:01:21 +01:00
Felix Linker
53c40ac9c4 Fix indentation 2021-01-10 21:59:22 +01:00
Felix Linker
a180cbfdd4 Fix: showProp is not required in <Modification> 2021-01-10 21:58:35 +01:00
Felix Linker
fc1524a943 Support non-percent modifiers 2021-01-03 12:32:01 +01:00
Felix Linker
c3747e4e5e Add toggle for properties in overview 2021-01-03 10:17:10 +01:00
Felix Linker
ab153981c9 Rework Modifictaions(Menu) 2021-01-02 10:59:58 +01:00
Felix Linker
a970e052c1 Update react-number-editor
Mitigates a bug where non-rounded numbers were shown to the user.
2021-01-02 10:55:16 +01:00
Felix Linker
df7e264a02 Use package-lock.json
Otherwise `npm audit` does not work.
2021-01-02 10:54:44 +01:00
Felix Linker
cdcda004f3 Implement units in modifications menu 2020-12-31 18:54:36 +01:00
Felix Linker
20e448fc0a Optimize constructors 2020-12-29 16:39:18 +01:00
Felix Linker
436e626c42 Group module selection by category 2020-12-29 16:37:28 +01:00
Felix Linker
3dd4675a0b Hide searchbar for core internal modules 2020-12-29 16:36:43 +01:00
Felix Linker
d3766d9e17 Migrate ed-forge API change 2020-12-29 13:18:57 +01:00
Felix Linker
d987c08ac8 Ship summary key for ship type is id 2020-12-29 12:23:23 +01:00
Felix Linker
f865ef6c6c Fix retrofit cost 2020-11-01 19:54:48 +01:00
Felix Linker
f2b7daac82 MovementProfile code includes pips for re-render on state change 2020-11-01 18:29:04 +01:00
Felix Linker
832bc488b6 Fix excluding modules from costs 2020-11-01 18:25:28 +01:00
Felix Linker
f513166d6c Rework boost button 2020-11-01 17:56:33 +01:00
Felix Linker
61fd0eb991 Rework profiles section 2020-11-01 16:01:53 +01:00
Felix Linker
1e51e7d4a6 Rework WeaponDamageChart 2020-11-01 15:58:28 +01:00
Felix Linker
4943d36bb8 Rework FSD profile 2020-11-01 02:59:37 +01:00
Felix Linker
9271d1fa09 Rework Movement graph 2020-11-01 02:32:52 +01:00
Felix Linker
8a09d94dfa Rework EngineProfile 2020-11-01 02:19:59 +01:00
Felix Linker
c44925dd62 Show normal speed in summary 2020-10-31 13:03:10 +01:00
Felix Linker
d006bbcb0f Handle no shield 2020-10-31 13:02:51 +01:00
Felix Linker
14453f6b80 Rework defence tab 2020-10-24 17:47:17 +02:00
felixlinker
8c267150a9 Rework Offence tab 2020-08-13 20:20:22 +02:00
felixlinker
ed60a78be0 Priority groups are zero indexed 2020-08-09 19:00:57 +02:00
felixlinker
82142b0cb1 Use Module.setEnabled in Power Management table 2020-08-09 19:00:45 +02:00
felixlinker
d8949fedb2 Rework PIP menu 2020-08-09 18:39:39 +02:00
felixlinker
cf72bd11a8 Replace manual bind(this) calls with auto-bind 2020-08-09 17:41:15 +02:00
Felix Linker
16ef7ea389 Rework cost section 2020-04-30 14:25:07 +02:00
Felix Linker
ff455e349e Implement coding standards 2020-04-16 15:22:07 +02:00
Felix Linker
ba9e7f1a32 Add code props variable as ship hash to update changes 2020-04-16 15:12:38 +02:00
Felix Linker
904498b20c Make power stats working 2020-04-15 19:59:50 +02:00
Felix Linker
409be7374c Make outfitting page working 2020-04-10 13:19:53 +02:00
Felix Linker
00c525e6ab Update shipyard-page to ed-forge 2020-04-10 12:50:56 +02:00
felixlinker
a2f52c03a1 Move hardpoint class for module selection into leaves of HTML tree 2019-10-10 18:18:18 +02:00
felixlinker
037df6b166 Remove InternalSlot component 2019-10-10 16:42:14 +02:00
felixlinker
90ab5b4b0a Remove component HardpointSlot 2019-10-10 16:30:51 +02:00
felixlinker
7bbfa8c43f Remove component StandardSlot 2019-10-10 16:11:54 +02:00
felixlinker
2fbcd158cc Rewrite ModificationsMenu 2019-10-10 16:06:41 +02:00
felixlinker
33c201800e Rewrite AvailableModulesMenu.jsx 2019-10-08 22:53:31 +02:00
Felix Linker
9797a8d781 First steps towards ed-forge rewrite 2019-10-08 15:02:16 +02:00
109 changed files with 28028 additions and 19883 deletions

View File

@@ -7,8 +7,6 @@
"@babel/plugin-syntax-dynamic-import", "@babel/plugin-syntax-dynamic-import",
"@babel/plugin-syntax-import-meta", "@babel/plugin-syntax-import-meta",
["@babel/plugin-proposal-class-properties", { "loose": true }], ["@babel/plugin-proposal-class-properties", { "loose": true }],
"@babel/plugin-proposal-do-expressions",
"@babel/plugin-proposal-function-bind",
"@babel/plugin-proposal-json-strings", "@babel/plugin-proposal-json-strings",
[ [
"@babel/plugin-proposal-decorators", "@babel/plugin-proposal-decorators",
@@ -30,7 +28,7 @@
} }
], ],
"@babel/plugin-proposal-nullish-coalescing-operator", "@babel/plugin-proposal-nullish-coalescing-operator",
["@babel/plugin-proposal-private-methods", { "loose": true }], "@babel/plugin-proposal-do-expressions",
["@babel/plugin-proposal-private-property-in-object", { "loose": true }] "@babel/plugin-proposal-function-bind"
] ]
} }

View File

@@ -1,7 +1,77 @@
Dockerfile
.dockerignore
.gitignore
README.md
build
node_modules node_modules
npm-debug.log
### Node template
# Logs
logs
*.log
npm-debug.log*
yarn-debug.log*
yarn-error.log*
# Runtime data
pids
*.pid
*.seed
*.pid.lock
# Directory for instrumented libs generated by jscoverage/JSCover
lib-cov
# Coverage directory used by tools like istanbul
coverage
# nyc test coverage
.nyc_output
# Grunt intermediate storage (http://gruntjs.com/creating-plugins#storing-task-files)
.grunt
# Bower dependency directory (https://bower.io/)
bower_components
# node-waf configuration
.lock-wscript
# Compiled binary addons (https://nodejs.org/api/addons.html)
build/Release
# Dependency directories
node_modules/
jspm_packages/
# TypeScript v1 declaration files
typings/
# Optional npm cache directory
.npm
# Optional eslint cache
.eslintcache
# Optional REPL history
.node_repl_history
# Output of 'npm pack'
*.tgz
# Yarn Integrity file
.yarn-integrity
# dotenv environment variables file
.env
# parcel-bundler cache (https://parceljs.org/)
.cache
# next.js build output
.next
# nuxt.js build output
.nuxt
# vuepress build output
.vuepress/dist
# Serverless directories
.serverless

14
.gitattributes vendored
View File

@@ -1,14 +0,0 @@
# Set the default behavior, in case people don't have core.autocrlf set, in order to prevent line ending inconsistency.
* text=auto
# Explicitly declare text files you want to always be normalized and converted
# to native line endings on checkout.
*.jsx text
*.js text
# Declare files that will always have CRLF line endings on checkout.
# *.sln text eol=crlf
# Denote all files that are truly binary and should not be modified.
*.png binary
*.jpg binary

1
.github/FUNDING.yml vendored
View File

@@ -1 +0,0 @@
github: # Replace with up to 4 GitHub Sponsors-enabled usernames e.g., [Brighter-Applications]

13
.gitlab-ci.yml Normal file
View File

@@ -0,0 +1,13 @@
image: docker:stable
services:
- docker:dind
stages:
- Build image
docker build:
stage: Build image
script:
- img build --build-arg branch=$CI_COMMIT_REF_NAME -t edcd/coriolis:$CI_COMMIT_REF_NAME .
- echo "$REGISTRY_PASSWORD" | img login --username "$REGISTRY_USER" --password-stdin
- img push edcd/coriolis:$CI_COMMIT_REF_NAME

16
.travis.yml Normal file
View File

@@ -0,0 +1,16 @@
language: node_js
notifications:
email: false
sudo: false
node_js:
- "4.8.1"
cache:
directories:
- node_modules
before_install:
- git clone https://github.com/EDCD/coriolis-data.git ../coriolis-data
script:
- npm run lint
- npm test

View File

@@ -1,25 +1,35 @@
#syntax=docker/dockerfile:1.4 ### STAGE 1: Build ###
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed. FROM node:9.11.1-alpine as builder
# docker buildx build --build-context data=../coriolis-data --tag coriolis . ARG branch=develop
ENV BRANCH=$branch
WORKDIR /src/app
RUN mkdir -p /src/app/coriolis
RUN mkdir -p /src/app/coriolis-data
FROM node:18-alpine RUN apk add --update git
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source. COPY . /src/app/coriolis
WORKDIR /app
ADD . .
COPY --from=data . /coriolis-data/
# Git is required before install if any modules (like coriolis-data) are loaded from github RUN npm i -g npm
RUN apk update
RUN apk add git
WORKDIR /app/coriolis-data # Set up coriolis-data
RUN npm install WORKDIR /src/app/coriolis-data
WORKDIR /app RUN git clone https://github.com/EDCD/coriolis-data.git .
RUN npm install RUN git checkout ${BRANCH}
# Bundle for production config with webpack & log RUN npm install --no-package-lock
RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2) RUN npm start
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server. # Set up coriolis
CMD ["npm", "start"] WORKDIR /src/app/coriolis
EXPOSE 3300 RUN git checkout ${BRANCH}
RUN npm install --no-package-lock
RUN npm run build
### STAGE 2: Production Environment ###
FROM fholzer/nginx-brotli as web
COPY nginx.conf /etc/nginx/nginx.conf
COPY --from=builder /src/app/coriolis/build /usr/share/nginx/html
WORKDIR /usr/share/nginx/html
EXPOSE 80
CMD ["nginx", "-c", "/etc/nginx/nginx.conf", "-g", "daemon off;"]

View File

@@ -1,23 +0,0 @@
#syntax=docker/dockerfile:1.4
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
# docker buildx build --build-context data=../coriolis-data --tag coriolis -f ./Dockerfile-dev .
FROM node:18-alpine
WORKDIR /app
ADD . .
COPY --from=data . /coriolis-data/
# Install git & any other desired in-container dev tools
# Git is required before install if any modules (like coriolis-data) are loaded from github
RUN apk update
RUN apk add git
WORKDIR /app/coriolis-data
RUN npm install
WORKDIR /app
RUN npm install
CMD ["npm", "start"]
EXPOSE 3300

View File

@@ -1,32 +0,0 @@
#syntax=docker/dockerfile:1.4
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
# docker buildx build --build-context data=../coriolis-data --tag coriolis:0.0.7-local-prod -f Dockerfile-local-prod .
# docker run -d -p 80:8080 coriolis:0.0.7-local-prod
FROM node:18-alpine
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source.
WORKDIR /app
ADD . .
# COPY --from=data . /coriolis-data/
# Git is required before install if any modules (like coriolis-data is now referenced in the package.json) are loaded from github
RUN apk update
RUN apk add git
# WORKDIR /app/coriolis-data
# RUN npm install
# WORKDIR /app
# RUN npm install
# Bundle for production config with webpack & log
# In this version of the dockerfile, I'm deferring automated webpack build so I can monitor a manual build
# RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)
RUN npm install -g http-server
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server.
# CMD ["http-server", "/app/build", "-c-1"]
CMD ["/bin/ash"]
# CMD [""]
EXPOSE 8080

View File

@@ -1,57 +1,60 @@
[![Chat to us on Discord](https://img.shields.io/badge/Discord-EDCD%20%23coriolis-blue.svg?style=social)](https://discord.gg/0uwCh6R62aPRjk9w) ![Latest Release](https://img.shields.io/github/release/EDCD/coriolis.svg) [![Build Status](https://travis-ci.org/EDCD/coriolis.svg?branch=master)](https://travis-ci.org/EDCD/coriolis) [![Chat to us on Discord](https://img.shields.io/badge/Discord-EDCD%20%23coriolis-blue.svg?style=social)](https://discord.gg/0uwCh6R62aPRjk9w)
## About ## About
The Coriolis project was inspired by E:D Shipyard and, of course, [Elite Dangerous](http://www.elitedangerous.com). The ultimate goal of Coriolis is to provide rich features to support in-game play and planning while engaging the E:D community to support its development. The Coriolis project was inspired by [E:D Shipyard](http://www.edshipyard.com/) and, of course, [Elite Dangerous](http://www.elitedangerous.com). The ultimate goal of Coriolis is to provide rich features to support in-game play and planning while engaging the E:D community to support its development.
Coriolis was created using assets and imagery from Elite: Dangerous, with the permission of Frontier Developments plc, for non-commercial purposes. It is not endorsed by nor reflects the views or opinions of Frontier Developments and no employee of Frontier Developments was involved in the making of it. Coriolis was created using assets and imagery from Elite: Dangerous, with the permission of Frontier Developments plc, for non-commercial purposes. It is not endorsed by nor reflects the views or opinions of Frontier Developments and no employee of Frontier Developments was involved in the making of it.
## Contributing ## Contributing
- [Submit issues](https://github.com/EDCD/coriolis/issues) Please [submit issues](https://github.com/EDCD/coriolis/issues), or better yet [pull requests](https://github.com/EDCD/coriolis/pulls) for any corrections or additions to the database or the code.
- [Submit pull requests](https://github.com/EDCD/coriolis/pulls) targetting `develop` branch
- Chat to us on [Discord](https://discord.gg/0uwCh6R62aPRjk9w)! ### Translations
Please use the OneSky translation site to suggest new translations: http://edcd-coriolis.oneskyapp.com
These will be merged regularly by the project manager.
### Feature Requests, Suggestions & Bugs
Chat to us on [Discord](https://discord.gg/0uwCh6R62aPRjk9w)!
## Development ## Development
This release includes the ability to run the app as a Docker container. See the [Developer's Guide](https://github.com/EDCD/coriolis/wiki/Developing-for-Coriolis) in the wiki.
```sh
> git clone https://github.com/EDCD/coriolis.git
> git clone https://github.com/EDCD/coriolis-data.git
> cd coriolis
> docker buildx build --build-context data=../coriolis-data --tag coriolis .
> docker run -d -p 3300:3300 coriolis
```
Or to run an instance of coriolis without Docker Desktop, perform the following steps in a shell: Also see [the documentation site.](https://coriolis.willb.info/)
```sh
> git clone https://github.com/EDCD/coriolis.git
> git clone https://github.com/EDCD/coriolis-data.git
> cd ./coriolis-data
> npm install
> cd ../coriolis
> npm install
> npm start
```
You will then have a development server running on `localhost:3300`.
### Ship and Module Database ### Ship and Module Database
See the [Data wiki](https://github.com/EDCD/coriolis-data/wiki) for details on structure, etc. See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc.
## Deployment You can find hosted and compiled versions of these data-jsons under https://coriolis.io/data/ and https://beta.coriolis.io/data/.
You might want to load these as depedency instead of reyling on the npm-dependency.
Follow the steps for [Development](#development) as above, but instead ## License
of `npm start` you'll want to:
```sh All Data and [associated JSON](https://github.com/EDCD/coriolis-data) files are intellectual property and copyright of Frontier Developments plc ('Frontier', 'Frontier Developments') and are subject to their
> npm run build [terms and conditions](https://www.frontierstore.net/terms-and-conditions/).
```
this will result in a `build/` directory being created containing all the necessary files. The code (Javascript, CSS, HTML, and SVG files only) specificially for Coriolis.io is released under the MIT License.
After this you need to serve the files in some manner. Copyright (c) 2015 Coriolis.io, Colin McLeod
Either configure your webserver to make the actual `build/` directory
visible on the web, or alternatively copy it to somewhere to serve it Permission is hereby granted, free of charge, to any person obtaining a copy
from. of this software (Javascript, CSS, HTML, and SVG files only), and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in
all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
THE SOFTWARE.

View File

@@ -1,50 +1,50 @@
{ {
"type_6_transporter": { "type_6_transporter": {
"Cargo": "A0p0tdFal8d8s8f4-----04040303430101-.Iw18UA==.Aw18UA==.", "Cargo": "A0p0tdFal8d8s8f4-----04040303430101.Iw1/kA==.Aw1/kA==.",
"Miner": "A0p5tdFal8d8s8f42l2l---040403451q0101-.Iw18UA==.Aw18UA==.", "Miner": "A0p5tdFal8d8s8f42l2l---040403451q0101.Iw1/kA==.Aw1/kA==.",
"Hopper": "A0p0tdFal8d0s8f41717---030302024300--.Iw18UA==.Aw18UA==." "Hopper": "A0p0tdFal8d0s8f41717---030302024300-.Iw1/kA==.Aw1/kA==."
}, },
"type_7_transport": { "type_7_transport": {
"Cargo": "A0p0tiFfliddsdf5--------0505040403480101--.Iw18eQ==.Aw18eQ==.", "Cargo": "A0p0tiFfliddsdf5--------0505040403480101.Iw18aQ==.Aw18aQ==.",
"Miner": "A0pdtiFflid8sdf5--2l2l----0505041v03450000--.Iw18eQ==.Aw18eQ==." "Miner": "A0pdtiFflid8sdf5--2l2l----0505041v03450000.Iw18aQ==.Aw18aQ==."
}, },
"federal_dropship": { "federal_dropship": {
"Cargo": "A0pdtiFflnddsif4-1717------05040448--020201-.Iw18RQ==.Aw18RQ==." "Cargo": "A0pdtiFflnddsif4-1717------05040448--020201.Iw18eQ==.Aw18eQ==."
}, },
"asp": { "asp": {
"Miner": "A2pftfFflidfskf50s0s24242l2l---04054a1q02022o27-.Iw18eQ==.Aw18eQ==." "Miner": "A2pftfFflidfskf50s0s24242l2l---04054a1q02022o27.Iw18WQ==.Aw18WQ==."
}, },
"imperial_clipper": { "imperial_clipper": {
"Cargo": "A0p5tiFflndisnf4--0s0s----0605450302020101-.Iw18WQ==.Aw18WQ==.", "Cargo": "A0p5tiFflndisnf4--0s0s----0605450302020101.Iw18aQ==.Aw18aQ==.",
"Dream": "A2pktkFflndpskf40v0v0s0s0404040n4k5n5d2b29292o--.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA.", "Dream": "A2pktkFflndpskf40v0v0s0s0404040n4k5n5d2b29292o-.AwRj4yWU1I==.CwBhCYy6YRigzLIA.",
"Current": "A0patkFflndfskf4-----------------.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA." "Current": "A0patkFflndfskf4----------------.AwRj4yWU1I==.CwBhCYy6YRigzLIA."
}, },
"type_9_heavy": { "type_9_heavy": {
"Current": "A0patsFklndnsif6---------0706054a0303020224--.AwRj4yo5iA==.EwBhEYy6d6g=." "Current": "A0patsFklndnsif6---------0706054a0303020224.AwRj4yoo.EwBhEYy6dsg=."
}, },
"python": { "python": {
"Cargo": "A0patnFflidsssf5---------050505040448020201-.Iw18eAMQ.Aw18RQ==.", "Cargo": "A0patnFflidsssf5---------050505040448020201.Iw18eQ==.Aw18eQ==.",
"Miner": "A0pktkFflidpspf50v0v0v2m2m0404--050505Ce4a1v02022o-.Iw18eAMQ.IwBhBYy6dkCYRA==.", "Miner": "A0pktkFflidpspf50v0v0v2m2m0404--050505Ce4a1v02022o.Iw18eQ==.IwBhBYy6dkCYg===.",
"Dream": "A2pptkFfliduspf50v0v0v27270404040m5n5n4f2d2d032t0201-.Iw1+gDByUA==.EwBhEYy6e0VEA===.", "Dream": "A2pptkFfliduspf50v0v0v27270404040m5n5n4f2d2d032t0201.Iw1+gDBxA===.EwBhEYy6e0WEA===.",
"Missile": "A0pttoFjljdystf52f2g2d2ePh----04044j03---00--.Iw18eAMQ.Aw18RQ==." "Missile": "A0pttoFjljdystf52f2g2d2ePh----04044j03---002h.Iw18eQ==.Aw18eQ==."
}, },
"anaconda": { "anaconda": {
"Dream": "A4putpFklndzsuf52c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d04-0303326b-.AwRj4yo5dzhA.MwBhCYy6duvARhEA.", "Dream": "A4putpFklndzsuf52c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d04-0303326b.AwRj4yo5dyg=.MwBhCYy6duvARiA=.",
"Cargo": "A0patnFklndnsxf5----------------06050505040404-45030301-.Iw18ZUAxA===.Aw18ZXEA.", "Cargo": "A0patnFklndnsxf5----------------06050505040404-45030301.Iw18ZVA=.Aw18ZVA=.",
"Current": "A0patnFklndksxf5----------------06050505040404-03034524-.Iw18ZUAxA===.Aw18ZXEA.", "Current": "A0patnFklndksxf5----------------06050505040404-03034524.Iw18ZVA=.Aw18ZVA=.",
"Explorer": "A0patnFklndksxf5--------0202------f7050505040s37--2i4524-.AwRj4yVKJ9jCA===.AwhMIyumQRgkA===.", "Explorer": "A0patnFklndksxf5--------0202------f7050505040s37-2f2i4524.AwRj4yVKJ9hA.AwhMIyumQRhEA===.",
"Test": "A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.Iw18ZUAxA===.Aw18ZXEA." "Test": "A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b.Iw18ZVA=.Aw18ZVA=."
}, },
"diamondback_explorer": { "diamondback_explorer": {
"Explorer": "A0p0tdFfldddsdf5---0202--320p432i----.AwRj4zTZaA==.AwiMIyqo." "Explorer": "A0p0tdFfldddsdf5---0202--320p432i2f-.AwRj4zTYg===.AwiMIyoo."
}, },
"vulture": { "vulture": {
"Bounty Hunter": "A3patcFalddksff31e1e0404-0l4a-5d27662j--.AwRj4z2Gg===.MwBhBYy6oJmAjLMQ." "Bounty Hunter": "A3patcFalddksff31e1e0404-0l4a-5d27662j.AwRj4z2I.MwBhBYy6oJmAjLIA."
}, },
"fer_de_lance": { "fer_de_lance": {
"Attack": "A2pfthFalidpsff31r0s0s0s0s000404-04-4a-5d27--.Iw18aAMQ.CwBhrSu8EZxEA===." "Attack": "A2pfthFalidpsff31r0s0s0s0s000404-04-4a-5d27-.Iw18aQ==.CwBhrSu8EZyA."
}, },
"eagle": { "eagle": {
"Figther": "A4p0t5F5l3d5s5f20p0p24-4053-2j---.Iw18gDJQ.Aw19kA==." "Figther": "A4p0t5F5l3d5s5f20p0p24-4053-2j-.Iw18kA==.Aw18kA==."
} }
} }

View File

@@ -1,366 +0,0 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
},
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "diamondbackxl",
"ShipID": 11,
"ShipName": "star Hopper",
"ShipIdent": "PH-02",
"HullValue": 1615649,
"ModulesValue": 16981039,
"Rebuy": 929837,
"Modules": [
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true,
"Value": 3072
},
{
"Slot": "slot01_size4",
"Item": "int_fuelscoop_size4_class5",
"On": true,
"Priority": 3,
"Value": 2862364
},
{
"Slot": "slot02_size4",
"Item": "int_guardianfsdbooster_size4",
"On": true,
"Value": 2847499
},
{
"Slot": "slot03_size3",
"Item": "int_shieldgenerator_size3_class2",
"On": true,
"Value": 18812,
"Engineering": {
"BlueprintName": "shieldgenerator_thermic",
"Level": 3,
"Quality": 1,
"ExperimentalEffect": "special_shield_health"
}
},
{
"Slot": "slot04_size3",
"Item": "int_repairer_size3_class5",
"On": true,
"Value": 2302911
},
{
"Slot": "slot05_size2",
"Item": "int_buggybay_size2_class2",
"On": true,
"Priority": 3,
"Value": 21600
},
{
"Slot": "slot06_size2",
"Item": "int_cargorack_size2_class1",
"On": true,
"Priority": 1,
"Value": 2852
},
{
"Slot": "slot07_size1",
"Item": "int_supercruiseassist",
"On": true,
"Priority": 3,
"Value": 9121
},
{
"Slot": "slot08_size1",
"Item": "int_detailedsurfacescanner_tiny",
"On": true,
"Value": 250000,
"Engineering": {
"BlueprintName": "sensor_expanded",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size4_class5",
"On": true,
"Priority": 1,
"Value": 1441233,
"Engineering": {
"BlueprintName": "powerplant_boosted",
"Level": 1,
"Quality": 1
}
},
{
"Slot": "mainengines",
"Item": "int_engine_size4_class5",
"On": true,
"Value": 1610080,
"Engineering": {
"BlueprintName": "engine_dirty",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_engine_lightweight"
}
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Value": 5103953,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_fsd_lightweight"
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "misc_lightweight",
"Level": 3,
"Quality": 1
}
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size4_class5",
"On": true,
"Value": 389022,
"Engineering": {
"BlueprintName": "powerdistributor_highfrequency",
"Level": 4,
"Quality": 1
}
},
{
"Slot": "radar",
"Item": "int_sensors_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "sensor_lightweight",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1,
"Value": 97754
},
{
"Slot": "armour",
"Item": "diamondbackxl_armour_grade1",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -1,8 +0,0 @@
{
"krait_mkii": {
"Imported pancake hammer": "A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ==.AwRgzKIkA===."
},
"diamondback_explorer": {
"Imported star Hopper": "A0pataFflddfsdf5---02---321P430iv6013w2i.Iw18SQ==.AwRm44GYpKg=."
}
}

View File

@@ -1,188 +0,0 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -18,13 +18,13 @@ describe('Import Modal', function() {
const mockContext = { const mockContext = {
language: getLanguage('en'), language: getLanguage('en'),
sizeRatio: 1, sizeRatio: 1,
openMenu: jest.fn(), openMenu: jest.genMockFunction(),
closeMenu: jest.fn(), closeMenu: jest.genMockFunction(),
showModal: jest.fn(), showModal: jest.genMockFunction(),
hideModal: jest.fn(), hideModal: jest.genMockFunction(),
tooltip: jest.fn(), tooltip: jest.genMockFunction(),
termtip: jest.fn(), termtip: jest.genMockFunction(),
onWindowResize: jest.fn() onWindowResize: jest.genMockFunction()
}; };
let modal, render, ContextProvider = Utils.createContextProvider(mockContext); let modal, render, ContextProvider = Utils.createContextProvider(mockContext);
@@ -110,25 +110,21 @@ describe('Import Modal', function() {
it('catches an invalid backup', function() { it('catches an invalid backup', function() {
const importData = require('./fixtures/valid-backup'); const importData = require('./fixtures/valid-backup');
let invalidImportData = Object.assign({}, importData); let invalidImportData = Object.assign({}, importData);
// Remove Asp Miner build used in comparison //invalidImportData.builds.asp = null; // Remove Asp Miner build used in comparison
delete(invalidImportData.builds.asp); delete(invalidImportData.builds.asp);
pasteText('"this is not valid"'); pasteText('"this is not valid"');
expect(modal.state.importValid).toBeFalsy(); expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('Must be an object or array!'); expect(modal.state.errorMsg).toEqual('Must be an object or array!');
pasteText('{ "builds": "Should not be a string" }'); pasteText('{ "builds": "Should not be a string" }');
expect(modal.state.importValid).toBeFalsy(); expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('builds must be an object!'); expect(modal.state.errorMsg).toEqual('builds must be an object!');
pasteText(JSON.stringify(importData).replace('anaconda', 'invalid_ship'));
pasteText(JSON.stringify(importData).replace(/anaconda/g, 'invalid_ship'));
expect(modal.state.importValid).toBeFalsy(); expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds)).not.toContain('anaconda'); expect(modal.state.errorMsg).toEqual('"invalid_ship" is not a valid Ship Id!');
pasteText(JSON.stringify(importData).replace('Dream', '')); pasteText(JSON.stringify(importData).replace('Dream', ''));
expect(modal.state.importValid).toBeFalsy(); expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds.imperial_clipper).length).toEqual(3); expect(modal.state.errorMsg).toEqual('Imperial Clipper build "" must be a string at least 1 character long!');
pasteText(JSON.stringify(invalidImportData)); pasteText(JSON.stringify(invalidImportData));
expect(modal.state.importValid).toBeFalsy(); expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('asp build "Miner" data is missing!'); expect(modal.state.errorMsg).toEqual('asp build "Miner" data is missing!');
@@ -148,7 +144,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.&bn=Test%20My%20Ship'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b.AwRj4zNLaA%3D%3D.CwBhCYzBGW9qCTSqq5xA.&bn=Test%20My%20Ship');
}); });
it('catches an invalid build', function() { it('catches an invalid build', function() {
@@ -173,7 +169,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.H4sIAAAAAAAAE2MUe8HMwPD%2FPwMAAGvB0AkAAAA%3D&bn=Test%20My%20Ship'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b.AwRj4zNLaA%3D%3D.CwBhCYzBGW9qCTSqq5xA.H4sIAAAAAAAAA2MUe8HMwPD%2FPwMAAGvB0AkAAAA%3D&bn=Test%20My%20Ship');
}); });
}); });
@@ -190,7 +186,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/asp?code=A0pftiFflfddsnf5------020202033c044002v6-2i-.AwRj4yvYg%3D%3D%3D.CwRgDBldHn5A.H4sIAAAAAAAAE2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FA7kMAExxqlSAAAAA&bn=Multi-purpose%20Asp%20Explorer'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/asp?code=A0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FA7kMAExxqlSAAAAA&bn=Multi-purpose%20Asp%20Explorer');
}); });
it('imports a valid v4 build with modifications', function() { it('imports a valid v4 build with modifications', function() {
@@ -202,11 +198,11 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/imperial_courier?code=A0patzF5l0das8f31a1a270202000e402t0101----.AwRj4zOYg%3D%3D%3D.CwRgDBldLuZA.H4sIAAAAAAAAE12OPUvDYBSFT1OTfkRJjUkbbC3Yj8mlODgUISAtdOlety5ODv0Vgji7O7kJ%2FgzBQX%2BEY7Gg0NKhfY%2FnHQLFDBdynufe9%2BRMCmCb06g29oCgacjiRx6gY6oWKUT8UgLaszqQfHmSnpVFN1uSeXNsJVcj%2FA2EHlZkspIUpUc6UjTXGT85qwHuSEuVc%2F16r99kDQeSSjvSbSjpyUpNK10uJJ3aYqk6smwm1lQ9bOxw71TMm8VanEqq9JW1r3Qo%2BREOLnQHvbWmb7rZIu5VLIyGQGOukPv%2F0WQk5LeEAjPOUDwtAP6bShy2HKAz0HPO%2B5KsP25I79O2I7LvD%2Bz4Il1XAQAA&bn=Multi-purpose%20Imperial%20Courier'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/imperial_courier?code=A0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ%3D.H4sIAAAAAAAAA12OPUvDYBSFT1OTfkRJjUkbbC3Yj8mlODgUISAtdOlety5ODv0Vgji7O7kJ%2FgzBQX%2BEY7Gg0NKhfY%2FnHQLFDBdynufe9%2BRMCmCb06g29oCgacjiRx6gY6oWKUT8UgLaszqQfHmSnpVFN1uSeXNsJVcj%2FA2EHlZkspIUpUc6UjTXGT85qwHuSEuVc%2F16r99kDQeSSjvSbSjpyUpNK10uJJ3aYqk6smwm1lQ9bOxw71TMm8VanEqq9JW1r3Qo%2BREOLnQHvbWmb7rZIu5VLIyGQGOukPv%2F0WQk5LeEAjPOUDwtAP6bShy2HKAz0HPO%2B5KsP25I79O2I7LvD%2Bz4Il1XAQAA&bn=Multi-purpose%20Imperial%20Courier');
}); });
}); });
describe('Import Detailed Builds Array', function() { describe('Import Detaild Builds Array', function() {
beforeEach(reset); beforeEach(reset);
@@ -244,7 +240,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/federal_corvette?code=A2putsFklndzsxf50x0x7l28281919040404040402020l06p05sf63c5ifr--v66g--.AwRj4zNapI%3D%3D.CwRgDBldUExuBiIlWIA%3D.&bn=Imported%20Federal%20Corvette'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/federal_corvette?code=A2putsFklndzsxf50x0x7l28281919040404040402020l06p05sf63c5ifr--v66g2f.AwRj4zNaqA%3D%3D.CwRgDBldUExuBiIlUA%3D%3D.H4sIAAAAAAAAA12STy8DURTFb1szU53Ga8dg2qqqDmJDIoKFxJImumYjVrVqfAALC4lNbcUnkLCoDbEQu0bSlQVhI8JHsJBIQ73rXMkwMYuT9%2Bb87nl%2F7ovoRSL6ikD6TYNINZg5XsWUo7pfrBikr2USlRyXyDuLAhr6ZHanNLOzD5tjOiskysk5dOBvfTB7bjeRW0MNG3ohSBq1bKKxKwyLLUAjmwjpPu4wJx4xVbNI57heDfbUKUAy2xaRUQZpllHoHMHxKqjhhF4LgjtJiFHDmqbrEeVnUJOax7%2FSdRfRwBNotv9wo5kAuZMD2egKyDYcdYl1OBki6z%2BZQjaFnBPyFCM1LefF%2BcgrY0es9FKwbW8ZYj9gmBbxRVRdglMh6BNqnwsk4ouoO4HSIehNoBuBRHwR1QOmsBvHmk6IfMbd2fdCEka%2BjNSexPWGoEkcyX6CnxbxRZQtd%2BPpym%2B31xFtn0iSFPkf%2BBkttZlzB9KDFyBuFRfAGV0Ogoff8SSsCfjjD5hGWtLIwZB%2FgX5Zt%2BLHMI9My7sp6nzgZzekswTxVvCOkq%2FSXqb%2F3zfLxh6HrwIAAA%3D%3D&bn=Imported%20Federal%20Corvette');
}); });
it('imports a valid companion API build', function() { it('imports a valid companion API build', function() {
@@ -256,7 +252,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/beluga?code=A0pktsFplCdpsnf70t0t2727270004040404043c4fmimlmm04mc0iv62i--.AwRj4yusg%3D%3D%3D.CwRgDBldHi8IWIA%3D.&bn=Imported%20Beluga%20Liner'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/beluga?code=A0pktsFplCdpsnf70t0t2727270004040404043c4fmimlmm04mc0iv62i2f.AwRj4yukg%3D%3D%3D.CwRgDBldHi8IUA%3D%3D.H4sIAAAAAAAAA2P8Z8%2FAwPCXEUiIKTMxMPCv%2F%2Ff%2FP8cFIPGf6Z8YTEr0GjMDg%2FJWICERBOTzn%2Fn7%2F7%2FIO5Ai5n9SIEWsQEIoSxAolfbt%2F3%2BJPk4GBhE7YQYGYVmgcuVnf4Aq%2FwOVAAAyiFctbgAAAA%3D%3D&bn=Imported%20Beluga%20Liner');
}); });
it('imports a valid companion API build', function() { it('imports a valid companion API build', function() {
@@ -268,7 +264,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/type_7_transport?code=A0patfFflidasdf5----0404040005050504044d2402--.AwRj4yoo.CwRgDBlVK7HjEA%3D%3D.&bn=Imported%20Type-7%20Transporter'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/type_7_transport?code=A0patfFflidasdf5----0404040005050504044d2402.AwRj4yrI.CwRgDBlVK7EiA%3D%3D%3D.&bn=Imported%20Type-7%20Transporter');
}); });
it('imports a valid companion API build', function() { it('imports a valid companion API build', function() {
@@ -280,7 +276,7 @@ describe('Import Modal', function() {
expect(modal.state.singleBuild).toBe(true); expect(modal.state.singleBuild).toBe(true);
clickProceed(); clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1); expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/cobra_mk_iii?code=A0p0tdFaldd3sdf4------34----2i--.AwRj4yqA.CwRgDMYExrezBig%3D.&bn=Imported%20Cobra%20Mk%20III'); expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/cobra_mk_iii?code=A0p0tdFaldd3sdf4------34---2f2i.AwRj4yKA.CwRgDMYExrezBUg%3D.&bn=Imported%20Cobra%20Mk%20III');
}); });
}); });
@@ -328,41 +324,4 @@ describe('Import Modal', function() {
}); });
}); });
describe('Imports SLEF data', () => {
beforeEach(reset);
it('imports a single valid SLEF build', () => {
const importData = require('./fixtures/slef-single-build.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/krait_mkii?code=A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ%3D%3D.AwRgzKIkA%3D%3D%3D.&bn=Imported%20pancake%20hammer');
});
it('imports multiple SLEF builds', () => {
const importData = require('./fixtures/slef-multiple-builds.json');
const expectedBuilds = require('./fixtures/slef-multiple-expected-builds.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(false);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
const builds = Persist.getBuilds();
for (const shipModel in builds) {
for (const buildName in builds[shipModel]) {
expect(builds[shipModel][buildName])
.toEqual(expectedBuilds[shipModel][buildName]);
}
}
});
});
}); });

View File

@@ -3,13 +3,24 @@ var WebpackDevServer = require("webpack-dev-server");
var config = require('./webpack.config.dev'); var config = require('./webpack.config.dev');
new WebpackDevServer(webpack(config), { new WebpackDevServer(webpack(config), {
publicPath: config.output.publicPath,
hot: true, hot: true,
disableHostCheck: true,
headers: { "Access-Control-Allow-Origin": "*" }, headers: { "Access-Control-Allow-Origin": "*" },
historyApiFallback: { historyApiFallback: {
rewrites: [ rewrites: [
// For some reason connect-history-api-fallback does not allow '.' in the URL for history fallback... // For some reason connect-history-api-fallback does not allow '.' in the URL for history fallback...
{ from: /\/outfit\//, to: '/index.html' } { from: /\/outfit\//, to: '/index.html' }
] ]
},
stats: {
assets: true,
colors: true,
version: false,
hash: false,
timings: true,
chunks: false,
chunkModules: false
} }
}).listen(3300, "0.0.0.0", function (err, result) { }).listen(3300, "0.0.0.0", function (err, result) {
if (err) { if (err) {

56
docker-compose.yml Normal file
View File

@@ -0,0 +1,56 @@
version: '2.2'
services:
coriolis_prod:
image: edcd/coriolis:master
build:
dockerfile: Dockerfile
args:
branch: master
restart: always
volumes:
- ./nginx.conf:/etc/nginx/nginx.conf
networks:
- web
labels:
- "traefik.docker.network=web"
- "traefik.enable=true"
- "traefik.basic.frontend.rule=Host:coriolis.io,coriolis.edcd.io"
- "traefik.basic.port=80"
- "traefik.basic.protocol=http"
coriolis_dev:
image: edcd/coriolis:develop
build:
dockerfile: Dockerfile
args:
branch: develop
restart: always
volumes:
- ./nginx.conf:/etc/nginx/nginx.conf
networks:
- web
labels:
- "traefik.docker.network=web"
- "traefik.enable=true"
- "traefik.basic.frontend.rule=Host:beta.coriolis.io,beta.coriolis.edcd.io"
- "traefik.basic.port=80"
- "traefik.basic.protocol=http"
coriolis_dw2:
image: edcd/coriolis:dw2
restart: always
volumes:
- ./nginx.conf:/etc/nginx/nginx.conf
networks:
- web
labels:
- "traefik.docker.network=web"
- "traefik.enable=true"
- "traefik.basic.frontend.rule=Host:dw2.coriolis.io"
- "traefik.basic.port=80"
- "traefik.basic.protocol=http"
networks:
web:
external: true

96
nginx.conf Normal file
View File

@@ -0,0 +1,96 @@
worker_processes 1;
user nobody nobody;
error_log /tmp/error.log;
pid /tmp/nginx.pid;
events {
worker_connections 1024;
}
http {
include /etc/nginx/mime.types;
default_type application/octet-stream;
sendfile on;
client_body_temp_path /tmp/client_body;
fastcgi_temp_path /tmp/fastcgi_temp;
proxy_temp_path /tmp/proxy_temp;
scgi_temp_path /tmp/scgi_temp;
uwsgi_temp_path /tmp/uwsgi_temp;
access_log /tmp/access.log;
error_log /tmp/error.log;
# https://nginx.org/en/docs/http/ngx_http_gzip_module.html
# Enable gzip compression.
# Default: off
gzip off;
# Compression level (1-9).
# 5 is a perfect compromise between size and CPU usage, offering about
# 75% reduction for most ASCII files (almost identical to level 9).
# Default: 1
gzip_comp_level 5;
# Don't compress anything that's already small and unlikely to shrink much
# if at all (the default is 20 bytes, which is bad as that usually leads to
# larger files after gzipping).
# Default: 20
gzip_min_length 256;
# Compress data even for clients that are connecting to us via proxies,
# identified by the "Via" header (required for CloudFront).
# Default: off
gzip_proxied any;
# Tell proxies to cache both the gzipped and regular version of a resource
# whenever the client's Accept-Encoding capabilities header varies;
# Avoids the issue where a non-gzip capable client (which is extremely rare
# today) would display gibberish if their proxy gave them the gzipped version.
# Default: off
gzip_vary on;
# Compress all output labeled with one of the following MIME-types.
# text/html is always compressed by gzip module.
# Default: text/html
gzip_types *;
brotli on;
# brotli_static on;
brotli_types *;
# This should be turned on if you are going to have pre-compressed copies (.gz) of
# static files available. If not it should be left off as it will cause extra I/O
# for the check. It is best if you enable this in a location{} block for
# a specific directory, or on an individual server{} level.
# gzip_static on;
keepalive_timeout 3000;
server {
listen 80;
listen [::]:80;
index index.html;
server_name localhost;
root /usr/share/nginx/html;
autoindex on;
location ~* \.(?:manifest|appcache|html?|xml|json|css|js|map|jpg|jpeg|gif|png|ico|svg|eot|ttf|woff|woff2)$ {
add_header Access-Control-Allow-Origin *;
add_header Access-Control-Allow-Credentials true;
add_header Access-Control-Allow-Methods 'GET, POST, OPTIONS';
add_header Access-Control-Allow-Headers 'DNT,X-CustomHeader,Keep-Alive,User-Agent,X-Requested-With,If-Modified-Since,Cache-Control,Content-Type';
access_log off;
}
location /service-worker.js {
expires -1;
add_header Access-Control-Allow-Origin *;
add_header Access-Control-Allow-Credentials true;
add_header Access-Control-Allow-Methods 'GET, POST, OPTIONS';
add_header Access-Control-Allow-Headers 'DNT,X-CustomHeader,Keep-Alive,User-Agent,X-Requested-With,If-Modified-Since,Cache-Control,Content-Type';
access_log off;
}
location / {
try_files $uri $uri/ /index.html =404;
}
location /iframe.html {
try_files $uri $uri/ /iframe.html =404;
}
}
}

31303
package-lock.json generated

File diff suppressed because it is too large Load Diff

View File

@@ -1,19 +1,14 @@
{ {
"name": "coriolis_shipyard", "name": "coriolis_shipyard",
"version": "3.0.1", "version": "3.0.0",
"repository": { "repository": {
"type": "git", "type": "git",
"url": "https://github.com/EDCD/coriolis" "url": "https://github.com/EDCD/coriolis"
}, },
"homepage": "https://coriolis.io", "homepage": "https://coriolis.io",
"bugs": "https://github.com/EDCD/coriolis/issues", "bugs": "https://github.com/EDCD/coriolis/issues",
"contributors": [
{ "name": "cmdrmcdonald" },
{ "name": "willb321" },
{ "name": "felixlinker" }
],
"private": true, "private": true,
"engine": "node >= 10.13.0", "engine": "node >= 4.8.1",
"license": "MIT", "license": "MIT",
"scripts": { "scripts": {
"extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f", "extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f",
@@ -23,8 +18,7 @@
"test": "jest", "test": "jest",
"prod-serve": "nginx -p $(pwd) -c nginx.conf", "prod-serve": "nginx -p $(pwd) -c nginx.conf",
"prod-stop": "kill -QUIT $(cat nginx.pid)", "prod-stop": "kill -QUIT $(cat nginx.pid)",
"buildfresh": "rimraf node_modules && rm package-lock.json && npm install && npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)", "build": "npm run clean && cross-env NODE_ENV=production webpack -p --config webpack.config.prod.js",
"build": "npm run clean && cross-env NODE_ENV=production webpack --config webpack.config.prod.js",
"rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws", "rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws",
"deploy": "npm run lint && npm test && npm run build && npm run rsync" "deploy": "npm run lint && npm test && npm run build && npm run rsync"
}, },
@@ -61,7 +55,7 @@
] ]
}, },
"devDependencies": { "devDependencies": {
"@babel/core": "^7.20.12", "@babel/core": "^7.0.0",
"@babel/plugin-proposal-class-properties": "^7.0.0", "@babel/plugin-proposal-class-properties": "^7.0.0",
"@babel/plugin-proposal-decorators": "^7.0.0", "@babel/plugin-proposal-decorators": "^7.0.0",
"@babel/plugin-proposal-do-expressions": "^7.0.0", "@babel/plugin-proposal-do-expressions": "^7.0.0",
@@ -80,12 +74,15 @@
"@babel/plugin-syntax-import-meta": "^7.0.0", "@babel/plugin-syntax-import-meta": "^7.0.0",
"@babel/preset-env": "^7.0.0", "@babel/preset-env": "^7.0.0",
"@babel/preset-react": "^7.0.0", "@babel/preset-react": "^7.0.0",
"@rollup/plugin-node-resolve": "^15.0.1", "appcache-webpack-plugin": "^1.4.0",
"babel-core": "^7.0.0-bridge.0",
"babel-eslint": "^10.0.1",
"babel-jest": "^23.6.0",
"babel-loader": "^8.0.0", "babel-loader": "^8.0.0",
"copy-webpack-plugin": "^10.2.4", "copy-webpack-plugin": "^4.5.2",
"create-react-class": "^15.6.3", "create-react-class": "^15.6.3",
"cross-env": "^5.2.0", "cross-env": "^5.2.0",
"css-loader": "^6.7.3", "css-loader": "^1.0.0",
"d3-selection": "^1.3.2", "d3-selection": "^1.3.2",
"esdoc": "^1.1.0", "esdoc": "^1.1.0",
"esdoc-custom-theme": "^1.4.2", "esdoc-custom-theme": "^1.4.2",
@@ -96,66 +93,56 @@
"esdoc-standard-plugin": "^1.0.0", "esdoc-standard-plugin": "^1.0.0",
"eslint": "^5.6.0", "eslint": "^5.6.0",
"eslint-plugin-react": "^7.11.1", "eslint-plugin-react": "^7.11.1",
"expose-loader": "^3.1.0", "expose-loader": "^0.7.5",
"express": "^4.18.2", "express": "^4.16.3",
"html-webpack-plugin": "^5.5.0", "extract-text-webpack-plugin": "^4.0.0-beta.0",
"jsen": "^0.6.6", "file-loader": "^2.0.0",
"html-webpack-plugin": "^3.0.7",
"jest-cli": "^23.6.0",
"jsen": "^0.6.4",
"json-loader": "^0.5.4", "json-loader": "^0.5.4",
"less": "^3.8.1", "less": "^3.8.1",
"less-loader": "^11.1.0", "less-loader": "^4.1.0",
"mini-css-extract-plugin": "^2.7.2", "react-addons-perf": "^15.4.2",
"react-container-dimensions": "^1.4.1", "react-container-dimensions": "^1.4.1",
"react-testutils-additions": "^15.0.0", "react-testutils-additions": "^16.0.0",
"react-transition-group": "^2.5.0", "react-transition-group": "^2.5.0",
"rimraf": "^4.1.2", "rimraf": "^2.6.1",
"rollup": "^3.17.2", "rollup": "^0.66.2",
"style-loader": "^3.3.1", "rollup-plugin-node-resolve": "^3.4.0",
"uglify-js": "^3.17.4", "style-loader": "^0.23.0",
"webpack": "^5.75.0", "uglify-js": "^3.4.9",
"webpack-cli": "^5.0.1", "url-loader": "^1.1.1",
"webpack-dev-server": "^4.11.1", "webpack": "^4.20.2",
"webpack-merge": "^5.8.0", "webpack-bugsnag-plugins": "^1.2.2",
"webpack-notifier": "^1.15.0", "webpack-cli": "^3.1.1",
"workbox-cacheable-response": "^6.5.4", "webpack-dev-server": "^3.1.9",
"workbox-expiration": "^6.5.4", "webpack-notifier": "^1.6.0",
"workbox-precaching": "^6.5.4", "workbox-webpack-plugin": "^3.6.1"
"workbox-routing": "^6.5.4",
"workbox-strategies": "^6.5.4",
"workbox-webpack-plugin": "^6.5.4"
}, },
"sideEffects": false, "sideEffects": false,
"dependencies": { "dependencies": {
"assert": "^1.5.0", "@babel/polyfill": "^7.0.0",
"auto-bind": "^5.0.1", "auto-bind": "^2.1.1",
"base64url": "^3.0.1",
"browserify-zlib-next": "^1.0.1", "browserify-zlib-next": "^1.0.1",
"buffer": "^5.7.0",
"classnames": "^2.2.6", "classnames": "^2.2.6",
"constants-browserify": "^1.0.0",
"core-js": "^3.28.0",
"coriolis-data": "../coriolis-data", "coriolis-data": "../coriolis-data",
"crypto-browserify": "^3.12.0",
"d3": "^5.7.0", "d3": "^5.7.0",
"detect-browser": "^3.0.1", "detect-browser": "^3.0.1",
"ed-forge": "github:EDCD/ed-forge",
"fbemitter": "^2.1.1", "fbemitter": "^2.1.1",
"https-browserify": "^1.0.0",
"lodash": "^4.17.11", "lodash": "^4.17.11",
"lz-string": "^1.4.4", "lz-string": "^1.4.4",
"os-browserify": "^0.3.0", "pako": "^1.0.6",
"pako": "^2.1.0",
"path-browserify": "^1.0.1",
"prop-types": "^15.6.2", "prop-types": "^15.6.2",
"react": "^15.6.2", "react": "^15.5.4",
"react-dom": "^15.6.2", "react-dom": "^15.5.4",
"react-extras": "^0.7.1",
"react-fuzzy": "^0.5.2", "react-fuzzy": "^0.5.2",
"react-ga": "^2.5.3", "react-ga": "^2.5.3",
"react-number-editor": "^4.0.3", "react-number-editor": "^4.0.3",
"recharts": "^1.2.0", "recharts": "^1.2.0",
"register-service-worker": "^1.7.2", "register-service-worker": "^1.5.2",
"stream-browserify": "^3.0.0", "superagent": "^3.8.3"
"stream-http": "^3.2.0",
"superagent": "^3.8.3",
"url": "^0.11.0",
"vm-browserify": "^1.1.2"
} }
} }

View File

@@ -1,4 +1,4 @@
import nodeResolve from "@rollup/plugin-node-resolve"; import nodeResolve from "rollup-plugin-node-resolve";
export default { export default {
entry: "d3-funcs.js", entry: "d3-funcs.js",

View File

@@ -214,7 +214,7 @@ Options -MultiViews
# </Files> # </Files>
AddType application/x-web-app-manifest+json webapp AddType application/x-web-app-manifest+json webapp
# AddType text/cache-manifest appcache manifest AddType text/cache-manifest appcache manifest
# Media files # Media files
AddType audio/mp4 f4a f4b m4a AddType audio/mp4 f4a f4b m4a

View File

@@ -5,16 +5,14 @@ import { register } from 'register-service-worker';
import { EventEmitter } from 'fbemitter'; import { EventEmitter } from 'fbemitter';
import { getLanguage } from './i18n/Language'; import { getLanguage } from './i18n/Language';
import Persist from './stores/Persist'; import Persist from './stores/Persist';
import { Ship } from 'ed-forge';
import Announcement from './components/Announcement'; import Announcement from './components/Announcement';
import Header from './components/Header'; import Header from './components/Header';
import Tooltip from './components/Tooltip'; import Tooltip from './components/Tooltip';
import ModalExport from './components/ModalExport';
import ModalHelp from './components/ModalHelp'; import ModalHelp from './components/ModalHelp';
import ModalImport from './components/ModalImport'; import ModalImport from './components/ModalImport';
import ModalPermalink from './components/ModalPermalink'; import ModalPermalink from './components/ModalPermalink';
import * as CompanionApiUtils from './utils/CompanionApiUtils';
import * as JournalUtils from './utils/JournalUtils';
import AboutPage from './pages/AboutPage'; import AboutPage from './pages/AboutPage';
import NotFoundPage from './pages/NotFoundPage'; import NotFoundPage from './pages/NotFoundPage';
import OutfittingPage from './pages/OutfittingPage'; import OutfittingPage from './pages/OutfittingPage';
@@ -22,8 +20,6 @@ import ComparisonPage from './pages/ComparisonPage';
import ShipyardPage from './pages/ShipyardPage'; import ShipyardPage from './pages/ShipyardPage';
import ErrorDetails from './pages/ErrorDetails'; import ErrorDetails from './pages/ErrorDetails';
const zlib = require('pako');
const request = require('superagent'); const request = require('superagent');
/** /**
@@ -62,18 +58,17 @@ export default class Coriolis extends React.Component {
this._onLanguageChange = this._onLanguageChange.bind(this); this._onLanguageChange = this._onLanguageChange.bind(this);
this._onSizeRatioChange = this._onSizeRatioChange.bind(this); this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
this._keyDown = this._keyDown.bind(this); this._keyDown = this._keyDown.bind(this);
this._importBuild = this._importBuild.bind(this);
this.emitter = new EventEmitter(); this.emitter = new EventEmitter();
this.state = { this.state = {
noTouch: !('ontouchstart' in window || navigator.msMaxTouchPoints || navigator.maxTouchPoints), noTouch: !('ontouchstart' in window || navigator.msMaxTouchPoints || navigator.maxTouchPoints),
page: null, page: null,
// Announcements must have an expiry date in format "YYYY-MM-DDTHH:MM:SSZ" announcements: [],
announcements: [{expiry: "2025-04-10T00:00:00Z", text: "Corsair added"}],
language: getLanguage(Persist.getLangCode()), language: getLanguage(Persist.getLangCode()),
route: {}, route: {},
sizeRatio: Persist.getSizeRatio() sizeRatio: Persist.getSizeRatio()
}; };
this._getAnnouncements();
Router('', (r) => this._setPage(ShipyardPage, r)); Router('', (r) => this._setPage(ShipyardPage, r));
Router('/import?', (r) => this._importBuild(r)); Router('/import?', (r) => this._importBuild(r));
Router('/import/:data', (r) => this._importBuild(r)); Router('/import/:data', (r) => this._importBuild(r));
@@ -94,44 +89,22 @@ export default class Coriolis extends React.Component {
_importBuild(r) { _importBuild(r) {
try { try {
// Need to decode and gunzip the data, then build the ship // Need to decode and gunzip the data, then build the ship
const data = zlib.inflate(new Buffer.from(r.params.data, 'base64'), { to: 'string' }); let ship = new Ship(r.params.data);
const json = JSON.parse(data); r.params.ship = ship.getShipType();
console.info('Ship import data: '); r.params.code = ship.compress();
console.info(json); this._setPage(OutfittingPage, r);
let ship, importString;
if (json) {
if (json.length && json[0].data) { // SLEF
if (json.length > 1) { // Multiple builds, open modal
importString = data;
} else { // Single build, import directly
ship = JournalUtils.shipFromLoadoutJSON(json[0].data);
}
} else { // not SLEF
if (json.modules) {
ship = CompanionApiUtils.shipFromJson(json);
} else if (json.Modules) {
ship = JournalUtils.shipFromLoadoutJSON(json);
}
}
}
if (ship) {
r.params.ship = ship.id;
r.params.code = ship.toString();
this._setPage(OutfittingPage, r);
} else if (importString) {
this._setPage(ShipyardPage, r);
this._showModal(<ModalImport importString={data}/>);
}
} catch (err) { } catch (err) {
const fullUrl = window.location.href; this._onError('Failed to import ship', r.path, 0, 0, err);
}
}
if (fullUrl.length >= 2083) { async _getAnnouncements() {
err = 'URL Length = ' + fullUrl.length; try {
this._onError('Failed to import ship - Potential URL Length issue', r.path, 0, 0, err); const announces = await request.get('https://orbis.zone/api/announcement')
} .query({ showInCoriolis: true });
else { this.setState({ announcements: announces.body });
this._onError('Failed to import ship - Unknown Reason', r.path, 0, 0, err); } catch (err) {
} console.error(err)
} }
} }
@@ -158,6 +131,13 @@ export default class Coriolis extends React.Component {
*/ */
_onError(msg, scriptUrl, line, col, errObj) { _onError(msg, scriptUrl, line, col, errObj) {
console && console.error && console.error(arguments); // eslint-disable-line no-console console && console.error && console.error(arguments); // eslint-disable-line no-console
if (errObj) {
if (errObj instanceof Error) {
bugsnagClient.notify(errObj); // eslint-disable-line
} else if (errObj instanceof String) {
bugsnagClient.notify(msg, errObj); // eslint-disable-line
}
}
this.setState({ this.setState({
error: <ErrorDetails error={{ message: msg, details: { scriptUrl, line, col, error: JSON.stringify(errObj) } }}/>, error: <ErrorDetails error={{ message: msg, details: { scriptUrl, line, col, error: JSON.stringify(errObj) } }}/>,
page: null, page: null,
@@ -401,18 +381,18 @@ export default class Coriolis extends React.Component {
*/ */
render() { render() {
let currentMenu = this.state.currentMenu; let currentMenu = this.state.currentMenu;
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu} return <div style={{ minHeight: '100%' }} onClick={this._closeMenu}
className={this.state.noTouch ? 'no-touch' : null}> className={this.state.noTouch ? 'no-touch' : null}>
<Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate} <Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate}
currentMenu={currentMenu}/> currentMenu={currentMenu}/>
<div className="announcement-container">{this.state.announcements.map(a => <Announcement <div className="announcement-container">{this.state.announcements.map(a => <Announcement
text={a.text}/>)}</div> text={a.message}/>)}</div>
{this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) : {this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) :
<NotFoundPage/>} <NotFoundPage/>}
{this.state.modal} {this.state.modal}
{this.state.tooltip} {this.state.tooltip}
<footer> <footer>
<div className="right cap"> <div className="right cap">
<a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer" <a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer"
title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a> title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a>

View File

@@ -72,7 +72,6 @@ Router.go = function(path, state) {
gaTrack(path); gaTrack(path);
let ctx = new Context(path, state); let ctx = new Context(path, state);
Router.dispatch(ctx); Router.dispatch(ctx);
if (!ctx.unhandled) { if (!ctx.unhandled) {
if (isStandAlone()) { if (isStandAlone()) {
Persist.setState(ctx); Persist.setState(ctx);

View File

@@ -1,12 +1,11 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import autoBind from 'auto-bind'; import { autoBind } from 'react-extras';
/** /**
* Announcement component * Announcement component
*/ */
export default class Announcement extends React.Component { export default class Announcement extends React.Component {
static propTypes = { static propTypes = {
text: PropTypes.string text: PropTypes.string
}; };
@@ -27,5 +26,4 @@ export default class Announcement extends React.Component {
render() { render() {
return <div className="announcement" >{this.props.text}</div>; return <div className="announcement" >{this.props.text}</div>;
} }
} }

View File

@@ -1,129 +1,20 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { CoriolisLogo, MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import FuzzySearch from 'react-fuzzy'; import FuzzySearch from 'react-fuzzy';
import { getModuleInfo } from 'ed-forge/lib/data/items';
import { groupBy, mapValues, sortBy } from 'lodash';
import autoBind from 'auto-bind';
const PRESS_THRESHOLD = 500; // mouse/touch down threshold const PRESS_THRESHOLD = 500; // mouse/touch down threshold
/* const MOUNT_MAP = {
* Categorisation of module groups fixed: <MountFixed className={'lg'} />,
*/ gimbal: <MountGimballed className={'lg'} />,
const GRPCAT = { turret: <MountTurret className={'lg'} />,
'sg': 'shields',
'bsg': 'shields',
'psg': 'shields',
'scb': 'shields',
'cc': 'limpet controllers',
'fx': 'limpet controllers',
'hb': 'limpet controllers',
'mlc': 'limpet controllers',
'pc': 'limpet controllers',
'rpl': 'limpet controllers',
'pce': 'passenger cabins',
'pci': 'passenger cabins',
'pcm': 'passenger cabins',
'pcq': 'passenger cabins',
'fh': 'hangars',
'pv': 'hangars',
'fs': 'fuel',
'ft': 'fuel',
'hr': 'structural reinforcement',
'mrp': 'structural reinforcement',
'bl': 'lasers',
'pl': 'lasers',
'ul': 'lasers',
'ml': 'lasers',
'c': 'projectiles',
'mc': 'projectiles',
'advmc': 'projectiles',
'axmc': 'experimental',
'axmce': 'experimental',
'ntp': 'experimental',
'fc': 'projectiles',
'rfl': 'experimental',
'pa': 'projectiles',
'rg': 'projectiles',
'mr': 'ordnance',
'amr': 'ordnance',
'axmr': 'experimental',
'axmre': 'experimental',
'rcpl': 'experimental',
'dtl': 'experimental',
'tbsc': 'experimental',
'tbem': 'experimental',
'tbrfl': 'experimental',
'mahr': 'experimental',
'rsl': 'experimental',
'tp': 'ordnance',
'nl': 'ordnance',
'sc': 'scanners',
'ss': 'scanners',
// Utilities
'cs': 'scanners',
'kw': 'scanners',
'ws': 'scanners',
'xs': 'scanners',
'ch': 'defence',
'po': 'defence',
'ec': 'defence',
'sfn': 'defence',
// Guardian
'gpp': 'guardian',
'gpc': 'guardian',
'gsrp': 'guardian',
'ggc': 'guardian',
'gfsb': 'guardian',
'gmrp': 'guardian',
'gsc': 'guardian',
'ghrp': 'guardian',
// Mining
'scl': 'mining',
'pwa': 'mining',
'sdm': 'mining',
// Assists
'dc': 'flight assists',
'sua': 'flight assists',
// Stabilizers
'ews': 'weapon stabilizers',
};
// Order here is the order in which items will be shown in the modules menu
const CATEGORIES = {
// Internals
'am': ['am'],
'cr': ['cr'],
'fi': ['fi'],
'fuel': ['ft', 'fs'],
'hangars': ['fh', 'pv'],
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl', 'mlc'],
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
'rf': ['rf'],
'shields': ['sg', 'bsg', 'psg', 'scb'],
'structural reinforcement': ['hr', 'mrp'],
'flight assists': ['dc', 'sua'],
// Hardpoints
'lasers': ['pl', 'ul', 'bl'],
'projectiles': ['mc', 'advmc', 'c', 'fc', 'pa', 'rg'],
'ordnance': ['mr', 'amr', 'tp', 'nl'],
// Utilities
'sb': ['sb'],
'hs': ['hs'],
'csl': ['csl'],
'defence': ['ch', 'po', 'ec'],
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
// Experimental
'experimental': ['axmc', 'axmce', 'axmr', 'axmre', 'ntp','rfl', 'tbrfl', 'tbsc', 'tbem', 'xs', 'sfn', 'rcpl', 'dtl', 'rsl', 'mahr',],
'weapon stabilizers': ['ews'],
// Guardian
'guardian': ['gpp', 'gpd', 'gpc', 'ggc', 'gsrp', 'gfsb', 'ghrp', 'gmrp', 'gsc'],
'mining': ['ml', 'scl', 'pwa', 'sdm', 'abl'],
}; };
/** /**
@@ -131,15 +22,11 @@ const CATEGORIES = {
*/ */
export default class AvailableModulesMenu extends TranslatedComponent { export default class AvailableModulesMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
diffDetails: PropTypes.func, diffDetails: PropTypes.func,
hideSearch: PropTypes.bool,
m: PropTypes.object, m: PropTypes.object,
ship: PropTypes.object.isRequired,
warning: PropTypes.func, warning: PropTypes.func,
firstSlotId: PropTypes.string,
lastSlotId: PropTypes.string,
activeSlotId: PropTypes.string,
slotDiv: PropTypes.object slotDiv: PropTypes.object
}; };
@@ -150,10 +37,8 @@ export default class AvailableModulesMenu extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this._hideDiff = this._hideDiff.bind(this); autoBind(this);
this._showSearch = this._showSearch.bind(this);
this.state = this._initState(props, context); this.state = this._initState(props, context);
this.slotItems = [];// Array to hold <li> refs.
} }
/** /**
@@ -163,278 +48,173 @@ export default class AvailableModulesMenu extends TranslatedComponent {
* @return {Object} list: Array of React Components, currentGroup Component if any * @return {Object} list: Array of React Components, currentGroup Component if any
*/ */
_initState(props, context) { _initState(props, context) {
let translate = context.language.translate; const { translate } = context.language;
let { m, warning, onSelect, modules, ship } = props; const { m } = props;
let list, currentGroup; const list = [], fuzzy = [];
let currentGroup;
let buildGroup = this._buildGroup.bind( const modules = m.getApplicableItems().map(getModuleInfo);
this, const groups = mapValues(
ship, groupBy(modules, (info) => info.meta.group),
translate, (infos) => groupBy(infos, (info) => info.meta.type),
m,
warning,
(m, event) => {
this._hideDiff(event);
onSelect(m);
}
); );
let fuzzy = []; // Build categories sorted by translated category name
if (modules instanceof Array) { const groupKeys = sortBy(Object.keys(groups), translate);
list = buildGroup(modules[0].grp, modules); for (const group of groupKeys) {
} else { const groupName = translate(group);
list = []; if (groupKeys.length > 1) {
// At present time slots with grouped options (Hardpoints and Internal) can be empty list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>);
if (m) {
let emptyId = 'empty';
if (this.firstSlotId == null) this.firstSlotId = emptyId;
let keyDown = this._keyDown.bind(this, onSelect);
list.push(<div className='empty-c upp' key={emptyId} data-id={emptyId} onClick={onSelect.bind(null, null)}
onKeyDown={keyDown} tabIndex="0"
ref={slotItem => this.slotItems[emptyId] = slotItem}>{translate('empty')}</div>);
} }
// Need to regroup the modules by our own categorisation const categories = groups[group];
let catmodules = {}; const categoryKeys = sortBy(Object.keys(categories), translate);
// Pre-create to preserve ordering for (const category of categoryKeys) {
for (let cat in CATEGORIES) { const categoryName = translate(category);
catmodules[cat] = []; const infos = categories[category];
} if (categoryKeys.length > 1) {
for (let g in modules) { list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>);
const moduleCategory = GRPCAT[g] || g;
const existing = catmodules[moduleCategory] || [];
catmodules[moduleCategory] = existing.concat(modules[g]);
}
for (let category in catmodules) {
let categoryHeader = false;
// Order through CATEGORIES if present
const categories = CATEGORIES[category] || [category];
if (categories && categories.length) {
for (let n in categories) {
const grp = categories[n];
// We now have the group and the category. We might not have any modules, though...
if (modules[grp]) {
// Decide if we need a category header as well as a group header
if (categories.length === 1) {
// Show category header instead of group header
if (m && grp == m.grp) {
// If this is a missing module/weapon, skip it
if (m.grp == "mh" || m.grp == "mm"){
continue;
} else {
list.push(<div ref={(elem) => this.groupElem = elem} key={category}
className={'select-category upp'}>{translate(category)}</div>);
}
} else {
if (category == "mh" || category == "mm"){
continue;
} else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
}
}
} else {
// Show category header as well as group header
if (!categoryHeader) {
if (category == "mh" || category == "mm"){
continue;
}
else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
categoryHeader = true;
}
}
if (m && grp == m.grp) {
list.push(<div ref={(elem) => this.groupElem = elem} key={grp}
className={'select-group cap'}>{translate(grp)}</div>);
} else {
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
}
}
list.push(buildGroup(grp, modules[grp]));
for (const i of modules[grp]) {
let mount = '';
if (i.mount === 'F') {
mount = 'Fixed';
} else if (i.mount === 'G') {
mount = 'Gimballed';
} else if (i.mount === 'T') {
mount = 'Turreted';
}
let special = '';
if (typeof(i.special) !== 'undefined') {
special = `(${translate(i.special)})`;
}
const fuzz = { grp, m: i, name: `${i.class}${i.rating}${mount ? ' ' + mount : ''} ${translate(grp)} ${translate(special)}` };
fuzzy.push(fuzz);
}
}
}
} }
list.push(
this._buildGroup(
m,
category,
infos,
),
);
fuzzy.push(
...infos.map((info) => {
const { meta } = info;
const mount = meta.mount ? ' ' + translate(meta.mount) : '';
return {
grp: groupName,
cat: categoryName,
m: info.proto.Item,
name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
};
}),
);
} }
} }
let trackingFocus = false; return { list, currentGroup, fuzzy, trackingFocus: false };
return { list, currentGroup, fuzzy, trackingFocus };
}
/**
* Return Is expiremental capacity reached
* @return {boolean} Is experimental capacity reached
*/
_experimentalCapacityReached() {
const ship = this.props.ship;
const ews = ship.internal.filter(o => o.m && o.m.grp === 'ews');
let expCap;
if(ews.length < 1){
expCap = 4;
} else{
expCap = ews[0].m.class == 3 ? 5 : 6;
}
return expCap <= this.props.ship.hardpoints.filter(o => o.m && o.m.experimental).length;
} }
/** /**
* Generate React Components for Module Group * Generate React Components for Module Group
* @param {Ship} ship Ship the selection is for
* @param {Function} translate Translate function
* @param {Object} mountedModule Mounted Module * @param {Object} mountedModule Mounted Module
* @param {Function} warningFunc Warning function * @param {String} category Category key
* @param {function} onSelect Select/Mount callback
* @param {string} grp Group name
* @param {Array} modules Available modules * @param {Array} modules Available modules
* @return {React.Component} Available Module Group contents * @return {React.Component} Available Module Group contents
*/ */
_buildGroup(ship, translate, mountedModule, warningFunc, onSelect, grp, modules) { _buildGroup(mountedModule, category, modules) {
let prevClass = null, prevRating = null, prevName; const { warning } = this.props;
let elems = []; const ship = mountedModule.getShip();
const classMapping = groupBy(modules, (info) => info.meta.class);
const sortedModules = modules.sort(this._moduleOrder); const itemsPerClass = Math.max(
...Object.values(classMapping).map((l) => l.length),
);
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
// Nested array of <li> elements; will be flattened before being rendered.
// Each sub-array represents one row in the final view.
const elems = [[]];
// Calculate the number of items per class. Used so we don't have long lists with only a few items in each row // Reverse sort for descending order of module class
const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => { for (const clazz of Object.keys(classMapping).sort().reverse()) {
count[cls] = ++count[cls] || 1; for (let info of sortBy(
return count; classMapping[clazz],
}, {}); (info) => info.meta.mount || info.meta.rating,
const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key])); )) {
const { meta } = info;
const { Item } = info.proto;
let itemsOnThisRow = 0; // Can only be true if shieldgenmaximalmass is defined, i.e. this
for (let i = 0; i < sortedModules.length; i++) { // module must be a shield generator
let m = sortedModules[i]; let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass');
// If m.grp is mh or mm, or m.symbol contains 'Missing' skip it if (meta.experimental && !mountedModule.readMeta('experimental')) {
if (m.grp == 'mh' || m.grp == 'mm' || (typeof(m.symbol) !== 'undefined' && m.symbol.includes("Missing"))) { disabled =
// If this is a missing module, skip it 4 <=
continue; ship.getHardpoints().filter((m) => m.readMeta('experimental'))
.length;
}
// Default event handlers for objects that are disabled
let eventHandlers = {};
if (!disabled) {
const showDiff = this._showDiff.bind(this, mountedModule, info);
const select = (event) => {
this._hideDiff(event);
this.props.onSelect(Item);
};
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
};
}
const mountSymbol = MOUNT_MAP[meta.mount] || '';
const li = (
<li key={Item} data-id={Item}
ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
className={cn(meta.type === 'armour' ? 'lc' : 'c', {
warning: !disabled && warning && warning(info),
active: mountedModule.getItem() === Item,
disabled,
hardpoint: mountSymbol,
})}
{...eventHandlers}
>{meta.type === 'armour' ? Item : `${mountSymbol}${meta.class}${meta.rating}`}</li>
);
const tail = elems.pop();
let newTail = [tail];
if (tail.length < itemsPerRow) {
// If the row has not grown too long, the new <li> element can be
// added to the row itself
tail.push(li);
} else {
// Otherwise, the last row gets a line break element added and this
// item is put into a new row
tail.push(<br key={elems.length}/>);
newTail.push([li]);
}
elems.push(...newTail);
} }
let mount = null;
let disabled = false;
prevName = m.name;
if (ModuleUtils.isShieldGenerator(m.grp)) {
// Shield generators care about maximum hull mass
disabled = ship.hullMass > m.maxmass;
// If the mounted module is experimental as well, we can replace it so
// the maximum does not apply
} else if (m.experimental && (!mountedModule || !mountedModule.experimental)) {
disabled = this._experimentalCapacityReached();
} else if (m.grp === 'mlc' && (!mountedModule || mountedModule.grp !== 'mlc')) {
disabled = 1 <= ship.internal.filter(o => o.m && o.m.grp === 'mlc').length;
}
let active = mountedModule && mountedModule.id === m.id;
let classes = cn(m.name ? 'lc' : 'c', {
warning: !disabled && warningFunc && warningFunc(m),
active,
disabled
});
let eventHandlers;
if (disabled) {
eventHandlers = {
onKeyDown: this._keyDown.bind(this, null),
onKeyUp: this._keyUp.bind(this, null)
};
} else {
/**
* Get the ids of the first and last <li> elements in the <ul> that are focusable (i.e. are not active or disabled)
* Will be used to keep focus inside the <ul> on Tab and Shift-Tab while it is visible
*/
if (this.firstSlotId == null) this.firstSlotId = sortedModules[i].id;
if (active) this.activeSlotId = sortedModules[i].id;
this.lastSlotId = sortedModules[i].id;
let showDiff = this._showDiff.bind(this, mountedModule, m);
let select = onSelect.bind(null, m);
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
onKeyDown: this._keyDown.bind(this, select),
onKeyUp: this._keyUp.bind(this, select)
};
}
switch (m.mount) {
case 'F':
mount = <MountFixed className={'lg'}/>;
break;
case 'G':
mount = <MountGimballed className={'lg'}/>;
break;
case 'T':
mount = <MountTurret className={'lg'}/>;
break;
}
if (m.name && m.name === prevName) {
// elems.push(<br key={'b' + m.grp + i} />);
itemsOnThisRow = 0;
}
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
elems.push(<br key={'b' + m.grp + i}/>);
itemsOnThisRow = 0;
}
let tbIdx = (classes.indexOf('disabled') < 0) ? 0 : undefined;
elems.push(
<li key={m.id} data-id={m.id} className={classes} {...eventHandlers} tabIndex={tbIdx}
ref={slotItem => this.slotItems[m.id] = slotItem}>
{mount}
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
</li>
);
itemsOnThisRow++;
prevClass = m.class;
prevRating = m.rating;
prevName = m.name;
} }
return <ul key={'modules' + grp}>{elems}</ul>;
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>;
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @param {Object} mm The module mounet currently * @param {Object} mountedModule The module mounted currently
* @param {Object} m The hovered module * @param {Object} hoveringModule The hovered module
* @param {DOMRect} rect DOMRect for target element * @param {DOMRect} rect DOMRect for target element
*/ */
_showDiff(mm, m, rect) { _showDiff(mountedModule, hoveringModule, rect) {
if (this.props.diffDetails) { if (this.props.diffDetails) {
this.touchTimeout = null; this.touchTimeout = null;
this.context.tooltip(this.props.diffDetails(m, mm), rect); // TODO:
// this.context.tooltip(
// this.props.diffDetails(hoveringModule, mountedModule),
// rect,
// );
} }
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @returns {React.Component} Search component if available
*/ */
_showSearch() { _showSearch() {
if (this.props.modules instanceof Array) { if (this.props.hideSearch) {
return; return;
} }
const mountedModule = this.props.m;
return ( return (
<FuzzySearch <FuzzySearch
list={this.state.fuzzy} list={this.state.fuzzy}
@@ -446,20 +226,11 @@ export default class AvailableModulesMenu extends TranslatedComponent {
onSelect={e => this.props.onSelect.bind(null, e.m)()} onSelect={e => this.props.onSelect.bind(null, e.m)()}
resultsTemplate={(props, state, styles, clickHandler) => { resultsTemplate={(props, state, styles, clickHandler) => {
return state.results.map((val, i) => { return state.results.map((val, i) => {
let disabled;
if(val.m.experimental && (!mountedModule || !mountedModule.experimental)) {
disabled = this._experimentalCapacityReached();
} else{
disabled = false;
}
const handler = disabled ? null : () => clickHandler(i);
return ( return (
<div <div
key={i} key={i}
className={cn('lc', {disabled})} className={'lc'}
onClick={handler} onClick={() => clickHandler(i)}
> >
{val.name} {val.name}
</div> </div>
@@ -504,41 +275,6 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this._hideDiff(); this._hideDiff();
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {Function} select Select module callback
* @param {SyntheticEvent} event Event
*/
_keyDown(select, event) {
let className = event.currentTarget.attributes['class'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
select();
return;
}
let elemId = event.currentTarget.attributes['data-id'].value;
if (className.indexOf('disabled') < 0 && event.key == 'Tab') {
if (event.shiftKey && elemId == this.firstSlotId) {
event.preventDefault();
this.slotItems[this.lastSlotId].focus();
return;
}
if (!event.shiftKey && elemId == this.lastSlotId) {
event.preventDefault();
this.slotItems[this.firstSlotId].focus();
return;
}
}
}
/**
* Key Up
* @param {Function} select Select module callback
* @param {SytheticEvent} event Event
*/
_keyUp(select, event) {
// nothing here yet
}
/** /**
* Hide diff tooltip * Hide diff tooltip
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -549,69 +285,12 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this.context.tooltip(); this.context.tooltip();
} }
/**
* Order two modules suitably for display in module selection
* @param {Object} a the first module
* @param {Object} b the second module
* @return {int} -1 if the first module should go first, 1 if the second module should go first
*/
_moduleOrder(a, b) {
// Named modules go last
if (!a.name && b.name) {
return -1;
}
if (a.name && !b.name) {
return 1;
}
// Class ordered from highest (8) to lowest (1)
if (a.class < b.class) {
return 1;
}
if (a.class > b.class) {
return -1;
}
// Mount type, if applicable
if (a.mount && b.mount && a.mount !== b.mount) {
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
return -1;
} else {
return 1;
}
}
// Sort multi limpet controllers by name
if (a.grp === 'mlc') {
if (a.name[0] <= b.name[0]) {
return -1;
}
if (a.name[0] > b.name[0]) {
return 1;
}
}
// Rating ordered from highest (A) to lowest (E)
if (a.rating < b.rating) {
return -1;
}
if (a.rating > b.rating) {
return 1;
}
// Do not attempt to order by name at this point, as that mucks up the order of armour
return 0;
}
/** /**
* Scroll to mounted (if it exists) module group on mount * Scroll to mounted (if it exists) module group on mount
*/ */
componentDidMount() { componentDidMount() {
if (this.groupElem) { // Scroll to currently selected group if (this.activeSlotRef) {
this.node.scrollTop = this.groupElem.offsetTop; this.activeSlotRef.focus();
}
/**
* Set focus on active or first slot element, if applicable.
*/
if (this.slotItems[this.activeSlotId]) {
this.slotItems[this.activeSlotId].focus();
} else if (this.slotItems[this.firstSlotId]) {
this.slotItems[this.firstSlotId].focus();
} }
} }
@@ -641,10 +320,10 @@ export default class AvailableModulesMenu extends TranslatedComponent {
render() { render() {
return ( return (
<div ref={node => this.node = node} <div ref={node => this.node = node}
className={cn('select', this.props.className)} className={cn('select', this.props.className)}
onScroll={this._hideDiff} onScroll={this._hideDiff}
onClick={(e) => e.stopPropagation()} onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation} onContextMenu={stopCtxPropagation}
> >
{this._showSearch()} {this._showSearch()}
{this.state.list} {this.state.list}

View File

@@ -1,6 +1,7 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
/** /**
* Boost displays a boost button that toggles bosot * Boost displays a boost button that toggles bosot
@@ -8,8 +9,6 @@ import TranslatedComponent from './TranslatedComponent';
*/ */
export default class Boost extends TranslatedComponent { export default class Boost extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
onChange: PropTypes.func.isRequired onChange: PropTypes.func.isRequired
}; };
@@ -19,12 +18,9 @@ export default class Boost extends TranslatedComponent {
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
const { ship, boost } = props; autoBind(this);
this._keyDown = this._keyDown.bind(this);
this._toggleBoost = this._toggleBoost.bind(this);
} }
/** /**
@@ -70,13 +66,12 @@ export default class Boost extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { ship, boost } = this.props;
// TODO disable if ship cannot boost
return ( return (
<span id='boost'> <span id='boost'>
<button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button> <button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}>
{translate('boost')}
</button>
</span> </span>
); );
} }

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Cargo slider * Cargo slider
@@ -21,8 +22,7 @@ export default class Cargo extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._cargoChange = this._cargoChange.bind(this);
} }
/** /**

View File

@@ -1,13 +1,14 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import Ship from '../shipyard/Ship'; import { Factory, Ship } from 'ed-forge';
import { Insurance } from '../shipyard/Constants'; import { Insurance } from '../shipyard/Constants';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShoppingIcon } from '../components/SvgIcons'; import { ShoppingIcon } from './SvgIcons';
import autoBind from 'auto-bind';
import { assign, differenceBy, sortBy, reverse } from 'lodash';
import { FUEL_CAPACITY } from 'ed-forge/lib/ship-stats';
/** /**
* Cost Section * Cost Section
@@ -16,7 +17,7 @@ export default class CostSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
buildName: PropTypes.string buildName: PropTypes.string,
}; };
/** /**
@@ -25,71 +26,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._costsTab = this._costsTab.bind(this); autoBind(this);
this._sortCost = this._sortCost.bind(this);
this._sortAmmo = this._sortAmmo.bind(this);
this._sortRetrofit = this._sortRetrofit.bind(this);
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
this._eddbShoppingList = this._inaraShoppingList.bind(this);
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
const { ship, buildName } = props;
this.shipType = ship.getShipType();
this.state = { this.state = {
retrofitShip, retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null,
retrofitName, shipDiscount: Persist.getShipDiscount(),
shipDiscount, moduleDiscount: Persist.getModuleDiscount(),
moduleDiscount,
insurance: Insurance[Persist.getInsurance()], insurance: Insurance[Persist.getInsurance()],
tab: Persist.getCostTab(), tab: Persist.getCostTab(),
buildOptions: Persist.getBuildsNamesFor(props.ship.id), buildOptions: Persist.getBuildsNamesFor(ship.getShipType()),
ammoPredicate: 'cr', predicate: 'cr',
ammoDesc: true, desc: true,
costPredicate: 'cr', excluded: {},
costDesc: true,
retroPredicate: 'cr',
retroDesc: true
}; };
} }
/** /**
* Create a ship instance to base/reference retrofit changes from * Create a ship instance to base/reference retrofit changes from
* @param {string} shipId Ship Id
* @param {string} name Build name
* @param {Ship} retrofitShip Existing retrofit ship
* @return {Ship} Retrofit ship * @return {Ship} Retrofit ship
*/ */
_buildRetrofitShip(shipId, name, retrofitShip) { _buildRetrofitShip() {
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults const { retrofitName } = this.state;
if (Persist.hasBuild(this.shipType, retrofitName)) {
if (!retrofitShip) { // Don't create a new instance unless needed return new Ship(Persist.getBuild(this.shipType, retrofitName));
retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
}
if (Persist.hasBuild(shipId, name)) {
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
} else { } else {
retrofitShip.buildWith(data.defaults); // Populate with default components return Factory.newShip(this.shipType);
} }
return retrofitShip;
}
/**
* Get the default retrofit build name if it exists
* @param {string} shipId Ship Id
* @param {string} name Build name
* @return {string} Build name or null
*/
_defaultRetrofitName(shipId, name) {
return Persist.hasBuild(shipId, name) ? name : null;
} }
/** /**
@@ -107,9 +71,6 @@ export default class CostSection extends TranslatedComponent {
_onDiscountChanged() { _onDiscountChanged() {
let shipDiscount = Persist.getShipDiscount(); let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount(); let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this.setState({ shipDiscount, moduleDiscount }); this.setState({ shipDiscount, moduleDiscount });
} }
@@ -126,156 +87,33 @@ export default class CostSection extends TranslatedComponent {
* @param {SyntheticEvent} event Build name to base the retrofit ship on * @param {SyntheticEvent} event Build name to base the retrofit ship on
*/ */
_onBaseRetrofitChange(event) { _onBaseRetrofitChange(event) {
let retrofitName = event.target.value; this.setState({ retrofitName: event.target.value });
let ship = this.props.ship;
if (retrofitName) {
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
} else {
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
}
this._updateRetrofit(ship, this.state.retrofitShip);
this.setState({ retrofitName });
} }
/** /**
* On builds changed check to see if the retrofit ship needs * Toggle item cost inclusion
* to be updated * @param {String} key Key of the row to toggle
*/ */
_onBuildsChanged() { _toggleExcluded(key) {
let update = false; let { excluded } = this.state;
let ship = this.props.ship; excluded = assign({}, excluded);
let { retrofitName, retrofitShip } = this.state; const slotExcluded = excluded[key];
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
if(!Persist.hasBuild(ship.id, retrofitName)) { this.setState({ excluded });
retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
this.setState({ retrofitName: null });
update = true;
} else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
update = true;
}
if (update) { // Update retrofit comparison
this._updateRetrofit(ship, retrofitShip);
}
// Update list of retrofit base build options
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
} }
/** /**
* Toggle item cost inclusion in overall total * Set list sort predicate
* @param {Object} item Cost item * @param {string} newPredicate sort predicate
*/ */
_toggleCost(item) { _sortBy(newPredicate) {
this.props.ship.setCostIncluded(item, !item.incCost); let { predicate, desc } = this.state;
this.forceUpdate();
}
/** if (newPredicate == predicate) {
* Toggle item cost inclusion in retrofit total desc = !desc;
* @param {Object} item Cost item
*/
_toggleRetrofitCost(item) {
let retrofitTotal = this.state.retrofitTotal;
item.retroItem.incCost = !item.retroItem.incCost;
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
this.setState({ retrofitTotal });
}
/**
* Set cost list sort predicate
* @param {string} predicate sort predicate
*/
_sortCostBy(predicate) {
let { costPredicate, costDesc } = this.state;
if (costPredicate == predicate) {
costDesc = !costDesc;
} }
this.setState({ costPredicate: predicate, costDesc }); this.setState({ predicate: newPredicate, desc });
}
/**
* Sort cost list
* @param {Ship} ship Ship instance
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortCost(ship, predicate, desc) {
let costList = ship.costList;
let translate = this.context.language.translate;
if (predicate == 'm') {
costList.sort(slotComparator(translate, null, desc));
} else {
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
}
}
/**
* Set ammo list sort predicate
* @param {string} predicate sort predicate
*/
_sortAmmoBy(predicate) {
let { ammoPredicate, ammoDesc } = this.state;
if (ammoPredicate == predicate) {
ammoDesc = !ammoDesc;
}
this.setState({ ammoPredicate: predicate, ammoDesc });
}
/**
* Sort ammo cost list
* @param {Array} ammoCosts Ammo cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortAmmo(ammoCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'm') {
ammoCosts.sort(slotComparator(translate, null, desc));
} else {
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
}
}
/**
* Set retrofit list sort predicate
* @param {string} predicate sort predicate
*/
_sortRetrofitBy(predicate) {
let { retroPredicate, retroDesc } = this.state;
if (retroPredicate == predicate) {
retroDesc = !retroDesc;
}
this.setState({ retroPredicate: predicate, retroDesc });
}
/**
* Sort retrofit cost list
* @param {Array} retrofitCosts Retrofit cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortRetrofit(retrofitCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'cr') {
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
} else {
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
}
if (!desc) {
retrofitCosts.reverse();
}
} }
/** /**
@@ -284,18 +122,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
_costsTab() { _costsTab() {
let { ship } = this.props; let { ship } = this.props;
let { shipDiscount, moduleDiscount, insurance } = this.state; let {
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
} = this.state;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let rows = []; let rows = [];
for (let i = 0, l = ship.costList.length; i < l; i++) { let modules = sortBy(
let item = ship.costList[i]; ship.getModules(),
if (item.m && item.m.cost) { (predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost'))
let toggle = this._toggleCost.bind(this, item); );
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}> if (desc) {
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td> reverse(modules);
<td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td> }
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
let totalCost = 0;
for (let module of modules) {
const cost = module.readMeta('cost');
const slot = module.getSlot();
if (cost) {
let toggle = this._toggleExcluded.bind(this, slot);
const disabled = excluded[slot];
if (!disabled) {
totalCost += cost;
}
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
</tr>); </tr>);
} }
} }
@@ -304,23 +158,23 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%', borderCollapse: 'collapse' }}> <table style={{ width: '100%', borderCollapse: 'collapse' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>
{translate('module')} {translate('module')}
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null} {shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} -${formats.pct(shipDiscount)}]`}</u> : null}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
<th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl' >{translate('total')}</td> <td colSpan='2' className='lbl' >{translate('total')}</td>
<td className='val'>{formats.int(ship.totalCost)}{units.CR}</td> <td className='val'>{formats.int(totalCost)}{units.CR}</td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl'>{translate('insurance')}</td> <td colSpan='2' className='lbl'>{translate('insurance')}</td>
<td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td> <td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -328,17 +182,66 @@ export default class CostSection extends TranslatedComponent {
} }
/** /**
* Open up a window for inara with a shopping list of our retrofit components * Open up a window for EDDB with a shopping list of our retrofit components
*/ */
_inaraShoppingList() { _eddbShoppingList() {
const { retrofitCosts } = this.state; const {} = this.state;
const { ship } = this.props; const { ship } = this.props;
// Provide unique list of non-PP module EDDB IDs to buy // Provide unique list of non-PP module EDDB IDs to buy
const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i); // const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
// Open up the relevant URL // Open up the relevant URL
window.open('https://inara.cz/inapi/corisearch.php?m=' + modIds.join(',')); // TODO:
// window.open('https://eddb.io/station?m=' + modIds.join(','));
}
/**
*
*/
_retrofitInfo() {
const { ship } = this.props;
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
const retrofitShip = this._buildRetrofitShip();
const currentModules = ship.getModules();
const oldModules = retrofitShip.getModules();
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
let modules = [];
let totalCost = 0;
const addModule = (m, costFactor) => {
const key = `${m.getItem()}@${m.getSlot()}`;
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
modules.push({
key, cost,
rating: m.getClassRating(),
item: m.readMeta('type'),
});
if (!excluded[key]) {
totalCost += cost;
}
};
for (let m of buyModules) {
addModule(m, 1);
}
for (let m of sellModules) {
addModule(m, -1);
}
let _sortF = undefined;
switch (predicate) {
case 'cr': _sortF = (o) => o.cost; break;
case 'm':
default: _sortF = (o) => o.item; break;
};
modules = sortBy(modules, _sortF);
if (desc) {
reverse(modules);
}
return [totalCost, modules];
} }
/** /**
@@ -346,59 +249,52 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_retrofitTab() { _retrofitTab() {
let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state; let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state;
const { termtip, tooltip } = this.context; const { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let int = formats.int; let int = formats.int;
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
for (let opt of this.state.buildOptions) {
options.push(<option key={opt} value={opt}>{opt}</option>);
}
if (retrofitCosts.length) {
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
let item = retrofitCosts[i];
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
</tr>);
}
} else {
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
}
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
return <div> return <div>
<div className='scroll-x'> <div className='scroll-x'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
{translate('net cost')} {translate('net cost')}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {retrofitInfo.length ?
retrofitInfo.map((info) => (
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
onClick={() => this._toggleExcluded(info.key)}>
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
<td className='le ptr shorten cap'>{translate(info.item)}</td>
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
{int(info.cost)}{units.CR}
</td>
</tr>
)) : (
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
)}
<tr className='ri'> <tr className='ri'>
<td className='lbl' ><button onClick={this._inaraShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td> <td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
<td colSpan='3' className='lbl' >{translate('cost')}</td> <td className='lbl' >{translate('cost')}</td>
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}> <td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
{int(retrofitTotal)}{units.CR} {int(retrofitTotal)}{units.CR}
</td> </td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td> <td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td>
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td> <td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td>
<td className='val' style={{ borderLeft:'none', padding: 0 }}> <td className='val' style={{ borderLeft:'none', padding: 0 }}>
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}> <select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
{options} <option key='stock' value=''>{translate('Stock')}</option>
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
</select> </select>
</td> </td>
</tr> </tr>
@@ -408,63 +304,50 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/** /**
* Update retrofit costs *
* @param {Ship} ship Ship instance * @param {*} modules
* @param {Ship} retrofitShip Retrofit Ship instance
*/ */
_updateRetrofit(ship, retrofitShip) { _ammoInfo() {
let retrofitCosts = []; const { ship } = this.props;
let retrofitTotal = 0, i, l, item; const { desc, predicate } = this.state;
if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) { let info = [{
item = { key: 'fuel',
buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating, item: 'Fuel',
buyId: ship.bulkheads.m.eddbID, qty: ship.get(FUEL_CAPACITY),
buyPp: ship.bulkheads.m.pp, unitCost: 50,
buyName: ship.bulkheads.m.name, cost: 50 * ship.get(FUEL_CAPACITY),
sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating, }];
sellName: retrofitShip.bulkheads.m.name, for (let m of ship.getModules()) {
netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost, const rebuilds = m.get('bays') * m.get('rebuildsperbay');
retroItem: retrofitShip.bulkheads const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds;
}; if (ammo) {
retrofitCosts.push(item); const unitCost = m.readMeta('ammocost');
if (retrofitShip.bulkheads.incCost) { info.push({
retrofitTotal += item.netCost; key: `restock_${m.getSlot()}`,
rating: m.getClassRating(),
item: m.readMeta('type'),
qty: ammo,
unitCost, cost: unitCost * ammo,
});
} }
} }
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) { let _sortF = undefined;
let retroSlotGroup = retrofitShip[g]; switch (predicate) {
let slotGroup = ship[g]; case 'cr': _sortF = (o) => o.cost; break;
for (i = 0, l = slotGroup.length; i < l; i++) { case 'qty': _sortF = (o) => o.qty; break;
const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null; case 'cost': _sortF = (o) => o.unitCost; break;
const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null; case 'm':
if (modId != retroModId) { default: _sortF = (o) => o.item;
item = { netCost: 0, retroItem: retroSlotGroup[i] }; }
if (slotGroup[i].m) { info = sortBy(info, _sortF);
item.buyId = slotGroup[i].m.eddbID, if (desc) {
item.buyPp = slotGroup[i].m.pp, reverse(info);
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
item.netCost = slotGroup[i].discountedCost;
}
if (retroSlotGroup[i].m) {
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
item.netCost -= retroSlotGroup[i].discountedCost;
}
retrofitCosts.push(item);
if (retroSlotGroup[i].incCost) {
retrofitTotal += item.netCost;
}
}
}
} }
this.setState({ retrofitCosts, retrofitTotal }); return info;
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
} }
/** /**
@@ -472,20 +355,24 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_ammoTab() { _ammoTab() {
let { ammoTotal, ammoCosts } = this.state; const { excluded } = this.state;
let { translate, formats, units } = this.context.language; const { translate, formats, units } = this.context.language;
let int = formats.int; const int = formats.int;
let rows = []; const rows = [];
for (let i = 0, l = ammoCosts.length; i < l; i++) { const ammoInfo = this._ammoInfo();
let item = ammoCosts[i]; let total = 0;
rows.push(<tr key={i} className='highlight'> for (let i of ammoInfo) {
<td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td> const disabled = excluded[i.key];
<td className='le shorten cap'>{slotName(translate, item)}</td> rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)}
<td className='ri'>{int(item.max)}</td> className={cn('highlight', { disabled })}>
<td className='ri'>{int(item.cost)}{units.CR}</td> <td style={{ width: '1em' }}>{i.rating}</td>
<td className='ri'>{int(item.total)}{units.CR}</td> <td className='le shorten cap'>{translate(i.item)}</td>
<td className='ri'>{int(i.qty)}</td>
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
<td className='ri'>{int(i.cost)}{units.CR}</td>
</tr>); </tr>);
total += disabled ? 0 : i.cost;
} }
return <div> return <div>
@@ -493,17 +380,17 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th>
<th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl' >{translate('total')}</td> <td colSpan='4' className='lbl' >{translate('total')}</td>
<td className='val'>{int(ammoTotal)}{units.CR}</td> <td className='val'>{int(total)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -511,103 +398,6 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/**
* Recalculate all ammo costs
* @param {Ship} ship Ship instance
*/
_updateAmmoCosts(ship) {
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
let slotGroup = ship[g];
for (let i = 0, l = slotGroup.length; i < l; i++) {
if (slotGroup[i].m) {
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
q = 0;
switch (slotGroup[i].m.grp) {
case 'fs': // Skip fuel calculation if scoop present
scoop = true;
break;
case 'scb':
q = slotGroup[i].m.getAmmo() + 1;
break;
case 'am':
q = slotGroup[i].m.getAmmo();
break;
case 'pv':
srvs += slotGroup[i].m.getBays();
break;
case 'fx': case 'hb': case 'cc': case 'pc':
limpets = ship.cargoCapacity;
break;
default:
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
}
// Calculate ammo costs only if a cost is specified
if (slotGroup[i].m.ammocost > 0) {
item = {
m: slotGroup[i].m,
max: q,
cost: slotGroup[i].m.ammocost,
total: q * slotGroup[i].m.ammocost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Add fighters
if (slotGroup[i].m.grp === 'fh') {
item = {
m: slotGroup[i].m,
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
cost: slotGroup[i].m.fightercost,
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
}
}
}
// Limpets if controllers exist and cargo space available
if (limpets > 0) {
item = {
m: { name: 'limpets', class: '', rating: '' },
max: ship.cargoCapacity,
cost: 101,
total: ship.cargoCapacity * 101
};
ammoCosts.push(item);
ammoTotal += item.total;
}
if (srvs > 0) {
item = {
m: { name: 'SRVs', class: '', rating: '' },
max: srvs,
cost: 1030,
total: srvs * 1030
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Calculate refuel costs if no scoop present
if (!scoop) {
item = {
m: { name: 'fuel', class: '', rating: '' },
max: ship.fuelCapacity,
cost: 50,
total: ship.fuelCapacity * 50
};
ammoCosts.push(item);
ammoTotal += item.total;
}
this.setState({ ammoTotal, ammoCosts });
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
}
/** /**
* Add listeners on mount and update costs * Add listeners on mount and update costs
*/ */
@@ -615,64 +405,7 @@ export default class CostSection extends TranslatedComponent {
this.listeners = [ this.listeners = [
Persist.addListener('discounts', this._onDiscountChanged.bind(this)), Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)), Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
]; ];
this._updateAmmoCosts(this.props.ship);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this._sortCost(this.props.ship);
}
/**
* Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context
*/
componentWillReceiveProps(nextProps, nextContext) {
let retrofitShip = this.state.retrofitShip;
if (nextProps.ship != this.props.ship) { // Ship has changed
let nextId = nextProps.ship.id;
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
this.setState({
retrofitShip,
retrofitName,
buildOptions: Persist.getBuildsNamesFor(nextId)
});
}
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
this._updateAmmoCosts(nextProps.ship);
this._updateRetrofit(nextProps.ship, retrofitShip);
this._sortCost(nextProps.ship);
}
}
/**
* Sort lists before render
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
let state = this.state;
switch (nextState.tab) {
case 'ammo':
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
}
break;
case 'retrofit':
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
}
break;
default:
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
}
}
} }
/** /**

View File

@@ -4,6 +4,8 @@ import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import VerticalBarChart from './VerticalBarChart'; import VerticalBarChart from './VerticalBarChart';
import autoBind from 'auto-bind';
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/ship-stats';
/** /**
* Defence information * Defence information
@@ -15,12 +17,10 @@ import VerticalBarChart from './VerticalBarChart';
*/ */
export default class Defence extends TranslatedComponent { export default class Defence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.object.isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
sys: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired
}; };
/** /**
@@ -29,22 +29,7 @@ export default class Defence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
this.state = { shield, armour, shielddamage, armourdamage };
}
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
this.setState({ shield, armour, shielddamage, armourdamage });
}
return true;
} }
/** /**
@@ -52,187 +37,104 @@ export default class Defence extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { opponent, sys, opponentWep } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { shield, armour, shielddamage, armourdamage } = this.state;
const pd = opponent.standard[4].m; const shields = ship.get(SHIELD_METRICS);
const shieldSourcesData = []; // Data for pie chart (absolute MJ)
const effectiveShieldData = []; const shieldSourcesData = [
const shieldDamageTakenData = []; 'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs',
const shieldSourcesTt = []; ].map((key) => { return { label: key, value: Math.round(shields[key]) }; });
const shieldDamageTakenAbsoluteTt = [];
const shieldDamageTakenExplosiveTt = [];
const shieldDamageTakenKineticTt = [];
const shieldDamageTakenThermalTt = [];
const effectiveShieldAbsoluteTt = [];
const effectiveShieldExplosiveTt = [];
const effectiveShieldKineticTt = [];
const effectiveShieldThermalTt = [];
let maxEffectiveShield = 0;
if (shield.total) {
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
shieldSourcesData.push({ value: Math.round(shield.addition), label: translate('shield addition') });
if (shield.generator > 0) { // Data for tooltip
shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); const shieldSourcesTt = shieldSourcesData.map((o) => {
effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); let { label, value } = o;
effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); return <div key={label}>
effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); {translate(label)} {formats.int(value)}{units.MJ}
effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); </div>;
if (shield.boosters > 0) { });
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
}
if (shield.cells > 0) { // Shield resistances
shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const shieldDamageTakenData = [
effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); 'absolute', 'explosive', 'kinetic', 'thermal',
effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); ].map((label) => {
effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const dmgMult = shields[label];
effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
} (label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
});
// Add effective shield from resistances // Effective MJ
const rawMj = shield.generator + shield.boosters + shield.cells; const effectiveShieldData = [
const explosiveMj = rawMj / (shield.explosive.base) - rawMj; 'absolute', 'explosive', 'kinetic', 'thermal'
if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>); ].map((label) => {
const kineticMj = rawMj / (shield.kinetic.base) - rawMj; const dmgMult = shields[label];
if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>); const raw = shields.withSCBs;
const thermalMj = rawMj / (shield.thermal.base) - rawMj; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>); (label) => <div key={label}>
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
</div>
);
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
});
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
// Add effective shield from power distributor SYS pips const armour = ship.get(ARMOUR_METRICS);
if (shield.absolute.sys != 1) { const moduleProtection = ship.get(MODULE_PROTECTION_METRICS);
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.total - rawMj)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.total - rawMj / shield.explosive.base)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.total - rawMj / shield.kinetic.base)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.total - rawMj / shield.thermal.base)}{units.MJ}</div>);
}
}
shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>); // Data for pie chart (absolute HP)
shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>); const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map(
shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>); (key) => { return { label: key, value: Math.round(armour[key]) }; }
);
shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>); // Data for tooltip
shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>); const armourSourcesTt = armourSourcesData.map((o) => {
shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>); let { label, value } = o;
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
});
shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>); // Armour resistances
shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>); const armourDamageTakenData = [
shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal', 'caustic',
].map((label) => {
const dmgMult = armour[label];
const tooltip = ['byAlloys', 'byHRPs'].map(
(label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
});
shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>); // Effective HP
shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>); const effectiveArmourData = [
shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal'
].map((label) => {
const effectiveAbsoluteShield = shield.total / shield.absolute.total; const dmgMult = armour[label];
effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt }); const raw = armour.armour;
const effectiveExplosiveShield = shield.total / shield.explosive.total; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt }); (label) => <div key={label}>
const effectiveKineticShield = shield.total / shield.kinetic.total; {translate(label)} {formats.int(raw * dmgMult[label])}
effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt }); </div>
const effectiveThermalShield = shield.total / shield.thermal.total; );
effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt }); return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip };
});
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
}
const armourSourcesData = [];
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
const armourSourcesTt = [];
const effectiveArmourAbsoluteTt = [];
const effectiveArmourExplosiveTt = [];
const effectiveArmourKineticTt = [];
const effectiveArmourThermalTt = [];
const effectiveArmourCausticTt = [];
if (armour.bulkheads > 0) {
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
if (armour.reinforcement > 0) {
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
}
}
const rawArmour = armour.bulkheads + armour.reinforcement;
const armourDamageTakenTt = [];
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
const armourDamageTakenExplosiveTt = [];
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
if (armour.explosive.total != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.explosive.total - rawArmour)}</div>);
const armourDamageTakenKineticTt = [];
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
if (armour.kinetic.total != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.kinetic.total - rawArmour)}</div>);
const armourDamageTakenThermalTt = [];
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.thermal.total - rawArmour)}</div>);
const armourDamageTakenCausticTt = [];
armourDamageTakenCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.caustic.bulkheads)}</div>);
armourDamageTakenCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.caustic.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourCausticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.caustic.total - rawArmour)}</div>);
const effectiveArmourData = [];
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
const effectiveKineticArmour = armour.total / armour.kinetic.total;
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
const effectiveThermalArmour = armour.total / armour.thermal.total;
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
const effectiveCausticArmour = armour.total / armour.caustic.total;
effectiveArmourData.push({ value: Math.round(effectiveCausticArmour), label: translate('caustic'), tooltip: effectiveArmourCausticTt });
const armourDamageTakenData = [];
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
armourDamageTakenData.push({ value: Math.round(armour.caustic.total * 100), label: translate('caustic'), tooltip: armourDamageTakenCausticTt });
return ( return (
<span id='defence'> <span id='defence'>
{shield.total ? <span> {shields.withSCBs ? <span>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('shield metrics')}</h2> <h2>{translate('shield metrics')}</h2>
<br/> <br/>
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2> <h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
@@ -250,11 +152,11 @@ export default class Defence extends TranslatedComponent {
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('armour metrics')}</h2> <h2>{translate('armour metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2> <h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2>
<br/> <br/>
</div> </div>
<div className='group quarter'> <div className='group quarter'>

View File

@@ -2,98 +2,58 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/stats/SpeedProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* Engine profile for a given ship * Engine profile for a given ship
*/ */
export default class EngineProfile extends TranslatedComponent { export default class EngineProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
}
return true;
}
/**
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
* @param {Object} ship The ship
* @param {Object} eng The number of pips to ENG
* @param {Object} boost If boost is enabled
* @param {Object} mass The mass at which to calculate the top speed
* @return {number} The maximum speed
*/
calcMaxSpeed(ship, eng, boost, mass) {
// Obtain the top speed
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
}
/** /**
* Render engine profile * Render engine profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, eng, fuel, boost } = this.props; const { code, ship, pips, boost } = this.props;
// Calculate bounds for our line chart // Calculate bounds for our line chart
const thrusters = ship.standard[1].m; const minMass = ship.readProp('hullmass');
const minMass = ship.calcLowestPossibleMass({ th: thrusters }); const maxMass = ship.getThrusters().get('enginemaximalmass');
const maxMass = thrusters.getMaxMass(); const baseSpeed = ship.readProp('speed');
const mass = ship.unladenMass + fuel + cargo; const baseBoost = getBoostMultiplier(ship);
const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false); const cb = (eng, boost, mass) => {
const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true); const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5];
// Add a mark at our current mass return baseSpeed * (boost ? baseBoost : 1) * mult;
const mark = Math.min(mass, maxMass); };
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother // This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minSpeed} yMin={cb(0, false, maxMass)}
yMax={maxSpeed} yMax={cb(4, true, minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum speed')} yLabel={translate('maximum speed')}
yUnit={translate('m/s')} yUnit={translate('m/s')}
func={this.state.calcMaxSpeedFunc} func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)}
points={1000} points={1000}
code={code} // Encode boost in code to re-render on state change
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
aspect={0.7} aspect={0.7}
/> />
); );

View File

@@ -3,46 +3,21 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import { calculateJumpRange } from 'ed-forge/lib/stats/JumpRangeProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* FSD profile for a given ship * FSD profile for a given ship
*/ */
export default class FSDProfile extends TranslatedComponent { export default class FSDProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
}
return true;
}
/** /**
* Calculate the maximum range for this ship across its applicable mass * Calculate the maximum range for this ship across its applicable mass
* @param {Object} ship The ship * @param {Object} ship The ship
@@ -60,36 +35,27 @@ export default class FSDProfile extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, fuel } = this.props; const { code, ship } = this.props;
// Calculate bounds for our line chart - use thruster info for X
const thrusters = ship.standard[1].m;
const fsd = ship.standard[2].m;
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
const maxMass = thrusters.getMaxMass();
const mass = ship.unladenMass + fuel + cargo;
const minRange = 0;
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump(), ship);
// Add a mark at our current mass
const mark = Math.min(mass, maxMass);
const code = ship.name + ship.toString() + '.' + fuel;
const minMass = ship.readProp('hullmass');
const maxMass = ship.getThrusters().get('enginemaximalmass');
const mass = ship.get(LADEN_MASS);
const cb = (mass) => calculateJumpRange(ship, mass, Infinity, true);
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minRange} yMin={0}
yMax={maxRange} yMax={cb(minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(mass, maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum range')} yLabel={translate('maximum range')}
yUnit={translate('LY')} yUnit={translate('LY')}
func={this.state.calcMaxRangeFunc} func={cb}
points={200} points={200}
code={code} code={code}
aspect={0.7} aspect={0.7}

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Fuel slider * Fuel slider
@@ -21,8 +22,7 @@ export default class Fuel extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._fuelChange = this._fuelChange.bind(this);
} }
/** /**

View File

@@ -1,152 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import {
DamageAbsolute,
DamageKinetic,
DamageThermal,
DamageExplosive,
MountFixed,
MountGimballed,
MountTurret,
ListModifications,
Modified
} from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Hardpoint / Utility Slot
*/
export default class HardpointSlot extends Slot {
/**
* Get the CSS class name for the slot.
* @return {string} CSS Class name
*/
_getClassNames() {
return this.props.maxClass > 0 ? 'hardpoint' : null;
}
/**
* Get the label for the slot
* @param {Function} translate Translate function
* @return {string} Label
*/
_getMaxClassLabel(translate) {
return translate(['U', 'S', 'M', 'L', 'H'][this.props.maxClass]);
}
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
let { drag, drop } = this.props;
let { termtip, tooltip } = this.context;
let validMods = Modifications.modules[m.grp].modifications || [];
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')}
onMouseOut={tooltip.bind(null, null)}><MountFixed/></span> : ''}
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')}
onMouseOut={tooltip.bind(null, null)}><MountGimballed/></span> : ''}
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')}
onMouseOut={tooltip.bind(null, null)}><MountTurret/></span> : ''}
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')}
onMouseOut={tooltip.bind(null, null)}><DamageKinetic/></span> : ''}
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')}
onMouseOut={tooltip.bind(null, null)}><DamageThermal/></span> : ''}
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')}
onMouseOut={tooltip.bind(null, null)}><DamageExplosive/></span> : ''}
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')}
onMouseOut={tooltip.bind(null, null)}><DamageAbsolute/></span> : ''}
{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r'
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}><Modified/></span> : null}
</div>
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
</div>
<div className={'cb'}>
{m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} {m.getClip() ?
<span>({formats.round1(m.getSDps())})</span> : null}</div> : null}
{m.getDamage() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getDamage() ? 'shotdmg' : 'shotdmg')}
onMouseOut={tooltip.bind(null, null)}>{translate('shotdmg')}: {formats.round1(m.getDamage())}</div> : null}
{m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')}
onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} {m.getClip() ?
<span>({formats.round1(m.getEps() * m.getSustainedFactor())}{u.MW})</span> : null}</div> : null}
{m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')}
onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} {m.getClip() ?
<span>({formats.round1(m.getHps() * m.getSustainedFactor())})</span> : null}</div> : null}
{m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null}
{m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')}
onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null}
{m.getRange() ? <div
className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null}
{m.getScanTime() ? <div
className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null}
{m.getFalloff() ? <div
className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null}
{m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null}
{m.getAmmo() ? <div
className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null}
{m.getReload() ? <div className={'l'}>{translate('wep_reload')}: {formats.round(m.getReload())}{u.s}</div> : null}
{m.getShotSpeed() ? <div
className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null}
{m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null}
{m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null}
{m.getScanAngle() ? <div className={'l'}>{translate('scan angle')}: {formats.f2(m.getScanAngle())}°</div> : null}
{m.getScanRange() ? <div className={'l'}>{translate('scan range')}: {formats.int(m.getScanRange())}{u.m}</div> : null}
{m.getMaxAngle() ? <div className={'l'}>{translate('max angle')}: {formats.f2(m.getMaxAngle())}°</div> : null}
{showModuleResistances && m.getExplosiveResistance() ? <div
className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null}
{showModuleResistances && m.getKineticResistance() ? <div
className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null}
{showModuleResistances && m.getThermalResistance() ? <div
className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null}
{m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null}
{m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null}
{m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={modButton => this.modButton = modButton}>
<button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}>
<ListModifications/></button>
</div> : null}
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,42 +1,29 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Hardpoint slot section * Hardpoint slot section
*/ */
export default class HardpointSlotSection extends SlotSection { export default class HardpointSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'hardpoints', 'hardpoints'); super(props, 'hardpoints');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'nl-F';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; // TODO:
this.props.ship.emptyWeapons(); // this.props.ship.emptyWeapons();
this.props.onChange();
this._close(); this._close();
} }
@@ -47,9 +34,8 @@ export default class HardpointSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fill(group, mount, event) { _fill(group, mount, event) {
this.selectedRefId = group + '-' + mount; // TODO:
this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt')); // this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
this.props.onChange();
this._close(); this._close();
} }
@@ -65,32 +51,24 @@ export default class HardpointSlotSection extends SlotSection {
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let slots = []; let slots = [];
let hardpoints = ship.hardpoints;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getHardpoints(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass) { key={h.object.Slot}
slots.push(<HardpointSlot maxClass={h.getSize()}
key={i} currentMenu={currentMenu}
maxClass={h.maxClass} drag={this._drag.bind(this, h)}
availableModules={() => availableModules.getHps(h.maxClass)} dragOver={this._dragOverSlot.bind(this, h)}
onOpen={this._openMenu.bind(this, h)} drop={this._drop}
onSelect={this._selectModule.bind(this, h)} dropClass={this._dropClass(h, originSlot, targetSlot)}
onChange={this.props.onChange} m={h}
selected={currentMenu == h} enabled={h.enabled ? true : false}
drag={this._drag.bind(this, h)} propsToShow={propsToShow}
dragOver={this._dragOverSlot.bind(this, h)} onPropToggle={onPropToggle}
drop={this._drop} />);
dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -101,68 +79,68 @@ export default class HardpointSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _fill = this._fill; let _fill = this._fill;
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex="0" onClick={this._empty} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('pl')}</div> <div className='select-group cap'>{translate('pl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('ul')}</div> <div className='select-group cap'>{translate('ul')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('bl')}</div> <div className='select-group cap'>{translate('bl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('mc')}</div> <div className='select-group cap'>{translate('mc')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('c')}</div> <div className='select-group cap'>{translate('c')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('fc')}</div> <div className='select-group cap'>{translate('fc')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'G')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('pa')}</div> <div className='select-group cap'>{translate('pa')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'pa', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pa-F'] = smRef}>{translate('pa')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'pa', 'F')}>{translate('pa')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rg')}</div> <div className='select-group cap'>{translate('rg')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'rg', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rg-F'] = smRef}>{translate('rg')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'rg', 'F')}>{translate('rg')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('nl')}</div> <div className='select-group cap'>{translate('nl')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'nl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['nl-F'] = smRef}>{translate('nl')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'nl', 'F')}>{translate('nl')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rfl')}</div> <div className='select-group cap'>{translate('rfl')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'F')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'T')}><MountTurret className='lg'/></li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -10,6 +10,7 @@ import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import { toDetailedExport } from '../shipyard/Serializer'; import { toDetailedExport } from '../shipyard/Serializer';
import Ship from '../shipyard/Ship'; import Ship from '../shipyard/Ship';
import ModalBatchOrbis from './ModalBatchOrbis';
import ModalDeleteAll from './ModalDeleteAll'; import ModalDeleteAll from './ModalDeleteAll';
import ModalExport from './ModalExport'; import ModalExport from './ModalExport';
import ModalHelp from './ModalHelp'; import ModalHelp from './ModalHelp';
@@ -55,12 +56,11 @@ function selectAll(e) {
* Coriolis App Header section / menus * Coriolis App Header section / menus
*/ */
export default class Header extends TranslatedComponent { export default class Header extends TranslatedComponent {
/**
/** * Constructor
* Constructor * @param {Object} props React Component properties
* @param {Object} props React Component properties * @param {Object} context React Component context
* @param {Object} context React Component context */
*/
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this.shipOrder = Object.keys(Ships).sort(); this.shipOrder = Object.keys(Ships).sort();
@@ -240,6 +240,43 @@ export default class Header extends TranslatedComponent {
/>); />);
}; };
/**
* Uploads all ship-builds to orbis
* @param {e} e Event
*/
_uploadAllBuildsToOrbis(e) {
e.preventDefault();
const data = Persist.getBuilds();
let postObject = [];
for (const ship in data) {
for (const code in data[ship]) {
const shipModel = ship;
if (!shipModel) {
throw 'No such ship found: "' + ship + '"';
}
const shipTemplate = Ships[shipModel];
const shipPostObject = {};
let shipInstance = new Ship(shipModel, shipTemplate.properties, shipTemplate.slots);
shipInstance.buildWith(null);
shipInstance.buildFrom(data[ship][code]);
shipPostObject.coriolisId = shipInstance.id;
shipPostObject.coriolisShip = shipInstance;
shipPostObject.coriolisShip.url = window.location.origin + outfitURL(shipModel, data[ship][code], code);
shipPostObject.title = code || shipInstance.id;
shipPostObject.description = code || shipInstance.id;
shipPostObject.ShipName = shipInstance.id;
shipPostObject.Ship = shipInstance.id;
postObject.push(shipPostObject);
}
}
console.log(postObject);
this.context.showModal(<ModalBatchOrbis
ships={postObject}
/>);
}
/** /**
* Show export modal with detailed export * Show export modal with detailed export
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} e Event
@@ -388,18 +425,14 @@ export default class Header extends TranslatedComponent {
if (this.props.announcements) { if (this.props.announcements) {
announcements = []; announcements = [];
for (let announce of this.props.announcements) { for (let announce of this.props.announcements) {
// Announcement has expired, skip it announcements.push(<Announcement text={announce.message} />);
if (Date.now() > Date.parse(announce.expiry)) {
continue;
}
// Add announcements which have not expired to the menu
announcements.push(<Announcement text={announce.text} />);
announcements.push(<hr/>); announcements.push(<hr/>);
} }
} }
return ( return (
<div className='menu-list' onClick={ (e) => e.stopPropagation() } style={{ whiteSpace: 'nowrap' }}> <div className='menu-list' onClick={ (e) => e.stopPropagation() } style={{ whiteSpace: 'nowrap' }}>
{announcements} {announcements}
<hr />
</div> </div>
); );
} }
@@ -462,6 +495,7 @@ export default class Header extends TranslatedComponent {
{translate('builds')} & {translate('comparisons')} {translate('builds')} & {translate('comparisons')}
<li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li> <li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li> <li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li>
<li><Link href="#" className='block' onClick={this._uploadAllBuildsToOrbis.bind(this)}>{translate('upload all builds to orbis')}</Link></li>
<li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li> <li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li> <li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li>
</ul> </ul>
@@ -474,7 +508,7 @@ export default class Header extends TranslatedComponent {
<td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td> <td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td>
</tr> </tr>
<tr> <tr>
<td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td> <td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -573,7 +607,7 @@ export default class Header extends TranslatedComponent {
</div> </div>
<div className='l menu'> <div className='l menu'>
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0})} onClick={this.props.announcements.length !== 0 && this._openAnnounce}> <div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0 })} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
<span className='menu-item-label'>{translate('announcements')}</span> <span className='menu-item-label'>{translate('announcements')}</span>
</div> </div>
{openedMenu == 'announce' ? this._getAnnouncementsMenu() : null} {openedMenu == 'announce' ? this._getAnnouncementsMenu() : null}
@@ -604,5 +638,4 @@ export default class Header extends TranslatedComponent {
</header> </header>
); );
} }
} }

View File

@@ -1,99 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Internal Slot
*/
export default class InternalSlot extends Slot {
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = m.class + m.rating;
let { drag, drop, ship } = this.props;
let { termtip, tooltip } = this.context;
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
let mass = m.getMass() || m.cargo || m.fuel || 0;
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
<div className={'r'}>{formats.round(mass)}{u.T}</div>
</div>
<div className={'cb'}>
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs}&nbsp;&nbsp;&nbsp;{translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
{ m.grp === 'gsrp' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.grp === 'gfsb' ? <div className={'l'}>{translate('jump addition')}: {formats.f1(m.getJumpBoost())}{u.LY}</div> : null }
{ m.grp === 'gs' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
{ m.rangeLS === null ? <div className={'l'}>{u.Ls}</div> : null }
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ showModuleResistances && m.getCausticResistance() ? <div className='l'>{translate('causres')}: {formats.pct(m.getCausticResistance())}</div> : null }
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
{ m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,52 +1,30 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import InternalSlot from './InternalSlot'; import Slot from './Slot';
import * as ModuleUtils from '../shipyard/ModuleUtils'; import * as ModuleUtils from '../shipyard/ModuleUtils';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions'; import { canMount } from '../utils/SlotFunctions';
import autoBind from 'auto-bind';
/** /**
* Internal slot section * Internal slot section
*/ */
export default class InternalSlotSection extends SlotSection { export default class InternalSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'internal', 'optional internal'); super(props, 'optional internal');
this._empty = this._empty.bind(this); autoBind(this);
this._fillWithCargo = this._fillWithCargo.bind(this);
this._fillWithCells = this._fillWithCells.bind(this);
this._fillWithArmor = this._fillWithArmor.bind(this);
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = this.sectionRefArr['pcq'] ? 'pcq' : 'pcm';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; // TODO:
this.props.ship.emptyInternal(); // this.props.ship.emptyInternal();
this.props.onChange();
this._close(); this._close();
} }
@@ -55,7 +33,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCargo(event) { _fillWithCargo(event) {
this.selectedRefId = 'cargo';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -63,7 +40,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E')); ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -72,7 +48,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFuelTanks(event) { _fillWithFuelTanks(event) {
this.selectedRefId = 'ft';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -80,7 +55,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C')); ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -89,7 +63,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithLuxuryCabins(event) { _fillWithLuxuryCabins(event) {
this.selectedRefId = 'pcq';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -97,7 +70,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -106,7 +78,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFirstClassCabins(event) { _fillWithFirstClassCabins(event) {
this.selectedRefId = 'pcm';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -114,7 +85,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -123,7 +93,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithBusinessClassCabins(event) { _fillWithBusinessClassCabins(event) {
this.selectedRefId = 'pci';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -131,7 +100,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -140,7 +108,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithEconomyClassCabins(event) { _fillWithEconomyClassCabins(event) {
this.selectedRefId = 'pce';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -148,7 +115,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6 ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -157,7 +123,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCells(event) { _fillWithCells(event) {
this.selectedRefId = 'scb';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
let chargeCap = 0; // Capacity of single activation let chargeCap = 0; // Capacity of single activation
@@ -168,7 +133,6 @@ export default class InternalSlotSection extends SlotSection {
chargeCap += slot.m.recharge; chargeCap += slot.m.recharge;
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -177,7 +141,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithArmor(event) { _fillWithArmor(event) {
this.selectedRefId = 'hr';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -185,7 +148,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -194,7 +156,6 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithModuleReinforcementPackages(event) { _fillWithModuleReinforcementPackages(event) {
this.selectedRefId = 'mrp';
let clobber = event.getModifierState('Alt'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship; let ship = this.props.ship;
ship.internal.forEach((slot) => { ship.internal.forEach((slot) => {
@@ -202,7 +163,6 @@ export default class InternalSlotSection extends SlotSection {
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
} }
}); });
this.props.onChange();
this._close(); this._close();
} }
@@ -219,31 +179,20 @@ export default class InternalSlotSection extends SlotSection {
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { currentMenu, ship } = this.props; let { currentMenu, ship, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let { internal, fuelCapacity } = ship;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = internal.length; i < l; i++) { for (const m of ship.getInternals(undefined, true)) {
let s = internal[i]; slots.push(<Slot
key={m.object.Slot}
slots.push(<InternalSlot currentMenu={currentMenu}
key={i} m={m}
maxClass={s.maxClass} drag={this._drag.bind(this, m)}
availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)} dragOver={this._dragOverSlot.bind(this, m)}
onOpen={this._openMenu.bind(this,s)}
onChange={this.props.onChange}
onSelect={this._selectModule.bind(this, s)}
selected={currentMenu == s}
eligible={s.eligible}
m={s.m}
drag={this._drag.bind(this, s)}
dragOver={this._dragOverSlot.bind(this, s)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(s, originSlot, targetSlot)} dropClass={this._dropClass(m, originSlot, targetSlot)}
fuel={fuelCapacity} propsToShow={propsToShow}
ship={ship} onPropToggle={onPropToggle}
enabled={s.enabled ? true : false}
/>); />);
} }
@@ -256,22 +205,23 @@ export default class InternalSlotSection extends SlotSection {
* @param {Function} ship The ship * @param {Function} ship The ship
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate, ship) { _getSectionMenu() {
const { ship } = this.props;
const { translate } = this.context.language;
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCargo} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['cargo'] = smRef}>{translate('cargo')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCells} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['scb'] = smRef}>{translate('scb')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithArmor} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hr'] = smRef}>{translate('hr')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mrp'] = smRef}>{translate('mrp')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ft'] = smRef}>{translate('ft')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pce'] = smRef}>{translate('pce')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pci'] = smRef}>{translate('pci')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown} ref={smRef => this.sectionRefArr['pcm'] = smRef}>{translate('pcm')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li>
{ ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pcq'] = smRef}>{translate('pcq')}</li> : ''} { ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -57,7 +57,7 @@ export default class JumpRange extends TranslatedComponent {
const fuel = this.state.fuelLevel * ship.fuelCapacity; const fuel = this.state.fuelLevel * ship.fuelCapacity;
// Obtain the jump range // Obtain the jump range
return Calc.jumpRange(ship.unladenMass + cargo, fsd, fuel, ship); return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel, ship);
} }
/** /**

View File

@@ -1,281 +1,275 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
/**
* Line Chart /**
*/ * Line Chart
export default class LineChart extends TranslatedComponent { */
export default class LineChart extends TranslatedComponent {
static defaultProps = { static defaultProps = {
code: '', code: '',
xMin: 0, xMin: 0,
yMin: 0, yMin: 0,
points: 20, points: 20,
colors: ['#ff8c0d'], colors: ['#ff8c0d'],
aspect: 0.5 aspect: 0.5
}; };
static propTypes = { static propTypes = {
func: PropTypes.func.isRequired, func: PropTypes.func.isRequired,
xLabel: PropTypes.string.isRequired, xLabel: PropTypes.string.isRequired,
xMin: PropTypes.number, xMin: PropTypes.number,
xMax: PropTypes.number.isRequired, xMax: PropTypes.number.isRequired,
xUnit: PropTypes.string.isRequired, xUnit: PropTypes.string.isRequired,
xMark: PropTypes.number, xMark: PropTypes.number,
yLabel: PropTypes.string.isRequired, yLabel: PropTypes.string.isRequired,
yMin: PropTypes.number, yMin: PropTypes.number,
yMax: PropTypes.number.isRequired, yMax: PropTypes.number.isRequired,
yUnit: PropTypes.string, yUnit: PropTypes.string,
series: PropTypes.array, series: PropTypes.array,
colors: PropTypes.array, colors: PropTypes.array,
points: PropTypes.number, points: PropTypes.number,
aspect: PropTypes.number, aspect: PropTypes.number,
code: PropTypes.string, code: PropTypes.string,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateSeries = this._updateSeries.bind(this); const series = props.series;
this._tooltip = this._tooltip.bind(this);
this._showTip = this._showTip.bind(this); let xScale = d3.scaleLinear();
this._hideTip = this._hideTip.bind(this); let yScale = d3.scaleLinear();
this._moveTip = this._moveTip.bind(this); let xAxisScale = d3.scaleLinear();
const series = props.series; this.xAxis = d3.axisBottom(xAxisScale).tickSizeOuter(0);
this.yAxis = d3.axisLeft(yScale).ticks(6).tickSizeOuter(0);
let xScale = d3.scaleLinear();
let yScale = d3.scaleLinear(); this.state = {
let xAxisScale = d3.scaleLinear(); xScale,
xAxisScale,
this.xAxis = d3.axisBottom(xAxisScale).tickSizeOuter(0); yScale,
this.yAxis = d3.axisLeft(yScale).ticks(6).tickSizeOuter(0); tipHeight: 2 + (1.2 * (series ? series.length : 0.8)),
};
this.state = { }
xScale,
xAxisScale, /**
yScale, * Update tooltip content
tipHeight: 2 + (1.2 * (series ? series.length : 0.8)), * @param {number} xPos x coordinate
}; * @param {number} width current container width
} */
_tooltip(xPos, width) {
/** let { xLabel, yLabel, xUnit, yUnit, func, series } = this.props;
* Update tooltip content let { xScale, yScale } = this.state;
* @param {number} xPos x coordinate let { formats, translate } = this.context.language;
* @param {number} width current container width let x0 = xScale.invert(xPos),
*/ y0 = func(x0),
_tooltip(xPos, width) { tips = this.tipContainer,
let { xLabel, yLabel, xUnit, yUnit, func, series } = this.props; yTotal = 0,
let { xScale, yScale } = this.state; flip = (xPos / width > 0.50),
let { formats, translate } = this.context.language; tipWidth = 0,
let x0 = xScale.invert(xPos), tipHeightPx = tips.selectAll('rect').node().getBoundingClientRect().height;
y0 = func(x0),
tips = this.tipContainer,
yTotal = 0, xPos = xScale(x0); // Clamp xPos
flip = (xPos / width > 0.50),
tipWidth = 0, tips.selectAll('text.text-tip.y').text(function(d, i) {
tipHeightPx = tips.selectAll('rect').node().getBoundingClientRect().height; let yVal = series ? y0[series[i]] : y0;
yTotal += yVal;
return (series ? translate(series[i]) : '') + ' ' + formats.f2(yVal);
xPos = xScale(x0); // Clamp xPos }).append('tspan').attr('class', 'metric').text(yUnit ? ' ' + yUnit : '');
tips.selectAll('text.text-tip.y').text(function(d, i) { tips.selectAll('text').each(function() {
let yVal = series ? y0[series[i]] : y0; if (this.getBBox().width > tipWidth) {
yTotal += yVal; tipWidth = Math.ceil(this.getBBox().width);
return (series ? translate(series[i]) : '') + ' ' + formats.f2(yVal); }
}).append('tspan').attr('class', 'metric').text(yUnit ? ' ' + yUnit : ''); });
tips.selectAll('text').each(function() { let tipY = Math.floor(yScale(yTotal / (series ? series.length : 1)) - (tipHeightPx / 2));
if (this.getBBox().width > tipWidth) {
tipWidth = Math.ceil(this.getBBox().width); tipWidth += 8;
} tips.attr('transform', 'translate(' + xPos + ',' + tipY + ')');
}); tips.selectAll('text.text-tip').attr('x', flip ? -12 : 12).style('text-anchor', flip ? 'end' : 'start');
tips.selectAll('text.text-tip.x').text(formats.f2(x0)).append('tspan').attr('class', 'metric').text(' ' + xUnit);
let tipY = Math.floor(yScale(yTotal / (series ? series.length : 1)) - (tipHeightPx / 2)); tips.selectAll('rect').attr('width', tipWidth + 4).attr('x', flip ? -tipWidth - 12 : 8).attr('y', 0).style('text-anchor', flip ? 'end' : 'start');
this.markersContainer.selectAll('circle').attr('cx', xPos).attr('cy', (d, i) => yScale(series ? y0[series[i]] : y0));
tipWidth += 8; }
tips.attr('transform', 'translate(' + xPos + ',' + tipY + ')');
tips.selectAll('text.text-tip').attr('x', flip ? -12 : 12).style('text-anchor', flip ? 'end' : 'start'); /**
tips.selectAll('text.text-tip.x').text(formats.f2(x0)).append('tspan').attr('class', 'metric').text(' ' + xUnit); * Update dimensions based on properties and scale
tips.selectAll('rect').attr('width', tipWidth + 4).attr('x', flip ? -tipWidth - 12 : 8).attr('y', 0).style('text-anchor', flip ? 'end' : 'start'); * @param {Object} props React Component properties
this.markersContainer.selectAll('circle').attr('cx', xPos).attr('cy', (d, i) => yScale(series ? y0[series[i]] : y0)); * @param {number} scale size ratio / scale
} * @param {number} width current width of the container
* @returns {Object} calculated dimensions
/** */
* Update dimensions based on properties and scale _updateDimensions(props, scale, width) {
* @param {Object} props React Component properties const { xMax, xMin, yMin, yMax } = props;
* @param {number} scale size ratio / scale const innerWidth = width - MARGIN.left - MARGIN.right;
* @param {number} width current width of the container const outerHeight = Math.round(width * props.aspect);
* @returns {Object} calculated dimensions const innerHeight = outerHeight - MARGIN.top - MARGIN.bottom;
*/
_updateDimensions(props, scale, width) { this.state.xScale.range([0, innerWidth]).domain([xMin, xMax || 1]).clamp(true);
const { xMax, xMin, yMin, yMax } = props; this.state.xAxisScale.range([0, innerWidth]).domain([xMin, xMax]).clamp(true);
const innerWidth = width - MARGIN.left - MARGIN.right; this.state.yScale.range([innerHeight, 0]).domain([yMin, yMax + (yMax - yMin) * 0.1]); // 10% higher than maximum value for tooltip visibility
const outerHeight = Math.round(width * props.aspect); return { innerWidth, outerHeight, innerHeight };
const innerHeight = outerHeight - MARGIN.top - MARGIN.bottom; }
this.state.xScale.range([0, innerWidth]).domain([xMin, xMax || 1]).clamp(true); /**
this.state.xAxisScale.range([0, innerWidth]).domain([xMin, xMax]).clamp(true); * Show tooltip
this.state.yScale.range([innerHeight, 0]).domain([yMin, yMax + (yMax - yMin) * 0.1]); // 10% higher than maximum value for tooltip visibility * @param {SyntheticEvent} e Event
return { innerWidth, outerHeight, innerHeight }; */
} _showTip(e) {
e.preventDefault();
/** this.tipContainer.style('display', null);
* Show tooltip this.markersContainer.style('display', null);
* @param {SyntheticEvent} e Event this._moveTip(e);
*/ }
_showTip(e) {
e.preventDefault(); /**
this.tipContainer.style('display', null); * Move and update tooltip
this.markersContainer.style('display', null); * @param {SyntheticEvent} e Event
this._moveTip(e); * @param {number} width current container width
} */
_moveTip(e, width) {
/** let clientX = e.touches ? e.touches[0].clientX : e.clientX;
* Move and update tooltip this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left), width);
* @param {SyntheticEvent} e Event }
* @param {number} width current container width
*/ /**
_moveTip(e, width) { * Hide tooltip
let clientX = e.touches ? e.touches[0].clientX : e.clientX; * @param {SyntheticEvent} e Event
this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left), width); */
} _hideTip(e) {
e.preventDefault();
/** this.tipContainer.style('display', 'none');
* Hide tooltip this.markersContainer.style('display', 'none');
* @param {SyntheticEvent} e Event }
*/
_hideTip(e) { /**
e.preventDefault(); * Update series generated from props
this.tipContainer.style('display', 'none'); * @param {Object} props React Component properties
this.markersContainer.style('display', 'none'); * @param {Object} state React Component state
} */
_updateSeries(props, state) {
/** let { func, xMin, xMax, series, points } = props;
* Update series generated from props let delta = (xMax - xMin) / points;
* @param {Object} props React Component properties let seriesData = new Array(points);
* @param {Object} state React Component state
*/ if (delta) {
_updateSeries(props, state) { seriesData = new Array(points);
let { func, xMin, xMax, series, points } = props; for (let i = 0, x = xMin; i < points; i++) {
let delta = (xMax - xMin) / points; seriesData[i] = [x, func(x)];
let seriesData = new Array(points); x += delta;
}
if (delta) { seriesData[points - 1] = [xMax, func(xMax)];
seriesData = new Array(points); } else {
for (let i = 0, x = xMin; i < points; i++) { let yVal = func(xMin);
seriesData[i] = [x, func(x)]; seriesData = [[0, yVal], [1, yVal]];
x += delta; }
}
seriesData[points - 1] = [xMax, func(xMax)]; const markerElems = [];
} else { const detailElems = [<text key='lbl' className='text-tip x' y='1.25em'/>];
let yVal = func(xMin); const seriesLines = [];
seriesData = [[0, yVal], [1, yVal]]; for (let i = 0, l = series ? series.length : 1; i < l; i++) {
} const yAccessor = series ? function(d) { return state.yScale(d[1][this]); }.bind(series[i]) : (d) => state.yScale(d[1]);
seriesLines.push(d3.line().x((d, i) => this.state.xScale(d[0])).y(yAccessor));
const markerElems = []; detailElems.push(<text key={i} className='text-tip y' strokeWidth={0} fill={props.colors[i]} y={1.25 * (i + 2) + 'em'}/>);
const detailElems = [<text key='lbl' className='text-tip x' y='1.25em'/>]; markerElems.push(<circle key={i} className='marker' r='4' />);
const seriesLines = []; }
for (let i = 0, l = series ? series.length : 1; i < l; i++) {
const yAccessor = series ? function(d) { return state.yScale(d[1][this]); }.bind(series[i]) : (d) => state.yScale(d[1]); const tipHeight = 2 + (1.2 * (seriesLines ? seriesLines.length : 0.8));
seriesLines.push(d3.line().x((d, i) => this.state.xScale(d[0])).y(yAccessor));
detailElems.push(<text key={i} className='text-tip y' strokeWidth={0} fill={props.colors[i]} y={1.25 * (i + 2) + 'em'}/>); this.setState({ markerElems, detailElems, seriesLines, seriesData, tipHeight });
markerElems.push(<circle key={i} className='marker' r='4' />); }
}
/**
const tipHeight = 2 + (1.2 * (seriesLines ? seriesLines.length : 0.8)); * Update dimensions and series data based on props and context.
*/
this.setState({ markerElems, detailElems, seriesLines, seriesData, tipHeight }); componentWillMount() {
} this._updateSeries(this.props, this.state);
}
/**
* Update dimensions and series data based on props and context. /**
*/ * Update state based on property and context changes
componentWillMount() { * @param {Object} nextProps Incoming/Next properties
this._updateSeries(this.props, this.state); * @param {Object} nextContext Incoming/Next conext
} */
componentWillReceiveProps(nextProps, nextContext) {
/** const props = this.props;
* Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties if (props.code != nextProps.code) {
* @param {Object} nextContext Incoming/Next conext this._updateSeries(nextProps, this.state);
*/ }
componentWillReceiveProps(nextProps, nextContext) { }
const props = this.props;
/**
if (props.code != nextProps.code) { * Render the chart
this._updateSeries(nextProps, this.state); * @return {React.Component} Chart SVG
} */
} render() {
return (
/** <ContainerDimensions>
* Render the chart { ({ width, height }) => {
* @return {React.Component} Chart SVG const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio, width, height);
*/ const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props;
render() { const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state;
return ( const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse();
<ContainerDimensions>
{ ({ width, height }) => { const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0;
const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio, width, height); const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : '';
const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props; return (
const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state; <div width={width} height={height}>
const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse(); <svg style={{ width: '100%', height: outerHeight }}>
<g transform={`translate(${MARGIN.left},${MARGIN.top})`}>
const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0; <g>{xmark}</g>
const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : ''; <g>{lines}</g>
return ( <g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}>
<div width={width} height={height}> <text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}>
<svg style={{ width: '100%', height: outerHeight }}> <tspan>{xLabel}</tspan>
<g transform={`translate(${MARGIN.left},${MARGIN.top})`}> <tspan className='metric'> ({xUnit})</tspan>
<g>{xmark}</g> </text>
<g>{lines}</g> </g>
<g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}> <g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}>
<text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}> <text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}>
<tspan>{xLabel}</tspan> <tspan>{yLabel}</tspan>
<tspan className='metric'> ({xUnit})</tspan> { yUnit && <tspan className='metric'> ({yUnit})</tspan> }
</text> </text>
</g> </g>
<g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}> <g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}>
<text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}> <rect className='tooltip' height={tipHeight + 'em'}></rect>
<tspan>{yLabel}</tspan> {detailElems}
{ yUnit && <tspan className='metric'> ({yUnit})</tspan> } </g>
</text> <g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}>
</g> {markerElems}
<g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}> </g>
<rect className='tooltip' height={tipHeight + 'em'}></rect> <rect
{detailElems} fillOpacity='0'
</g> height={innerHeight}
<g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}> width={innerWidth + 1}
{markerElems} onMouseEnter={this._showTip}
</g> onTouchStart={this._showTip}
<rect onMouseLeave={this._hideTip}
fillOpacity='0' onTouchEnd={this._hideTip}
height={innerHeight} onMouseMove={e => this._moveTip(e, width)}
width={innerWidth + 1} onTouchMove={e => this._moveTip(e, width)}
onMouseEnter={this._showTip} />
onTouchStart={this._showTip} </g>
onMouseLeave={this._hideTip} </svg>
onTouchEnd={this._hideTip} </div>
onMouseMove={e => this._moveTip(e, width)} );
onTouchMove={e => this._moveTip(e, width)} }}
/> </ContainerDimensions>
</g> );
</svg> }
</div> }
);
}}
</ContainerDimensions>
);
}
}

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Link wrapper component * Link wrapper component
*/ */
export default class Link extends React.Component { export default class Link extends React.Component {
static propTypes = { static propTypes = {
children: PropTypes.any, children: PropTypes.any,
href: PropTypes.string.isRequired, href: PropTypes.string.isRequired,
@@ -56,5 +55,4 @@ export default class Link extends React.Component {
render() { render() {
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>; return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
} }
} }

View File

@@ -0,0 +1,92 @@
import React from 'react';
import PropTypes from 'prop-types';
import request from 'superagent';
import TranslatedComponent from './TranslatedComponent';
import { orbisUpload } from '../utils/ShortenUrl';
import Persist from '../stores/Persist';
/**
* Permalink modal
*/
export default class ModalBatchOrbis extends TranslatedComponent {
static propTypes = {
ships: PropTypes.any.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this.state = {
orbisCreds: Persist.getOrbisCreds(),
resp: ''
};
}
/**
* Send ship to Orbis.zone
* @param {SyntheticEvent} e React Event
* @return {Promise} Promise sending post request to orbis
*/
sendToOrbis(e) {
let agent;
try {
agent = request.agent(); // apparently this crashes somehow
} catch (e) {
console.error(e);
}
if (!agent) {
agent = request;
}
const API_ORBIS = 'https://orbis.zone/api/builds/add/batch';
return new Promise((resolve, reject) => {
try {
agent
.post(API_ORBIS)
.withCredentials()
.redirects(0)
.set('Content-Type', 'application/json')
.send(this.props.ships)
.end((err, response) => {
console.log(response);
if (err) {
console.error(err);
this.setState({ resp: response.text });
reject('Bad Request');
} else {
this.setState({ resp: 'All builds uploaded. Check https://orbis.zone' });
resolve('All builds uploaded. Check https://orbis.zone');
}
});
} catch (e) {
console.log(e);
reject(e.message ? e.message : e);
}
});
}
/**
* Render the modal
* @return {React.Component} Modal Content
*/
render() {
let translate = this.context.language.translate;
this.sendToOrbis = this.sendToOrbis.bind(this);
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h2>{translate('permalink')}</h2>
<br/>
<a className='button' href="https://orbis.zone/api/auth">Log in / signup to Orbis</a>
<br/><br/>
<h3 >{translate('success')}</h3>
<input value={this.state.resp} readOnly size={25} onFocus={ (e) => e.target.select() }/>
<br/><br/>
<p>Orbis.zone is currently in a trial period, and may be wiped at any time as development progresses. Some elements are also still placeholders.</p>
<button className={'l cb dismiss cap'} disabled={!!this.state.failed} onClick={this.sendToOrbis}>{translate('PHASE_UPLOAD_ORBIS')}</button>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>;
}
}

View File

@@ -21,7 +21,6 @@ function buildComparator(a, b) {
* Compare builds modal * Compare builds modal
*/ */
export default class ModalCompare extends TranslatedComponent { export default class ModalCompare extends TranslatedComponent {
static propTypes = { static propTypes = {
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
builds: PropTypes.array builds: PropTypes.array
@@ -105,8 +104,8 @@ export default class ModalCompare extends TranslatedComponent {
let selectedBuilds = usedBuilds.map((build, i) => let selectedBuilds = usedBuilds.map((build, i) =>
<tr key={i} onClick={this._removeBuild.bind(this, i)}> <tr key={i} onClick={this._removeBuild.bind(this, i)}>
<td className='tl'>{build.name}</td>< <td className='tl'>{build.name}</td>
td className='tl'>{build.buildName}</td> <td className='tl'>{build.buildName}</td>
</tr> </tr>
); );

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Export Modal * Export Modal
*/ */
export default class ModalExport extends TranslatedComponent { export default class ModalExport extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string, title: PropTypes.string,
generator: PropTypes.func, generator: PropTypes.func,

View File

@@ -7,19 +7,10 @@ import TranslatedComponent from './TranslatedComponent';
* Help Modal * Help Modal
*/ */
export default class ModalHelp extends TranslatedComponent { export default class ModalHelp extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string title: PropTypes.string
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render the modal * Render the modal
* @return {React.Component} Modal Content * @return {React.Component} Modal Content

View File

@@ -11,8 +11,7 @@ import * as ModuleUtils from '../shipyard/ModuleUtils';
import { fromDetailedBuild } from '../shipyard/Serializer'; import { fromDetailedBuild } from '../shipyard/Serializer';
import { Download } from './SvgIcons'; import { Download } from './SvgIcons';
import { outfitURL } from '../utils/UrlGenerators'; import { outfitURL } from '../utils/UrlGenerators';
import { shipFromJson, shipModelFromJson } from '../utils/CompanionApiUtils'; import * as CompanionApiUtils from '../utils/CompanionApiUtils';
import { shipFromLoadoutJSON } from '../utils/JournalUtils';
const zlib = require('pako'); const zlib = require('pako');
@@ -86,10 +85,7 @@ function detailedJsonToBuild(detailedBuild) {
* Import Modal * Import Modal
*/ */
export default class ModalImport extends TranslatedComponent { export default class ModalImport extends TranslatedComponent {
static propTypes = { static propTypes = {
importString: PropTypes.string, // Optional: Default data for import modal
builds: PropTypes.object, // Optional: Import object builds: PropTypes.object, // Optional: Import object
}; };
@@ -108,7 +104,7 @@ export default class ModalImport extends TranslatedComponent {
shipDiscount: null, shipDiscount: null,
moduleDiscount: null, moduleDiscount: null,
errorMsg: null, errorMsg: null,
importString: props.importString || null, importString: null,
importValid: false, importValid: false,
insurance: null insurance: null
}; };
@@ -132,7 +128,7 @@ export default class ModalImport extends TranslatedComponent {
if (data && data.Ship && data.Modules) { if (data && data.Ship && data.Modules) {
const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' }); const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' });
let compressed = btoa(deflated); let compressed = btoa(deflated);
this.setState({loadoutEvent: compressed}); this.setState({ loadoutEvent: compressed });
} else { } else {
throw 'Loadout event must contain Ship and Modules'; throw 'Loadout event must contain Ship and Modules';
} }
@@ -216,8 +212,8 @@ export default class ModalImport extends TranslatedComponent {
* @throws {string} if parse/import fails * @throws {string} if parse/import fails
*/ */
_importCompanionApiBuild(build) { _importCompanionApiBuild(build) {
const shipModel = shipModelFromJson(build); const shipModel = CompanionApiUtils.shipModelFromJson(build);
const ship = shipFromJson(build); const ship = CompanionApiUtils.shipFromJson(build);
let builds = {}; let builds = {};
builds[shipModel] = {}; builds[shipModel] = {};
@@ -323,30 +319,6 @@ export default class ModalImport extends TranslatedComponent {
this.setState({ builds, singleBuild: true }); this.setState({ builds, singleBuild: true });
} }
/**
* Import SLEF formatted builds. Sets state to a map of the builds on success
* and flags if there was only a single build.
*
* @param {string} importData - Array of the list of builds.
* @throws {string} If parse / import fails
*/
_importSlefBuilds(importData) {
const builds = importData.reduce((memo, { data }) => {
const shipModel = shipModelFromJson(data);
const ship = shipFromLoadoutJSON(data);
const shipTemplate = Ships[shipModel];
const shipName = data.ShipName || shipTemplate.properties.name;
const key = `Imported ${shipName}`;
memo[shipModel] = {};
memo[shipModel][key] = ship.toString();
return memo;
}, {});
this.setState({ builds, singleBuild: Object.keys(builds).length === 1 });
}
/** /**
* Validate the import string / text box contents * Validate the import string / text box contents
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -381,10 +353,8 @@ export default class ModalImport extends TranslatedComponent {
throw 'Must be an object or array!'; throw 'Must be an object or array!';
} }
if (importData?.[0]?.header?.appName) { // has SLEF envelope? if (importData.modules != null && importData.modules.Armour != null) { // Only the companion API has this information
this._importSlefBuilds(importData); this._importCompanionApiBuild(importData); // Single sihp definition
} else if (importData.modules != null && importData.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData); // Single ship definition
} else if (importData.ship != null && importData.ship.modules != null && importData.ship.modules.Armour != null) { // Only the companion API has this information } else if (importData.ship != null && importData.ship.modules != null && importData.ship.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData.ship); // Complete API dump this._importCompanionApiBuild(importData.ship); // Complete API dump
} else if (importData instanceof Array) { // Must be detailed export json } else if (importData instanceof Array) { // Must be detailed export json

View File

@@ -0,0 +1,140 @@
import React from 'react';
import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent';
import { orbisUpload } from '../utils/ShortenUrl';
import Persist from '../stores/Persist';
/**
* Permalink modal
*/
export default class ModalOrbis extends TranslatedComponent {
static propTypes = {
ship: PropTypes.any.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this.state = {
orbisCreds: Persist.getOrbisCreds(),
orbisUrl: '...',
ship: this.props.ship,
authenticatedStatus: 'Checking...'
};
this.orbisCategory = this.orbisCategory.bind(this);
}
/**
* Send ship to Orbis.zone
* @param {SyntheticEvent} e React Event
*/
sendToOrbis(e) {
const target = e.target;
target.disabled = true;
this.setState({ orbisUrl: 'Sending...' }, () => {
orbisUpload(this.props.ship, this.state.orbisCreds)
.then(orbisUrl => {
target.disabled = false;
this.setState({ orbisUrl });
})
.catch(err => {
target.disabled = false;
this.setState({ orbisUrl: 'Error - ' + err });
});
});
}
/**
* Get Orbis.zone auth status
* @returns {Object} auth status
*/
getOrbisAuthStatus() {
return fetch('https://orbis.zone/api/checkauth', {
credentials: 'include',
mode: 'cors'
})
.then(data => data.json())
.then(res => {
this.setState({ authenticatedStatus: res.status || res.error });
})
.catch(err => {
console.error(err);
this.setState({ authenticatedStatus: err.message });
});
}
/**
* Handler for changing cmdr name
* @param {SyntheticEvent} e React Event
*/
orbisPasswordHandler(e) {
let password = e.target.value;
this.setState({ orbisCreds: { email: this.state.orbisCreds.email, password } }, () => {
Persist.setOrbisCreds(this.state.orbisCreds);
});
}
/**
* Handler for changing cmdr name
* @param {SyntheticEvent} e React Event
*/
orbisUsername(e) {
let orbisUsername = e.target.value;
this.setState({ orbisCreds: { email: orbisUsername, password: this.state.orbisCreds.password } }, () => {
Persist.setOrbisCreds(this.state.orbisCreds);
});
}
/**
* Handler for changing category
* @param {SyntheticEvent} e React Event
*/
orbisCategory(e) {
let ship = this.state.ship;
let cat = e.target.value;
ship.category = cat;
this.setState({ ship });
}
/**
* Render the modal
* @return {React.Component} Modal Content
*/
render() {
let translate = this.context.language.translate;
this.orbisPasswordHandler = this.orbisPasswordHandler.bind(this);
this.orbisUsername = this.orbisUsername.bind(this);
this.sendToOrbis = this.sendToOrbis.bind(this);
this.getOrbisAuthStatus();
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h2>{translate('upload to orbis')}</h2>
<br/>
<label>Orbis auth status: </label>
<input value={this.state.authenticatedStatus} readOnly size={25} onFocus={ (e) => e.target.select() }/>
<br/><br/>
<a className='button' href="https://orbis.zone/api/auth">Log in / signup to Orbis</a>
<br/><br/>
<h3>Category</h3>
<select onChange={this.orbisCategory}>
<option value="">No Category</option>
<option>Combat</option>
<option>Mining</option>
<option>Trading</option>
<option>Exploration</option>
<option>Passenger Liner</option>
<option>PvP</option>
</select>
<br/><br/>
<h3 >{translate('Orbis link')}</h3>
<input value={this.state.orbisUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/>
<br/><br/>
<p>Orbis.zone is currently in a trial period, and may be wiped at any time as development progresses. Some elements are also still placeholders.</p>
<button className={'l cb dismiss cap'} disabled={!!this.state.failed} onClick={this.sendToOrbis}>{translate('PHASE_UPLOAD_ORBIS')}</button>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>;
}
}

View File

@@ -7,7 +7,6 @@ import ShortenUrl from '../utils/ShortenUrl';
* Permalink modal * Permalink modal
*/ */
export default class ModalPermalink extends TranslatedComponent { export default class ModalPermalink extends TranslatedComponent {
static propTypes = { static propTypes = {
url: PropTypes.string.isRequired url: PropTypes.string.isRequired
}; };
@@ -34,18 +33,6 @@ export default class ModalPermalink extends TranslatedComponent {
); );
} }
/**
* Copy the shortened URL to the clipboard
* @param {Event} e Click event
* @return {void}
*/
copyShortLink() {
let copyText = document.getElementById("shortenedUrl");
// Copy the text inside the shortendUrl input to the clipboard
copyText.select();
document.execCommand("copy");
}
/** /**
* Render the modal * Render the modal
* @return {React.Component} Modal Content * @return {React.Component} Modal Content
@@ -54,17 +41,15 @@ export default class ModalPermalink extends TranslatedComponent {
let translate = this.context.language.translate; let translate = this.context.language.translate;
return <div className='modal' onClick={ (e) => e.stopPropagation() }> return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h3>{translate('permalink')}</h3> <h2>{translate('permalink')}</h2>
<br/> <br/>
<h3>{translate('URL')}</h3> <h3>{translate('URL')}</h3>
<input value={this.props.url} size={40} readOnly onFocus={ (e) => e.target.select() }/> <input value={this.props.url} size={40} readOnly onFocus={ (e) => e.target.select() }/>
<br/><br/> <br/><br/>
<h3 >{translate('shortened')}</h3> <h3 >{translate('shortened')}</h3>
<input id={'shortenedUrl'} value={this.state.shortenedUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/><button className={'cb dismiss cap'} onClick={this.copyShortLink}>{translate('copy to clipboard')}</button> <input value={this.state.shortenedUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/>
<br/><br/> <br/><br/>
<hr /> <p>s.orbis.zone is the new URL shortener domain, old eddp.co urls are considered end of life and could go down at any moment. Sorry for any inconvenience.</p>
<p>s.orbis.zone is the URL shortener domain. These links should persist indefinitely going forward. If for some reason there is a problem with the link shortening process, please report it in the EDCD Discord Server.</p>
<hr />
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button> <button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>; </div>;
} }

View File

@@ -3,17 +3,13 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import request from 'superagent'; import request from 'superagent';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
const zlib = require('zlib');
const base64url = require('base64url');
/** /**
* Permalink modal * Permalink modal
*/ */
export default class ModalShoppingList extends TranslatedComponent { export default class ModalShoppingList extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired
buildName: PropTypes.string
}; };
/** /**
@@ -59,6 +55,7 @@ export default class ModalShoppingList extends TranslatedComponent {
continue; continue;
} }
if (module.m.blueprint.special) { if (module.m.blueprint.special) {
console.log(module.m.blueprint.special);
blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 }); blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 });
} }
for (const g in module.m.blueprint.grades) { for (const g in module.m.blueprint.grades) {
@@ -91,10 +88,8 @@ export default class ModalShoppingList extends TranslatedComponent {
request request
.get('http://localhost:44405/commanders') .get('http://localhost:44405/commanders')
.end((err, res) => { .end((err, res) => {
this.display = 'block';
if (err) { if (err) {
console.log(err); console.log(err);
this.display = 'none';
return this.setState({ failed: true }); return this.setState({ failed: true });
} }
const cmdrs = JSON.parse(res.text); const cmdrs = JSON.parse(res.text);
@@ -150,113 +145,6 @@ export default class ModalShoppingList extends TranslatedComponent {
} }
} }
/**
* Fix issues with the item name for bulkheads when sending to EDOMH
* @param {*} ship Ship object
* @param {*} item Item name
* @returns updated item name
*/
fixArmourItemNameForEDOMH(ship, item) {
// The module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
switch (ship.bulkheads.m.name){
case "Lightweight Alloy":
item = ship.id + "_Armour_Grade1";
break;
case "Reinforced Alloy":
item = ship.id + "_Armour_Grade2";
break;
case "Military Grade Composite":
item = ship.id + "_Armour_Grade3";
break;
case "Mirrored Surface Composite":
item = ship.id + "_Armour_Mirrored";
break;
case "Reactive Surface Composite":
item = ship.id + "_Armour_Reactive";
break;
}
return item;
}
/**
* Send all blueprints to EDOMH. This is a modified copy of registerBPs because this.state.blueprints was empty when I tried to modify sendToEDEng and I couldn't figure out why
* @param {Event} event React event
*/
sendToEDOMH(event) {
event.preventDefault();
const ship = this.props.ship;
const buildName = this.props.buildName;
let blueprints = [];
//create the json
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
if (module.m.blueprint.special) {
let item = "";
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
if (module.m.blueprint.fdname.includes("Armour_")) {
item = this.fixArmourItemNameForEDOMH(ship, item)
}
else {
item = module.m.symbol;
}
blueprints.push({
"item": item,
"blueprint": module.m.blueprint.special.edname
});
}
for (let g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
// We only want the grade that the module is currently at, not every grade up to that point
if (Number(g) !== module.m.blueprint.grade) {
continue;
}
let item = "";
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
if (module.m.blueprint.fdname.includes("Armour_")) {
item = this.fixArmourItemNameForEDOMH(ship, item)
}
else {
item = module.m.symbol;
}
blueprints.push({
"item": item,
"blueprint": module.m.blueprint.fdname,
"grade": module.m.blueprint.grade,
"highestGradePercentage":1.0
});
}
}
}
let shipName = buildName + " - " + ship.name;
//create JSON to encode
let baseJson = {
"version":1,
"name": shipName, // TO-DO: Import build name and put that here correctly
"items": blueprints
}
let JSONString = JSON.stringify(baseJson)
let deflated = zlib.deflateSync(JSONString)
//actually encode
let link = base64url.encode(deflated)
link = "edomh://coriolis/?" + link;
window.open(link, "_self")
}
/** /**
* Convert mats object to string * Convert mats object to string
*/ */
@@ -271,15 +159,14 @@ export default class ModalShoppingList extends TranslatedComponent {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) { if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue; continue;
} }
for (let g in module.m.blueprint.grades) { for (const g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) { if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue; continue;
} }
// Ignore grades higher than the grade selected if (g > module.m.blueprint.grade) {
if (Number(g) > module.m.blueprint.grade) {
continue; continue;
} }
for (let i in module.m.blueprint.grades[g].components) { for (const i in module.m.blueprint.grades[g].components) {
if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) { if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) {
continue; continue;
} }
@@ -290,18 +177,6 @@ export default class ModalShoppingList extends TranslatedComponent {
} }
} }
} }
if (module.m.blueprint.special) {
for (const j in module.m.blueprint.special.components) {
if (!module.m.blueprint.special.components.hasOwnProperty(j)) {
continue;
}
if (mats[j]) {
mats[j] += module.m.blueprint.special.components[j];
} else {
mats[j] = module.m.blueprint.special.components[j];
}
}
}
} }
} }
let matsString = ''; let matsString = '';
@@ -353,48 +228,34 @@ export default class ModalShoppingList extends TranslatedComponent {
const compatible = this.checkBrowserIsCompatible(); const compatible = this.checkBrowserIsCompatible();
this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this); this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this);
this.sendToEDEng = this.sendToEDEng.bind(this); this.sendToEDEng = this.sendToEDEng.bind(this);
this.sendToEDOMH = this.sendToEDOMH.bind(this);
return <div className='modal' onClick={ (e) => e.stopPropagation() }> return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h3>{translate('PHRASE_SHOPPING_MATS')}</h3> <h2>{translate('PHRASE_SHOPPING_MATS')}</h2>
<label>{translate('Grade 1 rolls ')}</label>
<input id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 2 rolls ')}</label>
<input id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 3 rolls ')}</label>
<input id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 4 rolls ')}</label>
<input id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 5 rolls ')}</label>
<input id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
<div> <div>
<p>{translate('PHRASE_DIFFERENT_ROLLS')}</p>
<label>{translate('G1')}</label>
<input className={'groll'} id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G2')}</label>
<input className={'groll'} id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G3')}</label>
<input className={'groll'} id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G4')}</label>
<input className={'groll'} id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G5')}</label>
<input className={'groll'} id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
</div>
<div>
<p>{translate('PHRASE_ALL_MODULES_ALL_ROLLS')}</p>
<textarea className='cb json' readOnly value={this.state.matsList} /> <textarea className='cb json' readOnly value={this.state.matsList} />
<p>{translate('PHRASE_FOR_FINER_CONTROL')}</p>
</div> </div>
<label hidden={!compatible} className={'l cap'}>{translate('CMDR Name')}</label>
<div id='edengineer' display={this.display} hidden={!!this.state.failed && !compatible}> <br/>
<hr /> <select hidden={!compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}>
<h3>ED Engineer</h3> {this.state.cmdrs.map(e => <option key={e}>{e}</option>)}
<h4 hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</h4> </select>
<h4 hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAILED_TO_FIND_EDENGINEER')}</h4> <br/>
<label for='cmdr-select' hidden={!!this.state.failed || !compatible} className={'l cap'}>{translate('CMDR Name:')}</label> <p hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAIL_EDENGINEER')}</p>
<select id='cmdr-select' hidden={!!this.state.failed || !compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}> <p hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</p>
{this.state.cmdrs.map(e => <option key={e}>{e}</option>)} <button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
</select>
<br/>
<button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
</div>
<div id='edomh'>
<hr />
<h3>ED Odyssey Materials Helper</h3>
<p>{translate('PHRASE_ENSURE_EDOMH')}</p>
<button className={'l cb dismiss cap'} onClick={this.sendToEDOMH}>{translate('Send to EDOMH')}</button>
</div>
<hr />
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button> <button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>; </div>;
} }

View File

@@ -3,131 +3,106 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import NumberEditor from 'react-number-editor'; import NumberEditor from 'react-number-editor';
import { isChangeValueBeneficial } from '../utils/BlueprintFunctions'; import { Module } from 'ed-forge';
import { Modifications } from 'coriolis-data/dist';
/** /**
* Modification * Modification
*/ */
export default class Modification extends TranslatedComponent { export default class Modification extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, highlight: PropTypes.bool,
m: PropTypes.object.isRequired, m: PropTypes.instanceOf(Module).isRequired,
name: PropTypes.string.isRequired, property: PropTypes.string.isRequired,
value: PropTypes.number.isRequired, onSet: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired, showProp: PropTypes.object,
onKeyDown: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modItems: PropTypes.array.isRequired,
handleModChange: PropTypes.func.isRequired
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
this.state = {}; const { m, property, showProp } = props;
this.state.value = props.value; const { beneficial, unit, value } = m.getFormatted(property, true);
this.state = { beneficial, unit, value, showProp };
} }
/** /**
* Update modification given a value. * Notify listeners that a new value has been entered and commited.
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
* in a value by hand
*/
_updateValue(value) {
this.setState({ value });
let reCast = String(Number(value));
if (reCast.endsWith(value) || reCast.startsWith(value)) {
let { m, name, ship } = this.props;
value = Math.max(Math.min(value, 50000), -50000);
ship.setModification(m, name, value, true);
}
}
/**
* Triggered when a key is pressed down with focus on the number editor.
* @param {SyntheticEvent} event Key down event
*/
_keyDown(event) {
if (event.key == 'Enter') {
this._updateFinished();
}
this.props.onKeyDown(event);
}
/**
* Triggered when an update to slider value is finished i.e. when losing focus
*
* pnellesen (24/05/2018): added value check below - this should prevent experimental effects from being recalculated
* with each onBlur event, even when no change has actually been made to the field.
*/ */
_updateFinished() { _updateFinished() {
if (this.props.value != this.state.value) { const { onSet, m, property } = this.props;
this.props.handleModChange(true); const { inputValue } = this.state;
this.props.onChange(); const numValue = Number(inputValue);
if (!isNaN(numValue) && this.state.value !== numValue) {
onSet(property, numValue);
const { beneficial, unit, value } = m.getFormatted(property, true);
this.setState({ beneficial, unit, value });
} }
} }
_toggleProperty() {
const { onPropToggle, property } = this.props;
const showProp = !this.state.showProp;
// TODO: defer until menu closed
onPropToggle(property, showProp);
this.setState({ showProp });
}
/** /**
* Render the modification * Render the modification
* @return {React.Component} modification * @return {React.Component} modification
*/ */
render() { render() {
let { translate, formats, units } = this.context.language; const { formats } = this.context.language;
let { m, name } = this.props; const { highlight, m, property } = this.props;
let modValue = m.getChange(name); const { beneficial, unit, value, inputValue, showProp } = this.state;
let isOverwrite = Modifications.modifications[name].method === 'overwrite';
if (name === 'damagedist') { // Some features only apply to specific modules; these features will be
// We don't show damage distribution // undefined on items that do not belong to the same class. Filter these
// features here
if (value === undefined) {
return null; return null;
} }
let inputClassNames = { const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property);
'cb': true,
'greyed-out': !this.props.highlight
};
return ( return (
<div onBlur={this._updateFinished.bind(this)} key={name} <tr>
className={cn('cb', 'modification-container')} <td>
ref={ modItem => this.props.modItems[name] = modItem }> <span>
<span className={'cb'}>{translate(name, m.grp)}</span> <input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/>
<span className={'header-adjuster'}></span> </span>
<table style={{ width: '100%' }}> </td>
<tbody> <td className="input-container">
<tr> <span>
<td className={'input-container'}> <NumberEditor value={inputValue || value} stepModifier={1}
<span> decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }}
{this.props.editable ? className={cn('cb', { 'greyed-out': !highlight })}
<NumberEditor className={cn(inputClassNames)} value={this.state.value} onKeyDown={(event) => {
decimals={2} style={{ textAlign: 'right' }} step={0.01} if (event.key == 'Enter') {
stepModifier={1} onKeyDown={this._keyDown.bind(this)} this._updateFinished();
onValueChange={this._updateValue.bind(this)} /> : event.stopPropagation();
<input type="text" value={formats.f2(this.state.value)} }
disabled className={cn('number-editor', 'greyed-out')} }}
style={{ textAlign: 'right', cursor: 'inherit' }}/> onValueChange={(inputValue) => {
} if (inputValue.length <= 15) {
<span className={'unit-container'}> this.setState({ inputValue });
{units[m.getStoredUnitFor(name)]} }
</span> }} />
</span> </span>
</td> </td>
<td style={{ textAlign: 'center' }} className={ <td style={{ textAlign: 'left' }}>
modValue ? <span className="unit-container">{unit}</span>
isChangeValueBeneficial(name, modValue) ? 'secondary' : 'warning' : </td>
'' <td style={{ textAlign: 'center' }}
}> className={cn({
{formats.f2(modValue / 100) || 0}{isOverwrite ? '' : '%'} secondary: beneficial,
</td> warning: beneficial === false,
</tr> })}
</tbody> >{formats.f2(modifierValue)}{modifierUnit || ''}</td>
</table> </tr>
</div>
); );
} }
} }

View File

@@ -1,34 +1,27 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as _ from 'lodash'; import { chain, flatMap, keys } from 'lodash';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { Modifications } from 'coriolis-data/dist';
import Modification from './Modification'; import Modification from './Modification';
import { import {
getBlueprint,
blueprintTooltip, blueprintTooltip,
setPercent,
getPercent,
setRandom,
specialToolTip specialToolTip
} from '../utils/BlueprintFunctions'; } from '../utils/BlueprintFunctions';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
const MODIFICATIONS_COMPARATOR = (mod1, mod2) => { import { getModuleInfo } from 'ed-forge/lib/data/items';
return mod1.props.name.localeCompare(mod2.props.name); import { SHOW } from '../shipyard/StatsMapping';
};
/** /**
* Modifications menu * Modifications menu
*/ */
export default class ModificationsMenu extends TranslatedComponent { export default class ModificationsMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, className: PropTypes.string,
m: PropTypes.object.isRequired, m: PropTypes.object.isRequired,
marker: PropTypes.string.isRequired, propsToShow: PropTypes.object.isRequired,
onChange: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modButton:PropTypes.object
}; };
/** /**
@@ -41,328 +34,177 @@ export default class ModificationsMenu extends TranslatedComponent {
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this); this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this); this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
this._rollFifty = this._rollFifty.bind(this); this.selectedModRef = null;
this._rollRandom = this._rollRandom.bind(this); this.selectedSpecialRef = null;
this._rollBest = this._rollBest.bind(this);
this._rollWorst = this._rollWorst.bind(this);
this._reset = this._reset.bind(this);
this._keyDown = this._keyDown.bind(this);
this.modItems = [];// Array to hold various element refs (<li>, <div>, <ul>, etc.)
this.firstModId = null;
this.firstBPLabel = null;// First item in mod menu
this.lastModId = null;
this.selectedModId = null;
this.selectedSpecialId = null;
this.lastNeId = null;// Last number editor id. Used to set focus to last number editor when shift-tab pressed on first element in mod menu.
this.modValDidChange = false; // used to determine if component update was caused by change in modification value.
this._handleModChange = this._handleModChange.bind(this);
// console.log(props.m.blueprint) const { m } = props;
this.state = { this.state = {
blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name), blueprintProgress: m.getBlueprintProgress(),
blueprintMenuOpened: !m.getBlueprint(),
specialMenuOpened: false specialMenuOpened: false
}; };
} }
/** /**
* Render the blueprints * Render the blueprints
* @param {Object} props React component properties
* @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderBlueprints(props, context) { _renderBlueprints() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const { translate } = language;
const blueprints = [];
for (const blueprintName in Modifications.modules[m.grp].blueprints) { const blueprints = m.getApplicableBlueprints().map(blueprint => {
const blueprint = getBlueprint(blueprintName, m); const info = getBlueprintInfo(blueprint);
let blueprintGrades = []; let blueprintGrades = keys(info.features).map(grade => {
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
// Grade is a string in the JSON so make it a number // Grade is a string in the JSON so make it a number
grade = Number(grade); grade = Number(grade);
const classes = cn('c', { const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade;
active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade const key = blueprint + ':' + grade;
}); return <li key={key} data-id={key} className={cn('c', { active })}
const close = this._blueprintSelected.bind(this, blueprintName, grade); style={{ width: '2em' }}
const key = blueprintName + ':' + grade; onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))}
const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp); onMouseOut={tooltip.bind(null, null)}
if (classes.indexOf('active') >= 0) this.selectedModId = key; onClick={() => {
blueprintGrades.unshift(<li key={key} tabIndex="0" data-id={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close} onKeyDown={this._keyDown} ref={modItem => this.modItems[key] = modItem}>{grade}</li>); m.setBlueprint(blueprint, grade, 1);
} this.setState({
if (blueprintGrades) { blueprintMenuOpened: false,
const thisLen = blueprintGrades.length; specialMenuOpened: true,
if (this.firstModId == null) this.firstModId = blueprintGrades[0].key; });
this.lastModId = blueprintGrades[thisLen - 1].key; }}
blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>); ref={active ? (ref) => { this.selectedModRef = ref; } : undefined}
blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>); >{grade}</li>;
} });
}
return blueprints; return [
<div key={'div' + blueprint} className={'select-group cap'}>
{translate(blueprint)}
</div>,
<ul key={'ul' + blueprint}>{blueprintGrades}</ul>
];
});
return flatMap(blueprints);
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {SyntheticEvent} event Event
*
*/
_keyDown(event) {
let className = null;
let elemId = null;
if (event.currentTarget.attributes['class']) className = event.currentTarget.attributes['class'].value;
if (event.currentTarget.attributes['data-id']) elemId = event.currentTarget.attributes['data-id'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
event.stopPropagation();
if (elemId != null) {
this.modItems[elemId].click();
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
// Shift-Tab
if(event.shiftKey) {
if (elemId == this.firstModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.lastModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null && this.lastNeId != null && this.modItems[this.lastNeId] != null) {
// shift-tab on first element in modifications menu. set focus to last number editor field if open
event.preventDefault();
this.modItems[this.lastNeId].lastChild.focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null) {
// shift-tab on button-inline-menu with no number editor
event.preventDefault();
event.currentTarget.parentElement.lastElementChild.focus();
}
} else {
if (elemId == this.lastModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.firstModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.nextSibling == null && event.currentTarget.nodeName != 'TD') {
// Experimental menu
event.preventDefault();
event.currentTarget.parentElement.firstElementChild.focus();
return;
} else if (event.currentTarget.className == 'cb' && event.currentTarget.parentElement.nextSibling == null) {
event.preventDefault();
this.modItems[this.firstBPLabel].focus();
}
}
}
}
/** /**
* Render the specials * Render the specials
* @param {Object} props React component properties * @param {Object} props React component properties
* @param {Object} context React component context * @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderSpecials(props, context) { _renderSpecials() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const specials = [];
const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials'; const applied = m.getExperimental();
if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) { const experimentals = [];
const close = this._specialSelected.bind(this, null); for (const experimental of m.getApplicableExperimentals()) {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } data-id={ 'none' } onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems['none'] = modItem}>{translate('PHRASE_NO_SPECIAL')}</div>); const active = experimental === applied;
for (const specialName of Modifications.modules[m.grp][specialsId]) { let specialTt = specialToolTip(language, m, experimental);
if (Modifications.specials[specialName].name.search('Legacy') >= 0) { experimentals.push(
continue; <div key={experimental} data-id={experimental}
} style={{ cursor: 'pointer' }}
const classes = cn('button-inline-menu', { className={cn('button-inline-menu', { active })}
active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName onClick={this._specialSelected(experimental)}
}); ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
if (classes.indexOf('active') >= 0) this.selectedSpecialId = specialName; onMouseOver={termtip.bind(null, specialTt)}
const close = this._specialSelected.bind(this, specialName); onMouseOut={tooltip.bind(null, null)}
if (m.blueprint && m.blueprint.name) { >{translate(experimental)}</div>
let tmp = {}; );
if (m.blueprint.special) {
tmp = m.blueprint.special;
} else {
tmp = undefined;
}
m.blueprint.special = Modifications.specials[specialName];
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName);
m.blueprint.special = tmp;
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
} else {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName }onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
}
}
} }
return specials;
if (experimentals.length) {
experimentals.unshift(
<div style={{ cursor: 'pointer', fontWeight: 'bold' }}
className="button-inline-menu warning" key="none" data-id="none"
// Setting the special effect to undefined clears it
onClick={this._specialSelected(undefined)}
ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
>{translate('PHRASE_NO_SPECIAL')}</div>
);
}
return experimentals;
}
/**
* Create a modification component
*/
_mkModification(property, highlight) {
const { translate } = this.context.language;
const { m, propsToShow, onPropToggle } = this.props;
let onSet = m.set.bind(m);
// Show resistance instead of effectiveness
const mapped = SHOW[property];
if (mapped) {
property = mapped.as;
onSet = mapped.setter.bind(undefined, m);
}
return [
<tr key={`th-${property}`}>
<th colSpan="4">
<span className="cb">{translate(property)}</span>
</th>
</tr>,
<Modification key={property} m={m} property={property}
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
onPropToggle={onPropToggle} />
];
} }
/** /**
* Render the modifications * Render the modifications
* @param {Object} props React Component properties * @return {Array} Array of React Components
* @return {Object} list: Array of React Components
*/ */
_renderModifications(props) { _renderModifications() {
const { m, onChange, ship } = props; const { m } = this.props;
const modifiableModifications = [];
const modifications = [];
for (const modName of Modifications.modules[m.grp].modifications) {
if (!Modifications.modifications[modName].hidden) {
const key = modName + (m.getModValue(modName) / 100 || 0);
const editable = modName !== 'fallofffromrange';
const highlight = m.blueprint.grades[m.blueprint.grade].features[modName];
this.lastNeId = modName;
(editable && highlight ? modifiableModifications : modifications).push(
<Modification key={ key } ship={ ship } m={ m } highlight={highlight}
value={m.getPretty(modName) || 0} modItems={this.modItems}
onChange={onChange} onKeyDown={this._keyDown} name={modName}
editable={editable} handleModChange = {this._handleModChange} />
);
}
}
modifiableModifications.sort(MODIFICATIONS_COMPARATOR); const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[
modifications.sort(MODIFICATIONS_COMPARATOR); m.getBlueprintGrade()
return modifiableModifications.concat(modifications); ];
const blueprintModifications = chain(keys(blueprintFeatures))
.map((feature) => this._mkModification(feature, true))
.filter(([_, mod]) => Boolean(mod))
.flatMap()
.value();
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
.filter((prop) => !blueprintFeatures[prop])
.map((prop) => this._mkModification(prop, false))
.flatMap()
.value();
return blueprintModifications.concat(moduleModifications);
} }
/** /**
* Toggle the blueprints menu * Toggle the blueprints menu
*/ */
_toggleBlueprintsMenu() { _toggleBlueprintsMenu() {
const blueprintMenuOpened = !this.state.blueprintMenuOpened; this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened });
this.setState({ blueprintMenuOpened });
}
/**
* Activated when a blueprint is selected
* @param {int} fdname The Frontier name of the blueprint
* @param {int} grade The grade of the selected blueprint
*/
_blueprintSelected(fdname, grade) {
this.context.tooltip(null);
const { m, ship } = this.props;
const blueprint = getBlueprint(fdname, m);
blueprint.grade = grade;
ship.setModuleBlueprint(m, blueprint);
setPercent(ship, m, 100);
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
this.props.onChange();
} }
/** /**
* Toggle the specials menu * Toggle the specials menu
*/ */
_toggleSpecialsMenu() { _toggleSpecialsMenu() {
const specialMenuOpened = !this.state.specialMenuOpened; this.setState({ specialMenuOpened: !this.state.specialMenuOpened });
this.setState({ specialMenuOpened });
} }
/** /**
* Activated when a special is selected * Creates a callback for when a special effect is being selected
* @param {int} special The name of the selected special * @param {string} special The name of the selected special
* @returns {function} Callback
*/ */
_specialSelected(special) { _specialSelected(special) {
this.context.tooltip(null); return () => {
const { m, ship } = this.props; const { m } = this.props;
m.setExperimental(special);
if (special === null) { this.setState({ specialMenuOpened: false });
ship.clearModuleSpecial(m); };
} else {
ship.setModuleSpecial(m, Modifications.specials[special]);
}
this.setState({ specialMenuOpened: false });
this.props.onChange();
}
/**
* Provide a '50%' roll within the information we have
*/
_rollFifty() {
const { m, ship } = this.props;
setPercent(ship, m, 50);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a random roll within the information we have
*/
_rollRandom() {
const { m, ship } = this.props;
setRandom(ship, m);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'best' roll within the information we have
*/
_rollBest() {
const { m, ship } = this.props;
setPercent(ship, m, 100);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'worst' roll within the information we have
*/
_rollWorst() {
const { m, ship } = this.props;
setPercent(ship, m, 0);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Reset modification information
*/
_reset() {
const { m, ship } = this.props;
ship.clearModifications(m);
ship.clearModuleBlueprint(m);
this.selectedModId = null;
this.selectedSpecialId = null;
this.props.onChange();
}
/**
* set mod did change boolean
* @param {boolean} b Boolean to determine if a change has been made to a module
*/
_handleModChange(b) {
this.modValDidChange = b;
}
/**
* Set focus on first element in modifications menu
* after it first mounts
*/
componentDidMount() {
let firstEleCn = this.modItems['modMainDiv'].children.length > 0 ? this.modItems['modMainDiv'].children[0].className : null;
if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
} else {
this.modItems['modMainDiv'].firstElementChild.focus();
}
} }
/** /**
@@ -371,32 +213,12 @@ export default class ModificationsMenu extends TranslatedComponent {
* in a modification * in a modification
*/ */
componentDidUpdate() { componentDidUpdate() {
if (!this.modValDidChange) { if (this.selectedModRef) {
if (this.modItems['modMainDiv'].children.length > 0) { this.selectedModRef.focus();
if (this.modItems[this.selectedModId]) { return;
this.modItems[this.selectedModId].focus(); } else if (this.selectedSpecialRef) {
return; this.selectedSpecialRef.focus();
} else if (this.modItems[this.selectedSpecialId]) { return;
this.modItems[this.selectedSpecialId].focus();
return;
}
let firstEleCn = this.modItems['modMainDiv'].children[0].className;
if (firstEleCn.indexOf('button-inline-menu') >= 0) {
this.modItems['modMainDiv'].firstElementChild.focus();
} else if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
}
}
} else {
this._handleModChange(false);// Need to reset if component update due to value change
}
}
/**
* set focus to the modification menu icon after mod menu is unmounted.
*/
componentWillUnmount() {
if (this.props.modButton) {
this.props.modButton.focus();
} }
} }
@@ -408,106 +230,155 @@ export default class ModificationsMenu extends TranslatedComponent {
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const { m } = this.props; const { m } = this.props;
const { blueprintMenuOpened, specialMenuOpened } = this.state; const {
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
} = this.state;
const _toggleBlueprintsMenu = this._toggleBlueprintsMenu; const appliedBlueprint = m.getBlueprint();
const _toggleSpecialsMenu = this._toggleSpecialsMenu; const appliedGrade = m.getBlueprintGrade();
const _rollFull = this._rollBest; const appliedExperimental = m.getExperimental();
const _rollWorst = this._rollWorst;
const _rollFifty = this._rollFifty;
const _rollRandom = this._rollRandom;
const _reset = this._reset;
let blueprintLabel; let renderComponents = [];
let haveBlueprint = false; switch (true) {
let blueprintTt; case !appliedBlueprint || blueprintMenuOpened:
let blueprintCv; renderComponents = this._renderBlueprints();
let bprintSearchName; break;
case specialMenuOpened:
renderComponents = this._renderSpecials();
break;
default:
// Since the first case didn't apply, there is a blueprint applied so
// we render the modifications
let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade);
// If the fdname is Weapon_Overcharged, we need to check if it's an MC renderComponents.push(
if (m.blueprint && m.blueprint.fdname) { <div style={{ cursor: 'pointer' }} key="blueprintsMenu"
// Set the bprintSearchName value to the fdname of the blueprint for this module className="section-menu button-inline-menu"
bprintSearchName = m.blueprint.fdname; onMouseOver={termtip.bind(null, blueprintTt)}
if (m.blueprint.fdname === 'Weapon_Overcharged') { onMouseOut={tooltip.bind(null, null)}
// If the module is a MultiCannon, we need to fix the blueprint search name, else it will find the Laser Weapon_Overcharged Blueprint and not the MC Weapon_Overcharged Blueprint onClick={this._toggleBlueprintsMenu}
if (m.symbol.match(/MultiCannon/i)) { >
// console.log(Modifications.modules[m.grp].blueprints['MC_Overcharged']); {translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
// console.log(m.blueprint.fdname); </div>
bprintSearchName = 'MC_Overcharged'; );
if (m.getApplicableExperimentals().length) {
let specialLabel = translate('PHRASE_SELECT_SPECIAL');
let specialTt;
if (appliedExperimental) {
specialLabel = appliedExperimental;
specialTt = specialToolTip(language, m, appliedExperimental);
}
renderComponents.push(
<div className="section-menu button-inline-menu"
style={{ cursor: 'pointer' }}
onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
onMouseOut={specialTt ? tooltip.bind(null, null) : null}
onClick={this._toggleSpecialsMenu}
>{specialLabel}</div>
);
} }
}
}
// TODO: Fix this to actually find the correct blueprint.
if (!m.blueprint || !m.blueprint.name || !m.blueprint.fdname || !Modifications.modules[m.grp].blueprints || !Modifications.modules[m.grp].blueprints[bprintSearchName]) {
this.props.ship.clearModuleBlueprint(m);
this.props.ship.clearModuleSpecial(m);
}
if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[bprintSearchName].grades[m.blueprint.grade]) {
blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
haveBlueprint = true;
// console.log(haveBlueprint);
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[bprintSearchName].grades[m.blueprint.grade].engineers, m.grp);
blueprintCv = getPercent(m);
}
let specialLabel;
let specialTt;
if (m.blueprint && m.blueprint.special) {
specialLabel = translate(m.blueprint.special.name);
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname);
} else {
specialLabel = translate('PHRASE_SELECT_SPECIAL');
}
const specials = this._renderSpecials(this.props, this.context);
/**
* pnellesen - 05/28/2018 - added additional checks for specials.length below to ensure menus
* display correctly in cases where there are no specials (ex: AFMUs.)
*/
const showBlueprintsMenu = blueprintMenuOpened;
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened;
const showSpecialsMenu = specialMenuOpened && specials.length;
const showRolls = haveBlueprint && !blueprintMenuOpened && (!specialMenuOpened || !specials.length);
const showReset = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
const showMods = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
if (haveBlueprint) {
this.firstBPLabel = blueprintLabel;
} else {
this.firstBPLabel = 'selectBP';
}
return (
<div
className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation() }
onContextMenu={stopCtxPropagation}
ref={modItem => this.modItems['modMainDiv'] = modItem}
>
{ showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ?
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{blueprintLabel}</div> :
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> }
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
{ showSpecial & !showSpecialsMenu ? <div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu} onKeyDown={ this._keyDown }>{specialLabel}</div> : null }
{ showSpecialsMenu ? specials : null }
{ showReset ? <div tabIndex="0" className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
{ showRolls ?
renderComponents.push(
<div
className="section-menu button-inline-menu warning"
style={{ cursor: 'pointer' }}
onClick={() => {
m.resetEngineering();
this.selectedModRef = null;
this.selectedSpecialRef = null;
tooltip(null);
this.setState({
blueprintMenuOpened: true,
blueprintProgress: undefined,
});
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
onMouseOut={tooltip.bind(null, null)}
>{translate('reset')}</div>,
<table style={{ width: '100%', backgroundColor: 'transparent' }}> <table style={{ width: '100%', backgroundColor: 'transparent' }}>
<tbody> <tbody>
{ showRolls ? <tr>
<tr> <td
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: false }) }> { translate('mroll') }: </td> className={cn(
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 }) } style={{ cursor: 'pointer' }} onClick={_rollWorst} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td> 'section-menu button-inline-menu',
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td> { active: false },
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td> )}
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td> >{translate('mroll')}:</td>
</tr> : null } <td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0);
this.setState({ blueprintProgress: 0 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('0%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0.5 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0.5);
this.setState({ blueprintProgress: 0.5 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
onMouseOut={tooltip.bind(null, null)}
>{translate('50%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 1 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(1);
this.setState({ blueprintProgress: 1 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('100%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress % 0.5 !== 0 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
const blueprintProgress = Math.random();
m.setBlueprintProgress(blueprintProgress);
this.setState({ blueprintProgress });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
onMouseOut={tooltip.bind(null, null)}
>{translate('random')}</td>
</tr>
</tbody> </tbody>
</table> : null } </table>,
{ showMods ? <hr /> : null } <hr />,
{ showMods ? <span
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} > onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
{ this._renderModifications(this.props) } onMouseOut={tooltip.bind(null, null)}
</span> : null } >
<table style={{ width: '100%' }}>
<tbody>
{this._renderModifications()}
</tbody>
</table>
</span>
);
}
return (
<div className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation}
>
{renderComponents}
</div> </div>
); );
} }

View File

@@ -1,36 +1,28 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShipProps } from 'ed-forge';
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
/** /**
* Movement * Movement
*/ */
export default class Movement extends TranslatedComponent { export default class Movement extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
fuel: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render movement * Render movement
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, boost, eng, cargo, fuel } = this.props; const { ship, boost } = this.props;
const { language } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { formats } = language;
return ( return (
<span id='movement'> <span id='movement'>
@@ -57,14 +49,10 @@ export default class Movement extends TranslatedComponent {
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/> <path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/> <path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
{/* Speed */} <text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text>
<text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text> <text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text>
{/* Pitch */} <text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text>
<text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text> <text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text>
{/* Roll */}
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
{/* Yaw */}
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
</svg> </svg>
</span>); </span>);
} }

View File

@@ -3,101 +3,36 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import { nameComparator } from '../utils/SlotFunctions';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { DAMAGE_METRICS } from 'ed-forge/lib/ship-stats';
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
/** /**
* Generates an internationalization friendly weapon comparator that will * Turns an object into a tooltip.
* sort by specified property (if provided) then by name/group, class, rating * @param {function} translate Translate function
* @param {function} translate Translation function * @param {object} o Map to make the tooltip from
* @param {function} propComparator Optional property comparator * @returns {React.Component} Tooltip
* @param {boolean} desc Use descending order
* @return {function} Comparator function for names
*/ */
export function weaponComparator(translate, propComparator, desc) { function objToTooltip(translate, o) {
return (a, b) => { return toPairs(o)
if (!desc) { // Flip A and B if ascending order .filter(([k, v]) => Boolean(v))
let t = a; .map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>);
a = b;
b = t;
}
// If a property comparator is provided use it first
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
if (diff) {
return diff;
}
// Property matches so sort by name / group, then class, rating
if (a.name === b.name && a.grp === b.grp) {
if(a.class == b.class) {
return a.rating > b.rating ? 1 : -1;
}
return a.class - b.class;
}
return nameComparator(translate, a, b);
};
}
/**
* Creates a tooltip that shows damage by type.
* @param {function} translate Translation function
* @param {Object} formats Object that holds format functions
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
* @returns {Array} Tooltip
*/
function getSDpsTooltip(translate, formats, sdpsObject) {
return Object.keys(sdpsObject).filter(key => sdpsObject[key])
.map(key => {
return (
<div key={key}>
{translate(key) + ' ' + formats.f1(sdpsObject[key])}
</div>
);
});
} }
/** /**
* Returns a data object used by {@link PieChart} that shows damage by type. * Returns a data object used by {@link PieChart} that shows damage by type.
* @param {function} translate Translation function * @param {function} translate Translation function
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type * @param {Calc.SDps} o Object that holds sdps split up by type
* @returns {Object} Data object * @returns {Object} Data object
*/ */
function getSDpsData(translate, sdpsObject) { function objToPie(translate, o) {
return Object.keys(sdpsObject).map(key => { return toPairs(o).map(([k, value]) => {
return { return { label: translate(k), value };
value: Math.round(sdpsObject[key]),
label: translate(key)
};
}); });
} }
/**
* Adds all damage of `add` onto `addOn`.
* @param {Calc.SDps} addOn Object that holds sdps split up by type (will be mutated)
* @param {Calc.SDps} add Object that holds sdps split up by type
*/
function addSDps(addOn, add) {
Object.keys(addOn).map(k => addOn[k] += (add[k] ? add[k] : 0));
}
/**
* Calculates the overall sdps of an sdps object.
* @param {Calc.SDps} sdpsObject Object that holds sdps spluit up by type
*/
function sumSDps(sdpsObject) {
if (sdpsObject.total) {
return sdpsObject.total;
}
return Object.keys(sdpsObject).reduce(
(acc, k) => acc + (sdpsObject[k] ? sdpsObject[k] : 0),
0
);
}
/** /**
* Offence information * Offence information
* Offence information consists of four panels: * Offence information consists of four panels:
@@ -108,12 +43,10 @@ function sumSDps(sdpsObject) {
*/ */
export default class Offence extends TranslatedComponent { export default class Offence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.instanceOf(Ship).isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired
}; };
/** /**
@@ -122,151 +55,196 @@ export default class Offence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._sort = this._sort.bind(this);
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
this.state = { this.state = {
predicate: 'n', predicate: 'classRating',
desc: true, desc: true,
damage
}; };
} }
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
this.setState({ damage });
}
return true;
}
/** /**
* Set the sort order and sort * Set the sort order and sort
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
let desc = this.state.desc; let desc = predicate == this.state.predicate ? !this.state.desc : true;
if (predicate == this.state.predicate) {
desc = !desc;
} else {
desc = true;
}
this._sort(predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/**
* Sorts the weapon list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort order descending
*/
_sort(predicate, desc) {
let comp = weaponComparator.bind(null, this.context.language.translate);
switch (predicate) {
case 'n': comp = comp(null, desc); break;
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
}
this.state.damage.sort(comp);
}
/** /**
* Render offence * Render offence
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, opponent, wep, engagementrange } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { damage } = this.state;
const sortOrder = this._sortOrder; const sortOrder = this._sortOrder;
const pd = ship.standard[4].m; const damage = ship.getMetrics(DAMAGE_METRICS);
const portions = {
Absolute: damage.types.abs,
Explosive: damage.types.expl,
Kinetic: damage.types.kin,
Thermic: damage.types.therm,
};
const opponentShields = Calc.shieldMetrics(opponent, 4); const oppShield = ship.getOpponent().getShield();
const opponentArmour = Calc.armourMetrics(opponent); const shieldMults = {
Absolute: 1,
Explosive: oppShield.explosive.damageMultiplier,
Kinetic: oppShield.kinetic.damageMultiplier,
Thermic: oppShield.thermal.damageMultiplier,
};
const timeToDrain = Calc.timeToDrainWep(ship, wep); const oppArmour = ship.getOpponent().getArmour();
const armourMults = {
Absolute: 1,
Explosive: oppArmour.explosive.damageMultiplier,
Kinetic: oppArmour.kinetic.damageMultiplier,
Thermic: oppArmour.thermal.damageMultiplier,
};
let rows = [];
for (let weapon of ship.getHardpoints()) {
const sdps = weapon.get('sustaineddamagepersecond');
const byRange = weapon.getRangeEffectiveness();
const weaponPortions = {
Absolute: weapon.get('absolutedamageportion'),
Explosive: weapon.get('explosivedamageportion'),
Kinetic: weapon.get('kineticdamageportion'),
Thermic: weapon.get('thermicdamageportion'),
};
const baseSdpsTooltip = objToTooltip(
translate,
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
);
let totalSEps = 0; const bySys = oppShield.absolute.bySys;
let totalSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; const shieldResEfts = mergeWith(
let shieldsSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; clone(weaponPortions),
let armourSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; shieldMults,
(objV, srcV) => objV * srcV
);
const byShieldRes = sum(values(shieldResEfts));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(
shieldResEfts,
(mult) => formats.f1(byRange * mult * bySys * sdps),
),
);
const shieldsEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byShieldRes),
'power distributor': formats.pct1(bySys),
},
);
const shieldEft = byRange * byShieldRes * bySys;
const rows = []; const byHardness = weapon.getArmourEffectiveness();
for (let i = 0; i < damage.length; i++) { const armourResEfts = mergeWith(
const weapon = damage[i]; clone(weaponPortions),
armourMults,
(objV, srcV) => objV * srcV,
);
const byArmourRes = sum(values(armourResEfts));
const armourSdpsTooltip = objToTooltip(
translate,
mapValues(
armourResEfts,
(mult) => formats.f1(byRange * mult * byHardness * sdps)
),
);
const armourEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byArmourRes),
hardness: formats.pct1(byHardness),
},
);
const armourEft = byRange * byArmourRes * byHardness;
totalSEps += weapon.seps; const bp = weapon.getBlueprint();
addSDps(totalSDpsObject, weapon.sdps.base); const grade = weapon.getBlueprintGrade();
addSDps(shieldsSDpsObject, weapon.sdps.shields); const exp = weapon.getExperimental();
addSDps(armourSDpsObject, weapon.sdps.armour); let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`;
if (exp) {
const baseSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.base); bpTitle += `, ${translate(exp)}`;
}
const effectivenessShieldsTooltipDetails = []; rows.push({
effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>); slot: weapon.getSlot(),
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>); mount: weapon.mount,
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>); classRating: weapon.getClassRating(),
type: weapon.readMeta('type'),
const effectiveShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour); bpTitle: bp ? ` (${bpTitle})` : null,
sdps,
const effectivenessArmourTooltipDetails = []; baseSdpsTooltip,
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>); shieldSdps: sdps * shieldEft,
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>); shieldEft,
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>); shieldsSdpsTooltip,
shieldsEftTooltip,
const effectiveArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour); armourSdps: sdps * armourEft,
armourEft,
rows.push( armourSdpsTooltip,
<tr key={weapon.id}> armourEftTooltip,
<td className='ri'> });
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null} }
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null} const { predicate, desc } = this.state;
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null} rows = sortBy(rows, (row) => row[predicate]);
{weapon.classRating} {translate(weapon.name)} if (desc) {
{weapon.engineering ? ' (' + weapon.engineering + ')' : null } reverse(rows);
</td>
<td className='ri'><span onMouseOver={termtip.bind(null, baseSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.base.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.shields.dpe)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.armour.dpe)}</span></td>
</tr>);
} }
const totalSDps = sumSDps(totalSDpsObject); const sdpsTooltip = objToTooltip(
const totalSDpsTooltipDetails = getSDpsTooltip(translate, formats, totalSDpsObject); translate,
const totalSDpsData = getSDpsData(translate, totalSDpsObject); mapValues(portions, (p) => formats.f1(damage.sustained.dps * p)),
);
const sdpsPie = objToPie(
translate,
mapValues(portions, (p) => Math.round(damage.sustained.dps * p)),
);
const totalShieldsSDps = sumSDps(shieldsSDpsObject); const shieldSdpsSrcs = mergeWith(
const totalShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, shieldsSDpsObject); clone(portions),
const shieldsSDpsData = getSDpsData(translate, shieldsSDpsObject); shieldMults,
(objV, srcV) => damage.sustained.dps * oppShield.absolute.bySys *
damage.rangeMultiplier * objV * srcV,
);
const shieldsSdps = sum(values(shieldSdpsSrcs));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
);
const shieldsSdpsPie = objToPie(
translate,
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
);
const totalArmourSDps = sumSDps(armourSDpsObject); const armourSdpsSrcs = mergeWith(
const totalArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, armourSDpsObject); clone(portions),
const armourSDpsData = getSDpsData(translate, armourSDpsObject); armourMults,
(objV, srcV) => damage.sustained.dps * damage.hardnessMultiplier *
damage.rangeMultiplier * objV * srcV,
);
const armourSdps = sum(values(armourSdpsSrcs));
const totalArmourSDpsTooltipDetails = objToTooltip(
translate,
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
);
const armourSDpsData = objToPie(
translate,
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
);
const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); const pd = ship.getPowerDistributor();
const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); const timeToDrain = damage.sustained.timeToDrain[ship.getDistributorSettings().Wep];
// const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, shieldsSdps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
// const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, armourSdps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
return ( return (
<span id='offence'> <span id='offence'>
@@ -274,35 +252,75 @@ export default class Offence extends TranslatedComponent {
<table> <table>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th> <th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th>
<th colSpan='1'>{translate('overall')}</th> <th colSpan='1'>{translate('overall')}</th>
<th colSpan='3'>{translate('opponent\'s shields')}</th> <th colSpan='2'>{translate('opponent\'s shields')}</th>
<th colSpan='3'>{translate('opponent\'s armour')}</th> <th colSpan='2'>{translate('opponent\'s armour')}</th>
</tr> </tr>
<tr> <tr>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
<th className='sortable'>{'dpe'}</th> <th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')}
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')}
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th> onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
<th className='sortable'>{'dpe'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows.map((row) => (
<tr key={row.slot}>
<td className='ri'>
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{row.classRating} {translate(row.type)}
{row.bpTitle}
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.sdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.shieldSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.shieldEft)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.armourSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.armourEft)}</span></td>
</tr>
))}
{rows.length > 0 && {rows.length > 0 &&
<tr> <tr>
<td></td> <td></td>
<td className='ri'><span onMouseOver={termtip.bind(null, totalSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalSDps)}</span></td> <td className='ri'>
<td className='ri'><span onMouseOver={termtip.bind(null, totalShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalShieldsSDps)}</span></td> <span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
<td></td> ={formats.f1(damage.sustained.dps)}
<td></td> </span>
<td className='ri'><span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalArmourSDps)}</span></td> </td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(shieldsSdps)}
</span>
</td>
<td></td> <td></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(armourSdps)}
</span>
</td>
<td></td> <td></td>
</tr> </tr>
} }
@@ -311,22 +329,53 @@ export default class Offence extends TranslatedComponent {
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('offence metrics')}</h2> <h2>{translate('offence metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))}
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2> onMouseOut={tooltip.bind(null, null)}>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2> {translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2> {timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2> </h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
{formats.f1(shieldsSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
ToDo
{/* {timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)} */}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
{formats.f1(armourSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
ToDo
{/* {timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)} */}
</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('overall damage')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))}
<PieChart data={totalSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('overall damage')}
</h2>
<PieChart data={sdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))}
<PieChart data={shieldsSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('shield damage sources')}
</h2>
<PieChart data={shieldsSdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('armour damage sources')}
</h2>
<PieChart data={armourSDpsData} /> <PieChart data={armourSDpsData} />
</div> </div>
</span>); </span>);

View File

@@ -11,29 +11,24 @@ import Movement from './Movement';
import Offence from './Offence'; import Offence from './Offence';
import Defence from './Defence'; import Defence from './Defence';
import WeaponDamageChart from './WeaponDamageChart'; import WeaponDamageChart from './WeaponDamageChart';
import Pips from '../components/Pips';
import Boost from '../components/Boost';
import Fuel from '../components/Fuel';
import Cargo from '../components/Cargo';
import ShipPicker from '../components/ShipPicker';
import EngagementRange from '../components/EngagementRange';
import autoBind from 'auto-bind';
import { ShipProps } from 'ed-forge';
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
/** /**
* Outfitting subpages * Outfitting subpages
*/ */
export default class OutfittingSubpages extends TranslatedComponent { export default class OutfittingSubpages extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired,
buildName: PropTypes.string, buildName: PropTypes.string,
sys: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired,
opponent: PropTypes.object.isRequired,
opponentBuild: PropTypes.string,
opponentSys: PropTypes.number.isRequired,
opponentEng: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired,
}; };
/** /**
@@ -42,13 +37,17 @@ export default class OutfittingSubpages extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._powerTab = this._powerTab.bind(this); autoBind(this);
this._profilesTab = this._profilesTab.bind(this);
this._offenceTab = this._offenceTab.bind(this);
this._defenceTab = this._defenceTab.bind(this);
this.props.ship.setOpponent(this.props.ship);
this.state = { this.state = {
boost: false,
cargo: props.ship.get(CARGO_CAPACITY),
fuel: props.ship.get(FUEL_CAPACITY),
pips: props.ship.getDistributorSettingsObject(),
tab: Persist.getOutfittingTab() || 'power', tab: Persist.getOutfittingTab() || 'power',
engagementRange: 1000,
opponent: this.props.ship,
}; };
} }
@@ -57,128 +56,114 @@ export default class OutfittingSubpages extends TranslatedComponent {
* @param {string} tab Tab name * @param {string} tab Tab name
*/ */
_showTab(tab) { _showTab(tab) {
Persist.setOutfittingTab(tab);
this.setState({ tab }); this.setState({ tab });
} }
/**
* Render the power tab
* @return {React.Component} Tab contents
*/
_powerTab() {
let { ship, buildName, code, onChange } = this.props;
Persist.setOutfittingTab('power');
const powerMarker = `${ship.toString()}`;
const costMarker = `${ship.toString().split('.')[0]}`;
return <div>
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
<CostSection ship={ship} buildName={buildName} code={costMarker} />
</div>;
}
/**
* Render the profiles tab
* @return {React.Component} Tab contents
*/
_profilesTab() {
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
const { translate } = this.context.language;
let realBoost = boost && ship.canBoost(cargo, fuel);
Persist.setOutfittingTab('profiles');
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
return <div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
</div>
</div>;
}
/**
* Render the offence tab
* @return {React.Component} Tab contents
*/
_offenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
Persist.setOutfittingTab('offence');
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
return <div>
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
</div>;
}
/**
* Render the defence tab
* @return {React.Component} Tab contents
*/
_defenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
Persist.setOutfittingTab('defence');
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
return <div>
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
</div>;
}
/** /**
* Render the section * Render the section
* @return {React.Component} Contents * @return {React.Component} Contents
*/ */
render() { render() {
const tab = this.state.tab; const { buildName, code, ship } = this.props;
const translate = this.context.language.translate; const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state;
let tabSection; const { translate } = this.context.language;
switch (tab) {
case 'power': tabSection = this._powerTab(); break;
case 'profiles': tabSection = this._profilesTab(); break;
case 'offence': tabSection = this._offenceTab(); break;
case 'defence': tabSection = this._defenceTab(); break;
}
const cargoCapacity = ship.get(CARGO_CAPACITY);
const showCargoSlider = cargoCapacity > 0;
return ( return (
<div className='group full' style={{ minHeight: '1000px' }}> <div>
<table className='tabs'> {/* Control of ship and opponent */}
<thead> <div className="group quarter">
<tr> <h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th> {translate('ship control')}
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th> </h2>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th> <Boost boost={boost} onChange={(boost) => this.setState({ boost })} />
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('tab_defence')}</th> </div>
</tr> <div className="group quarter">
</thead> <h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
</table> {translate('opponent')}
{tabSection} </h2>
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
</div>
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
onChange={(fuel) => this.setState({ fuel })} />
</div>
{showCargoSlider ?
<div className="group quarter">
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
onChange={(cargo) => this.setState({ cargo })} />
</div> : null}
<div className="group half">
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
</div>
<div className="group half">
<EngagementRange ship={ship} engagementRange={engagementRange}
onChange={(engagementRange) => this.setState({ engagementRange })} />
</div>
<div className='group full' style={{ minHeight: '1000px' }}>
<table className='tabs'>
{/* Select tab section */}
<thead>
<tr>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
onClick={this._showTab.bind(this, 'power')}>
{translate('power and costs')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
onClick={this._showTab.bind(this, 'profiles')}>
{translate('profiles')}</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
onClick={this._showTab.bind(this, 'offence')}>
{translate('offence')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
onClick={this._showTab.bind(this, 'defence')}>
{translate('tab_defence')}
</th>
</tr>
</thead>
</table>
{/* Show selected tab */}
{tab == 'power' ?
<div>
<PowerManagement ship={ship} code={code} />
<CostSection ship={ship} buildName={buildName} code={code} />
</div> : null}
{tab == 'profiles' ?
<div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement code={code} ship={ship} boost={boost} pips={pips} />
</div>
<div className='group third'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
</div>
<div className='group third'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
</div>
</div> : null}
{tab == 'offence' ?
<div>
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
{tab == 'defence' ?
<div>
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
</div>
</div> </div>
); );
} }

View File

@@ -1,92 +1,91 @@
import React, { Component } from 'react'; import React, { Component } from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D']; const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
const LABEL_COLOUR = '#000000'; const LABEL_COLOUR = '#000000';
/** /**
* A pie chart * A pie chart
*/ */
export default class PieChart extends Component { export default class PieChart extends Component {
static propTypes = {
static propTypes = { data : PropTypes.array.isRequired
data : PropTypes.array.isRequired };
};
/**
/** * Constructor
* Constructor * @param {Object} props React Component properties
* @param {Object} props React Component properties * @param {Object} context React Component context
* @param {Object} context React Component context */
*/ constructor(props, context) {
constructor(props, context) { super(props);
super(props);
this.pie = d3.pie().value((d) => d.value);
this.pie = d3.pie().value((d) => d.value); this.colors = CORIOLIS_COLOURS;
this.colors = CORIOLIS_COLOURS; this.arc = d3.arc();
this.arc = d3.arc(); this.arc.innerRadius(0);
this.arc.innerRadius(0); }
}
/**
/** * Generate a slice of the pie chart
* Generate a slice of the pie chart * @param {Object} d the data for this slice
* @param {Object} d the data for this slice * @param {number} i the index of this slice
* @param {number} i the index of this slice * @param {number} width the current width of the parent container
* @param {number} width the current width of the parent container * @returns {Object} the SVG for the slice
* @returns {Object} the SVG for the slice */
*/ sliceGenerator(d, i, width) {
sliceGenerator(d, i, width) { if (!d || d.value == 0) {
if (!d || d.value == 0) { // Ignore 0 values
// Ignore 0 values return null;
return null; }
}
const { data } = this.props;
const { data } = this.props;
// Push the labels further out from the centre of the slice
// Push the labels further out from the centre of the slice let [labelX, labelY] = this.arc.centroid(d);
let [labelX, labelY] = this.arc.centroid(d); const labelTranslate = `translate(${labelX * 1.5}, ${labelY * 1.5})`;
const labelTranslate = `translate(${labelX * 1.5}, ${labelY * 1.5})`;
// Put the keys in a line with equal spacing
// Put the keys in a line with equal spacing const nonZeroItems = data.filter(d => d.value != 0).length;
const nonZeroItems = data.filter(d => d.value != 0).length; const thisItemIndex = data.slice(0, i + 1).filter(d => d.value != 0).length - 1;
const thisItemIndex = data.slice(0, i + 1).filter(d => d.value != 0).length - 1; const keyX = -width / 2 + (width / nonZeroItems) * (thisItemIndex + 0.5);
const keyX = -width / 2 + (width / nonZeroItems) * (thisItemIndex + 0.5); const keyTranslate = `translate(${keyX}, ${width * 0.45})`;
const keyTranslate = `translate(${keyX}, ${width * 0.45})`;
return (
return ( <g key={`group-${i}`}>
<g key={`group-${i}`}> <path key={`arc-${i}`} d={this.arc(d)} style={{ fill: this.colors[i] }} />
<path key={`arc-${i}`} d={this.arc(d)} style={{ fill: this.colors[i] }} /> <text key={`label-${i}`} transform={labelTranslate} style={{ strokeWidth: '0px', fill: LABEL_COLOUR }} textAnchor='middle'>{d.value}</text>
<text key={`label-${i}`} transform={labelTranslate} style={{ strokeWidth: '0px', fill: LABEL_COLOUR }} textAnchor='middle'>{d.value}</text> <text key={`key-${i}`} transform={keyTranslate} style={{ strokeWidth:'0px', fill: this.colors[i] }} textAnchor='middle'>{d.data.label}</text>
<text key={`key-${i}`} transform={keyTranslate} style={{ strokeWidth:'0px', fill: this.colors[i] }} textAnchor='middle'>{d.data.label}</text> </g>
</g> );
); }
}
/**
/** * Render the component
* Render the component * @returns {object} Markup
* @returns {object} Markup */
*/ render() {
render() { return (
return ( <ContainerDimensions>
<ContainerDimensions> { ({ width }) => {
{ ({ width }) => { const pie = this.pie(this.props.data),
const pie = this.pie(this.props.data), translate = `translate(${width / 2}, ${width * 0.4})`;
translate = `translate(${width / 2}, ${width * 0.4})`;
this.arc.outerRadius(width * 0.4);
this.arc.outerRadius(width * 0.4); return (
return ( <div width={width} height={width}>
<div width={width} height={width}> <svg style={{ stroke: 'None' }} width={width} height={width * 0.9}>
<svg style={{ stroke: 'None' }} width={width} height={width * 0.9}> <g transform={translate}>
<g transform={translate}> {pie.map((d, i) => this.sliceGenerator(d, i, width))}
{pie.map((d, i) => this.sliceGenerator(d, i, width))} </g>
</g> </svg>
</svg> </div>
</div> );
); }}
}} </ContainerDimensions>
</ContainerDimensions> );
); }
} }
}

View File

@@ -2,7 +2,8 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Pip } from './SvgIcons'; import { Pip } from './SvgIcons';
import autoBind from 'auto-bind'; import { autoBind } from 'react-extras';
import { Ship } from 'ed-forge';
/** /**
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area. * Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
@@ -10,13 +11,9 @@ import autoBind from 'auto-bind';
*/ */
export default class Pips extends TranslatedComponent { export default class Pips extends TranslatedComponent {
static propTypes = { static propTypes = {
sys: PropTypes.number.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
wep: PropTypes.number.isRequired, onChange: PropTypes.func.isRequired,
mcSys: PropTypes.number.isRequired,
mcEng: PropTypes.number.isRequired,
mcWep: PropTypes.number.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -27,6 +24,12 @@ export default class Pips extends TranslatedComponent {
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); autoBind(this);
const { ship } = props;
this._incSys = this._change(ship.incSys);
this._incEng = this._change(ship.incEng);
this._incWep = this._change(ship.incWep);
this._reset = this._change(ship.pipsReset);
} }
/** /**
@@ -71,153 +74,42 @@ export default class Pips extends TranslatedComponent {
} }
/** /**
* Reset the capacitor * Creates a function that handles pip assignment and call `onChance`.
*/ * @param {String} cb Callback that handles the actual pip assignment
_reset(isMc) {
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
if (isMc) {
if (mcSys || mcEng || mcWep) {
sys -= mcSys;
eng -= mcEng;
wep -= mcWep;
this.props.onChange(sys, eng, wep, 0, 0, 0);
}
} else if (sys != 2 || eng != 2 || wep != 2) {
sys = eng = wep = 2;
this.props.onChange(sys + mcSys, eng + mcEng, wep + mcWep, mcSys, mcEng, mcWep);
}
}
/**
* Increment the SYS capacitor
*/
_incSys() {
this._inc('sys', false);
}
/**
* Increment the ENG capacitor
*/
_incEng() {
this._inc('eng', false);
}
/**
* Increment the WEP capacitor
*/
_incWep() {
this._inc('wep', false);
}
_wrapMcClick(key) {
return (event) => {
event.stopPropagation();
event.preventDefault();
if (key == 'rst') {
this._reset(true);
} else {
this._inc(key, true);
}
};
}
/**
* Increases a given capacitor
* @param {String} key Pip name to increase (one of 'sys', 'eng', 'wep')
* @param {Boolean} isMc True when increase is by multi crew * @param {Boolean} isMc True when increase is by multi crew
* @returns {Function} Function that handles pip assigment
*/ */
_inc(key, isMc) { _change(cb, isMc) {
if (!['sys', 'eng', 'wep'].includes(key)) { return () => {
return; cb(isMc);
} this.props.onChange(this.props.ship.getDistributorSettingsObject());
};
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
let mc = key == 'sys' ? mcSys : (key == 'eng' ? mcEng : mcWep);
let pips = this.props[key] - mc;
let other1 = key == 'sys' ? eng - mcEng : sys - mcSys;
let other2 = key == 'wep' ? eng - mcEng : wep - mcWep;
const required = Math.min(1, 4 - mc - pips);
if (isMc) {
// We can only set full pips in multi-crew also we can only set two pips
if (required > 0.5 && mcSys + mcEng + mcWep < 2) {
if (key == 'sys') {
mcSys += 1;
} else if (key == 'eng') {
mcEng += 1;
} else {
mcWep += 1;
}
}
} else if (required > 0) {
if (required == 0.5) {
// Take from whichever is larger
if (other1 > other2) {
other1 -= 0.5;
} else {
other2 -= 0.5;
}
pips += 0.5;
} else {
// Required is 1 - take from both if possible
if (other1 == 0) {
other2 -= 1;
} else if (other2 == 0) {
other1 -= 1;
} else {
other1 -= 0.5;
other2 -= 0.5;
}
pips += 1;
}
}
sys = mcSys + (key == 'sys' ? pips : other1);
eng = mcEng + (key == 'eng' ? pips : (key == 'sys' ? other1 : other2));
wep = mcWep + (key == 'wep' ? pips : other2);
this.props.onChange(sys, eng, wep, mcSys, mcEng, mcWep);
} }
/** /**
* Set up the rendering for pips * Set up the rendering for pips
* @param {Number} sys the SYS pips
* @param {Number} eng the ENG pips
* @param {Number} wep the WEP pips
* @param {Number} mcSys SYS pips from multi-crew
* @param {Number} mcEng ENG pips from multi-crew
* @param {Number} mcWep WEP pips from multi-crew
* @returns {Object} Object containing the rendering for the pips * @returns {Object} Object containing the rendering for the pips
*/ */
_renderPips(sys, eng, wep, mcSys, mcEng, mcWep) { _renderPips() {
const pipsSvg = { const pipsSvg = {
SYS: [], Sys: [],
ENG: [], Eng: [],
WEP: [], Wep: [],
}; };
// Multi-crew pipsSettings actually are included in the overall pip count therefore for (let k in this.props.pips) {
// we can consider [0, sys - mcSys] as normal pipsSettings whilst [sys - mcSys, sys] let { base, mc } = this.props.pips[k];
// are the multi-crew pipsSettings in what follows. for (let i = 0; i < Math.floor(base); i++) {
pipsSvg[k].push(<Pip key={i} className='full' />);
let pipsSettings = {
SYS: [sys, mcSys],
ENG: [eng, mcEng],
WEP: [wep, mcWep],
};
for (let pipName in pipsSettings) {
let [pips, mcPips] = pipsSettings[pipName];
for (let i = 0; i < Math.floor(pips - mcPips); i++) {
pipsSvg[pipName].push(<Pip key={i} className='full' />);
} }
if (pips > Math.floor(pips)) { if (base > Math.floor(base)) {
pipsSvg[pipName].push(<Pip className='half' key={'half'} />); pipsSvg[k].push(<Pip className='half' key={'half'} />);
} }
for (let i = pips - mcPips; i < Math.floor(pips); i++) { for (let i = 0; i < mc; i++) {
pipsSvg[pipName].push(<Pip key={i} className='mc' />); pipsSvg[k].push(<Pip key={base + i} className='mc' />);
} }
for (let i = Math.floor(pips + 0.5); i < 4; i++) { for (let i = Math.ceil(base + mc); i < 4; i++) {
pipsSvg[pipName].push(<Pip className='empty' key={i} />); pipsSvg[k].push(<Pip className='empty' key={i} />);
} }
} }
@@ -229,11 +121,10 @@ export default class Pips extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { tooltip, termtip } = this.context; const { ship } = this.props;
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
const pipsSvg = this._renderPips(sys, eng, wep, mcSys, mcEng, mcWep); const pipsSvg = this._renderPips();
return ( return (
<span id='pips'> <span id='pips'>
<table> <table>
@@ -241,38 +132,40 @@ export default class Pips extends TranslatedComponent {
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={() => this._inc('eng')} <td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td>
onContextMenu={this._wrapMcClick('eng')}>{pipsSvg['ENG']}</td>
<td>&nbsp;</td> <td>&nbsp;</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td>
onContextMenu={this._wrapMcClick('sys')}>{pipsSvg['SYS']}</td> <td className='clickable' onClick={this._incEng}>
<td className='clickable' onClick={this._incEng} {translate('ENG')}
onContextMenu={this._wrapMcClick('eng')}>{translate('ENG')}</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td>
onContextMenu={this._wrapMcClick('wep')}>{pipsSvg['WEP']}</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>
onContextMenu={this._wrapMcClick('sys')}>{translate('SYS')}</td> {translate('SYS')}
<td className='clickable' onClick={this._reset.bind(this, false)}> </td>
<td className='clickable' onClick={this._reset}>
{translate('RST')} {translate('RST')}
</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>
onContextMenu={this._wrapMcClick('wep')}>{translate('WEP')}</td> {translate('WEP')}
</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td className='clickable' onClick={this._change(ship.incSys, true)}>
<td className='clickable secondary' onClick={this._wrapMcClick('rst')} <Pip className='mc' />
onMouseEnter={termtip.bind(null, 'PHRASE_MULTI_CREW_CAPACITOR_POINTS')} </td>
onMouseLeave={tooltip.bind(null, null)}> <td className='clickable' onClick={this._change(ship.incEng, true)}>
{translate('RST')} <Pip className='mc' />
</td>
<td className='clickable' onClick={this._change(ship.incWep, true)}>
<Pip className='mc' />
</td> </td>
<td>&nbsp;</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -4,27 +4,25 @@ import * as d3 from 'd3';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { Ship } from 'ed-forge';
import { POWER_METRICS } from 'ed-forge/lib/ship-stats';
import autoBind from 'auto-bind';
/** /**
* Round to avoid floating point precision errors * Get the band-class.
* @param {Boolean} selected Band selected * @param {Boolean} selected Band selected
* @param {number} sum Band power sum * @param {Number} relDraw Relative amount of power drawn by this band and
* @param {number} avail Total available power * all prior
* @return {string} CSS Class name * @return {string} CSS Class name
*/ */
function getClass(selected, sum, avail) { function getClass(selected, relDraw) {
return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary'; if (selected) {
} return 'secondary';
} else if (relDraw >= 1) {
/** return 'warning';
* Get the # label for a Priority band } else {
* @param {number} val Priority Band Watt value return 'primary';
* @param {number} index Priority Band index }
* @param {Function} wattScale Watt Scale function
* @return {number} label / text
*/
function bandText(val, index, wattScale) {
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
} }
/** /**
@@ -33,10 +31,9 @@ function bandText(val, index, wattScale) {
*/ */
export default class PowerBands extends TranslatedComponent { export default class PowerBands extends TranslatedComponent {
static propTypes = { static propTypes = {
bands: PropTypes.array.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
available: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
width: PropTypes.number.isRequired, width: PropTypes.number.isRequired,
code: PropTypes.string,
}; };
/** /**
@@ -46,20 +43,16 @@ export default class PowerBands extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this.wattScale = d3.scaleLinear(); this.wattScale = d3.scaleLinear();
this.pctScale = d3.scaleLinear().domain([0, 1]); this.pctScale = d3.scaleLinear().domain([0, 1]);
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2); this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct); this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateScales = this._updateScales.bind(this);
this._selectNone = this._selectNone.bind(this);
this._hidetip = () => this.context.tooltip(); this._hidetip = () => this.context.tooltip();
let maxBand = props.bands[props.bands.length - 1]; this.profile = props.ship.getMetrics(POWER_METRICS);
this.state = { this.state = {
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
ret: {}, ret: {},
dep: {} dep: {}
}; };
@@ -83,8 +76,6 @@ export default class PowerBands extends TranslatedComponent {
let mRight = Math.round(140 * scale); let mRight = Math.round(140 * scale);
let innerWidth = props.width - mLeft - mRight; let innerWidth = props.width - mLeft - mRight;
this._updateScales(innerWidth, this.state.maxPwr, props.available);
this.setState({ this.setState({
barHeight, barHeight,
innerHeight, innerHeight,
@@ -140,41 +131,67 @@ export default class PowerBands extends TranslatedComponent {
this.setState({ dep: Object.assign({}, dep) }); this.setState({ dep: Object.assign({}, dep) });
} }
/**
* Update scale
* @param {number} innerWidth SVG innerwidth
* @param {number} maxPwr Maximum power level MJ (deployed or available)
* @param {number} available Available power MJ
*/
_updateScales(innerWidth, maxPwr, available) {
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
}
/** /**
* Update state based on property and context changes * Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties * @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context * @param {Object} nextContext Incoming/Next context
*/ */
componentWillReceiveProps(nextProps, nextContext) { componentWillReceiveProps(nextProps, nextContext) {
let { innerWidth, maxPwr } = this.state;
let { language, sizeRatio } = this.context; let { language, sizeRatio } = this.context;
let maxBand = nextProps.bands[nextProps.bands.length - 1];
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
if (language !== nextContext.language) { if (language !== nextContext.language) {
this.wattAxis.tickFormat(nextContext.language.formats.r2); this.wattAxis.tickFormat(nextContext.language.formats.r2);
this.pctAxis.tickFormat(nextContext.language.formats.rPct); this.pctAxis.tickFormat(nextContext.language.formats.rPct);
} }
if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
this.setState({ maxPwr: nextMaxPwr });
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateDimensions(nextProps, nextContext.sizeRatio); this._updateDimensions(nextProps, nextContext.sizeRatio);
} }
} }
/**
* Assemble bands for relative consumption array.
* @param {Number[]} consumed Array of relative-consumption numbers
* @param {object} selected Object mapping selected bands to 1
* @param {Number} yOffset Offset in y-direction of the bar
* @param {Function} onClick onClick callback
* @returns {React.Component} Bands
*/
_consumedToBands(consumed, selected, yOffset, onClick) {
const { state, wattScale } = this;
const bands = [];
let consumesPrev = 0;
for (let i = 0; i < consumed.length; i++) {
consumesPrev = consumed[i - 1] || consumesPrev;
const consumes = consumed[i];
if (!consumes) {
continue;
}
bands.push(<rect
key={'b' + i}
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
height={state.barHeight}
x={wattScale(consumesPrev)}
y={yOffset + 1}
onClick={onClick.bind(this, i)}
className={getClass(selected[i], consumes)}
/>);
bands.push(<text
key={'t' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
y={yOffset + (state.barHeight / 2)}
onClick={onClick.bind(this, i)}
className='primary-bg'>{i + 1}</text>
);
}
return bands;
}
/** /**
* Render the power bands * Render the power bands
* @return {React.Component} Power bands * @return {React.Component} Power bands
@@ -184,78 +201,27 @@ export default class PowerBands extends TranslatedComponent {
return null; return null;
} }
let { wattScale, pctScale, context, props, state } = this; let { pctScale, context, props, state } = this;
let { translate, formats } = context.language; let { translate, formats } = context.language;
let { f2, pct1 } = formats; // wattFmt, pctFmt let { f2, pct1 } = formats; // wattFmt, pctFmt
let { available, bands } = props; let { ship } = props;
let { innerWidth, ret, dep } = state; let { innerWidth, ret, dep, barHeight } = state;
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
let deployed = []; let {
let retracted = []; consumed, generated, relativeConsumed, relativeConsumedRetracted
} = ship.getMetrics(POWER_METRICS);
let maxPwr = Math.max(consumed, generated);
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
let depSum = relativeConsumed[relativeConsumed.length - 1];
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
let retSelected = Object.keys(ret).length > 0; let retSelected = Object.keys(ret).length > 0;
let depSelected = Object.keys(dep).length > 0; let depSelected = Object.keys(dep).length > 0;
let retSum = 0;
let depSum = 0;
for (let i = 0; i < bands.length; i++) {
let b = bands[i];
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
if (b.retracted > 0) {
let retLbl = bandText(b.retracted, i, wattScale);
retracted.push(<rect
key={'rB' + i}
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
y={1}
onClick={this._selectRet.bind(this, i)}
className={getClass(ret[i], b.retractedSum, available)}
/>);
if (retLbl) {
retracted.push(<text
key={'rT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
y={state.retY}
onClick={this._selectRet.bind(this, i)}
className='primary-bg'>{retLbl}</text>
);
}
}
if (b.retracted > 0 || b.deployed > 0) {
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
deployed.push(<rect
key={'dB' + i}
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
y={state.barHeight + 1}
onClick={this._selectDep.bind(this, i)}
className={getClass(dep[i], b.deployedSum, available)}
/>);
if (depLbl) {
deployed.push(<text
key={'dT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
y={state.depY}
onClick={this._selectDep.bind(this, i)}
className='primary-bg'>{depLbl}</text>
);
}
}
}
return ( return (
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}> <svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
@@ -271,8 +237,8 @@ export default class PowerBands extends TranslatedComponent {
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} /> <line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text> <text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text> <text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text>
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text>
</g> </g>
</svg> </svg>
); );

View File

@@ -3,24 +3,49 @@ import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import PowerBands from './PowerBands'; import PowerBands from './PowerBands';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import { Power, NoPower } from './SvgIcons'; import { Power, NoPower } from './SvgIcons';
import autoBind from 'auto-bind';
import { Ship, Module } from 'ed-forge';
const POWER = [ /**
null, * Makes a comparison based on the order `false < undefined < true` (fut) and
null, * maps it to `[-1, 0, 1]`.
<NoPower className='icon warning' />, * @param {boolean} a Bool or undefined
<Power className='secondary-disabled' /> * @param {boolean} b Bool or undefined
]; * @returns {number} Comparison
*/
function futComp(a, b) {
switch (a) {
case false: return (b === false ? 0 : 1);
// The next else-expression maps false to -1 and true to 1
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
case true: return (b === true ? 0 : -1);
}
}
/**
* Get the enabled-icon.
* @param {boolean} enabled Is the module enabled?
* @returns {React.Component} Enabled icon.
*/
function getPowerIcon(enabled) {
if (enabled === undefined) {
return null;
}
if (enabled) {
return <Power className='secondary-disabled' />;
} else {
return <NoPower className='icon warning' />;
}
}
/** /**
* Power Management Section * Power Management Section
*/ */
export default class PowerManagement extends TranslatedComponent { export default class PowerManagement extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -29,19 +54,17 @@ export default class PowerManagement extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._renderPowerRows = this._renderPowerRows.bind(this); autoBind(this);
this._updateWidth = this._updateWidth.bind(this);
this._sort = this._sort.bind(this);
this.state = { this.state = {
predicate: 'pwr', predicate: 'pwr',
desc: false, desc: true,
width: 0 width: 0
}; };
} }
/** /**
* Set the sort order and sort * Set the sort order
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
@@ -53,50 +76,51 @@ export default class PowerManagement extends TranslatedComponent {
desc = true; desc = true;
} }
this._sort(this.props.ship, predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/** /**
* Sorts the power list * Sorts the power list
* @param {Ship} ship Ship instance * @param {Module[]} modules Modules to sort
* @param {string} predicate Sort predicate * @returns {Module[]} Sorted modules
* @param {Boolean} desc Sort order descending
*/ */
_sort(ship, predicate, desc) { _sortAndFilter(modules) {
let powerList = ship.powerList; modules = modules.filter((m) => m.get('powerdraw') >= 0);
let comp = slotComparator.bind(null, this.context.language.translate); let { translate } = this.context.language;
const { predicate, desc } = this.state;
let comp;
switch (predicate) { switch (predicate) {
case 'n': comp = comp(null, desc); break; case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare(
case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break; translate(b.readMeta('type'))
case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break; ); break;
case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break; // case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break; case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break;
case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break; case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break;
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
} }
modules.sort(comp);
powerList.sort(comp); if (desc) {
modules.reverse();
}
return modules;
} }
/** /**
* Update slot priority * Creates a callback that changes the power priority for the given module
* @param {Object} slot Slot model * based on the given delta.
* @param {number} inc increment / decrement * @param {Module} m Module to set the priority for
* @param {Number} delta Delta to set
* @returns {Function} Callback
*/ */
_priority(slot, inc) { _prioCb(m, delta) {
if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) { return () => {
this.props.onChange(); const prio = m.getPowerPriority();
} const newPrio = Math.max(0, prio + delta);
} if (0 <= newPrio) {
m.setPowerPriority(newPrio);
/** }
* Toggle slot active/inactive };
* @param {Object} slot Slot model
*/
_toggleEnabled(slot) {
this.props.ship.setSlotEnabled(slot, !slot.enabled);
this.props.onChange();
} }
/** /**
@@ -110,52 +134,35 @@ export default class PowerManagement extends TranslatedComponent {
_renderPowerRows(ship, translate, pwr, pct) { _renderPowerRows(ship, translate, pwr, pct) {
let powerRows = []; let powerRows = [];
for (let i = 0, l = ship.powerList.length; i < l; i++) { let modules = this._sortAndFilter(ship.getModules());
let slot = ship.powerList[i]; for (let m of modules) {
let retractedElem = null, deployedElem = null;
if (slot.m && slot.m.getPowerUsage() > 0) { const flipEnabled = () => m.setEnabled();
let m = slot.m; if (m.isEnabled()) {
let toggleEnabled = this._toggleEnabled.bind(this, slot); let powered = m.isPowered();
let retractedElem = null, deployedElem = null; retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
if (slot.enabled) { } else {
retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>; retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>;
} else {
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>;
}
// If this is a Guardian Shield Reinforcement Package or Guardian Hull Reinforcement Package, or Guardian Module Reinforcement Package, it cannot change priority
let priorityField;
if (m.symbol) {
if (m.symbol.match(/GuardianShield/i) || m.symbol.match(/GuardianHull/i) || m.symbol.match(/GuardianModule/i)) {
priorityField = <td>1</td>;
} else {
priorityField = <td>
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>&#9658;</span>
{' ' + (slot.priority + 1) + ' '}
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>&#9658;</span>
</td>;
}
}
else {
priorityField = <td>
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>&#9658;</span>
{' ' + (slot.priority + 1) + ' '}
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>&#9658;</span>
</td>;
}
powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td>
<td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td>
<td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td>
{priorityField}
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
{retractedElem}
{deployedElem}
</tr>);
} }
const slot = m.getSlot();
powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}>
<td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td>
<td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td>
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
<td>
<span className='flip ptr btn' onClick={this._prioCb(m, -1)}>&#9658;</span>
{' ' + (m.getPowerPriority() + 1) + ' '}
<span className='ptr btn' onClick={this._prioCb(m, 1)}>&#9658;</span>
</td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u>
</td>
{retractedElem}
{deployedElem}
</tr>);
} }
return powerRows; return powerRows;
} }
@@ -171,7 +178,6 @@ export default class PowerManagement extends TranslatedComponent {
* Add listeners when about to mount and sort power list * Add listeners when about to mount and sort power list
*/ */
componentWillMount() { componentWillMount() {
this._sort(this.props.ship, this.state.predicate, this.state.desc);
this.resizeListener = this.context.onWindowResize(this._updateWidth); this.resizeListener = this.context.onWindowResize(this._updateWidth);
} }
@@ -182,17 +188,6 @@ export default class PowerManagement extends TranslatedComponent {
this._updateWidth(); this._updateWidth();
} }
/**
* Sort power list if the ship instance has changed
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
if (this.props.ship != nextProps.ship) {
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
}
}
/** /**
* Remove listeners on unmount * Remove listeners on unmount
*/ */
@@ -207,39 +202,38 @@ export default class PowerManagement extends TranslatedComponent {
render() { render() {
let { ship, code } = this.props; let { ship, code } = this.props;
let { translate, formats } = this.context.language; let { translate, formats } = this.context.language;
let pwr = formats.f2; let pp = ship.getPowerPlant();
let pp = ship.standard[0].m;
let sortOrder = this._sortOrder;
return ( return (
<div ref={node => this.node = node} className='group half' id='componentPriority'> <div ref={node => this.node = node} className='group half' id='componentPriority'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th> {/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */}
<th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th> <th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th>
<th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th> <th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{pp.class + pp.rating}</td> <td>{String(pp.getClass()) + pp.getRating()}</td>
<td className='le shorten cap' >{translate('pp')}</td> <td className='le shorten cap' >{translate('pp')}</td>
<td><u >{translate('SYS')}</u></td>
<td>1</td> <td>1</td>
<td className='ri'>{pwr(pp.getPowerGeneration())}</td> <td className='ri'>{formats.f2(pp.get('powercapacity'))}</td>
<td className='ri'><u>100%</u></td> <td className='ri'><u>100%</u></td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
<tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr> <tr><td style={{ lineHeight:0 }} colSpan='8'>
{this._renderPowerRows(ship, translate, pwr, formats.pct1)} <hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} />
</td></tr>
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
</tbody> </tbody>
</table> </table>
<PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} /> <PowerBands width={this.state.width} ship={ship} code={code} />
</div> </div>
); );
} }

View File

@@ -5,6 +5,7 @@ import { Ships } from 'coriolis-data/dist';
import { Rocket } from './SvgIcons'; import { Rocket } from './SvgIcons';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import cn from 'classnames'; import cn from 'classnames';
import autoBind from 'auto-bind';
/** /**
* Ship picker * Ship picker
@@ -26,13 +27,9 @@ export default class ShipPicker extends TranslatedComponent {
* @param {object} props Properties react * @param {object} props Properties react
* @param {object} context react context * @param {object} context react context
*/ */
constructor(props, context) { // eslint-disable-line constructor(props, context) {
super(props); super(props);
autoBind(this);
this.shipOrder = Object.keys(Ships).sort();
this._toggleMenu = this._toggleMenu.bind(this);
this._closeMenu = this._closeMenu.bind(this);
this.state = { menuOpen: false }; this.state = { menuOpen: false };
} }
@@ -114,11 +111,11 @@ export default class ShipPicker extends TranslatedComponent {
<span className='menu-item-label'>{shipString}</span> <span className='menu-item-label'>{shipString}</span>
</div> </div>
{ menuOpen ? { menuOpen ?
<div className='menu-list' onClick={ (e) => e.stopPropagation() }> <div className='menu-list' onClick={ (e) => e.stopPropagation() }>
<div className='quad'> <div className='quad'>
{this._renderPickerMenu()} {this._renderPickerMenu()}
</div> </div>
</div> : null } </div> : null }
</div> </div>
</div> </div>
); );

View File

@@ -1,21 +1,24 @@
import autoBind from 'auto-bind';
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { Warning } from './SvgIcons'; import { Warning } from './SvgIcons';
import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
const {
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, MAXIMUM_MASS,
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
} = ShipProps;
/** /**
* Ship Summary Table / Stats * Ship Summary Table / Stats
*/ */
export default class ShipSummaryTable extends TranslatedComponent { export default class ShipSummaryTable extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired,
pips: PropTypes.object.isRequired
}; };
/** /**
@@ -24,7 +27,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this.didContextChange = this.didContextChange.bind(this); autoBind(this);
this.state = { this.state = {
shieldColour: 'blue' shieldColour: 'blue'
}; };
@@ -35,46 +38,54 @@ export default class ShipSummaryTable extends TranslatedComponent {
* @return {React.Component} Summary table * @return {React.Component} Summary table
*/ */
render() { render() {
const { ship, cargo, fuel, pips } = this.props; const { ship } = this.props;
let { language, tooltip, termtip } = this.context; let { language, tooltip, termtip } = this.context;
let translate = language.translate; let translate = language.translate;
let u = language.units; let u = language.units;
let formats = language.formats; let formats = language.formats;
let { time, int, round, f1, f2 } = formats; let { time, int, f1, f2 } = formats;
let hide = tooltip.bind(null, null); let hide = tooltip.bind(null, null);
const shieldGenerator = ship.findInternalByGroup('sg') || ship.findInternalByGroup('psg');
const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator }); const speed = ship.get(SPEED);
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL'; const shipBoost = ship.get(BOOST_SPEED);
const timeToDrain = Calc.timeToDrainWep(ship, 4); const canThrust = 0 < speed;
const canThrust = ship.canThrust(cargo, ship.fuelCapacity); const canBoost = canThrust && !isNaN(shipBoost);
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canJump = ship.getSlotStatus(ship.standard[2]) == 3;
const sgMetrics = Calc.shieldMetrics(ship, pips.sys); const sgMetrics = ship.get(SHIELD_METRICS);
const distBoost = canBoost ? Calc.calcBoost(ship) : 'No Boost'; const armourMetrics = ship.get(ARMOUR_METRICS);
//const shipBoost = ship.boostInterval(ship) const damageMetrics = ship.get(DAMAGE_METRICS);
const restingHeat = Math.sqrt(((ship.standard[0].m.pgen * ship.standard[0].m.eff) / ship.heatCapacity) / 0.2); const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
const armourMetrics = Calc.armourMetrics(ship); const timeToDrain = damageMetrics.timeToDrain[8];
const shieldGenerator = ship.getShieldGenerator();
const sgClassNames = cn({
warning: shieldGenerator && !shieldGenerator.isEnabled(),
muted: !shieldGenerator,
});
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined;
let shieldColour = 'blue'; let shieldColour = 'blue';
if (shieldGenerator && shieldGenerator.m.grp === 'psg') { switch (sgType) {
shieldColour = 'green'; case 'biweaveshieldgen': shieldColour = 'purple'; break;
} else if (shieldGenerator && shieldGenerator.m.grp === 'bsg') { case 'prismaticshieldgen': shieldColour = 'green'; break;
shieldColour = 'purple';
} }
this.state = { this.state = { shieldColour };
shieldColour
}; const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS);
// TODO:
const canJump = true;
return <div id='summary'> return <div id='summary'>
<div style={{display: "table", width: "100%"}}> <div style={{ display: 'table', width: '100%' }}>
<div style={{display: "table-row"}}> <div style={{ display: 'table-row' }}>
<table className={'summaryTable'}> <table className={'summaryTable'}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVALS', { cap: 0 })}colSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost int')}</th> <th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRange == 0 }) }>{translate('jump range')}</th>
<th colSpan={5} className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('jump range')}</th>
<th rowSpan={2}>{translate('shield')}</th> <th rowSpan={2}>{translate('shield')}</th>
<th rowSpan={2}>{translate('integrity')}</th> <th rowSpan={2}>{translate('integrity')}</th>
<th rowSpan={2}>{translate('DPS')}</th> <th rowSpan={2}>{translate('DPS')}</th>
@@ -88,16 +99,15 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th onMouseEnter={termtip.bind(null, 'hull hardness', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('hrd')}</th> <th onMouseEnter={termtip.bind(null, 'hull hardness', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('hrd')}</th>
<th rowSpan={2}>{translate('crew')}</th> <th rowSpan={2}>{translate('crew')}</th>
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th> <th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th>
<th rowSpan={2}>{translate('resting heat (Beta)')}</th> <th rowSpan={2}>{translate('resting heat (Beta)')}</th>
</tr> </tr>
<tr> <tr>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide}>{translate('distro')}</th> <th className="lft">{translate('max')}</th>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_SHIP_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide}>{translate('ship')}</th> <th>{translate('unladen')}</th>
<th className={ cn({ 'lft': true, 'bg-warning-disabled': !canJump }) }>{translate('max')}</th> <th>{translate('laden')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('unladen')}</th> <th>{translate('total unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('laden')}</th> <th>{translate('total laden')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total laden')}</th>
<th className='lft'>{translate('hull')}</th> <th className='lft'>{translate('hull')}</th>
<th>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th>{translate('laden')}</th> <th>{translate('laden')}</th>
@@ -105,31 +115,87 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })}
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> onMouseLeave={hide}
<td>{distBoost !== 'No Boost' ? formats.time(distBoost) : 'No Boost'}</td> >{canThrust ?
<td>{ship.boostInt && ship.boostInt !== 'undefined' ? formats.time(ship.boostInt) : 0 }</td> <span>{int(speed)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{ f2(Calc.jumpRange(ship.unladenMass - ship.fuelCapacity + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump(), ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> >{canBoost ?
<td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td> <span>{int(shipBoost)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td> onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
<span>{f2(jumpRangeMetrics.jumpRange)}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
// TODO:
<span>{NaN}{u.LY}</span> :
<span className='warning'>0 <Warning/></span>
}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{canJump ?
<span>{f2(jumpRangeMetrics.totalRange)}{u.LY}</span> :
<span className='warning'>0<Warning/></span>
}</td>
<td className={sgClassNames}
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
onMouseLeave={hide}
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
onMouseLeave={hide}
>{int(armourMetrics.armour)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.dps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.eps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
onMouseLeave={hide}
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
{/* <td>{f1(ship.totalHps)}</td> */} {/* <td>{f1(ship.totalHps)}</td> */}
<td>{round(ship.cargoCapacity)}{u.T}</td> <td>{ship.get(CARGO_CAPACITY)}{u.T}</td>
<td>{ship.passengerCapacity}</td> <td>{ship.get(PASSENGER_CAPACITY)}</td>
<td>{round(ship.fuelCapacity)}{u.T}</td> <td>{ship.get(FUEL_CAPACITY)}{u.T}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td> >{ship.readProp('hullmass')}{u.T}</td>
<td>{int(ship.hardness)}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })}
<td>{ship.crew}</td> onMouseLeave={hide}
<td>{ship.masslock}</td> >{int(ship.get(UNLADEN_MASS))}{u.T}</td>
<td>{formats.pct(restingHeat)}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })}
onMouseLeave={hide}
>{int(ship.get(MAXIMUM_MASS))}{u.T}</td>
<td>{int(ship.readProp('hardness'))}</td>
<td>{ship.readMeta('crew')}</td>
<td>{ship.readProp('masslock')}</td>
{/* TODO: boost intervall */}
<td>{NaN}</td>
{/* TODO: resting heat */}
<td>{NaN}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -157,21 +223,21 @@ export default class ShipSummaryTable extends TranslatedComponent {
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(shieldGenerator && shieldGenerator.m.grp || 'No Shield')}</td> <td>{translate(sgType || 'No Shield')}</td>
<td>{formats.pct1(ship.shieldExplRes)}</td> <td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldKinRes)}</td> <td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldThermRes)}</td> <td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td>
<td></td> <td></td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary / sgMetrics.explosive.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.kinetic.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.thermal.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td>
<td></td> <td></td>
<td>{sgMetrics && sgMetrics.recover === Math.Inf ? translate('Never') : formats.time(sgMetrics.recover)}</td> <td>{formats.time(sgMetrics.recover) || translate('Never')}</td>
<td>{sgMetrics && sgMetrics.recharge === Math.Inf ? translate('Never') : formats.time(sgMetrics.recharge)}</td> <td>{formats.time(sgMetrics.recharge) || translate('Never')}</td>
</tr> </tr>
</tbody> </tbody>
<thead> <thead>
<tr> <tr>
@@ -183,7 +249,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th> <th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th>
</tr> </tr>
<tr> <tr>
<th>{`${translate('explosive')}`}</th> <th>{`${translate('explosive')}`}</th>
<th>{`${translate('kinetic')}`}</th> <th>{`${translate('kinetic')}`}</th>
<th>{`${translate('thermal')}`}</th> <th>{`${translate('thermal')}`}</th>
<th>{`${translate('caustic')}`}</th> <th>{`${translate('caustic')}`}</th>
@@ -197,19 +263,18 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(ship && ship.bulkheads && ship.bulkheads.m && ship.bulkheads.m.name || 'No Armour')}</td> <td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td>
<td>{formats.pct1(ship.hullExplRes)}</td> <td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullKinRes)}</td> <td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullThermRes)}</td> <td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullCausRes)}</td> <td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.total)}</td> <td>{int(armourMetrics.armour)}</td>
<td>{int(armourMetrics.total / armourMetrics.explosive.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.kinetic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td>
<td>{int(armourMetrics.total / armourMetrics.thermal.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.caustic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.modulearmour)}</td> <td>{int(moduleProtectionMetrics.moduleArmour)}</td>
<td>{int(armourMetrics.moduleprotection * 100) + '%'}</td> <td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -1,386 +1,386 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
const MARGIN_LR = 8; // Left/ Right margin const MARGIN_LR = 8; // Left/ Right margin
/** /**
* Horizontal Slider * Horizontal Slider
*/ */
export default class Slider extends React.Component { export default class Slider extends React.Component {
static defaultProps = { static defaultProps = {
axis: false, axis: false,
min: 0, min: 0,
max: 1, max: 1,
scale: 1 // SVG render scale scale: 1 // SVG render scale
}; };
static propTypes = { static propTypes = {
axis: PropTypes.bool, axis: PropTypes.bool,
axisUnit: PropTypes.string,// units (T, M, etc.) axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number, max: PropTypes.number,
min: PropTypes.number, min: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value onChange: PropTypes.func.isRequired,// function which determins percent value
onResize: PropTypes.func, onResize: PropTypes.func,
percent: PropTypes.number.isRequired,// value of slider percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number scale: PropTypes.number
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._down = this._down.bind(this); this._down = this._down.bind(this);
this._move = this._move.bind(this); this._move = this._move.bind(this);
this._up = this._up.bind(this); this._up = this._up.bind(this);
this._keyup = this._keyup.bind(this); this._keyup = this._keyup.bind(this);
this._keydown = this._keydown.bind(this); this._keydown = this._keydown.bind(this);
this._touchstart = this._touchstart.bind(this); this._touchstart = this._touchstart.bind(this);
this._touchend = this._touchend.bind(this); this._touchend = this._touchend.bind(this);
this._updatePercent = this._updatePercent.bind(this); this._updatePercent = this._updatePercent.bind(this);
this._updateDimensions = this._updateDimensions.bind(this); this._updateDimensions = this._updateDimensions.bind(this);
this.state = { width: 0 }; this.state = { width: 0 };
} }
/** /**
* On Mouse/Touch down handler * On Mouse/Touch down handler
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_down(event) { _down(event) {
let rect = event.currentTarget.getBoundingClientRect(); let rect = event.currentTarget.getBoundingClientRect();
this.left = rect.left; this.left = rect.left;
this.width = rect.width; this.width = rect.width;
this._move(event); this._move(event);
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500); this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
} }
/** /**
* Update the slider percentage on move * Update the slider percentage on move
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_move(event) { _move(event) {
if(this.width !== null && this.left != null) { if(this.width !== null && this.left != null) {
let clientX = event.touches ? event.touches[0].clientX : event.clientX; let clientX = event.touches ? event.touches[0].clientX : event.clientX;
event.preventDefault(); event.preventDefault();
this._updatePercent(clientX - this.left, this.width); this._updatePercent(clientX - this.left, this.width);
} }
} }
/** /**
* On Mouse/Touch up handler * On Mouse/Touch up handler
* @param {Event} event DOM Event * @param {Event} event DOM Event
*/ */
_up(event) { _up(event) {
this.sliderInputBox.sliderVal.focus(); this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer); clearTimeout(this.touchStartTimer);
event.preventDefault(); event.preventDefault();
this.left = null; this.left = null;
this.width = null; this.width = null;
} }
/** /**
* Key up handler for keyboard. * Key up handler for keyboard.
* display the number field then set focus to it * display the number field then set focus to it
* when "Enter" key is pressed * when "Enter" key is pressed
* @param {Event} event Keyboard event * @param {Event} event Keyboard event
*/ */
_keyup(event) { _keyup(event) {
switch (event.key) { switch (event.key) {
case 'Enter': case 'Enter':
event.preventDefault(); event.preventDefault();
this.sliderInputBox._setDisplay('block'); this.sliderInputBox._setDisplay('block');
return; return;
default: default:
return; return;
} }
} }
/** /**
* Key down handler * Key down handler
* increment slider position by +/- 1 when right/left arrow key is pressed or held * increment slider position by +/- 1 when right/left arrow key is pressed or held
* @param {Event} event Keyboard even * @param {Event} event Keyboard even
*/ */
_keydown(event) { _keydown(event) {
let newVal = this.props.percent * this.props.max; let newVal = this.props.percent * this.props.max;
switch (event.key) { switch (event.key) {
case 'ArrowRight': case 'ArrowRight':
newVal += 1; newVal += 1;
if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max); if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
return; return;
case 'ArrowLeft': case 'ArrowLeft':
newVal -= 1; newVal -= 1;
if (newVal >= 0) this.props.onChange(newVal / this.props.max); if (newVal >= 0) this.props.onChange(newVal / this.props.max);
return; return;
default: default:
return; return;
} }
} }
/** /**
* Touch start handler * Touch start handler
* @param {Event} event DOM Event * @param {Event} event DOM Event
* *
*/ */
_touchstart(event) { _touchstart(event) {
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500); this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
} }
/** /**
* Touch end handler * Touch end handler
* @param {Event} event DOM Event * @param {Event} event DOM Event
* *
*/ */
_touchend(event) { _touchend(event) {
this.sliderInputBox.sliderVal.focus(); this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer); clearTimeout(this.touchStartTimer);
} }
/** /**
* Determine if the user is still dragging * Determine if the user is still dragging
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_enter(event) { _enter(event) {
if(event.buttons !== 1) { if(event.buttons !== 1) {
this.left = null; this.left = null;
this.width = null; this.width = null;
} }
} }
/** /**
* Update the slider percentage * Update the slider percentage
* @param {number} pos Slider drag position * @param {number} pos Slider drag position
* @param {number} width Slider width * @param {number} width Slider width
* @param {Event} event DOM Event * @param {Event} event DOM Event
*/ */
_updatePercent(pos, width) { _updatePercent(pos, width) {
this.props.onChange(Math.min(Math.max(pos / width, 0), 1)); this.props.onChange(Math.min(Math.max(pos / width, 0), 1));
} }
/** /**
* Update dimenions from rendered DOM * Update dimenions from rendered DOM
*/ */
_updateDimensions() { _updateDimensions() {
this.setState({ this.setState({
outerWidth: this.node.getBoundingClientRect().width outerWidth: this.node.getBoundingClientRect().width
}); });
} }
/** /**
* Add listeners when about to mount * Add listeners when about to mount
*/ */
componentWillMount() { componentWillMount() {
if (this.props.onResize) { if (this.props.onResize) {
this.resizeListener = this.props.onResize(this._updateDimensions); this.resizeListener = this.props.onResize(this._updateDimensions);
} }
} }
/** /**
* Trigger DOM updates on mount * Trigger DOM updates on mount
*/ */
componentDidMount() { componentDidMount() {
this._updateDimensions(); this._updateDimensions();
} }
/** /**
* Remove listeners on unmount * Remove listeners on unmount
*/ */
componentWillUnmount() { componentWillUnmount() {
if (this.resizeListener) { if (this.resizeListener) {
this.resizeListener.remove(); this.resizeListener.remove();
} }
} }
/** /**
* Render the slider * Render the slider
* @return {React.Component} The slider * @return {React.Component} The slider
*/ */
render() { render() {
let outerWidth = this.state.outerWidth; let outerWidth = this.state.outerWidth;
let { axis, axisUnit, min, max, scale } = this.props; let { axis, axisUnit, min, max, scale } = this.props;
let style = { let style = {
width: '100%', width: '100%',
height: axis ? '2.5em' : '1.5em', height: axis ? '2.5em' : '1.5em',
boxSizing: 'border-box' boxSizing: 'border-box'
}; };
if (!outerWidth) { if (!outerWidth) {
return <svg style={style} ref={node => this.node = node} />; return <svg style={style} ref={node => this.node = node} />;
} }
let margin = MARGIN_LR * scale; let margin = MARGIN_LR * scale;
let width = outerWidth - (margin * 2); let width = outerWidth - (margin * 2);
let pctPos = width * this.props.percent; let pctPos = width * this.props.percent;
return <div><svg return <div><svg
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0"> onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0">
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' /> <rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' /> <rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} /> <circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
<rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} onTouchEnd={this._touchend} /> <rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} onTouchEnd={this._touchend} />
{axis && <g style={{ fontSize: '.7em' }}> {axis && <g style={{ fontSize: '.7em' }}>
<text className='primary-disabled' y='3em' x={margin} style={{ textAnchor: 'middle' }}>{min + axisUnit}</text> <text className='primary-disabled' y='3em' x={margin} style={{ textAnchor: 'middle' }}>{min + axisUnit}</text>
<text className='primary-disabled' y='3em' x='50%' style={{ textAnchor: 'middle' }}>{(min + max / 2) + axisUnit}</text> <text className='primary-disabled' y='3em' x='50%' style={{ textAnchor: 'middle' }}>{(min + max / 2) + axisUnit}</text>
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text> <text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
</g>} </g>}
</svg> </svg>
<TextInputBox ref={(tb) => this.sliderInputBox = tb} <TextInputBox ref={(tb) => this.sliderInputBox = tb}
onChange={this.props.onChange} onChange={this.props.onChange}
percent={this.props.percent} percent={this.props.percent}
axisUnit={this.props.axisUnit} axisUnit={this.props.axisUnit}
scale={this.props.scale} scale={this.props.scale}
max={this.props.max} max={this.props.max}
/> />
</div>; </div>;
} }
} }
/** /**
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android) * New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
**/ **/
class TextInputBox extends React.Component { class TextInputBox extends React.Component {
static propTypes = { static propTypes = {
axisUnit: PropTypes.string,// units (T, M, etc.) axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number, max: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value onChange: PropTypes.func.isRequired,// function which determins percent value
percent: PropTypes.number.isRequired,// value of slider percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number scale: PropTypes.number
}; };
/** /**
* Determine if the user is still dragging * Determine if the user is still dragging
* @param {Object} props React Component properties * @param {Object} props React Component properties
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._handleFocus = this._handleFocus.bind(this); this._handleFocus = this._handleFocus.bind(this);
this._handleBlur = this._handleBlur.bind(this); this._handleBlur = this._handleBlur.bind(this);
this._handleChange = this._handleChange.bind(this); this._handleChange = this._handleChange.bind(this);
this._keyup = this._keyup.bind(this); this._keyup = this._keyup.bind(this);
this.state = this._getInitialState(); this.state = this._getInitialState();
} }
/** /**
* Update input value if slider changes will change props/state * Update input value if slider changes will change props/state
* @param {Object} nextProps React Component properites * @param {Object} nextProps React Component properites
* @param {Object} nextState React Component state values * @param {Object} nextState React Component state values
*/ */
componentWillReceiveProps(nextProps, nextState) { componentWillReceiveProps(nextProps, nextState) {
let nextValue = nextProps.percent * nextProps.max; let nextValue = nextProps.percent * nextProps.max;
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form // See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) { if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
this.setState({ inputValue: nextValue }); this.setState({ inputValue: nextValue });
} }
} }
/** /**
* Update slider textbox visibility/values if changes are made to slider * Update slider textbox visibility/values if changes are made to slider
* @param {Object} prevProps React Component properites * @param {Object} prevProps React Component properites
* @param {Object} prevState React Component state values * @param {Object} prevState React Component state values
*/ */
componentDidUpdate(prevProps, prevState) { componentDidUpdate(prevProps, prevState) {
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') { if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10); this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
} }
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) { if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
// they chose a different module // they chose a different module
this.setState({ inputValue: this.props.max }); this.setState({ inputValue: this.props.max });
} }
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) { if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
this.props.onChange(this.state.inputValue / this.props.max); this.props.onChange(this.state.inputValue / this.props.max);
} }
} }
/** /**
* Set initial state for the textbox. * Set initial state for the textbox.
* We may want to rethink this to * We may want to rethink this to
* try and make it a stateless component * try and make it a stateless component
* @returns {object} React state object with initial values set * @returns {object} React state object with initial values set
*/ */
_getInitialState() { _getInitialState() {
return { return {
divStyle: { display:'none' }, divStyle: { display:'none' },
inputStyle: { width:'4em' }, inputStyle: { width:'4em' },
labelStyle: { marginLeft: '.1em' }, labelStyle: { marginLeft: '.1em' },
maxLength:5, maxLength:5,
size:5, size:5,
min:0, min:0,
tabIndex:-1, tabIndex:-1,
type:'number', type:'number',
readOnly: true, readOnly: true,
inputValue: this.props.percent * this.props.max inputValue: this.props.percent * this.props.max
}; };
} }
/** /**
* *
* @param {string} val block or none * @param {string} val block or none
*/ */
_setDisplay(val) { _setDisplay(val) {
this.setState({ this.setState({
divStyle: { display:val } divStyle: { display:val }
}); });
} }
/** /**
* Update the input value * Update the input value
* when textbox gets focus * when textbox gets focus
*/ */
_handleFocus() { _handleFocus() {
this.setState({ this.setState({
inputValue:this._getValue() inputValue:this._getValue()
}); });
} }
/** /**
* Update inputValue when textbox loses focus * Update inputValue when textbox loses focus
*/ */
_handleBlur() { _handleBlur() {
this._setDisplay('none'); this._setDisplay('none');
if (this.state.inputValue !== '') { if (this.state.inputValue !== '') {
this.props.onChange(this.state.inputValue / this.props.max); this.props.onChange(this.state.inputValue / this.props.max);
} else { } else {
this.setState({ this.setState({
inputValue: this.props.percent * this.props.max inputValue: this.props.percent * this.props.max
}); });
} }
} }
/** /**
* Get the value in the text box * Get the value in the text box
* @returns {number} inputValue Value of the input box * @returns {number} inputValue Value of the input box
*/ */
_getValue() { _getValue() {
return this.state.inputValue; return this.state.inputValue;
} }
/** /**
* Update and set limits on input box * Update and set limits on input box
* values depending on what user * values depending on what user
* has selected * has selected
* *
* @param {SyntheticEvent} event ReactJs onChange event * @param {SyntheticEvent} event ReactJs onChange event
*/ */
_handleChange(event) { _handleChange(event) {
if (event.target.value < 0) { if (event.target.value < 0) {
this.setState({ inputValue: 0 }); this.setState({ inputValue: 0 });
} else if (event.target.value <= this.props.max) { } else if (event.target.value <= this.props.max) {
this.setState({ inputValue: event.target.value }); this.setState({ inputValue: event.target.value });
} else { } else {
this.setState({ inputValue: this.props.max }); this.setState({ inputValue: this.props.max });
} }
} }
/** /**
* Key up handler for input field. * Key up handler for input field.
* If user hits Enter key, blur/close the input field * If user hits Enter key, blur/close the input field
* @param {Event} event Keyboard event * @param {Event} event Keyboard event
*/ */
_keyup(event) { _keyup(event) {
switch (event.key) { switch (event.key) {
case 'Enter': case 'Enter':
this.sliderVal.blur(); this.sliderVal.blur();
return; return;
default: default:
return; return;
} }
} }
/** /**
* Get the value in the text box * Get the value in the text box
* @return {React.Component} Text Input component for Slider * @return {React.Component} Text Input component for Slider
*/ */
render() { render() {
let { axisUnit, onChange, percent, scale } = this.props; let { axisUnit, onChange, percent, scale } = this.props;
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>; return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
} }
} }

View File

@@ -2,30 +2,38 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { ListModifications, Modified } from './SvgIcons';
import AvailableModulesMenu from './AvailableModulesMenu'; import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu'; import ModificationsMenu from './ModificationsMenu';
import { diffDetails } from '../utils/SlotFunctions'; import { diffDetails } from '../utils/SlotFunctions';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
import { Module } from 'ed-forge';
import { REG_MILITARY_SLOT, REG_HARDPOINT_SLOT } from 'ed-forge/lib/data/slots';
import autoBind from 'auto-bind';
import { toPairs } from 'lodash';
const HARDPOINT_SLOT_LABELS = {
1: 'S',
2: 'M',
3: 'L',
4: 'H',
};
/** /**
* Abstract Slot * Abstract Slot
*/ */
export default class Slot extends TranslatedComponent { export default class Slot extends TranslatedComponent {
static propTypes = { static propTypes = {
availableModules: PropTypes.func.isRequired, currentMenu: PropTypes.any,
onSelect: PropTypes.func.isRequired, hideSearch: PropTypes.bool,
onOpen: PropTypes.func.isRequired, m: PropTypes.instanceOf(Module),
maxClass: PropTypes.number.isRequired,
selected: PropTypes.bool,
m: PropTypes.object,
enabled: PropTypes.bool.isRequired,
ship: PropTypes.object.isRequired,
eligible: PropTypes.object,
warning: PropTypes.func, warning: PropTypes.func,
drag: PropTypes.func, drag: PropTypes.func,
drop: PropTypes.func, drop: PropTypes.func,
dropClass: PropTypes.string dropClass: PropTypes.string,
propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
@@ -34,25 +42,122 @@ export default class Slot extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._modificationsSelected = false; this.state = { menuIndex: 0 };
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
this._keyDown = this._keyDown.bind(this);
this.slotDiv = null;
} }
// Must be implemented by subclasses: /**
// _getSlotDetails() * Opens a menu while setting state.
* @param {Object} newMenuIndex New menu index
* @param {Event} event Event object
*/
_openMenu(newMenuIndex, event) {
const slotName = this.props.m.getSlot();
if (
this.props.currentMenu === slotName &&
newMenuIndex === this.state.menuIndex
) {
this.context.closeMenu();
} {
this.setState({ menuIndex: newMenuIndex });
this.context.openMenu(slotName);
}
// If we don't stop event propagation, the underlying divs also might
// get clicked which would open up other menus
event.stopPropagation();
}
/** /**
* Get the CSS class name for the slot. Can/should be overriden * Generate the slot contents
* as necessary. * @return {React.Component} Slot contents
* @return {string} CSS Class name
*/ */
_getClassNames() { _getSlotDetails() {
return null; const { m, propsToShow } = this.props;
let { termtip, tooltip, language } = this.context;
const { translate, units, formats } = language;
if (m.isEmpty()) {
return <div className="empty">
{translate(
m.getSlot().match(REG_MILITARY_SLOT) ? 'emptyrestricted' : 'empty'
)}
</div>;
} else {
let classRating = m.getClassRating();
let { drag, drop } = this.props;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
const blueprint = m.getBlueprint();
const experimental = m.getExperimental();
const grade = m.getBlueprintGrade();
if (blueprint) {
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
if (experimental) {
modTT += `, ${translate(experimental)}`;
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(language, m)}
</div>
);
}
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
return (
<div
className={cn('details', { disabled: !m.isEnabled() })}
draggable="true"
onDragStart={drag}
onDragEnd={drop}
>
<div className={'cb'}>
<div className={'l'}>
{classRating} {translate(m.readMeta('type'))}
{blueprint && (
<span
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}
>
<Modified />
</span>
)}
</div>
{propsToShow.mass ?
<div className={'r'}>
{formats.round(mass)}
{units.T}
</div> : null}
</div>
<div className={'cb'}>
{toPairs(propsToShow).sort().map(([prop, show]) => {
const { unit, value } = m.getFormatted(prop, true);
// Don't show mass again; it's already shown on the top right
// corner of a slot
if (!show || isNaN(value) || prop == 'mass') {
return null;
} else {
return (<div className='l'>
{translate(prop)}: {formats.round(value)}{unit}
</div>);
}
})}
{(m.getApplicableBlueprints() || []).length > 0 ? (
<div className="r">
<button onClick={this._openMenu.bind(this, 1)}
onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, translate('modifications'))}
onMouseOut={tooltip.bind(null, null)}
>
<ListModifications />
</button>
</div>
) : null}
</div>
</div>
);
}
} }
/** /**
@@ -61,7 +166,19 @@ export default class Slot extends TranslatedComponent {
* @return {string} label * @return {string} label
*/ */
_getMaxClassLabel() { _getMaxClassLabel() {
return this.props.maxClass; const { m } = this.props;
let size = m.getSize();
switch (true) {
case m.getSlot() === 'armour':
return '';
case size === 0:
// This can also happen for armour but that case was handled above
return 'U';
case Boolean(m.getSlot().match(REG_HARDPOINT_SLOT)):
return HARDPOINT_SLOT_LABELS[size];
default:
return size;
}
} }
/** /**
@@ -71,25 +188,15 @@ export default class Slot extends TranslatedComponent {
_contextMenu(event) { _contextMenu(event) {
event.stopPropagation(); event.stopPropagation();
event.preventDefault(); event.preventDefault();
this.props.onSelect(null,null); const { m } = this.props;
} m.reset();
if (this.props.currentMenu === m.getSlot()) {
/** Key Down handler this.context.closeMenu();
* @param {SyntheticEvent} event Event } else {
* ToDo: see if this can be moved up this.forceUpdate();
* we do more or less the same thing
* in every section when Enter key is pressed
* on a focusable item
*
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
} }
} }
/** /**
* Render the slot * Render the slot
* @return {React.Component} The slot * @return {React.Component} The slot
@@ -97,73 +204,42 @@ export default class Slot extends TranslatedComponent {
render() { render() {
let language = this.context.language; let language = this.context.language;
let translate = language.translate; let translate = language.translate;
let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props; let {
let slotDetails, modificationsMarker, menu; currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow,
let missing = false; onPropToggle,
} = this.props;
if (!selected) { const { menuIndex } = this.state;
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
if (m) {
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
modificationsMarker = JSON.stringify(m);
if(typeof m.grp !== 'undefined' || m.grp !== null) {
if(m.grp == "mh" || m.grp == "mm") {
missing = true;
}
}
} else {
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
modificationsMarker = '';
}
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className={this._getClassNames()}
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className={this._getClassNames()}
modules={availableModules()}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
// TODO: implement touch dragging // TODO: implement touch dragging
const selected = currentMenu === m.getSlot();
return ( return (
<div className={cn('slot', dropClass, { selected })} onClick={onOpen} onKeyDown={this._keyDown} onContextMenu={this._contextMenu} onDragOver={dragOver} tabIndex="0" ref={slotDiv => this.slotDiv = slotDiv}> <div
{ className={cn('slot', dropClass, { selected })}
// If missing module/hardpoint, set the div container to warning status. onContextMenu={this._contextMenu}
} onDragOver={dragOver} tabIndex="0"
<div className={ missing === true ? 'details-container warning' : 'details-container'}> onClick={this._openMenu.bind(this, 0)}
<div className='sz'>{this._getMaxClassLabel(translate)}</div> >
{slotDetails} <div className={cn(
</div> 'details-container',
{menu} { warning: warning && warning(m) },
)}>
<div className="sz">{this._getMaxClassLabel(translate)}</div>
{this._getSlotDetails()}
</div>
{selected && menuIndex === 0 &&
<AvailableModulesMenu
m={m} hideSearch={hideSearch}
onSelect={(item) => {
m.setItem(item);
this.context.closeMenu();
}}
warning={warning}
// diffDetails={diffDetails.bind(ship, this.context.language)}
/>}
{selected && menuIndex === 1 &&
<ModificationsMenu m={m} propsToShow={propsToShow}
onPropToggle={onPropToggle} />}
</div> </div>
); );
} }
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
} }

View File

@@ -5,47 +5,33 @@ import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions'; import { canMount } from '../utils/SlotFunctions';
import { Equalizer } from '../components/SvgIcons'; import { Equalizer } from '../components/SvgIcons';
import cn from 'classnames'; import cn from 'classnames';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
const browser = require('detect-browser'); const browser = require('detect-browser');
/** /**
* Abstract Slot Section * Abstract Slot Section
*/ */
export default class SlotSection extends TranslatedComponent { export default class SlotSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship),
onChange: PropTypes.func.isRequired,
onCargoChange: PropTypes.func.isRequired,
onFuelChange: PropTypes.func.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
togglePwr: PropTypes.func, togglePwr: PropTypes.func,
sectionMenuRefs: PropTypes.object propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
* @param {string} sectionId Section DOM Id
* @param {string} sectionName Section name * @param {string} sectionName Section name
*/ */
constructor(props, context, sectionId, sectionName) { constructor(props, sectionName) {
super(props); super(props);
this.sectionId = sectionId; autoBind(this);
this.sectionName = sectionName;
this.ssHeadRef = null; this.sectionName = sectionName;
this.sectionRefArr = this.props.sectionMenuRefs[this.sectionId] = [];
this.sectionRefArr['selectedRef'] = null;
this._getSlots = this._getSlots.bind(this);
this._selectModule = this._selectModule.bind(this);
this._getSectionMenu = this._getSectionMenu.bind(this);
this._contextMenu = this._contextMenu.bind(this);
this._drop = this._drop.bind(this);
this._dragOverNone = this._dragOverNone.bind(this);
this._close = this._close.bind(this);
this._keyDown = this._keyDown.bind(this);
this._handleSectionFocus = this._handleSectionFocus.bind(this);
this.state = {}; this.state = {};
} }
@@ -55,82 +41,6 @@ export default class SlotSection extends TranslatedComponent {
// _contextMenu() // _contextMenu()
// componentDidUpdate(prevProps) // componentDidUpdate(prevProps)
/**
* TODO: May either need to send the function to be triggered when Enter key is pressed, or else
* may need a separate keyDown handler for each subclass (StandardSlotSection, HardpointSlotSection, etc.)
* ex: _keyDown(_keyDownfn, event)
*
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
event.stopPropagation();
if (event.currentTarget.nodeName === 'H1') {
this._openMenu(this.sectionName, event);
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
if (event.shiftKey) {
if ((event.currentTarget === this.sectionRefArr[this.firstRefId]) && this.sectionRefArr[this.lastRefId]) {
event.preventDefault();
this.sectionRefArr[this.lastRefId].focus();
}
} else {
if ((event.currentTarget === this.sectionRefArr[this.lastRefId]) && this.sectionRefArr[this.firstRefId]) {
event.preventDefault();
this.sectionRefArr[this.firstRefId].focus();
}
}
}
}
/**
* Set focus on appropriate Slot Section Menu element
* @param {Object} focusPrevProps prevProps for componentDidUpdate() from ...SlotSection.jsx
* @param {String} firstRef id of the first ref in ...SlotSection.jsx
* @param {String} lastRef id of the last ref in ...SlotSection.jsx
*
*/
_handleSectionFocus(focusPrevProps, firstRef, lastRef) {
if (this.selectedRefId !== null && this.sectionRefArr[this.selectedRefId]) {
// set focus on the previously selected option for the currently open section menu
this.sectionRefArr[this.selectedRefId].focus();
} else if (this.sectionRefArr[firstRef] && this.sectionRefArr[firstRef] != null) {
// set focus on the first option in the currently open section menu if none have been selected previously
this.sectionRefArr[firstRef].focus();
} else if (this.props.currentMenu == null && focusPrevProps.currentMenu == this.sectionName && this.sectionRefArr['ssHeadRef']) {
// set focus on the section menu header when section menu is closed
this.sectionRefArr['ssHeadRef'].focus();
}
}
/**
* Open a menu
* @param {string} menu Menu name
* @param {SyntheticEvent} event Event
*/
_openMenu(menu, event) {
event.preventDefault();
event.stopPropagation();
if (this.props.currentMenu === menu) {
menu = null;
}
this.context.openMenu(menu);
}
/**
* Mount/Use the specified module in the slot
* @param {Object} slot Slot
* @param {Object} m Selected module
*/
_selectModule(slot, m) {
this.props.ship.use(slot, m, false);
this.props.onChange();
this._close();
}
/** /**
* Slot Drag Handler * Slot Drag Handler
* @param {object} originSlot Origin slot model * @param {object} originSlot Origin slot model
@@ -207,7 +117,6 @@ export default class SlotSection extends TranslatedComponent {
// Copy power info // Copy power info
targetSlot.enabled = originSlot.enabled; targetSlot.enabled = originSlot.enabled;
targetSlot.priority = originSlot.priority; targetSlot.priority = originSlot.priority;
this.props.onChange();
} }
} else { } else {
// Store power info // Store power info
@@ -236,7 +145,6 @@ export default class SlotSection extends TranslatedComponent {
targetSlot.enabled = targetEnabled; targetSlot.enabled = targetEnabled;
targetSlot.priority = targetPriority; targetSlot.priority = targetPriority;
} }
this.props.onChange();
this.props.ship this.props.ship
.updatePowerGenerated() .updatePowerGenerated()
.updatePowerUsed() .updatePowerUsed()
@@ -282,6 +190,17 @@ export default class SlotSection extends TranslatedComponent {
return 'ineligible'; // Cannot be dropped / invalid drop slot return 'ineligible'; // Cannot be dropped / invalid drop slot
} }
_open(newMenu, event) {
event.preventDefault();
event.stopPropagation();
const { currentMenu } = this.props;
if (currentMenu === newMenu) {
this.context.closeMenu();
} else {
this.context.openMenu(newMenu);
}
}
/** /**
* Close current menu * Close current menu
*/ */
@@ -298,14 +217,13 @@ export default class SlotSection extends TranslatedComponent {
render() { render() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let sectionMenuOpened = this.props.currentMenu === this.sectionName; let sectionMenuOpened = this.props.currentMenu === this.sectionName;
let open = this._openMenu.bind(this, this.sectionName);
let ctx = wrapCtxMenu(this._contextMenu);
return ( return (
<div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}> <div className="group" onDragLeave={this._dragOverNone}>
<div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}> <div className={cn('section-menu', { selected: sectionMenuOpened })}
<h1 tabIndex="0" onKeyDown={this._keyDown} ref={ssHead => this.sectionRefArr['ssHeadRef'] = ssHead}>{translate(this.sectionName)} <Equalizer/></h1> onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}>
{sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null } <h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1>
{sectionMenuOpened && this._getSectionMenu()}
</div> </div>
{this._getSlots()} {this._getSlots()}
</div> </div>

View File

@@ -1,168 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
import cn from 'classnames';
import Persist from '../stores/Persist';
import TranslatedComponent from './TranslatedComponent';
import { diffDetails } from '../utils/SlotFunctions';
import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Standard Slot
*/
export default class StandardSlot extends TranslatedComponent {
static propTypes = {
slot: PropTypes.object,
modules: PropTypes.array.isRequired,
onSelect: PropTypes.func.isRequired,
onOpen: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired,
ship: PropTypes.object.isRequired,
selected: PropTypes.bool,
warning: PropTypes.func,
};
/**
* Construct the slot
* @param {object} props Object properties
*/
constructor(props) {
super(props);
this._modificationsSelected = false;
this._keyDown = this._keyDown.bind(this);
this.modButton = null;
this.slotDiv = null;
}
/**
* Handle Enter key
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/**
* Render the slot
* @return {React.Component} Slot component
*/
render() {
let { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language;
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
let m = slot.m;
let classRating = m.class + m.rating;
let menu;
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
if (m && m.name && m.name === 'Guardian Hybrid Power Plant') {
validMods = [];
}
if (m && m.name && m.name === 'Guardian Power Distributor') {
validMods = [];
}
let showModuleResistances = Persist.showModuleResistances();
let mass = m.getMass() || m.cargo || m.fuel || 0;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
if (!selected) {
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
// If this is a missing module, therefore has the 'info' field, set the warning value on the module to be true when loaded.
if (m.info) {
warning = () => true;
}
const modificationsMarker = JSON.stringify(m);
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className='standard'
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className='standard'
modules={modules}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
return (
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onKeyDown={this._keyDown} onContextMenu={stopCtxPropagation} tabIndex="0" ref={ slotDiv => this.slotDiv = slotDiv }>
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
<div>
<div className={'l'}>{classRating} {m.getInfo() ? translate(m.ukName) : translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
<div className={'r'}>{formats.round(mass)}{units.T}</div>
<div/>
<div className={'cb'}>
{ m.getMinMass() ? <div className='l'>{translate('minmass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
{ m.getOptMass() ? <div className='l'>{translate('optmass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
{ m.getMaxMass() ? <div className='l'>{translate('maxmass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
{ m.getOptMul() ? <div className='l'>{translate('optmul')}: {formats.rPct(m.getOptMul())}</div> : null }
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
{ m.getInfo() ? <div className='r'></div> : validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>
</div>
{menu}
</div>
);
}
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
}

View File

@@ -1,46 +1,33 @@
import React from 'react'; import React from 'react';
import cn from 'classnames'; import cn from 'classnames';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import StandardSlot from './StandardSlot'; import Slot from './Slot';
import Module from '../shipyard/Module'; import Module from '../shipyard/Module';
import * as ShipRoles from '../shipyard/ShipRoles'; import * as ShipRoles from '../shipyard/ShipRoles';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import autoBind from 'auto-bind';
import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions';
import { ShipProps } from 'ed-forge';
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
/** /**
* Standard Slot section * Standard Slot section
*/ */
export default class StandardSlotSection extends SlotSection { export default class StandardSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'standard', 'core internal'); super(props, 'core internal');
this._optimizeStandard = this._optimizeStandard.bind(this); autoBind(this);
this._selectBulkhead = this._selectBulkhead.bind(this);
this.selectedRefId = null;
this.firstRefId = 'maxjump';
this.lastRefId = 'racer';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Use the lightest/optimal available standard modules * Use the lightest/optimal available standard modules
*/ */
_optimizeStandard() { _optimizeStandard() {
this.selectedRefId = 'maxjump';
this.props.ship.useLightestStandard(); this.props.ship.useLightestStandard();
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -50,12 +37,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames * @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
*/ */
_multiPurpose(shielded, bulkheadIndex) { _multiPurpose(shielded, bulkheadIndex) {
this.selectedRefId = 'multipurpose';
if (bulkheadIndex === 2) this.selectedRefId = 'combat';
ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex); ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -64,11 +46,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} shielded True if shield generator should be included * @param {Boolean} shielded True if shield generator should be included
*/ */
_optimizeCargo(shielded) { _optimizeCargo(shielded) {
this.selectedRefId = 'trader';
ShipRoles.trader(this.props.ship, shielded); ShipRoles.trader(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -77,11 +55,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} shielded True if shield generator should be included * @param {Boolean} shielded True if shield generator should be included
*/ */
_optimizeMiner(shielded) { _optimizeMiner(shielded) {
this.selectedRefId = 'miner';
ShipRoles.miner(this.props.ship, shielded); ShipRoles.miner(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -90,12 +64,7 @@ export default class StandardSlotSection extends SlotSection {
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included * @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
*/ */
_optimizeExplorer(planetary) { _optimizeExplorer(planetary) {
this.selectedRefId = 'explorer';
if (planetary) this.selectedRefId = 'planetary';
ShipRoles.explorer(this.props.ship, planetary); ShipRoles.explorer(this.props.ship, planetary);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
@@ -103,22 +72,7 @@ export default class StandardSlotSection extends SlotSection {
* Racer role * Racer role
*/ */
_optimizeRacer() { _optimizeRacer() {
this.selectedRefId = 'racer';
ShipRoles.racer(this.props.ship); ShipRoles.racer(this.props.ship);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Use the specified bulkhead
* @param {Object} bulkhead Bulkhead module details
*/
_selectBulkhead(bulkhead) {
this.props.ship.useBulkhead(bulkhead.index);
this.context.tooltip();
this.props.onChange();
this._close(); this._close();
} }
@@ -129,113 +83,48 @@ export default class StandardSlotSection extends SlotSection {
this._optimizeStandard(); this._optimizeStandard();
} }
/**
* Creates a new slot for a given module.
* @param {Module} m Module to create the slot for
* @param {function} warning Warning callback
* @return {React.Component} Slot component
*/
_mkSlot(m, warning) {
const { currentMenu, propsToShow, onPropToggle } = this.props;
return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true}
currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle}
/>;
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu, cargo, fuel } = this.props; const { ship } = this.props;
let slots = new Array(8); const fsd = ship.getFSD();
let open = this._openMenu; return [
let select = this._selectModule; this._mkSlot(ship.getAlloys()),
let st = ship.standard; this._mkSlot(
let avail = ship.getAvailableModules().standard; ship.getPowerPlant(),
let bh = ship.bulkheads; (m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR),
),
slots[0] = <StandardSlot this._mkSlot(
key='bh' ship.getThrusters(),
slot={bh} (m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS),
modules={ship.getAvailableModules().bulkheads} ),
onOpen={open.bind(this, bh)} this._mkSlot(fsd),
onSelect={this._selectBulkhead} this._mkSlot(
selected={currentMenu == bh} ship.getPowerDistributor(),
onChange={this.props.onChange} (m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'),
ship={ship} ),
/>; this._mkSlot(ship.getLifeSupport()),
this._mkSlot(ship.getSensors()),
slots[1] = <StandardSlot this._mkSlot(
key='pp' ship.getCoreFuelTank(),
slot={st[0]} (m) => moduleGet(m, 'fuel') < fsd.get('maxfuel')
modules={avail[0]} ),
onOpen={open.bind(this, st[0])} ];
onSelect={select.bind(this, st[0])}
selected={currentMenu == st[0]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
/>;
slots[2] = <StandardSlot
key='th'
slot={st[1]}
modules={avail[1]}
onOpen={open.bind(this, st[1])}
onSelect={select.bind(this, st[1])}
selected={currentMenu == st[1]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
/>;
slots[3] = <StandardSlot
key='fsd'
slot={st[2]}
modules={avail[2]}
onOpen={open.bind(this, st[2])}
onSelect={select.bind(this, st[2])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[2]}
/>;
slots[4] = <StandardSlot
key='ls'
slot={st[3]}
modules={avail[3]}
onOpen={open.bind(this, st[3])}
onSelect={select.bind(this, st[3])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[3]}
/>;
slots[5] = <StandardSlot
key='pd'
slot={st[4]}
modules={avail[4]}
onOpen={open.bind(this, st[4])}
onSelect={select.bind(this, st[4])}
selected={currentMenu == st[4]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getEnginesCapacity() < ship.boostEnergy : m.engcap < ship.boostEnergy}
/>;
slots[6] = <StandardSlot
key='ss'
slot={st[5]}
modules={avail[5]}
onOpen={open.bind(this, st[5])}
onSelect={select.bind(this, st[5])}
selected={currentMenu == st[5]}
onChange={this.props.onChange}
ship={ship}
/>;
slots[7] = <StandardSlot
key='ft'
slot={st[6]}
modules={avail[6]}
onOpen={open.bind(this, st[6])}
onSelect={select.bind(this, st[6])}
selected={currentMenu == st[6]}
onChange={this.props.onChange}
ship={ship}
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
/>;
return slots;
} }
/** /**
@@ -243,23 +132,22 @@ export default class StandardSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
let planetaryDisabled = this.props.ship.internal.length < 4; const { translate } = this.context.language;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._optimizeStandard} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['maxjump'] = smRef}>{translate('Maximize Jump Range')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeStandard}>{translate('Maximize Jump Range')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('roles')}</div> <div className='select-group cap'>{translate('roles')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['multipurpose'] = smRef}>{translate('Multi-purpose')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)}>{translate('Multi-purpose')}</li>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['combat'] = smRef}>{translate('Combat')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)}>{translate('Combat')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['trader'] = smRef}>{translate('Trader')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)}>{translate('Trader')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['explorer'] = smRef}>{translate('Explorer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)}>{translate('Explorer')}</li>
<li className={cn('lc', { disabled: planetaryDisabled })} tabIndex={planetaryDisabled ? '' : '0'} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['planetary'] = smRef}>{translate('Planetary Explorer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, true)}>{translate('Planetary Explorer')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['miner'] = smRef}>{translate('Miner')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)}>{translate('Miner')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['racer'] = smRef}>{translate('Racer')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)}>{translate('Racer')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -247,8 +247,7 @@ export class OrbisIcon extends SvgIcon {
<path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/> <path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/>
<path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" /> <path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" />
<rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" /> <rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" />
</g> </g>);
);
} }
} }
@@ -742,9 +741,9 @@ export class Modified extends SvgIcon {
*/ */
svg() { svg() {
return <g> return <g>
<path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/> <path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/>
<path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/> <path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/>
</g>; </g>;
} }
} }

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Document Root Tooltip * Document Root Tooltip
*/ */
export default class Tooltip extends TranslatedComponent { export default class Tooltip extends TranslatedComponent {
static propTypes = { static propTypes = {
rect: PropTypes.object.isRequired, rect: PropTypes.object.isRequired,
options: PropTypes.object options: PropTypes.object
@@ -127,5 +126,4 @@ export default class Tooltip extends TranslatedComponent {
</div> </div>
</div>; </div>;
} }
} }

View File

@@ -6,7 +6,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract Translated Component * Abstract Translated Component
*/ */
export default class TranslatedComponent extends React.Component { export default class TranslatedComponent extends React.Component {
static contextTypes = { static contextTypes = {
language: PropTypes.object.isRequired, language: PropTypes.object.isRequired,
sizeRatio: PropTypes.number.isRequired, sizeRatio: PropTypes.number.isRequired,

View File

@@ -1,7 +1,8 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Utility Slot Section * Utility Slot Section
@@ -10,28 +11,16 @@ export default class UtilitySlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'utility', 'utility mounts'); super(props, 'utility mounts');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'po';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all utility slots and close the menu * Empty all utility slots and close the menu
*/ */
_empty() { _empty() {
this.selectedRefId = this.firstRefId;
this.props.ship.emptyUtility(); this.props.ship.emptyUtility();
this.props.onChange(); this.props.onChange();
this._close(); this._close();
@@ -45,9 +34,6 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Synthetic} event Event * @param {Synthetic} event Event
*/ */
_use(group, rating, name, event) { _use(group, rating, name, event) {
this.selectedRefId = group;
if (rating !== null) this.selectedRefId += '-' + rating;
this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt')); this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt'));
this.props.onChange(); this.props.onChange();
this._close(); this._close();
@@ -66,31 +52,24 @@ export default class UtilitySlotSection extends SlotSection {
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let hardpoints = ship.hardpoints;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getUtilities(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass === 0) { key={h.object.Slot}
slots.push(<HardpointSlot maxClass={h.getSize()}
key={i} onChange={this.props.onChange}
maxClass={h.maxClass} currentMenu={currentMenu}
availableModules={() => availableModules.getHps(h.maxClass)} drag={this._drag.bind(this, h)}
onOpen={this._openMenu.bind(this,h)} dragOver={this._dragOverSlot.bind(this, h)}
onSelect={this._selectModule.bind(this, h)} drop={this._drop}
onChange={this.props.onChange} dropClass={this._dropClass(h, originSlot, targetSlot)}
selected={currentMenu == h} m={h}
drag={this._drag.bind(this, h)} enabled={h.enabled ? true : false}
dragOver={this._dragOverSlot.bind(this, h)} propsToShow={propsToShow}
drop={this._drop} onPropToggle={onPropToggle}
dropClass={this._dropClass(h, originSlot, targetSlot)} />);
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -101,33 +80,34 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _use = this._use; let _use = this._use;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('sb')}</div> <div className='select-group cap'>{translate('sb')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-A'] = smRef}>A</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)}>A</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-B'] = smRef}>B</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)}>B</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-C'] = smRef}>C</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)}>C</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-D'] = smRef}>D</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)}>D</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-E'] = smRef}>E</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)}>E</li>
</ul> </ul>
<div className='select-group cap'>{translate('hs')}</div> <div className='select-group cap'>{translate('hs')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hs'] = smRef}>{translate('Heat Sink Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')}>{translate('Heat Sink Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('ch')}</div> <div className='select-group cap'>{translate('ch')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ch'] = smRef}>{translate('Chaff Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')}>{translate('Chaff Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('po')}</div> <div className='select-group cap'>{translate('po')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['po'] = smRef}>{translate('Point Defence')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')}>{translate('Point Defence')}</li>
</ul> </ul>
</div>; </div>;
} }

View File

@@ -1,80 +1,80 @@
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import React, { PropTypes } from 'react'; import React, { PropTypes } from 'react';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import { BarChart, Bar, XAxis, YAxis, LabelList } from 'recharts'; import { BarChart, Bar, XAxis, YAxis, LabelList } from 'recharts';
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D']; const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
const LABEL_COLOUR = '#000000'; const LABEL_COLOUR = '#000000';
const AXIS_COLOUR = '#C06400'; const AXIS_COLOUR = '#C06400';
const ASPECT = 1; const ASPECT = 1;
const merge = function(one, two) { const merge = function(one, two) {
return Object.assign({}, one, two); return Object.assign({}, one, two);
}; };
/** /**
* A vertical bar chart * A vertical bar chart
*/ */
export default class VerticalBarChart extends TranslatedComponent { export default class VerticalBarChart extends TranslatedComponent {
static propTypes = { static propTypes = {
data : PropTypes.array.isRequired, data : PropTypes.array.isRequired,
yMax : PropTypes.number yMax : PropTypes.number
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this._termtip = this._termtip.bind(this); this._termtip = this._termtip.bind(this);
} }
/** /**
* Render the bar chart * Render the bar chart
* @returns {Object} the markup * @returns {Object} the markup
*/ */
render() { render() {
const { tooltip, termtip } = this.context; const { tooltip, termtip } = this.context;
// Calculate maximum for Y // Calculate maximum for Y
let dataMax = Math.max(...this.props.data.map(d => d.value)); let dataMax = Math.max(...this.props.data.map(d => d.value));
if (dataMax == -Infinity) dataMax = 0; if (dataMax == -Infinity) dataMax = 0;
let yMax = this.props.yMax ? Math.round(this.props.yMax) : 0; let yMax = this.props.yMax ? Math.round(this.props.yMax) : 0;
const localMax = Math.max(dataMax, yMax); const localMax = Math.max(dataMax, yMax);
return ( return (
<ContainerDimensions> <ContainerDimensions>
{ ({ width }) => ( { ({ width }) => (
<div width='100%'> <div width='100%'>
<BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}> <BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}>
<XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' /> <XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' />
<YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/> <YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/>
<Bar dataKey='value' fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}> <Bar dataKey='value' fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}>
<LabelList dataKey='value' position='insideTop'/> <LabelList dataKey='value' position='insideTop'/>
</Bar> </Bar>
</BarChart> </BarChart>
</div> </div>
)} )}
</ContainerDimensions> </ContainerDimensions>
); );
} }
/** /**
* Generate a term tip * Generate a term tip
* @param {Object} d the data * @param {Object} d the data
* @param {number} i the index * @param {number} i the index
* @param {Object} e the event * @param {Object} e the event
* @returns {Object} termtip markup * @returns {Object} termtip markup
*/ */
_termtip(d, i, e) { _termtip(d, i, e) {
if (this.props.data[i].tooltip) { if (this.props.data[i].tooltip) {
return this.context.termtip(this.props.data[i].tooltip, e); return this.context.termtip(this.props.data[i].tooltip, e);
} else { } else {
return null; return null;
} }
} }
} }

View File

@@ -3,193 +3,99 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import * as Calc from '../shipyard/Calculations';
import { moduleReduce } from 'ed-forge/lib/helper';
import { chain, keys, mapValues, values } from 'lodash';
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777']; const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
const PORTION_MAPPINGS = {
'absolute': 'absolutedamageportion',
'explosive': 'explosivedamageportion',
'kinetic': 'kineticdamageportion',
'thermal': 'thermicdamageportion',
};
const MULTS = keys(PORTION_MAPPINGS);
// TODO: help with this in ed-forge
/**
* .
* @param {Object} opponentDefence .
* @returns {Object} .
*/
function defenceToMults(opponentDefence) {
return chain(opponentDefence)
.pick(MULTS)
.mapKeys((v, k) => PORTION_MAPPINGS[k])
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
.value();
}
/** /**
* Weapon damage chart * Weapon damage chart
*/ */
export default class WeaponDamageChart extends TranslatedComponent { export default class WeaponDamageChart extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponentDefence: PropTypes.object.isRequired,
hull: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
}
/**
* Set the initial weapons state
*/
componentWillMount() {
const weaponNames = this._weaponNames(this.props.ship, this.context);
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
const opponentArmour = Calc.armourMetrics(this.props.opponent);
const maxRange = this._calcMaxRange(this.props.ship);
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
}
/**
* Set the updated weapons state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
const maxRange = this._calcMaxRange(nextProps.ship);
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
this.setState({ weaponNames,
opponentShields,
opponentArmour,
maxRange,
maxDps,
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
});
}
return true;
}
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000; // Minimum
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/**
* Calculate the maximum sustained single-weapon DPS for this ship
* @param {Object} ship The ship
* @param {Object} opponent The opponent ship
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @return {number} The maximum sustained single-weapon DPS
*/
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
// Additional information to allow effectiveness calculations
let maxSDps = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
if (thisSDps > maxSDps) {
maxSDps = thisSDps;
}
}
}
return maxSDps;
}
/**
* Obtain the weapon names for this ship
* @param {Object} ship The ship
* @param {Object} context The context
* @return {array} The weapon names
*/
_weaponNames(ship, context) {
const translate = context.language.translate;
let names = [];
let num = 1;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
let engineering;
if (m.blueprint && m.blueprint.name) {
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id) {
engineering += ', ' + translate(m.blueprint.special.name);
}
}
if (engineering) {
name = name + ' (' + engineering + ')';
}
names.push(name);
}
}
return names;
}
/**
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
* @param {Object} ship The ship
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
* @param {Object} opponent The target
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
* @param {Object} engagementRange The engagement range
* @return {array} The array of weapon DPS
*/
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
let results = {};
let weaponNum = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
}
}
return results;
}
/** /**
* Render damage dealt * Render damage dealt
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { maxRange } = this.state; const { code, ship, opponentDefence, engagementRange } = this.props;
const { ship, opponent, engagementRange } = this.props;
const sortOrder = this._sortOrder; const hardpoints = ship.getHardpoints();
const onCollapseExpand = this._onCollapseExpand; const hardpointsMap = chain(hardpoints)
.map((m) => [m.getSlot(), m])
const code = `${ship.toString()}:${opponent.toString()}`; .fromPairs()
.value();
const mults = defenceToMults(opponentDefence);
const cb = (range) => {
return mapValues(
hardpointsMap,
(m) => {
const sdps = m.get('sustaineddamagepersecond', true);
const resistanceMul = chain(mults)
.toPairs()
.map((pair) => {
const [k, mul] = pair;
return m.get(k, true) * mul;
})
.sum()
.value();
const falloff = m.get('damagefalloffrange', true);
const rangeMul = Math.min(1, Math.max(0,
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
));
return sdps * resistanceMul * rangeMul;
}
);
};
return ( return (
<div> <div>
<LineChart <LineChart
xMax={maxRange} xMin={0}
yMax={this.state.maxDps} xMax={moduleReduce(
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
)}
yMin={0}
// Factor in highest damage multiplier to get a safe upper bound
yMax={Math.max(1, ...values(mults)) * moduleReduce(
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
)}
xLabel={translate('range')} xLabel={translate('range')}
xUnit={translate('m')} xUnit={translate('m')}
yLabel={translate('sdps')} yLabel={translate('sustaineddamagepersecond')}
series={this.state.weaponNames} series={hardpoints.map((m) => m.getSlot())}
xMark={this.props.engagementRange} xMark={engagementRange}
colors={DAMAGE_DEALT_COLORS} colors={DAMAGE_DEALT_COLORS}
func={this.state.calcSDpsFunc} func={cb}
points={200} points={200}
code={code} code={code}
/> />

View File

@@ -8,7 +8,6 @@ import * as RU from './ru';
import * as PL from './pl'; import * as PL from './pl';
import * as PT from './pt'; import * as PT from './pt';
import * as CN from './cn'; import * as CN from './cn';
import * as KO from './ko';
import * as d3 from 'd3'; import * as d3 from 'd3';
let fallbackTerms = EN.terms; let fallbackTerms = EN.terms;
@@ -30,7 +29,6 @@ export function getLanguage(langCode) {
case 'pl': lang = PL; break; case 'pl': lang = PL; break;
case 'pt': lang = PT; break; case 'pt': lang = PT; break;
case 'cn': lang = CN; break; case 'cn': lang = CN; break;
case 'ko': lang = KO; break;
default: default:
lang = EN; lang = EN;
} }
@@ -99,6 +97,5 @@ export const Languages = {
ru: 'ру́сский', ru: 'ру́сский',
pl: 'polski', pl: 'polski',
pt: 'português', pt: 'português',
cn: '中文', cn: '中文'
ko: '한국어'
}; };

View File

@@ -398,7 +398,6 @@
"No modded components.": "没有改装的部件", "No modded components.": "没有改装的部件",
"Sending...": "发送中...", "Sending...": "发送中...",
"Send to EDEngineer": "发送至EDEngineer", "Send to EDEngineer": "发送至EDEngineer",
"Send to EDOMH": "发送至EDOMH",
"PHASE_UPLOAD_ORBIS": "上传到orbis.zone测试阶段", "PHASE_UPLOAD_ORBIS": "上传到orbis.zone测试阶段",
"orbis username": "orbis.zone的Email或用户名", "orbis username": "orbis.zone的Email或用户名",
"orbis password": "orbis.zone的密码", "orbis password": "orbis.zone的密码",

View File

@@ -1,17 +1,16 @@
export const formats = { export const formats = {
decimal: ',', decimal: ',',
thousands: '.', thousands: '.',
grouping: [3], grouping: [3],
currency: ['', ' €'], currency: ['', ' €'],
dateTime: '%A, der %e. %B %Y, %X', dateTime: '%A, der %e. %B %Y, %X',
date: '%d.%m.%Y', date: '%d.%m.%Y',
time: '%H:%M:%S', time: '%H:%M:%S',
periods: ['AM', 'PM'], // unused periods: ['AM', 'PM'], // unused
days: ['Sonntag', 'Montag', 'Dienstag', 'Mittwoch', 'Donnerstag', 'Freitag', 'Samstag'], days: ['Sonntag', 'Montag', 'Dienstag', 'Mittwoch', 'Donnerstag', 'Freitag', 'Samstag'],
shortDays: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'], shortDays: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'],
months: ['Januar', 'Februar', 'März', 'April', 'Mai', 'Juni', 'Juli', 'August', 'September', 'Oktober', 'November', 'Dezember'], months: ['Januar', 'Februar', 'März', 'April', 'Mai', 'Juni', 'Juli', 'August', 'September', 'Oktober', 'November', 'Dezember'],
shortMonths: ['Jan', 'Feb', 'Mrz', 'Apr', 'Mai', 'Jun', 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Dez'] shortMonths: ['Jan', 'Feb', 'Mrz', 'Apr', 'Mai', 'Jun', 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Dez']
}; };
export { default as terms } from './de.json'; export { default as terms } from './de.json';

File diff suppressed because one or more lines are too long

View File

@@ -26,9 +26,6 @@
"PHRASE_NO_SPECIAL": "No experimental effect", "PHRASE_NO_SPECIAL": "No experimental effect",
"PHRASE_SHOPPING_LIST": "Stations that sell this build", "PHRASE_SHOPPING_LIST": "Stations that sell this build",
"PHRASE_SHOPPING_MATS": "Materials needed for this build", "PHRASE_SHOPPING_MATS": "Materials needed for this build",
"PHRASE_DIFFERENT_ROLLS": "Material requirements will differ, based on the number of rolls per grade, per module.",
"PHRASE_FOR_FINER_CONTROL": "For finer control over rolls per grade/module, a more accurate list of required mats and help in finding those mats, please consider using the export options below to ED Odyssey Materials Helper, or ED Engineer, or use the Crafting Lists feature on inara.cz.",
"PHRASE_ALL_MODULES_ALL_ROLLS": "The list below, assumes standard to G5 Engineered (approx 80% - 90%) with the rolls above, for ALL engineered modules in the build. You can adjust the number of rolls above for each grade, however it will still apply to all engineered modules in the build.",
"PHRASE_REFIT_SHOPPING_LIST": "Stations that sell required modules", "PHRASE_REFIT_SHOPPING_LIST": "Stations that sell required modules",
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Total amount of damage that can be taken from each damage type, if using all shield cells", "PHRASE_TOTAL_EFFECTIVE_SHIELD": "Total amount of damage that can be taken from each damage type, if using all shield cells",
"PHRASE_TIME_TO_LOSE_SHIELDS": "Shields will hold for", "PHRASE_TIME_TO_LOSE_SHIELDS": "Shields will hold for",
@@ -66,17 +63,15 @@
"TT_SUMMARY_SPEED": "With full fuel tank and 4 pips to ENG", "TT_SUMMARY_SPEED": "With full fuel tank and 4 pips to ENG",
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "Thrusters powered off or over maximum mass with full fuel and cargo loads", "TT_SUMMARY_SPEED_NONFUNCTIONAL": "Thrusters powered off or over maximum mass with full fuel and cargo loads",
"TT_SUMMARY_BOOST": "With full fuel tank and 4 pips to ENG", "TT_SUMMARY_BOOST": "With full fuel tank and 4 pips to ENG",
"TT_SUMMARY_SHIP_BOOST_INTERVAL": "Time each boost lasts on this ship", "TT_SUMMARY_BOOST_INTERVAL": "Time between each boost with 4 pips to ENG",
"TT_SUMMARY_BOOST_INTERVAL": "Time between boosts with 4 pips to ENG",
"TT_SUMMARY_BOOST_INTERVALS": "If DISTRO is less than or equal to SHIP, the ship can boost continuously",
"TT_SUMMARY_BOOST_NONFUNCTIONAL": "Power distributor not able to supply enough power to boost", "TT_SUMMARY_BOOST_NONFUNCTIONAL": "Power distributor not able to supply enough power to boost",
"TT_SUMMARY_SHIELDS": "Raw shield strength, including boosters", "TT_SUMMARY_SHIELDS": "Raw shield strength, including boosters",
"TT_SUMMARY_SHIELDS_SCB": "Raw shield strength, including boosters and SCBs", "TT_SUMMARY_SHIELDS_SCB": "Raw shield strength, including boosters and SCBs",
"TT_SUMMARY_SHIELDS_NONFUNCTIONAL": "No shield generator or shield generator powered off", "TT_SUMMARY_SHIELDS_NONFUNCTIONAL": "No shield generator or shield generator powered off",
"TT_SUMMARY_INTEGRITY": "Ship integrity, including bulkheads and hull reinforcement packages", "TT_SUMMARY_INTEGRITY": "Ship integrity, including bulkheads and hull reinforcement packages",
"TT_SUMMARY_HULL_MASS": "Mass of the hull prior to any modules being installed", "TT_SUMMARY_HULL_MASS": "Mass of the hull prior to any modules being installed",
"TT_SUMMARY_UNLADEN_MASS": "Mass of the hull and modules prior to any cargo or passengers", "TT_SUMMARY_UNLADEN_MASS": "Mass of the hull and modules prior to any fuel or cargo",
"TT_SUMMARY_LADEN_MASS": "Mass of the hull and modules with full fuel, cargo, passengers, etc.", "TT_SUMMARY_LADEN_MASS": "Mass of the hull and modules with full fuel and cargo",
"TT_SUMMARY_DPS": "Damage per second with all weapons firing", "TT_SUMMARY_DPS": "Damage per second with all weapons firing",
"TT_SUMMARY_EPS": "WEP capacitor consumed per second with all weapons firing", "TT_SUMMARY_EPS": "WEP capacitor consumed per second with all weapons firing",
"TT_SUMMARY_TTD": "Time to drain WEP capacitor with all weapons firing and 4 pips to WEP", "TT_SUMMARY_TTD": "Time to drain WEP capacitor with all weapons firing and 4 pips to WEP",
@@ -86,10 +81,8 @@
"TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Farthest possible range with no cargo, a full fuel tank, and jumping as far as possible each time", "TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Farthest possible range with no cargo, a full fuel tank, and jumping as far as possible each time",
"TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time", "TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time",
"HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes", "HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes",
"PHRASE_ENSURE_EDOMH": "Ensure ED Odyssey Material Helper is installed and registered to handle edomh:// urls, else this button will do nothing!", "PHRASE_FAIL_EDENGINEER": "Failed to send to EDEngineer (Launch EDEngineer and make sure the API is started then refresh the page.)",
"PHRASE_FIREFOX_EDENGINEER": "Sending to EDEngineer is not compatible with Firefox's security settings. Please try again with Chrome.", "PHRASE_FIREFOX_EDENGINEER": "Sending to EDEngineer is not compatible with Firefox's security settings. Please try again with Chrome.",
"PHRASE_FAILED_TO_FIND_EDENGINEER": "Failed to find ED Engineer API. Please ensure it is running and try again.",
"MISSING_MODULES": "Missing Modules",
"am": "Auto Field-Maintenance Unit", "am": "Auto Field-Maintenance Unit",
"bh": "Bulkheads", "bh": "Bulkheads",
"bl": "Beam Laser", "bl": "Beam Laser",
@@ -100,7 +93,6 @@
"ch": "Chaff Launcher", "ch": "Chaff Launcher",
"cr": "Cargo Rack", "cr": "Cargo Rack",
"cs": "Manifest Scanner", "cs": "Manifest Scanner",
"csl": "Caustic Sink Launcher",
"dc": "Docking Computer", "dc": "Docking Computer",
"ec": "Electronic Countermeasure", "ec": "Electronic Countermeasure",
"fc": "Fragment Cannon", "fc": "Fragment Cannon",
@@ -116,18 +108,10 @@
"kw": "Kill Warrant Scanner", "kw": "Kill Warrant Scanner",
"ls": "Life Support", "ls": "Life Support",
"mc": "Multi-cannon", "mc": "Multi-cannon",
"mh": "Missing Weapon/Utility",
"mm": "Missing Module",
"advmc": "Multi-cannon (Advanced)",
"axmc": "AX Multi-cannon", "axmc": "AX Multi-cannon",
"axmce": "AX Multi-cannon (Enhanced)",
"ml": "Mining Laser", "ml": "Mining Laser",
"mlc": "Multi Limpet Controller",
"mr": "Missile Rack", "mr": "Missile Rack",
"amr": "Missile Rack (Advanced)",
"axmr": "AX Missile Rack", "axmr": "AX Missile Rack",
"axmre": "AX Missile Rack (Enhanced)",
"ews": "Experimental Weapon Stabilizer",
"mrp": "Module Reinforcement Package", "mrp": "Module Reinforcement Package",
"nl": "Mine Launcher", "nl": "Mine Launcher",
"pa": "Plasma Accelerator", "pa": "Plasma Accelerator",
@@ -172,10 +156,8 @@
"sua": "Supercruise Assist", "sua": "Supercruise Assist",
"t": "thrusters", "t": "thrusters",
"tp": "Torpedo Pylon", "tp": "Torpedo Pylon",
"ntp": "Nanite Torpedo Pylon",
"ul": "Burst Laser", "ul": "Burst Laser",
"Send To EDEngineer": "Send To EDEngineer", "Send To EDEngineer": "Send To EDEngineer",
"Send To EDOMH": "Send To EDOMH",
"ws": "Frame Shift Wake Scanner", "ws": "Frame Shift Wake Scanner",
"rpl": "Repair Limpet Controller", "rpl": "Repair Limpet Controller",
"rcpl": "Recon Limpet Controller", "rcpl": "Recon Limpet Controller",
@@ -223,10 +205,9 @@
"internal protection": "Internal protection", "internal protection": "Internal protection",
"external protection": "External protection", "external protection": "External protection",
"engagement range": "Engagement range", "engagement range": "Engagement range",
"boost interval": "Boost interval", "boost interval": "Boost intervall",
"total": "Total", "total": "Total",
"ammo": "Ammunition maximum", "ammo": "Ammunition maximum",
"info": "Info",
"boot": "Boot time", "boot": "Boot time",
"hacktime": "Hack time", "hacktime": "Hack time",
"brokenregen": "Broken regeneration rate", "brokenregen": "Broken regeneration rate",
@@ -276,10 +257,8 @@
"thermres": "Thermal resistance", "thermres": "Thermal resistance",
"wepcap": "Weapons capacity", "wepcap": "Weapons capacity",
"weprate": "Weapons recharge rate", "weprate": "Weapons recharge rate",
"minmass": "Minimum mass",
"minmass_sg": "Minimum hull mass", "minmass_sg": "Minimum hull mass",
"optmass_sg": "Optimal hull mass", "optmass_sg": "Optimal hull mass",
"maxmass": "Maximum mass",
"maxmass_sg": "Maximum hull mass", "maxmass_sg": "Maximum hull mass",
"minmul_sg": "Minimum strength", "minmul_sg": "Minimum strength",
"optmul_sg": "Optimal strength", "optmul_sg": "Optimal strength",

View File

@@ -1,16 +0,0 @@
export const formats = {
decimal: '.',
thousands: ',',
grouping: [3],
currency: ['₩', ''],
dateTime: '%a %b %e %X %Y',
date: '%Y/%m/%d',
time: '%H:%M:%S',
periods: ['오전', '오후'],
days: ['일요일', '월요일', '화요일', '수요일', '목요일', '금요일', '토요일'],
shortDays: ['일', '월', '화', '수', '목', '금', '토'],
months: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월'],
shortMonths: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월']
};
export { default as terms } from './ko.json';

File diff suppressed because one or more lines are too long

View File

@@ -2,15 +2,15 @@ export const formats = {
decimal: ',', decimal: ',',
thousands: '.', thousands: '.',
grouping: [3], grouping: [3],
currency: ['$', ''], currency: ['', ''],
dateTime: '%A, %e de %B de %Y, %X', dateTime: '%A, %e de %B de %Y, %X',
date: '%d/%m/%Y', date: '%d/%m/%Y',
time: '%H:%M:%S', time: '%H:%M:%S',
periods: ['AM', 'PM'], periods: ['AM', 'PM'],
days: ['domingo', 'segunda', 'terça', 'quarta', 'quinta', 'sexta', 'sábado'], days: ['domingo', 'lunes', 'martes', 'miércoles', 'jueves', 'viernes', 'sábado'],
shortDays: ['dom', 'seg', 'ter', 'qua', 'qui', 'sex', 'sab'], shortDays: ['dom', 'lun', 'mar', 'mié', 'jue', 'vie', 'sáb'],
months: ['janeiro', 'fevereiro', 'março', 'abril', 'maio', 'junho', 'julho', 'agosto', 'setembro', 'outubro', 'novembro', 'dezembro'], months: ['enero', 'febrero', 'marzo', 'abril', 'mayo', 'junio', 'julio', 'agosto', 'septiembre', 'octubre', 'noviembre', 'diciembre'],
shortMonths: ['jan', 'fev', 'mar', 'abr', 'mai', 'jun', 'jul', 'ago', 'set', 'out', 'nov', 'dez'] shortMonths: ['ene', 'feb', 'mar', 'abr', 'may', 'jun', 'jul', 'ago', 'sep', 'oct', 'nov', 'dic']
}; };
export { default as terms } from './pt.json'; export { default as terms } from './pt.json';

File diff suppressed because one or more lines are too long

File diff suppressed because it is too large Load Diff

View File

@@ -1,6 +1,12 @@
import '@babel/polyfill';
import React from 'react'; import React from 'react';
import { render } from 'react-dom'; import { render } from 'react-dom';
import '../less/app.less'; import '../less/app.less';
import Coriolis from './Coriolis'; import Coriolis from './Coriolis';
// import TapEventPlugin from 'react/lib/TapEventPlugin';
// import EventPluginHub from 'react/lib/EventPluginHub';
// onTouchTap not ready for primetime yet, too many issues with preventing default
// EventPluginHub.injection.injectEventPluginsByName({ TapEventPlugin });
render(<Coriolis />, document.getElementById('coriolis')); render(<Coriolis />, document.getElementById('coriolis'));

View File

@@ -33,27 +33,24 @@ export default class AboutPage extends Page {
</h1> </h1>
<p> <p>
This is now the only active version of the Coriolis project. The original author has handed over the maintenance of the project to the {' '} This is a clone of the Coriolis project, whose original author is
currently unable to maintain it. This clone is maintained by the{' '}
<a href="http://edcd.github.io/">EDCD community</a>. <a href="http://edcd.github.io/">EDCD community</a>.
</p> </p>
<h3>Expectations</h3>
<p> <p>
Although every attempt is made to update the data as soon as possible, following the release of new modules and ships, there may be a delay, of up-to a few days, before the data is available. Wherever possible, the current maintainers aim to keep this delay to a minimum. Please be aware that the project maintainers are volunteers and have real lives to attend to, so please be patient. If you would like to help with the maintenance of the project, please see the link to the EDCD Discord Server below, where you can get involved. To recover your builds, go to{' '}
<a href="https://coriolis.io/" target="_blank">
https://coriolis.io/
</a>
, backup your builds (Settings / Backup), copy the text, return here
and import (Settings / Import).
</p> </p>
<p> <p>
There are, some missing modules from the time where the project was essentially not being maintained. These modules are gradually being added to the Coriolis database as and when the maintainers have the time to do so. The Coriolis project was inspired by{' '}
</p> <a href="http://www.edshipyard.com/" target="_blank">
<p> E:D Shipyard
Please check the {' '} <a href="https://github.com/EDCD/coriolis/issues/" target="_blank" >Github Issues List</a> for any specific modules you cannot find and see if there is an open request for them. If not, please feel free to open a new issue, however, please note that there is an existing issue open for the addition of pre-engineered modules, so please do not open a new issue for these. </a>{' '}
</p> and, of course,{' '}
<h3>Donations</h3>
<p>
If you would like to donate to the project, in order to help with the costs of hosting and maintainence, please see the link to the {' '}
<a href="https://github.com/Brighter-Applications/coriolis" target="_blank">Current Maintainers version of the Git Repository</a> and use the 'Sponsor' button at the top of the page.
</p>
<h3>History</h3>
<p>
The Coriolis project was inspired by 'E:D Shipyard' (Now Defunct) and, of course,{' '}
<a href="http://www.elitedangerous.com" target="_blank"> <a href="http://www.elitedangerous.com" target="_blank">
Elite Dangerous Elite Dangerous
</a> </a>
@@ -97,6 +94,39 @@ export default class AboutPage extends Page {
</a> </a>
. .
</p> </p>
<h3>Supporting Coriolis</h3>
<p>
Coriolis is an open source project, and I work on it in my free time.
I have set up a patreon at{' '}
<a href="https://www.patreon.com/coriolis_elite">
patreon.com/coriolis_elite
</a>
, which will be used to keep Coriolis up to date and the servers
running.
</p>
<form
action="https://www.paypal.com/cgi-bin/webscr"
method="post"
target="_top"
>
<input type="hidden" name="cmd" value="_s-xclick" />
<input type="hidden" name="hosted_button_id" value="SJBKT2SWEEU68" />
<input
type="image"
src="https://www.paypalobjects.com/en_AU/i/btn/btn_donate_SM.gif"
border="0"
name="submit"
alt="PayPal The safer, easier way to pay online!"
/>
<img
alt=""
border="0"
src="https://www.paypalobjects.com/en_AU/i/scr/pixel.gif"
width="1"
height="1"
/>
</form>
</div> </div>
); );
} }

View File

@@ -5,7 +5,6 @@ import PropTypes from 'prop-types';
* Unexpected Error page / block * Unexpected Error page / block
*/ */
export default class ErrorDetails extends React.Component { export default class ErrorDetails extends React.Component {
static contextTypes = { static contextTypes = {
route: PropTypes.object.isRequired, route: PropTypes.object.isRequired,
language: PropTypes.object.isRequired language: PropTypes.object.isRequired
@@ -33,7 +32,7 @@ export default class ErrorDetails extends React.Component {
<div style={{ marginTop: '2em' }}> <div style={{ marginTop: '2em' }}>
<div><span className='warning'>Browser:</span> {window.navigator.userAgent}</div> <div><span className='warning'>Browser:</span> {window.navigator.userAgent}</div>
<div><span className='warning'>Path:</span> {this.context.route.canonicalPath}</div> <div><span className='warning'>Path:</span> {this.context.route.canonicalPath}</div>
<div><span className='warning'>Error:</span> {ed["error"] || 'Unknown'}</div> <div><span className='warning'>Error:</span> {error.type || 'Unknown'}</div>
<div className='warning'>Details:</div> <div className='warning'>Details:</div>
<div><pre>{typeof ed == 'object' ? Object.keys(ed).map((e) => `${e}: ${ed[e]}\n`) : ed}</pre></div> <div><pre>{typeof ed == 'object' ? Object.keys(ed).map((e) => `${e}: ${ed[e]}\n`) : ed}</pre></div>
</div> </div>
@@ -42,67 +41,15 @@ export default class ErrorDetails extends React.Component {
const importerror = ed && ed.scriptUrl && ed.scriptUrl.indexOf('/import') != -1; const importerror = ed && ed.scriptUrl && ed.scriptUrl.indexOf('/import') != -1;
if (ed['error'].match(/URL Length/i)) { return <div className='error'>
return <div className='error'> <h1>Jameson, we have a problem..</h1>
<h1>Jameson, we have a problem..</h1> <h1><small>{error.message}</small></h1>
<h1><small>{error.message}</small></h1> <br/>
It looks as though you've encountered a URL Length issue for your browser. {importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
<br/>
<br /><br /> <div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div>
<br/>
This is a known issue with Internet Explorer and Edge, as well as Google Chrome, all of which only support 2083 characters and your URL is: {content}
</div>;
<br /><br />
{ed["error"]} characters.
<br /><br />
Please try using another browser first, before reporting an issue, such as Firefox which supports 65,536 characters or Safari, which supports 80,000 characters.
<br /><br />
Don't copy the URL from Explorer, Edge or Chrome, as they will have truncated it and the data string will be incorrect. You'll need to change your default browser settings, so that when you click the link, it opens in the browser you want to use.
<br /><br />
If you're already using Firefox, which supports up to 65,536 characters or Safari, which supports up to 80,000 characters, please see the data output below.
<br/><br />
<h3>Data Output</h3>
{content}
</div>;
}
else {
return <div className='error'>
<h1>Jameson, we have a problem..</h1>
<h1><small>{error.message}</small></h1>
Import Error handling has been improved, but still isn't perfect.
<br /><br />
If you're seeing this page, we may have failed to handle the errors in your import correctly. Please check the common import failures list and then the data output below, specifically the 'scriptUrl:' section if it's there and then if you feel confident enough, please check the github issues page linked below and see if there is a similar issue already logged. If not, please create a new issue with the data below. If you're not confident, please ask for help on the Coriolis Channel of the EDCD Discord server.
<br /><br />
<h3>Common Import Failures</h3>
<ul>
<li>
Previously, most failures were a result of missing modules in Coriolis, although this is rarer now since the import system was improved. If you're using a module in game and you know it isn't in Coriolis, this could be the problem, please check the data output section below.
</li>
<li>
Incorrect import strings generated by third party apps do still occur, please check the data output below and if the import was from something like EDMC, please check you're using the latest version.
</li>
<li>
You've hit a 'maximum URL Length' for your browser. This is a known issue with Internet Explorer and Edge, as well as Google Chrome, all of which only support 2083 characters. Please try using another browser first, before reporting an issue, such as Firefox which supports 65,536 characters or Safari, which supports 80,000 characters. Don't copy the URL from Explorer, Edge or Chrome, as they will have truncated it and the data string will be incorrect. You'll need to change your default browser settings, so that when you click the link, it opens in the browser you want to use.
</li>
<li>
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been understood correctly by the browser. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
</li>
</ul>
<br/>
<div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div>
<br/>
<h3>Data Output</h3>
{content}
</div>;
}
} }
} }

File diff suppressed because it is too large Load Diff

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract/Base Page * Abstract/Base Page
*/ */
export default class Page extends React.Component { export default class Page extends React.Component {
static contextTypes = { static contextTypes = {
closeMenu: PropTypes.func.isRequired, closeMenu: PropTypes.func.isRequired,
hideModal: PropTypes.func.isRequired, hideModal: PropTypes.func.isRequired,
@@ -62,14 +61,6 @@ export default class Page extends React.Component {
*/ */
componentDidMount() { componentDidMount() {
document.title = this.state.title || 'Coriolis'; document.title = this.state.title || 'Coriolis';
try {
(window.adsbygoogle = window.adsbygoogle || []).push({
google_ad_client: "ca-pub-3709458261881414",
enable_page_level_ads: true
});
} catch (error) {
}
} }
/** /**
@@ -92,5 +83,4 @@ export default class Page extends React.Component {
} }
return this.renderPage(); return this.renderPage();
} }
} }

View File

@@ -1,102 +1,81 @@
import React from 'react'; import React from 'react';
import Page from './Page'; import Page from './Page';
import { Ships } from 'coriolis-data/dist';
import cn from 'classnames'; import cn from 'classnames';
import Ship from '../shipyard/Ship'; import { Factory } from 'ed-forge';
import * as ModuleUtils from '../shipyard/ModuleUtils'; import { JUMP_METRICS } from 'ed-forge/lib/ship-stats';
import { SizeMap } from '../shipyard/Constants'; import { SizeMap } from '../shipyard/Constants';
import Link from '../components/Link'; import Link from '../components/Link';
/**
* Counts the hardpoints by class/size
* @param {Object} slot Hardpoint Slot model
*/
function countHp(slot) {
this.hp[slot.maxClass]++;
this.hpCount++;
}
/**
* Counts the internal slots and aggregated properties
* @param {Object} slot Internal Slots
*/
function countInt(slot) {
let crEligible = !slot.eligible || slot.eligible.cr;
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
this.intCount++;
this.maxCargo += crEligible ?
ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo :
0;
// if no eligiblity, then assume pce
let passSlotType = null;
let passSlotRating = null;
if (!slot.eligible || slot.eligible.pce) {
passSlotType = 'pce';
passSlotRating = 'E';
} else if (slot.eligible.pci) {
passSlotType = 'pci';
passSlotRating = 'D';
} else if (slot.eligible.pcm) {
passSlotType = 'pcm';
passSlotRating = 'C';
} else if (slot.eligible.pcq) {
passSlotType = 'pcq';
passSlotRating = 'B';
}
let passengerBay = passSlotType ?
ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) :
null;
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
}
/** /**
* Generate Ship summary and aggregated properties * Generate Ship summary and aggregated properties
* @param {String} shipId Ship Id * @param {String} shipId Ship Id
* @param {Object} shipData Ship Default Data
* @return {Object} Ship summary and aggregated properties * @return {Object} Ship summary and aggregated properties
*/ */
function shipSummary(shipId, shipData) { function shipSummary(shipId) {
// Build Ship
let ship = Factory.newShip(shipId);
let coreSizes = ship.readMeta('coreSizes');
let { jumpRange, totalRange } = ship.getMetrics(JUMP_METRICS);
let summary = { let summary = {
agility: ship.readProp('pitch') + ship.readProp('yaw') + ship.readProp('roll'),
baseArmour: ship.readProp('basearmour'),
baseShieldStrength: ship.readProp('baseshieldstrength'),
boost: ship.readProp('boost'),
class: ship.readMeta('class'),
crew: ship.readMeta('crew'),
id: shipId, id: shipId,
hardness: ship.readProp('hardness'),
hpCount: 0, hpCount: 0,
hullMass: ship.readProp('hullmass'),
intCount: 0, intCount: 0,
beta: shipData.beta, masslock: ship.readProp('masslock'),
maxCargo: 0,
maxPassengers: 0,
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8 int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
standard: shipData.slots.standard, jumpRange,
agility: pitch: ship.readProp('pitch'),
shipData.properties.pitch + retailCost: ship.readMeta('retailCost'),
shipData.properties.yaw + roll: ship.readProp('roll'),
shipData.properties.roll speed: ship.readProp('speed'),
standard: [
'powerplant',
'mainengines',
'frameshiftdrive',
'lifesupport',
'powerdistributor',
'radar',
'fueltank'
].map(k => coreSizes[k]),
totalRange,
yaw: ship.readProp('yaw'),
}; };
Object.assign(summary, shipData.properties);
let ship = new Ship(shipId, shipData.properties, shipData.slots);
// Build Ship // Count Hardpoints by class
ship.buildWith(shipData.defaults); // Populate with stock/default components ship.getHardpoints(undefined, true).forEach(hardpoint => {
ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class summary.hp[hardpoint.getSize()]++;
ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class summary.hpCount++;
summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost });
ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range // Count Internal Compartments by class
summary.maxJumpRange = ship.unladenRange; // Record Jump Range let maxCargo = 0, maxPassengers = 0;
ship.getInternals(undefined, true).forEach(internal => {
const size = String(internal.getSize());
summary.int[size]++;
summary.intCount++;
// Best thrusters // Try cargo racks
let th; try {
if (ship.standard[1].maxClass === 3) { internal.setItem('cargorack', size);
th = 'tz'; maxCargo += internal.get('cargo');
} else if (ship.standard[1].maxClass === 2) { } catch {}
th = 'u0'; // Try economy cabins
} else { try {
th = ship.standard[1].maxClass + 'A'; internal.setItem('passengercabins', size < '6' ? size : '6', '1');
} maxPassengers += internal.get('cabincapacity');
} catch {}
});
ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters summary.maxCargo = maxCargo;
summary.topSpeed = ship.topSpeed; summary.maxPassengers = maxPassengers;
summary.topBoost = ship.topBoost;
summary.baseArmour = ship.armour;
return summary; return summary;
} }
@@ -117,14 +96,14 @@ export default class ShipyardPage extends Page {
if (!ShipyardPage.cachedShipSummaries) { if (!ShipyardPage.cachedShipSummaries) {
ShipyardPage.cachedShipSummaries = []; ShipyardPage.cachedShipSummaries = [];
for (let s in Ships) { for (let s of Factory.getAllShipTypes()) {
ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s])); ShipyardPage.cachedShipSummaries.push(shipSummary(s));
} }
} }
this.state = { this.state = {
title: 'Coriolis EDCD Edition - Shipyard', title: 'Coriolis EDCD Edition - Shipyard',
shipPredicate: 'name', shipPredicate: 'id',
shipDesc: true, shipDesc: true,
shipSummaries: ShipyardPage.cachedShipSummaries, shipSummaries: ShipyardPage.cachedShipSummaries,
compare: {}, compare: {},
@@ -157,7 +136,7 @@ export default class ShipyardPage extends Page {
* @private * @private
*/ */
_toggleGroupCompared() { _toggleGroupCompared() {
this.setState({groupCompared: !this.state.groupCompared}) this.setState({ groupCompared: !this.state.groupCompared });
} }
/** /**
@@ -209,16 +188,18 @@ export default class ShipyardPage extends Page {
<td className="ri cap">{translate(SizeMap[s.class])}</td> <td className="ri cap">{translate(SizeMap[s.class])}</td>
<td className="ri">{fInt(s.crew)}</td> <td className="ri">{fInt(s.crew)}</td>
<td className="ri">{s.masslock}</td> <td className="ri">{s.masslock}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.hullMass)}</td> <td className="ri">{fInt(s.hullMass)}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.speed)}</td> <td className="ri">{fInt(s.speed)}</td>
<td className="ri">{fInt(s.boost)}</td> <td className="ri">{fInt(s.boost)}</td>
<td className="ri">{fInt(s.pitch)}</td>
<td className="ri">{fInt(s.yaw)}</td>
<td className="ri">{fInt(s.roll)}</td>
<td className="ri">{fRound(s.jumpRange)}</td>
<td className="ri">{fRound(s.totalRange)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.baseArmour)}</td> <td className="ri">{fInt(s.baseArmour)}</td>
<td className="ri">{fInt(s.baseShieldStrength)}</td> <td className="ri">{fInt(s.baseShieldStrength)}</td>
<td className="ri">{fInt(s.topSpeed)}</td>
<td className="ri">{fInt(s.topBoost)}</td>
<td className="ri">{fRound(s.maxJumpRange)}</td>
<td className="ri">{fInt(s.maxCargo)}</td> <td className="ri">{fInt(s.maxCargo)}</td>
<td className="ri">{fInt(s.maxPassengers)}</td> <td className="ri">{fInt(s.maxPassengers)}</td>
<td className="cn">{s.standard[0]}</td> <td className="cn">{s.standard[0]}</td>
@@ -254,7 +235,6 @@ export default class ShipyardPage extends Page {
let { translate, formats, units } = language; let { translate, formats, units } = language;
let hide = this.context.tooltip.bind(null, null); let hide = this.context.tooltip.bind(null, null);
let fInt = formats.int; let fInt = formats.int;
let fRound = formats.round;
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state; let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
let sortShips = (predicate, index) => let sortShips = (predicate, index) =>
this._sortShips.bind(this, predicate, index); this._sortShips.bind(this, predicate, index);
@@ -298,7 +278,7 @@ export default class ShipyardPage extends Page {
} }
if (valA == valB) { if (valA == valB) {
if (a.name > b.name) { if (a.id > b.id) {
return 1; return 1;
} else { } else {
return -1; return -1;
@@ -334,7 +314,7 @@ export default class ShipyardPage extends Page {
onClick={() => this._toggleCompare(s.id)} onClick={() => this._toggleCompare(s.id)}
> >
<td className="le"> <td className="le">
<Link href={'/outfit/' + s.id}>{s.name} {s.beta === true ? '(Beta)' : null}</Link> <Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link>
</td> </td>
</tr> </tr>
); );
@@ -342,281 +322,249 @@ export default class ShipyardPage extends Page {
} }
return ( return (
<div className="page" style={{fontSize: sizeRatio + 'em'}}> <div className="page" style={{ fontSize: sizeRatio + 'em' }}>
<div className="content-wrapper"> <div className="content-wrapper">
<div className="shipyard-table-wrapper"> <div className="shipyard-table-wrapper">
<table style={{width: '12em', position: 'absolute', zIndex: 1}} className="shipyard-table"> <table style={{ width: '12em', position: 'absolute', zIndex: 1 }} className="shipyard-table">
<thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main">
<th className="sortable le rgt" onClick={sortShips('name')}>
{translate('ship')}
</th>
</tr>
<tr>
<th className="le rgt invisible">{units['m/s']}</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{shipRows}
</tbody>
</table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead> <thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main"> <tr className="main">
<th>&nbsp;</th> <th className="sortable le rgt" onClick={sortShips('id')}>
<th {translate('ship')}
rowSpan={3}
className="sortable"
onClick={sortShips('class')}
>
{translate('size')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('crew')}
>
{translate('crew')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide}
onClick={sortShips('masslock')}
>
{translate('MLF')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('agility')}
>
{translate('agility')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide}
onClick={sortShips('hardness')}
>
{translate('hrd')}
</th>
<th>&nbsp;</th>
<th colSpan={4}>{translate('base')}</th>
<th colSpan={5}>{translate('max')}</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')}
onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th
colSpan={5}
className="sortable lft"
onClick={sortShips('hpCount')}
>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th> </th>
</tr> </tr>
<tr> <tr>
<th <th className="le rgt invisible">{units['m/s']}</th>
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{units.T}
</th>
<th>&nbsp;</th>
<th
className="sortable lft"
onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide}
onClick={sortShips('standard', 0)}
>
{'pp'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide}
onClick={sortShips('standard', 1)}
>
{'th'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide}
onClick={sortShips('standard', 2)}
>
{'fsd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide}
onClick={sortShips('standard', 3)}
>
{'ls'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'power distributor')}
onMouseLeave={hide}
onClick={sortShips('standard', 4)}
>
{'pd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide}
onClick={sortShips('standard', 5)}
>
{'s'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide}
onClick={sortShips('standard', 6)}
>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr> </tr>
</thead> </thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}> <tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{detailRows} {shipRows}
</tbody> </tbody>
</table> </table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead>
<tr className="main">
{/* First all headers that spread out over three rows */}
{/* cost placeholder */}
<th>&nbsp;</th>
<th rowSpan={3} className="sortable" onClick={sortShips('class')}>
{translate('size')}
</th>
<th rowSpan={3} className="sortable" onClick={sortShips('crew')}>
{translate('crew')}
</th>
<th rowSpan={3} className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide} onClick={sortShips('masslock')}>
{translate('MLF')}
</th>
{/* hull mass placeholder */}
<th>&nbsp;</th>
<th colSpan={6}>{translate('agility')}</th>
<th colSpan={2}>{translate('travel')}</th>
<th colSpan={3}>{translate('defence')}</th>
{/* cargo placeholder */}
<th>&nbsp;</th>
{/* pax placeholder */}
<th>&nbsp;</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
{/* Now all headers in a second-row */}
<th className="sortable lft" onClick={sortShips('retailCost')}>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('agility')}>
{translate('rating')}
</th>
<th className="sortable" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{translate('pitch')}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{translate('yaw')}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{translate('roll')}
</th>
<th className="sortable lft" onClick={sortShips('jumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{translate('range')}
</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide} onClick={sortShips('hardness')}>
{translate('hrd')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th className="sortable" onClick={sortShips('baseShieldStrength')}>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable lft" onClick={sortShips('maxPassengers')}
onMouseEnter={termtip.bind(null, 'passenger capacity')} onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th colSpan={5} className="sortable lft" onClick={sortShips('hpCount')}>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th>
</tr>
<tr>
{/* Third row headers, i.e., units */}
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
{/* agility rating placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{units['°/s']}
</th>
<th className="sortable lft" onClick={sortShips('jumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{units.LY}
</th>
<th className="lft">&nbsp;</th>
{/* armour placeholder */}
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{units.T}
</th>
{/* pax placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide} onClick={sortShips('standard', 0)}>
{'pp'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide} onClick={sortShips('standard', 1)}>
{'th'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide} onClick={sortShips('standard', 2)}>
{'fsd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide} onClick={sortShips('standard', 3)}>
{'ls'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'power distriubtor')}
onMouseLeave={hide} onClick={sortShips('standard', 4)}>
{'pd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide} onClick={sortShips('standard', 5)}>
{'s'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide} onClick={sortShips('standard', 6)}>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{detailRows}
</tbody>
</table>
</div>
</div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
</div> </div>
</div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>{translate('Group highlighted ships')}</label>
</div>
</div> </div>
</div> </div>
); );

View File

@@ -14,7 +14,6 @@ export function jumpRange(mass, fsd, fuel, ship) {
const fsdOptimalMass = fsd instanceof Module ? fsd.getOptMass() : fsd.optmass; const fsdOptimalMass = fsd instanceof Module ? fsd.getOptMass() : fsd.optmass;
let jumpAddition = 0; let jumpAddition = 0;
if (ship) { if (ship) {
mass += ship.reserveFuelCapacity || 0;
for (const module of ship.internal) { for (const module of ship.internal) {
if (module && module.m && module.m.grp === 'gfsb' && ship.getSlotStatus(module) == 3) { if (module && module.m && module.m.grp === 'gfsb' && ship.getSlotStatus(module) == 3) {
jumpAddition += module.m.getJumpBoost(); jumpAddition += module.m.getJumpBoost();
@@ -341,30 +340,63 @@ export function shieldMetrics(ship, sys) {
const maxSysResistance = this.sysResistance(4); const maxSysResistance = this.sysResistance(4);
let shield = {}; let shield = {};
const dimReturnLine = (res) => 1 - (1 - res) * 0.7;
const shieldGeneratorSlot = ship.findInternalByGroup('sg'); const shieldGeneratorSlot = ship.findInternalByGroup('sg');
if (shieldGeneratorSlot && shieldGeneratorSlot.enabled && shieldGeneratorSlot.m) { if (shieldGeneratorSlot && shieldGeneratorSlot.enabled && shieldGeneratorSlot.m) {
const shieldGenerator = shieldGeneratorSlot.m; const shieldGenerator = shieldGeneratorSlot.m;
let res = {
kin: shieldGenerator.kinres,
therm: shieldGenerator.thermres,
expl: shieldGenerator.explres
};
// Boosters // Boosters
let boost = 1; let boost = 1;
let boosterExplDmg = 1; let boosterExplDmg = 1;
let boosterKinDmg = 1; let boosterKinDmg = 1;
let boosterThermDmg = 1; let boosterThermDmg = 1;
// const explDim = dimReturnLine(shieldGenerator.explres);
// const thermDim = dimReturnLine(shieldGenerator.thermres);
// const kinDim = dimReturnLine(shieldGenerator.kinres);
for (let slot of ship.hardpoints) { for (let slot of ship.hardpoints) {
if (slot.enabled && slot.m && slot.m.grp == 'sb') { if (slot.enabled && slot.m && slot.m.grp == 'sb') {
boost += slot.m.getShieldBoost(); boost += slot.m.getShieldBoost();
res.expl += slot.m.getExplosiveResistance();
res.kin += slot.m.getKineticResistance();
res.therm += slot.m.getThermalResistance();
boosterExplDmg = boosterExplDmg * (1 - slot.m.getExplosiveResistance()); boosterExplDmg = boosterExplDmg * (1 - slot.m.getExplosiveResistance());
boosterKinDmg = boosterKinDmg * (1 - slot.m.getKineticResistance()); boosterKinDmg = boosterKinDmg * (1 - slot.m.getKineticResistance());
boosterThermDmg = boosterThermDmg * (1 - slot.m.getThermalResistance()); boosterThermDmg = boosterThermDmg * (1 - slot.m.getThermalResistance());
} }
if (slot.m && slot.m.grp == 'gsrp') {
}
} }
// Calculate diminishing returns for boosters // Calculate diminishing returns for boosters
// Diminishing returns not currently in-game // Diminishing returns not currently in-game
// boost = Math.min(boost, (1 - Math.pow(Math.E, -0.7 * boost)) * 2.5); // boost = Math.min(boost, (1 - Math.pow(Math.E, -0.7 * boost)) * 2.5);
// Remove base shield generator strength // Remove base shield generator strength
boost -= 1; boost -= 1;
// if (res.expl > explDim) {
// const overage = (res.expl - explDim) * 0.5;
// res.expl = explDim + overage;
// boosterExplDmg = explDim + overage;
// }
//
// if (res.therm > thermDim) {
// const overage = (res.therm - thermDim) * 0.5;
// res.therm = thermDim + overage;
// boosterThermDmg = thermDim + overage;
// }
//
// if (res.kin > kinDim) {
// const overage = (res.kin - kinDim) * 0.5;
// res.kin = kinDim + overage;
// boosterKinDmg = kinDim + overage;
// }
let shieldAddition = 0; let shieldAddition = 0;
if (ship) { if (ship) {
for (const module of ship.internal) { for (const module of ship.internal) {
@@ -383,8 +415,7 @@ export function shieldMetrics(ship, sys) {
// Our initial regeneration comes from the SYS capacitor store, which is replenished as it goes // Our initial regeneration comes from the SYS capacitor store, which is replenished as it goes
// 0.6 is a magic number from FD: each 0.6 MW of energy from the power distributor recharges 1 MJ/s of regeneration // 0.6 is a magic number from FD: each 0.6 MW of energy from the power distributor recharges 1 MJ/s of regeneration
let capacitorDrain = (shieldGenerator.getBrokenRegenerationRate() * shieldGenerator.getDistDraw()) - sysRechargeRate; let capacitorDrain = (shieldGenerator.getBrokenRegenerationRate() * 0.6) - sysRechargeRate;
let capacitorLifetime = powerDistributor.getSystemsCapacity() / capacitorDrain; let capacitorLifetime = powerDistributor.getSystemsCapacity() / capacitorDrain;
let recover = 16; let recover = 16;
@@ -400,7 +431,7 @@ export function shieldMetrics(ship, sys) {
recover = Math.Infinity; recover = Math.Infinity;
} else { } else {
// Recover remaining shields at the rate of the power distributor's recharge // Recover remaining shields at the rate of the power distributor's recharge
recover += remainingShieldToRecover / (sysRechargeRate / shieldGenerator.getDistDraw()); recover += remainingShieldToRecover / (sysRechargeRate / 0.6);
} }
} }
@@ -409,7 +440,7 @@ export function shieldMetrics(ship, sys) {
// Our initial regeneration comes from the SYS capacitor store, which is replenished as it goes // Our initial regeneration comes from the SYS capacitor store, which is replenished as it goes
// 0.6 is a magic number from FD: each 0.6 MW of energy from the power distributor recharges 1 MJ/s of regeneration // 0.6 is a magic number from FD: each 0.6 MW of energy from the power distributor recharges 1 MJ/s of regeneration
capacitorDrain = (shieldGenerator.getRegenerationRate() * shieldGenerator.getDistDraw()) - sysRechargeRate; capacitorDrain = (shieldGenerator.getRegenerationRate() * 0.6) - sysRechargeRate;
capacitorLifetime = powerDistributor.getSystemsCapacity() / capacitorDrain; capacitorLifetime = powerDistributor.getSystemsCapacity() / capacitorDrain;
let recharge = 0; let recharge = 0;
@@ -425,7 +456,7 @@ export function shieldMetrics(ship, sys) {
recharge = Math.Inf; recharge = Math.Inf;
} else { } else {
// Recharge remaining shields at the rate of the power distributor's recharge // Recharge remaining shields at the rate of the power distributor's recharge
recharge += remainingShieldToRecharge / (sysRechargeRate / shieldGenerator.getDistDraw()); recharge += remainingShieldToRecharge / (sysRechargeRate / 0.6);
} }
} }
@@ -467,7 +498,7 @@ export function shieldMetrics(ship, sys) {
*/ */
let sgExplosiveDmg = 1 - shieldGenerator.getExplosiveResistance(); let sgExplosiveDmg = 1 - shieldGenerator.getExplosiveResistance();
let sgSbExplosiveDmg = diminishingReturnsShields(sgExplosiveDmg, sgExplosiveDmg * boosterExplDmg); let sgSbExplosiveDmg = diminishDamageMult(sgExplosiveDmg * 0.7, (1 - shieldGenerator.getExplosiveResistance()) * boosterExplDmg);
/** @type {ShieldDamageMults} */ /** @type {ShieldDamageMults} */
shield.explosive = { shield.explosive = {
generator: sgExplosiveDmg, generator: sgExplosiveDmg,
@@ -479,7 +510,7 @@ export function shieldMetrics(ship, sys) {
}; };
let sgKineticDmg = 1 - shieldGenerator.getKineticResistance(); let sgKineticDmg = 1 - shieldGenerator.getKineticResistance();
let sgSbKineticDmg = diminishingReturnsShields(sgKineticDmg, sgKineticDmg * boosterKinDmg); let sgSbKineticDmg = diminishDamageMult(sgKineticDmg * 0.7, (1 - shieldGenerator.getKineticResistance()) * boosterKinDmg);
/** @type {ShieldDamageMults} */ /** @type {ShieldDamageMults} */
shield.kinetic = { shield.kinetic = {
generator: sgKineticDmg, generator: sgKineticDmg,
@@ -491,7 +522,7 @@ export function shieldMetrics(ship, sys) {
}; };
let sgThermalDmg = 1 - shieldGenerator.getThermalResistance(); let sgThermalDmg = 1 - shieldGenerator.getThermalResistance();
let sgSbThermalDmg = diminishingReturnsShields(sgThermalDmg , sgThermalDmg * boosterThermDmg); let sgSbThermalDmg = diminishDamageMult(sgThermalDmg * 0.7, (1 - shieldGenerator.getThermalResistance()) * boosterThermDmg);
/** @type {ShieldDamageMults} */ /** @type {ShieldDamageMults} */
shield.thermal = { shield.thermal = {
generator: sgThermalDmg, generator: sgThermalDmg,
@@ -531,20 +562,29 @@ export function armourMetrics(ship) {
let moduleArmour = 0; let moduleArmour = 0;
let moduleProtection = 1; let moduleProtection = 1;
const bulkheads = ship.bulkheads.m; const bulkheads = ship.bulkheads.m;
let hullExplDmgs = []; let hullExplDmg = 1;
let hullKinDmgs = []; let hullKinDmg = 1;
let hullThermDmgs = []; let hullThermDmg = 1;
let hullCausDmgs = []; let hullCausDmg = 1;
// const dimReturnLine = (res) => 1 - (1 - res) * 0.7;
// let res = {
// kin: 0,
// therm: 0,
// expl: 0
// };
// Armour from HRPs and module armour from MRPs // Armour from HRPs and module armour from MRPs
for (let slot of ship.internal) { for (let slot of ship.internal) {
if (slot.m && slot.enabled && (slot.m.grp === 'hr' || slot.m.grp === 'ghrp' || slot.m.grp == 'mahr')) { if (slot.m && slot.enabled && (slot.m.grp === 'hr' || slot.m.grp === 'ghrp' || slot.m.grp == 'mahr')) {
armourReinforcement += slot.m.getHullReinforcement(); armourReinforcement += slot.m.getHullReinforcement();
// Hull boost for HRPs is applied against the ship's base armour // Hull boost for HRPs is applied against the ship's base armour
armourReinforcement += ship.baseArmour * slot.m.getModValue('hullboost') / 10000; armourReinforcement += ship.baseArmour * slot.m.getModValue('hullboost') / 10000;
hullExplDmgs.push(1 - slot.m.getExplosiveResistance()); // res.expl += slot.m.getExplosiveResistance();
hullKinDmgs.push(1 - slot.m.getKineticResistance()); // res.kin += slot.m.getKineticResistance();
hullThermDmgs.push(1 - slot.m.getThermalResistance()); // res.therm += slot.m.getThermalResistance();
hullCausDmgs.push(1 - slot.m.getCausticResistance()); hullExplDmg = hullExplDmg * (1 - slot.m.getExplosiveResistance());
hullKinDmg = hullKinDmg * (1 - slot.m.getKineticResistance());
hullThermDmg = hullThermDmg * (1 - slot.m.getThermalResistance());
hullCausDmg = hullCausDmg * (1 - slot.m.getCausticResistance());
} }
if (slot.m && slot.enabled && (slot.m.grp == 'mrp' || slot.m.grp == 'gmrp')) { if (slot.m && slot.enabled && (slot.m.grp == 'mrp' || slot.m.grp == 'gmrp')) {
moduleArmour += slot.m.getIntegrity(); moduleArmour += slot.m.getIntegrity();
@@ -553,6 +593,27 @@ export function armourMetrics(ship) {
} }
moduleProtection = 1 - moduleProtection; moduleProtection = 1 - moduleProtection;
// const explDim = dimReturnLine(bulkheads.explres);
// const thermDim = dimReturnLine(bulkheads.thermres);
// const kinDim = dimReturnLine(bulkheads.kinres);
// if (res.expl > explDim) {
// const overage = (res.expl - explDim) * 0.5;
// res.expl = explDim + overage;
// hullExplDmg = explDim + overage;
// }
//
// if (res.therm > thermDim) {
// const overage = (res.therm - thermDim) * 0.5;
// res.therm = thermDim + overage;
// hullThermDmg = thermDim + overage;
// }
//
// if (res.kin > kinDim) {
// const overage = (res.kin - kinDim) * 0.5;
// res.kin = kinDim + overage;
// hullKinDmg = kinDim + overage;
// }
const armour = { const armour = {
bulkheads: armourBulkheads, bulkheads: armourBulkheads,
reinforcement: armourReinforcement, reinforcement: armourReinforcement,
@@ -569,8 +630,8 @@ export function armourMetrics(ship) {
total: 1 total: 1
}; };
let armourExplDmg = 1 - ship.bulkheads.m.getExplosiveResistance(); let armourExplDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getExplosiveResistance());
let armourReinforcedExplDmg = diminishingReturnsArmour(armourExplDmg, ...hullExplDmgs); let armourReinforcedExplDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getExplosiveResistance()) * hullExplDmg);
armour.explosive = { armour.explosive = {
bulkheads: armourExplDmg, bulkheads: armourExplDmg,
reinforcement: armourReinforcedExplDmg / armourExplDmg, reinforcement: armourReinforcedExplDmg / armourExplDmg,
@@ -578,8 +639,8 @@ export function armourMetrics(ship) {
res: 1 - armourReinforcedExplDmg res: 1 - armourReinforcedExplDmg
}; };
let armourKinDmg = 1 - ship.bulkheads.m.getKineticResistance(); let armourKinDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getKineticResistance());
let armourReinforcedKinDmg = diminishingReturnsArmour(armourKinDmg, ...hullKinDmgs); let armourReinforcedKinDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getKineticResistance()) * hullKinDmg);
armour.kinetic = { armour.kinetic = {
bulkheads: armourKinDmg, bulkheads: armourKinDmg,
reinforcement: armourReinforcedKinDmg / armourKinDmg, reinforcement: armourReinforcedKinDmg / armourKinDmg,
@@ -587,8 +648,8 @@ export function armourMetrics(ship) {
res: 1 - armourReinforcedKinDmg res: 1 - armourReinforcedKinDmg
}; };
let armourThermDmg = 1 - ship.bulkheads.m.getThermalResistance(); let armourThermDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getThermalResistance());
let armourReinforcedThermDmg = diminishingReturnsArmour(armourThermDmg, ...hullThermDmgs); let armourReinforcedThermDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getThermalResistance()) * hullThermDmg);
armour.thermal = { armour.thermal = {
bulkheads: armourThermDmg, bulkheads: armourThermDmg,
reinforcement: armourReinforcedThermDmg / armourThermDmg, reinforcement: armourReinforcedThermDmg / armourThermDmg,
@@ -596,8 +657,8 @@ export function armourMetrics(ship) {
res: 1 - armourReinforcedThermDmg res: 1 - armourReinforcedThermDmg
}; };
let armourCausDmg = 1 - ship.bulkheads.m.getCausticResistance(); let armourCausDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getCausticResistance());
let armourReinforcedCausDmg = diminishingReturnsArmour(armourCausDmg, ...hullCausDmgs); let armourReinforcedCausDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getCausticResistance()) * hullCausDmg);
armour.caustic = { armour.caustic = {
bulkheads: armourCausDmg, bulkheads: armourCausDmg,
reinforcement: armourReinforcedCausDmg / armourCausDmg, reinforcement: armourReinforcedCausDmg / armourCausDmg,
@@ -843,14 +904,12 @@ export function _weaponSustainedDps(m, opponent, opponentShields, opponentArmour
shields: { shields: {
range: 1, range: 1,
sys: opponentHasShields ? opponentShields.absolute.sys : 1, sys: opponentHasShields ? opponentShields.absolute.sys : 1,
resistance: 1, resistance: 1
dpe: 1
}, },
armour: { armour: {
range: 1, range: 1,
hardness: 1, hardness: 1,
resistance: 1, resistance: 1
dpe: 1
} }
} }
}; };
@@ -910,19 +969,11 @@ export function _weaponSustainedDps(m, opponent, opponentShields, opponentArmour
weapon.damage.shields.total = weapon.damage.shields.absolute + weapon.damage.shields.explosive + weapon.damage.shields.kinetic + weapon.damage.shields.thermal; weapon.damage.shields.total = weapon.damage.shields.absolute + weapon.damage.shields.explosive + weapon.damage.shields.kinetic + weapon.damage.shields.thermal;
weapon.damage.armour.total = weapon.damage.armour.absolute + weapon.damage.armour.explosive + weapon.damage.armour.kinetic + weapon.damage.armour.thermal; weapon.damage.armour.total = weapon.damage.armour.absolute + weapon.damage.armour.explosive + weapon.damage.armour.kinetic + weapon.damage.armour.thermal;
weapon.effectiveness.shields.resistance *= shieldsResistance; weapon.effectiveness.shields.resistance *= shieldsResistance;
weapon.effectiveness.armour.resistance *= armourResistance; weapon.effectiveness.armour.resistance *= armourResistance;
weapon.effectiveness.shields.total = weapon.effectiveness.shields.range * weapon.effectiveness.shields.sys * weapon.effectiveness.shields.resistance; weapon.effectiveness.shields.total = weapon.effectiveness.shields.range * weapon.effectiveness.shields.sys * weapon.effectiveness.shields.resistance;
weapon.effectiveness.armour.total = weapon.effectiveness.armour.range * weapon.effectiveness.armour.resistance * weapon.effectiveness.armour.hardness; weapon.effectiveness.armour.total = weapon.effectiveness.armour.range * weapon.effectiveness.armour.resistance * weapon.effectiveness.armour.hardness;
weapon.effectiveness.shields.dpe = weapon.damage.shields.total / m.getEps() / m.getSustainedFactor();
weapon.effectiveness.armour.dpe = weapon.damage.armour.total / m.getEps() / m.getSustainedFactor();
return weapon; return weapon;
} }
@@ -986,50 +1037,15 @@ export function timeToDeplete(amount, dps, eps, capacity, recharge) {
} }
/** /**
* Checks whether diminishing returns should be applied to shield damage * Applies diminishing returns to resistances.
* multipliers and does so if necessary. * @param {number} diminishFrom The base resistance up to which no diminishing returns are applied.
* @param {number} shieldMult Damage multiplier of shield generator * @param {number} damageMult Resistance as damage multiplier
* @param {number} combinedMult Damage multiplier of shields and shield boosters * @returns {number} Actual damage multiplier
* @returns {number} Overall damage multiplier
*/ */
export function diminishingReturnsShields(shieldMult, combinedMult) { export function diminishDamageMult(diminishFrom, damageMult) {
let max = shieldMult * 0.7; if (damageMult > diminishFrom) {
if (combinedMult < max) { return damageMult;
return mapIntoDiminishingRange(max / 2, max, combinedMult);
} else { } else {
return combinedMult; return (diminishFrom / 2) + 0.5 * damageMult;
} }
} }
/**
* Checks whether diminishing returns should be applied to armour damage
* multipliers and does so if necessary.
* @param {...any} mults Damage multipliers of alloys and hull reinforcement
* packages
* @returns {number} Overall damage multiplier
*/
export function diminishingReturnsArmour(...mults) {
let max = Math.min(0.7, ...mults);
let combined = mults.reduce((aggr, v) => aggr * v);
let diminished = mapIntoDiminishingRange(0.35, max, combined);
if (diminished < 0.7) {
return diminished;
} else {
return combined;
}
}
/**
* Applies diminishing returns to a damage multiplier. Effictively, the range
* [`0`, `max`]` is mapped into the range [`min`, `max`] for the value `now`.
* It can also happen, that `now` is outside of the range [`min`, `max`], then
* `now` is actually improved, i.e. enlarged.
* @param {number} min Best theoretical damage multiplier
* @param {number} max Damage multiplier from which diminishing returns start to
* be applied
* @param {number} now The current damage multiplier
* @returns {number} Remapped damage multiplier
*/
export function mapIntoDiminishingRange(min, max, now) {
return min + (max - min) * (now / max);
}

View File

@@ -25,6 +25,7 @@ export const ModuleGroupToName = {
pd: 'Power Distributor', pd: 'Power Distributor',
s: 'Sensors', s: 'Sensors',
ft: 'Fuel Tank', ft: 'Fuel Tank',
pas: 'Planetary Approach Suite',
// Internal // Internal
fs: 'Fuel Scoop', fs: 'Fuel Scoop',
@@ -57,9 +58,6 @@ export const ModuleGroupToName = {
gmrp: 'Guardian Module Reinforcement Package', gmrp: 'Guardian Module Reinforcement Package',
mahr: 'Meta Alloy Hull Reinforcement Package', mahr: 'Meta Alloy Hull Reinforcement Package',
sua: 'Supercruise Assist', sua: 'Supercruise Assist',
mlc: "Multi Limpet Controller",
rpl: "Repair Limpet Controller",
pas: 'Planetary Approach Suite',
// Hard Points // Hard Points
bl: 'Beam Laser', bl: 'Beam Laser',
@@ -77,15 +75,11 @@ export const ModuleGroupToName = {
nl: 'Mine Launcher', nl: 'Mine Launcher',
ml: 'Mining Laser', ml: 'Mining Laser',
mr: 'Missile Rack', mr: 'Missile Rack',
amr: 'Missile Rack (Advanced)',
axmr: 'AX Missile Rack', axmr: 'AX Missile Rack',
axmre: 'AX Missile Rack (Enhanced)',
pa: 'Plasma Accelerator', pa: 'Plasma Accelerator',
po: 'Point Defence', po: 'Point Defence',
mc: 'Multi-cannon', mc: 'Multi-cannon',
advmc: 'Multi-cannon (Advanced)',
axmc: 'AX Multi-cannon', axmc: 'AX Multi-cannon',
axmce: 'AX Multi-cannon (Enhanced)',
pl: 'Pulse Laser', pl: 'Pulse Laser',
rg: 'Rail Gun', rg: 'Rail Gun',
sb: 'Shield Booster', sb: 'Shield Booster',

View File

@@ -70,7 +70,7 @@ export default class Module {
/** /**
* Set a value for a given modification ID * Set a value for a given modification ID
* @param {String} name The name of the modification * @param {Number} name The name of the modification
* @param {object} value The value of the modification. If it is a numeric value then it should be an integer scaled so that -2.34% == -234 * @param {object} value The value of the modification. If it is a numeric value then it should be an integer scaled so that -2.34% == -234
* @param {Boolean} valueiswithspecial true if the value includes the special effect (when coming from a UI component) * @param {Boolean} valueiswithspecial true if the value includes the special effect (when coming from a UI component)
*/ */
@@ -81,13 +81,7 @@ export default class Module {
if (!this.origVals) { if (!this.origVals) {
this.origVals = {}; this.origVals = {};
} }
if (!valueiswithspecial) { if (valueiswithspecial && this.blueprint && this.blueprint.special) {
// Resistance modifiers scale with the base value.
if (name === 'kinres' || name === 'thermres' || name === 'causres' || name === 'explres') {
let baseValue = this.get(name, false);
value = (1 - baseValue) * value;
}
} else if (valueiswithspecial && this.blueprint && this.blueprint.special) {
// This module has a special effect, see if we need to alter the stored value // This module has a special effect, see if we need to alter the stored value
const modifierActions = Modifications.modifierActions[this.blueprint.special.edname]; const modifierActions = Modifications.modifierActions[this.blueprint.special.edname];
if (modifierActions && modifierActions[name]) { if (modifierActions && modifierActions[name]) {
@@ -119,7 +113,7 @@ export default class Module {
/** /**
* Helper to obtain a module's value. * Helper to obtain a module's value.
* @param {String} name The name of the modifier to obtain * @param {String} name The name of the modifier to obtain
* @param {Boolean} modified Whether to return the raw or modified value * @param {Number} modified Whether to return the raw or modified value
* @return {Number} The value queried * @return {Number} The value queried
*/ */
get(name, modified = true) { get(name, modified = true) {
@@ -439,15 +433,6 @@ export default class Module {
return this.get('integrity', modified); return this.get('integrity', modified);
} }
/**
* Get the info of this module
* @param {Boolean} [modified=false] Whether to take modifications into account
* @return {String} the info of this module
*/
getInfo(modified = false) {
return (modified && this.getModValue('info')) || this.info;
}
/** /**
* Get the mass of this module * Get the mass of this module
* @param {Boolean} [modified=true] Whether to take modifications into account * @param {Boolean} [modified=true] Whether to take modifications into account
@@ -709,7 +694,7 @@ export default class Module {
let result = 0; let result = 0;
if (this['maxmass']) { if (this['maxmass']) {
result = this['maxmass']; result = this['maxmass'];
if (result && modified && !ModuleUtils.isShieldGenerator(this['grp'])) { if (result && modified) {
let mult = this.getModValue('optmass') / 10000; let mult = this.getModValue('optmass') / 10000;
if (mult) { result = result * (1 + mult); } if (mult) { result = result * (1 + mult); }
} }
@@ -927,9 +912,8 @@ export default class Module {
const burst = this.get('burst', modified) || 1; const burst = this.get('burst', modified) || 1;
const burstRoF = this.get('burstrof', modified) || 1; const burstRoF = this.get('burstrof', modified) || 1;
const intRoF = this.get('rof', modified); const intRoF = this.get('rof', modified);
const charge = this.get('charge', modified) || 0;
return burst / (((burst - 1) / burstRoF) + 1 / intRoF + charge); return burst / (((burst - 1) / burstRoF) + 1 / intRoF);
} }
/** /**

View File

@@ -13,19 +13,6 @@ function filter(arr, maxClass, minClass, mass) {
return arr.filter(m => m.class <= maxClass && m.class >= minClass && (m.maxmass === undefined || mass <= m.maxmass)); return arr.filter(m => m.class <= maxClass && m.class >= minClass && (m.maxmass === undefined || mass <= m.maxmass));
} }
/**
* Filter SCO Modules to only return legal size.
* @param {Array} arr Array of available FSD modules.
* @param {number} maxSize Maximum allowable size for SCO modules.
* @return {Array} Subset of modules filtered based on legal size amd type.
*/
function sco_filter(arr, maxSize) {
return arr.filter(module => {
return !(module.hasOwnProperty('name') && module['name'] === "Frame Shift Drive (SCO)" && module['class'] < maxSize);
});
}
/** /**
* The available module set for a specific ship * The available module set for a specific ship
*/ */
@@ -54,7 +41,6 @@ export default class ModuleSet {
this.standard[0] = filter(stnd.pp, maxStandardArr[0], 0, mass); // Power Plant this.standard[0] = filter(stnd.pp, maxStandardArr[0], 0, mass); // Power Plant
this.standard[2] = filter(stnd.fsd, maxStandardArr[2], 0, mass); // FSD this.standard[2] = filter(stnd.fsd, maxStandardArr[2], 0, mass); // FSD
this.standard[2] = sco_filter(this.standard[2], maxStandardArr[2]) // FSD - Filter SCO Modules
this.standard[4] = filter(stnd.pd, maxStandardArr[4], 0, mass); // Power Distributor this.standard[4] = filter(stnd.pd, maxStandardArr[4], 0, mass); // Power Distributor
this.standard[6] = filter(stnd.ft, maxStandardArr[6], 0, mass); // Fuel Tank this.standard[6] = filter(stnd.ft, maxStandardArr[6], 0, mass); // Fuel Tank
// Thrusters, filter modules by class only (to show full list of ratings for that class) // Thrusters, filter modules by class only (to show full list of ratings for that class)

View File

@@ -10,7 +10,7 @@ import { Ships, Modifications } from 'coriolis-data/dist';
import { chain } from 'lodash'; import { chain } from 'lodash';
const zlib = require('zlib'); const zlib = require('zlib');
const UNIQUE_MODULES = ['psg', 'sg', 'bsg', 'rf', 'fs', 'fh', 'gfsb', 'dc', 'ews']; const UNIQUE_MODULES = ['psg', 'sg', 'bsg', 'rf', 'fs', 'fh', 'gfsb', 'dc'];
// Constants for modifications struct // Constants for modifications struct
const SLOT_ID_DONE = -1; const SLOT_ID_DONE = -1;
@@ -140,7 +140,7 @@ export default class Ship {
*/ */
canBoost(cargo, fuel) { canBoost(cargo, fuel) {
return this.canThrust(cargo, fuel) && // Thrusters operational return this.canThrust(cargo, fuel) && // Thrusters operational
this.standard[4].m.getEnginesCapacity() >= this.boostEnergy; // PD capacitor is sufficient for boost this.standard[4].m.getEnginesCapacity() > this.boostEnergy; // PD capacitor is sufficient for boost
} }
/** /**
@@ -492,18 +492,25 @@ export default class Ship {
* @param {Object} m The module to change * @param {Object} m The module to change
* @param {Object} name The name of the modification to change * @param {Object} name The name of the modification to change
* @param {Number} value The new value of the modification. The value of the modification is scaled to provide two decimal places of precision in an integer. For example 1.23% is stored as 123 * @param {Number} value The new value of the modification. The value of the modification is scaled to provide two decimal places of precision in an integer. For example 1.23% is stored as 123
* @param {boolean} isAbsolute True if value is an absolute value and not a modification value * @param {bool} sentfromui True if this update was sent from the UI
* @param {bool} isAbsolute True if value is an absolute value and not a
* modification value
*/ */
setModification(m, name, value, isAbsolute = false) { setModification(m, name, value, sentfromui, isAbsolute) {
if (isNaN(value)) { if (isNaN(value)) {
// Value passed is invalid; reset it to 0 // Value passed is invalid; reset it to 0
value = 0; value = 0;
} }
if (isAbsolute) { if (isAbsolute) {
m.setPretty(name, value, isAbsolute); m.setPretty(name, value, sentfromui);
} else { } else {
m.setModValue(name, value, false); // Resistance modifiers scale with the base value
if (name == 'kinres' || name == 'thermres' || name == 'causres' || name == 'explres') {
let baseValue = m.get(name, false);
value = (1 - baseValue) * value;
}
m.setModValue(name, value, sentfromui);
} }
// Handle special cases // Handle special cases
@@ -536,7 +543,7 @@ export default class Ship {
this.recalculateArmour(); this.recalculateArmour();
} else if (name === 'shieldreinforcement') { } else if (name === 'shieldreinforcement') {
this.recalculateShieldCells(); this.recalculateShieldCells();
} else if (name === 'burst' || name === 'burstrof' || name === 'clip' || name === 'damage' || name === 'distdraw' || name === 'jitter' || name === 'piercing' || name === 'range' || name === 'reload' || name === 'rof' || name === 'thermload') { } else if (name === 'burst' || name == 'burstrof' || name === 'clip' || name === 'damage' || name === 'distdraw' || name === 'jitter' || name === 'piercing' || name === 'range' || name === 'reload' || name === 'rof' || name === 'thermload') {
this.recalculateDps(); this.recalculateDps();
this.recalculateHps(); this.recalculateHps();
this.recalculateEps(); this.recalculateEps();
@@ -1210,11 +1217,12 @@ export default class Ship {
.value(); .value();
// Update global stats // Update global stats
this.unladenMass = unladenMass + fuelCapacity; this.unladenMass = unladenMass;
this.cargoCapacity = cargoCapacity; this.cargoCapacity = cargoCapacity;
this.fuelCapacity = fuelCapacity; this.fuelCapacity = fuelCapacity;
this.passengerCapacity = passengerCapacity; this.passengerCapacity = passengerCapacity;
this.ladenMass = unladenMass + fuelCapacity + cargoCapacity; this.ladenMass = unladenMass + fuelCapacity + cargoCapacity;
return this; return this;
} }

View File

@@ -0,0 +1,33 @@
import { Module } from 'ed-forge';
/**
* Sets a resistance value of a module as
* @param {Module} module Module to set the property
* @param {string} prop Property name; must end with 'resistance'
* @param {number} val Resistance value to set
*/
function setterResToEff(module, prop, val) {
module.set(
prop.replace('resistance', 'effectiveness'),
1 - val / 100,
);
}
export const SHOW = {
causticeffectiveness: {
as: 'causticresistance',
setter: setterResToEff,
},
explosiveeffectiveness: {
as: 'explosiveresistance',
setter: setterResToEff,
},
kineticeffectiveness: {
as: 'kineticresistance',
setter: setterResToEff,
},
thermiceffectiveness: {
as: 'thermicresistance',
setter: setterResToEff,
},
};

View File

@@ -15,6 +15,7 @@ const LS_KEY_SIZE_RATIO = 'sizeRatio';
const LS_KEY_TOOLTIPS = 'tooltips'; const LS_KEY_TOOLTIPS = 'tooltips';
const LS_KEY_MODULE_RESISTANCES = 'moduleResistances'; const LS_KEY_MODULE_RESISTANCES = 'moduleResistances';
const LS_KEY_ROLLS = 'matsPerGrade'; const LS_KEY_ROLLS = 'matsPerGrade';
const LS_KEY_ORBIS = 'orbis';
let LS; let LS;
@@ -94,6 +95,7 @@ export class Persist extends EventEmitter {
let buildJson = _get(LS_KEY_BUILDS); let buildJson = _get(LS_KEY_BUILDS);
let comparisonJson = _get(LS_KEY_COMPARISONS); let comparisonJson = _get(LS_KEY_COMPARISONS);
this.orbisCreds = _get(LS_KEY_ORBIS) || { email: '', password: '' };
this.onStorageChange = this.onStorageChange.bind(this); this.onStorageChange = this.onStorageChange.bind(this);
this.langCode = _getString(LS_KEY_LANG) || 'en'; this.langCode = _getString(LS_KEY_LANG) || 'en';
this.insurance = insurance && Insurance[insurance.toLowerCase()] !== undefined ? insurance : 'standard'; this.insurance = insurance && Insurance[insurance.toLowerCase()] !== undefined ? insurance : 'standard';
@@ -108,9 +110,9 @@ export class Persist extends EventEmitter {
this.matsPerGrade = matsPerGrade || { this.matsPerGrade = matsPerGrade || {
1: 2, 1: 2,
2: 2, 2: 2,
3: 3, 3: 4,
4: 4, 4: 4,
5: 5 5: 10
}; };
this.cmdrName = cmdrName || { selected: '', cmdrs: [] }; this.cmdrName = cmdrName || { selected: '', cmdrs: [] };
this.tooltipsEnabled = tips === null ? true : tips; this.tooltipsEnabled = tips === null ? true : tips;
@@ -167,6 +169,10 @@ export class Persist extends EventEmitter {
this.matsPerGrade = JSON.parse(newValue); this.matsPerGrade = JSON.parse(newValue);
this.emit('matsPerGrade', this.matsPerGrade); this.emit('matsPerGrade', this.matsPerGrade);
break; break;
case LS_KEY_ORBIS:
this.orbisCreds = JSON.parse(newValue);
this.emit('orbis', this.orbisCreds);
break;
} }
} catch (e) { } catch (e) {
// On JSON.Parse Error - don't sync or do anything // On JSON.Parse Error - don't sync or do anything
@@ -192,6 +198,24 @@ export class Persist extends EventEmitter {
this.emit('language', langCode); this.emit('language', langCode);
} }
/**
* Get the current orbis.zone credentials
* @return {String} language code
*/
getOrbisCreds() {
return this.orbisCreds;
};
/**
* Update and save the orbis.zone credentials
* @param {Object} creds object with username and password properties.
*/
setOrbisCreds(creds) {
this.langCode = creds;
_put(LS_KEY_ORBIS, creds);
this.emit('orbis', creds);
}
/** /**
* Show tooltips setting * Show tooltips setting
* @param {boolean} show Optional - update setting * @param {boolean} show Optional - update setting

View File

@@ -1,458 +1,127 @@
import React from 'react'; import React from 'react';
import { Modifications } from 'coriolis-data/dist'; import { Modifications } from 'coriolis-data/dist';
import { STATS_FORMATTING } from '../shipyard/StatsFormatting'; import { Module } from 'ed-forge';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
/** import { entries, keys, uniq } from 'lodash';
* Generate a tooltip with details of a blueprint's specials
* @param {Object} translate The translate object /**
* @param {Object} blueprint The blueprint at the required grade * Generate a tooltip with details of a blueprint's specials
* @param {string} grp The group of the module * @param {Object} language The translate object
* @param {Object} m The module to compare with * @param {Module} m The module to compare with
* @param {string} specialName The name of the special * @param {string} specialName The name of the special
* @returns {Object} The react components * @returns {Object} The react components
*/ */
export function specialToolTip(translate, blueprint, grp, m, specialName) { export function specialToolTip(language, m, specialName) {
const description = []; const { formats, translate } = language;
const effects = []; return (
if (!blueprint || !blueprint.features) { <div>
return undefined; <table width='100%'>
} <tbody>
if (m) { {entries(getExperimentalInfo(specialName).features).map(
// We also add in any benefits from specials that aren't covered above ([prop, feats]) => {
if (m.blueprint) { const { max, only } = feats;
if (specialName) { if (only && !m.getItem().match(only)) {
if (Modifications.specials[specialName].description) { return null;
description.push( }
<div className={'success'} style={{ maxWidth: 350, padding: 5, marginBottom: 10 }}>
{Modifications.specials[specialName].description} const { value, unit, beneficial } = m.getModifierFormatted(prop);
</div> // If the product of value and min/max is positive, both values
); // point into the same direction, i.e. positive/negative.
} const specialBeneficial = (value * max) > 0 === beneficial;
}
for (const feature in Modifications.modifierActions[specialName]) { return <tr key={prop + '_specialTT'}>
// if (!blueprint.features[feature] && !m.mods.feature) { <td style={{ textAlign: 'left' }}>{translate(prop)}</td>
const featureDef = Modifications.modifications[feature]; <td>&nbsp;</td>
if (featureDef && !featureDef.hidden) { <td className={specialBeneficial ? 'secondary' : 'warning'}
let symbol = ''; style={{ textAlign: 'right' }}>{formats.round(max * 100)}{unit}</td>
if (feature === 'jitter') { <td>&nbsp;</td>
symbol = '°'; </tr>;
} else if (featureDef.type === 'percentage') { }
symbol = '%'; )}
} </tbody>
let current = m.getModValue(feature) - m.getModValue(feature, true); </table>
if (featureDef.type === 'percentage') { </div>
current = Math.round(current / 10) / 10; );
} else if (featureDef.type === 'numeric') { }
current /= 100;
} /**
const currentIsBeneficial = isValueBeneficial(feature, current); * Generate a tooltip with details and preview of a blueprint's effects
* @param {Object} language The language object
effects.push( * @param {Module} m The module to compare with
<tr key={feature + '_specialTT'}> * @param {string} previewBP Blueprint to preview
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td> * @param {number} previewGrade Grade to preview
<td>&nbsp;</td> * @returns {Object} The react components
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} */
style={{ textAlign: 'right' }}>{current}{symbol}</td> export function blueprintTooltip(language, m, previewBP, previewGrade) {
<td>&nbsp;</td> const { translate, formats } = language;
</tr> const blueprint = previewBP || m.getBlueprint();
); const grade = previewGrade || m.getBlueprintGrade();
} if (!blueprint) {
} return null;
} }
}
const bpFeatures = getBlueprintInfo(blueprint).features[grade];
return ( const features = uniq(m.getModifiedProperties().concat(keys(bpFeatures)));
<div>
{description} return (
<table width='100%'> <div>
<tbody> <table width='100%'>
{effects} <thead>
</tbody> <tr>
</table> <td>{translate('feature')}</td>
</div> <td>{translate('worst')}</td>
); <td>{translate('current')}</td>
} <td>{translate('best')}</td>
</tr>
/** </thead>
* Generate a tooltip with details of a blueprint's effects <tbody>
* @param {Object} translate The translate object {features.map((prop) => {
* @param {Object} blueprint The blueprint at the required grade const { min, max, only } = bpFeatures[prop] || {};
* @param {Array} engineers The engineers supplying this blueprint // Skip this property if it doesn't apply to this module
* @param {string} grp The group of the module if (only && !m.getItem().match(only)) {
* @param {Object} m The module to compare with return null;
* @returns {Object} The react components }
*/ const { value, unit, beneficial } = m.getModifierFormatted(prop);
export function blueprintTooltip(translate, blueprint, engineers, grp, m) { if (!bpFeatures[prop] && !value) {
const effects = []; // Can happen for exported synthetics
if (!blueprint || !blueprint.features) { return null;
return undefined; }
} // If the product of value and min/max is positive, both values
for (const feature in blueprint.features) { // point into the same direction, i.e. positive/negative.
const featureIsBeneficial = isBeneficial(feature, blueprint.features[feature]); const minBeneficial = (value * min) > 0 === beneficial;
const featureDef = Modifications.modifications[feature]; const maxBeneficial = (value * max) > 0 === beneficial;
if (!featureDef.hidden) { return (<tr key={prop}>
let symbol = ''; <td style={{ textAlign: 'left' }}>{translate(prop)}</td>
if (feature === 'jitter') { <td className={!min ? '' : minBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
symbol = '°'; {!isNaN(min) && formats.round(min * 100)}{!isNaN(min) && unit}
} else if (featureDef.type === 'percentage') { </td>
symbol = '%'; <td className={!value ? '' : beneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
} {formats.round(value || 0)}{unit}
let lowerBound = blueprint.features[feature][0]; </td>
let upperBound = blueprint.features[feature][1]; <td className={!max ? '' : maxBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
if (featureDef.type === 'percentage') { {!isNaN(max) && formats.round(max * 100)}{!isNaN(max) && unit}
lowerBound = Math.round(lowerBound * 1000) / 10; </td>
upperBound = Math.round(upperBound * 1000) / 10; </tr>);
} })}
const lowerIsBeneficial = isValueBeneficial(feature, lowerBound); </tbody>
const upperIsBeneficial = isValueBeneficial(feature, upperBound); </table>
if (m) { </div>
// We have a module - add in the current value );
let current = m.getModValue(feature); }
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10; /**
} else if (featureDef.type === 'numeric') { * Get a blueprint with a given name and an optional module
current /= 100; * @param {string} name The name of the blueprint
} * @param {Object} module The module for which to obtain this blueprint
const currentIsBeneficial = isValueBeneficial(feature, current); * @returns {Object} The matching blueprint
effects.push( */
<tr key={feature}> export function getBlueprint(name, module) {
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td> // Start with a copy of the blueprint
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td> const findMod = val => Object.keys(Modifications.blueprints).find(elem => elem.toString().toLowerCase().search(val.toString().toLowerCase().replace(/(OutfittingFieldType_|persecond)/igm, '')) >= 0);
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td> const found = Modifications.blueprints[findMod(name)];
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td> if (!found || !found.fdname) {
</tr> return {};
); }
} else { const blueprint = JSON.parse(JSON.stringify(found));
// We do not have a module, no value return blueprint;
effects.push( }
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
</tr>
);
}
}
}
if (m) {
// Because we have a module add in any benefits that aren't part of the primary blueprint
for (const feature in m.mods) {
if (!blueprint.features[feature]) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
// We also add in any benefits from specials that aren't covered above
if (m.blueprint && m.blueprint.special) {
for (const feature in Modifications.modifierActions[m.blueprint.special.edname]) {
if (!blueprint.features[feature] && !m.mods.feature) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
}
}
let components;
if (!m) {
components = [];
for (const component in blueprint.components) {
components.push(
<tr key={component}>
<td style={{ textAlign: 'left' }}>{translate(component)}</td>
<td style={{ textAlign: 'right' }}>{blueprint.components[component]}</td>
</tr>
);
}
}
let engineersList;
if (engineers) {
engineersList = [];
for (const engineer of engineers) {
engineersList.push(
<tr key={engineer}>
<td style={{ textAlign: 'left' }}>{engineer}</td>
</tr>
);
}
}
return (
<div>
<table width='100%'>
<thead>
<tr>
<td>{translate('feature')}</td>
<td>{translate('worst')}</td>
{m ? <td>{translate('current')}</td> : null }
<td>{translate('best')}</td>
</tr>
</thead>
<tbody>
{effects}
</tbody>
</table>
{ components ? <table width='100%'>
<thead>
<tr>
<td>{translate('component')}</td>
<td>{translate('amount')}</td>
</tr>
</thead>
<tbody>
{components}
</tbody>
</table> : null }
{ engineersList ? <table width='100%'>
<thead>
<tr>
<td>{translate('engineers')}</td>
</tr>
</thead>
<tbody>
{engineersList}
</tbody>
</table> : null }
</div>
);
}
/**
* Is this blueprint feature beneficial?
* @param {string} feature The name of the feature
* @param {array} values The value of the feature
* @returns {boolean} True if this feature is beneficial
*/
export function isBeneficial(feature, values) {
const fact = (values[0] < 0 || (values[0] === 0 && values[1] < 0));
if (Modifications.modifications[feature].higherbetter) {
return !fact;
} else {
return fact;
}
}
/**
* Is this feature value beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature
* @returns {boolean} True if this value is beneficial
*/
export function isValueBeneficial(feature, value) {
if (Modifications.modifications[feature].higherbetter) {
return value > 0;
} else {
return value < 0;
}
}
/**
* Is the change as shown beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature as percentage change
* @returns True if the value is beneficial
*/
export function isChangeValueBeneficial(feature, value) {
let changeHigherBetter = STATS_FORMATTING[feature].higherbetter;
if (changeHigherBetter === undefined) {
return isValueBeneficial(feature, value);
}
if (changeHigherBetter) {
return value > 0;
} else {
return value < 0;
}
}
/**
* Get a blueprint with a given name and an optional module
* @param {string} name The name of the blueprint
* @param {Object} module The module for which to obtain this blueprint
* @returns {Object} The matching blueprint
*/
export function getBlueprint(name, module) {
// Special case for multi-cannons. Conflicting 'Weapon_Overcharged' Blueprints exist due to FD's naming conventions. If this blueprint is for a multi-cannon, we need to use the correct blueprint.
if (name === 'weapon_overcharged') {
if (module.symbol.match(/MultiCannon/i)) {
name = 'mc_overcharged';
}
}
else if (name === 'Weapon_Overcharged') {
if (module.symbol.match(/MultiCannon/i)) {
name = 'MC_Overcharged';
}
}
// Start with a copy of the blueprint
const findMod = val => Object.keys(Modifications.blueprints).find(elem => elem.toString().toLowerCase().search(val.toString().toLowerCase().replace(/(OutfittingFieldType_|persecond)/igm, '')) >= 0);
const found = Modifications.blueprints[findMod(name)];
if (!found || !found.fdname) {
console.error('Blueprint not found:', name);
return {};
}
const blueprint = JSON.parse(JSON.stringify(found));
return blueprint;
}
/**
* Provide 'percent' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
* @param {Number} percent The percent to set values to of full.
*/
export function setPercent(ship, m, percent) {
ship.clearModifications(m);
// Pick given value as multiplier
const mult = percent / 100;
setQualityCB(m.blueprint, mult, (featureName, value) => ship.setModification(m, featureName, value));
}
/**
* Sets the blueprint quality and fires a callback for each property affected.
* @param {Object} blueprint The ship for which to perform the modifications
* @param {Number} quality The quality to apply - float number 0 to 1.
* @param {Function} cb The Callback to run for each property. Function (featureName, value)
*/
export function setQualityCB(blueprint, quality, cb) {
// Pick given value as multiplier
const features = blueprint.grades[blueprint.grade].features;
for (const featureName in features) {
let value;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * quality);
} else {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * quality);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * quality);
} else {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * quality);
}
}
if (Modifications.modifications[featureName].type == 'percentage') {
value = value * 10000;
} else if (Modifications.modifications[featureName].type == 'numeric') {
value = value * 100;
}
cb(featureName, value);
}
}
/**
* Provide 'random' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
*/
export function setRandom(ship, m) {
// Pick a single value for our randomness
setPercent(ship, m, Math.random() * 100);
}
/**
* Provide 'percent' primary query
* @param {Object} m The module for which to perform the query
* @returns {Number} percent The percentage indicator of current applied values.
*/
export function getPercent(m) {
let result = null;
const features = m.blueprint.grades[m.blueprint.grade].features;
for (const featureName in features) {
if (features[featureName][0] === features[featureName][1]) {
continue;
}
let value = _getValue(m, featureName);
let mult;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
} else {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
} else {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
}
}
if (result && result != mult) {
return null;
} else if (result != mult) {
result = mult;
}
}
return result;
}
/**
* Query a feature value
* @param {Object} m The module for which to perform the query
* @param {string} featureName The feature being queried
* @returns {number} The value of the modification as a %
*/
function _getValue(m, featureName) {
if (Modifications.modifications[featureName].type == 'percentage') {
return m.getModValue(featureName, true) / 10000;
} else if (Modifications.modifications[featureName].type == 'numeric') {
return m.getModValue(featureName, true) / 100;
} else {
return m.getModValue(featureName, true);
}
}

View File

@@ -14,8 +14,6 @@ export const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
'BelugaLiner': 'beluga', 'BelugaLiner': 'beluga',
'CobraMkIII': 'cobra_mk_iii', 'CobraMkIII': 'cobra_mk_iii',
'CobraMkIV': 'cobra_mk_iv', 'CobraMkIV': 'cobra_mk_iv',
'CobraMkV': 'cobramkv',
'Corsair': 'imperial_corsair',
'Cutter': 'imperial_cutter', 'Cutter': 'imperial_cutter',
'DiamondBackXL': 'diamondback_explorer', 'DiamondBackXL': 'diamondback_explorer',
'DiamondBack': 'diamondback', 'DiamondBack': 'diamondback',
@@ -33,15 +31,12 @@ export const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
'Independant_Trader': 'keelback', 'Independant_Trader': 'keelback',
'Krait_MkII': 'krait_mkii', 'Krait_MkII': 'krait_mkii',
'Mamba': 'mamba', 'Mamba': 'mamba',
'Mandalay': 'mandalay',
'Krait_Light': 'krait_phantom', 'Krait_Light': 'krait_phantom',
'Orca': 'orca', 'Orca': 'orca',
'Python': 'python', 'Python': 'python',
'Python_nx': 'python_nx',
'SideWinder': 'sidewinder', 'SideWinder': 'sidewinder',
'Type6': 'type_6_transporter', 'Type6': 'type_6_transporter',
'Type7': 'type_7_transport', 'Type7': 'type_7_transport',
'Type8': 'type_8_transport',
'Type9': 'type_9_heavy', 'Type9': 'type_9_heavy',
'Type9_Military': 'type_10_defender', 'Type9_Military': 'type_10_defender',
'TypeX': 'alliance_chieftain', 'TypeX': 'alliance_chieftain',

View File

@@ -1,396 +1,303 @@
import Ship from '../shipyard/Ship'; import Ship from '../shipyard/Ship';
import { HARDPOINT_NUM_TO_CLASS, shipModelFromJson } from './CompanionApiUtils'; import { HARDPOINT_NUM_TO_CLASS, shipModelFromJson } from './CompanionApiUtils';
import { Ships } from 'coriolis-data/dist'; import { Ships } from 'coriolis-data/dist';
import Module from '../shipyard/Module'; import Module from '../shipyard/Module';
import { Modules } from 'coriolis-data/dist'; import { Modules } from 'coriolis-data/dist';
import { Modifications } from 'coriolis-data/dist'; import { Modifications } from 'coriolis-data/dist';
import { getBlueprint, setQualityCB } from './BlueprintFunctions'; import { getBlueprint } from './BlueprintFunctions';
/** /**
* Check if an imported module is valid * Obtain a module given its FD Name
* @param {Object} module the module to check * @param {string} fdname the FD Name of the module
* @param {Object} moduleType the type of module to check * @return {Module} the module
* @return {boolean} true if the module is valid */
*/ function _moduleFromFdName(fdname) {
function _isValidImportedModule(module, moduleType) { if (!fdname) return null;
// First of all, has the _moduleFromFdName function returned 'null'? fdname = fdname.toLowerCase();
if (!module){ // Check standard modules
return false for (const grp in Modules.standard) {
} if (Modules.standard.hasOwnProperty(grp)) {
else { for (const i in Modules.standard[grp]) {
return true if (Modules.standard[grp][i].symbol && Modules.standard[grp][i].symbol.toLowerCase() === fdname) {
} // Found it
} return new Module({ template: Modules.standard[grp][i] });
}
/** }
* Obtain a module given its FD Name }
* @param {string} fdname the FD Name of the module }
* @return {Module} the module
*/ // Check hardpoint modules
function _moduleFromFdName(fdname) { for (const grp in Modules.hardpoints) {
if (!fdname) return null; if (Modules.hardpoints.hasOwnProperty(grp)) {
fdname = fdname.toLowerCase(); for (const i in Modules.hardpoints[grp]) {
// Check standard modules if (Modules.hardpoints[grp][i].symbol && Modules.hardpoints[grp][i].symbol.toLowerCase() === fdname) {
for (const grp in Modules.standard) { // Found it
if (Modules.standard.hasOwnProperty(grp)) { return new Module({ template: Modules.hardpoints[grp][i] });
for (const i in Modules.standard[grp]) { }
if (Modules.standard[grp][i].symbol && Modules.standard[grp][i].symbol.toLowerCase() === fdname) { }
// Found it }
return new Module({ template: Modules.standard[grp][i] }); }
}
} // Check internal modules
} for (const grp in Modules.internal) {
} if (Modules.internal.hasOwnProperty(grp)) {
for (const i in Modules.internal[grp]) {
// Check hardpoint modules if (Modules.internal[grp][i].symbol && Modules.internal[grp][i].symbol.toLowerCase() === fdname) {
for (const grp in Modules.hardpoints) { // Found it
if (Modules.hardpoints.hasOwnProperty(grp)) { return new Module({ template: Modules.internal[grp][i] });
for (const i in Modules.hardpoints[grp]) { }
if (Modules.hardpoints[grp][i].symbol && Modules.hardpoints[grp][i].symbol.toLowerCase() === fdname) { }
// Found it }
return new Module({ template: Modules.hardpoints[grp][i] }); }
}
} // Not found
} return null;
} }
// Check internal modules /**
for (const grp in Modules.internal) { * Build a ship from the journal Loadout event JSON
if (Modules.internal.hasOwnProperty(grp)) { * @param {object} json the Loadout event JSON
for (const i in Modules.internal[grp]) { * @return {Ship} the built ship
if (Modules.internal[grp][i].symbol && Modules.internal[grp][i].symbol.toLowerCase() === fdname) { */
// Found it export function shipFromLoadoutJSON(json) {
return new Module({ template: Modules.internal[grp][i] }); // Start off building a basic ship
} const shipModel = shipModelFromJson(json);
} if (!shipModel) {
} throw 'No such ship found: "' + json.Ship + '"';
} }
const shipTemplate = Ships[shipModel];
// Not found
return null; let ship = new Ship(shipModel, shipTemplate.properties, shipTemplate.slots);
} ship.buildWith(null);
// Initial Ship building, don't do engineering yet.
/** let modsToAdd = [];
* Build a ship from the journal Loadout event JSON
* @param {object} json the Loadout event JSON for (const module of json.Modules) {
* @return {Ship} the built ship switch (module.Slot.toLowerCase()) {
*/ // Cargo Hatch.
export function shipFromLoadoutJSON(json) { case 'cargohatch':
// Start off building a basic ship ship.cargoHatch.enabled = module.On;
const shipModel = shipModelFromJson(json); ship.cargoHatch.priority = module.Priority;
if (!shipModel) { break;
throw 'No such ship found: "' + json.Ship + '"'; // Add the bulkheads
} case 'armour':
const shipTemplate = Ships[shipModel]; if (module.Item.toLowerCase().endsWith('_armour_grade1')) {
ship.useBulkhead(0, true);
let ship = new Ship(shipModel, shipTemplate.properties, shipTemplate.slots); } else if (module.Item.toLowerCase().endsWith('_armour_grade2')) {
ship.buildWith(null); ship.useBulkhead(1, true);
// Initial Ship building, don't do engineering yet. } else if (module.Item.toLowerCase().endsWith('_armour_grade3')) {
let modsToAdd = []; ship.useBulkhead(2, true);
} else if (module.Item.toLowerCase().endsWith('_armour_mirrored')) {
for (const module of json.Modules) { ship.useBulkhead(3, true);
switch (module.Slot.toLowerCase()) { } else if (module.Item.toLowerCase().endsWith('_armour_reactive')) {
// Cargo Hatch. ship.useBulkhead(4, true);
case 'cargohatch': } else {
ship.cargoHatch.enabled = module.On; throw 'Unknown bulkheads "' + module.Item + '"';
ship.cargoHatch.priority = module.Priority; }
break; ship.bulkheads.enabled = true;
// Add the bulkheads if (module.Engineering) _addModifications(ship.bulkheads.m, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
case 'armour': break;
if (module.Item.toLowerCase().endsWith('_armour_grade1')) { case 'powerplant':
ship.useBulkhead(0, true); const powerplant = _moduleFromFdName(module.Item);
} else if (module.Item.toLowerCase().endsWith('_armour_grade2')) { ship.use(ship.standard[0], powerplant, true);
ship.useBulkhead(1, true); ship.standard[0].enabled = module.On;
} else if (module.Item.toLowerCase().endsWith('_armour_grade3')) { ship.standard[0].priority = module.Priority;
ship.useBulkhead(2, true); if (module.Engineering) _addModifications(powerplant, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
} else if (module.Item.toLowerCase().endsWith('_armour_mirrored')) { break;
ship.useBulkhead(3, true); case 'mainengines':
} else if (module.Item.toLowerCase().endsWith('_armour_reactive')) { const thrusters = _moduleFromFdName(module.Item);
ship.useBulkhead(4, true); ship.use(ship.standard[1], thrusters, true);
} else { ship.standard[1].enabled = module.On;
throw 'Unknown bulkheads "' + module.Item + '"'; ship.standard[1].priority = module.Priority;
} if (module.Engineering) _addModifications(thrusters, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
ship.bulkheads.enabled = true; break;
if (module.Engineering) _addModifications(ship.bulkheads.m, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); case 'frameshiftdrive':
break; const frameshiftdrive = _moduleFromFdName(module.Item);
case 'powerplant': ship.use(ship.standard[2], frameshiftdrive, true);
let powerplant = _moduleFromFdName(module.Item); ship.standard[2].enabled = module.On;
// Check the powerplant returned is valid ship.standard[2].priority = module.Priority;
if (!_isValidImportedModule(powerplant, 'powerplant')) if (module.Engineering) _addModifications(frameshiftdrive, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
{ break;
powerplant = _moduleFromFdName('Int_Missing_Powerplant'); case 'lifesupport':
module.Engineering = null; const lifesupport = _moduleFromFdName(module.Item);
} ship.use(ship.standard[3], lifesupport, true);
ship.use(ship.standard[0], powerplant, true); ship.standard[3].enabled = module.On === true;
ship.standard[0].enabled = module.On; ship.standard[3].priority = module.Priority;
ship.standard[0].priority = module.Priority; if (module.Engineering) _addModifications(lifesupport, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
if (module.Engineering) _addModifications(powerplant, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); break;
break; case 'powerdistributor':
case 'mainengines': const powerdistributor = _moduleFromFdName(module.Item);
let thrusters = _moduleFromFdName(module.Item); ship.use(ship.standard[4], powerdistributor, true);
// Check the thrusters returned is valid ship.standard[4].enabled = module.On;
if (!_isValidImportedModule(thrusters, 'thrusters')) ship.standard[4].priority = module.Priority;
{ if (module.Engineering) _addModifications(powerdistributor, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
thrusters = _moduleFromFdName('Int_Missing_Engine'); break;
module.Engineering = null; case 'radar':
} const sensors = _moduleFromFdName(module.Item);
ship.use(ship.standard[1], thrusters, true); ship.use(ship.standard[5], sensors, true);
ship.standard[1].enabled = module.On; ship.standard[5].enabled = module.On;
ship.standard[1].priority = module.Priority; ship.standard[5].priority = module.Priority;
if (module.Engineering) _addModifications(thrusters, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); if (module.Engineering) _addModifications(sensors, module.Engineering.Modifiers, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
break; break;
case 'frameshiftdrive': case 'fueltank':
let frameshiftdrive = _moduleFromFdName(module.Item); const fueltank = _moduleFromFdName(module.Item);
// Check the frameshiftdrive returned is valid ship.use(ship.standard[6], fueltank, true);
if (!_isValidImportedModule(frameshiftdrive, 'frameshiftdrive')) ship.standard[6].enabled = true;
{ ship.standard[6].priority = 0;
frameshiftdrive = _moduleFromFdName('Int_Missing_Hyperdrive'); break;
module.Engineering = null; default:
} }
ship.use(ship.standard[2], frameshiftdrive, true); if (module.Slot.toLowerCase().search(/hardpoint/) !== -1) {
ship.standard[2].enabled = module.On; // Add hardpoints
ship.standard[2].priority = module.Priority; let hardpoint;
if (module.Engineering) _addModifications(frameshiftdrive, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); let hardpointClassNum = -1;
break; let hardpointSlotNum = -1;
case 'lifesupport': let hardpointArrayNum = 0;
let lifesupport = _moduleFromFdName(module.Item); for (let i in shipTemplate.slots.hardpoints) {
// Check the lifesupport returned is valid if (shipTemplate.slots.hardpoints[i] === hardpointClassNum) {
if (!_isValidImportedModule(lifesupport, 'lifesupport')) // Another slot of the same class
{ hardpointSlotNum++;
lifesupport = _moduleFromFdName('Int_Missing_LifeSupport'); } else {
module.Engineering = null; // The first slot of a new class
} hardpointClassNum = shipTemplate.slots.hardpoints[i];
ship.use(ship.standard[3], lifesupport, true); hardpointSlotNum = 1;
ship.standard[3].enabled = module.On === true; }
ship.standard[3].priority = module.Priority;
if (module.Engineering) _addModifications(lifesupport, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); // Now that we know what we're looking for, find it
break; const hardpointName = HARDPOINT_NUM_TO_CLASS[hardpointClassNum] + 'Hardpoint' + hardpointSlotNum;
case 'powerdistributor': const hardpointSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === hardpointName.toLowerCase());
let powerdistributor = _moduleFromFdName(module.Item); if (!hardpointSlot) {
// Check the powerdistributor returned is valid // This can happen with old imports that don't contain new hardpoints
if (!_isValidImportedModule(powerdistributor, 'powerdistributor')) } else if (!hardpointSlot) {
{ // No module
powerdistributor = _moduleFromFdName('Int_Missing_PowerDistributor'); } else {
module.Engineering = null; hardpoint = _moduleFromFdName(hardpointSlot.Item);
} ship.use(ship.hardpoints[hardpointArrayNum], hardpoint, true);
ship.use(ship.standard[4], powerdistributor, true); ship.hardpoints[hardpointArrayNum].enabled = hardpointSlot.On;
ship.standard[4].enabled = module.On; ship.hardpoints[hardpointArrayNum].priority = hardpointSlot.Priority;
ship.standard[4].priority = module.Priority; modsToAdd.push({ coriolisMod: hardpoint, json: hardpointSlot });
if (module.Engineering) _addModifications(powerdistributor, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect); }
break; hardpointArrayNum++;
case 'radar': }
let sensors = _moduleFromFdName(module.Item); }
// Check the sensors returned is valid }
if (!_isValidImportedModule(sensors, 'sensors'))
{ let internalSlotNum = 0;
sensors = _moduleFromFdName('Int_Missing_Sensors'); let militarySlotNum = 1;
module.Engineering = null; for (let i in shipTemplate.slots.internal) {
} if (!shipTemplate.slots.internal.hasOwnProperty(i)) {
ship.use(ship.standard[5], sensors, true); continue;
ship.standard[5].enabled = module.On; }
ship.standard[5].priority = module.Priority; const isMilitary = isNaN(shipTemplate.slots.internal[i]) ? shipTemplate.slots.internal[i].name == 'Military' : false;
if (module.Engineering) _addModifications(sensors, module.Engineering.Modifiers, module.Engineering.Quality, module.Engineering.BlueprintName, module.Engineering.Level, module.Engineering.ExperimentalEffect);
break; // The internal slot might be a standard or a military slot. Military slots have a different naming system
case 'fueltank': let internalSlot = null;
let fueltank = _moduleFromFdName(module.Item); if (isMilitary) {
// Check the fueltank returned is valid const internalName = 'Military0' + militarySlotNum;
if (!_isValidImportedModule(fueltank, 'fueltank')) internalSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase());
{ militarySlotNum++;
fueltank = _moduleFromFdName('Int_Missing_FuelTank'); } else {
} // Slot numbers are not contiguous so handle skips.
ship.use(ship.standard[6], fueltank, true); for (; internalSlot === null && internalSlotNum < 99; internalSlotNum++) {
ship.standard[6].enabled = true; // Slot sizes have no relationship to the actual size, either, so check all possibilities
ship.standard[6].priority = 0; for (let slotsize = 0; slotsize < 9; slotsize++) {
break; const internalName = 'Slot' + (internalSlotNum <= 9 ? '0' : '') + internalSlotNum + '_Size' + slotsize;
default: if (json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase())) {
} internalSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase());
if (module.Slot.toLowerCase().search(/hardpoint/) !== -1) { break;
// Add hardpoints }
let hardpoint; }
let hardpointClassNum = -1; }
let hardpointSlotNum = -1; }
let hardpointArrayNum = 0;
for (let i in shipTemplate.slots.hardpoints) { if (!internalSlot) {
if (shipTemplate.slots.hardpoints[i] === hardpointClassNum) { // This can happen with old imports that don't contain new slots
// Another slot of the same class } else {
hardpointSlotNum++; const internalJson = internalSlot;
} else { const internal = _moduleFromFdName(internalJson.Item);
// The first slot of a new class ship.use(ship.internal[i], internal, true);
hardpointClassNum = shipTemplate.slots.hardpoints[i]; ship.internal[i].enabled = internalJson.On === true;
hardpointSlotNum = 1; ship.internal[i].priority = internalJson.Priority;
} modsToAdd.push({ coriolisMod: internal, json: internalSlot });
}
// Now that we know what we're looking for, find it }
const hardpointName = HARDPOINT_NUM_TO_CLASS[hardpointClassNum] + 'Hardpoint' + hardpointSlotNum;
const hardpointSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === hardpointName.toLowerCase()); for (const i of modsToAdd) {
if (!hardpointSlot) { if (i.json.Engineering) {
// This can happen with old imports that don't contain new hardpoints _addModifications(i.coriolisMod, i.json.Engineering.Modifiers, i.json.Engineering.BlueprintName, i.json.Engineering.Level, i.json.Engineering.ExperimentalEffect);
} else { }
hardpoint = _moduleFromFdName(hardpointSlot.Item); }
// Check the hardpoint module returned is valid // We don't have any information on it so guess it's priority 5 and disabled
if (!_isValidImportedModule(hardpoint, 'hardpoint')){ if (!ship.cargoHatch) {
// Check if it's a Utility or Hardpoint ship.cargoHatch.enabled = false;
if (hardpointSlot.Slot.toLowerCase().search(/tiny/)) ship.cargoHatch.priority = 4;
{ }
// Use the missing_hardpoint module 'Missing Hardpoint' which will inform the user that the module is missing
hardpoint = _moduleFromFdName('Hpt_Missing_Hardpoint'); // Now update the ship's codes before returning it
} return ship.updatePowerPrioritesString().updatePowerEnabledString().updateModificationsString();
else { }
// Use the missing_hardpoint module 'Missing Utility' which will inform the user that the module is missing
hardpoint = _moduleFromFdName('Hpt_Missing_Utility'); /**
} * Add the modifications for a module
ship.use(ship.hardpoints[hardpointArrayNum], hardpoint, true); * @param {Module} module the module
ship.hardpoints[hardpointArrayNum].enabled = hardpointSlot.On; * @param {Object} modifiers the modifiers
ship.hardpoints[hardpointArrayNum].priority = hardpointSlot.Priority; * @param {Object} blueprint the blueprint of the modification
} else { * @param {Object} grade the grade of the modification
ship.use(ship.hardpoints[hardpointArrayNum], hardpoint, true); * @param {Object} specialModifications special modification
ship.hardpoints[hardpointArrayNum].enabled = hardpointSlot.On; */
ship.hardpoints[hardpointArrayNum].priority = hardpointSlot.Priority; function _addModifications(module, modifiers, blueprint, grade, specialModifications) {
modsToAdd.push({ coriolisMod: hardpoint, json: hardpointSlot }); if (!modifiers) return;
} let special;
} if (specialModifications) {
hardpointArrayNum++; if (specialModifications == 'special_plasma_slug') {
} if (module.symbol.match(/PlasmaAccelerator/i)) {
} specialModifications = 'special_plasma_slug_pa';
} } else {
specialModifications = 'special_plasma_slug_cooled';
let internalSlotNum = 0; }
let militarySlotNum = 1; }
for (let i in shipTemplate.slots.internal) { special = Modifications.specials[specialModifications];
if (!shipTemplate.slots.internal.hasOwnProperty(i)) { }
continue; // Add the blueprint definition, grade and special
} if (blueprint) {
const isMilitary = isNaN(shipTemplate.slots.internal[i]) ? shipTemplate.slots.internal[i].name == 'Military' : false; module.blueprint = getBlueprint(blueprint, module);
const isPlanetary = isNaN(shipTemplate.slots.internal[i]) ? shipTemplate.slots.internal[i].name == 'PlanetaryApproachSuite' : false; if (grade) {
module.blueprint.grade = Number(grade);
// The internal slot might be a standard or a military slot, or a planetary slot. Military and Planetary slots have a different naming system }
let internalSlot = null; if (special) {
if (isMilitary) { module.blueprint.special = special;
const internalName = 'Military0' + militarySlotNum; }
internalSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase()); }
militarySlotNum++; for (const i in modifiers) {
} else if (isPlanetary) { // Some special modifications
const internalName = 'PlanetaryApproachSuite'; // Look up the modifiers to find what we need to do
internalSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase()); const findMod = val => Object.keys(Modifications.modifierActions).find(elem => elem.toString().toLowerCase().replace(/(outfittingfieldtype_|persecond)/igm, '') === val.toString().toLowerCase().replace(/(outfittingfieldtype_|persecond)/igm, ''));
} else { const modifierActions = Modifications.modifierActions[findMod(modifiers[i].Label)];
// Slot numbers are not contiguous so handle skips. // TODO: Figure out how to scale this value.
for (; internalSlot === null && internalSlotNum < 99; internalSlotNum++) { if (!!modifiers[i].LessIsGood) {
// Slot sizes have no relationship to the actual size, either, so check all possibilities
for (let slotsize = 0; slotsize < 9; slotsize++) { }
const internalName = 'Slot' + (internalSlotNum <= 9 ? '0' : '') + internalSlotNum + '_Size' + slotsize; let value = (modifiers[i].Value / modifiers[i].OriginalValue * 100 - 100) * 100;
if (json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase())) { if (value === Infinity) {
internalSlot = json.Modules.find(elem => elem.Slot.toLowerCase() === internalName.toLowerCase()); value = modifiers[i].Value * 100;
break; }
} if (modifiers[i].Label.search('DamageFalloffRange') >= 0) {
} value = (modifiers[i].Value / module.range - 1) * 100;
} }
} if (modifiers[i].Label.search('Resistance') >= 0) {
value = (modifiers[i].Value * 100) - (modifiers[i].OriginalValue * 100);
if (!internalSlot) { }
// This can happen with old imports that don't contain new slots if (modifiers[i].Label.search('ShieldMultiplier') >= 0 || modifiers[i].Label.search('DefenceModifierHealthMultiplier') >= 0) {
} else { value = ((100 + modifiers[i].Value) / (100 + modifiers[i].OriginalValue) * 100 - 100) * 100;
const internalJson = internalSlot; }
let internal = _moduleFromFdName(internalJson.Item);
// Check the internal module returned is valid // Carry out the required changes
if (!_isValidImportedModule(internal, 'internal')) for (const action in modifierActions) {
{ if (isNaN(modifierActions[action])) {
internal = _moduleFromFdName('Int_Missing_Module'); module.setModValue(action, modifierActions[action]);
ship.use(ship.internal[i], internal, true); } else {
ship.internal[i].enabled = internalJson.On === true; module.setModValue(action, value, true);
ship.internal[i].priority = internalJson.Priority; }
//throw 'Unknown internal module: "' + module.Item + '"'; }
} }
else { }
ship.use(ship.internal[i], internal, true);
ship.internal[i].enabled = internalJson.On === true;
ship.internal[i].priority = internalJson.Priority;
modsToAdd.push({ coriolisMod: internal, json: internalSlot });
}
}
}
for (const i of modsToAdd) {
if (i.json.Engineering) {
_addModifications(i.coriolisMod, i.json.Engineering.Modifiers, i.json.Engineering.Quality, i.json.Engineering.BlueprintName, i.json.Engineering.Level, i.json.Engineering.ExperimentalEffect);
}
}
// We don't have any information on it so guess it's priority 5 and disabled
if (!ship.cargoHatch) {
ship.cargoHatch.enabled = false;
ship.cargoHatch.priority = 4;
}
// Now update the ship's codes before returning it
return ship.updatePowerPrioritesString().updatePowerEnabledString().updateModificationsString();
}
/**
* Add the modifications for a module
* @param {Module} module the module
* @param {Object} modifiers the modifiers
* @param {float} quality quality of the modifiers 0 to 1
* @param {Object} blueprint the blueprint of the modification
* @param {Object} grade the grade of the modification
* @param {Object} specialModifications special modification
*/
function _addModifications(module, modifiers, quality, blueprint, grade, specialModifications) {
if (!modifiers && !quality) return;
let special;
if (specialModifications) {
if (specialModifications == 'special_plasma_slug') {
if (module.symbol.match(/PlasmaAccelerator/i)) {
specialModifications = 'special_plasma_slug_pa';
} else {
specialModifications = 'special_plasma_slug_cooled';
}
}
special = Modifications.specials[specialModifications];
}
// Add the blueprint definition, grade and special
if (blueprint) {
module.blueprint = getBlueprint(blueprint, module);
if (grade) {
module.blueprint.grade = Number(grade);
}
if (special) {
module.blueprint.special = special;
}
}
if (modifiers) {
for (const i in modifiers) {
// Some special modifications
// Look up the modifiers to find what we need to do
const findMod = val => Object.keys(Modifications.modifierActions).find(elem => elem.toString().toLowerCase().replace(/(outfittingfieldtype_|persecond)/igm, '') === val.toString().toLowerCase().replace(/(outfittingfieldtype_|persecond)/igm, ''));
const modifierActions = Modifications.modifierActions[findMod(modifiers[i].Label)];
// TODO: Figure out how to scale this value.
if (!!modifiers[i].LessIsGood) {
}
let value = (modifiers[i].Value / modifiers[i].OriginalValue * 100 - 100) * 100;
if (value === Infinity) {
value = modifiers[i].Value * 100;
}
if (modifiers[i].Label.search('DamageFalloffRange') >= 0) {
value = (modifiers[i].Value / module.range - 1) * 100;
}
if (modifiers[i].Label.search('Resistance') >= 0) {
value = (modifiers[i].Value * 100) - (modifiers[i].OriginalValue * 100);
}
if (modifiers[i].Label.search('ShieldMultiplier') >= 0 || modifiers[i].Label.search('DefenceModifierHealthMultiplier') >= 0) {
value = ((100 + modifiers[i].Value) / (100 + modifiers[i].OriginalValue) * 100 - 100) * 100;
}
// Carry out the required changes
for (const action in modifierActions) {
if (isNaN(modifierActions[action])) {
module.setModValue(action, modifierActions[action]);
} else {
module.setModValue(action, value, true);
}
}
}
} else if (quality) {
setQualityCB(module.blueprint, quality, (featureName, value) => module.setModValue(featureName, value, false));
}
}

View File

@@ -105,7 +105,7 @@ function orbisShorten(url, success, error) {
} }
} }
const API_ORBIS = 'https://api.orbis.zone/ships'; const API_ORBIS = 'https://orbis.zone/api/builds/add';
/** /**
* Upload to Orbis * Upload to Orbis
* @param {object} ship The URL to shorten * @param {object} ship The URL to shorten

View File

@@ -1,3 +1,4 @@
import { Module } from 'ed-forge';
/** /**
* Wraps the callback/context menu handler such that the default * Wraps the callback/context menu handler such that the default
@@ -83,3 +84,18 @@ export function isEmpty(obj) {
} }
return true; return true;
}; };
/**
* Fetches a property from either a Module or a moduleInfo object
* @param {Object} m Either a Module or a moduleInfo object
* @param {string} property Property name
* @returns {number} Property value
*/
export function moduleGet(m, property) {
if (m instanceof Module) {
return m.get(property);
} else {
// Assume its a moduleInfo object
return m.props[property];
}
}

View File

@@ -2,14 +2,19 @@
<html> <html>
<head> <head>
<title>Coriolis EDCD Edition</title> <title>Coriolis EDCD Edition</title>
<script async src="https://pagead2.googlesyndication.com/pagead/js/adsbygoogle.js"></script>
<script>
(adsbygoogle = window.adsbygoogle || []).push({
google_ad_client: "ca-pub-3709458261881414",
enable_page_level_ads: true
});
</script>
<meta charset="UTF-8"> <meta charset="UTF-8">
<link rel="stylesheet" href="<%= htmlWebpackPlugin.files.css[0] %>"> <link rel="stylesheet" href="<%= htmlWebpackPlugin.files.css[0] %>">
<!-- Standard headers --> <!-- Standard headers -->
<meta name="description" content="A ship builder, outfitting and comparison <meta name="description" content="A ship builder, outfitting and comparison
tool for Elite Dangerous"> tool for Elite Dangerous">
<meta name="mobile-web-app-capable" content="yes"> <meta name="mobile-web-app-capable" content="yes">
<meta name="viewport" content="width=device-width, initial-scale=1.0, <meta name="viewport" content="width=device-width, initial-scale=1.0,
maximum-scale=1.0, user-scalable=0"> maximum-scale=1.0, user-scalable=0">
<link rel="manifest" href="/manifest.json"> <link rel="manifest" href="/manifest.json">
@@ -27,7 +32,7 @@
<meta name="msapplication-TileImage" content="/mstile-144x144.png"> <meta name="msapplication-TileImage" content="/mstile-144x144.png">
<meta name="msapplication-config" content="/browserconfig.xml"> <meta name="msapplication-config" content="/browserconfig.xml">
<meta name="theme-color" content="#000000"> <meta name="theme-color" content="#000000">
<!-- <script data-ad-client="ca-pub-3709458261881414" async src="https://pagead2.googlesyndication.com/pagead/js/adsbygoogle.js"></script> -->
<script> <script>
window.CORIOLIS_GAPI_KEY = '<%- htmlWebpackPlugin.options.gapiKey %>'; window.CORIOLIS_GAPI_KEY = '<%- htmlWebpackPlugin.options.gapiKey %>';
window.CORIOLIS_VERSION = '<%- htmlWebpackPlugin.options.version %>'; window.CORIOLIS_VERSION = '<%- htmlWebpackPlugin.options.version %>';
@@ -40,12 +45,21 @@
window.dataLayer = window.dataLayer || []; window.dataLayer = window.dataLayer || [];
function gtag(){dataLayer.push(arguments);} function gtag(){dataLayer.push(arguments);}
gtag('js', new Date()); gtag('js', new Date());
gtag('config', 'UA-55840909-18'); gtag('config', 'UA-55840909-18');
</script> </script>
</head>
<body style="background-color:#000;">
<section id="coriolis">
</section>
</body>
</html> <!-- Bugsnag -->
<script src="https://d2wy8f7a9ursnm.cloudfront.net/v5.0.0/bugsnag.min.js"></script>
<script>
window.bugsnagClient = bugsnag('ba9fae819372850fb660755341fa6ef5', {appVersion: window.BUGSNAG_VERSION || undefined})
window.Bugsnag = window.bugsnagClient
</script>
</head>
<body style="background-color:#000;">
<section id="coriolis"></section>
</body>
</html>

Some files were not shown because too many files have changed in this diff Show More