mirror of
https://github.com/EDCD/coriolis.git
synced 2025-12-11 00:33:03 +00:00
Compare commits
82 Commits
070beade85
...
ed-forge
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
25c30e46a6 | ||
|
|
870c033c64 | ||
|
|
46b0200b28 | ||
|
|
e8bcb18f12 | ||
|
|
68ca24ef96 | ||
|
|
7ca2754934 | ||
|
|
e82ab0aec0 | ||
|
|
d406018f0b | ||
|
|
2438aa1f48 | ||
|
|
c5bbeacc6a | ||
|
|
d9763f2db7 | ||
|
|
5692cc6fe3 | ||
|
|
22cdfcdecf | ||
|
|
3db3b09c22 | ||
|
|
23c264e321 | ||
|
|
d2c3787165 | ||
|
|
1e18d6e463 | ||
|
|
044fea2d33 | ||
|
|
bc865f534b | ||
|
|
796694a4e0 | ||
|
|
829815a40b | ||
|
|
7a2c849ece | ||
|
|
2eed1bc85b | ||
|
|
3469af10b6 | ||
|
|
629ba35bc5 | ||
|
|
e453ff73b7 | ||
|
|
c73ce1c234 | ||
|
|
00d3a93b91 | ||
|
|
d4e612cb61 | ||
|
|
c07cfc6e70 | ||
|
|
c4c6d32a5d | ||
|
|
a65bb06754 | ||
|
|
23548e7c5c | ||
|
|
74e6f54e19 | ||
|
|
a46f8f97f6 | ||
|
|
44dbdb1703 | ||
|
|
187c5dae4a | ||
|
|
07d324a3fa | ||
|
|
5c63afd96c | ||
|
|
53c40ac9c4 | ||
|
|
a180cbfdd4 | ||
|
|
fc1524a943 | ||
|
|
c3747e4e5e | ||
|
|
ab153981c9 | ||
|
|
a970e052c1 | ||
|
|
df7e264a02 | ||
|
|
cdcda004f3 | ||
|
|
20e448fc0a | ||
|
|
436e626c42 | ||
|
|
3dd4675a0b | ||
|
|
d3766d9e17 | ||
|
|
d987c08ac8 | ||
|
|
f865ef6c6c | ||
|
|
f2b7daac82 | ||
|
|
832bc488b6 | ||
|
|
f513166d6c | ||
|
|
61fd0eb991 | ||
|
|
1e51e7d4a6 | ||
|
|
4943d36bb8 | ||
|
|
9271d1fa09 | ||
|
|
8a09d94dfa | ||
|
|
c44925dd62 | ||
|
|
d006bbcb0f | ||
|
|
14453f6b80 | ||
|
|
8c267150a9 | ||
|
|
ed60a78be0 | ||
|
|
82142b0cb1 | ||
|
|
d8949fedb2 | ||
|
|
cf72bd11a8 | ||
|
|
16ef7ea389 | ||
|
|
ff455e349e | ||
|
|
ba9e7f1a32 | ||
|
|
904498b20c | ||
|
|
409be7374c | ||
|
|
00c525e6ab | ||
|
|
a2f52c03a1 | ||
|
|
037df6b166 | ||
|
|
90ab5b4b0a | ||
|
|
7bbfa8c43f | ||
|
|
2fbcd158cc | ||
|
|
33c201800e | ||
|
|
9797a8d781 |
6
.babelrc
6
.babelrc
@@ -7,8 +7,6 @@
|
||||
"@babel/plugin-syntax-dynamic-import",
|
||||
"@babel/plugin-syntax-import-meta",
|
||||
["@babel/plugin-proposal-class-properties", { "loose": true }],
|
||||
"@babel/plugin-proposal-do-expressions",
|
||||
"@babel/plugin-proposal-function-bind",
|
||||
"@babel/plugin-proposal-json-strings",
|
||||
[
|
||||
"@babel/plugin-proposal-decorators",
|
||||
@@ -30,7 +28,7 @@
|
||||
}
|
||||
],
|
||||
"@babel/plugin-proposal-nullish-coalescing-operator",
|
||||
["@babel/plugin-proposal-private-methods", { "loose": true }],
|
||||
["@babel/plugin-proposal-private-property-in-object", { "loose": true }]
|
||||
"@babel/plugin-proposal-do-expressions",
|
||||
"@babel/plugin-proposal-function-bind"
|
||||
]
|
||||
}
|
||||
|
||||
@@ -1,7 +0,0 @@
|
||||
Dockerfile
|
||||
.dockerignore
|
||||
.gitignore
|
||||
README.md
|
||||
|
||||
build
|
||||
node_modules
|
||||
14
.gitattributes
vendored
14
.gitattributes
vendored
@@ -1,14 +0,0 @@
|
||||
# Set the default behavior, in case people don't have core.autocrlf set, in order to prevent line ending inconsistency.
|
||||
* text=auto
|
||||
|
||||
# Explicitly declare text files you want to always be normalized and converted
|
||||
# to native line endings on checkout.
|
||||
*.jsx text
|
||||
*.js text
|
||||
|
||||
# Declare files that will always have CRLF line endings on checkout.
|
||||
# *.sln text eol=crlf
|
||||
|
||||
# Denote all files that are truly binary and should not be modified.
|
||||
*.png binary
|
||||
*.jpg binary
|
||||
25
Dockerfile
25
Dockerfile
@@ -1,25 +0,0 @@
|
||||
#syntax=docker/dockerfile:1.4
|
||||
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
|
||||
# docker buildx build --build-context data=../coriolis-data --tag coriolis .
|
||||
|
||||
FROM node:18-alpine
|
||||
|
||||
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source.
|
||||
WORKDIR /app
|
||||
ADD . .
|
||||
COPY --from=data . /coriolis-data/
|
||||
|
||||
# Git is required before install if any modules (like coriolis-data) are loaded from github
|
||||
RUN apk update
|
||||
RUN apk add git
|
||||
|
||||
WORKDIR /app/coriolis-data
|
||||
RUN npm install
|
||||
WORKDIR /app
|
||||
RUN npm install
|
||||
# Bundle for production config with webpack & log
|
||||
RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)
|
||||
|
||||
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server.
|
||||
CMD ["npm", "start"]
|
||||
EXPOSE 3300
|
||||
@@ -1,23 +0,0 @@
|
||||
#syntax=docker/dockerfile:1.4
|
||||
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
|
||||
# docker buildx build --build-context data=../coriolis-data --tag coriolis -f ./Dockerfile-dev .
|
||||
|
||||
FROM node:18-alpine
|
||||
|
||||
WORKDIR /app
|
||||
ADD . .
|
||||
COPY --from=data . /coriolis-data/
|
||||
|
||||
# Install git & any other desired in-container dev tools
|
||||
# Git is required before install if any modules (like coriolis-data) are loaded from github
|
||||
RUN apk update
|
||||
RUN apk add git
|
||||
|
||||
WORKDIR /app/coriolis-data
|
||||
RUN npm install
|
||||
WORKDIR /app
|
||||
RUN npm install
|
||||
|
||||
|
||||
CMD ["npm", "start"]
|
||||
EXPOSE 3300
|
||||
@@ -1,32 +0,0 @@
|
||||
#syntax=docker/dockerfile:1.4
|
||||
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
|
||||
# docker buildx build --build-context data=../coriolis-data --tag coriolis:0.0.7-local-prod -f Dockerfile-local-prod .
|
||||
# docker run -d -p 80:8080 coriolis:0.0.7-local-prod
|
||||
|
||||
FROM node:18-alpine
|
||||
|
||||
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source.
|
||||
WORKDIR /app
|
||||
ADD . .
|
||||
# COPY --from=data . /coriolis-data/
|
||||
|
||||
# Git is required before install if any modules (like coriolis-data is now referenced in the package.json) are loaded from github
|
||||
RUN apk update
|
||||
RUN apk add git
|
||||
|
||||
# WORKDIR /app/coriolis-data
|
||||
# RUN npm install
|
||||
# WORKDIR /app
|
||||
# RUN npm install
|
||||
# Bundle for production config with webpack & log
|
||||
# In this version of the dockerfile, I'm deferring automated webpack build so I can monitor a manual build
|
||||
# RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)
|
||||
|
||||
RUN npm install -g http-server
|
||||
|
||||
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server.
|
||||
# CMD ["http-server", "/app/build", "-c-1"]
|
||||
CMD ["/bin/ash"]
|
||||
# CMD [""]
|
||||
|
||||
EXPOSE 8080
|
||||
15
README.md
15
README.md
@@ -2,7 +2,7 @@
|
||||
|
||||
## About
|
||||
|
||||
The Coriolis project was inspired by E:D Shipyard and, of course, [Elite Dangerous](http://www.elitedangerous.com). The ultimate goal of Coriolis is to provide rich features to support in-game play and planning while engaging the E:D community to support its development.
|
||||
The Coriolis project was inspired by [E:D Shipyard](http://www.edshipyard.com/) and, of course, [Elite Dangerous](http://www.elitedangerous.com). The ultimate goal of Coriolis is to provide rich features to support in-game play and planning while engaging the E:D community to support its development.
|
||||
|
||||
Coriolis was created using assets and imagery from Elite: Dangerous, with the permission of Frontier Developments plc, for non-commercial purposes. It is not endorsed by nor reflects the views or opinions of Frontier Developments and no employee of Frontier Developments was involved in the making of it.
|
||||
|
||||
@@ -14,16 +14,7 @@ Coriolis was created using assets and imagery from Elite: Dangerous, with the pe
|
||||
|
||||
## Development
|
||||
|
||||
This release includes the ability to run the app as a Docker container.
|
||||
```sh
|
||||
> git clone https://github.com/EDCD/coriolis.git
|
||||
> git clone https://github.com/EDCD/coriolis-data.git
|
||||
> cd coriolis
|
||||
> docker buildx build --build-context data=../coriolis-data --tag coriolis .
|
||||
> docker run -d -p 3300:3300 coriolis
|
||||
```
|
||||
|
||||
Or to run an instance of coriolis without Docker Desktop, perform the following steps in a shell:
|
||||
To get a local instance of coriolis running, perform the following steps in a shell:
|
||||
```sh
|
||||
> git clone https://github.com/EDCD/coriolis.git
|
||||
> git clone https://github.com/EDCD/coriolis-data.git
|
||||
@@ -38,7 +29,7 @@ You will then have a development server running on `localhost:3300`.
|
||||
|
||||
### Ship and Module Database
|
||||
|
||||
See the [Data wiki](https://github.com/EDCD/coriolis-data/wiki) for details on structure, etc.
|
||||
See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc.
|
||||
|
||||
## Deployment
|
||||
|
||||
|
||||
@@ -1,30 +0,0 @@
|
||||
{
|
||||
"adder": {
|
||||
"t3": {"speed": 205, "boost": 298, "pitch": 35.37, "roll": 93.09, "yaw": 13.03},
|
||||
"t2": {"speed": 209, "boost": 304, "pitch": 36.06, "roll": 94.90, "yaw": 13.29},
|
||||
"t1": {"speed": 213, "boost": 310, "pitch": 36.80, "roll": 96.84, "yaw": 13.56},
|
||||
"t0": {"speed": 218, "boost": 317, "pitch": 37.70, "roll": 99.20, "yaw": 13.89},
|
||||
"t9": {"speed": 220, "boost": 321, "pitch": 38.08, "roll": 100.21, "yaw": 14.03},
|
||||
"t8": {"speed": 225, "boost": 327, "pitch": 38.86, "roll": 102.26, "yaw": 14.32},
|
||||
"t7": {"speed": 230, "boost": 334, "pitch": 39.69, "roll": 104.44, "yaw": 14.62},
|
||||
"t6": {"speed": 234, "boost": 340, "pitch": 40.41, "roll": 106.34, "yaw": 14.89},
|
||||
"t5": {"speed": 242, "boost": 351, "pitch": 41.71, "roll": 109.78, "yaw": 15.37}
|
||||
},
|
||||
"eagle": {
|
||||
"t2": {"speed": 223, "boost": 325, "pitch": 46.45, "roll": 111.48, "yaw": 16.72},
|
||||
"t1": {"speed": 229, "boost": 334, "pitch": 47.69, "roll": 114.46, "yaw": 17.17},
|
||||
"t0": {"speed": 235, "boost": 343, "pitch": 49.00, "roll": 117.60, "yaw": 17.64},
|
||||
"t9": {"speed": 239, "boost": 349, "pitch": 49.80, "roll": 119.53, "yaw": 17.93},
|
||||
"t8": {"speed": 243, "boost": 355, "pitch": 50.70, "roll": 121.69, "yaw": 18.25},
|
||||
"t7": {"speed": 248, "boost": 361, "pitch": 51.62, "roll": 123.89, "yaw": 18.58},
|
||||
"t6": {"speed": 252, "boost": 367, "pitch": 52.46, "roll": 125.91, "yaw": 18.89},
|
||||
"t5": {"speed": 259, "boost": 378, "pitch": 53.99, "roll": 129.56, "yaw": 19.43}
|
||||
},
|
||||
"hauler": {
|
||||
"t4": {"speed": 203, "boost": 305, "pitch": 36.61, "roll": 101.71, "yaw": 14.24},
|
||||
"t3": {"speed": 209, "boost": 314, "pitch": 37.63, "roll": 104.54, "yaw": 14.64},
|
||||
"t2": {"speed": 216, "boost": 324, "pitch": 38.89, "roll": 108.03, "yaw": 15.12},
|
||||
"t1": {"speed": 222, "boost": 333, "pitch": 39.97, "roll": 111.02, "yaw": 15.54},
|
||||
"t0": {"speed": 232, "boost": 348, "pitch": 41.76, "roll": 116.00, "yaw": 16.24}
|
||||
}
|
||||
}
|
||||
@@ -1,289 +0,0 @@
|
||||
{
|
||||
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/3.json#",
|
||||
"name": "Test My Ship",
|
||||
"ship": "Anaconda",
|
||||
"references": [
|
||||
{
|
||||
"name": "Coriolis.io",
|
||||
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA?bn=Test%20My%20Ship",
|
||||
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
|
||||
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
|
||||
"shipId": "anaconda"
|
||||
}
|
||||
],
|
||||
"components": {
|
||||
"standard": {
|
||||
"bulkheads": "Reactive Surface Composite",
|
||||
"cargoHatch": {
|
||||
"enabled": false,
|
||||
"priority": 5
|
||||
},
|
||||
"powerPlant": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"thrusters": {
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"frameShiftDrive": {
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3
|
||||
},
|
||||
"lifeSupport": {
|
||||
"class": 5,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"powerDistributor": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"sensors": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"fuelTank": {
|
||||
"class": 5,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
}
|
||||
},
|
||||
"hardpoints": [
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Plasma Accelerator",
|
||||
"mount": "Fixed"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cannon",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cannon",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
}
|
||||
],
|
||||
"utility": [
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Booster"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Booster"
|
||||
},
|
||||
null,
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Kill Warrant Scanner"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Scanner"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "F",
|
||||
"enabled": false,
|
||||
"priority": 1,
|
||||
"group": "Countermeasure",
|
||||
"name": "Electronic Countermeasure"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Countermeasure",
|
||||
"name": "Chaff Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Countermeasure",
|
||||
"name": "Point Defence"
|
||||
}
|
||||
],
|
||||
"internal": [
|
||||
{
|
||||
"class": 7,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Generator"
|
||||
},
|
||||
{
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Cell Bank"
|
||||
},
|
||||
{
|
||||
"class": 6,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 5,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Hull Reinforcement Package"
|
||||
},
|
||||
{
|
||||
"class": 5,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
null,
|
||||
null,
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3,
|
||||
"group": "Fuel Scoop"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3,
|
||||
"group": "Frame Shift Drive Interdictor"
|
||||
}
|
||||
]
|
||||
},
|
||||
"stats": {
|
||||
"class": 3,
|
||||
"hullCost": 141889930,
|
||||
"speed": 180,
|
||||
"topSpeed": 186.5,
|
||||
"boost": 240,
|
||||
"boostEnergy": 29,
|
||||
"topBoost": 248.66,
|
||||
"agility": 2,
|
||||
"baseShieldStrength": 350,
|
||||
"baseArmour": 945,
|
||||
"hullMass": 400,
|
||||
"masslock": 23,
|
||||
"pipSpeed": 0.14,
|
||||
"moduleCostMultiplier": 1,
|
||||
"fuelCapacity": 32,
|
||||
"cargoCapacity": 128,
|
||||
"ladenMass": 1339.2,
|
||||
"armour": 2228,
|
||||
"armourAdded": 390,
|
||||
"armourMultiplier": 1.95,
|
||||
"shieldMultiplier": 1.4,
|
||||
"totalCost": 882362060,
|
||||
"unladenMass": 1179.2,
|
||||
"totalDps": 29,
|
||||
"powerAvailable": 36,
|
||||
"powerRetracted": 23.33,
|
||||
"powerDeployed": 34.76,
|
||||
"unladenRange": 18.49,
|
||||
"fullTankRange": 18.12,
|
||||
"ladenRange": 16.39,
|
||||
"unladenFastestRange": 73.21,
|
||||
"ladenFastestRange": 66.15,
|
||||
"maxJumpCount": 4,
|
||||
"shieldStrength": 833
|
||||
}
|
||||
}
|
||||
@@ -1,325 +0,0 @@
|
||||
{
|
||||
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
|
||||
"name": "Test My Ship",
|
||||
"ship": "Anaconda",
|
||||
"references": [
|
||||
{
|
||||
"name": "Coriolis.io",
|
||||
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==?bn=Test%20My%20Ship",
|
||||
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
|
||||
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
|
||||
"shipId": "anaconda"
|
||||
}
|
||||
],
|
||||
"components": {
|
||||
"standard": {
|
||||
"bulkheads": "Reactive Surface Composite",
|
||||
"cargoHatch": {
|
||||
"enabled": false,
|
||||
"priority": 5
|
||||
},
|
||||
"powerPlant": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"modifications": {
|
||||
"pgen": 1000
|
||||
}
|
||||
},
|
||||
"thrusters": {
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"frameShiftDrive": {
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3
|
||||
},
|
||||
"lifeSupport": {
|
||||
"class": 5,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"powerDistributor": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"sensors": {
|
||||
"class": 8,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"fuelTank": {
|
||||
"class": 5,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
}
|
||||
},
|
||||
"hardpoints": [
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Plasma Accelerator",
|
||||
"mount": "Fixed"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cannon",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cannon",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Beam Laser",
|
||||
"mount": "Turret"
|
||||
}
|
||||
],
|
||||
"utility": [
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Booster"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Booster"
|
||||
},
|
||||
null,
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Kill Warrant Scanner"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Scanner"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "F",
|
||||
"enabled": false,
|
||||
"priority": 1,
|
||||
"group": "Electronic Countermeasure",
|
||||
"name": "Electronic Countermeasure"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Chaff Launcher",
|
||||
"name": "Chaff Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Point Defence",
|
||||
"name": "Point Defence"
|
||||
}
|
||||
],
|
||||
"internal": [
|
||||
{
|
||||
"class": 7,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Generator"
|
||||
},
|
||||
{
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Cell Bank"
|
||||
},
|
||||
{
|
||||
"class": 6,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 5,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Hull Reinforcement Package"
|
||||
},
|
||||
{
|
||||
"class": 5,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
null,
|
||||
null,
|
||||
null,
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3,
|
||||
"group": "Fuel Scoop"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 3,
|
||||
"group": "Frame Shift Drive Interdictor"
|
||||
}
|
||||
]
|
||||
},
|
||||
"stats": {
|
||||
"class": 3,
|
||||
"fighterHangars": 1,
|
||||
"hullCost": 141889930,
|
||||
"speed": 180,
|
||||
"topSpeed": 186.5,
|
||||
"boost": 240,
|
||||
"boostEnergy": 27,
|
||||
"topBoost": 249.34,
|
||||
"topPitch": 25.97,
|
||||
"topRoll": 62.34,
|
||||
"topYaw": 10.39,
|
||||
"topSpeed": 187.01,
|
||||
"totalCost": 882362058,
|
||||
"totalDpe": 142.68,
|
||||
"totalDps": 101.13,
|
||||
"totalEps": 18.71,
|
||||
"totalExplDpe": 0,
|
||||
"totalExplDps": 0,
|
||||
"totalExplSDps": 0,
|
||||
"totalAbsDpe": 3.57,
|
||||
"totalAbsDps": 18.78,
|
||||
"totalAbsSDps": 14.45,
|
||||
"totalHps": 28.28,
|
||||
"totalKinDpe": 117.48,
|
||||
"totalKinDps": 22.27,
|
||||
"totalKinSDps": 16.91,
|
||||
"totalSDps": 89.99,
|
||||
"totalThermDpe": 21.63,
|
||||
"totalThermDps": 60.08,
|
||||
"totalThermSDps": 58.64,
|
||||
"baseShieldStrength": 350,
|
||||
"baseArmour": 945,
|
||||
"hullExplRes": 0.22,
|
||||
"hullKinRes": 0.27,
|
||||
"hullMass": 400,
|
||||
"hullThermRes": -0.36,
|
||||
"masslock": 23,
|
||||
"pipSpeed": 0.14,
|
||||
"pitch": 25,
|
||||
"moduleCostMultiplier": 1,
|
||||
"modulearmour": 0,
|
||||
"moduleprotection": 0,
|
||||
"fuelCapacity": 32,
|
||||
"cargoCapacity": 128,
|
||||
"ladenMass": 1323.2,
|
||||
"armour": 2227.5,
|
||||
"baseArmour": 525,
|
||||
"unladenMass": 1163.2,
|
||||
"powerAvailable": 39.6,
|
||||
"powerRetracted": 23.33,
|
||||
"powerDeployed": 34.13,
|
||||
"roll": 60,
|
||||
"unladenRange": 18.74,
|
||||
"yaw": 10,
|
||||
"fullTankRange": 18.36,
|
||||
"hardness": 65,
|
||||
"ladenRange": 16.59,
|
||||
"unladenFastestRange": 74.2,
|
||||
"ladenFastestRange": 66.96,
|
||||
"maxJumpCount": 4,
|
||||
"shield": 833,
|
||||
"shieldCells": 1840,
|
||||
"shieldExplRes": 0.5,
|
||||
"shieldKinRes": 0.4,
|
||||
"shieldThermRes": -0.2,
|
||||
"crew": 3
|
||||
}
|
||||
}
|
||||
@@ -1,255 +0,0 @@
|
||||
{
|
||||
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
|
||||
"name": "Multi-purpose Asp Explorer",
|
||||
"ship": "Asp Explorer",
|
||||
"references": [
|
||||
{
|
||||
"name": "Coriolis.io",
|
||||
"url": "https://coriolis.edcd.io/outfit/asp?code=0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FAwDFxwtofAAAAA%3D%3D&bn=Multi-purpose%20Asp%20Explorer",
|
||||
"code": "0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx/78YG5AltB7I/8/0TwImJboDSPJ/+/f/v/KlX///i3AwMTBIfARK/Gf+JwVSxArStVAYqOjvz///JVo5GRhE2IBc4SKQSSz/DGEmCa398P8//2+gTf//AwDFxwtofAAAAA==",
|
||||
"shipId": "asp"
|
||||
}
|
||||
],
|
||||
"components": {
|
||||
"standard": {
|
||||
"bulkheads": "Lightweight Alloy",
|
||||
"cargoHatch": {
|
||||
"enabled": false,
|
||||
"priority": 5
|
||||
},
|
||||
"powerPlant": {
|
||||
"class": 5,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"modifications": {
|
||||
"eff": -1850,
|
||||
"pgen": 6,
|
||||
"mass": 431
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 64,
|
||||
"name": "Low emissions",
|
||||
"grade": 1
|
||||
}
|
||||
},
|
||||
"thrusters": {
|
||||
"class": 5,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"modifications": {
|
||||
"optmul": 440,
|
||||
"integrity": -266,
|
||||
"thermload": -1326,
|
||||
"optmass": 520,
|
||||
"power": 241
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 24,
|
||||
"name": "Clean",
|
||||
"grade": 1
|
||||
}
|
||||
},
|
||||
"frameShiftDrive": {
|
||||
"class": 5,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"modifications": {
|
||||
"mass": 5025,
|
||||
"integrity": -1539,
|
||||
"power": 2437,
|
||||
"optmass": 4870,
|
||||
"maxfuel": 370
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 26,
|
||||
"name": "Increased range",
|
||||
"grade": 5
|
||||
}
|
||||
},
|
||||
"lifeSupport": {
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"modifications": {
|
||||
"mass": -3923,
|
||||
"integrity": -1797
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 49,
|
||||
"name": "Lightweight",
|
||||
"grade": 1
|
||||
}
|
||||
},
|
||||
"powerDistributor": {
|
||||
"class": 3,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"sensors": {
|
||||
"class": 5,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"fuelTank": {
|
||||
"class": 5,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
}
|
||||
},
|
||||
"hardpoints": [
|
||||
null,
|
||||
null,
|
||||
null,
|
||||
null,
|
||||
null,
|
||||
null
|
||||
],
|
||||
"utility": [
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Heat Sink Launcher",
|
||||
"name": "Heat Sink Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Heat Sink Launcher",
|
||||
"name": "Heat Sink Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Heat Sink Launcher",
|
||||
"name": "Heat Sink Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Point Defence",
|
||||
"name": "Point Defence"
|
||||
}
|
||||
],
|
||||
"internal": [
|
||||
{
|
||||
"class": 6,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Fuel Scoop"
|
||||
},
|
||||
{
|
||||
"class": 5,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Generator"
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "G",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Planetary Vehicle Hangar"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Scanner",
|
||||
"name": "Advanced Discovery Scanner"
|
||||
},
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Scanner",
|
||||
"name": "Detailed Surface Scanner"
|
||||
}
|
||||
]
|
||||
},
|
||||
"stats": {
|
||||
"class": 2,
|
||||
"hullCost": 6135660,
|
||||
"speed": 250,
|
||||
"boost": 340,
|
||||
"boostEnergy": 13,
|
||||
"agility": 6,
|
||||
"baseShieldStrength": 140,
|
||||
"baseArmour": 210,
|
||||
"hullMass": 280,
|
||||
"masslock": 11,
|
||||
"pipSpeed": 0.13,
|
||||
"moduleCostMultiplier": 1,
|
||||
"fuelCapacity": 32,
|
||||
"cargoCapacity": 40,
|
||||
"ladenMass": 435.26,
|
||||
"armour": 378,
|
||||
"shield": 113.43,
|
||||
"shieldCells": 0,
|
||||
"totalCost": 48402550,
|
||||
"unladenMass": 363.26,
|
||||
"totalDpe": 0,
|
||||
"totalExplDpe": 0,
|
||||
"totalKinDpe": 0,
|
||||
"totalThermDpe": 0,
|
||||
"totalDps": 0,
|
||||
"totalExplDps": 0,
|
||||
"totalKinDps": 0,
|
||||
"totalThermDps": 0,
|
||||
"totalSDps": 0,
|
||||
"totalExplSDps": 0,
|
||||
"totalKinSDps": 0,
|
||||
"totalThermSDps": 0,
|
||||
"totalEps": 1.2,
|
||||
"totalHps": 1,
|
||||
"shieldExplRes": 0.5,
|
||||
"shieldKinRes": 0.6,
|
||||
"shieldThermRes": 1.2,
|
||||
"hullExplRes": 1.4,
|
||||
"hullKinRes": 1.2,
|
||||
"hullThermRes": 1,
|
||||
"powerAvailable": 20.41,
|
||||
"powerRetracted": 11.91,
|
||||
"powerDeployed": 11.91,
|
||||
"unladenRange": 50.45,
|
||||
"fullTankRange": 47.03,
|
||||
"ladenRange": 42.71,
|
||||
"unladenFastestRange": 317.24,
|
||||
"ladenFastestRange": 287.02,
|
||||
"maxJumpCount": 7,
|
||||
"topSpeed": 274.01,
|
||||
"topBoost": 372.65
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,552 +0,0 @@
|
||||
{
|
||||
"cargo": {
|
||||
"capacity": 32
|
||||
},
|
||||
"free": false,
|
||||
"fuel": {
|
||||
"main": {
|
||||
"capacity": 128
|
||||
},
|
||||
"reserve": {
|
||||
"capacity": 0.81
|
||||
}
|
||||
},
|
||||
"id": 31,
|
||||
"modules": {
|
||||
"Armour": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049346,
|
||||
"name": "BelugaLiner_Armour_Grade1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Bobble01": [],
|
||||
"Bobble02": [],
|
||||
"Bobble03": [],
|
||||
"Bobble04": [],
|
||||
"Bobble05": [],
|
||||
"Bobble06": [],
|
||||
"Bobble07": [],
|
||||
"Bobble08": [],
|
||||
"Bobble09": [],
|
||||
"Bobble10": [],
|
||||
"Decal1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667757,
|
||||
"name": "Decal_Explorer_Ranger",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Decal2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667742,
|
||||
"name": "Decal_Combat_Deadly",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Decal3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667750,
|
||||
"name": "Decal_Trade_Tycoon",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"EngineColour": [],
|
||||
"FrameShiftDrive": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064132,
|
||||
"modifiers": {
|
||||
"engineerID": 300100,
|
||||
"id": 175,
|
||||
"modifiers": [
|
||||
{
|
||||
"name": "mod_mass",
|
||||
"type": 1,
|
||||
"value": 0.4457540512085
|
||||
},
|
||||
{
|
||||
"name": "mod_health",
|
||||
"type": 1,
|
||||
"value": -0.24584779143333
|
||||
},
|
||||
{
|
||||
"name": "mod_passive_power",
|
||||
"type": 1,
|
||||
"value": 0.24457727372646
|
||||
},
|
||||
{
|
||||
"name": "mod_fsd_optimised_mass",
|
||||
"type": 1,
|
||||
"value": 0.49257898330688
|
||||
},
|
||||
{
|
||||
"name": "mod_fsd_max_fuel_per_jump",
|
||||
"type": 2,
|
||||
"value": 0.028505677357316
|
||||
},
|
||||
{
|
||||
"name": "mod_fsd_heat_rate",
|
||||
"type": 2,
|
||||
"value": -0.079360365867615
|
||||
}
|
||||
],
|
||||
"moduleTags": [
|
||||
16
|
||||
],
|
||||
"recipeID": 128673694,
|
||||
"slotIndex": 53
|
||||
},
|
||||
"name": "Int_Hyperdrive_Size7_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"recipeLevel": 5,
|
||||
"recipeName": "FSD_LongRange",
|
||||
"recipeValue": 0,
|
||||
"unloaned": 0,
|
||||
"value": 46160201
|
||||
}
|
||||
},
|
||||
"FuelTank": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064352,
|
||||
"name": "Int_FuelTank_Size7_Class3",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 1602822,
|
||||
"value": 1602822
|
||||
}
|
||||
},
|
||||
"LifeSupport": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064174,
|
||||
"name": "Int_LifeSupport_Size8_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 1569565
|
||||
}
|
||||
},
|
||||
"MainEngines": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064094,
|
||||
"modifiers": {
|
||||
"engineerID": 300100,
|
||||
"id": 253,
|
||||
"modifiers": [
|
||||
{
|
||||
"name": "mod_engine_mass_curve_multiplier",
|
||||
"type": 1,
|
||||
"value": 0.098235413432121
|
||||
},
|
||||
{
|
||||
"name": "mod_engine_heat",
|
||||
"type": 1,
|
||||
"value": 0.18069696426392
|
||||
},
|
||||
{
|
||||
"name": "mod_passive_power",
|
||||
"type": 1,
|
||||
"value": 0.033788848668337
|
||||
},
|
||||
{
|
||||
"name": "mod_health",
|
||||
"type": 1,
|
||||
"value": -0.056404989212751
|
||||
},
|
||||
{
|
||||
"name": "mod_engine_mass_curve",
|
||||
"type": 1,
|
||||
"value": -0.027384582906961
|
||||
},
|
||||
{
|
||||
"name": "mod_engine_heat",
|
||||
"type": 2,
|
||||
"value": -0.072683908045292
|
||||
}
|
||||
],
|
||||
"moduleTags": [
|
||||
17
|
||||
],
|
||||
"recipeID": 128673655,
|
||||
"slotIndex": 52
|
||||
},
|
||||
"name": "Int_Engine_Size7_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"recipeLevel": 1,
|
||||
"recipeName": "Engine_Dirty",
|
||||
"recipeValue": 0,
|
||||
"unloaned": 0,
|
||||
"value": 1709638
|
||||
}
|
||||
},
|
||||
"MediumHardpoint1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049436,
|
||||
"name": "Hpt_BeamLaser_Turret_Medium",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 1889910
|
||||
}
|
||||
},
|
||||
"MediumHardpoint2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049436,
|
||||
"name": "Hpt_BeamLaser_Turret_Medium",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 1889910
|
||||
}
|
||||
},
|
||||
"MediumHardpoint3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049460,
|
||||
"name": "Hpt_MultiCannon_Gimbal_Medium",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 51300
|
||||
}
|
||||
},
|
||||
"MediumHardpoint4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049460,
|
||||
"name": "Hpt_MultiCannon_Gimbal_Medium",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 51300
|
||||
}
|
||||
},
|
||||
"MediumHardpoint5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049460,
|
||||
"name": "Hpt_MultiCannon_Gimbal_Medium",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 51300
|
||||
}
|
||||
},
|
||||
"PaintJob": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128732290,
|
||||
"name": "PaintJob_BelugaLiner_Tactical_White",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"PlanetaryApproachSuite": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128672317,
|
||||
"name": "Int_PlanetApproachSuite",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 450,
|
||||
"value": 450
|
||||
}
|
||||
},
|
||||
"PowerDistributor": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064207,
|
||||
"name": "Int_PowerDistributor_Size6_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 3128120
|
||||
}
|
||||
},
|
||||
"PowerPlant": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064057,
|
||||
"modifiers": {
|
||||
"engineerID": 300100,
|
||||
"id": 277,
|
||||
"modifiers": [
|
||||
{
|
||||
"name": "mod_powerplant_power",
|
||||
"type": 1,
|
||||
"value": 0.054692290723324
|
||||
},
|
||||
{
|
||||
"name": "mod_health",
|
||||
"type": 1,
|
||||
"value": -0.033690698444843
|
||||
},
|
||||
{
|
||||
"name": "mod_powerplant_heat",
|
||||
"type": 1,
|
||||
"value": 0.027470717206597
|
||||
},
|
||||
{
|
||||
"name": "mod_powerplant_heat",
|
||||
"type": 2,
|
||||
"value": -0.056317910552025
|
||||
}
|
||||
],
|
||||
"moduleTags": [
|
||||
18
|
||||
],
|
||||
"recipeID": 128673765,
|
||||
"slotIndex": 51
|
||||
},
|
||||
"name": "Int_Powerplant_Size6_Class5",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"recipeLevel": 1,
|
||||
"recipeName": "PowerPlant_Boosted",
|
||||
"recipeValue": 0,
|
||||
"unloaned": 0,
|
||||
"value": 14561578
|
||||
}
|
||||
},
|
||||
"Radar": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064239,
|
||||
"name": "Int_Sensors_Size5_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 71500
|
||||
}
|
||||
},
|
||||
"Slot01_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128666681,
|
||||
"name": "Int_FuelScoop_Size6_Class5",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 25887249
|
||||
}
|
||||
},
|
||||
"Slot02_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064287,
|
||||
"name": "Int_ShieldGenerator_Size6_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 14561578
|
||||
}
|
||||
},
|
||||
"Slot03_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128727927,
|
||||
"name": "Int_PassengerCabin_Size6_Class2",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 165808,
|
||||
"value": 165808
|
||||
}
|
||||
},
|
||||
"Slot04_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128727928,
|
||||
"name": "Int_PassengerCabin_Size6_Class3",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 497429
|
||||
}
|
||||
},
|
||||
"Slot05_Size5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128727925,
|
||||
"name": "Int_PassengerCabin_Size5_Class4",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 1492286
|
||||
}
|
||||
},
|
||||
"Slot06_Size5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064342,
|
||||
"name": "Int_CargoRack_Size5_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 100409,
|
||||
"value": 100409
|
||||
}
|
||||
},
|
||||
"Slot07_Size4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128727922,
|
||||
"name": "Int_PassengerCabin_Size4_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 17059
|
||||
}
|
||||
},
|
||||
"Slot08_Size3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667632,
|
||||
"name": "Int_Repairer_Size3_Class5",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 2361960
|
||||
}
|
||||
},
|
||||
"Slot09_Size3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128672289,
|
||||
"name": "Int_BuggyBay_Size2_Class2",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 19440
|
||||
}
|
||||
},
|
||||
"Slot10_Size3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128666634,
|
||||
"name": "Int_DetailedSurfaceScanner_Tiny",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 225000
|
||||
}
|
||||
},
|
||||
"Slot11_Size3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128663561,
|
||||
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 1390500
|
||||
}
|
||||
},
|
||||
"TinyHardpoint1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049513,
|
||||
"name": "Hpt_ChaffLauncher_Tiny",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 7650
|
||||
}
|
||||
},
|
||||
"TinyHardpoint2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 252900
|
||||
}
|
||||
},
|
||||
"TinyHardpoint3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 252900
|
||||
}
|
||||
},
|
||||
"TinyHardpoint4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"TinyHardpoint5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"TinyHardpoint6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"WeaponColour": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128732194,
|
||||
"name": "WeaponCustomisation_Purple",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
}
|
||||
},
|
||||
"name": "BelugaLiner",
|
||||
"value": {
|
||||
"hull": 71688743,
|
||||
"modules": 120812762,
|
||||
"unloaned": 1869489
|
||||
}
|
||||
}
|
||||
@@ -1,314 +0,0 @@
|
||||
{
|
||||
"cargo": {
|
||||
"capacity": 264
|
||||
},
|
||||
"free": false,
|
||||
"fuel": {
|
||||
"main": {
|
||||
"capacity": 32
|
||||
},
|
||||
"reserve": {
|
||||
"capacity": 0.52
|
||||
}
|
||||
},
|
||||
"id": 4,
|
||||
"modules": {
|
||||
"Armour": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049298,
|
||||
"name": "Type7_Armour_Grade1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Bobble01": [],
|
||||
"Bobble02": [],
|
||||
"Bobble03": [],
|
||||
"Bobble04": [],
|
||||
"Bobble05": [],
|
||||
"Bobble06": [],
|
||||
"Bobble07": [],
|
||||
"Bobble08": [],
|
||||
"Bobble09": [],
|
||||
"Bobble10": [],
|
||||
"Decal1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667746,
|
||||
"name": "Decal_Trade_Dealer",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Decal2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667738,
|
||||
"name": "Decal_Combat_Competent",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Decal3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128667753,
|
||||
"name": "Decal_Explorer_Scout",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"EngineColour": [],
|
||||
"FrameShiftDrive": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064122,
|
||||
"name": "Int_Hyperdrive_Size5_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 5103953
|
||||
}
|
||||
},
|
||||
"FuelTank": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064350,
|
||||
"name": "Int_FuelTank_Size5_Class3",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 97754,
|
||||
"value": 97754
|
||||
}
|
||||
},
|
||||
"LifeSupport": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064154,
|
||||
"name": "Int_LifeSupport_Size4_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 28373
|
||||
}
|
||||
},
|
||||
"MainEngines": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064087,
|
||||
"name": "Int_Engine_Size5_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 5103953
|
||||
}
|
||||
},
|
||||
"PaintJob": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128671422,
|
||||
"name": "PaintJob_Type7_Tactical_White",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"PlanetaryApproachSuite": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128672317,
|
||||
"name": "Int_PlanetApproachSuite",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 500,
|
||||
"value": 500
|
||||
}
|
||||
},
|
||||
"PowerDistributor": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064192,
|
||||
"name": "Int_PowerDistributor_Size3_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 158331
|
||||
}
|
||||
},
|
||||
"PowerPlant": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064047,
|
||||
"name": "Int_Powerplant_Size4_Class5",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 1610080
|
||||
}
|
||||
},
|
||||
"Radar": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064229,
|
||||
"name": "Int_Sensors_Size3_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 10133
|
||||
}
|
||||
},
|
||||
"Slot01_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064343,
|
||||
"name": "Int_CargoRack_Size6_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 362591
|
||||
}
|
||||
},
|
||||
"Slot02_Size6": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064343,
|
||||
"name": "Int_CargoRack_Size6_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 362591
|
||||
}
|
||||
},
|
||||
"Slot03_Size5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064343,
|
||||
"name": "Int_CargoRack_Size6_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 362591
|
||||
}
|
||||
},
|
||||
"Slot04_Size5": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064342,
|
||||
"name": "Int_CargoRack_Size5_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 111566,
|
||||
"value": 111566
|
||||
}
|
||||
},
|
||||
"Slot05_Size4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064342,
|
||||
"name": "Int_CargoRack_Size5_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 111566,
|
||||
"value": 111566
|
||||
}
|
||||
},
|
||||
"Slot06_Size4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064279,
|
||||
"name": "Int_ShieldGenerator_Size5_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 189035
|
||||
}
|
||||
},
|
||||
"Slot07_Size2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049549,
|
||||
"name": "Int_DockingComputer_Standard",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 4500
|
||||
}
|
||||
},
|
||||
"Slot08_Size2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064340,
|
||||
"name": "Int_CargoRack_Size3_Class1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"unloaned": 0,
|
||||
"value": 10563
|
||||
}
|
||||
},
|
||||
"SmallHardpoint1": [],
|
||||
"SmallHardpoint2": [],
|
||||
"SmallHardpoint3": [],
|
||||
"SmallHardpoint4": [],
|
||||
"TinyHardpoint1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"TinyHardpoint2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"TinyHardpoint3": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128668536,
|
||||
"name": "Hpt_ShieldBooster_Size0_Class5",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 281000
|
||||
}
|
||||
},
|
||||
"TinyHardpoint4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049513,
|
||||
"name": "Hpt_ChaffLauncher_Tiny",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"unloaned": 0,
|
||||
"value": 8500
|
||||
}
|
||||
},
|
||||
"WeaponColour": []
|
||||
},
|
||||
"name": "Type7",
|
||||
"value": {
|
||||
"hull": 16780009,
|
||||
"modules": 14479580,
|
||||
"unloaned": 321386
|
||||
}
|
||||
}
|
||||
@@ -1,225 +0,0 @@
|
||||
{
|
||||
"free": false,
|
||||
"id": 2,
|
||||
"modules": {
|
||||
"Armour": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128049280,
|
||||
"name": "CobraMkIII_Armour_Grade1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"FrameShiftDrive": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064117,
|
||||
"name": "Int_Hyperdrive_Size4_Class5",
|
||||
"on": true,
|
||||
"priority": 4,
|
||||
"value": 1610080
|
||||
}
|
||||
},
|
||||
"FuelTank": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064349,
|
||||
"name": "Int_FuelTank_Size4_Class3",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 24734
|
||||
}
|
||||
},
|
||||
"LifeSupport": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064149,
|
||||
"name": "Int_LifeSupport_Size3_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"value": 10133
|
||||
}
|
||||
},
|
||||
"MainEngines": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064079,
|
||||
"name": "Int_Engine_Size4_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"value": 59633
|
||||
}
|
||||
},
|
||||
"PaintJob": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128741033,
|
||||
"name": "PaintJob_CobraMKIII_Corrosive_05",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"PlanetaryApproachSuite": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128672317,
|
||||
"name": "Int_PlanetApproachSuite",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 500
|
||||
}
|
||||
},
|
||||
"PowerDistributor": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064179,
|
||||
"name": "Int_PowerDistributor_Size1_Class2",
|
||||
"on": true,
|
||||
"priority": 2,
|
||||
"value": 1293
|
||||
}
|
||||
},
|
||||
"PowerPlant": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064037,
|
||||
"name": "Int_Powerplant_Size2_Class5",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 160224
|
||||
}
|
||||
},
|
||||
"Radar": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128064229,
|
||||
"name": "Int_Sensors_Size3_Class2",
|
||||
"on": true,
|
||||
"priority": 0,
|
||||
"value": 10133
|
||||
}
|
||||
},
|
||||
"ShipID0": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128758976,
|
||||
"name": "Nameplate_ShipID_Black",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipID1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128758976,
|
||||
"name": "Nameplate_ShipID_Black",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipKitBumper": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128740698,
|
||||
"name": "CobraMkIII_ShipkitRaider1_Bumper1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipKitSpoiler": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128740701,
|
||||
"name": "CobraMkIII_ShipkitRaider1_Spoiler1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipKitTail": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128740705,
|
||||
"name": "CobraMkIII_ShipkitRaider1_Tail2",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipKitWings": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128740707,
|
||||
"name": "CobraMkIII_ShipkitRaider1_Wings1",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipName0": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128758944,
|
||||
"name": "Nameplate_Explorer01_Black",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"ShipName1": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128758944,
|
||||
"name": "Nameplate_Explorer01_Black",
|
||||
"on": true,
|
||||
"priority": 1,
|
||||
"value": 0
|
||||
}
|
||||
},
|
||||
"Slot01_Size4": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128666663,
|
||||
"name": "Int_FuelScoop_Size4_Class3",
|
||||
"on": true,
|
||||
"priority": 2,
|
||||
"value": 178898
|
||||
}
|
||||
},
|
||||
"Slot02_Size4": [],
|
||||
"Slot03_Size4": [],
|
||||
"Slot04_Size2": [],
|
||||
"Slot05_Size2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128663561,
|
||||
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
|
||||
"on": true,
|
||||
"priority": 2,
|
||||
"value": 1545000
|
||||
}
|
||||
},
|
||||
"Slot06_Size2": {
|
||||
"module": {
|
||||
"free": false,
|
||||
"id": 128666634,
|
||||
"name": "Int_DetailedSurfaceScanner_Tiny",
|
||||
"on": true,
|
||||
"priority": 2,
|
||||
"value": 250000
|
||||
}
|
||||
}
|
||||
},
|
||||
"name": "CobraMkIII",
|
||||
"value": {
|
||||
"hull": 205287,
|
||||
"modules": 3850628,
|
||||
"unloaned": 1751109
|
||||
}
|
||||
}
|
||||
@@ -1,327 +0,0 @@
|
||||
{
|
||||
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
|
||||
"name": "Multi-purpose Imperial Courier",
|
||||
"ship": "Imperial Courier",
|
||||
"references": [
|
||||
{
|
||||
"name": "Coriolis.io",
|
||||
"url": "https://coriolis.edcd.io/outfit/imperial_courier?code=0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ%3D.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s%2FkIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA%2B%2Fz%2Bz3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ%2BLgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ%2F0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g%2F6v0TTdbxJ2KhdEIaCw15MF%2FNB0L%2BS2hwEwyFM8KgP%2BqEpWWA3Qu9Z3z9kPWHzakt7Dt%2BAeD7ghSTgEAAA%3D%3D&bn=Multi-purpose%20Imperial%20Courier",
|
||||
"code": "0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ=.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s/kIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA+/z+z3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ+LgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ/0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g/6v0TTdbxJ2KhdEIaCw15MF/NB0L+S2hwEwyFM8KgP+qEpWWA3Qu9Z3z9kPWHzakt7Dt+AeD7ghSTgEAAA==",
|
||||
"shipId": "imperial_courier"
|
||||
}
|
||||
],
|
||||
"components": {
|
||||
"standard": {
|
||||
"bulkheads": "Lightweight Alloy",
|
||||
"cargoHatch": {
|
||||
"enabled": false,
|
||||
"priority": 5
|
||||
},
|
||||
"powerPlant": {
|
||||
"class": 4,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"modifications": {
|
||||
"pgen": 1052,
|
||||
"integrity": -482,
|
||||
"eff": 974
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 63,
|
||||
"name": "Overcharged",
|
||||
"grade": 1
|
||||
}
|
||||
},
|
||||
"thrusters": {
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"name": "Enhanced Performance",
|
||||
"modifications": {
|
||||
"optmul": 2476,
|
||||
"thermload": 7023,
|
||||
"power": 1763,
|
||||
"integrity": 165,
|
||||
"optmass": -667
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 22,
|
||||
"name": "Dirty",
|
||||
"grade": 4
|
||||
}
|
||||
},
|
||||
"frameShiftDrive": {
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"modifications": {
|
||||
"mass": 4082,
|
||||
"integrity": -2422,
|
||||
"power": 1782,
|
||||
"optmass": 4927
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 26,
|
||||
"name": "Increased range",
|
||||
"grade": 5
|
||||
}
|
||||
},
|
||||
"lifeSupport": {
|
||||
"class": 1,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"powerDistributor": {
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"sensors": {
|
||||
"class": 2,
|
||||
"rating": "D",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
},
|
||||
"fuelTank": {
|
||||
"class": 3,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 1
|
||||
}
|
||||
},
|
||||
"hardpoints": [
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Pulse Laser",
|
||||
"mount": "Fixed",
|
||||
"modifications": {
|
||||
"rof": 5931,
|
||||
"damage": -184,
|
||||
"jitter": 50,
|
||||
"distdraw": -4689,
|
||||
"piercing": 3328
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 89,
|
||||
"name": "Rapid fire",
|
||||
"grade": 5
|
||||
}
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Pulse Laser",
|
||||
"mount": "Fixed",
|
||||
"modifications": {
|
||||
"rof": 4715,
|
||||
"damage": -97,
|
||||
"jitter": 30,
|
||||
"distdraw": -4548,
|
||||
"piercing": 1057,
|
||||
"integrity": 319
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 89,
|
||||
"name": "Rapid fire",
|
||||
"grade": 5
|
||||
}
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "F",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Multi-cannon",
|
||||
"mount": "Gimballed",
|
||||
"modifications": {
|
||||
"damage": 2437,
|
||||
"distdraw": 5487,
|
||||
"rof": 1120,
|
||||
"jitter": 58,
|
||||
"thermload": 1346,
|
||||
"power": 1009,
|
||||
"integrity": -202,
|
||||
"ammo": -2000
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 88,
|
||||
"name": "Overcharged",
|
||||
"grade": 3,
|
||||
"special": {
|
||||
"id": 3,
|
||||
"name": "Corrosive shell"
|
||||
}
|
||||
}
|
||||
}
|
||||
],
|
||||
"utility": [
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Heat Sink Launcher",
|
||||
"name": "Heat Sink Launcher",
|
||||
"modifications": {
|
||||
"ammo": 5000,
|
||||
"mass": 17684,
|
||||
"reload": 9707
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 37,
|
||||
"name": "Ammo capacity",
|
||||
"grade": 3
|
||||
}
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Heat Sink Launcher",
|
||||
"name": "Heat Sink Launcher",
|
||||
"modifications": {
|
||||
"ammo": 5000,
|
||||
"mass": 18520,
|
||||
"reload": 8715
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 37,
|
||||
"name": "Ammo capacity",
|
||||
"grade": 3
|
||||
}
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "I",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Chaff Launcher",
|
||||
"name": "Chaff Launcher"
|
||||
},
|
||||
{
|
||||
"class": 0,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Frame Shift Wake Scanner"
|
||||
}
|
||||
],
|
||||
"internal": [
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Shield Generator",
|
||||
"modifications": {
|
||||
"optmul": 1888,
|
||||
"explres": 455,
|
||||
"kinres": 546,
|
||||
"thermres": 1092,
|
||||
"brokenregen": -2614,
|
||||
"regen": -876,
|
||||
"distdraw": 463
|
||||
},
|
||||
"blueprint": {
|
||||
"id": 77,
|
||||
"name": "Reinforced",
|
||||
"grade": 3
|
||||
}
|
||||
},
|
||||
{
|
||||
"class": 3,
|
||||
"rating": "A",
|
||||
"enabled": true,
|
||||
"priority": 1,
|
||||
"group": "Fuel Scoop"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
{
|
||||
"class": 2,
|
||||
"rating": "E",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Cargo Rack"
|
||||
},
|
||||
null,
|
||||
{
|
||||
"class": 1,
|
||||
"rating": "C",
|
||||
"enabled": true,
|
||||
"priority": 2,
|
||||
"group": "Scanner",
|
||||
"name": "Advanced Discovery Scanner"
|
||||
}
|
||||
]
|
||||
},
|
||||
"stats": {
|
||||
"class": 1,
|
||||
"hullCost": 2481550,
|
||||
"speed": 280,
|
||||
"boost": 380,
|
||||
"boostEnergy": 10,
|
||||
"agility": 6,
|
||||
"baseShieldStrength": 200,
|
||||
"baseArmour": 80,
|
||||
"hullMass": 35,
|
||||
"masslock": 7,
|
||||
"pipSpeed": 0.05,
|
||||
"moduleCostMultiplier": 1,
|
||||
"fuelCapacity": 8,
|
||||
"cargoCapacity": 8,
|
||||
"ladenMass": 104.25,
|
||||
"armour": 144,
|
||||
"shield": 404.19,
|
||||
"shieldCells": 0,
|
||||
"totalCost": 14059860,
|
||||
"unladenMass": 88.25,
|
||||
"totalDpe": 32.25,
|
||||
"totalExplDpe": 0,
|
||||
"totalKinDpe": 9.41,
|
||||
"totalThermDpe": 22.84,
|
||||
"totalDps": 53.8,
|
||||
"totalExplDps": 0,
|
||||
"totalKinDps": 17.44,
|
||||
"totalThermDps": 36.35,
|
||||
"totalSDps": 48.99,
|
||||
"totalExplSDps": 0,
|
||||
"totalKinSDps": 12.64,
|
||||
"totalThermSDps": 36.35,
|
||||
"totalEps": 9.84,
|
||||
"totalHps": 12.28,
|
||||
"shieldExplRes": 0.48,
|
||||
"shieldKinRes": 0.55,
|
||||
"shieldThermRes": 1.09,
|
||||
"hullExplRes": 1.4,
|
||||
"hullKinRes": 1.2,
|
||||
"hullThermRes": 1,
|
||||
"powerAvailable": 17.24,
|
||||
"powerRetracted": 11.3,
|
||||
"powerDeployed": 16.41,
|
||||
"unladenRange": 25.57,
|
||||
"fullTankRange": 23.92,
|
||||
"ladenRange": 22.09,
|
||||
"unladenFastestRange": 116.23,
|
||||
"ladenFastestRange": 107,
|
||||
"maxJumpCount": 5,
|
||||
"topSpeed": 386.56,
|
||||
"topBoost": 524.62
|
||||
}
|
||||
}
|
||||
@@ -1,22 +0,0 @@
|
||||
[
|
||||
{
|
||||
"buildText": "[Imaginary Ship]\nbla bla",
|
||||
"errorMsg": "No such ship found: \"Imaginary Ship\""
|
||||
},
|
||||
{
|
||||
"buildText": "[Viper]\nS: 1F/F Pulse Laser\nsome un-parseable nonsense\nS: 1F/F Pulse Laser\n",
|
||||
"errorMsg": "Error parsing: \"some un-parseable nonsense\""
|
||||
},
|
||||
{
|
||||
"buildText": "[Sidewinder]\nS: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
|
||||
"errorMsg": "2F Pulse Laser exceeds slot size: \"S: 2F/F Pulse Laser\""
|
||||
},
|
||||
{
|
||||
"buildText": "[Sidewinder]\nL: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
|
||||
"errorMsg": "No hardpoint slot available for: \"L: 2F/F Pulse Laser\""
|
||||
},
|
||||
{
|
||||
"buildText": "[Sidewinder]\nS: 1F/F Magic Thing\nS: 1F/F Pulse Laser\n",
|
||||
"errorMsg": "Unknown component: \"S: 1F/F Magic Thing\""
|
||||
}
|
||||
]
|
||||
@@ -1,32 +0,0 @@
|
||||
[
|
||||
{
|
||||
"shipId": "anaconda",
|
||||
"buildName": "Imported Anaconda",
|
||||
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
|
||||
"buildText": "[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
|
||||
},
|
||||
{
|
||||
"shipId": "anaconda",
|
||||
"buildName": "Imported Anaconda",
|
||||
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
|
||||
"buildText": "\n\n \t[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
|
||||
},
|
||||
{
|
||||
"shipId": "cobra_mk_iii",
|
||||
"buildName": "Imported Cobra Mk III",
|
||||
"buildCode": "0patcFeldd5sdf41712222503040202490f242h.Iw1-kA==.Aw1-kA==.",
|
||||
"buildText": "[Cobra Mk III]\nM: 1F/F Pulse Laser\nM: 1G/G Burst Laser\nS: 1E/T Fragment Cannon\nS: 1G/T Multi-cannon\nU: 0I Point Defence\nU: 0A Shield Booster\n\nBH: 1I Lightweight Alloy\nRB: 4A Power Plant\nTM: 4C Thrusters\nFH: 4E Frame Shift Drive\nEC: 3D Life Support\nPC: 2A Power Distributor\nSS: 3D Sensors\nFS: 4C Fuel Tank (Capacity: 16)\n\n4: 3E Cargo Rack (Capacity: 8)\n4: 3E Cargo Rack (Capacity: 8)\n4: 4E Shield Generator\n2: 2C Auto Field-Maintenance Unit\n2: 1E Standard Docking Computer\n2: 1E Basic Discovery Scanner\n---\nShield: 112.29 MJ\nPower : 10.45 MW retracted (67%)\n 12.16 MW deployed (78%)\n 15.60 MW available\nCargo : 16 T\nFuel : 16 T\nMass : 235.5 T empty\n 267.5 T full\nRange : 10.69 LY unladen\n 10.05 LY laden\nPrice : 2,929,040 CR\nRe-Buy: 146,452 CR @ 95% insurance\n"
|
||||
},
|
||||
{
|
||||
"shipId": "type_9_heavy",
|
||||
"buildName": "Imported Type-9 Heavy",
|
||||
"buildCode": "3pftsFklkdisif57e2k2f2h110001020306054j03022f01242i.Iw18eQ==.Aw18eQ==.",
|
||||
"buildText": "[Type-9 Heavy]\nM: 2D/G Fragment Cannon\nM: 2I/F Mine Launcher\nM: 2B/FD Missile Rack\nS: 1I/FS Torpedo Pylon\nS: 1F/F Burst Laser\nU: 0I Chaff Launcher\nU: 0F Electronic Countermeasure\nU: 0I Heat Sink Launcher\nU: 0I Point Defence\n\nBH: 1I Mirrored Surface Composite\nRB: 5A Power Plant\nTM: 7D Thrusters\nFH: 6A Frame Shift Drive\nEC: 5A Life Support\nPC: 4D Power Distributor\nSS: 4D Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n8: 7E Cargo Rack (Capacity: 128)\n7: 6E Cargo Rack (Capacity: 64)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 3E Cargo Rack (Capacity: 8)\n4: 1C Advanced Discovery Scanner\n3: 2E Cargo Rack (Capacity: 4)\n3: 1E Standard Docking Computer\n2: 1C Detailed Surface Scanner\n"
|
||||
},
|
||||
{
|
||||
"shipId": "vulture",
|
||||
"buildName": "Imported Vulture",
|
||||
"buildCode": "4patfFalddksif31e1e0e0j04044a0n532jf1.Iw19kA==.Aw19kA==.",
|
||||
"buildText": "[Vulture]\nL: 3E/G Pulse Laser\nL: 3E/G Pulse Laser\nU: 0A Frame Shift Wake Scanner\nU: 0A Kill Warrant Scanner\nU: 0A Shield Booster\nU: 0A Shield Booster\n\nBH: 1I Reactive Surface Composite\nRB: 4A Power Plant\nTM: 5A Thrusters\nFH: 4A Frame Shift Drive\nEC: 3D Life Support\nPC: 5A Power Distributor\nSS: 4D Sensors\nFS: 3C Fuel Tank (Capacity: 8)\n\n5: 5A Shield Generator\n4: 4A Auto Field-Maintenance Unit\n2: 2A Shield Cell Bank\n1: 1A Fuel Scoop\n1: 1C Fuel Tank (Capacity: 2)"
|
||||
}
|
||||
]
|
||||
@@ -1,50 +0,0 @@
|
||||
{
|
||||
"type_6_transporter": {
|
||||
"Cargo": "A0p0tdFal8d8s8f4-----04040303430101-.Iw18UA==.Aw18UA==.",
|
||||
"Miner": "A0p5tdFal8d8s8f42l2l---040403451q0101-.Iw18UA==.Aw18UA==.",
|
||||
"Hopper": "A0p0tdFal8d0s8f41717---030302024300--.Iw18UA==.Aw18UA==."
|
||||
},
|
||||
"type_7_transport": {
|
||||
"Cargo": "A0p0tiFfliddsdf5--------0505040403480101--.Iw18eQ==.Aw18eQ==.",
|
||||
"Miner": "A0pdtiFflid8sdf5--2l2l----0505041v03450000--.Iw18eQ==.Aw18eQ==."
|
||||
},
|
||||
"federal_dropship": {
|
||||
"Cargo": "A0pdtiFflnddsif4-1717------05040448--020201-.Iw18RQ==.Aw18RQ==."
|
||||
},
|
||||
"asp": {
|
||||
"Miner": "A2pftfFflidfskf50s0s24242l2l---04054a1q02022o27-.Iw18eQ==.Aw18eQ==."
|
||||
},
|
||||
"imperial_clipper": {
|
||||
"Cargo": "A0p5tiFflndisnf4--0s0s----0605450302020101-.Iw18WQ==.Aw18WQ==.",
|
||||
"Dream": "A2pktkFflndpskf40v0v0s0s0404040n4k5n5d2b29292o--.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA.",
|
||||
"Current": "A0patkFflndfskf4-----------------.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA."
|
||||
},
|
||||
"type_9_heavy": {
|
||||
"Current": "A0patsFklndnsif6---------0706054a0303020224--.AwRj4yo5iA==.EwBhEYy6d6g=."
|
||||
},
|
||||
"python": {
|
||||
"Cargo": "A0patnFflidsssf5---------050505040448020201-.Iw18eAMQ.Aw18RQ==.",
|
||||
"Miner": "A0pktkFflidpspf50v0v0v2m2m0404--050505Ce4a1v02022o-.Iw18eAMQ.IwBhBYy6dkCYRA==.",
|
||||
"Dream": "A2pptkFfliduspf50v0v0v27270404040m5n5n4f2d2d032t0201-.Iw1+gDByUA==.EwBhEYy6e0VEA===.",
|
||||
"Missile": "A0pttoFjljdystf52f2g2d2ePh----04044j03---00--.Iw18eAMQ.Aw18RQ==."
|
||||
},
|
||||
"anaconda": {
|
||||
"Dream": "A4putpFklndzsuf52c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d04-0303326b-.AwRj4yo5dzhA.MwBhCYy6duvARhEA.",
|
||||
"Cargo": "A0patnFklndnsxf5----------------06050505040404-45030301-.Iw18ZUAxA===.Aw18ZXEA.",
|
||||
"Current": "A0patnFklndksxf5----------------06050505040404-03034524-.Iw18ZUAxA===.Aw18ZXEA.",
|
||||
"Explorer": "A0patnFklndksxf5--------0202------f7050505040s37--2i4524-.AwRj4yVKJ9jCA===.AwhMIyumQRgkA===.",
|
||||
"Test": "A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.Iw18ZUAxA===.Aw18ZXEA."
|
||||
},
|
||||
"diamondback_explorer": {
|
||||
"Explorer": "A0p0tdFfldddsdf5---0202--320p432i----.AwRj4zTZaA==.AwiMIyqo."
|
||||
},
|
||||
"vulture": {
|
||||
"Bounty Hunter": "A3patcFalddksff31e1e0404-0l4a-5d27662j--.AwRj4z2Gg===.MwBhBYy6oJmAjLMQ."
|
||||
},
|
||||
"fer_de_lance": {
|
||||
"Attack": "A2pfthFalidpsff31r0s0s0s0s000404-04-4a-5d27--.Iw18aAMQ.CwBhrSu8EZxEA===."
|
||||
},
|
||||
"eagle": {
|
||||
"Figther": "A4p0t5F5l3d5s5f20p0p24-4053-2j---.Iw18gDJQ.Aw19kA==."
|
||||
}
|
||||
}
|
||||
@@ -1,50 +0,0 @@
|
||||
{
|
||||
"builds": {
|
||||
"type_6_transporter": {
|
||||
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
|
||||
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
|
||||
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
|
||||
},
|
||||
"type_7_transport": {
|
||||
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
|
||||
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
|
||||
},
|
||||
"federal_dropship": {
|
||||
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
|
||||
},
|
||||
"asp": {
|
||||
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
|
||||
},
|
||||
"imperial_clipper": {
|
||||
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
|
||||
"Dream": "26A6A5A5D6A5A4C0v0v0s0s0404040n4k5n5d2b29292o-.AwRj4yWU1I==.CwBhCYy6YRigzLIA",
|
||||
"Current": "04A6A5A5D4A5A4C----------------.AwRj4yWU1I==.CwBhCYy6YRigzLIA"
|
||||
},
|
||||
"type_9_heavy": {
|
||||
"Current": "04A7D6A5D5D4D6C---------0706054a0303020224.AwRj4yoo.EwBhEYy6dsg="
|
||||
},
|
||||
"python": {
|
||||
"Cargo": "04A6D5A4D6D6D5C---------050505040448020201.Iw18eQ==.Aw18eQ==",
|
||||
"Miner": "06A6A5A4D6A6A5C0v0v0v2m2m0404--050505Ce4a1v02022o.Iw18eQ==.IwBhBYy6dkCYg===",
|
||||
"Dream": "27A6A5A4D7A6A5C0v0v0v27270404040m5n5n4f2d2d032t0201.Iw1+gDBxA===.EwBhEYy6e0WEA==="
|
||||
},
|
||||
"anaconda": {
|
||||
"Dream": "48A7A6A5D8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d040303326b.AwRj4yo5dig=.MwBhCYy6du3ARiA=",
|
||||
"Cargo": "04A6D6A5D5D8D5C----------------0605050504040445030301.Iw18ZlA=.Aw18ZlA=",
|
||||
"Current": "04A6D6A5D5A8D5C----------------0605050504040403034524.Iw18ZlA=.Aw18ZlA=",
|
||||
"Explorer": "04A6D6A5D5A8D5C--------0202------f7050505040s372f2i4524.AwRj4yVKJthA.AwhMIyungRhEA==="
|
||||
},
|
||||
"diamondback_explorer": {
|
||||
"Explorer": "02A4D5A3D3D3D5C---0202--320p432i2f.AwRj4zTI.AwiMIypI"
|
||||
},
|
||||
"vulture": {
|
||||
"Bounty Hunter": "34A4C4A3D5A4A3C1e1e0404-0l4a5d27662j.AwRj4y2I.MwBhBYy6wJmAjLIA"
|
||||
},
|
||||
"fer_de_lance": {
|
||||
"Attack": "25A5C4A4D6A4A3C1r0s0s0s0s000404-04-4a-5d27-.Iw18aQ==.CwBhrSu8EZyA"
|
||||
},
|
||||
"eagle": {
|
||||
"Figther": "42A3A3A1D2A2A2C0p0p24-40532j.AwRj49iA.AwgsIkEZigmIA==="
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,366 +0,0 @@
|
||||
[
|
||||
{
|
||||
"header": {
|
||||
"appName": "Inara",
|
||||
"appVersion": "1.0",
|
||||
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
|
||||
"appCustomProperties": {
|
||||
"inaraCommanderID": 123,
|
||||
"inaraShipID": 123
|
||||
}
|
||||
},
|
||||
"data": {
|
||||
"Ship": "krait_mkii",
|
||||
"ShipID": 7,
|
||||
"ShipName": "pancake hammer",
|
||||
"ShipIdent": "PH-01",
|
||||
"HullValue": 44160710,
|
||||
"ModulesValue": 111274094,
|
||||
"Rebuy": 7771743,
|
||||
"Modules": [
|
||||
{
|
||||
"Slot": "largehardpoint1",
|
||||
"Item": "hpt_mininglaser_fixed_small",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "largehardpoint2",
|
||||
"Item": "hpt_cannon_gimbal_large",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_overcharged",
|
||||
"Level": 2,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_auto_loader"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "largehardpoint3",
|
||||
"Item": "hpt_cannon_gimbal_large",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_overcharged",
|
||||
"Level": 2,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_auto_loader"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "mediumhardpoint1",
|
||||
"Item": "hpt_basicmissilerack_fixed_medium",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_highcapacity",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "mediumhardpoint2",
|
||||
"Item": "hpt_basicmissilerack_fixed_medium",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint1",
|
||||
"Item": "hpt_heatsinklauncher_turret_tiny",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint2",
|
||||
"Item": "hpt_cloudscanner_size0_class3",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint3",
|
||||
"Item": "hpt_shieldbooster_size0_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint4",
|
||||
"Item": "hpt_shieldbooster_size0_class5",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot01_size6",
|
||||
"Item": "int_cargorack_size6_class1",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot02_size6",
|
||||
"Item": "int_cargorack_size6_class1",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot03_size5",
|
||||
"Item": "int_guardianfsdbooster_size5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot04_size5",
|
||||
"Item": "int_fighterbay_size5_class1",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot05_size4",
|
||||
"Item": "int_shieldgenerator_size4_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot06_size3",
|
||||
"Item": "int_dronecontrol_collection_size3_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot07_size3",
|
||||
"Item": "int_dronecontrol_collection_size3_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot08_size2",
|
||||
"Item": "int_refinery_size2_class2",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot09_size1",
|
||||
"Item": "int_dronecontrol_prospector_size1_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "powerplant",
|
||||
"Item": "int_powerplant_size7_class5",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "mainengines",
|
||||
"Item": "int_engine_size6_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "frameshiftdrive",
|
||||
"Item": "int_hyperdrive_size5_class5",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "fsd_longrange",
|
||||
"Level": 2,
|
||||
"Quality": 0.861
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "lifesupport",
|
||||
"Item": "int_lifesupport_size4_class2",
|
||||
"On": true,
|
||||
"Priority": 3
|
||||
},
|
||||
{
|
||||
"Slot": "powerdistributor",
|
||||
"Item": "int_powerdistributor_size7_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "radar",
|
||||
"Item": "int_sensors_size6_class2",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "fueltank",
|
||||
"Item": "int_fueltank_size5_class3",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "armour",
|
||||
"Item": "krait_mkii_armour_grade3",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Engineering": {
|
||||
"BlueprintName": "armour_heavyduty",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
}
|
||||
]
|
||||
}
|
||||
},
|
||||
{
|
||||
"header": {
|
||||
"appName": "Inara",
|
||||
"appVersion": "1.0",
|
||||
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
|
||||
"appCustomProperties": {
|
||||
"inaraCommanderID": 123,
|
||||
"inaraShipID": 123
|
||||
}
|
||||
},
|
||||
"data": {
|
||||
"Ship": "diamondbackxl",
|
||||
"ShipID": 11,
|
||||
"ShipName": "star Hopper",
|
||||
"ShipIdent": "PH-02",
|
||||
"HullValue": 1615649,
|
||||
"ModulesValue": 16981039,
|
||||
"Rebuy": 929837,
|
||||
"Modules": [
|
||||
{
|
||||
"Slot": "tinyhardpoint1",
|
||||
"Item": "hpt_heatsinklauncher_turret_tiny",
|
||||
"On": true,
|
||||
"Value": 3072
|
||||
},
|
||||
{
|
||||
"Slot": "slot01_size4",
|
||||
"Item": "int_fuelscoop_size4_class5",
|
||||
"On": true,
|
||||
"Priority": 3,
|
||||
"Value": 2862364
|
||||
},
|
||||
{
|
||||
"Slot": "slot02_size4",
|
||||
"Item": "int_guardianfsdbooster_size4",
|
||||
"On": true,
|
||||
"Value": 2847499
|
||||
},
|
||||
{
|
||||
"Slot": "slot03_size3",
|
||||
"Item": "int_shieldgenerator_size3_class2",
|
||||
"On": true,
|
||||
"Value": 18812,
|
||||
"Engineering": {
|
||||
"BlueprintName": "shieldgenerator_thermic",
|
||||
"Level": 3,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_shield_health"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "slot04_size3",
|
||||
"Item": "int_repairer_size3_class5",
|
||||
"On": true,
|
||||
"Value": 2302911
|
||||
},
|
||||
{
|
||||
"Slot": "slot05_size2",
|
||||
"Item": "int_buggybay_size2_class2",
|
||||
"On": true,
|
||||
"Priority": 3,
|
||||
"Value": 21600
|
||||
},
|
||||
{
|
||||
"Slot": "slot06_size2",
|
||||
"Item": "int_cargorack_size2_class1",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Value": 2852
|
||||
},
|
||||
{
|
||||
"Slot": "slot07_size1",
|
||||
"Item": "int_supercruiseassist",
|
||||
"On": true,
|
||||
"Priority": 3,
|
||||
"Value": 9121
|
||||
},
|
||||
{
|
||||
"Slot": "slot08_size1",
|
||||
"Item": "int_detailedsurfacescanner_tiny",
|
||||
"On": true,
|
||||
"Value": 250000,
|
||||
"Engineering": {
|
||||
"BlueprintName": "sensor_expanded",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "powerplant",
|
||||
"Item": "int_powerplant_size4_class5",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Value": 1441233,
|
||||
"Engineering": {
|
||||
"BlueprintName": "powerplant_boosted",
|
||||
"Level": 1,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "mainengines",
|
||||
"Item": "int_engine_size4_class5",
|
||||
"On": true,
|
||||
"Value": 1610080,
|
||||
"Engineering": {
|
||||
"BlueprintName": "engine_dirty",
|
||||
"Level": 5,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_engine_lightweight"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "frameshiftdrive",
|
||||
"Item": "int_hyperdrive_size5_class5",
|
||||
"On": true,
|
||||
"Value": 5103953,
|
||||
"Engineering": {
|
||||
"BlueprintName": "fsd_longrange",
|
||||
"Level": 5,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_fsd_lightweight"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "lifesupport",
|
||||
"Item": "int_lifesupport_size3_class2",
|
||||
"On": true,
|
||||
"Value": 10133,
|
||||
"Engineering": {
|
||||
"BlueprintName": "misc_lightweight",
|
||||
"Level": 3,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "powerdistributor",
|
||||
"Item": "int_powerdistributor_size4_class5",
|
||||
"On": true,
|
||||
"Value": 389022,
|
||||
"Engineering": {
|
||||
"BlueprintName": "powerdistributor_highfrequency",
|
||||
"Level": 4,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "radar",
|
||||
"Item": "int_sensors_size3_class2",
|
||||
"On": true,
|
||||
"Value": 10133,
|
||||
"Engineering": {
|
||||
"BlueprintName": "sensor_lightweight",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "fueltank",
|
||||
"Item": "int_fueltank_size5_class3",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Value": 97754
|
||||
},
|
||||
{
|
||||
"Slot": "armour",
|
||||
"Item": "diamondbackxl_armour_grade1",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Engineering": {
|
||||
"BlueprintName": "armour_heavyduty",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
}
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
@@ -1,8 +0,0 @@
|
||||
{
|
||||
"krait_mkii": {
|
||||
"Imported pancake hammer": "A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ==.AwRgzKIkA===."
|
||||
},
|
||||
"diamondback_explorer": {
|
||||
"Imported star Hopper": "A0pataFflddfsdf5---02---321P430iv6013w2i.Iw18SQ==.AwRm44GYpKg=."
|
||||
}
|
||||
}
|
||||
@@ -1,188 +0,0 @@
|
||||
[
|
||||
{
|
||||
"header": {
|
||||
"appName": "Inara",
|
||||
"appVersion": "1.0",
|
||||
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
|
||||
"appCustomProperties": {
|
||||
"inaraCommanderID": 123,
|
||||
"inaraShipID": 123
|
||||
}
|
||||
},
|
||||
"data": {
|
||||
"Ship": "krait_mkii",
|
||||
"ShipID": 7,
|
||||
"ShipName": "pancake hammer",
|
||||
"ShipIdent": "PH-01",
|
||||
"HullValue": 44160710,
|
||||
"ModulesValue": 111274094,
|
||||
"Rebuy": 7771743,
|
||||
"Modules": [
|
||||
{
|
||||
"Slot": "largehardpoint1",
|
||||
"Item": "hpt_mininglaser_fixed_small",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "largehardpoint2",
|
||||
"Item": "hpt_cannon_gimbal_large",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_overcharged",
|
||||
"Level": 2,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_auto_loader"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "largehardpoint3",
|
||||
"Item": "hpt_cannon_gimbal_large",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_overcharged",
|
||||
"Level": 2,
|
||||
"Quality": 1,
|
||||
"ExperimentalEffect": "special_auto_loader"
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "mediumhardpoint1",
|
||||
"Item": "hpt_basicmissilerack_fixed_medium",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "weapon_highcapacity",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "mediumhardpoint2",
|
||||
"Item": "hpt_basicmissilerack_fixed_medium",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint1",
|
||||
"Item": "hpt_heatsinklauncher_turret_tiny",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint2",
|
||||
"Item": "hpt_cloudscanner_size0_class3",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint3",
|
||||
"Item": "hpt_shieldbooster_size0_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "tinyhardpoint4",
|
||||
"Item": "hpt_shieldbooster_size0_class5",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot01_size6",
|
||||
"Item": "int_cargorack_size6_class1",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot02_size6",
|
||||
"Item": "int_cargorack_size6_class1",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "slot03_size5",
|
||||
"Item": "int_guardianfsdbooster_size5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot04_size5",
|
||||
"Item": "int_fighterbay_size5_class1",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot05_size4",
|
||||
"Item": "int_shieldgenerator_size4_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot06_size3",
|
||||
"Item": "int_dronecontrol_collection_size3_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot07_size3",
|
||||
"Item": "int_dronecontrol_collection_size3_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot08_size2",
|
||||
"Item": "int_refinery_size2_class2",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "slot09_size1",
|
||||
"Item": "int_dronecontrol_prospector_size1_class4",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "powerplant",
|
||||
"Item": "int_powerplant_size7_class5",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "mainengines",
|
||||
"Item": "int_engine_size6_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "frameshiftdrive",
|
||||
"Item": "int_hyperdrive_size5_class5",
|
||||
"On": true,
|
||||
"Engineering": {
|
||||
"BlueprintName": "fsd_longrange",
|
||||
"Level": 2,
|
||||
"Quality": 0.861
|
||||
}
|
||||
},
|
||||
{
|
||||
"Slot": "lifesupport",
|
||||
"Item": "int_lifesupport_size4_class2",
|
||||
"On": true,
|
||||
"Priority": 3
|
||||
},
|
||||
{
|
||||
"Slot": "powerdistributor",
|
||||
"Item": "int_powerdistributor_size7_class5",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "radar",
|
||||
"Item": "int_sensors_size6_class2",
|
||||
"On": true
|
||||
},
|
||||
{
|
||||
"Slot": "fueltank",
|
||||
"Item": "int_fueltank_size5_class3",
|
||||
"On": true,
|
||||
"Priority": 1
|
||||
},
|
||||
{
|
||||
"Slot": "armour",
|
||||
"Item": "krait_mkii_armour_grade3",
|
||||
"On": true,
|
||||
"Priority": 1,
|
||||
"Engineering": {
|
||||
"BlueprintName": "armour_heavyduty",
|
||||
"Level": 5,
|
||||
"Quality": 1
|
||||
}
|
||||
}
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
@@ -1,67 +0,0 @@
|
||||
{
|
||||
"builds": {
|
||||
"type_6_transporter": {
|
||||
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
|
||||
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
|
||||
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
|
||||
},
|
||||
"type_7_transport": {
|
||||
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
|
||||
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
|
||||
},
|
||||
"federal_dropship": {
|
||||
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
|
||||
},
|
||||
"asp": {
|
||||
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
|
||||
},
|
||||
"cobra_mk_iii": {
|
||||
"Example": "24A4A4A3D3A3A4C0s0s2d2d0m0445032b2o2753.AwRj4yKA.CwBhEYyrKhmMQ==="
|
||||
},
|
||||
"imperial_clipper": {
|
||||
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
|
||||
"Multi-purpose": "26A4A5A5D6A5A4C0v0v272704090j0h064f2c0302020101",
|
||||
"Current": "05A6D5A5D6A5A4C0v0v27270404050n4m05035d29292o01.AwRj4yrI.AwhMIyuBGNiA",
|
||||
"Dream": "26A6A5A5D6A5A4C0v0v0s0s04040c0n064f5d2b02022o0d.AwRj49UlmI==.AwiMIyuo"
|
||||
},
|
||||
"type_9_heavy": {
|
||||
"Cargo": "04A6D6A5D4D4D5C---------07064f040303010201.AwRj4yoo.EwBhEYy6dsg="
|
||||
},
|
||||
"python": {
|
||||
"Cargo": "04A6D5A4D6D6D5C---------050505044a03020201",
|
||||
"Miner": "04A6D5A4D6D6D5C---2m2m----050505044d1v02022o"
|
||||
},
|
||||
"anaconda": {
|
||||
"Dream": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100034k5n05050404040303326b.AwRj4yo5dig=.MwBhEYy6duwEziA=",
|
||||
"Cargo": "03A7D6A5D4D8D5C----------------060505054d040403030301.AwRj4yuqg===.Aw18ZlA=",
|
||||
"Modified": "0pyttFolodDsyf5------1717--------05044j-03----2h00.Iw18ZlA=.Aw18ZlA=.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA=="
|
||||
},
|
||||
"diamondback_explorer": {
|
||||
"Explorer": "02A4D5A3D3D3D5C-------320p432i2f.AwRj4zTI.AwiMIypI"
|
||||
}
|
||||
},
|
||||
"comparisons": {
|
||||
"Test": {
|
||||
"facets": [ 9, 6, 4, 1, 3, 2 ],
|
||||
"builds": [
|
||||
{
|
||||
"shipId": "anaconda",
|
||||
"buildName": "Dream"
|
||||
},
|
||||
{
|
||||
"shipId": "asp",
|
||||
"buildName": "Miner"
|
||||
},
|
||||
{
|
||||
"shipId": "diamondback_explorer",
|
||||
"buildName": "Explorer"
|
||||
}
|
||||
]
|
||||
}
|
||||
},
|
||||
"insurance": "Beta",
|
||||
"discounts": [
|
||||
1,
|
||||
1
|
||||
]
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,90 +0,0 @@
|
||||
import Ship from '../src/app/shipyard/Ship';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
|
||||
|
||||
describe("Agility", function() {
|
||||
|
||||
it("correctly calculates speed", function() {
|
||||
let agilityData = require('./fixtures/agility-data');
|
||||
|
||||
for (let shipId in agilityData) {
|
||||
for (let thrusterId in agilityData[shipId]) {
|
||||
const thrusterData = agilityData[shipId][thrusterId];
|
||||
let shipData = Ships[shipId];
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildWith(shipData.defaults);
|
||||
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
|
||||
|
||||
expect(Math.round(ship.topSpeed)).toBe(thrusterData.speed);
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
it("correctly calculates boost", function() {
|
||||
let agilityData = require('./fixtures/agility-data');
|
||||
|
||||
for (let shipId in agilityData) {
|
||||
for (let thrusterId in agilityData[shipId]) {
|
||||
const thrusterData = agilityData[shipId][thrusterId];
|
||||
let shipData = Ships[shipId];
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildWith(shipData.defaults);
|
||||
// Turn off internals to ensure we have enough power to boost
|
||||
for (let internal in ship.internal) {
|
||||
ship.internal[internal].enabled = 0;
|
||||
}
|
||||
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
|
||||
|
||||
expect(Math.round(ship.topBoost)).toBe(thrusterData.boost);
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
it("correctly calculates pitch", function() {
|
||||
let agilityData = require('./fixtures/agility-data');
|
||||
|
||||
for (let shipId in agilityData) {
|
||||
for (let thrusterId in agilityData[shipId]) {
|
||||
const thrusterData = agilityData[shipId][thrusterId];
|
||||
let shipData = Ships[shipId];
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildWith(shipData.defaults);
|
||||
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
|
||||
|
||||
expect(Math.round(ship.pitches[4] * 100) / 100).toBeCloseTo(thrusterData.pitch, 1);
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
it("correctly calculates roll", function() {
|
||||
let agilityData = require('./fixtures/agility-data');
|
||||
|
||||
for (let shipId in agilityData) {
|
||||
for (let thrusterId in agilityData[shipId]) {
|
||||
const thrusterData = agilityData[shipId][thrusterId];
|
||||
let shipData = Ships[shipId];
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildWith(shipData.defaults);
|
||||
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
|
||||
|
||||
expect(Math.round(ship.rolls[4] * 100) / 100).toBeCloseTo(thrusterData.roll, 1);
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
it("correctly calculates yaw", function() {
|
||||
let agilityData = require('./fixtures/agility-data');
|
||||
|
||||
for (let shipId in agilityData) {
|
||||
for (let thrusterId in agilityData[shipId]) {
|
||||
const thrusterData = agilityData[shipId][thrusterId];
|
||||
let shipData = Ships[shipId];
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildWith(shipData.defaults);
|
||||
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
|
||||
|
||||
expect(Math.round(ship.yaws[4] * 100) / 100).toBeCloseTo(thrusterData.yaw, 1);
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
@@ -1,368 +0,0 @@
|
||||
jest.unmock('../src/app/stores/Persist');
|
||||
jest.unmock('../src/app/components/TranslatedComponent');
|
||||
jest.unmock('../src/app/components/ModalImport');
|
||||
jest.unmock('prop-types');
|
||||
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import ReactDOM from 'react-dom';
|
||||
import TU from 'react-testutils-additions';
|
||||
import Utils from './testUtils';
|
||||
import { getLanguage } from '../src/app/i18n/Language';
|
||||
|
||||
describe('Import Modal', function() {
|
||||
|
||||
let MockRouter = require('../src/app/Router').default;
|
||||
const Persist = require('../src/app/stores/Persist').default;
|
||||
const ModalImport = require('../src/app/components/ModalImport').default;
|
||||
const mockContext = {
|
||||
language: getLanguage('en'),
|
||||
sizeRatio: 1,
|
||||
openMenu: jest.fn(),
|
||||
closeMenu: jest.fn(),
|
||||
showModal: jest.fn(),
|
||||
hideModal: jest.fn(),
|
||||
tooltip: jest.fn(),
|
||||
termtip: jest.fn(),
|
||||
onWindowResize: jest.fn()
|
||||
};
|
||||
|
||||
let modal, render, ContextProvider = Utils.createContextProvider(mockContext);
|
||||
|
||||
/**
|
||||
* Clear saved builds, and reset React DOM
|
||||
*/
|
||||
function reset() {
|
||||
MockRouter.go.mockClear();
|
||||
Persist.deleteAll();
|
||||
render = TU.renderIntoDocument(<ContextProvider><ModalImport /></ContextProvider>);
|
||||
modal = TU.findRenderedComponentWithType(render, ModalImport);
|
||||
}
|
||||
|
||||
/**
|
||||
* Simulate user import text entry / paste
|
||||
* @param {string} text Import text / raw data
|
||||
*/
|
||||
function pasteText(text) {
|
||||
let textarea = TU.findRenderedDOMComponentWithTag(render, 'textarea');
|
||||
TU.Simulate.change(textarea, { target: { value: text } });
|
||||
}
|
||||
|
||||
/**
|
||||
* Simulate click on Proceed button
|
||||
*/
|
||||
function clickProceed() {
|
||||
let proceedButton = TU.findRenderedDOMComponentWithId(render, 'proceed');
|
||||
TU.Simulate.click(proceedButton);
|
||||
}
|
||||
|
||||
/**
|
||||
* Simulate click on Import button
|
||||
*/
|
||||
function clickImport() {
|
||||
let importButton = TU.findRenderedDOMComponentWithId(render, 'import');
|
||||
TU.Simulate.click(importButton);
|
||||
}
|
||||
|
||||
describe('Import Backup', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a valid backup', function() {
|
||||
let importData = require('./fixtures/valid-backup');
|
||||
let importString = JSON.stringify(importData);
|
||||
|
||||
expect(modal.state.importValid).toEqual(false);
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
pasteText(importString);
|
||||
expect(modal.state.importValid).toBe(true);
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.builds).toEqual(importData.builds);
|
||||
expect(modal.state.comparisons).toEqual(importData.comparisons);
|
||||
expect(modal.state.shipDiscount).toEqual(importData.discounts[0]);
|
||||
expect(modal.state.moduleDiscount).toEqual(importData.discounts[1]);
|
||||
expect(modal.state.insurance).toBe(importData.insurance.toLowerCase());
|
||||
clickProceed();
|
||||
expect(modal.state.processed).toBe(true);
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
clickImport();
|
||||
expect(Persist.getBuilds()).toEqual(importData.builds);
|
||||
expect(Persist.getComparisons()).toEqual(importData.comparisons);
|
||||
expect(Persist.getInsurance()).toEqual(importData.insurance.toLowerCase());
|
||||
expect(Persist.getShipDiscount()).toEqual(importData.discounts[0]);
|
||||
expect(Persist.getModuleDiscount()).toEqual(importData.discounts[1]);
|
||||
});
|
||||
|
||||
it('imports an old valid backup', function() {
|
||||
const importData = require('./fixtures/old-valid-export');
|
||||
const importStr = JSON.stringify(importData);
|
||||
|
||||
pasteText(importStr);
|
||||
expect(modal.state.builds).toEqual(importData.builds);
|
||||
expect(modal.state.importValid).toBe(true);
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
clickProceed();
|
||||
expect(modal.state.processed).toBeTruthy();
|
||||
clickImport();
|
||||
expect(Persist.getBuilds()).toEqual(importData.builds);
|
||||
});
|
||||
|
||||
it('catches an invalid backup', function() {
|
||||
const importData = require('./fixtures/valid-backup');
|
||||
let invalidImportData = Object.assign({}, importData);
|
||||
// Remove Asp Miner build used in comparison
|
||||
delete(invalidImportData.builds.asp);
|
||||
|
||||
pasteText('"this is not valid"');
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(modal.state.errorMsg).toEqual('Must be an object or array!');
|
||||
|
||||
pasteText('{ "builds": "Should not be a string" }');
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(modal.state.errorMsg).toEqual('builds must be an object!');
|
||||
|
||||
pasteText(JSON.stringify(importData).replace(/anaconda/g, 'invalid_ship'));
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(Object.keys(modal.state.builds)).not.toContain('anaconda');
|
||||
|
||||
pasteText(JSON.stringify(importData).replace('Dream', ''));
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(Object.keys(modal.state.builds.imperial_clipper).length).toEqual(3);
|
||||
|
||||
pasteText(JSON.stringify(invalidImportData));
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(modal.state.errorMsg).toEqual('asp build "Miner" data is missing!');
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import Detailed V3 Build', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a valid v3 build', function() {
|
||||
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.&bn=Test%20My%20Ship');
|
||||
});
|
||||
|
||||
it('catches an invalid build', function() {
|
||||
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
|
||||
pasteText(JSON.stringify(importData).replace('references', 'refs'));
|
||||
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(modal.state.errorMsg).toEqual('Anaconda Build "Test My Ship": Invalid data');
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import Detailed V4 Build', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a valid v4 build', function() {
|
||||
const importData = require('./fixtures/anaconda-test-detailed-export-v4');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.H4sIAAAAAAAAE2MUe8HMwPD%2FPwMAAGvB0AkAAAA%3D&bn=Test%20My%20Ship');
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import Detailed Engineered V4 Build', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a valid v4 build', function() {
|
||||
const importData = require('./fixtures/asp-test-detailed-export-v4');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/asp?code=A0pftiFflfddsnf5------020202033c044002v6-2i-.AwRj4yvYg%3D%3D%3D.CwRgDBldHn5A.H4sIAAAAAAAAE2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FA7kMAExxqlSAAAAA&bn=Multi-purpose%20Asp%20Explorer');
|
||||
});
|
||||
|
||||
it('imports a valid v4 build with modifications', function() {
|
||||
const importData = require('./fixtures/courier-test-detailed-export-v4');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/imperial_courier?code=A0patzF5l0das8f31a1a270202000e402t0101----.AwRj4zOYg%3D%3D%3D.CwRgDBldLuZA.H4sIAAAAAAAAE12OPUvDYBSFT1OTfkRJjUkbbC3Yj8mlODgUISAtdOlety5ODv0Vgji7O7kJ%2FgzBQX%2BEY7Gg0NKhfY%2FnHQLFDBdynufe9%2BRMCmCb06g29oCgacjiRx6gY6oWKUT8UgLaszqQfHmSnpVFN1uSeXNsJVcj%2FA2EHlZkspIUpUc6UjTXGT85qwHuSEuVc%2F16r99kDQeSSjvSbSjpyUpNK10uJJ3aYqk6smwm1lQ9bOxw71TMm8VanEqq9JW1r3Qo%2BREOLnQHvbWmb7rZIu5VLIyGQGOukPv%2F0WQk5LeEAjPOUDwtAP6bShy2HKAz0HPO%2B5KsP25I79O2I7LvD%2Bz4Il1XAQAA&bn=Multi-purpose%20Imperial%20Courier');
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import Detailed Builds Array', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports all builds', function() {
|
||||
const importData = require('./fixtures/valid-detailed-export');
|
||||
const expectedBuilds = require('./fixtures/expected-builds');
|
||||
|
||||
pasteText(JSON.stringify(importData));
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
clickProceed();
|
||||
expect(modal.state.processed).toBeTruthy();
|
||||
clickImport();
|
||||
|
||||
let builds = Persist.getBuilds();
|
||||
|
||||
for (let s in builds) {
|
||||
for (let b in builds[s]) {
|
||||
expect(builds[s][b]).toEqual(expectedBuilds[s][b]);
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import Companion API Build', function() {
|
||||
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a valid companion API build', function() {
|
||||
const importData = require('./fixtures/companion-api-import-1');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/federal_corvette?code=A2putsFklndzsxf50x0x7l28281919040404040402020l06p05sf63c5ifr--v66g--.AwRj4zNapI%3D%3D.CwRgDBldUExuBiIlWIA%3D.&bn=Imported%20Federal%20Corvette');
|
||||
});
|
||||
|
||||
it('imports a valid companion API build', function() {
|
||||
const importData = require('./fixtures/companion-api-import-2');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/beluga?code=A0pktsFplCdpsnf70t0t2727270004040404043c4fmimlmm04mc0iv62i--.AwRj4yusg%3D%3D%3D.CwRgDBldHi8IWIA%3D.&bn=Imported%20Beluga%20Liner');
|
||||
});
|
||||
|
||||
it('imports a valid companion API build', function() {
|
||||
const importData = require('./fixtures/companion-api-import-3');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/type_7_transport?code=A0patfFflidasdf5----0404040005050504044d2402--.AwRj4yoo.CwRgDBlVK7HjEA%3D%3D.&bn=Imported%20Type-7%20Transporter');
|
||||
});
|
||||
|
||||
it('imports a valid companion API build', function() {
|
||||
const importData = require('./fixtures/companion-api-import-4');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/cobra_mk_iii?code=A0p0tdFaldd3sdf4------34----2i--.AwRj4yqA.CwRgDMYExrezBig%3D.&bn=Imported%20Cobra%20Mk%20III');
|
||||
});
|
||||
});
|
||||
|
||||
describe('Import E:D Shipyard Builds', function() {
|
||||
|
||||
// it('imports a valid build', function() {
|
||||
// const imports = require('./fixtures/ed-shipyard-import-valid');
|
||||
//
|
||||
// for (let i = 0; i < imports.length; i++ ) {
|
||||
// reset();
|
||||
// let fixture = imports[i];
|
||||
// pasteText(fixture.buildText);
|
||||
// expect(modal.state.importValid).toBeTruthy();
|
||||
// expect(modal.state.errorMsg).toEqual(null);
|
||||
// clickProceed();
|
||||
// expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
// expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/' + fixture.shipId + '?code=' + encodeURIComponent(fixture.buildCode) + '&bn=' + encodeURIComponent(fixture.buildName));
|
||||
// }
|
||||
// });
|
||||
|
||||
it('catches invalid builds', function() {
|
||||
const imports = require('./fixtures/ed-shipyard-import-invalid');
|
||||
|
||||
for (let i = 0; i < imports.length; i++ ) {
|
||||
reset();
|
||||
pasteText(imports[i].buildText);
|
||||
expect(modal.state.importValid).toBeFalsy();
|
||||
expect(modal.state.errorMsg).toEqual(imports[i].errorMsg);
|
||||
}
|
||||
});
|
||||
});
|
||||
|
||||
describe('Imports from a Comparison', function() {
|
||||
|
||||
it('imports a valid comparison', function() {
|
||||
const importBuilds = require('./fixtures/valid-backup').builds;
|
||||
Persist.deleteAll();
|
||||
render = TU.renderIntoDocument(<ContextProvider><ModalImport builds={importBuilds} /></ContextProvider>);
|
||||
modal = TU.findRenderedComponentWithType(render, ModalImport);
|
||||
|
||||
expect(modal.state.processed).toBe(true);
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
clickImport();
|
||||
expect(Persist.getBuilds()).toEqual(importBuilds);
|
||||
});
|
||||
});
|
||||
|
||||
describe('Imports SLEF data', () => {
|
||||
beforeEach(reset);
|
||||
|
||||
it('imports a single valid SLEF build', () => {
|
||||
const importData = require('./fixtures/slef-single-build.json');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(true);
|
||||
clickProceed();
|
||||
expect(MockRouter.go.mock.calls.length).toBe(1);
|
||||
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/krait_mkii?code=A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ%3D%3D.AwRgzKIkA%3D%3D%3D.&bn=Imported%20pancake%20hammer');
|
||||
});
|
||||
|
||||
it('imports multiple SLEF builds', () => {
|
||||
const importData = require('./fixtures/slef-multiple-builds.json');
|
||||
const expectedBuilds = require('./fixtures/slef-multiple-expected-builds.json');
|
||||
pasteText(JSON.stringify(importData));
|
||||
|
||||
expect(modal.state.importValid).toBeTruthy();
|
||||
expect(modal.state.errorMsg).toEqual(null);
|
||||
expect(modal.state.singleBuild).toBe(false);
|
||||
clickProceed();
|
||||
expect(modal.state.processed).toBeTruthy();
|
||||
clickImport();
|
||||
|
||||
const builds = Persist.getBuilds();
|
||||
|
||||
for (const shipModel in builds) {
|
||||
for (const buildName in builds[shipModel]) {
|
||||
expect(builds[shipModel][buildName])
|
||||
.toEqual(expectedBuilds[shipModel][buildName]);
|
||||
}
|
||||
}
|
||||
});
|
||||
});
|
||||
});
|
||||
@@ -1,143 +0,0 @@
|
||||
jest.unmock('../src/app/stores/Persist');
|
||||
|
||||
import React from 'react';
|
||||
import ReactDOM from 'react-dom';
|
||||
import TU from 'react-testutils-additions';
|
||||
|
||||
let origAddEventListener = window.addEventListener;
|
||||
let storageListener;
|
||||
let ls = {};
|
||||
|
||||
// Implment mock localStorage
|
||||
let localStorage = {
|
||||
getItem: function(key) {
|
||||
return ls[key];
|
||||
},
|
||||
setItem: function(key, value) {
|
||||
ls[key] = value;
|
||||
},
|
||||
removeItem: function(key) {
|
||||
delete ls[key];
|
||||
},
|
||||
clear: function() {
|
||||
ls = {};
|
||||
}
|
||||
}
|
||||
|
||||
window.addEventListener = function(eventName, listener) {
|
||||
|
||||
if(eventName == 'storage') {
|
||||
storageListener = listener; // Keep track of latest storage listener
|
||||
} else {
|
||||
origAddEventListener.apply(arguments);
|
||||
}
|
||||
}
|
||||
|
||||
describe('Persist', function() {
|
||||
|
||||
const Persist = require('../src/app/stores/Persist').Persist;
|
||||
|
||||
describe('Multi tab/window', function() {
|
||||
it("syncs builds", function() {
|
||||
window.localStorage = localStorage;
|
||||
ls = {};
|
||||
let p = new Persist();
|
||||
let newBuilds = {
|
||||
anaconda: { test: '1234' }
|
||||
};
|
||||
|
||||
storageListener({ key: 'builds', newValue: JSON.stringify(newBuilds) });
|
||||
expect(p.getBuild('anaconda', 'test')).toBe('1234');
|
||||
});
|
||||
});
|
||||
|
||||
describe('General and Settings', function() {
|
||||
it("has defaults", function() {
|
||||
window.localStorage = localStorage;
|
||||
ls = {};
|
||||
let p = new Persist();
|
||||
expect(p.getLangCode()).toBe('en');
|
||||
expect(p.showTooltips()).toBe(true);
|
||||
expect(p.getInsurance()).toBe('standard');
|
||||
expect(p.getShipDiscount()).toBe(0);
|
||||
expect(p.getModuleDiscount()).toBe(0);
|
||||
expect(p.getSizeRatio()).toBe(1);
|
||||
});
|
||||
|
||||
it("loads from localStorage correctly", function() {
|
||||
window.localStorage = localStorage;
|
||||
let savedData = require('./fixtures/valid-backup');
|
||||
ls = {};
|
||||
ls.builds = JSON.stringify(savedData.builds);
|
||||
ls.NG_TRANSLATE_LANG_KEY = 'de';
|
||||
ls.insurance = 'Standard';
|
||||
ls.shipDiscount = 0.25;
|
||||
ls.moduleDiscount = 0.15;
|
||||
let p = new Persist();
|
||||
|
||||
expect(p.getInsurance()).toBe('standard');
|
||||
expect(p.getShipDiscount()).toBe(0.25);
|
||||
expect(p.getModuleDiscount()).toBe(0.15);
|
||||
expect(p.getLangCode()).toEqual('de');
|
||||
expect(p.getBuilds('anaconda')).toEqual(savedData.builds.anaconda);
|
||||
expect(p.getBuilds('python')).toEqual(savedData.builds.python);
|
||||
expect(p.getBuildsNamesFor('imperial_clipper')).toEqual(['Cargo', 'Current', 'Dream', 'Multi-purpose']);
|
||||
expect(p.getBuild('type_7_transport', 'Cargo')).toEqual('02A5D5A4D3D3D5C--------0505040403480101');
|
||||
});
|
||||
|
||||
it("uses defaults from a corrupted localStorage", function() {
|
||||
window.localStorage = localStorage;
|
||||
ls = {};
|
||||
ls.builds = "not valid json";
|
||||
ls.comparisons = "1, 3, 4";
|
||||
ls.insurance = 'this insurance does not exist';
|
||||
ls.shipDiscount = 'this is not a number';
|
||||
ls.moduleDiscount = 10; // Way to big
|
||||
|
||||
let p = new Persist();
|
||||
expect(p.getLangCode()).toBe('en');
|
||||
expect(p.showTooltips()).toBe(true);
|
||||
expect(p.getInsurance()).toBe('standard');
|
||||
expect(p.getShipDiscount()).toBe(0);
|
||||
expect(p.getModuleDiscount()).toBe(0);
|
||||
expect(p.getBuilds()).toEqual({});
|
||||
expect(p.getComparisons()).toEqual({});
|
||||
});
|
||||
|
||||
it("works without localStorage", function() {
|
||||
window.localStorage = null;
|
||||
let p = new Persist();
|
||||
expect(p.getLangCode()).toBe('en');
|
||||
expect(p.showTooltips()).toBe(true);
|
||||
expect(p.getInsurance()).toBe('standard');
|
||||
expect(p.getShipDiscount()).toBe(0);
|
||||
expect(p.getModuleDiscount()).toBe(0);
|
||||
expect(p.getSizeRatio()).toBe(1);
|
||||
|
||||
p.saveBuild('anaconda', 'test', '12345');
|
||||
expect(p.getBuild('anaconda', 'test')).toBe('12345');
|
||||
|
||||
p.deleteBuild('anaconda', 'test');
|
||||
expect(p.hasBuilds()).toBe(false);
|
||||
});
|
||||
|
||||
it("generates the backup", function() {
|
||||
window.localStorage = localStorage;
|
||||
let savedData = require('./fixtures/valid-backup');
|
||||
ls = {};
|
||||
ls.builds = JSON.stringify(savedData.builds);
|
||||
ls.insurance = 'Beta';
|
||||
ls.shipDiscount = 0.25;
|
||||
ls.moduleDiscount = 0.15;
|
||||
|
||||
let p = new Persist();
|
||||
let backup = p.getAll();
|
||||
|
||||
expect(backup.insurance).toBe('beta');
|
||||
expect(backup.shipDiscount).toBe(0.25);
|
||||
expect(backup.moduleDiscount).toBe(0.15);
|
||||
expect(backup.builds).toEqual(savedData.builds);
|
||||
expect(backup.comparisons).toEqual({});
|
||||
});
|
||||
});
|
||||
})
|
||||
@@ -1,63 +0,0 @@
|
||||
import Ship from '../src/app/shipyard/Ship';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import * as Serializer from '../src/app/shipyard/Serializer';
|
||||
import jsen from 'jsen';
|
||||
|
||||
describe("Serializer", function() {
|
||||
const anacondaTestExport = require.requireActual('./fixtures/anaconda-test-detailed-export-v4');
|
||||
const code = anacondaTestExport.references[0].code;
|
||||
const anaconda = Ships.anaconda;
|
||||
const validate = jsen(require('../src/schemas/ship-loadout/4'));
|
||||
|
||||
describe("To Detailed Build", function() {
|
||||
let testBuild = new Ship('anaconda', anaconda.properties, anaconda.slots).buildFrom(code);
|
||||
let exportData = Serializer.toDetailedBuild('Test My Ship', testBuild);
|
||||
|
||||
it("conforms to the v4 ship-loadout schema", function() {
|
||||
expect(validate(exportData)).toBe(true);
|
||||
});
|
||||
|
||||
it("contains the correct components and stats", function() {
|
||||
expect(exportData.components).toEqual(anacondaTestExport.components);
|
||||
expect(exportData.stats).toEqual(anacondaTestExport.stats);
|
||||
expect(exportData.ship).toEqual(anacondaTestExport.ship);
|
||||
expect(exportData.name).toEqual(anacondaTestExport.name);
|
||||
});
|
||||
|
||||
});
|
||||
|
||||
describe("Export Detailed Builds", function() {
|
||||
const expectedExport = require('./fixtures/valid-detailed-export');
|
||||
const builds = require('./fixtures/expected-builds');
|
||||
const exportData = Serializer.toDetailedExport(builds);
|
||||
|
||||
it("conforms to the v4 ship-loadout schema", function() {
|
||||
expect(exportData instanceof Array).toBe(true);
|
||||
|
||||
for (let detailedBuild of exportData) {
|
||||
expect(validate(detailedBuild)).toBe(true);
|
||||
}
|
||||
});
|
||||
|
||||
});
|
||||
|
||||
describe("From Detailed Build", function() {
|
||||
|
||||
it("builds the ship correctly", function() {
|
||||
let testBuildA = new Ship('anaconda', anaconda.properties, anaconda.slots);
|
||||
testBuildA.buildFrom(code);
|
||||
let testBuildB = Serializer.fromDetailedBuild(anacondaTestExport);
|
||||
|
||||
for(var p in testBuildB) {
|
||||
if (p == 'availCS') {
|
||||
continue;
|
||||
}
|
||||
expect(testBuildB[p]).toEqual(testBuildA[p], p + ' does not match');
|
||||
}
|
||||
|
||||
});
|
||||
|
||||
});
|
||||
|
||||
|
||||
});
|
||||
@@ -1,156 +0,0 @@
|
||||
import Ship from '../src/app/shipyard/Ship';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
|
||||
|
||||
describe("Ship", function() {
|
||||
|
||||
it("can build all ships", function() {
|
||||
for (let s in Ships) {
|
||||
let shipData = Ships[s];
|
||||
let ship = new Ship(s, shipData.properties, shipData.slots);
|
||||
|
||||
for (let p in shipData.properties) {
|
||||
expect(ship[p]).toEqual(shipData.properties[p], s + ' property [' + p + '] does not match when built');
|
||||
}
|
||||
|
||||
ship.buildWith(shipData.defaults);
|
||||
|
||||
expect(ship.totalCost).toEqual(shipData.retailCost, s + ' retail cost does not match default build cost');
|
||||
expect(ship.cargoCapacity).toBeDefined();
|
||||
expect(ship.priorityBands[0].retracted).toBeGreaterThan(0, s + ' priorityBands');
|
||||
expect(ship.powerAvailable).toBeGreaterThan(0, s + ' powerAvailable');
|
||||
expect(ship.unladenRange).toBeGreaterThan(0, s + ' unladenRange');
|
||||
expect(ship.ladenRange).toBeGreaterThan(0, s + ' ladenRange');
|
||||
expect(ship.fuelCapacity).toBeGreaterThan(0, s + ' fuelCapacity');
|
||||
expect(ship.unladenFastestRange).toBeGreaterThan(0, s + ' unladenFastestRange');
|
||||
expect(ship.ladenFastestRange).toBeGreaterThan(0, s + ' ladenFastestRange');
|
||||
expect(ship.shield).toBeGreaterThan(0, s + ' shield');
|
||||
expect(ship.armour).toBeGreaterThan(0, s + ' armour');
|
||||
expect(ship.topSpeed).toBeGreaterThan(0, s + ' topSpeed');
|
||||
}
|
||||
});
|
||||
|
||||
it("resets and rebuilds properly", function() {
|
||||
var id = 'cobra_mk_iii';
|
||||
var cobra = Ships[id];
|
||||
var shipA = new Ship(id, cobra.properties, cobra.slots);
|
||||
var shipB = new Ship(id, cobra.properties, cobra.slots);
|
||||
var testShip = new Ship(id, cobra.properties, cobra.slots);
|
||||
|
||||
var buildA = cobra.defaults;
|
||||
var buildB = {
|
||||
standard:['4A', '4A', '4A', '3D', '3A', '3A', '4C'],
|
||||
hardpoints: ['0s', '0s', '2d', '2d', 0, '04'],
|
||||
internal: ['45', '03', '2b', '2o', '27', '53']
|
||||
};
|
||||
|
||||
shipA.buildWith(buildA); // Build A
|
||||
shipB.buildWith(buildB);// Build B
|
||||
testShip.buildWith(buildA);
|
||||
|
||||
for(var p in testShip) {
|
||||
if (p == 'availCS') {
|
||||
continue;
|
||||
}
|
||||
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
|
||||
}
|
||||
|
||||
testShip.buildWith(buildB);
|
||||
|
||||
for(var p in testShip) {
|
||||
if (p == 'availCS') {
|
||||
continue;
|
||||
}
|
||||
expect(testShip[p]).toEqual(shipB[p], p + ' does not match');
|
||||
}
|
||||
|
||||
testShip.buildWith(buildA);
|
||||
|
||||
for(var p in testShip) {
|
||||
if (p == 'availCS') {
|
||||
continue;
|
||||
}
|
||||
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
|
||||
}
|
||||
});
|
||||
|
||||
it("discounts hull and components properly", function() {
|
||||
var id = 'cobra_mk_iii';
|
||||
var cobra = Ships[id];
|
||||
var testShip = new Ship(id, cobra.properties, cobra.slots);
|
||||
testShip.buildWith(cobra.defaults);
|
||||
|
||||
var originalHullCost = testShip.hullCost;
|
||||
var originalTotalCost = testShip.totalCost;
|
||||
var discount = 0.1;
|
||||
|
||||
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
|
||||
|
||||
testShip.applyDiscounts(discount, discount);
|
||||
|
||||
// Floating point errors cause miniscule decimal places which are handled in the app by rounding/formatting
|
||||
|
||||
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.floor(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
|
||||
expect(Math.floor(testShip.totalCost)).toEqual(Math.floor(originalTotalCost * (1 - discount)), 'Discounted Total cost does not match');
|
||||
|
||||
testShip.applyDiscounts(0, 0); // No discount, 100% of cost
|
||||
|
||||
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
|
||||
expect(testShip.totalCost).toEqual(originalTotalCost, 'Total cost does not match');
|
||||
|
||||
testShip.applyDiscounts(discount, 0); // Only discount hull
|
||||
|
||||
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.round(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
|
||||
expect(testShip.totalCost).toEqual(originalTotalCost - originalHullCost + testShip.m.discountedCost, 'Total cost does not match');
|
||||
|
||||
});
|
||||
|
||||
it("enforces a single shield generator", function() {
|
||||
var id = 'anaconda';
|
||||
var anacondaData = Ships[id];
|
||||
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
|
||||
anaconda.buildWith(anacondaData.defaults);
|
||||
|
||||
expect(anaconda.internal[2].m.grp).toEqual('sg', 'Anaconda default shield generator slot');
|
||||
|
||||
anaconda.use(anaconda.internal[1], ModuleUtils.internal('4j')); // 6E Shield Generator
|
||||
|
||||
expect(anaconda.internal[2].m).toEqual(null, 'Anaconda default shield generator slot is empty');
|
||||
expect(anaconda.internal[1].m.id).toEqual('4j', 'Slot 1 should have SG 4j in it');
|
||||
expect(anaconda.internal[1].m.grp).toEqual('sg','Slot 1 should have SG 4j in it');
|
||||
|
||||
});
|
||||
|
||||
it("enforces a single shield fuel scoop", function() {
|
||||
var id = 'anaconda';
|
||||
var anacondaData = Ships[id];
|
||||
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
|
||||
anaconda.buildWith(anacondaData.defaults);
|
||||
|
||||
anaconda.use(anaconda.internal[4], ModuleUtils.internal('32')); // 4A Fuel Scoop
|
||||
expect(anaconda.internal[4].m.grp).toEqual('fs', 'Anaconda fuel scoop slot');
|
||||
|
||||
anaconda.use(anaconda.internal[3], ModuleUtils.internal('32'));
|
||||
|
||||
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original fuel scoop slot is empty');
|
||||
expect(anaconda.internal[3].m.id).toEqual('32', 'Slot 1 should have FS 32 in it');
|
||||
expect(anaconda.internal[3].m.grp).toEqual('fs','Slot 1 should have FS 32 in it');
|
||||
});
|
||||
|
||||
it("enforces a single refinery", function() {
|
||||
var id = 'anaconda';
|
||||
var anacondaData = Ships[id];
|
||||
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
|
||||
anaconda.buildWith(anacondaData.defaults);
|
||||
|
||||
anaconda.use(anaconda.internal[4], ModuleUtils.internal('23')); // 4E Refinery
|
||||
expect(anaconda.internal[4].m.grp).toEqual('rf', 'Anaconda refinery slot');
|
||||
|
||||
anaconda.use(anaconda.internal[3], ModuleUtils.internal('23'));
|
||||
|
||||
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original refinery slot is empty');
|
||||
expect(anaconda.internal[3].m.id).toEqual('23', 'Slot 1 should have RF 23 in it');
|
||||
expect(anaconda.internal[3].m.grp).toEqual('rf','Slot 1 should have RF 23 in it');
|
||||
});
|
||||
|
||||
});
|
||||
@@ -1,25 +0,0 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
|
||||
const TestUtils = {
|
||||
createContextProvider: function(context) {
|
||||
var _contextTypes = {};
|
||||
|
||||
Object.keys(context).forEach(function(key) {
|
||||
_contextTypes[key] = PropTypes.any;
|
||||
});
|
||||
|
||||
return React.createClass({
|
||||
displayName: 'ContextProvider',
|
||||
childContextTypes: _contextTypes,
|
||||
getChildContext() { return context; },
|
||||
|
||||
render() {
|
||||
return React.Children.only(this.props.children);
|
||||
}
|
||||
});
|
||||
}
|
||||
};
|
||||
|
||||
|
||||
export default TestUtils;
|
||||
11
devServer.js
11
devServer.js
@@ -3,13 +3,24 @@ var WebpackDevServer = require("webpack-dev-server");
|
||||
var config = require('./webpack.config.dev');
|
||||
|
||||
new WebpackDevServer(webpack(config), {
|
||||
publicPath: config.output.publicPath,
|
||||
hot: true,
|
||||
disableHostCheck: true,
|
||||
headers: { "Access-Control-Allow-Origin": "*" },
|
||||
historyApiFallback: {
|
||||
rewrites: [
|
||||
// For some reason connect-history-api-fallback does not allow '.' in the URL for history fallback...
|
||||
{ from: /\/outfit\//, to: '/index.html' }
|
||||
]
|
||||
},
|
||||
stats: {
|
||||
assets: true,
|
||||
colors: true,
|
||||
version: false,
|
||||
hash: false,
|
||||
timings: true,
|
||||
chunks: false,
|
||||
chunkModules: false
|
||||
}
|
||||
}).listen(3300, "0.0.0.0", function (err, result) {
|
||||
if (err) {
|
||||
|
||||
29224
package-lock.json
generated
29224
package-lock.json
generated
File diff suppressed because it is too large
Load Diff
127
package.json
127
package.json
@@ -1,67 +1,28 @@
|
||||
{
|
||||
"name": "coriolis_shipyard",
|
||||
"version": "3.0.1",
|
||||
"version": "3.0.0",
|
||||
"repository": {
|
||||
"type": "git",
|
||||
"url": "https://github.com/EDCD/coriolis"
|
||||
},
|
||||
"homepage": "https://coriolis.io",
|
||||
"bugs": "https://github.com/EDCD/coriolis/issues",
|
||||
"contributors": [
|
||||
{ "name": "cmdrmcdonald" },
|
||||
{ "name": "willb321" },
|
||||
{ "name": "felixlinker" }
|
||||
],
|
||||
"private": true,
|
||||
"engine": "node >= 10.13.0",
|
||||
"engine": "node >= 4.8.1",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
"extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f",
|
||||
"clean": "rimraf build",
|
||||
"start": "node devServer.js",
|
||||
"lint": "eslint --ext .js,.jsx src",
|
||||
"test": "jest",
|
||||
"prod-serve": "nginx -p $(pwd) -c nginx.conf",
|
||||
"prod-stop": "kill -QUIT $(cat nginx.pid)",
|
||||
"buildfresh": "rimraf node_modules && rm package-lock.json && npm install && npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)",
|
||||
"build": "npm run clean && cross-env NODE_ENV=production webpack --config webpack.config.prod.js",
|
||||
"build": "npm run clean && cross-env NODE_ENV=production webpack -p --config webpack.config.prod.js",
|
||||
"rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws",
|
||||
"deploy": "npm run lint && npm test && npm run build && npm run rsync"
|
||||
},
|
||||
"jest": {
|
||||
"transform": {
|
||||
".*": "<rootDir>/node_modules/babel-jest"
|
||||
},
|
||||
"testRegex": "(/__tests__/test-.*|\\.(test|spec))\\.js$",
|
||||
"moduleFileExtensions": [
|
||||
"js",
|
||||
"json",
|
||||
"jsx"
|
||||
],
|
||||
"automock": true,
|
||||
"bail": false,
|
||||
"unmockedModulePathPatterns": [
|
||||
"<rootDir>/node_modules/lodash",
|
||||
"<rootDir>/node_modules/react",
|
||||
"<rootDir>/node_modules/react-dom",
|
||||
"<rootDir>/node_modules/react-transition-group",
|
||||
"<rootDir>/node_modules/react-testutils-additions",
|
||||
"<rootDir>/node_modules/fbjs",
|
||||
"<rootDir>/node_modules/fbemitter",
|
||||
"<rootDir>/node_modules/classnames",
|
||||
"<rootDir>/node_modules/d3",
|
||||
"<rootDir>/node_modules/lz-string",
|
||||
"<rootDir>/node_modules/jsen",
|
||||
"coriolis-data",
|
||||
"<rootDir>/src/app/shipyard",
|
||||
"<rootDir>/src/app/i18n",
|
||||
"<rootDir>/src/app/utils",
|
||||
"<rootDir>/src/schemas",
|
||||
"<rootDir>/__tests__"
|
||||
]
|
||||
},
|
||||
"devDependencies": {
|
||||
"@babel/core": "^7.20.12",
|
||||
"@babel/core": "^7.0.0",
|
||||
"@babel/plugin-proposal-class-properties": "^7.0.0",
|
||||
"@babel/plugin-proposal-decorators": "^7.0.0",
|
||||
"@babel/plugin-proposal-do-expressions": "^7.0.0",
|
||||
@@ -80,12 +41,14 @@
|
||||
"@babel/plugin-syntax-import-meta": "^7.0.0",
|
||||
"@babel/preset-env": "^7.0.0",
|
||||
"@babel/preset-react": "^7.0.0",
|
||||
"@rollup/plugin-node-resolve": "^15.0.1",
|
||||
"appcache-webpack-plugin": "^1.4.0",
|
||||
"babel-core": "^7.0.0-bridge.0",
|
||||
"babel-eslint": "^10.0.1",
|
||||
"babel-loader": "^8.0.0",
|
||||
"copy-webpack-plugin": "^10.2.4",
|
||||
"copy-webpack-plugin": "^4.5.2",
|
||||
"create-react-class": "^15.6.3",
|
||||
"cross-env": "^5.2.0",
|
||||
"css-loader": "^6.7.3",
|
||||
"css-loader": "^1.0.0",
|
||||
"d3-selection": "^1.3.2",
|
||||
"esdoc": "^1.1.0",
|
||||
"esdoc-custom-theme": "^1.4.2",
|
||||
@@ -96,66 +59,54 @@
|
||||
"esdoc-standard-plugin": "^1.0.0",
|
||||
"eslint": "^5.6.0",
|
||||
"eslint-plugin-react": "^7.11.1",
|
||||
"expose-loader": "^3.1.0",
|
||||
"express": "^4.18.2",
|
||||
"html-webpack-plugin": "^5.5.0",
|
||||
"jsen": "^0.6.6",
|
||||
"expose-loader": "^0.7.5",
|
||||
"express": "^4.16.3",
|
||||
"extract-text-webpack-plugin": "^4.0.0-beta.0",
|
||||
"file-loader": "^2.0.0",
|
||||
"html-webpack-plugin": "^3.0.7",
|
||||
"jsen": "^0.6.4",
|
||||
"json-loader": "^0.5.4",
|
||||
"less": "^3.8.1",
|
||||
"less-loader": "^11.1.0",
|
||||
"mini-css-extract-plugin": "^2.7.2",
|
||||
"less-loader": "^4.1.0",
|
||||
"react-addons-perf": "^15.4.2",
|
||||
"react-container-dimensions": "^1.4.1",
|
||||
"react-testutils-additions": "^15.0.0",
|
||||
"react-testutils-additions": "^16.0.0",
|
||||
"react-transition-group": "^2.5.0",
|
||||
"rimraf": "^4.1.2",
|
||||
"rollup": "^3.17.2",
|
||||
"style-loader": "^3.3.1",
|
||||
"uglify-js": "^3.17.4",
|
||||
"webpack": "^5.75.0",
|
||||
"webpack-cli": "^5.0.1",
|
||||
"webpack-dev-server": "^4.11.1",
|
||||
"webpack-merge": "^5.8.0",
|
||||
"webpack-notifier": "^1.15.0",
|
||||
"workbox-cacheable-response": "^6.5.4",
|
||||
"workbox-expiration": "^6.5.4",
|
||||
"workbox-precaching": "^6.5.4",
|
||||
"workbox-routing": "^6.5.4",
|
||||
"workbox-strategies": "^6.5.4",
|
||||
"workbox-webpack-plugin": "^6.5.4"
|
||||
"rimraf": "^2.6.1",
|
||||
"rollup": "^0.66.2",
|
||||
"rollup-plugin-node-resolve": "^3.4.0",
|
||||
"style-loader": "^0.23.0",
|
||||
"uglify-js": "^3.4.9",
|
||||
"url-loader": "^1.1.1",
|
||||
"webpack": "^4.20.2",
|
||||
"webpack-bugsnag-plugins": "^1.2.2",
|
||||
"webpack-cli": "^3.1.1",
|
||||
"webpack-dev-server": "^3.1.9",
|
||||
"webpack-notifier": "^1.6.0",
|
||||
"workbox-webpack-plugin": "^3.6.1"
|
||||
},
|
||||
"sideEffects": false,
|
||||
"dependencies": {
|
||||
"assert": "^1.5.0",
|
||||
"auto-bind": "^5.0.1",
|
||||
"base64url": "^3.0.1",
|
||||
"@babel/polyfill": "^7.0.0",
|
||||
"auto-bind": "^2.1.1",
|
||||
"browserify-zlib-next": "^1.0.1",
|
||||
"buffer": "^5.7.0",
|
||||
"classnames": "^2.2.6",
|
||||
"constants-browserify": "^1.0.0",
|
||||
"core-js": "^3.28.0",
|
||||
"coriolis-data": "../coriolis-data",
|
||||
"crypto-browserify": "^3.12.0",
|
||||
"d3": "^5.7.0",
|
||||
"detect-browser": "^3.0.1",
|
||||
"ed-forge": "../ed-forge",
|
||||
"fbemitter": "^2.1.1",
|
||||
"https-browserify": "^1.0.0",
|
||||
"lodash": "^4.17.11",
|
||||
"lz-string": "^1.4.4",
|
||||
"os-browserify": "^0.3.0",
|
||||
"pako": "^2.1.0",
|
||||
"path-browserify": "^1.0.1",
|
||||
"pako": "^1.0.6",
|
||||
"prop-types": "^15.6.2",
|
||||
"react": "^15.6.2",
|
||||
"react-dom": "^15.6.2",
|
||||
"react": "^15.5.4",
|
||||
"react-dom": "^15.5.4",
|
||||
"react-extras": "^0.7.1",
|
||||
"react-fuzzy": "^0.5.2",
|
||||
"react-ga": "^2.5.3",
|
||||
"react-number-editor": "^4.0.3",
|
||||
"recharts": "^1.2.0",
|
||||
"register-service-worker": "^1.7.2",
|
||||
"stream-browserify": "^3.0.0",
|
||||
"stream-http": "^3.2.0",
|
||||
"superagent": "^3.8.3",
|
||||
"url": "^0.11.0",
|
||||
"vm-browserify": "^1.1.2"
|
||||
"register-service-worker": "^1.5.2",
|
||||
"superagent": "^3.8.3"
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
import nodeResolve from "@rollup/plugin-node-resolve";
|
||||
import nodeResolve from "rollup-plugin-node-resolve";
|
||||
|
||||
export default {
|
||||
entry: "d3-funcs.js",
|
||||
|
||||
@@ -214,7 +214,7 @@ Options -MultiViews
|
||||
# </Files>
|
||||
|
||||
AddType application/x-web-app-manifest+json webapp
|
||||
# AddType text/cache-manifest appcache manifest
|
||||
AddType text/cache-manifest appcache manifest
|
||||
|
||||
# Media files
|
||||
AddType audio/mp4 f4a f4b m4a
|
||||
|
||||
@@ -5,27 +5,20 @@ import { register } from 'register-service-worker';
|
||||
import { EventEmitter } from 'fbemitter';
|
||||
import { getLanguage } from './i18n/Language';
|
||||
import Persist from './stores/Persist';
|
||||
import { Ship } from 'ed-forge';
|
||||
|
||||
import Announcement from './components/Announcement';
|
||||
import Header from './components/Header';
|
||||
import Tooltip from './components/Tooltip';
|
||||
import ModalExport from './components/ModalExport';
|
||||
import ModalHelp from './components/ModalHelp';
|
||||
import ModalImport from './components/ModalImport';
|
||||
import ModalPermalink from './components/ModalPermalink';
|
||||
import * as CompanionApiUtils from './utils/CompanionApiUtils';
|
||||
import * as JournalUtils from './utils/JournalUtils';
|
||||
import AboutPage from './pages/AboutPage';
|
||||
import NotFoundPage from './pages/NotFoundPage';
|
||||
import OutfittingPage from './pages/OutfittingPage';
|
||||
import ComparisonPage from './pages/ComparisonPage';
|
||||
import ShipyardPage from './pages/ShipyardPage';
|
||||
import ErrorDetails from './pages/ErrorDetails';
|
||||
|
||||
|
||||
const zlib = require('pako');
|
||||
const request = require('superagent');
|
||||
|
||||
/**
|
||||
* Coriolis App
|
||||
*/
|
||||
@@ -62,27 +55,24 @@ export default class Coriolis extends React.Component {
|
||||
this._onLanguageChange = this._onLanguageChange.bind(this);
|
||||
this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this._importBuild = this._importBuild.bind(this);
|
||||
|
||||
this.emitter = new EventEmitter();
|
||||
this.state = {
|
||||
noTouch: !('ontouchstart' in window || navigator.msMaxTouchPoints || navigator.maxTouchPoints),
|
||||
page: null,
|
||||
// Announcements must have an expiry date in format "YYYY-MM-DDTHH:MM:SSZ"
|
||||
announcements: [{expiry: "2024-11-30T00:00:00Z", text: "Mandalay added"}, {expiry: "2024-12-06T00:00:00Z", text: "Concord Cannon added"}, {expiry: "2024-12-08T00:00:00Z", text: "Boost Interval Feature added"}],
|
||||
announcements: [],
|
||||
language: getLanguage(Persist.getLangCode()),
|
||||
route: {},
|
||||
sizeRatio: Persist.getSizeRatio()
|
||||
};
|
||||
// TODO: New mechanism for announcements
|
||||
// this._getAnnouncements();
|
||||
Router('', (r) => this._setPage(ShipyardPage, r));
|
||||
Router('/import?', (r) => this._importBuild(r));
|
||||
Router('/import/:data', (r) => this._importBuild(r));
|
||||
Router('/outfit/?', (r) => this._setPage(OutfittingPage, r));
|
||||
Router('/outfit/:ship/?', (r) => this._setPage(OutfittingPage, r));
|
||||
Router('/outfit/:ship/:code?', (r) => this._setPage(OutfittingPage, r));
|
||||
Router('/compare/:name?', (r) => this._setPage(ComparisonPage, r));
|
||||
Router('/comparison?', (r) => this._setPage(ComparisonPage, r));
|
||||
Router('/comparison/:code', (r) => this._setPage(ComparisonPage, r));
|
||||
Router('/about', (r) => this._setPage(AboutPage, r));
|
||||
Router('*', (r) => this._setPage(null, r));
|
||||
}
|
||||
@@ -94,39 +84,25 @@ export default class Coriolis extends React.Component {
|
||||
_importBuild(r) {
|
||||
try {
|
||||
// Need to decode and gunzip the data, then build the ship
|
||||
const data = zlib.inflate(new Buffer.from(r.params.data, 'base64'), { to: 'string' });
|
||||
const json = JSON.parse(data);
|
||||
console.info('Ship import data: ');
|
||||
console.info(json);
|
||||
let ship, importString;
|
||||
if (json) {
|
||||
if (json.length && json[0].data) { // SLEF
|
||||
if (json.length > 1) { // Multiple builds, open modal
|
||||
importString = data;
|
||||
} else { // Single build, import directly
|
||||
ship = JournalUtils.shipFromLoadoutJSON(json[0].data);
|
||||
}
|
||||
} else { // not SLEF
|
||||
if (json.modules) {
|
||||
ship = CompanionApiUtils.shipFromJson(json);
|
||||
} else if (json.Modules) {
|
||||
ship = JournalUtils.shipFromLoadoutJSON(json);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (ship) {
|
||||
r.params.ship = ship.id;
|
||||
r.params.code = ship.toString();
|
||||
let ship = new Ship(r.params.data);
|
||||
r.params.ship = ship.getShipType();
|
||||
r.params.code = ship.compress();
|
||||
this._setPage(OutfittingPage, r);
|
||||
} else if (importString) {
|
||||
this._setPage(ShipyardPage, r);
|
||||
this._showModal(<ModalImport importString={data}/>);
|
||||
}
|
||||
} catch (err) {
|
||||
this._onError('Failed to import ship', r.path, 0, 0, err);
|
||||
}
|
||||
}
|
||||
|
||||
// async _getAnnouncements() {
|
||||
// try {
|
||||
// const announces = await request.get('https://orbis.zone/api/announcement')
|
||||
// .query({ showInCoriolis: true });
|
||||
// this.setState({ announcements: announces.body });
|
||||
// } catch (err) {
|
||||
// console.error(err)
|
||||
// }
|
||||
// }
|
||||
|
||||
/**
|
||||
* Updates / Sets the page and route context
|
||||
* @param {[type]} page The page to be shown
|
||||
@@ -150,6 +126,13 @@ export default class Coriolis extends React.Component {
|
||||
*/
|
||||
_onError(msg, scriptUrl, line, col, errObj) {
|
||||
console && console.error && console.error(arguments); // eslint-disable-line no-console
|
||||
if (errObj) {
|
||||
if (errObj instanceof Error) {
|
||||
bugsnagClient.notify(errObj); // eslint-disable-line
|
||||
} else if (errObj instanceof String) {
|
||||
bugsnagClient.notify(msg, errObj); // eslint-disable-line
|
||||
}
|
||||
}
|
||||
this.setState({
|
||||
error: <ErrorDetails error={{ message: msg, details: { scriptUrl, line, col, error: JSON.stringify(errObj) } }}/>,
|
||||
page: null,
|
||||
@@ -394,11 +377,12 @@ export default class Coriolis extends React.Component {
|
||||
render() {
|
||||
let currentMenu = this.state.currentMenu;
|
||||
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu}
|
||||
className={this.state.noTouch ? 'no-touch' : null}>
|
||||
className={this.state.noTouch ? 'no-touch' : null}
|
||||
>
|
||||
<Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate}
|
||||
currentMenu={currentMenu}/>
|
||||
<div className="announcement-container">{this.state.announcements.map(a => <Announcement
|
||||
text={a.text}/>)}</div>
|
||||
{/* <div className="announcement-container">{this.state.announcements.map(a => <Announcement
|
||||
text={a.message}/>)}</div> */}
|
||||
{this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) :
|
||||
<NotFoundPage/>}
|
||||
{this.state.modal}
|
||||
|
||||
@@ -1,12 +1,11 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import autoBind from 'auto-bind';
|
||||
import { autoBind } from 'react-extras';
|
||||
|
||||
/**
|
||||
* Announcement component
|
||||
*/
|
||||
export default class Announcement extends React.Component {
|
||||
|
||||
static propTypes = {
|
||||
text: PropTypes.string
|
||||
};
|
||||
@@ -27,5 +26,4 @@ export default class Announcement extends React.Component {
|
||||
render() {
|
||||
return <div className="announcement" >{this.props.text}</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,129 +1,22 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import cn from 'classnames';
|
||||
import { CoriolisLogo, MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import FuzzySearch from 'react-fuzzy';
|
||||
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
|
||||
import { get, groupBy, mapValues, sortBy, zip, zipWith } from 'lodash';
|
||||
import autoBind from 'auto-bind';
|
||||
import MODULE_STATS from 'ed-forge/lib/src/module-stats';
|
||||
import { SHOW } from '../shipyard/StatsMapping';
|
||||
|
||||
const PRESS_THRESHOLD = 500; // mouse/touch down threshold
|
||||
|
||||
/*
|
||||
* Categorisation of module groups
|
||||
*/
|
||||
const GRPCAT = {
|
||||
'sg': 'shields',
|
||||
'bsg': 'shields',
|
||||
'psg': 'shields',
|
||||
'scb': 'shields',
|
||||
'cc': 'limpet controllers',
|
||||
'fx': 'limpet controllers',
|
||||
'hb': 'limpet controllers',
|
||||
'mlc': 'limpet controllers',
|
||||
'pc': 'limpet controllers',
|
||||
'rpl': 'limpet controllers',
|
||||
'pce': 'passenger cabins',
|
||||
'pci': 'passenger cabins',
|
||||
'pcm': 'passenger cabins',
|
||||
'pcq': 'passenger cabins',
|
||||
'fh': 'hangars',
|
||||
'pv': 'hangars',
|
||||
'fs': 'fuel',
|
||||
'ft': 'fuel',
|
||||
'hr': 'structural reinforcement',
|
||||
'mrp': 'structural reinforcement',
|
||||
'bl': 'lasers',
|
||||
'pl': 'lasers',
|
||||
'ul': 'lasers',
|
||||
'ml': 'lasers',
|
||||
'c': 'projectiles',
|
||||
'mc': 'projectiles',
|
||||
'advmc': 'projectiles',
|
||||
'axmc': 'experimental',
|
||||
'axmce': 'experimental',
|
||||
'ntp': 'experimental',
|
||||
'fc': 'projectiles',
|
||||
'rfl': 'experimental',
|
||||
'pa': 'projectiles',
|
||||
'rg': 'projectiles',
|
||||
'mr': 'ordnance',
|
||||
'amr': 'ordnance',
|
||||
'axmr': 'experimental',
|
||||
'axmre': 'experimental',
|
||||
'rcpl': 'experimental',
|
||||
'dtl': 'experimental',
|
||||
'tbsc': 'experimental',
|
||||
'tbem': 'experimental',
|
||||
'tbrfl': 'experimental',
|
||||
'mahr': 'experimental',
|
||||
'rsl': 'experimental',
|
||||
'tp': 'ordnance',
|
||||
'nl': 'ordnance',
|
||||
'sc': 'scanners',
|
||||
'ss': 'scanners',
|
||||
// Utilities
|
||||
'cs': 'scanners',
|
||||
'kw': 'scanners',
|
||||
'ws': 'scanners',
|
||||
'xs': 'scanners',
|
||||
'ch': 'defence',
|
||||
'po': 'defence',
|
||||
'ec': 'defence',
|
||||
'sfn': 'defence',
|
||||
// Guardian
|
||||
'gpp': 'guardian',
|
||||
'gpc': 'guardian',
|
||||
'gsrp': 'guardian',
|
||||
'ggc': 'guardian',
|
||||
'gfsb': 'guardian',
|
||||
'gmrp': 'guardian',
|
||||
'gsc': 'guardian',
|
||||
'ghrp': 'guardian',
|
||||
|
||||
// Mining
|
||||
'scl': 'mining',
|
||||
'pwa': 'mining',
|
||||
'sdm': 'mining',
|
||||
|
||||
// Assists
|
||||
'dc': 'flight assists',
|
||||
'sua': 'flight assists',
|
||||
// Stabilizers
|
||||
'ews': 'weapon stabilizers',
|
||||
};
|
||||
// Order here is the order in which items will be shown in the modules menu
|
||||
const CATEGORIES = {
|
||||
// Internals
|
||||
'am': ['am'],
|
||||
'cr': ['cr'],
|
||||
'fi': ['fi'],
|
||||
'fuel': ['ft', 'fs'],
|
||||
'hangars': ['fh', 'pv'],
|
||||
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl', 'mlc'],
|
||||
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
|
||||
'rf': ['rf'],
|
||||
'shields': ['sg', 'bsg', 'psg', 'scb'],
|
||||
'structural reinforcement': ['hr', 'mrp'],
|
||||
'flight assists': ['dc', 'sua'],
|
||||
|
||||
// Hardpoints
|
||||
'lasers': ['pl', 'ul', 'bl'],
|
||||
'projectiles': ['mc', 'advmc', 'c', 'fc', 'pa', 'rg'],
|
||||
'ordnance': ['mr', 'amr', 'tp', 'nl'],
|
||||
// Utilities
|
||||
'sb': ['sb'],
|
||||
'hs': ['hs'],
|
||||
'csl': ['csl'],
|
||||
'defence': ['ch', 'po', 'ec'],
|
||||
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
|
||||
// Experimental
|
||||
'experimental': ['axmc', 'axmce', 'axmr', 'axmre', 'ntp','rfl', 'tbrfl', 'tbsc', 'tbem', 'xs', 'sfn', 'rcpl', 'dtl', 'rsl', 'mahr',],
|
||||
'weapon stabilizers': ['ews'],
|
||||
// Guardian
|
||||
'guardian': ['gpp', 'gpd', 'gpc', 'ggc', 'gsrp', 'gfsb', 'ghrp', 'gmrp', 'gsc'],
|
||||
|
||||
'mining': ['ml', 'scl', 'pwa', 'sdm', 'abl'],
|
||||
const MOUNT_MAP = {
|
||||
fixed: <MountFixed className={'lg'} />,
|
||||
gimbal: <MountGimballed className={'lg'} />,
|
||||
turret: <MountTurret className={'lg'} />,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -131,15 +24,10 @@ const CATEGORIES = {
|
||||
*/
|
||||
export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
diffDetails: PropTypes.func,
|
||||
hideSearch: PropTypes.bool,
|
||||
m: PropTypes.object,
|
||||
ship: PropTypes.object.isRequired,
|
||||
warning: PropTypes.func,
|
||||
firstSlotId: PropTypes.string,
|
||||
lastSlotId: PropTypes.string,
|
||||
activeSlotId: PropTypes.string,
|
||||
slotDiv: PropTypes.object
|
||||
};
|
||||
|
||||
@@ -150,10 +38,8 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
this._hideDiff = this._hideDiff.bind(this);
|
||||
this._showSearch = this._showSearch.bind(this);
|
||||
autoBind(this);
|
||||
this.state = this._initState(props, context);
|
||||
this.slotItems = [];// Array to hold <li> refs.
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -163,207 +49,103 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
* @return {Object} list: Array of React Components, currentGroup Component if any
|
||||
*/
|
||||
_initState(props, context) {
|
||||
let translate = context.language.translate;
|
||||
let { m, warning, onSelect, modules, ship } = props;
|
||||
let list, currentGroup;
|
||||
const { translate } = context.language;
|
||||
const { m } = props;
|
||||
const list = [], fuzzy = [];
|
||||
let currentGroup;
|
||||
|
||||
let buildGroup = this._buildGroup.bind(
|
||||
this,
|
||||
ship,
|
||||
translate,
|
||||
m,
|
||||
warning,
|
||||
(m, event) => {
|
||||
this._hideDiff(event);
|
||||
onSelect(m);
|
||||
}
|
||||
const modules = m.getApplicableItems().map(getModuleInfo);
|
||||
const groups = mapValues(
|
||||
groupBy(modules, (info) => info.meta.group),
|
||||
(infos) => groupBy(infos, (info) => info.meta.type),
|
||||
);
|
||||
let fuzzy = [];
|
||||
if (modules instanceof Array) {
|
||||
list = buildGroup(modules[0].grp, modules);
|
||||
} else {
|
||||
list = [];
|
||||
// At present time slots with grouped options (Hardpoints and Internal) can be empty
|
||||
if (m) {
|
||||
let emptyId = 'empty';
|
||||
if (this.firstSlotId == null) this.firstSlotId = emptyId;
|
||||
let keyDown = this._keyDown.bind(this, onSelect);
|
||||
list.push(<div className='empty-c upp' key={emptyId} data-id={emptyId} onClick={onSelect.bind(null, null)}
|
||||
onKeyDown={keyDown} tabIndex="0"
|
||||
ref={slotItem => this.slotItems[emptyId] = slotItem}>{translate('empty')}</div>);
|
||||
// Build categories sorted by translated category name
|
||||
const groupKeys = sortBy(Object.keys(groups), translate);
|
||||
for (const group of groupKeys) {
|
||||
const groupName = translate(group);
|
||||
if (groupKeys.length > 1) {
|
||||
list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>);
|
||||
}
|
||||
|
||||
// Need to regroup the modules by our own categorisation
|
||||
let catmodules = {};
|
||||
// Pre-create to preserve ordering
|
||||
for (let cat in CATEGORIES) {
|
||||
catmodules[cat] = [];
|
||||
const categories = groups[group];
|
||||
const categoryKeys = sortBy(Object.keys(categories), translate);
|
||||
for (const category of categoryKeys) {
|
||||
const categoryName = translate(category);
|
||||
const infos = categories[category];
|
||||
if (categoryKeys.length > 1) {
|
||||
list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>);
|
||||
}
|
||||
for (let g in modules) {
|
||||
const moduleCategory = GRPCAT[g] || g;
|
||||
const existing = catmodules[moduleCategory] || [];
|
||||
catmodules[moduleCategory] = existing.concat(modules[g]);
|
||||
}
|
||||
|
||||
for (let category in catmodules) {
|
||||
let categoryHeader = false;
|
||||
// Order through CATEGORIES if present
|
||||
const categories = CATEGORIES[category] || [category];
|
||||
if (categories && categories.length) {
|
||||
for (let n in categories) {
|
||||
const grp = categories[n];
|
||||
// We now have the group and the category. We might not have any modules, though...
|
||||
if (modules[grp]) {
|
||||
// Decide if we need a category header as well as a group header
|
||||
if (categories.length === 1) {
|
||||
// Show category header instead of group header
|
||||
if (m && grp == m.grp) {
|
||||
// If this is a missing module/weapon, skip it
|
||||
if (m.grp == "mh" || m.grp == "mm"){
|
||||
continue;
|
||||
} else {
|
||||
list.push(<div ref={(elem) => this.groupElem = elem} key={category}
|
||||
className={'select-category upp'}>{translate(category)}</div>);
|
||||
}
|
||||
} else {
|
||||
if (category == "mh" || category == "mm"){
|
||||
continue;
|
||||
} else {
|
||||
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
|
||||
list.push(
|
||||
this._buildGroup(
|
||||
m,
|
||||
category,
|
||||
infos,
|
||||
),
|
||||
);
|
||||
fuzzy.push(
|
||||
...infos.map((info) => {
|
||||
const { meta } = info;
|
||||
const mount = meta.mount ? ' ' + translate(meta.mount) : '';
|
||||
return {
|
||||
grp: groupName,
|
||||
cat: categoryName,
|
||||
m: info.proto.Item,
|
||||
name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
|
||||
};
|
||||
}),
|
||||
);
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Show category header as well as group header
|
||||
if (!categoryHeader) {
|
||||
if (category == "mh" || category == "mm"){
|
||||
continue;
|
||||
}
|
||||
else {
|
||||
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
|
||||
categoryHeader = true;
|
||||
}
|
||||
}
|
||||
if (m && grp == m.grp) {
|
||||
list.push(<div ref={(elem) => this.groupElem = elem} key={grp}
|
||||
className={'select-group cap'}>{translate(grp)}</div>);
|
||||
} else {
|
||||
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
|
||||
}
|
||||
}
|
||||
list.push(buildGroup(grp, modules[grp]));
|
||||
for (const i of modules[grp]) {
|
||||
let mount = '';
|
||||
if (i.mount === 'F') {
|
||||
mount = 'Fixed';
|
||||
} else if (i.mount === 'G') {
|
||||
mount = 'Gimballed';
|
||||
} else if (i.mount === 'T') {
|
||||
mount = 'Turreted';
|
||||
}
|
||||
let special = '';
|
||||
if (typeof(i.special) !== 'undefined') {
|
||||
special = `(${translate(i.special)})`;
|
||||
}
|
||||
const fuzz = { grp, m: i, name: `${i.class}${i.rating}${mount ? ' ' + mount : ''} ${translate(grp)} ${translate(special)}` };
|
||||
fuzzy.push(fuzz);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
let trackingFocus = false;
|
||||
return { list, currentGroup, fuzzy, trackingFocus };
|
||||
}
|
||||
|
||||
/**
|
||||
* Return Is expiremental capacity reached
|
||||
* @return {boolean} Is experimental capacity reached
|
||||
*/
|
||||
_experimentalCapacityReached() {
|
||||
const ship = this.props.ship;
|
||||
const ews = ship.internal.filter(o => o.m && o.m.grp === 'ews');
|
||||
let expCap;
|
||||
|
||||
if(ews.length < 1){
|
||||
expCap = 4;
|
||||
} else{
|
||||
expCap = ews[0].m.class == 3 ? 5 : 6;
|
||||
}
|
||||
|
||||
return expCap <= this.props.ship.hardpoints.filter(o => o.m && o.m.experimental).length;
|
||||
return { list, currentGroup, fuzzy, trackingFocus: false };
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate React Components for Module Group
|
||||
* @param {Ship} ship Ship the selection is for
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} mountedModule Mounted Module
|
||||
* @param {Function} warningFunc Warning function
|
||||
* @param {function} onSelect Select/Mount callback
|
||||
* @param {string} grp Group name
|
||||
* @param {String} category Category key
|
||||
* @param {Array} modules Available modules
|
||||
* @return {React.Component} Available Module Group contents
|
||||
*/
|
||||
_buildGroup(ship, translate, mountedModule, warningFunc, onSelect, grp, modules) {
|
||||
let prevClass = null, prevRating = null, prevName;
|
||||
let elems = [];
|
||||
_buildGroup(mountedModule, category, modules) {
|
||||
const { warning } = this.props;
|
||||
const ship = mountedModule.getShip();
|
||||
const classMapping = groupBy(modules, (info) => info.meta.class);
|
||||
|
||||
const sortedModules = modules.sort(this._moduleOrder);
|
||||
const itemsPerClass = Math.max(
|
||||
...Object.values(classMapping).map((l) => l.length),
|
||||
);
|
||||
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
|
||||
// Nested array of <li> elements; will be flattened before being rendered.
|
||||
// Each sub-array represents one row in the final view.
|
||||
const elems = [[]];
|
||||
|
||||
// Calculate the number of items per class. Used so we don't have long lists with only a few items in each row
|
||||
const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => {
|
||||
count[cls] = ++count[cls] || 1;
|
||||
return count;
|
||||
}, {});
|
||||
const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key]));
|
||||
// Reverse sort for descending order of module class
|
||||
for (const clazz of Object.keys(classMapping).sort().reverse()) {
|
||||
for (let info of sortBy(
|
||||
classMapping[clazz],
|
||||
(info) => info.meta.mount || info.meta.rating,
|
||||
)) {
|
||||
const { meta } = info;
|
||||
const { Item } = info.proto;
|
||||
|
||||
let itemsOnThisRow = 0;
|
||||
for (let i = 0; i < sortedModules.length; i++) {
|
||||
let m = sortedModules[i];
|
||||
// If m.grp is mh or mm, or m.symbol contains 'Missing' skip it
|
||||
if (m.grp == 'mh' || m.grp == 'mm' || (typeof(m.symbol) !== 'undefined' && m.symbol.includes("Missing"))) {
|
||||
// If this is a missing module, skip it
|
||||
continue;
|
||||
// Can only be true if shieldgenmaximalmass is defined, i.e. this
|
||||
// module must be a shield generator
|
||||
let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass');
|
||||
if (meta.experimental && !mountedModule.readMeta('experimental')) {
|
||||
disabled =
|
||||
4 <=
|
||||
ship.getHardpoints().filter((m) => m.readMeta('experimental'))
|
||||
.length;
|
||||
}
|
||||
let mount = null;
|
||||
let disabled = false;
|
||||
prevName = m.name;
|
||||
if (ModuleUtils.isShieldGenerator(m.grp)) {
|
||||
// Shield generators care about maximum hull mass
|
||||
disabled = ship.hullMass > m.maxmass;
|
||||
// If the mounted module is experimental as well, we can replace it so
|
||||
// the maximum does not apply
|
||||
} else if (m.experimental && (!mountedModule || !mountedModule.experimental)) {
|
||||
disabled = this._experimentalCapacityReached();
|
||||
} else if (m.grp === 'mlc' && (!mountedModule || mountedModule.grp !== 'mlc')) {
|
||||
disabled = 1 <= ship.internal.filter(o => o.m && o.m.grp === 'mlc').length;
|
||||
}
|
||||
let active = mountedModule && mountedModule.id === m.id;
|
||||
let classes = cn(m.name ? 'lc' : 'c', {
|
||||
warning: !disabled && warningFunc && warningFunc(m),
|
||||
active,
|
||||
disabled
|
||||
});
|
||||
let eventHandlers;
|
||||
|
||||
if (disabled) {
|
||||
eventHandlers = {
|
||||
onKeyDown: this._keyDown.bind(this, null),
|
||||
onKeyUp: this._keyUp.bind(this, null)
|
||||
|
||||
// Default event handlers for objects that are disabled
|
||||
let eventHandlers = {};
|
||||
if (!disabled) {
|
||||
const showDiff = this._showDiff.bind(this, mountedModule, info);
|
||||
const select = (event) => {
|
||||
this._hideDiff(event);
|
||||
this.props.onSelect(Item);
|
||||
};
|
||||
} else {
|
||||
/**
|
||||
* Get the ids of the first and last <li> elements in the <ul> that are focusable (i.e. are not active or disabled)
|
||||
* Will be used to keep focus inside the <ul> on Tab and Shift-Tab while it is visible
|
||||
*/
|
||||
if (this.firstSlotId == null) this.firstSlotId = sortedModules[i].id;
|
||||
if (active) this.activeSlotId = sortedModules[i].id;
|
||||
this.lastSlotId = sortedModules[i].id;
|
||||
|
||||
let showDiff = this._showDiff.bind(this, mountedModule, m);
|
||||
let select = onSelect.bind(null, m);
|
||||
|
||||
eventHandlers = {
|
||||
onMouseEnter: this._over.bind(this, showDiff),
|
||||
@@ -371,70 +153,102 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
onTouchEnd: this._touchEnd.bind(this, select),
|
||||
onMouseLeave: this._hideDiff,
|
||||
onClick: select,
|
||||
onKeyDown: this._keyDown.bind(this, select),
|
||||
onKeyUp: this._keyUp.bind(this, select)
|
||||
};
|
||||
}
|
||||
|
||||
switch (m.mount) {
|
||||
case 'F':
|
||||
mount = <MountFixed className={'lg'}/>;
|
||||
break;
|
||||
case 'G':
|
||||
mount = <MountGimballed className={'lg'}/>;
|
||||
break;
|
||||
case 'T':
|
||||
mount = <MountTurret className={'lg'}/>;
|
||||
break;
|
||||
}
|
||||
if (m.name && m.name === prevName) {
|
||||
// elems.push(<br key={'b' + m.grp + i} />);
|
||||
itemsOnThisRow = 0;
|
||||
}
|
||||
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
|
||||
elems.push(<br key={'b' + m.grp + i}/>);
|
||||
itemsOnThisRow = 0;
|
||||
}
|
||||
let tbIdx = (classes.indexOf('disabled') < 0) ? 0 : undefined;
|
||||
elems.push(
|
||||
<li key={m.id} data-id={m.id} className={classes} {...eventHandlers} tabIndex={tbIdx}
|
||||
ref={slotItem => this.slotItems[m.id] = slotItem}>
|
||||
{mount}
|
||||
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
|
||||
</li>
|
||||
const mountSymbol = MOUNT_MAP[meta.mount];
|
||||
const li = (
|
||||
<li key={Item} data-id={Item}
|
||||
ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
|
||||
className={cn(meta.type === 'armour' ? 'lc' : 'c', {
|
||||
warning: !disabled && warning && warning(info),
|
||||
active: mountedModule.getItem() === Item,
|
||||
disabled,
|
||||
hardpoint: mountSymbol,
|
||||
})}
|
||||
{...eventHandlers}
|
||||
>{mountSymbol}{meta.type === 'armour' ? Item : `${meta.class}${meta.rating}`}</li>
|
||||
);
|
||||
|
||||
itemsOnThisRow++;
|
||||
prevClass = m.class;
|
||||
prevRating = m.rating;
|
||||
prevName = m.name;
|
||||
const tail = elems.pop();
|
||||
let newTail = [tail];
|
||||
if (tail.length < itemsPerRow) {
|
||||
// If the row has not grown too long, the new <li> element can be
|
||||
// added to the row itself
|
||||
tail.push(li);
|
||||
} else {
|
||||
// Otherwise, the last row gets a line break element added and this
|
||||
// item is put into a new row
|
||||
tail.push(<br key={elems.length}/>);
|
||||
newTail.push([li]);
|
||||
}
|
||||
return <ul key={'modules' + grp}>{elems}</ul>;
|
||||
elems.push(...newTail);
|
||||
}
|
||||
}
|
||||
|
||||
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate tooltip content for the difference between the
|
||||
* mounted module and the hovered modules
|
||||
* @param {Object} mm The module mounet currently
|
||||
* @param {Object} m The hovered module
|
||||
* @param {Object} mountedModule The module mounted currently
|
||||
* @param {Object} hoveringModule The hovered module
|
||||
* @param {DOMRect} rect DOMRect for target element
|
||||
*/
|
||||
_showDiff(mm, m, rect) {
|
||||
if (this.props.diffDetails) {
|
||||
_showDiff(mountedModule, hoveringModule, rect) {
|
||||
const { tooltip, language } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
this.touchTimeout = null;
|
||||
this.context.tooltip(this.props.diffDetails(m, mm), rect);
|
||||
const mountedIsEmpty = mountedModule.isEmpty();
|
||||
const props = (
|
||||
mountedIsEmpty ? ['mass'] : Object.keys(hoveringModule.props)
|
||||
).map((prop) => SHOW[prop] ? SHOW[prop].as : prop);
|
||||
const oldProps = mountedIsEmpty ?
|
||||
[{ value: 0 }] :
|
||||
props.map((prop) => mountedModule.getFormatted(prop, false));
|
||||
const newProps = mountedModule.try(() => {
|
||||
mountedModule.setItem(hoveringModule.proto.Item);
|
||||
return props.map((prop) => mountedModule.getFormatted(prop, false));
|
||||
});
|
||||
|
||||
const diffs = zipWith(oldProps, newProps, (oldVal, newVal) => {
|
||||
const { unit, value } = newVal;
|
||||
if (!oldVal.value) {
|
||||
return undefined;
|
||||
}
|
||||
return { value, diff: value - oldVal.value, unit };
|
||||
});
|
||||
const namedDiffs = zip(props, diffs).filter(([_, stat]) => stat !== undefined);
|
||||
namedDiffs.push(['cost', {
|
||||
value: hoveringModule.meta.cost,
|
||||
diff: hoveringModule.meta.cost - (mountedIsEmpty ? 0 : mountedModule.readMeta('cost')),
|
||||
unit: units.CR,
|
||||
}]);
|
||||
|
||||
const tt = <div className='cap' style={{ whiteSpace: 'nowrap' }}>
|
||||
{sortBy(namedDiffs, ([prop, _]) => prop).map(([prop, stats]) => {
|
||||
const { unit, value, diff } = stats;
|
||||
const beneficial = get(MODULE_STATS, [prop, 'higherbetter'], false) === diff > 0;
|
||||
return <div key={prop}>
|
||||
{translate(prop)}: <span className={diff === 0 ? 'disabled' : beneficial ? 'secondary' : 'warning'}>
|
||||
{formats.round(value)} {diff !== 0 && ` (${diff > 0 ? '+' : ''}${formats.round(diff)})`}{unit}
|
||||
</span>
|
||||
</div>;
|
||||
})}
|
||||
</div>;
|
||||
tooltip(tt, rect);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate tooltip content for the difference between the
|
||||
* mounted module and the hovered modules
|
||||
* @returns {React.Component} Search component if available
|
||||
*/
|
||||
_showSearch() {
|
||||
if (this.props.modules instanceof Array) {
|
||||
if (this.props.hideSearch) {
|
||||
return;
|
||||
}
|
||||
const mountedModule = this.props.m;
|
||||
return (
|
||||
<FuzzySearch
|
||||
list={this.state.fuzzy}
|
||||
@@ -446,20 +260,11 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
onSelect={e => this.props.onSelect.bind(null, e.m)()}
|
||||
resultsTemplate={(props, state, styles, clickHandler) => {
|
||||
return state.results.map((val, i) => {
|
||||
let disabled;
|
||||
|
||||
if(val.m.experimental && (!mountedModule || !mountedModule.experimental)) {
|
||||
disabled = this._experimentalCapacityReached();
|
||||
} else{
|
||||
disabled = false;
|
||||
}
|
||||
const handler = disabled ? null : () => clickHandler(i);
|
||||
|
||||
return (
|
||||
<div
|
||||
key={i}
|
||||
className={cn('lc', {disabled})}
|
||||
onClick={handler}
|
||||
className={'lc'}
|
||||
onClick={() => clickHandler(i)}
|
||||
>
|
||||
{val.name}
|
||||
</div>
|
||||
@@ -504,41 +309,6 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
this._hideDiff();
|
||||
}
|
||||
|
||||
/**
|
||||
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
|
||||
* @param {Function} select Select module callback
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_keyDown(select, event) {
|
||||
let className = event.currentTarget.attributes['class'].value;
|
||||
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
|
||||
select();
|
||||
return;
|
||||
}
|
||||
let elemId = event.currentTarget.attributes['data-id'].value;
|
||||
if (className.indexOf('disabled') < 0 && event.key == 'Tab') {
|
||||
if (event.shiftKey && elemId == this.firstSlotId) {
|
||||
event.preventDefault();
|
||||
this.slotItems[this.lastSlotId].focus();
|
||||
return;
|
||||
}
|
||||
if (!event.shiftKey && elemId == this.lastSlotId) {
|
||||
event.preventDefault();
|
||||
this.slotItems[this.firstSlotId].focus();
|
||||
return;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Key Up
|
||||
* @param {Function} select Select module callback
|
||||
* @param {SytheticEvent} event Event
|
||||
*/
|
||||
_keyUp(select, event) {
|
||||
// nothing here yet
|
||||
}
|
||||
|
||||
/**
|
||||
* Hide diff tooltip
|
||||
* @param {SyntheticEvent} event Event
|
||||
@@ -549,69 +319,12 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
this.context.tooltip();
|
||||
}
|
||||
|
||||
/**
|
||||
* Order two modules suitably for display in module selection
|
||||
* @param {Object} a the first module
|
||||
* @param {Object} b the second module
|
||||
* @return {int} -1 if the first module should go first, 1 if the second module should go first
|
||||
*/
|
||||
_moduleOrder(a, b) {
|
||||
// Named modules go last
|
||||
if (!a.name && b.name) {
|
||||
return -1;
|
||||
}
|
||||
if (a.name && !b.name) {
|
||||
return 1;
|
||||
}
|
||||
// Class ordered from highest (8) to lowest (1)
|
||||
if (a.class < b.class) {
|
||||
return 1;
|
||||
}
|
||||
if (a.class > b.class) {
|
||||
return -1;
|
||||
}
|
||||
// Mount type, if applicable
|
||||
if (a.mount && b.mount && a.mount !== b.mount) {
|
||||
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
|
||||
return -1;
|
||||
} else {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
// Sort multi limpet controllers by name
|
||||
if (a.grp === 'mlc') {
|
||||
if (a.name[0] <= b.name[0]) {
|
||||
return -1;
|
||||
}
|
||||
if (a.name[0] > b.name[0]) {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
// Rating ordered from highest (A) to lowest (E)
|
||||
if (a.rating < b.rating) {
|
||||
return -1;
|
||||
}
|
||||
if (a.rating > b.rating) {
|
||||
return 1;
|
||||
}
|
||||
// Do not attempt to order by name at this point, as that mucks up the order of armour
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Scroll to mounted (if it exists) module group on mount
|
||||
*/
|
||||
componentDidMount() {
|
||||
if (this.groupElem) { // Scroll to currently selected group
|
||||
this.node.scrollTop = this.groupElem.offsetTop;
|
||||
}
|
||||
/**
|
||||
* Set focus on active or first slot element, if applicable.
|
||||
*/
|
||||
if (this.slotItems[this.activeSlotId]) {
|
||||
this.slotItems[this.activeSlotId].focus();
|
||||
} else if (this.slotItems[this.firstSlotId]) {
|
||||
this.slotItems[this.firstSlotId].focus();
|
||||
if (this.activeSlotRef) {
|
||||
this.activeSlotRef.focus();
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Boost displays a boost button that toggles bosot
|
||||
@@ -8,8 +9,6 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
*/
|
||||
export default class Boost extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
};
|
||||
@@ -19,12 +18,9 @@ export default class Boost extends TranslatedComponent {
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
constructor(props) {
|
||||
super(props);
|
||||
const { ship, boost } = props;
|
||||
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this._toggleBoost = this._toggleBoost.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -70,13 +66,12 @@ export default class Boost extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { formats, translate, units } = this.context.language;
|
||||
const { ship, boost } = this.props;
|
||||
|
||||
// TODO disable if ship cannot boost
|
||||
const { translate } = this.context.language;
|
||||
return (
|
||||
<span id='boost'>
|
||||
<button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button>
|
||||
<button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}>
|
||||
{translate('boost')}
|
||||
</button>
|
||||
</span>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -2,6 +2,7 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import Slider from '../components/Slider';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Cargo slider
|
||||
@@ -21,8 +22,7 @@ export default class Cargo extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._cargoChange = this._cargoChange.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,13 +1,14 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Persist from '../stores/Persist';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import { Factory, Ship } from 'ed-forge';
|
||||
import { Insurance } from '../shipyard/Constants';
|
||||
import { slotName, slotComparator } from '../utils/SlotFunctions';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { ShoppingIcon } from '../components/SvgIcons';
|
||||
import { ShoppingIcon } from './SvgIcons';
|
||||
import autoBind from 'auto-bind';
|
||||
import { assign, differenceBy, sortBy, reverse } from 'lodash';
|
||||
import { FUEL_CAPACITY } from 'ed-forge/lib/src/ship-stats';
|
||||
|
||||
/**
|
||||
* Cost Section
|
||||
@@ -16,7 +17,7 @@ export default class CostSection extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
buildName: PropTypes.string
|
||||
buildName: PropTypes.string,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -25,71 +26,34 @@ export default class CostSection extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._costsTab = this._costsTab.bind(this);
|
||||
this._sortCost = this._sortCost.bind(this);
|
||||
this._sortAmmo = this._sortAmmo.bind(this);
|
||||
this._sortRetrofit = this._sortRetrofit.bind(this);
|
||||
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
|
||||
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
|
||||
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
|
||||
this._eddbShoppingList = this._inaraShoppingList.bind(this);
|
||||
|
||||
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
|
||||
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
|
||||
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
|
||||
let shipDiscount = Persist.getShipDiscount();
|
||||
let moduleDiscount = Persist.getModuleDiscount();
|
||||
|
||||
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
autoBind(this);
|
||||
|
||||
const { ship, buildName } = props;
|
||||
this.shipType = ship.getShipType();
|
||||
this.state = {
|
||||
retrofitShip,
|
||||
retrofitName,
|
||||
shipDiscount,
|
||||
moduleDiscount,
|
||||
retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null,
|
||||
shipDiscount: Persist.getShipDiscount(),
|
||||
moduleDiscount: Persist.getModuleDiscount(),
|
||||
insurance: Insurance[Persist.getInsurance()],
|
||||
tab: Persist.getCostTab(),
|
||||
buildOptions: Persist.getBuildsNamesFor(props.ship.id),
|
||||
ammoPredicate: 'cr',
|
||||
ammoDesc: true,
|
||||
costPredicate: 'cr',
|
||||
costDesc: true,
|
||||
retroPredicate: 'cr',
|
||||
retroDesc: true
|
||||
buildOptions: Persist.getBuildsNamesFor(ship.getShipType()),
|
||||
predicate: 'cr',
|
||||
desc: true,
|
||||
excluded: {},
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a ship instance to base/reference retrofit changes from
|
||||
* @param {string} shipId Ship Id
|
||||
* @param {string} name Build name
|
||||
* @param {Ship} retrofitShip Existing retrofit ship
|
||||
* @return {Ship} Retrofit ship
|
||||
*/
|
||||
_buildRetrofitShip(shipId, name, retrofitShip) {
|
||||
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults
|
||||
|
||||
if (!retrofitShip) { // Don't create a new instance unless needed
|
||||
retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
|
||||
}
|
||||
|
||||
if (Persist.hasBuild(shipId, name)) {
|
||||
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
|
||||
_buildRetrofitShip() {
|
||||
const { retrofitName } = this.state;
|
||||
if (Persist.hasBuild(this.shipType, retrofitName)) {
|
||||
return new Ship(Persist.getBuild(this.shipType, retrofitName));
|
||||
} else {
|
||||
retrofitShip.buildWith(data.defaults); // Populate with default components
|
||||
return Factory.newShip(this.shipType);
|
||||
}
|
||||
return retrofitShip;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the default retrofit build name if it exists
|
||||
* @param {string} shipId Ship Id
|
||||
* @param {string} name Build name
|
||||
* @return {string} Build name or null
|
||||
*/
|
||||
_defaultRetrofitName(shipId, name) {
|
||||
return Persist.hasBuild(shipId, name) ? name : null;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -107,9 +71,6 @@ export default class CostSection extends TranslatedComponent {
|
||||
_onDiscountChanged() {
|
||||
let shipDiscount = Persist.getShipDiscount();
|
||||
let moduleDiscount = Persist.getModuleDiscount();
|
||||
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
|
||||
this.setState({ shipDiscount, moduleDiscount });
|
||||
}
|
||||
|
||||
@@ -126,156 +87,33 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @param {SyntheticEvent} event Build name to base the retrofit ship on
|
||||
*/
|
||||
_onBaseRetrofitChange(event) {
|
||||
let retrofitName = event.target.value;
|
||||
let ship = this.props.ship;
|
||||
|
||||
if (retrofitName) {
|
||||
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
|
||||
} else {
|
||||
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
|
||||
}
|
||||
this._updateRetrofit(ship, this.state.retrofitShip);
|
||||
this.setState({ retrofitName });
|
||||
this.setState({ retrofitName: event.target.value });
|
||||
}
|
||||
|
||||
/**
|
||||
* On builds changed check to see if the retrofit ship needs
|
||||
* to be updated
|
||||
* Toggle item cost inclusion
|
||||
* @param {String} key Key of the row to toggle
|
||||
*/
|
||||
_onBuildsChanged() {
|
||||
let update = false;
|
||||
let ship = this.props.ship;
|
||||
let { retrofitName, retrofitShip } = this.state;
|
||||
|
||||
if(!Persist.hasBuild(ship.id, retrofitName)) {
|
||||
retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
|
||||
this.setState({ retrofitName: null });
|
||||
update = true;
|
||||
} else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
|
||||
retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
|
||||
update = true;
|
||||
}
|
||||
|
||||
if (update) { // Update retrofit comparison
|
||||
this._updateRetrofit(ship, retrofitShip);
|
||||
}
|
||||
// Update list of retrofit base build options
|
||||
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
|
||||
_toggleExcluded(key) {
|
||||
let { excluded } = this.state;
|
||||
excluded = assign({}, excluded);
|
||||
const slotExcluded = excluded[key];
|
||||
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
|
||||
this.setState({ excluded });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle item cost inclusion in overall total
|
||||
* @param {Object} item Cost item
|
||||
* Set list sort predicate
|
||||
* @param {string} newPredicate sort predicate
|
||||
*/
|
||||
_toggleCost(item) {
|
||||
this.props.ship.setCostIncluded(item, !item.incCost);
|
||||
this.forceUpdate();
|
||||
_sortBy(newPredicate) {
|
||||
let { predicate, desc } = this.state;
|
||||
|
||||
if (newPredicate == predicate) {
|
||||
desc = !desc;
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle item cost inclusion in retrofit total
|
||||
* @param {Object} item Cost item
|
||||
*/
|
||||
_toggleRetrofitCost(item) {
|
||||
let retrofitTotal = this.state.retrofitTotal;
|
||||
item.retroItem.incCost = !item.retroItem.incCost;
|
||||
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
|
||||
this.setState({ retrofitTotal });
|
||||
}
|
||||
|
||||
/**
|
||||
* Set cost list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortCostBy(predicate) {
|
||||
let { costPredicate, costDesc } = this.state;
|
||||
|
||||
if (costPredicate == predicate) {
|
||||
costDesc = !costDesc;
|
||||
}
|
||||
|
||||
this.setState({ costPredicate: predicate, costDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort cost list
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortCost(ship, predicate, desc) {
|
||||
let costList = ship.costList;
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'm') {
|
||||
costList.sort(slotComparator(translate, null, desc));
|
||||
} else {
|
||||
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Set ammo list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortAmmoBy(predicate) {
|
||||
let { ammoPredicate, ammoDesc } = this.state;
|
||||
|
||||
if (ammoPredicate == predicate) {
|
||||
ammoDesc = !ammoDesc;
|
||||
}
|
||||
|
||||
this.setState({ ammoPredicate: predicate, ammoDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort ammo cost list
|
||||
* @param {Array} ammoCosts Ammo cost list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortAmmo(ammoCosts, predicate, desc) {
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'm') {
|
||||
ammoCosts.sort(slotComparator(translate, null, desc));
|
||||
} else {
|
||||
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Set retrofit list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortRetrofitBy(predicate) {
|
||||
let { retroPredicate, retroDesc } = this.state;
|
||||
|
||||
if (retroPredicate == predicate) {
|
||||
retroDesc = !retroDesc;
|
||||
}
|
||||
|
||||
this.setState({ retroPredicate: predicate, retroDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort retrofit cost list
|
||||
* @param {Array} retrofitCosts Retrofit cost list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortRetrofit(retrofitCosts, predicate, desc) {
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'cr') {
|
||||
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
|
||||
} else {
|
||||
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
|
||||
}
|
||||
|
||||
if (!desc) {
|
||||
retrofitCosts.reverse();
|
||||
}
|
||||
this.setState({ predicate: newPredicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -284,18 +122,34 @@ export default class CostSection extends TranslatedComponent {
|
||||
*/
|
||||
_costsTab() {
|
||||
let { ship } = this.props;
|
||||
let { shipDiscount, moduleDiscount, insurance } = this.state;
|
||||
let {
|
||||
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
|
||||
} = this.state;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let rows = [];
|
||||
|
||||
for (let i = 0, l = ship.costList.length; i < l; i++) {
|
||||
let item = ship.costList[i];
|
||||
if (item.m && item.m.cost) {
|
||||
let toggle = this._toggleCost.bind(this, item);
|
||||
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td>
|
||||
<td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td>
|
||||
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
|
||||
let modules = sortBy(
|
||||
ship.getModules(),
|
||||
(predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost'))
|
||||
);
|
||||
if (desc) {
|
||||
reverse(modules);
|
||||
}
|
||||
|
||||
let totalCost = 0;
|
||||
for (let module of modules) {
|
||||
const cost = module.readMeta('cost');
|
||||
const slot = module.getSlot();
|
||||
if (cost) {
|
||||
let toggle = this._toggleExcluded.bind(this, slot);
|
||||
const disabled = excluded[slot];
|
||||
if (!disabled) {
|
||||
totalCost += cost;
|
||||
}
|
||||
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
|
||||
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
|
||||
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
|
||||
</tr>);
|
||||
}
|
||||
}
|
||||
@@ -304,23 +158,23 @@ export default class CostSection extends TranslatedComponent {
|
||||
<table style={{ width: '100%', borderCollapse: 'collapse' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>
|
||||
{translate('module')}
|
||||
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null}
|
||||
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null}
|
||||
</th>
|
||||
<th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th>
|
||||
<th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
<tr className='ri'>
|
||||
<td colSpan='2' className='lbl' >{translate('total')}</td>
|
||||
<td className='val'>{formats.int(ship.totalCost)}{units.CR}</td>
|
||||
<td className='val'>{formats.int(totalCost)}{units.CR}</td>
|
||||
</tr>
|
||||
<tr className='ri'>
|
||||
<td colSpan='2' className='lbl'>{translate('insurance')}</td>
|
||||
<td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td>
|
||||
<td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -328,17 +182,66 @@ export default class CostSection extends TranslatedComponent {
|
||||
}
|
||||
|
||||
/**
|
||||
* Open up a window for inara with a shopping list of our retrofit components
|
||||
* Open up a window for EDDB with a shopping list of our retrofit components
|
||||
*/
|
||||
_inaraShoppingList() {
|
||||
const { retrofitCosts } = this.state;
|
||||
_eddbShoppingList() {
|
||||
const {} = this.state;
|
||||
const { ship } = this.props;
|
||||
|
||||
// Provide unique list of non-PP module EDDB IDs to buy
|
||||
const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
|
||||
// const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
|
||||
|
||||
// Open up the relevant URL
|
||||
window.open('https://inara.cz/inapi/corisearch.php?m=' + modIds.join(','));
|
||||
// TODO:
|
||||
// window.open('https://eddb.io/station?m=' + modIds.join(','));
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
_retrofitInfo() {
|
||||
const { ship } = this.props;
|
||||
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
|
||||
const retrofitShip = this._buildRetrofitShip();
|
||||
|
||||
const currentModules = ship.getModules();
|
||||
const oldModules = retrofitShip.getModules();
|
||||
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
|
||||
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
|
||||
|
||||
let modules = [];
|
||||
let totalCost = 0;
|
||||
const addModule = (m, costFactor) => {
|
||||
const key = `${m.getItem()}@${m.getSlot()}`;
|
||||
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
|
||||
modules.push({
|
||||
key, cost,
|
||||
rating: m.getClassRating(),
|
||||
item: m.readMeta('type'),
|
||||
});
|
||||
if (!excluded[key]) {
|
||||
totalCost += cost;
|
||||
}
|
||||
};
|
||||
for (let m of buyModules) {
|
||||
addModule(m, 1);
|
||||
}
|
||||
for (let m of sellModules) {
|
||||
addModule(m, -1);
|
||||
}
|
||||
|
||||
let _sortF = undefined;
|
||||
switch (predicate) {
|
||||
case 'cr': _sortF = (o) => o.cost; break;
|
||||
case 'm':
|
||||
default: _sortF = (o) => o.item; break;
|
||||
};
|
||||
|
||||
modules = sortBy(modules, _sortF);
|
||||
if (desc) {
|
||||
reverse(modules);
|
||||
}
|
||||
return [totalCost, modules];
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -346,59 +249,52 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_retrofitTab() {
|
||||
let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state;
|
||||
let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state;
|
||||
const { termtip, tooltip } = this.context;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let int = formats.int;
|
||||
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
|
||||
|
||||
for (let opt of this.state.buildOptions) {
|
||||
options.push(<option key={opt} value={opt}>{opt}</option>);
|
||||
}
|
||||
|
||||
if (retrofitCosts.length) {
|
||||
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
|
||||
let item = retrofitCosts[i];
|
||||
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
|
||||
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
|
||||
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
|
||||
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
|
||||
</tr>);
|
||||
}
|
||||
} else {
|
||||
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
|
||||
}
|
||||
|
||||
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
|
||||
return <div>
|
||||
<div className='scroll-x'>
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}>
|
||||
{translate('net cost')}
|
||||
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
|
||||
</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
{retrofitInfo.length ?
|
||||
retrofitInfo.map((info) => (
|
||||
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
|
||||
onClick={() => this._toggleExcluded(info.key)}>
|
||||
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(info.item)}</td>
|
||||
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
|
||||
{int(info.cost)}{units.CR}
|
||||
</td>
|
||||
</tr>
|
||||
)) : (
|
||||
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
|
||||
)}
|
||||
<tr className='ri'>
|
||||
<td className='lbl' ><button onClick={this._inaraShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
|
||||
<td colSpan='3' className='lbl' >{translate('cost')}</td>
|
||||
<td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
|
||||
<td className='lbl' >{translate('cost')}</td>
|
||||
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
|
||||
{int(retrofitTotal)}{units.CR}
|
||||
</td>
|
||||
</tr>
|
||||
<tr className='ri'>
|
||||
<td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td>
|
||||
<td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td>
|
||||
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>▾</u></td>
|
||||
<td className='val' style={{ borderLeft:'none', padding: 0 }}>
|
||||
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
|
||||
{options}
|
||||
<option key='stock' value=''>{translate('Stock')}</option>
|
||||
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
|
||||
</select>
|
||||
</td>
|
||||
</tr>
|
||||
@@ -408,63 +304,50 @@ export default class CostSection extends TranslatedComponent {
|
||||
</div>;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Update retrofit costs
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {Ship} retrofitShip Retrofit Ship instance
|
||||
*
|
||||
* @param {*} modules
|
||||
*/
|
||||
_updateRetrofit(ship, retrofitShip) {
|
||||
let retrofitCosts = [];
|
||||
let retrofitTotal = 0, i, l, item;
|
||||
_ammoInfo() {
|
||||
const { ship } = this.props;
|
||||
const { desc, predicate } = this.state;
|
||||
|
||||
if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) {
|
||||
item = {
|
||||
buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating,
|
||||
buyId: ship.bulkheads.m.eddbID,
|
||||
buyPp: ship.bulkheads.m.pp,
|
||||
buyName: ship.bulkheads.m.name,
|
||||
sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating,
|
||||
sellName: retrofitShip.bulkheads.m.name,
|
||||
netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost,
|
||||
retroItem: retrofitShip.bulkheads
|
||||
};
|
||||
retrofitCosts.push(item);
|
||||
if (retrofitShip.bulkheads.incCost) {
|
||||
retrofitTotal += item.netCost;
|
||||
let info = [{
|
||||
key: 'fuel',
|
||||
item: 'Fuel',
|
||||
qty: ship.get(FUEL_CAPACITY),
|
||||
unitCost: 50,
|
||||
cost: 50 * ship.get(FUEL_CAPACITY),
|
||||
}];
|
||||
for (let m of ship.getModules()) {
|
||||
const rebuilds = m.get('bays') * m.get('rebuildsperbay');
|
||||
const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds;
|
||||
if (ammo) {
|
||||
const unitCost = m.readMeta('ammocost');
|
||||
info.push({
|
||||
key: `restock_${m.getSlot()}`,
|
||||
rating: m.getClassRating(),
|
||||
item: m.readMeta('type'),
|
||||
qty: ammo,
|
||||
unitCost, cost: unitCost * ammo,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
|
||||
let retroSlotGroup = retrofitShip[g];
|
||||
let slotGroup = ship[g];
|
||||
for (i = 0, l = slotGroup.length; i < l; i++) {
|
||||
const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null;
|
||||
const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null;
|
||||
if (modId != retroModId) {
|
||||
item = { netCost: 0, retroItem: retroSlotGroup[i] };
|
||||
if (slotGroup[i].m) {
|
||||
item.buyId = slotGroup[i].m.eddbID,
|
||||
item.buyPp = slotGroup[i].m.pp,
|
||||
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
|
||||
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
|
||||
item.netCost = slotGroup[i].discountedCost;
|
||||
}
|
||||
if (retroSlotGroup[i].m) {
|
||||
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
|
||||
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
|
||||
item.netCost -= retroSlotGroup[i].discountedCost;
|
||||
}
|
||||
retrofitCosts.push(item);
|
||||
if (retroSlotGroup[i].incCost) {
|
||||
retrofitTotal += item.netCost;
|
||||
}
|
||||
}
|
||||
let _sortF = undefined;
|
||||
switch (predicate) {
|
||||
case 'cr': _sortF = (o) => o.cost; break;
|
||||
case 'qty': _sortF = (o) => o.qty; break;
|
||||
case 'cost': _sortF = (o) => o.unitCost; break;
|
||||
case 'm':
|
||||
default: _sortF = (o) => o.item;
|
||||
}
|
||||
info = sortBy(info, _sortF);
|
||||
if (desc) {
|
||||
reverse(info);
|
||||
}
|
||||
|
||||
this.setState({ retrofitCosts, retrofitTotal });
|
||||
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
|
||||
return info;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -472,20 +355,24 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_ammoTab() {
|
||||
let { ammoTotal, ammoCosts } = this.state;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let int = formats.int;
|
||||
let rows = [];
|
||||
const { excluded } = this.state;
|
||||
const { translate, formats, units } = this.context.language;
|
||||
const int = formats.int;
|
||||
const rows = [];
|
||||
|
||||
for (let i = 0, l = ammoCosts.length; i < l; i++) {
|
||||
let item = ammoCosts[i];
|
||||
rows.push(<tr key={i} className='highlight'>
|
||||
<td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td>
|
||||
<td className='le shorten cap'>{slotName(translate, item)}</td>
|
||||
<td className='ri'>{int(item.max)}</td>
|
||||
<td className='ri'>{int(item.cost)}{units.CR}</td>
|
||||
<td className='ri'>{int(item.total)}{units.CR}</td>
|
||||
const ammoInfo = this._ammoInfo();
|
||||
let total = 0;
|
||||
for (let i of ammoInfo) {
|
||||
const disabled = excluded[i.key];
|
||||
rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)}
|
||||
className={cn('highlight', { disabled })}>
|
||||
<td style={{ width: '1em' }}>{i.rating}</td>
|
||||
<td className='le shorten cap'>{translate(i.item)}</td>
|
||||
<td className='ri'>{int(i.qty)}</td>
|
||||
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
|
||||
<td className='ri'>{int(i.cost)}{units.CR}</td>
|
||||
</tr>);
|
||||
total += disabled ? 0 : i.cost;
|
||||
}
|
||||
|
||||
return <div>
|
||||
@@ -493,17 +380,17 @@ export default class CostSection extends TranslatedComponent {
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th>
|
||||
<th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th>
|
||||
<th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
<tr className='ri'>
|
||||
<td colSpan='4' className='lbl' >{translate('total')}</td>
|
||||
<td className='val'>{int(ammoTotal)}{units.CR}</td>
|
||||
<td className='val'>{int(total)}{units.CR}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -511,103 +398,6 @@ export default class CostSection extends TranslatedComponent {
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Recalculate all ammo costs
|
||||
* @param {Ship} ship Ship instance
|
||||
*/
|
||||
_updateAmmoCosts(ship) {
|
||||
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
|
||||
|
||||
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
|
||||
let slotGroup = ship[g];
|
||||
for (let i = 0, l = slotGroup.length; i < l; i++) {
|
||||
if (slotGroup[i].m) {
|
||||
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
|
||||
q = 0;
|
||||
switch (slotGroup[i].m.grp) {
|
||||
case 'fs': // Skip fuel calculation if scoop present
|
||||
scoop = true;
|
||||
break;
|
||||
case 'scb':
|
||||
q = slotGroup[i].m.getAmmo() + 1;
|
||||
break;
|
||||
case 'am':
|
||||
q = slotGroup[i].m.getAmmo();
|
||||
break;
|
||||
case 'pv':
|
||||
srvs += slotGroup[i].m.getBays();
|
||||
break;
|
||||
case 'fx': case 'hb': case 'cc': case 'pc':
|
||||
limpets = ship.cargoCapacity;
|
||||
break;
|
||||
default:
|
||||
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
|
||||
}
|
||||
// Calculate ammo costs only if a cost is specified
|
||||
if (slotGroup[i].m.ammocost > 0) {
|
||||
item = {
|
||||
m: slotGroup[i].m,
|
||||
max: q,
|
||||
cost: slotGroup[i].m.ammocost,
|
||||
total: q * slotGroup[i].m.ammocost
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
// Add fighters
|
||||
if (slotGroup[i].m.grp === 'fh') {
|
||||
item = {
|
||||
m: slotGroup[i].m,
|
||||
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
|
||||
cost: slotGroup[i].m.fightercost,
|
||||
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Limpets if controllers exist and cargo space available
|
||||
if (limpets > 0) {
|
||||
item = {
|
||||
m: { name: 'limpets', class: '', rating: '' },
|
||||
max: ship.cargoCapacity,
|
||||
cost: 101,
|
||||
total: ship.cargoCapacity * 101
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
if (srvs > 0) {
|
||||
item = {
|
||||
m: { name: 'SRVs', class: '', rating: '' },
|
||||
max: srvs,
|
||||
cost: 1030,
|
||||
total: srvs * 1030
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
// Calculate refuel costs if no scoop present
|
||||
if (!scoop) {
|
||||
item = {
|
||||
m: { name: 'fuel', class: '', rating: '' },
|
||||
max: ship.fuelCapacity,
|
||||
cost: 50,
|
||||
total: ship.fuelCapacity * 50
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
this.setState({ ammoTotal, ammoCosts });
|
||||
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add listeners on mount and update costs
|
||||
*/
|
||||
@@ -615,64 +405,7 @@ export default class CostSection extends TranslatedComponent {
|
||||
this.listeners = [
|
||||
Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
|
||||
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
|
||||
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
|
||||
];
|
||||
this._updateAmmoCosts(this.props.ship);
|
||||
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
|
||||
this._sortCost(this.props.ship);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state based on property and context changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next context
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
let retrofitShip = this.state.retrofitShip;
|
||||
|
||||
if (nextProps.ship != this.props.ship) { // Ship has changed
|
||||
let nextId = nextProps.ship.id;
|
||||
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
|
||||
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
|
||||
this.setState({
|
||||
retrofitShip,
|
||||
retrofitName,
|
||||
buildOptions: Persist.getBuildsNamesFor(nextId)
|
||||
});
|
||||
}
|
||||
|
||||
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
|
||||
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
|
||||
this._updateAmmoCosts(nextProps.ship);
|
||||
this._updateRetrofit(nextProps.ship, retrofitShip);
|
||||
this._sortCost(nextProps.ship);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort lists before render
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextState Incoming/Next state
|
||||
*/
|
||||
componentWillUpdate(nextProps, nextState) {
|
||||
let state = this.state;
|
||||
|
||||
switch (nextState.tab) {
|
||||
case 'ammo':
|
||||
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
|
||||
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
|
||||
}
|
||||
break;
|
||||
case 'retrofit':
|
||||
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
|
||||
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
|
||||
}
|
||||
break;
|
||||
default:
|
||||
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
|
||||
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,9 +1,10 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import PieChart from './PieChart';
|
||||
import VerticalBarChart from './VerticalBarChart';
|
||||
import autoBind from 'auto-bind';
|
||||
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/src/ship-stats';
|
||||
|
||||
/**
|
||||
* Defence information
|
||||
@@ -15,12 +16,10 @@ import VerticalBarChart from './VerticalBarChart';
|
||||
*/
|
||||
export default class Defence extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
engagementrange: PropTypes.number.isRequired,
|
||||
sys: PropTypes.number.isRequired,
|
||||
opponentWep: PropTypes.number.isRequired
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -29,22 +28,7 @@ export default class Defence extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
|
||||
this.state = { shield, armour, shielddamage, armourdamage };
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our properties change
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps) {
|
||||
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
|
||||
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
|
||||
this.setState({ shield, armour, shielddamage, armourdamage });
|
||||
}
|
||||
return true;
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -52,187 +36,104 @@ export default class Defence extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { opponent, sys, opponentWep } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { shield, armour, shielddamage, armourdamage } = this.state;
|
||||
|
||||
const pd = opponent.standard[4].m;
|
||||
const shields = ship.get(SHIELD_METRICS);
|
||||
|
||||
const shieldSourcesData = [];
|
||||
const effectiveShieldData = [];
|
||||
const shieldDamageTakenData = [];
|
||||
const shieldSourcesTt = [];
|
||||
const shieldDamageTakenAbsoluteTt = [];
|
||||
const shieldDamageTakenExplosiveTt = [];
|
||||
const shieldDamageTakenKineticTt = [];
|
||||
const shieldDamageTakenThermalTt = [];
|
||||
const effectiveShieldAbsoluteTt = [];
|
||||
const effectiveShieldExplosiveTt = [];
|
||||
const effectiveShieldKineticTt = [];
|
||||
const effectiveShieldThermalTt = [];
|
||||
let maxEffectiveShield = 0;
|
||||
if (shield.total) {
|
||||
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
|
||||
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
|
||||
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
|
||||
shieldSourcesData.push({ value: Math.round(shield.addition), label: translate('shield addition') });
|
||||
// Data for pie chart (absolute MJ)
|
||||
const shieldSourcesData = [
|
||||
'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs',
|
||||
].map((key) => { return { label: key, value: Math.round(shields[key]) }; });
|
||||
|
||||
if (shield.generator > 0) {
|
||||
shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
if (shield.boosters > 0) {
|
||||
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
}
|
||||
// Data for tooltip
|
||||
const shieldSourcesTt = shieldSourcesData.map((o) => {
|
||||
let { label, value } = o;
|
||||
return <div key={label}>
|
||||
{translate(label)} {formats.int(value)}{units.MJ}
|
||||
</div>;
|
||||
});
|
||||
|
||||
if (shield.cells > 0) {
|
||||
shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
}
|
||||
// Shield resistances
|
||||
const shieldDamageTakenData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal',
|
||||
].map((label) => {
|
||||
const dmgMult = shields[label];
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.pct1(dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
|
||||
});
|
||||
|
||||
// Add effective shield from resistances
|
||||
const rawMj = shield.generator + shield.boosters + shield.cells;
|
||||
const explosiveMj = rawMj / (shield.explosive.base) - rawMj;
|
||||
if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>);
|
||||
const kineticMj = rawMj / (shield.kinetic.base) - rawMj;
|
||||
if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>);
|
||||
const thermalMj = rawMj / (shield.thermal.base) - rawMj;
|
||||
if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>);
|
||||
// Effective MJ
|
||||
const effectiveShieldData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal'
|
||||
].map((label) => {
|
||||
const dmgMult = shields[label];
|
||||
const raw = shields.withSCBs;
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
|
||||
});
|
||||
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
|
||||
|
||||
// Add effective shield from power distributor SYS pips
|
||||
if (shield.absolute.sys != 1) {
|
||||
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.total - rawMj)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.total - rawMj / shield.explosive.base)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.total - rawMj / shield.kinetic.base)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.total - rawMj / shield.thermal.base)}{units.MJ}</div>);
|
||||
}
|
||||
}
|
||||
const armour = ship.get(ARMOUR_METRICS);
|
||||
const moduleProtection = ship.get(MODULE_PROTECTION_METRICS);
|
||||
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>);
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>);
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>);
|
||||
// Data for pie chart (absolute HP)
|
||||
const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map(
|
||||
(key) => { return { label: key, value: Math.round(armour[key]) }; }
|
||||
);
|
||||
|
||||
shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>);
|
||||
shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>);
|
||||
shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>);
|
||||
// Data for tooltip
|
||||
const armourSourcesTt = armourSourcesData.map((o) => {
|
||||
let { label, value } = o;
|
||||
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
|
||||
});
|
||||
|
||||
shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>);
|
||||
shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>);
|
||||
shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>);
|
||||
// Armour resistances
|
||||
const armourDamageTakenData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal', 'caustic',
|
||||
].map((label) => {
|
||||
const dmgMult = armour[label];
|
||||
const tooltip = ['byAlloys', 'byHRPs'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.pct1(dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
|
||||
});
|
||||
|
||||
shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>);
|
||||
shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>);
|
||||
shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>);
|
||||
|
||||
const effectiveAbsoluteShield = shield.total / shield.absolute.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt });
|
||||
const effectiveExplosiveShield = shield.total / shield.explosive.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt });
|
||||
const effectiveKineticShield = shield.total / shield.kinetic.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt });
|
||||
const effectiveThermalShield = shield.total / shield.thermal.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt });
|
||||
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
|
||||
|
||||
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
|
||||
}
|
||||
|
||||
const armourSourcesData = [];
|
||||
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
|
||||
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
|
||||
|
||||
const armourSourcesTt = [];
|
||||
const effectiveArmourAbsoluteTt = [];
|
||||
const effectiveArmourExplosiveTt = [];
|
||||
const effectiveArmourKineticTt = [];
|
||||
const effectiveArmourThermalTt = [];
|
||||
const effectiveArmourCausticTt = [];
|
||||
if (armour.bulkheads > 0) {
|
||||
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
if (armour.reinforcement > 0) {
|
||||
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
}
|
||||
}
|
||||
|
||||
const rawArmour = armour.bulkheads + armour.reinforcement;
|
||||
|
||||
const armourDamageTakenTt = [];
|
||||
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
|
||||
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
|
||||
|
||||
const armourDamageTakenExplosiveTt = [];
|
||||
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
|
||||
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
|
||||
if (armour.explosive.total != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.explosive.total - rawArmour)}</div>);
|
||||
|
||||
const armourDamageTakenKineticTt = [];
|
||||
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
|
||||
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
|
||||
if (armour.kinetic.total != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.kinetic.total - rawArmour)}</div>);
|
||||
|
||||
const armourDamageTakenThermalTt = [];
|
||||
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
|
||||
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
|
||||
if (armour.thermal.total != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.thermal.total - rawArmour)}</div>);
|
||||
|
||||
const armourDamageTakenCausticTt = [];
|
||||
armourDamageTakenCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.caustic.bulkheads)}</div>);
|
||||
armourDamageTakenCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.caustic.reinforcement)}</div>);
|
||||
if (armour.thermal.total != 1) effectiveArmourCausticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.caustic.total - rawArmour)}</div>);
|
||||
|
||||
const effectiveArmourData = [];
|
||||
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
|
||||
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
|
||||
const effectiveKineticArmour = armour.total / armour.kinetic.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
|
||||
const effectiveThermalArmour = armour.total / armour.thermal.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
|
||||
const effectiveCausticArmour = armour.total / armour.caustic.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveCausticArmour), label: translate('caustic'), tooltip: effectiveArmourCausticTt });
|
||||
|
||||
const armourDamageTakenData = [];
|
||||
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.caustic.total * 100), label: translate('caustic'), tooltip: armourDamageTakenCausticTt });
|
||||
// Effective HP
|
||||
const effectiveArmourData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal'
|
||||
].map((label) => {
|
||||
const dmgMult = armour[label];
|
||||
const raw = armour.armour;
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.int(raw * dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip };
|
||||
});
|
||||
|
||||
return (
|
||||
<span id='defence'>
|
||||
{shield.total ? <span>
|
||||
{shields.withSCBs ? <span>
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('shield metrics')}</h2>
|
||||
<br/>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
|
||||
@@ -250,11 +151,11 @@ export default class Defence extends TranslatedComponent {
|
||||
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('armour metrics')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2>
|
||||
<br/>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
|
||||
134
src/app/components/EDEngineerButton.jsx
Normal file
134
src/app/components/EDEngineerButton.jsx
Normal file
@@ -0,0 +1,134 @@
|
||||
import React from 'react';
|
||||
import autoBind from 'auto-bind';
|
||||
import Persist from '../stores/Persist';
|
||||
import PropTypes from 'prop-types';
|
||||
import { getBlueprintUuid, getExperimentalUuid } from 'ed-forge/lib/src/data/blueprints';
|
||||
import { Loader, MatIcon } from '../components/SvgIcons';
|
||||
import request from 'superagent';
|
||||
import { chain, entries } from 'lodash';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
|
||||
const STATE = {
|
||||
READY: 0,
|
||||
LOADING: 1,
|
||||
ERROR: 2,
|
||||
DONE: 3,
|
||||
};
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
export default class EDEngineerButton extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
|
||||
const { ship } = props;
|
||||
const uuids = chain(ship.getModules())
|
||||
.filter((m) => m.getBlueprint())
|
||||
.map((m) => {
|
||||
const uuids = [getBlueprintUuid(m.getBlueprint(), m.getBlueprintGrade())];
|
||||
const exp = m.getExperimental();
|
||||
if (exp) {
|
||||
uuids.push(getExperimentalUuid(exp));
|
||||
}
|
||||
return uuids;
|
||||
})
|
||||
.flatMap()
|
||||
.groupBy()
|
||||
.mapValues((v) => v.length)
|
||||
.value();
|
||||
|
||||
this.state = {
|
||||
status: STATE.READY,
|
||||
uuids,
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Generates the shopping list
|
||||
*/
|
||||
_sendToEDEngineer() {
|
||||
const { uuids } = this.state;
|
||||
this.setState({ status: STATE.LOADING });
|
||||
request.get('http://localhost:44405/commanders')
|
||||
.then((data) => {
|
||||
const [cmdr] = JSON.parse(data.text);
|
||||
return Promise.all(
|
||||
entries(uuids).map(
|
||||
(entry) => {
|
||||
const [uuid, n] = entry;
|
||||
return new Promise((resolve, reject) => {
|
||||
request.patch(`http://localhost:44405/${cmdr}/shopping-list`)
|
||||
.field('uuid', uuid)
|
||||
.field('size', n)
|
||||
.end((err, res) => {
|
||||
console.log('request goes out!');
|
||||
if (err) {
|
||||
reject(err);
|
||||
} else {
|
||||
resolve(res);
|
||||
}
|
||||
});
|
||||
});
|
||||
},
|
||||
),
|
||||
);
|
||||
})
|
||||
.then(() => this.setState({ status: STATE.DONE }))
|
||||
.catch((err) => {
|
||||
console.error(err);
|
||||
this.setState({ status: STATE.ERROR });
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks for browser compatibility of sending to ED Engineer.
|
||||
* @returns {boolean} True if browser is compatible
|
||||
*/
|
||||
_browserIsCompatible() {
|
||||
// !== Firefox 1.0+
|
||||
// TODO: Double check if this really doesn't work in firefox
|
||||
return typeof InstallTrigger === 'undefined';
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @returns
|
||||
*/
|
||||
render() {
|
||||
const { termtip, tooltip } = this.context;
|
||||
const hide = tooltip.bind(null, null);
|
||||
const { status } = this.state;
|
||||
|
||||
let msg = 'PHRASE_FIREFOX_EDENGINEER';
|
||||
if (this._browserIsCompatible()) {
|
||||
switch (status) {
|
||||
case STATE.READY: msg = 'Send to EDEngineer'; break;
|
||||
case STATE.LOADING: msg = 'Sending...'; break;
|
||||
case STATE.ERROR: msg = 'Error sending to EDEngineer'; break;
|
||||
case STATE.DONE: msg = 'Success! Clicking sends again.'; break;
|
||||
}
|
||||
}
|
||||
|
||||
return (<button
|
||||
disabled={!this._browserIsCompatible()}
|
||||
onClick={status !== STATE.LOADING && this._sendToEDEngineer}
|
||||
onMouseOver={termtip.bind(null, msg)}
|
||||
onMouseOut={hide}
|
||||
>
|
||||
{status === STATE.LOADING ?
|
||||
<Loader className="lg" /> :
|
||||
<MatIcon className="lg" />
|
||||
}
|
||||
</button>);
|
||||
}
|
||||
}
|
||||
@@ -2,6 +2,7 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import Slider from '../components/Slider';
|
||||
import { moduleReduce } from 'ed-forge/lib/src/helper';
|
||||
|
||||
/**
|
||||
* Engagement range slider
|
||||
@@ -21,35 +22,18 @@ export default class EngagementRange extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const { ship } = props;
|
||||
|
||||
const maxRange = Math.round(this._calcMaxRange(ship));
|
||||
|
||||
this.state = {
|
||||
maxRange
|
||||
maxRange: moduleReduce(
|
||||
this.props.ship.getHardpoints(),
|
||||
'maximumrange',
|
||||
true,
|
||||
// Don't use plain `Math.max` because callback will be passed four args
|
||||
(a, v) => Math.max(a, v),
|
||||
1000,
|
||||
),
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum range of a ship's weapons
|
||||
* @param {Object} ship The ship
|
||||
* @returns {int} The maximum range, in metres
|
||||
*/
|
||||
_calcMaxRange(ship) {
|
||||
let maxRange = 1000;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const thisRange = ship.hardpoints[i].m.getRange();
|
||||
if (thisRange > maxRange) {
|
||||
maxRange = thisRange;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return maxRange;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update range
|
||||
* @param {number} rangeLevel percentage level from 0 to 1
|
||||
@@ -61,7 +45,9 @@ export default class EngagementRange extends TranslatedComponent {
|
||||
const range = Math.round(rangeLevel * maxRange);
|
||||
|
||||
if (range !== this.props.engagementRange) {
|
||||
this.props.onChange(range);
|
||||
const { onChange, ship } = this.props;
|
||||
ship.setEngagementRange(range);
|
||||
onChange(range);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -70,8 +56,8 @@ export default class EngagementRange extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { language, onWindowResize, sizeRatio } = this.context;
|
||||
const { formats, translate } = language;
|
||||
const { engagementRange } = this.props;
|
||||
const { maxRange } = this.state;
|
||||
|
||||
|
||||
@@ -2,98 +2,58 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import LineChart from '../components/LineChart';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/src/stats/SpeedProfile';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* Engine profile for a given ship
|
||||
*/
|
||||
export default class EngineProfile extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
pips: PropTypes.number.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const ship = this.props.ship;
|
||||
|
||||
this.state = {
|
||||
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} eng The number of pips to ENG
|
||||
* @param {Object} boost If boost is enabled
|
||||
* @param {Object} mass The mass at which to calculate the top speed
|
||||
* @return {number} The maximum speed
|
||||
*/
|
||||
calcMaxSpeed(ship, eng, boost, mass) {
|
||||
// Obtain the top speed
|
||||
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render engine profile
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship, cargo, eng, fuel, boost } = this.props;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship, pips, boost } = this.props;
|
||||
|
||||
// Calculate bounds for our line chart
|
||||
const thrusters = ship.standard[1].m;
|
||||
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
|
||||
const maxMass = thrusters.getMaxMass();
|
||||
const mass = ship.unladenMass + fuel + cargo;
|
||||
const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false);
|
||||
const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true);
|
||||
// Add a mark at our current mass
|
||||
const mark = Math.min(mass, maxMass);
|
||||
|
||||
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
|
||||
|
||||
const minMass = ship.readProp('hullmass');
|
||||
const maxMass = ship.getThrusters().get('enginemaximalmass');
|
||||
const baseSpeed = ship.readProp('speed');
|
||||
const baseBoost = getBoostMultiplier(ship);
|
||||
const cb = (eng, boost, mass) => {
|
||||
const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5];
|
||||
return baseSpeed * (boost ? baseBoost : 1) * mult;
|
||||
};
|
||||
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
|
||||
return (
|
||||
<LineChart
|
||||
xMin={minMass}
|
||||
xMax={maxMass}
|
||||
yMin={minSpeed}
|
||||
yMax={maxSpeed}
|
||||
xMark={mark}
|
||||
yMin={cb(0, false, maxMass)}
|
||||
yMax={cb(4, true, minMass)}
|
||||
// Add a mark at our current mass
|
||||
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
|
||||
xLabel={translate('mass')}
|
||||
xUnit={translate('T')}
|
||||
yLabel={translate('maximum speed')}
|
||||
yUnit={translate('m/s')}
|
||||
func={this.state.calcMaxSpeedFunc}
|
||||
func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)}
|
||||
points={1000}
|
||||
code={code}
|
||||
// Encode boost in code to re-render on state change
|
||||
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
|
||||
aspect={0.7}
|
||||
/>
|
||||
);
|
||||
|
||||
@@ -2,94 +2,47 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import LineChart from '../components/LineChart';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import { calculateJumpRange } from 'ed-forge/lib/src/stats/JumpRangeProfile';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* FSD profile for a given ship
|
||||
*/
|
||||
export default class FSDProfile extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const ship = this.props.ship;
|
||||
|
||||
this.state = {
|
||||
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum range for this ship across its applicable mass
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} fuel The fuel on the ship
|
||||
* @param {Object} mass The mass at which to calculate the maximum range
|
||||
* @return {number} The maximum range
|
||||
*/
|
||||
_calcMaxRange(ship, fuel, mass) {
|
||||
// Obtain the maximum range
|
||||
return Calc.jumpRange(mass, ship.standard[2].m, Math.min(fuel, ship.standard[2].m.getMaxFuelPerJump()), ship);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render FSD profile
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship, cargo, fuel } = this.props;
|
||||
|
||||
|
||||
// Calculate bounds for our line chart - use thruster info for X
|
||||
const thrusters = ship.standard[1].m;
|
||||
const fsd = ship.standard[2].m;
|
||||
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
|
||||
const maxMass = thrusters.getMaxMass();
|
||||
const mass = ship.unladenMass + fuel + cargo;
|
||||
const minRange = 0;
|
||||
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump(), ship);
|
||||
// Add a mark at our current mass
|
||||
const mark = Math.min(mass, maxMass);
|
||||
|
||||
const code = ship.name + ship.toString() + '.' + fuel;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship } = this.props;
|
||||
|
||||
const minMass = ship.readProp('hullmass');
|
||||
const maxMass = ship.getThrusters().get('enginemaximalmass');
|
||||
const mass = ship.get(LADEN_MASS);
|
||||
const cb = (mass) => calculateJumpRange(ship.getFSD(), 0, mass, Infinity, true);
|
||||
return (
|
||||
<LineChart
|
||||
xMin={minMass}
|
||||
xMax={maxMass}
|
||||
yMin={minRange}
|
||||
yMax={maxRange}
|
||||
xMark={mark}
|
||||
yMin={0}
|
||||
yMax={cb(minMass)}
|
||||
// Add a mark at our current mass
|
||||
xMark={Math.min(mass, maxMass)}
|
||||
xLabel={translate('mass')}
|
||||
xUnit={translate('T')}
|
||||
yLabel={translate('maximum range')}
|
||||
yUnit={translate('LY')}
|
||||
func={this.state.calcMaxRangeFunc}
|
||||
func={cb}
|
||||
points={200}
|
||||
code={code}
|
||||
aspect={0.7}
|
||||
|
||||
@@ -2,6 +2,7 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import Slider from '../components/Slider';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Fuel slider
|
||||
@@ -21,8 +22,7 @@ export default class Fuel extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._fuelChange = this._fuelChange.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,152 +0,0 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import Slot from './Slot';
|
||||
import Persist from '../stores/Persist';
|
||||
import {
|
||||
DamageAbsolute,
|
||||
DamageKinetic,
|
||||
DamageThermal,
|
||||
DamageExplosive,
|
||||
MountFixed,
|
||||
MountGimballed,
|
||||
MountTurret,
|
||||
ListModifications,
|
||||
Modified
|
||||
} from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
/**
|
||||
* Hardpoint / Utility Slot
|
||||
*/
|
||||
export default class HardpointSlot extends Slot {
|
||||
|
||||
/**
|
||||
* Get the CSS class name for the slot.
|
||||
* @return {string} CSS Class name
|
||||
*/
|
||||
_getClassNames() {
|
||||
return this.props.maxClass > 0 ? 'hardpoint' : null;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the label for the slot
|
||||
* @param {Function} translate Translate function
|
||||
* @return {string} Label
|
||||
*/
|
||||
_getMaxClassLabel(translate) {
|
||||
return translate(['U', 'S', 'M', 'L', 'H'][this.props.maxClass]);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the slot contents
|
||||
* @param {Object} m Mounted Module
|
||||
* @param {Boolean} enabled Slot enabled
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} formats Localized Formats map
|
||||
* @param {Object} u Localized Units Map
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getSlotDetails(m, enabled, translate, formats, u) {
|
||||
if (m) {
|
||||
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
|
||||
let { drag, drop } = this.props;
|
||||
let { termtip, tooltip } = this.context;
|
||||
let validMods = Modifications.modules[m.grp].modifications || [];
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
const className = cn('details', enabled ? '' : 'disabled');
|
||||
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>
|
||||
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')}
|
||||
onMouseOut={tooltip.bind(null, null)}><MountFixed/></span> : ''}
|
||||
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')}
|
||||
onMouseOut={tooltip.bind(null, null)}><MountGimballed/></span> : ''}
|
||||
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')}
|
||||
onMouseOut={tooltip.bind(null, null)}><MountTurret/></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')}
|
||||
onMouseOut={tooltip.bind(null, null)}><DamageKinetic/></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')}
|
||||
onMouseOut={tooltip.bind(null, null)}><DamageThermal/></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')}
|
||||
onMouseOut={tooltip.bind(null, null)}><DamageExplosive/></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')}
|
||||
onMouseOut={tooltip.bind(null, null)}><DamageAbsolute/></span> : ''}
|
||||
{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r'
|
||||
onMouseOver={termtip.bind(null, modTT)}
|
||||
onMouseOut={tooltip.bind(null, null)}><Modified/></span> : null}
|
||||
</div>
|
||||
|
||||
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} {m.getClip() ?
|
||||
<span>({formats.round1(m.getSDps())})</span> : null}</div> : null}
|
||||
{m.getDamage() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getDamage() ? 'shotdmg' : 'shotdmg')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('shotdmg')}: {formats.round1(m.getDamage())}</div> : null}
|
||||
{m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} {m.getClip() ?
|
||||
<span>({formats.round1(m.getEps() * m.getSustainedFactor())}{u.MW})</span> : null}</div> : null}
|
||||
{m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} {m.getClip() ?
|
||||
<span>({formats.round1(m.getHps() * m.getSustainedFactor())})</span> : null}</div> : null}
|
||||
{m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null}
|
||||
{m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')}
|
||||
onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null}
|
||||
{m.getRange() ? <div
|
||||
className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null}
|
||||
{m.getScanTime() ? <div
|
||||
className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null}
|
||||
{m.getFalloff() ? <div
|
||||
className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null}
|
||||
{m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null}
|
||||
{m.getAmmo() ? <div
|
||||
className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null}
|
||||
{m.getReload() ? <div className={'l'}>{translate('wep_reload')}: {formats.round(m.getReload())}{u.s}</div> : null}
|
||||
{m.getShotSpeed() ? <div
|
||||
className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null}
|
||||
{m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null}
|
||||
{m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null}
|
||||
{m.getScanAngle() ? <div className={'l'}>{translate('scan angle')}: {formats.f2(m.getScanAngle())}°</div> : null}
|
||||
{m.getScanRange() ? <div className={'l'}>{translate('scan range')}: {formats.int(m.getScanRange())}{u.m}</div> : null}
|
||||
{m.getMaxAngle() ? <div className={'l'}>{translate('max angle')}: {formats.f2(m.getMaxAngle())}°</div> : null}
|
||||
{showModuleResistances && m.getExplosiveResistance() ? <div
|
||||
className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null}
|
||||
{showModuleResistances && m.getKineticResistance() ? <div
|
||||
className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null}
|
||||
{showModuleResistances && m.getThermalResistance() ? <div
|
||||
className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null}
|
||||
{m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null}
|
||||
{m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null}
|
||||
{m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={modButton => this.modButton = modButton}>
|
||||
<button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation}
|
||||
onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}>
|
||||
<ListModifications/></button>
|
||||
</div> : null}
|
||||
</div>
|
||||
</div>;
|
||||
} else {
|
||||
return <div className={'empty'}>{translate('empty')}</div>;
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,63 +1,58 @@
|
||||
import React from 'react';
|
||||
import SlotSection from './SlotSection';
|
||||
import HardpointSlot from './HardpointSlot';
|
||||
import Slot from './Slot';
|
||||
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
const SIZE_ORDER = ['huge', 'large', 'medium', 'small'];
|
||||
|
||||
/**
|
||||
* Hardpoint slot section
|
||||
*/
|
||||
export default class HardpointSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'hardpoints', 'hardpoints');
|
||||
this._empty = this._empty.bind(this);
|
||||
this.selectedRefId = null;
|
||||
this.firstRefId = 'emptyall';
|
||||
this.lastRefId = 'nl-F';
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle focus when component updates
|
||||
* @param {Object} prevProps React Component properties
|
||||
*/
|
||||
componentDidUpdate(prevProps) {
|
||||
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
|
||||
constructor(props) {
|
||||
super(props, 'hardpoints');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all slots
|
||||
*/
|
||||
_empty() {
|
||||
this.selectedRefId = 'emptyall';
|
||||
this.props.ship.emptyWeapons();
|
||||
this.props.onChange();
|
||||
this.props.ship.getHardpoints(undefined, true).forEach((slot) => slot.reset());
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Fill slots with specified module
|
||||
* @param {string} group Group name
|
||||
* @param {string} mount Mount Type - F, G, T
|
||||
* @param {string} type Type of item
|
||||
* @param {string} rating Mount Type - (fixed, gimbal, turret)
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fill(group, mount, event) {
|
||||
this.selectedRefId = group + '-' + mount;
|
||||
this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
_fill(type, rating, event) {
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
this.props.ship.getHardpoints(undefined, true).forEach((slot) => {
|
||||
if (slot.isEmpty() || fillAll) {
|
||||
const slotSize = slot.getSize();
|
||||
const fittingSizes = SIZE_ORDER.slice(SIZE_ORDER.findIndex((e) => e === slotSize));
|
||||
for (const size of fittingSizes) {
|
||||
try {
|
||||
slot.setItem(type, size, rating);
|
||||
} catch (err) {
|
||||
// Try next item if this doesn't fit/exist
|
||||
continue;
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all on section header right click
|
||||
*/
|
||||
_contextMenu() {
|
||||
this._empty();
|
||||
// If still here, we were able to apply the module
|
||||
break;
|
||||
}
|
||||
}
|
||||
});
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -65,33 +60,24 @@ export default class HardpointSlotSection extends SlotSection {
|
||||
* @return {Array} Array of Slots
|
||||
*/
|
||||
_getSlots() {
|
||||
let { ship, currentMenu } = this.props;
|
||||
let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let slots = [];
|
||||
let hardpoints = ship.hardpoints;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = hardpoints.length; i < l; i++) {
|
||||
let h = hardpoints[i];
|
||||
if (h.maxClass) {
|
||||
slots.push(<HardpointSlot
|
||||
key={i}
|
||||
maxClass={h.maxClass}
|
||||
availableModules={() => availableModules.getHps(h.maxClass)}
|
||||
onOpen={this._openMenu.bind(this, h)}
|
||||
onSelect={this._selectModule.bind(this, h)}
|
||||
onChange={this.props.onChange}
|
||||
selected={currentMenu == h}
|
||||
for (let h of ship.getHardpoints(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={h.object.Slot}
|
||||
currentMenu={currentMenu}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
ship={ship}
|
||||
m={h.m}
|
||||
m={h}
|
||||
enabled={h.enabled ? true : false}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
}
|
||||
|
||||
return slots;
|
||||
}
|
||||
@@ -101,68 +87,68 @@ export default class HardpointSlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
let _fill = this._fill;
|
||||
|
||||
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('pl')}</div>
|
||||
<div className='select-group cap'>{translate('pulselaser')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('ul')}</div>
|
||||
<div className='select-group cap'>{translate('burstlaser')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('bl')}</div>
|
||||
<div className='select-group cap'>{translate('beamlaser')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('mc')}</div>
|
||||
<div className='select-group cap'>{translate('multicannon')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('c')}</div>
|
||||
<div className='select-group cap'>{translate('cannon')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('fc')}</div>
|
||||
<div className='select-group cap'>{translate('fragcannon')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-G'] = smRef}><MountGimballed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'gimbal')}><MountGimballed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('pa')}</div>
|
||||
<div className='select-group cap'>{translate('plasmaacc')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'pa', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pa-F'] = smRef}>{translate('pa')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'plasmaacc', 'fixed')}>{translate('pa')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('rg')}</div>
|
||||
<div className='select-group cap'>{translate('railgun')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'rg', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rg-F'] = smRef}>{translate('rg')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'railgun', 'fixed')}>{translate('rg')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('nl')}</div>
|
||||
<div className='select-group cap'>{translate('minelauncher')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'nl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['nl-F'] = smRef}>{translate('nl')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'minelauncher', 'fixed')}>{translate('nl')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('rfl')}</div>
|
||||
<div className='select-group cap'>{translate('flaklauncher')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-F'] = smRef}><MountFixed className='lg'/></li>
|
||||
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-T'] = smRef}><MountTurret className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'fixed')}><MountFixed className='lg'/></li>
|
||||
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'turret')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -6,10 +6,7 @@ import Link from './Link';
|
||||
import ActiveLink from './ActiveLink';
|
||||
import cn from 'classnames';
|
||||
import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Persist from '../stores/Persist';
|
||||
import { toDetailedExport } from '../shipyard/Serializer';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import ModalDeleteAll from './ModalDeleteAll';
|
||||
import ModalExport from './ModalExport';
|
||||
import ModalHelp from './ModalHelp';
|
||||
@@ -17,6 +14,9 @@ import ModalImport from './ModalImport';
|
||||
import Slider from './Slider';
|
||||
import Announcement from './Announcement';
|
||||
import { outfitURL } from '../utils/UrlGenerators';
|
||||
import autoBind from 'auto-bind';
|
||||
import { Factory, Ship } from 'ed-forge';
|
||||
import { chain, entries } from 'lodash';
|
||||
|
||||
const SIZE_MIN = 0.65;
|
||||
const SIZE_RANGE = 0.55;
|
||||
@@ -55,7 +55,6 @@ function selectAll(e) {
|
||||
* Coriolis App Header section / menus
|
||||
*/
|
||||
export default class Header extends TranslatedComponent {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
@@ -63,24 +62,14 @@ export default class Header extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
this.shipOrder = Object.keys(Ships).sort();
|
||||
autoBind(this);
|
||||
this.ships = Factory.getAllShipTypes().sort();
|
||||
|
||||
this._setLanguage = this._setLanguage.bind(this);
|
||||
this._setInsurance = this._setInsurance.bind(this);
|
||||
this._setShipDiscount = this._setShipDiscount.bind(this);
|
||||
this._changeShipDiscount = this._changeShipDiscount.bind(this);
|
||||
this._kpShipDiscount = this._kpShipDiscount.bind(this);
|
||||
this._setModuleDiscount = this._setModuleDiscount.bind(this);
|
||||
this._changeModuleDiscount = this._changeModuleDiscount.bind(this);
|
||||
this._kpModuleDiscount = this._kpModuleDiscount.bind(this);
|
||||
this._openShips = this._openMenu.bind(this, 's');
|
||||
this._openBuilds = this._openMenu.bind(this, 'b');
|
||||
this._openComp = this._openMenu.bind(this, 'comp');
|
||||
this._openAnnounce = this._openMenu.bind(this, 'announce');
|
||||
this._getAnnouncementsMenu = this._getAnnouncementsMenu.bind(this);
|
||||
this._openSettings = this._openMenu.bind(this, 'settings');
|
||||
this._showHelp = this._showHelp.bind(this);
|
||||
this.update = this.update.bind(this);
|
||||
this.languageOptions = [];
|
||||
this.insuranceOptions = [];
|
||||
this.state = {
|
||||
@@ -210,13 +199,6 @@ export default class Header extends TranslatedComponent {
|
||||
Persist.showTooltips(!Persist.showTooltips());
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle module resistances setting
|
||||
*/
|
||||
_toggleModuleResistances() {
|
||||
Persist.showModuleResistances(!Persist.showModuleResistances());
|
||||
}
|
||||
|
||||
/**
|
||||
* Show delete all modal
|
||||
* @param {SyntheticEvent} e Event
|
||||
@@ -226,20 +208,6 @@ export default class Header extends TranslatedComponent {
|
||||
this.context.showModal(<ModalDeleteAll />);
|
||||
};
|
||||
|
||||
/**
|
||||
* Show export modal with backup data
|
||||
* @param {SyntheticEvent} e Event
|
||||
*/
|
||||
_showBackup(e) {
|
||||
let translate = this.context.language.translate;
|
||||
e.preventDefault();
|
||||
this.context.showModal(<ModalExport
|
||||
title={translate('backup')}
|
||||
description={translate('PHRASE_BACKUP_DESC')}
|
||||
data={Persist.getAll()}
|
||||
/>);
|
||||
};
|
||||
|
||||
/**
|
||||
* Show export modal with detailed export
|
||||
* @param {SyntheticEvent} e Event
|
||||
@@ -248,10 +216,22 @@ export default class Header extends TranslatedComponent {
|
||||
let translate = this.context.language.translate;
|
||||
e.preventDefault();
|
||||
|
||||
const builds = chain(Persist.getBuilds())
|
||||
.values()
|
||||
.map((builds) => Object.values(builds))
|
||||
.flatMap()
|
||||
.map((code) => new Ship(code))
|
||||
.value();
|
||||
|
||||
this.context.showModal(<ModalExport
|
||||
title={translate('detailed export')}
|
||||
description={translate('PHRASE_EXPORT_DESC')}
|
||||
data={toDetailedExport(Persist.getBuilds())}
|
||||
data={JSON.stringify(builds.map((build) => {
|
||||
return {
|
||||
header: { appName: 'Inara', 'appVersion': '1.0' },
|
||||
data: build.toJSON(),
|
||||
};
|
||||
}))}
|
||||
/>);
|
||||
}
|
||||
|
||||
@@ -309,15 +289,10 @@ export default class Header extends TranslatedComponent {
|
||||
* @return {React.Component} Menu
|
||||
*/
|
||||
_getShipsMenu() {
|
||||
let shipList = [];
|
||||
|
||||
for (let s of this.shipOrder) {
|
||||
shipList.push(<ActiveLink key={s} href={outfitURL(s)} className='block'>{Ships[s].properties.name}</ActiveLink>);
|
||||
}
|
||||
|
||||
const { translate } = this.context.language;
|
||||
return (
|
||||
<div className='menu-list dbl no-wrap' onClick={ (e) => e.stopPropagation() }>
|
||||
{shipList}
|
||||
{this.ships.map((s) => <ActiveLink key={s} href={outfitURL(s)} className='block'>{translate(s)}</ActiveLink>)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
@@ -327,9 +302,10 @@ export default class Header extends TranslatedComponent {
|
||||
* @return {React.Component} Menu
|
||||
*/
|
||||
_getBuildsMenu() {
|
||||
const { translate } = this.context.language;
|
||||
let builds = Persist.getBuilds();
|
||||
let buildList = [];
|
||||
for (let shipId of this.shipOrder) {
|
||||
for (let shipId of this.ships) {
|
||||
if (builds[shipId]) {
|
||||
let shipBuilds = [];
|
||||
let buildNameOrder = Object.keys(builds[shipId]).sort();
|
||||
@@ -337,7 +313,7 @@ export default class Header extends TranslatedComponent {
|
||||
let href = outfitURL(shipId, builds[shipId][buildName], buildName);
|
||||
shipBuilds.push(<li key={shipId + '-' + buildName} ><ActiveLink href={href} className='block'>{buildName}</ActiveLink></li>);
|
||||
}
|
||||
buildList.push(<ul key={shipId}>{Ships[shipId].properties.name}{shipBuilds}</ul>);
|
||||
buildList.push(<ul key={shipId}>{translate(shipId)}{shipBuilds}</ul>);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -388,11 +364,9 @@ export default class Header extends TranslatedComponent {
|
||||
if (this.props.announcements) {
|
||||
announcements = [];
|
||||
for (let announce of this.props.announcements) {
|
||||
// Announcement has expired, skip it
|
||||
if (Date.now() > Date.parse(announce.expiry)) {
|
||||
if (announce.expiry < Date.now()) {
|
||||
continue;
|
||||
}
|
||||
// Add announcements which have not expired to the menu
|
||||
announcements.push(<Announcement text={announce.text} />);
|
||||
announcements.push(<hr/>);
|
||||
}
|
||||
@@ -400,6 +374,7 @@ export default class Header extends TranslatedComponent {
|
||||
return (
|
||||
<div className='menu-list' onClick={ (e) => e.stopPropagation() } style={{ whiteSpace: 'nowrap' }}>
|
||||
{announcements}
|
||||
<hr />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
@@ -411,7 +386,6 @@ export default class Header extends TranslatedComponent {
|
||||
_getSettingsMenu() {
|
||||
let translate = this.context.language.translate;
|
||||
let tips = Persist.showTooltips();
|
||||
let moduleResistances = Persist.showModuleResistances();
|
||||
|
||||
return (
|
||||
<div className='menu-list no-wrap cap' onClick={ (e) => e.stopPropagation() }>
|
||||
@@ -429,10 +403,6 @@ export default class Header extends TranslatedComponent {
|
||||
<td>{translate('tooltips')}</td>
|
||||
<td className={cn('ri', { disabled: !tips, 'primary-disabled': tips })}>{(tips ? '✓' : '✗')}</td>
|
||||
</tr>
|
||||
<tr className='cap ptr' onClick={this._toggleModuleResistances} >
|
||||
<td>{translate('module resistances')}</td>
|
||||
<td className={cn('ri', { disabled: !moduleResistances, 'primary-disabled': moduleResistances })}>{(moduleResistances ? '✓' : '✗')}</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>{translate('insurance')}</td>
|
||||
<td className='ri'>
|
||||
@@ -460,10 +430,9 @@ export default class Header extends TranslatedComponent {
|
||||
<hr />
|
||||
<ul style={{ width: '100%' }}>
|
||||
{translate('builds')} & {translate('comparisons')}
|
||||
<li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDetailedExport}>{translate('detailed export')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showImport}>{translate('import')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDeleteAll}>{translate('delete all')}</Link></li>
|
||||
</ul>
|
||||
<hr />
|
||||
<table style={{ width: 300, backgroundColor: 'transparent' }}>
|
||||
@@ -495,7 +464,6 @@ export default class Header extends TranslatedComponent {
|
||||
Persist.addListener('deletedAll', update);
|
||||
Persist.addListener('builds', update);
|
||||
Persist.addListener('tooltips', update);
|
||||
Persist.addListener('moduleresistances', update);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -565,19 +533,13 @@ export default class Header extends TranslatedComponent {
|
||||
{openedMenu == 'b' ? this._getBuildsMenu() : null}
|
||||
</div>
|
||||
|
||||
<div className='l menu'>
|
||||
<div className={cn('menu-header', { selected: openedMenu == 'comp', disabled: !hasBuilds })} onClick={hasBuilds && this._openComp}>
|
||||
<StatsBars className={cn('warning', { 'warning-disabled': !hasBuilds })} /><span className='menu-item-label'>{translate('compare')}</span>
|
||||
</div>
|
||||
{openedMenu == 'comp' ? this._getComparisonsMenu() : null}
|
||||
</div>
|
||||
|
||||
<div className='l menu'>
|
||||
{/* TODO: Enable */}
|
||||
{/* <div className='l menu'>
|
||||
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0 })} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
|
||||
<span className='menu-item-label'>{translate('announcements')}</span>
|
||||
</div>
|
||||
{openedMenu == 'announce' ? this._getAnnouncementsMenu() : null}
|
||||
</div>
|
||||
</div> */}
|
||||
|
||||
{window.location.origin.search('.edcd.io') >= 0 ?
|
||||
<div className='l menu'>
|
||||
@@ -604,5 +566,4 @@ export default class Header extends TranslatedComponent {
|
||||
</header>
|
||||
);
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,99 +0,0 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import Slot from './Slot';
|
||||
import Persist from '../stores/Persist';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
/**
|
||||
* Internal Slot
|
||||
*/
|
||||
export default class InternalSlot extends Slot {
|
||||
|
||||
/**
|
||||
* Generate the slot contents
|
||||
* @param {Object} m Mounted Module
|
||||
* @param {Boolean} enabled Slot enabled
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} formats Localized Formats map
|
||||
* @param {Object} u Localized Units Map
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getSlotDetails(m, enabled, translate, formats, u) {
|
||||
if (m) {
|
||||
let classRating = m.class + m.rating;
|
||||
let { drag, drop, ship } = this.props;
|
||||
let { termtip, tooltip } = this.context;
|
||||
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
let mass = m.getMass() || m.cargo || m.fuel || 0;
|
||||
|
||||
const className = cn('details', enabled ? '' : 'disabled');
|
||||
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
|
||||
<div className={'r'}>{formats.round(mass)}{u.T}</div>
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
|
||||
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
|
||||
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
|
||||
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
|
||||
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
|
||||
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs} {translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
|
||||
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
|
||||
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
|
||||
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
|
||||
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
|
||||
{ m.grp === 'gsrp' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
|
||||
{ m.grp === 'gfsb' ? <div className={'l'}>{translate('jump addition')}: {formats.f1(m.getJumpBoost())}{u.LY}</div> : null }
|
||||
{ m.grp === 'gs' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
|
||||
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
|
||||
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
|
||||
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
|
||||
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
|
||||
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
|
||||
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
|
||||
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
|
||||
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
|
||||
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
|
||||
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
|
||||
{ m.rangeLS === null ? <div className={'l'}>∞{u.Ls}</div> : null }
|
||||
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
|
||||
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
|
||||
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
|
||||
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
|
||||
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getCausticResistance() ? <div className='l'>{translate('causres')}: {formats.pct(m.getCausticResistance())}</div> : null }
|
||||
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
|
||||
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
|
||||
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
|
||||
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
|
||||
{ m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
|
||||
</div>
|
||||
</div>;
|
||||
} else {
|
||||
return <div className={'empty'}>{translate('empty')}</div>;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,52 +1,46 @@
|
||||
import React from 'react';
|
||||
import SlotSection from './SlotSection';
|
||||
import InternalSlot from './InternalSlot';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Slot from './Slot';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { canMount } from '../utils/SlotFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
import { TYPES } from 'ed-forge/lib/src/data/slots';
|
||||
|
||||
/**
|
||||
* Sets all empty slots of a ship to a item of the given size.
|
||||
* @param {Ship} ship Ship to set items for
|
||||
* @param {boolean} fillAll True to also fill occupied
|
||||
* @param {string} type Item type
|
||||
* @param {string} rating Item rating
|
||||
*/
|
||||
function setAllEmpty(ship, fillAll, type, rating = '') {
|
||||
ship.getModules(TYPES.ANY_INTERNAL, undefined, true).forEach((slot) => {
|
||||
if (slot.isEmpty() || fillAll) {
|
||||
try {
|
||||
// Maybe the item does not exist. Simply catch this error.
|
||||
slot.setItem(type, slot.getSize(), rating);
|
||||
} catch (e) {}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Internal slot section
|
||||
*/
|
||||
export default class InternalSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'internal', 'optional internal');
|
||||
this._empty = this._empty.bind(this);
|
||||
this._fillWithCargo = this._fillWithCargo.bind(this);
|
||||
this._fillWithCells = this._fillWithCells.bind(this);
|
||||
this._fillWithArmor = this._fillWithArmor.bind(this);
|
||||
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
|
||||
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
|
||||
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
|
||||
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
|
||||
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
|
||||
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
|
||||
this.selectedRefId = null;
|
||||
this.firstRefId = 'emptyall';
|
||||
this.lastRefId = this.sectionRefArr['pcq'] ? 'pcq' : 'pcm';
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle focus when component updates
|
||||
* @param {Object} prevProps React Component properties
|
||||
*/
|
||||
componentDidUpdate(prevProps) {
|
||||
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
|
||||
constructor(props) {
|
||||
super(props, 'optional internal');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all slots
|
||||
*/
|
||||
_empty() {
|
||||
this.selectedRefId = 'emptyall';
|
||||
this.props.ship.emptyInternal();
|
||||
this.props.onChange();
|
||||
this.props.ship.getModules(TYPES.ANY_INTERNAL).forEach((slot) => slot.reset());
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -55,15 +49,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithCargo(event) {
|
||||
this.selectedRefId = 'cargo';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'cr')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'cargorack');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -72,15 +59,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithFuelTanks(event) {
|
||||
this.selectedRefId = 'ft';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'ft')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'fueltank', '3');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -89,15 +69,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithLuxuryCabins(event) {
|
||||
this.selectedRefId = 'pcq';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'pcq')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '4');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -106,15 +79,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithFirstClassCabins(event) {
|
||||
this.selectedRefId = 'pcm';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'pcm')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '3');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -123,15 +89,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithBusinessClassCabins(event) {
|
||||
this.selectedRefId = 'pci';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'pci')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '2');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -140,15 +99,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithEconomyClassCabins(event) {
|
||||
this.selectedRefId = 'pce';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'pce')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '1');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -157,18 +109,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithCells(event) {
|
||||
this.selectedRefId = 'scb';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
let chargeCap = 0; // Capacity of single activation
|
||||
ship.internal.forEach(function(slot) {
|
||||
if ((clobber && !(slot.m && ModuleUtils.isShieldGenerator(slot.m.grp)) || !slot.m) && canMount(ship, slot, 'scb')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('scb', slot.maxClass, 'A'));
|
||||
ship.setSlotEnabled(slot, chargeCap <= ship.shieldStrength); // Don't waste cell capacity on overcharge
|
||||
chargeCap += slot.m.recharge;
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'scb', '5');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -177,15 +119,8 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithArmor(event) {
|
||||
this.selectedRefId = 'hr';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'hr')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'hrp', '2');
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -194,56 +129,31 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fillWithModuleReinforcementPackages(event) {
|
||||
this.selectedRefId = 'mrp';
|
||||
let clobber = event.getModifierState('Alt');
|
||||
let ship = this.props.ship;
|
||||
ship.internal.forEach((slot) => {
|
||||
if ((clobber || !slot.m) && canMount(ship, slot, 'mrp')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
setAllEmpty(this.props.ship, fillAll, 'mrp', '2');
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all on section header right click
|
||||
*/
|
||||
_contextMenu() {
|
||||
this._empty();
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the slot React Components
|
||||
* @return {Array} Array of Slots
|
||||
*/
|
||||
_getSlots() {
|
||||
let slots = [];
|
||||
let { currentMenu, ship } = this.props;
|
||||
let { currentMenu, ship, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let { internal, fuelCapacity } = ship;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = internal.length; i < l; i++) {
|
||||
let s = internal[i];
|
||||
|
||||
slots.push(<InternalSlot
|
||||
key={i}
|
||||
maxClass={s.maxClass}
|
||||
availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)}
|
||||
onOpen={this._openMenu.bind(this,s)}
|
||||
onChange={this.props.onChange}
|
||||
onSelect={this._selectModule.bind(this, s)}
|
||||
selected={currentMenu == s}
|
||||
eligible={s.eligible}
|
||||
m={s.m}
|
||||
drag={this._drag.bind(this, s)}
|
||||
dragOver={this._dragOverSlot.bind(this, s)}
|
||||
for (const m of ship.getInternals(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={m.object.Slot}
|
||||
currentMenu={currentMenu}
|
||||
m={m}
|
||||
drag={this._drag.bind(this, m)}
|
||||
dragOver={this._dragOverSlot.bind(this, m)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(s, originSlot, targetSlot)}
|
||||
fuel={fuelCapacity}
|
||||
ship={ship}
|
||||
enabled={s.enabled ? true : false}
|
||||
dropClass={this._dropClass(m, originSlot, targetSlot)}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
|
||||
@@ -256,22 +166,23 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {Function} ship The ship
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate, ship) {
|
||||
_getSectionMenu() {
|
||||
const { ship } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCargo} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['cargo'] = smRef}>{translate('cargo')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCells} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['scb'] = smRef}>{translate('scb')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithArmor} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hr'] = smRef}>{translate('hr')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mrp'] = smRef}>{translate('mrp')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ft'] = smRef}>{translate('ft')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pce'] = smRef}>{translate('pce')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pci'] = smRef}>{translate('pci')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown} ref={smRef => this.sectionRefArr['pcm'] = smRef}>{translate('pcm')}</li>
|
||||
{ ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pcq'] = smRef}>{translate('pcq')}</li> : ''}
|
||||
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li>
|
||||
{ ship.readMeta('luxuryCabins') ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,120 +0,0 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
|
||||
/**
|
||||
* Jump range for a given ship
|
||||
*/
|
||||
export default class JumpRange extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
code: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const ship = this.props.ship;
|
||||
|
||||
this.state = {
|
||||
fuelLevel: 1,
|
||||
calcJumpRangeFunc: this._calcJumpRange.bind(this, ship)
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.code != this.props.code) {
|
||||
this.setState({ fuelLevel: 1,
|
||||
calcJumpRangeFunc: this._calcJumpRange.bind(this, nextProps.ship) });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the jump range this ship at a given cargo
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} cargo The cargo
|
||||
* @return {number} The jump range
|
||||
*/
|
||||
_calcJumpRange(ship, cargo) {
|
||||
// Obtain the FSD for this ship
|
||||
const fsd = ship.standard[2].m;
|
||||
|
||||
const fuel = this.state.fuelLevel * ship.fuelCapacity;
|
||||
|
||||
// Obtain the jump range
|
||||
return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel, ship);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update fuel level
|
||||
* @param {number} fuelLevel Fuel level 0 - 1
|
||||
*/
|
||||
_fuelChange(fuelLevel) {
|
||||
this.setState({
|
||||
fuelLevel,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Render engine profile
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship } = this.props;
|
||||
const { fuelLevel } = this.state;
|
||||
|
||||
const code = ship.toString() + '.' + ship.getModificationsString() + '.' + fuelLevel;
|
||||
|
||||
return (
|
||||
<span>
|
||||
<h1>{translate('jump range')}</h1>
|
||||
<LineChart
|
||||
xMax={ship.cargoCapacity}
|
||||
yMax={ship.unladenRange}
|
||||
xLabel={translate('cargo')}
|
||||
xUnit={translate('T')}
|
||||
yLabel={translate('jump range')}
|
||||
yUnit={translate('LY')}
|
||||
func={this.state.calcJumpRangeFunc}
|
||||
points={200}
|
||||
code={code}
|
||||
/>
|
||||
<h3>{translate('fuel carried')}: {formats.f2(fuelLevel * ship.fuelCapacity)}{units.T}</h3>
|
||||
<table style={{ width: '100%', lineHeight: '1em', backgroundColor: 'transparent' }}>
|
||||
<tbody >
|
||||
<tr>
|
||||
<td>
|
||||
<Slider
|
||||
axis={true}
|
||||
onChange={this._fuelChange.bind(this)}
|
||||
axisUnit={translate('T')}
|
||||
percent={fuelLevel}
|
||||
max={ship.fuelCapacity}
|
||||
scale={sizeRatio}
|
||||
onResize={onWindowResize}
|
||||
/>
|
||||
</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
</span>
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -3,6 +3,7 @@ import PropTypes from 'prop-types';
|
||||
import ContainerDimensions from 'react-container-dimensions';
|
||||
import * as d3 from 'd3';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
|
||||
|
||||
@@ -10,7 +11,6 @@ const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
|
||||
* Line Chart
|
||||
*/
|
||||
export default class LineChart extends TranslatedComponent {
|
||||
|
||||
static defaultProps = {
|
||||
code: '',
|
||||
xMin: 0,
|
||||
@@ -45,13 +45,7 @@ export default class LineChart extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
this._updateSeries = this._updateSeries.bind(this);
|
||||
this._tooltip = this._tooltip.bind(this);
|
||||
this._showTip = this._showTip.bind(this);
|
||||
this._hideTip = this._hideTip.bind(this);
|
||||
this._moveTip = this._moveTip.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
const series = props.series;
|
||||
|
||||
|
||||
@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Link wrapper component
|
||||
*/
|
||||
export default class Link extends React.Component {
|
||||
|
||||
static propTypes = {
|
||||
children: PropTypes.any,
|
||||
href: PropTypes.string.isRequired,
|
||||
@@ -56,5 +55,4 @@ export default class Link extends React.Component {
|
||||
render() {
|
||||
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -21,7 +21,6 @@ function buildComparator(a, b) {
|
||||
* Compare builds modal
|
||||
*/
|
||||
export default class ModalCompare extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
builds: PropTypes.array
|
||||
@@ -105,8 +104,8 @@ export default class ModalCompare extends TranslatedComponent {
|
||||
|
||||
let selectedBuilds = usedBuilds.map((build, i) =>
|
||||
<tr key={i} onClick={this._removeBuild.bind(this, i)}>
|
||||
<td className='tl'>{build.name}</td><
|
||||
td className='tl'>{build.buildName}</td>
|
||||
<td className='tl'>{build.name}</td>
|
||||
<td className='tl'>{build.buildName}</td>
|
||||
</tr>
|
||||
);
|
||||
|
||||
|
||||
@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Export Modal
|
||||
*/
|
||||
export default class ModalExport extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
title: PropTypes.string,
|
||||
generator: PropTypes.func,
|
||||
|
||||
@@ -7,19 +7,10 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Help Modal
|
||||
*/
|
||||
export default class ModalHelp extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
title: PropTypes.string
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
|
||||
@@ -2,92 +2,21 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import Router from '../Router';
|
||||
import Persist from '../stores/Persist';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import { ModuleNameToGroup, Insurance } from '../shipyard/Constants';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { fromDetailedBuild } from '../shipyard/Serializer';
|
||||
import { Download } from './SvgIcons';
|
||||
import { outfitURL } from '../utils/UrlGenerators';
|
||||
import { shipFromJson, shipModelFromJson } from '../utils/CompanionApiUtils';
|
||||
import { shipFromLoadoutJSON } from '../utils/JournalUtils';
|
||||
import autoBind from 'auto-bind';
|
||||
import { isArray } from 'lodash';
|
||||
import { Ship } from 'ed-forge';
|
||||
|
||||
const zlib = require('pako');
|
||||
|
||||
const textBuildRegex = new RegExp('^\\[([\\w \\-]+)\\]\n');
|
||||
const lineRegex = new RegExp('^([\\dA-Z]{1,2}): (\\d)([A-I])[/]?([FGT])?([SD])? ([\\w\\- ]+)');
|
||||
const mountMap = { 'H': 4, 'L': 3, 'M': 2, 'S': 1, 'U': 0 };
|
||||
const standardMap = { 'RB': 0, 'TM': 1, 'FH': 2, 'EC': 3, 'PC': 4, 'SS': 5, 'FS': 6 };
|
||||
const bhMap = { 'lightweight alloy': 0, 'reinforced alloy': 1, 'military grade composite': 2, 'mirrored surface composite': 3, 'reactive surface composite': 4 };
|
||||
|
||||
/**
|
||||
* Check is slot is empty
|
||||
* @param {Object} slot Slot model
|
||||
* @return {Boolean} True if empty
|
||||
*/
|
||||
function isEmptySlot(slot) {
|
||||
return slot.maxClass == this && slot.m === null;
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if a build is valid
|
||||
* @param {string} shipId Ship ID
|
||||
* @param {string} code Serialzied ship build 'code'
|
||||
* @param {string} name Build name
|
||||
* @throws {string} If build is not valid
|
||||
*/
|
||||
function validateBuild(shipId, code, name) {
|
||||
let shipData = Ships[shipId];
|
||||
|
||||
if (!shipData) {
|
||||
throw '"' + shipId + '" is not a valid Ship Id!';
|
||||
}
|
||||
if (typeof name != 'string' || name.length == 0) {
|
||||
throw shipData.properties.name + ' build "' + name + '" must be a string at least 1 character long!';
|
||||
}
|
||||
if (typeof code != 'string' || code.length < 10) {
|
||||
throw shipData.properties.name + ' build "' + name + '" is not valid!';
|
||||
}
|
||||
try {
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
ship.buildFrom(code);
|
||||
} catch (e) {
|
||||
throw shipData.properties.name + ' build "' + name + '" is not valid!';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Convert a ship-loadout JSON object to a Coriolis build
|
||||
* @param {Object} detailedBuild ship-loadout
|
||||
* @return {Object} Coriolis build
|
||||
*/
|
||||
function detailedJsonToBuild(detailedBuild) {
|
||||
let ship;
|
||||
if (!detailedBuild.name) {
|
||||
throw 'Build Name missing!';
|
||||
}
|
||||
|
||||
if (!detailedBuild.name.trim()) {
|
||||
throw 'Build Name must be a string at least 1 character long!';
|
||||
}
|
||||
|
||||
try {
|
||||
ship = fromDetailedBuild(detailedBuild);
|
||||
} catch (e) {
|
||||
throw detailedBuild.ship + ' Build "' + detailedBuild.name + '": Invalid data';
|
||||
}
|
||||
|
||||
return { shipId: ship.id, name: detailedBuild.name, code: ship.toString() };
|
||||
}
|
||||
const STATE = {
|
||||
READY: 0,
|
||||
PARSED: 1,
|
||||
ERROR: 2,
|
||||
};
|
||||
|
||||
/**
|
||||
* Import Modal
|
||||
*/
|
||||
export default class ModalImport extends TranslatedComponent {
|
||||
|
||||
|
||||
static propTypes = {
|
||||
importString: PropTypes.string, // Optional: Default data for import modal
|
||||
builds: PropTypes.object, // Optional: Import object
|
||||
@@ -99,228 +28,12 @@ export default class ModalImport extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
|
||||
this.state = {
|
||||
builds: props.builds,
|
||||
canEdit: !props.builds,
|
||||
loadoutEvent: null,
|
||||
comparisons: null,
|
||||
shipDiscount: null,
|
||||
moduleDiscount: null,
|
||||
errorMsg: null,
|
||||
importString: props.importString || null,
|
||||
importValid: false,
|
||||
insurance: null
|
||||
status: STATE.READY,
|
||||
builds: props.builds || [],
|
||||
};
|
||||
|
||||
this._process = this._process.bind(this);
|
||||
this._import = this._import.bind(this);
|
||||
this._importBackup = this._importBackup.bind(this);
|
||||
this._importLoadout = this._importLoadout.bind(this);
|
||||
this._importDetailedArray = this._importDetailedArray.bind(this);
|
||||
this._importTextBuild = this._importTextBuild.bind(this);
|
||||
this._importCompanionApiBuild = this._importCompanionApiBuild.bind(this);
|
||||
this._validateImport = this._validateImport.bind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a Loadout event from Elite: Dangerous journal files
|
||||
* @param {Object} data Loadout event
|
||||
* @throws {string} If import fails
|
||||
*/
|
||||
_importLoadout(data) {
|
||||
if (data && data.Ship && data.Modules) {
|
||||
const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' });
|
||||
let compressed = btoa(deflated);
|
||||
this.setState({loadoutEvent: compressed});
|
||||
} else {
|
||||
throw 'Loadout event must contain Ship and Modules';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a Coriolis backup
|
||||
* @param {Object} importData Backup Data
|
||||
* @throws {string} If import fails
|
||||
*/
|
||||
_importBackup(importData) {
|
||||
if (importData.builds && typeof importData.builds == 'object') {
|
||||
for (let shipId in importData.builds) {
|
||||
for (let buildName in importData.builds[shipId]) {
|
||||
try {
|
||||
validateBuild(shipId, importData.builds[shipId][buildName], buildName);
|
||||
} catch (err) {
|
||||
delete importData.builds[shipId][buildName];
|
||||
}
|
||||
}
|
||||
}
|
||||
this.setState({ builds: importData.builds });
|
||||
} else {
|
||||
throw 'builds must be an object!';
|
||||
}
|
||||
if (importData.comparisons) {
|
||||
for (let compName in importData.comparisons) {
|
||||
let comparison = importData.comparisons[compName];
|
||||
for (let i = 0, l = comparison.builds.length; i < l; i++) {
|
||||
let build = comparison.builds[i];
|
||||
if (!importData.builds[build.shipId] || !importData.builds[build.shipId][build.buildName]) {
|
||||
throw build.shipId + ' build "' + build.buildName + '" data is missing!';
|
||||
}
|
||||
}
|
||||
}
|
||||
this.setState({ comparisons: importData.comparisons });
|
||||
}
|
||||
// Check for old/deprecated discounts
|
||||
if (importData.discounts instanceof Array && importData.discounts.length == 2) {
|
||||
this.setState({ shipDiscount: importData.discounts[0], moduleDiscount: importData.discounts[1] });
|
||||
}
|
||||
// Check for ship discount
|
||||
if (!isNaN(importData.shipDiscount)) {
|
||||
this.setState({ shipDiscount: importData.shipDiscount * 1 });
|
||||
}
|
||||
// Check for module discount
|
||||
if (!isNaN(importData.moduleDiscount)) {
|
||||
this.setState({ moduleDiscount: importData.moduleDiscount * 1 });
|
||||
}
|
||||
|
||||
if (typeof importData.insurance == 'string') {
|
||||
let insurance = importData.insurance.toLowerCase();
|
||||
|
||||
if (Insurance[insurance] !== undefined) {
|
||||
this.setState({ insurance });
|
||||
} else {
|
||||
throw 'Invalid insurance type: ' + insurance;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Import an array of ship-loadout objects / builds
|
||||
* @param {Array} importArr Array of ship-loadout JSON Schema builds
|
||||
*/
|
||||
_importDetailedArray(importArr) {
|
||||
let builds = {};
|
||||
for (let i = 0, l = importArr.length; i < l; i++) {
|
||||
let build = detailedJsonToBuild(importArr[i]);
|
||||
if (!builds[build.shipId]) {
|
||||
builds[build.shipId] = {};
|
||||
}
|
||||
builds[build.shipId][build.name] = build.code;
|
||||
}
|
||||
this.setState({ builds });
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a build direct from the companion API
|
||||
* @param {string} build JSON from the companion API information
|
||||
* @throws {string} if parse/import fails
|
||||
*/
|
||||
_importCompanionApiBuild(build) {
|
||||
const shipModel = shipModelFromJson(build);
|
||||
const ship = shipFromJson(build);
|
||||
|
||||
let builds = {};
|
||||
builds[shipModel] = {};
|
||||
builds[shipModel]['Imported ' + Ships[shipModel].properties.name] = ship.toString();
|
||||
this.setState({ builds, singleBuild: true });
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a text build from ED Shipyard
|
||||
* @param {string} buildStr Build string
|
||||
* @throws {string} If parse / import fails
|
||||
*/
|
||||
_importTextBuild(buildStr) {
|
||||
let buildName = textBuildRegex.exec(buildStr)[1].trim();
|
||||
let shipName = buildName.toLowerCase();
|
||||
let shipId = null;
|
||||
|
||||
for (let sId in Ships) {
|
||||
if (Ships[sId].properties.name.toLowerCase() == shipName) {
|
||||
shipId = sId;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if (!shipId) {
|
||||
throw 'No such ship found: "' + buildName + '"';
|
||||
}
|
||||
|
||||
let lines = buildStr.split('\n');
|
||||
let ship = new Ship(shipId, Ships[shipId].properties, Ships[shipId].slots);
|
||||
ship.buildWith(null);
|
||||
|
||||
for (let i = 1; i < lines.length; i++) {
|
||||
let line = lines[i].trim();
|
||||
|
||||
if (!line) { continue; }
|
||||
if (line.substring(0, 3) == '---') { break; }
|
||||
|
||||
let parts = lineRegex.exec(line);
|
||||
|
||||
if (!parts) { throw 'Error parsing: "' + line + '"'; }
|
||||
|
||||
let typeSize = parts[1];
|
||||
let cl = parts[2];
|
||||
let rating = parts[3];
|
||||
let mount = parts[4];
|
||||
let missile = parts[5];
|
||||
let name = parts[6].trim();
|
||||
let slot, group;
|
||||
|
||||
if (isNaN(typeSize)) { // Standard or Hardpoint
|
||||
if (typeSize.length == 1) { // Hardpoint
|
||||
let slotClass = mountMap[typeSize];
|
||||
|
||||
if (cl > slotClass) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
|
||||
|
||||
slot = ship.hardpoints.find(isEmptySlot, slotClass);
|
||||
|
||||
if (!slot) { throw 'No hardpoint slot available for: "' + line + '"'; }
|
||||
|
||||
group = ModuleNameToGroup[name.toLowerCase()];
|
||||
|
||||
let hp = ModuleUtils.findHardpoint(group, cl, rating, group ? null : name, mount, missile);
|
||||
|
||||
if (!hp) { throw 'Unknown component: "' + line + '"'; }
|
||||
|
||||
ship.use(slot, hp, true);
|
||||
} else if (typeSize == 'BH') {
|
||||
let bhId = bhMap[name.toLowerCase()];
|
||||
|
||||
if (bhId === undefined) { throw 'Unknown bulkhead: "' + line + '"'; }
|
||||
|
||||
ship.useBulkhead(bhId, true);
|
||||
} else if (standardMap[typeSize] != undefined) {
|
||||
let standardIndex = standardMap[typeSize];
|
||||
|
||||
if (ship.standard[standardIndex].maxClass < cl) { throw name + ' exceeds max class for the ' + ship.name; }
|
||||
|
||||
ship.use(ship.standard[standardIndex], ModuleUtils.standard(standardIndex, cl + rating), true);
|
||||
} else {
|
||||
throw 'Unknown component: "' + line + '"';
|
||||
}
|
||||
} else {
|
||||
if (cl > typeSize) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
|
||||
|
||||
slot = ship.internal.find(isEmptySlot, typeSize);
|
||||
|
||||
if (!slot) { throw 'No internal slot available for: "' + line + '"'; }
|
||||
|
||||
group = ModuleNameToGroup[name.toLowerCase()];
|
||||
|
||||
let intComp = ModuleUtils.findInternal(group, cl, rating, group ? null : name);
|
||||
|
||||
if (!intComp) { throw 'Unknown component: "' + line + '"'; }
|
||||
|
||||
ship.use(slot, intComp);
|
||||
}
|
||||
}
|
||||
|
||||
let builds = {};
|
||||
builds[shipId] = {};
|
||||
builds[shipId]['Imported ' + buildName] = ship.toString();
|
||||
this.setState({ builds, singleBuild: true });
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -352,166 +65,50 @@ export default class ModalImport extends TranslatedComponent {
|
||||
* @param {SyntheticEvent} event Event
|
||||
* @throws {string} If validation fails
|
||||
*/
|
||||
_validateImport(event) {
|
||||
let importData = null;
|
||||
let importString = event.target.value.trim();
|
||||
this.setState({
|
||||
builds: null,
|
||||
comparisons: null,
|
||||
shipDiscount: null,
|
||||
moduleDiscount: null,
|
||||
errorMsg: null,
|
||||
importValid: false,
|
||||
insurance: null,
|
||||
singleBuild: false,
|
||||
importString,
|
||||
});
|
||||
|
||||
if (!importString) {
|
||||
return;
|
||||
}
|
||||
|
||||
_parse(event) {
|
||||
const importString = event.target.value.trim();
|
||||
try {
|
||||
if (textBuildRegex.test(importString)) { // E:D Shipyard build text
|
||||
this._importTextBuild(importString);
|
||||
} else { // JSON Build data
|
||||
importData = JSON.parse(importString);
|
||||
|
||||
if (!importData || typeof importData != 'object') {
|
||||
throw 'Must be an object or array!';
|
||||
let data = JSON.parse(importString);
|
||||
if (!isArray(data)) {
|
||||
data = [data];
|
||||
}
|
||||
|
||||
if (importData?.[0]?.header?.appName) { // has SLEF envelope?
|
||||
this._importSlefBuilds(importData);
|
||||
} else if (importData.modules != null && importData.modules.Armour != null) { // Only the companion API has this information
|
||||
this._importCompanionApiBuild(importData); // Single ship definition
|
||||
} else if (importData.ship != null && importData.ship.modules != null && importData.ship.modules.Armour != null) { // Only the companion API has this information
|
||||
this._importCompanionApiBuild(importData.ship); // Complete API dump
|
||||
} else if (importData instanceof Array) { // Must be detailed export json
|
||||
this._importDetailedArray(importData);
|
||||
} else if (importData.ship && typeof importData.name !== undefined) { // Using JSON from a single ship build export
|
||||
this._importDetailedArray([importData]); // Convert to array with singleobject
|
||||
this.setState({ singleBuild: true });
|
||||
} else if (importData.Modules != null && importData.Modules[0] != null) {
|
||||
this._importLoadout(importData);
|
||||
} else { // Using Backup JSON
|
||||
this._importBackup(importData);
|
||||
const ships = data.map((item) => {
|
||||
try {
|
||||
return new Ship(item.data ? item.data : item);
|
||||
} catch (err) {
|
||||
return err;
|
||||
}
|
||||
});
|
||||
this.setState({ ships, status: STATE.PARSED });
|
||||
} catch (err) {
|
||||
this.setState({ err, status: STATE.ERROR });
|
||||
}
|
||||
}
|
||||
} catch (e) {
|
||||
console.log(e);
|
||||
this.setState({ errorMsg: (typeof e == 'string') ? e : 'Cannot Parse the data!' });
|
||||
return;
|
||||
}
|
||||
|
||||
this.setState({ importValid: true });
|
||||
};
|
||||
|
||||
/**
|
||||
* Process imported data
|
||||
*/
|
||||
_process() {
|
||||
let builds = null, comparisons = null;
|
||||
|
||||
if (this.state.loadoutEvent) {
|
||||
return Router.go(`/import?data=${this.state.loadoutEvent}`);
|
||||
}
|
||||
|
||||
// If only importing a single build go straight to the outfitting page
|
||||
if (this.state.singleBuild) {
|
||||
builds = this.state.builds;
|
||||
let shipId = Object.keys(builds)[0];
|
||||
let name = Object.keys(builds[shipId])[0];
|
||||
Router.go(outfitURL(shipId, builds[shipId][name], name));
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
if (this.state.builds) {
|
||||
builds = {}; // Create new builds object such that orginal name retained, but can be renamed
|
||||
for (let shipId in this.state.builds) {
|
||||
let shipbuilds = this.state.builds[shipId];
|
||||
builds[shipId] = {};
|
||||
for (let buildName in shipbuilds) {
|
||||
builds[shipId][buildName] = {
|
||||
code: shipbuilds[buildName],
|
||||
useName: buildName
|
||||
};
|
||||
for (const build of this.state.builds) {
|
||||
if (!build instanceof Error) {
|
||||
Persist.saveBuild(build.Ship, build.CoriolisBuildName || build.ShipName, build.compress());
|
||||
}
|
||||
}
|
||||
this.setState({ builds: [], status: STATE.READY });
|
||||
}
|
||||
|
||||
if (this.state.comparisons) {
|
||||
comparisons = {};
|
||||
for (let name in this.state.comparisons) {
|
||||
comparisons[name] = Object.assign({ useName: name }, this.state.comparisons[name]);
|
||||
}
|
||||
}
|
||||
|
||||
this.setState({ processed: true, builds, comparisons });
|
||||
};
|
||||
|
||||
/**
|
||||
* Import parsed, processed data and save
|
||||
*/
|
||||
_import() {
|
||||
let state = this.state;
|
||||
if (state.builds) {
|
||||
let builds = state.builds;
|
||||
for (let shipId in builds) {
|
||||
for (let buildName in builds[shipId]) {
|
||||
let build = builds[shipId][buildName];
|
||||
let name = build.useName.trim();
|
||||
if (name) {
|
||||
Persist.saveBuild(shipId, name, build.code);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (state.comparisons) {
|
||||
let comparisons = state.comparisons;
|
||||
for (let comp in comparisons) {
|
||||
let comparison = comparisons[comp];
|
||||
let useName = comparison.useName.trim();
|
||||
if (useName) {
|
||||
Persist.saveComparison(useName, comparison.builds, comparison.facets);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (state.shipDiscount !== undefined) {
|
||||
Persist.setShipDiscount(state.shipDiscount);
|
||||
}
|
||||
if (state.moduleDiscount !== undefined) {
|
||||
Persist.setModuleDiscount(state.moduleDiscount);
|
||||
}
|
||||
|
||||
if (state.insurance) {
|
||||
Persist.setInsurance(state.insurance);
|
||||
}
|
||||
|
||||
this.context.hideModal();
|
||||
};
|
||||
|
||||
/**
|
||||
* Capture build name changes
|
||||
* @param {Object} item Build/Comparison import object
|
||||
* @param {SyntheticEvent} e Event
|
||||
* @param {Object} index Build/Comparison import object
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_changeName(item, e) {
|
||||
item.useName = e.target.value;
|
||||
this.forceUpdate();
|
||||
_changeName(index, event) {
|
||||
const { builds } = this.state;
|
||||
builds[index].CoriolisBuildName = event.target.value.trim();
|
||||
this.setState({ builds });
|
||||
}
|
||||
|
||||
/**
|
||||
* If imported data is already provided process immediately on mount
|
||||
*/
|
||||
componentWillMount() {
|
||||
if (this.props.builds) {
|
||||
this._process();
|
||||
}
|
||||
}
|
||||
/**
|
||||
* If textarea is shown focus on mount
|
||||
*/
|
||||
@@ -526,77 +123,34 @@ export default class ModalImport extends TranslatedComponent {
|
||||
* @return {React.Component} Modal contents
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
let state = this.state;
|
||||
let importStage;
|
||||
const { translate } = this.context.language;
|
||||
const { status, builds, err } = this.state;
|
||||
|
||||
if (!state.processed) {
|
||||
importStage = (
|
||||
const buildRows = builds.map((build, i) => {
|
||||
if (build instanceof Error) {
|
||||
return <tr key={i} className='cb'>
|
||||
<td colSpan={3} className='warning'>Error: {build.name}</td>
|
||||
</tr>;
|
||||
}
|
||||
|
||||
const exists = Persist.hasBuild(build.Ship, build.CoriolisBuildName);
|
||||
const saveName = build.CoriolisBuildName || build.ShipName;
|
||||
return <tr key={i} className='cb'>
|
||||
<td>{translate(build.Ship)}</td>
|
||||
<td><input type='text' onChange={this._changeName.bind(this, i)} value={saveName}/></td>
|
||||
<td style={{ textAlign: 'center' }} className={cn('cap', { warning: exists, disabled: saveName === '' })}>
|
||||
{translate(saveName === '' ? 'skip' : (exists ? 'overwrite' : 'create'))}
|
||||
</td>
|
||||
</tr>;
|
||||
});
|
||||
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h2 >{translate('import')}</h2>
|
||||
<div>
|
||||
<textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._validateImport} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
|
||||
<button id='proceed' className='l cap' onClick={this._process} disabled={!state.importValid} >{translate('proceed')}</button>
|
||||
<div className='l warning' style={{ marginLeft:'3em' }}>{state.errorMsg}</div>
|
||||
<textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._parse} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
|
||||
{status === STATE.ERROR && <div className='l warning' style={{ marginLeft:'3em' }}>{err.toString()}</div>}
|
||||
</div>
|
||||
);
|
||||
} else {
|
||||
let comparisonTable, edit, buildRows = [];
|
||||
if (state.comparisons) {
|
||||
let comparisonRows = [];
|
||||
|
||||
for (let name in state.comparisons) {
|
||||
let comparison = state.comparisons[name];
|
||||
let hasComparison = Persist.hasComparison(comparison.useName);
|
||||
comparisonRows.push(
|
||||
<tr key={name} className='cb'>
|
||||
<td>
|
||||
<input type='text' onChange={this._changeName.bind(this, comparison)} value={comparison.useName}/>
|
||||
</td>
|
||||
<td style={{ textAlign:'center' }} className={ cn('cap', { warning: hasComparison, disabled: comparison.useName == '' }) }>
|
||||
{translate(comparison.useName == '' ? 'skip' : (hasComparison ? 'overwrite' : 'create'))}
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
|
||||
comparisonTable = (
|
||||
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }} >
|
||||
<thead>
|
||||
<tr>
|
||||
<th style={{ textAlign:'left' }}>{translate('comparison')}</th>
|
||||
<th>{translate('action')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{comparisonRows}
|
||||
</tbody>
|
||||
</table>
|
||||
);
|
||||
}
|
||||
|
||||
if(this.state.canEdit) {
|
||||
edit = <button className='l cap' style={{ marginLeft: '2em' }} onClick={() => this.setState({ processed: false })}>{translate('edit data')}</button>;
|
||||
}
|
||||
|
||||
let builds = this.state.builds;
|
||||
for (let shipId in builds) {
|
||||
let shipBuilds = builds[shipId];
|
||||
for (let buildName in shipBuilds) {
|
||||
let b = shipBuilds[buildName];
|
||||
let hasBuild = Persist.hasBuild(shipId, b.useName);
|
||||
buildRows.push(
|
||||
<tr key={shipId + buildName} className='cb'>
|
||||
<td>{Ships[shipId].properties.name}</td>
|
||||
<td><input type='text' onChange={this._changeName.bind(this, b)} value={b.useName}/></td>
|
||||
<td style={{ textAlign: 'center' }} className={cn('cap', { warning: hasBuild, disabled: b.useName == '' })}>
|
||||
{translate(b.useName == '' ? 'skip' : (hasBuild ? 'overwrite' : 'create'))}
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
importStage = (
|
||||
<div>
|
||||
{builds.length && <div>
|
||||
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }}>
|
||||
<thead>
|
||||
<tr>
|
||||
@@ -609,17 +163,14 @@ export default class ModalImport extends TranslatedComponent {
|
||||
{buildRows}
|
||||
</tbody>
|
||||
</table>
|
||||
{comparisonTable}
|
||||
<button id='import' className='cl l' onClick={this._import}><Download/> {translate('import')}</button>
|
||||
{edit}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h2 >{translate('import')}</h2>
|
||||
{importStage}
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>}
|
||||
<button id='proceed' className='l cap' onClick={this._process}
|
||||
disabled={status !== STATE.PARSED} >
|
||||
{translate('proceed')}
|
||||
</button>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>
|
||||
{translate('close')}
|
||||
</button>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -7,7 +7,6 @@ import ShortenUrl from '../utils/ShortenUrl';
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalPermalink extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
url: PropTypes.string.isRequired
|
||||
};
|
||||
@@ -34,18 +33,6 @@ export default class ModalPermalink extends TranslatedComponent {
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Copy the shortened URL to the clipboard
|
||||
* @param {Event} e Click event
|
||||
* @return {void}
|
||||
*/
|
||||
copyShortLink() {
|
||||
let copyText = document.getElementById("shortenedUrl");
|
||||
// Copy the text inside the shortendUrl input to the clipboard
|
||||
copyText.select();
|
||||
document.execCommand("copy");
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
@@ -54,17 +41,15 @@ export default class ModalPermalink extends TranslatedComponent {
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h3>{translate('permalink')}</h3>
|
||||
<h2>{translate('permalink')}</h2>
|
||||
<br/>
|
||||
<h3>{translate('URL')}</h3>
|
||||
<input value={this.props.url} size={40} readOnly onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<h3 >{translate('shortened')}</h3>
|
||||
<input id={'shortenedUrl'} value={this.state.shortenedUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/><button className={'cb dismiss cap'} onClick={this.copyShortLink}>{translate('copy to clipboard')}</button>
|
||||
<input value={this.state.shortenedUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<hr />
|
||||
<p>s.orbis.zone is the URL shortener domain. These links should persist indefinitely going forward. If for some reason there is a problem with the link shortening process, please report it in the EDCD Discord Server.</p>
|
||||
<hr />
|
||||
<p>s.orbis.zone is the new URL shortener domain, old eddp.co urls are considered end of life and could go down at any moment. Sorry for any inconvenience.</p>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
|
||||
@@ -1,401 +0,0 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import request from 'superagent';
|
||||
import Persist from '../stores/Persist';
|
||||
const zlib = require('zlib');
|
||||
const base64url = require('base64url');
|
||||
|
||||
/**
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalShoppingList extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
buildName: PropTypes.string
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.state = {
|
||||
matsList: '',
|
||||
mats: {},
|
||||
failed: false,
|
||||
cmdrName: Persist.getCmdr().selected,
|
||||
cmdrs: Persist.getCmdr().cmdrs,
|
||||
matsPerGrade: Persist.getRolls(),
|
||||
blueprints: []
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* React component did mount
|
||||
*/
|
||||
componentDidMount() {
|
||||
this.renderMats();
|
||||
if (this.checkBrowserIsCompatible()) {
|
||||
this.getCommanders();
|
||||
this.registerBPs();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Find all blueprints needed to make a build.
|
||||
*/
|
||||
registerBPs() {
|
||||
const ship = this.props.ship;
|
||||
let blueprints = [];
|
||||
for (const module of ship.costList) {
|
||||
if (module.type === 'SHIP') {
|
||||
continue;
|
||||
}
|
||||
if (module.m && module.m.blueprint) {
|
||||
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
|
||||
continue;
|
||||
}
|
||||
if (module.m.blueprint.special) {
|
||||
blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 });
|
||||
}
|
||||
for (const g in module.m.blueprint.grades) {
|
||||
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
|
||||
continue;
|
||||
}
|
||||
if (g > module.m.blueprint.grade) {
|
||||
continue;
|
||||
}
|
||||
blueprints.push({ uuid: module.m.blueprint.grades[g].uuid, number: this.state.matsPerGrade[g] });
|
||||
}
|
||||
}
|
||||
}
|
||||
this.setState({ blueprints });
|
||||
}
|
||||
|
||||
/**
|
||||
* Check browser isn't firefox.
|
||||
* @return {boolean} true if compatible, false if not.
|
||||
*/
|
||||
checkBrowserIsCompatible() {
|
||||
// Firefox 1.0+
|
||||
return typeof InstallTrigger === 'undefined';
|
||||
}
|
||||
|
||||
/**
|
||||
* Get a list of commanders from EDEngineer.
|
||||
*/
|
||||
getCommanders() {
|
||||
request
|
||||
.get('http://localhost:44405/commanders')
|
||||
.end((err, res) => {
|
||||
this.display = 'block';
|
||||
if (err) {
|
||||
console.log(err);
|
||||
this.display = 'none';
|
||||
return this.setState({ failed: true });
|
||||
}
|
||||
const cmdrs = JSON.parse(res.text);
|
||||
if (!this.state.cmdrName) {
|
||||
this.setState({ cmdrName: cmdrs[0] });
|
||||
}
|
||||
this.setState({ cmdrs }, () => {
|
||||
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs });
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Send all blueprints to ED Engineer
|
||||
* @param {Event} event React event
|
||||
*/
|
||||
sendToEDEng(event) {
|
||||
event.preventDefault();
|
||||
let translate = this.context.language.translate;
|
||||
const target = event.target;
|
||||
target.disabled = this.state.blueprints.length > 0;
|
||||
if (this.state.blueprints.length === 0) {
|
||||
target.innerText = translate('No modded components.');
|
||||
target.disabled = true;
|
||||
setTimeout(() => {
|
||||
target.innerText = translate('Send to EDEngineer');
|
||||
target.disabled = false;
|
||||
}, 3000);
|
||||
} else {
|
||||
target.innerText = translate('Sending...');
|
||||
}
|
||||
let countSent = 0;
|
||||
let countTotal = this.state.blueprints.length;
|
||||
|
||||
for (const i of this.state.blueprints) {
|
||||
request
|
||||
.patch(`http://localhost:44405/${this.state.cmdrName}/shopping-list`)
|
||||
.field('uuid', i.uuid)
|
||||
.field('size', i.number)
|
||||
.end(err => {
|
||||
if (err) {
|
||||
console.log(err);
|
||||
if (err.message !== 'Bad Request') {
|
||||
this.setState({ failed: true });
|
||||
}
|
||||
}
|
||||
countSent++;
|
||||
if (countSent === countTotal) {
|
||||
target.disabled = false;
|
||||
target.innerText = translate('Send to EDEngineer');
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Fix issues with the item name for bulkheads when sending to EDOMH
|
||||
* @param {*} ship Ship object
|
||||
* @param {*} item Item name
|
||||
* @returns updated item name
|
||||
*/
|
||||
fixArmourItemNameForEDOMH(ship, item) {
|
||||
// The module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
|
||||
switch (ship.bulkheads.m.name){
|
||||
case "Lightweight Alloy":
|
||||
item = ship.id + "_Armour_Grade1";
|
||||
break;
|
||||
case "Reinforced Alloy":
|
||||
item = ship.id + "_Armour_Grade2";
|
||||
break;
|
||||
case "Military Grade Composite":
|
||||
item = ship.id + "_Armour_Grade3";
|
||||
break;
|
||||
case "Mirrored Surface Composite":
|
||||
item = ship.id + "_Armour_Mirrored";
|
||||
break;
|
||||
case "Reactive Surface Composite":
|
||||
item = ship.id + "_Armour_Reactive";
|
||||
break;
|
||||
}
|
||||
return item;
|
||||
}
|
||||
|
||||
/**
|
||||
* Send all blueprints to EDOMH. This is a modified copy of registerBPs because this.state.blueprints was empty when I tried to modify sendToEDEng and I couldn't figure out why
|
||||
* @param {Event} event React event
|
||||
*/
|
||||
sendToEDOMH(event) {
|
||||
event.preventDefault();
|
||||
const ship = this.props.ship;
|
||||
const buildName = this.props.buildName;
|
||||
let blueprints = [];
|
||||
|
||||
//create the json
|
||||
for (const module of ship.costList) {
|
||||
if (module.type === 'SHIP') {
|
||||
continue;
|
||||
}
|
||||
if (module.m && module.m.blueprint) {
|
||||
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
|
||||
continue;
|
||||
}
|
||||
if (module.m.blueprint.special) {
|
||||
let item = "";
|
||||
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
|
||||
if (module.m.blueprint.fdname.includes("Armour_")) {
|
||||
item = this.fixArmourItemNameForEDOMH(ship, item)
|
||||
}
|
||||
else {
|
||||
item = module.m.symbol;
|
||||
}
|
||||
|
||||
blueprints.push({
|
||||
"item": item,
|
||||
"blueprint": module.m.blueprint.special.edname
|
||||
});
|
||||
}
|
||||
for (let g in module.m.blueprint.grades) {
|
||||
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
|
||||
continue;
|
||||
}
|
||||
// We only want the grade that the module is currently at, not every grade up to that point
|
||||
if (Number(g) !== module.m.blueprint.grade) {
|
||||
continue;
|
||||
}
|
||||
let item = "";
|
||||
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
|
||||
if (module.m.blueprint.fdname.includes("Armour_")) {
|
||||
item = this.fixArmourItemNameForEDOMH(ship, item)
|
||||
}
|
||||
else {
|
||||
item = module.m.symbol;
|
||||
}
|
||||
blueprints.push({
|
||||
"item": item,
|
||||
"blueprint": module.m.blueprint.fdname,
|
||||
"grade": module.m.blueprint.grade,
|
||||
"highestGradePercentage":1.0
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let shipName = buildName + " - " + ship.name;
|
||||
|
||||
//create JSON to encode
|
||||
let baseJson = {
|
||||
"version":1,
|
||||
"name": shipName, // TO-DO: Import build name and put that here correctly
|
||||
"items": blueprints
|
||||
}
|
||||
|
||||
let JSONString = JSON.stringify(baseJson)
|
||||
let deflated = zlib.deflateSync(JSONString)
|
||||
|
||||
//actually encode
|
||||
let link = base64url.encode(deflated)
|
||||
link = "edomh://coriolis/?" + link;
|
||||
|
||||
window.open(link, "_self")
|
||||
}
|
||||
|
||||
/**
|
||||
* Convert mats object to string
|
||||
*/
|
||||
renderMats() {
|
||||
const ship = this.props.ship;
|
||||
let mats = {};
|
||||
for (const module of ship.costList) {
|
||||
if (module.type === 'SHIP') {
|
||||
continue;
|
||||
}
|
||||
if (module.m && module.m.blueprint) {
|
||||
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
|
||||
continue;
|
||||
}
|
||||
for (let g in module.m.blueprint.grades) {
|
||||
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
|
||||
continue;
|
||||
}
|
||||
// Ignore grades higher than the grade selected
|
||||
if (Number(g) > module.m.blueprint.grade) {
|
||||
continue;
|
||||
}
|
||||
for (let i in module.m.blueprint.grades[g].components) {
|
||||
if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) {
|
||||
continue;
|
||||
}
|
||||
if (mats[i]) {
|
||||
mats[i] += module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
|
||||
} else {
|
||||
mats[i] = module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
|
||||
}
|
||||
}
|
||||
}
|
||||
if (module.m.blueprint.special) {
|
||||
for (const j in module.m.blueprint.special.components) {
|
||||
if (!module.m.blueprint.special.components.hasOwnProperty(j)) {
|
||||
continue;
|
||||
}
|
||||
if (mats[j]) {
|
||||
mats[j] += module.m.blueprint.special.components[j];
|
||||
} else {
|
||||
mats[j] = module.m.blueprint.special.components[j];
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
let matsString = '';
|
||||
for (const i in mats) {
|
||||
if (!mats.hasOwnProperty(i)) {
|
||||
continue;
|
||||
}
|
||||
if (mats[i] === 0) {
|
||||
delete mats[i];
|
||||
continue;
|
||||
}
|
||||
matsString += `${i}: ${mats[i]}\n`;
|
||||
}
|
||||
this.setState({ matsList: matsString, mats });
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing roll amounts
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
changeHandler(e) {
|
||||
let grade = e.target.id;
|
||||
let newState = this.state.matsPerGrade;
|
||||
newState[grade] = parseInt(e.target.value);
|
||||
this.setState({ matsPerGrade: newState });
|
||||
Persist.setRolls(newState);
|
||||
this.renderMats();
|
||||
this.registerBPs();
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing cmdr name
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
cmdrChangeHandler(e) {
|
||||
let cmdrName = e.target.value;
|
||||
this.setState({ cmdrName }, () => {
|
||||
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs: this.state.cmdrs });
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
this.changeHandler = this.changeHandler.bind(this);
|
||||
const compatible = this.checkBrowserIsCompatible();
|
||||
this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this);
|
||||
this.sendToEDEng = this.sendToEDEng.bind(this);
|
||||
this.sendToEDOMH = this.sendToEDOMH.bind(this);
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h3>{translate('PHRASE_SHOPPING_MATS')}</h3>
|
||||
<div>
|
||||
<p>{translate('PHRASE_DIFFERENT_ROLLS')}</p>
|
||||
<label>{translate('G1')}</label>
|
||||
<input className={'groll'} id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
|
||||
| <label>{translate('G2')}</label>
|
||||
<input className={'groll'} id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
|
||||
| <label>{translate('G3')}</label>
|
||||
<input className={'groll'} id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
|
||||
| <label>{translate('G4')}</label>
|
||||
<input className={'groll'} id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
|
||||
| <label>{translate('G5')}</label>
|
||||
<input className={'groll'} id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
|
||||
</div>
|
||||
|
||||
<div>
|
||||
<p>{translate('PHRASE_ALL_MODULES_ALL_ROLLS')}</p>
|
||||
<textarea className='cb json' readOnly value={this.state.matsList} />
|
||||
<p>{translate('PHRASE_FOR_FINER_CONTROL')}</p>
|
||||
</div>
|
||||
|
||||
<div id='edengineer' display={this.display} hidden={!!this.state.failed && !compatible}>
|
||||
<hr />
|
||||
<h3>ED Engineer</h3>
|
||||
<h4 hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</h4>
|
||||
<h4 hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAILED_TO_FIND_EDENGINEER')}</h4>
|
||||
<label for='cmdr-select' hidden={!!this.state.failed || !compatible} className={'l cap'}>{translate('CMDR Name:')}</label>
|
||||
<select id='cmdr-select' hidden={!!this.state.failed || !compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}>
|
||||
{this.state.cmdrs.map(e => <option key={e}>{e}</option>)}
|
||||
</select>
|
||||
<br/>
|
||||
<button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
|
||||
</div>
|
||||
<div id='edomh'>
|
||||
<hr />
|
||||
<h3>ED Odyssey Materials Helper</h3>
|
||||
<p>{translate('PHRASE_ENSURE_EDOMH')}</p>
|
||||
<button className={'l cb dismiss cap'} onClick={this.sendToEDOMH}>{translate('Send to EDOMH')}</button>
|
||||
</div>
|
||||
<hr />
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
@@ -3,131 +3,106 @@ import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import NumberEditor from 'react-number-editor';
|
||||
import { isChangeValueBeneficial } from '../utils/BlueprintFunctions';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { Module } from 'ed-forge';
|
||||
|
||||
/**
|
||||
* Modification
|
||||
*/
|
||||
export default class Modification extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
m: PropTypes.object.isRequired,
|
||||
name: PropTypes.string.isRequired,
|
||||
value: PropTypes.number.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
onKeyDown: PropTypes.func.isRequired,
|
||||
modItems: PropTypes.array.isRequired,
|
||||
handleModChange: PropTypes.func.isRequired
|
||||
highlight: PropTypes.bool,
|
||||
m: PropTypes.instanceOf(Module).isRequired,
|
||||
property: PropTypes.string.isRequired,
|
||||
onSet: PropTypes.func.isRequired,
|
||||
showProp: PropTypes.object,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.state = {};
|
||||
this.state.value = props.value;
|
||||
const { m, property, showProp } = props;
|
||||
const { beneficial, unit, value } = m.getFormatted(property, true);
|
||||
this.state = { beneficial, unit, value, showProp };
|
||||
}
|
||||
|
||||
/**
|
||||
* Update modification given a value.
|
||||
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
|
||||
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
|
||||
* in a value by hand
|
||||
*/
|
||||
_updateValue(value) {
|
||||
this.setState({ value });
|
||||
let reCast = String(Number(value));
|
||||
if (reCast.endsWith(value) || reCast.startsWith(value)) {
|
||||
let { m, name, ship } = this.props;
|
||||
value = Math.max(Math.min(value, 50000), -50000);
|
||||
ship.setModification(m, name, value, true);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Triggered when a key is pressed down with focus on the number editor.
|
||||
* @param {SyntheticEvent} event Key down event
|
||||
*/
|
||||
_keyDown(event) {
|
||||
if (event.key == 'Enter') {
|
||||
this._updateFinished();
|
||||
}
|
||||
this.props.onKeyDown(event);
|
||||
}
|
||||
|
||||
/**
|
||||
* Triggered when an update to slider value is finished i.e. when losing focus
|
||||
*
|
||||
* pnellesen (24/05/2018): added value check below - this should prevent experimental effects from being recalculated
|
||||
* with each onBlur event, even when no change has actually been made to the field.
|
||||
* Notify listeners that a new value has been entered and commited.
|
||||
*/
|
||||
_updateFinished() {
|
||||
if (this.props.value != this.state.value) {
|
||||
this.props.handleModChange(true);
|
||||
this.props.onChange();
|
||||
const { onSet, m, property } = this.props;
|
||||
const { inputValue } = this.state;
|
||||
const numValue = Number(inputValue);
|
||||
if (!isNaN(numValue) && this.state.value !== numValue) {
|
||||
onSet(property, numValue);
|
||||
const { beneficial, unit, value } = m.getFormatted(property, true);
|
||||
this.setState({ beneficial, unit, value });
|
||||
}
|
||||
}
|
||||
|
||||
_toggleProperty() {
|
||||
const { onPropToggle, property } = this.props;
|
||||
const showProp = !this.state.showProp;
|
||||
// TODO: defer until menu closed
|
||||
onPropToggle(property, showProp);
|
||||
this.setState({ showProp });
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modification
|
||||
* @return {React.Component} modification
|
||||
*/
|
||||
render() {
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let { m, name } = this.props;
|
||||
let modValue = m.getChange(name);
|
||||
let isOverwrite = Modifications.modifications[name].method === 'overwrite';
|
||||
const { formats } = this.context.language;
|
||||
const { highlight, m, property } = this.props;
|
||||
const { beneficial, unit, value, inputValue, showProp } = this.state;
|
||||
|
||||
if (name === 'damagedist') {
|
||||
// We don't show damage distribution
|
||||
// Some features only apply to specific modules; these features will be
|
||||
// undefined on items that do not belong to the same class. Filter these
|
||||
// features here
|
||||
if (value === undefined) {
|
||||
return null;
|
||||
}
|
||||
|
||||
let inputClassNames = {
|
||||
'cb': true,
|
||||
'greyed-out': !this.props.highlight
|
||||
};
|
||||
|
||||
const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property);
|
||||
return (
|
||||
<div onBlur={this._updateFinished.bind(this)} key={name}
|
||||
className={cn('cb', 'modification-container')}
|
||||
ref={ modItem => this.props.modItems[name] = modItem }>
|
||||
<span className={'cb'}>{translate(name, m.grp)}</span>
|
||||
<span className={'header-adjuster'}></span>
|
||||
<table style={{ width: '100%' }}>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td className={'input-container'}>
|
||||
<td>
|
||||
<span>
|
||||
{this.props.editable ?
|
||||
<NumberEditor className={cn(inputClassNames)} value={this.state.value}
|
||||
decimals={2} style={{ textAlign: 'right' }} step={0.01}
|
||||
stepModifier={1} onKeyDown={this._keyDown.bind(this)}
|
||||
onValueChange={this._updateValue.bind(this)} /> :
|
||||
<input type="text" value={formats.f2(this.state.value)}
|
||||
disabled className={cn('number-editor', 'greyed-out')}
|
||||
style={{ textAlign: 'right', cursor: 'inherit' }}/>
|
||||
<input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/>
|
||||
</span>
|
||||
</td>
|
||||
<td className="input-container">
|
||||
<span>
|
||||
<NumberEditor value={inputValue || value} stepModifier={1}
|
||||
decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }}
|
||||
className={cn('cb', { 'greyed-out': !highlight })}
|
||||
onKeyDown={(event) => {
|
||||
if (event.key == 'Enter') {
|
||||
this._updateFinished();
|
||||
event.stopPropagation();
|
||||
}
|
||||
<span className={'unit-container'}>
|
||||
{units[m.getStoredUnitFor(name)]}
|
||||
</span>
|
||||
}}
|
||||
onValueChange={(inputValue) => {
|
||||
if (inputValue.length <= 15) {
|
||||
this.setState({ inputValue });
|
||||
}
|
||||
}} />
|
||||
</span>
|
||||
</td>
|
||||
<td style={{ textAlign: 'center' }} className={
|
||||
modValue ?
|
||||
isChangeValueBeneficial(name, modValue) ? 'secondary' : 'warning' :
|
||||
''
|
||||
}>
|
||||
{formats.f2(modValue / 100) || 0}{isOverwrite ? '' : '%'}
|
||||
<td style={{ textAlign: 'left' }}>
|
||||
<span className="unit-container">{unit}</span>
|
||||
</td>
|
||||
<td style={{ textAlign: 'center' }}
|
||||
className={cn({
|
||||
secondary: beneficial,
|
||||
warning: beneficial === false,
|
||||
})}
|
||||
>{formats.f2(modifierValue)}{modifierUnit || ''}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,34 +1,27 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import * as _ from 'lodash';
|
||||
import { chain, flatMap, keys } from 'lodash';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import cn from 'classnames';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import Modification from './Modification';
|
||||
import {
|
||||
getBlueprint,
|
||||
blueprintTooltip,
|
||||
setPercent,
|
||||
getPercent,
|
||||
setRandom,
|
||||
specialToolTip
|
||||
} from '../utils/BlueprintFunctions';
|
||||
|
||||
const MODIFICATIONS_COMPARATOR = (mod1, mod2) => {
|
||||
return mod1.props.name.localeCompare(mod2.props.name);
|
||||
};
|
||||
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/src/data/blueprints';
|
||||
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
|
||||
import { SHOW } from '../shipyard/StatsMapping';
|
||||
|
||||
/**
|
||||
* Modifications menu
|
||||
*/
|
||||
export default class ModificationsMenu extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
className: PropTypes.string,
|
||||
m: PropTypes.object.isRequired,
|
||||
marker: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
modButton:PropTypes.object
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -41,123 +34,58 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
|
||||
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
|
||||
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
|
||||
this._rollFifty = this._rollFifty.bind(this);
|
||||
this._rollRandom = this._rollRandom.bind(this);
|
||||
this._rollBest = this._rollBest.bind(this);
|
||||
this._rollWorst = this._rollWorst.bind(this);
|
||||
this._reset = this._reset.bind(this);
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this.modItems = [];// Array to hold various element refs (<li>, <div>, <ul>, etc.)
|
||||
this.firstModId = null;
|
||||
this.firstBPLabel = null;// First item in mod menu
|
||||
this.lastModId = null;
|
||||
this.selectedModId = null;
|
||||
this.selectedSpecialId = null;
|
||||
this.lastNeId = null;// Last number editor id. Used to set focus to last number editor when shift-tab pressed on first element in mod menu.
|
||||
this.modValDidChange = false; // used to determine if component update was caused by change in modification value.
|
||||
this._handleModChange = this._handleModChange.bind(this);
|
||||
this.selectedModRef = null;
|
||||
this.selectedSpecialRef = null;
|
||||
|
||||
// console.log(props.m.blueprint)
|
||||
const { m } = props;
|
||||
this.state = {
|
||||
blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name),
|
||||
blueprintProgress: m.getBlueprintProgress(),
|
||||
blueprintMenuOpened: !m.getBlueprint(),
|
||||
specialMenuOpened: false
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the blueprints
|
||||
* @param {Object} props React component properties
|
||||
* @param {Object} context React component context
|
||||
* @return {Object} list: Array of React Components
|
||||
*/
|
||||
_renderBlueprints(props, context) {
|
||||
const { m } = props;
|
||||
const { language, tooltip, termtip } = context;
|
||||
const translate = language.translate;
|
||||
const blueprints = [];
|
||||
for (const blueprintName in Modifications.modules[m.grp].blueprints) {
|
||||
const blueprint = getBlueprint(blueprintName, m);
|
||||
let blueprintGrades = [];
|
||||
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
|
||||
_renderBlueprints() {
|
||||
const { m } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { translate } = language;
|
||||
|
||||
const blueprints = m.getApplicableBlueprints().map(blueprint => {
|
||||
const info = getBlueprintInfo(blueprint);
|
||||
let blueprintGrades = keys(info.features).map(grade => {
|
||||
// Grade is a string in the JSON so make it a number
|
||||
grade = Number(grade);
|
||||
const classes = cn('c', {
|
||||
active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade
|
||||
const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade;
|
||||
const key = blueprint + ':' + grade;
|
||||
return <li key={key} data-id={key} className={cn('c', { active })}
|
||||
style={{ width: '2em' }}
|
||||
onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
onClick={() => {
|
||||
m.setBlueprint(blueprint, grade, 1);
|
||||
this.setState({
|
||||
blueprintMenuOpened: false,
|
||||
specialMenuOpened: true,
|
||||
});
|
||||
}}
|
||||
ref={active ? (ref) => { this.selectedModRef = ref; } : undefined}
|
||||
>{grade}</li>;
|
||||
});
|
||||
const close = this._blueprintSelected.bind(this, blueprintName, grade);
|
||||
const key = blueprintName + ':' + grade;
|
||||
const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp);
|
||||
if (classes.indexOf('active') >= 0) this.selectedModId = key;
|
||||
blueprintGrades.unshift(<li key={key} tabIndex="0" data-id={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close} onKeyDown={this._keyDown} ref={modItem => this.modItems[key] = modItem}>{grade}</li>);
|
||||
}
|
||||
if (blueprintGrades) {
|
||||
const thisLen = blueprintGrades.length;
|
||||
if (this.firstModId == null) this.firstModId = blueprintGrades[0].key;
|
||||
this.lastModId = blueprintGrades[thisLen - 1].key;
|
||||
blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>);
|
||||
blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>);
|
||||
}
|
||||
}
|
||||
return blueprints;
|
||||
}
|
||||
|
||||
/**
|
||||
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
|
||||
* @param {SyntheticEvent} event Event
|
||||
*
|
||||
*/
|
||||
_keyDown(event) {
|
||||
let className = null;
|
||||
let elemId = null;
|
||||
if (event.currentTarget.attributes['class']) className = event.currentTarget.attributes['class'].value;
|
||||
if (event.currentTarget.attributes['data-id']) elemId = event.currentTarget.attributes['data-id'].value;
|
||||
return [
|
||||
<div key={'div' + blueprint} className={'select-group cap'}>
|
||||
{translate(blueprint)}
|
||||
</div>,
|
||||
<ul key={'ul' + blueprint}>{blueprintGrades}</ul>
|
||||
];
|
||||
});
|
||||
|
||||
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
|
||||
event.stopPropagation();
|
||||
if (elemId != null) {
|
||||
this.modItems[elemId].click();
|
||||
} else {
|
||||
event.currentTarget.click();
|
||||
return flatMap(blueprints);
|
||||
}
|
||||
return;
|
||||
}
|
||||
if (event.key == 'Tab') {
|
||||
// Shift-Tab
|
||||
if(event.shiftKey) {
|
||||
if (elemId == this.firstModId && elemId != null) {
|
||||
// Initial modification menu
|
||||
event.preventDefault();
|
||||
this.modItems[this.lastModId].focus();
|
||||
return;
|
||||
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null && this.lastNeId != null && this.modItems[this.lastNeId] != null) {
|
||||
// shift-tab on first element in modifications menu. set focus to last number editor field if open
|
||||
event.preventDefault();
|
||||
this.modItems[this.lastNeId].lastChild.focus();
|
||||
return;
|
||||
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null) {
|
||||
// shift-tab on button-inline-menu with no number editor
|
||||
event.preventDefault();
|
||||
event.currentTarget.parentElement.lastElementChild.focus();
|
||||
}
|
||||
} else {
|
||||
if (elemId == this.lastModId && elemId != null) {
|
||||
// Initial modification menu
|
||||
event.preventDefault();
|
||||
this.modItems[this.firstModId].focus();
|
||||
return;
|
||||
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.nextSibling == null && event.currentTarget.nodeName != 'TD') {
|
||||
// Experimental menu
|
||||
event.preventDefault();
|
||||
event.currentTarget.parentElement.firstElementChild.focus();
|
||||
return;
|
||||
} else if (event.currentTarget.className == 'cb' && event.currentTarget.parentElement.nextSibling == null) {
|
||||
event.preventDefault();
|
||||
this.modItems[this.firstBPLabel].focus();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Render the specials
|
||||
@@ -165,204 +93,118 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
* @param {Object} context React component context
|
||||
* @return {Object} list: Array of React Components
|
||||
*/
|
||||
_renderSpecials(props, context) {
|
||||
const { m } = props;
|
||||
const { language, tooltip, termtip } = context;
|
||||
_renderSpecials() {
|
||||
const { m } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const translate = language.translate;
|
||||
const specials = [];
|
||||
const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials';
|
||||
if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) {
|
||||
const close = this._specialSelected.bind(this, null);
|
||||
specials.push(<div tabIndex="0" style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } data-id={ 'none' } onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems['none'] = modItem}>{translate('PHRASE_NO_SPECIAL')}</div>);
|
||||
for (const specialName of Modifications.modules[m.grp][specialsId]) {
|
||||
if (Modifications.specials[specialName].name.search('Legacy') >= 0) {
|
||||
continue;
|
||||
|
||||
const applied = m.getExperimental();
|
||||
const experimentals = [];
|
||||
for (const experimental of m.getApplicableExperimentals()) {
|
||||
const active = experimental === applied;
|
||||
let specialTt = specialToolTip(language, m, experimental);
|
||||
experimentals.push(
|
||||
<div key={experimental} data-id={experimental}
|
||||
style={{ cursor: 'pointer' }}
|
||||
className={cn('button-inline-menu', { active })}
|
||||
onClick={this._specialSelected(experimental)}
|
||||
ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
|
||||
onMouseOver={termtip.bind(null, specialTt)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate(experimental)}</div>
|
||||
);
|
||||
}
|
||||
const classes = cn('button-inline-menu', {
|
||||
active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName
|
||||
});
|
||||
if (classes.indexOf('active') >= 0) this.selectedSpecialId = specialName;
|
||||
const close = this._specialSelected.bind(this, specialName);
|
||||
if (m.blueprint && m.blueprint.name) {
|
||||
let tmp = {};
|
||||
if (m.blueprint.special) {
|
||||
tmp = m.blueprint.special;
|
||||
} else {
|
||||
tmp = undefined;
|
||||
|
||||
if (experimentals.length) {
|
||||
experimentals.unshift(
|
||||
<div style={{ cursor: 'pointer', fontWeight: 'bold' }}
|
||||
className="button-inline-menu warning" key="none" data-id="none"
|
||||
// Setting the special effect to undefined clears it
|
||||
onClick={this._specialSelected(undefined)}
|
||||
ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
|
||||
>{translate('PHRASE_NO_SPECIAL')}</div>
|
||||
);
|
||||
}
|
||||
m.blueprint.special = Modifications.specials[specialName];
|
||||
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName);
|
||||
m.blueprint.special = tmp;
|
||||
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
|
||||
} else {
|
||||
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName }onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
|
||||
|
||||
return experimentals;
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a modification component
|
||||
*/
|
||||
_mkModification(property, highlight) {
|
||||
const { translate } = this.context.language;
|
||||
const { m, propsToShow, onPropToggle } = this.props;
|
||||
|
||||
let onSet = m.set.bind(m);
|
||||
// Show resistance instead of effectiveness
|
||||
const mapped = SHOW[property];
|
||||
if (mapped) {
|
||||
property = mapped.as;
|
||||
onSet = mapped.setter.bind(undefined, m);
|
||||
}
|
||||
}
|
||||
return specials;
|
||||
|
||||
return [
|
||||
<tr key={`th-${property}`}>
|
||||
<th colSpan="4">
|
||||
<span className="cb">{translate(property)}</span>
|
||||
</th>
|
||||
</tr>,
|
||||
<Modification key={property} m={m} property={property}
|
||||
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
|
||||
onPropToggle={onPropToggle} />
|
||||
];
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modifications
|
||||
* @param {Object} props React Component properties
|
||||
* @return {Object} list: Array of React Components
|
||||
* @return {Array} Array of React Components
|
||||
*/
|
||||
_renderModifications(props) {
|
||||
const { m, onChange, ship } = props;
|
||||
const modifiableModifications = [];
|
||||
const modifications = [];
|
||||
for (const modName of Modifications.modules[m.grp].modifications) {
|
||||
if (!Modifications.modifications[modName].hidden) {
|
||||
const key = modName + (m.getModValue(modName) / 100 || 0);
|
||||
const editable = modName !== 'fallofffromrange';
|
||||
const highlight = m.blueprint.grades[m.blueprint.grade].features[modName];
|
||||
this.lastNeId = modName;
|
||||
(editable && highlight ? modifiableModifications : modifications).push(
|
||||
<Modification key={ key } ship={ ship } m={ m } highlight={highlight}
|
||||
value={m.getPretty(modName) || 0} modItems={this.modItems}
|
||||
onChange={onChange} onKeyDown={this._keyDown} name={modName}
|
||||
editable={editable} handleModChange = {this._handleModChange} />
|
||||
);
|
||||
}
|
||||
}
|
||||
_renderModifications() {
|
||||
const { m } = this.props;
|
||||
|
||||
modifiableModifications.sort(MODIFICATIONS_COMPARATOR);
|
||||
modifications.sort(MODIFICATIONS_COMPARATOR);
|
||||
return modifiableModifications.concat(modifications);
|
||||
const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[
|
||||
m.getBlueprintGrade()
|
||||
];
|
||||
const blueprintModifications = chain(keys(blueprintFeatures))
|
||||
.map((feature) => this._mkModification(feature, true))
|
||||
.filter(([_, mod]) => Boolean(mod))
|
||||
.flatMap()
|
||||
.value();
|
||||
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
|
||||
.filter((prop) => !blueprintFeatures[prop])
|
||||
.map((prop) => this._mkModification(prop, false))
|
||||
.flatMap()
|
||||
.value();
|
||||
|
||||
return blueprintModifications.concat(moduleModifications);
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the blueprints menu
|
||||
*/
|
||||
_toggleBlueprintsMenu() {
|
||||
const blueprintMenuOpened = !this.state.blueprintMenuOpened;
|
||||
this.setState({ blueprintMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Activated when a blueprint is selected
|
||||
* @param {int} fdname The Frontier name of the blueprint
|
||||
* @param {int} grade The grade of the selected blueprint
|
||||
*/
|
||||
_blueprintSelected(fdname, grade) {
|
||||
this.context.tooltip(null);
|
||||
const { m, ship } = this.props;
|
||||
const blueprint = getBlueprint(fdname, m);
|
||||
blueprint.grade = grade;
|
||||
ship.setModuleBlueprint(m, blueprint);
|
||||
setPercent(ship, m, 100);
|
||||
|
||||
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
|
||||
this.props.onChange();
|
||||
this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the specials menu
|
||||
*/
|
||||
_toggleSpecialsMenu() {
|
||||
const specialMenuOpened = !this.state.specialMenuOpened;
|
||||
this.setState({ specialMenuOpened });
|
||||
this.setState({ specialMenuOpened: !this.state.specialMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Activated when a special is selected
|
||||
* @param {int} special The name of the selected special
|
||||
* Creates a callback for when a special effect is being selected
|
||||
* @param {string} special The name of the selected special
|
||||
* @returns {function} Callback
|
||||
*/
|
||||
_specialSelected(special) {
|
||||
this.context.tooltip(null);
|
||||
const { m, ship } = this.props;
|
||||
|
||||
if (special === null) {
|
||||
ship.clearModuleSpecial(m);
|
||||
} else {
|
||||
ship.setModuleSpecial(m, Modifications.specials[special]);
|
||||
}
|
||||
|
||||
return () => {
|
||||
const { m } = this.props;
|
||||
m.setExperimental(special);
|
||||
this.setState({ specialMenuOpened: false });
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a '50%' roll within the information we have
|
||||
*/
|
||||
_rollFifty() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 50);
|
||||
|
||||
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
|
||||
this._handleModChange(true);
|
||||
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a random roll within the information we have
|
||||
*/
|
||||
_rollRandom() {
|
||||
const { m, ship } = this.props;
|
||||
setRandom(ship, m);
|
||||
|
||||
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
|
||||
this._handleModChange(true);
|
||||
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a 'best' roll within the information we have
|
||||
*/
|
||||
_rollBest() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 100);
|
||||
|
||||
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
|
||||
this._handleModChange(true);
|
||||
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a 'worst' roll within the information we have
|
||||
*/
|
||||
_rollWorst() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 0);
|
||||
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
|
||||
this._handleModChange(true);
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset modification information
|
||||
*/
|
||||
_reset() {
|
||||
const { m, ship } = this.props;
|
||||
ship.clearModifications(m);
|
||||
ship.clearModuleBlueprint(m);
|
||||
this.selectedModId = null;
|
||||
this.selectedSpecialId = null;
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* set mod did change boolean
|
||||
* @param {boolean} b Boolean to determine if a change has been made to a module
|
||||
*/
|
||||
_handleModChange(b) {
|
||||
this.modValDidChange = b;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set focus on first element in modifications menu
|
||||
* after it first mounts
|
||||
*/
|
||||
componentDidMount() {
|
||||
let firstEleCn = this.modItems['modMainDiv'].children.length > 0 ? this.modItems['modMainDiv'].children[0].className : null;
|
||||
if (firstEleCn.indexOf('select-group cap') >= 0) {
|
||||
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
|
||||
} else {
|
||||
this.modItems['modMainDiv'].firstElementChild.focus();
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -371,33 +213,13 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
* in a modification
|
||||
*/
|
||||
componentDidUpdate() {
|
||||
if (!this.modValDidChange) {
|
||||
if (this.modItems['modMainDiv'].children.length > 0) {
|
||||
if (this.modItems[this.selectedModId]) {
|
||||
this.modItems[this.selectedModId].focus();
|
||||
if (this.selectedModRef) {
|
||||
this.selectedModRef.focus();
|
||||
return;
|
||||
} else if (this.modItems[this.selectedSpecialId]) {
|
||||
this.modItems[this.selectedSpecialId].focus();
|
||||
} else if (this.selectedSpecialRef) {
|
||||
this.selectedSpecialRef.focus();
|
||||
return;
|
||||
}
|
||||
let firstEleCn = this.modItems['modMainDiv'].children[0].className;
|
||||
if (firstEleCn.indexOf('button-inline-menu') >= 0) {
|
||||
this.modItems['modMainDiv'].firstElementChild.focus();
|
||||
} else if (firstEleCn.indexOf('select-group cap') >= 0) {
|
||||
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
|
||||
}
|
||||
}
|
||||
} else {
|
||||
this._handleModChange(false);// Need to reset if component update due to value change
|
||||
}
|
||||
}
|
||||
/**
|
||||
* set focus to the modification menu icon after mod menu is unmounted.
|
||||
*/
|
||||
componentWillUnmount() {
|
||||
if (this.props.modButton) {
|
||||
this.props.modButton.focus();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -408,106 +230,155 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const translate = language.translate;
|
||||
const { m } = this.props;
|
||||
const { blueprintMenuOpened, specialMenuOpened } = this.state;
|
||||
const {
|
||||
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
|
||||
} = this.state;
|
||||
|
||||
const _toggleBlueprintsMenu = this._toggleBlueprintsMenu;
|
||||
const _toggleSpecialsMenu = this._toggleSpecialsMenu;
|
||||
const _rollFull = this._rollBest;
|
||||
const _rollWorst = this._rollWorst;
|
||||
const _rollFifty = this._rollFifty;
|
||||
const _rollRandom = this._rollRandom;
|
||||
const _reset = this._reset;
|
||||
const appliedBlueprint = m.getBlueprint();
|
||||
const appliedGrade = m.getBlueprintGrade();
|
||||
const appliedExperimental = m.getExperimental();
|
||||
|
||||
let blueprintLabel;
|
||||
let haveBlueprint = false;
|
||||
let blueprintTt;
|
||||
let blueprintCv;
|
||||
let bprintSearchName;
|
||||
let renderComponents = [];
|
||||
switch (true) {
|
||||
case !appliedBlueprint || blueprintMenuOpened:
|
||||
renderComponents = this._renderBlueprints();
|
||||
break;
|
||||
case specialMenuOpened:
|
||||
renderComponents = this._renderSpecials();
|
||||
break;
|
||||
default:
|
||||
// Since the first case didn't apply, there is a blueprint applied so
|
||||
// we render the modifications
|
||||
let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade);
|
||||
|
||||
// If the fdname is Weapon_Overcharged, we need to check if it's an MC
|
||||
if (m.blueprint && m.blueprint.fdname) {
|
||||
// Set the bprintSearchName value to the fdname of the blueprint for this module
|
||||
bprintSearchName = m.blueprint.fdname;
|
||||
if (m.blueprint.fdname === 'Weapon_Overcharged') {
|
||||
// If the module is a MultiCannon, we need to fix the blueprint search name, else it will find the Laser Weapon_Overcharged Blueprint and not the MC Weapon_Overcharged Blueprint
|
||||
if (m.symbol.match(/MultiCannon/i)) {
|
||||
// console.log(Modifications.modules[m.grp].blueprints['MC_Overcharged']);
|
||||
// console.log(m.blueprint.fdname);
|
||||
bprintSearchName = 'MC_Overcharged';
|
||||
}
|
||||
}
|
||||
}
|
||||
// TODO: Fix this to actually find the correct blueprint.
|
||||
if (!m.blueprint || !m.blueprint.name || !m.blueprint.fdname || !Modifications.modules[m.grp].blueprints || !Modifications.modules[m.grp].blueprints[bprintSearchName]) {
|
||||
this.props.ship.clearModuleBlueprint(m);
|
||||
this.props.ship.clearModuleSpecial(m);
|
||||
}
|
||||
if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[bprintSearchName].grades[m.blueprint.grade]) {
|
||||
blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
haveBlueprint = true;
|
||||
// console.log(haveBlueprint);
|
||||
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[bprintSearchName].grades[m.blueprint.grade].engineers, m.grp);
|
||||
blueprintCv = getPercent(m);
|
||||
}
|
||||
|
||||
let specialLabel;
|
||||
let specialTt;
|
||||
if (m.blueprint && m.blueprint.special) {
|
||||
specialLabel = translate(m.blueprint.special.name);
|
||||
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname);
|
||||
} else {
|
||||
specialLabel = translate('PHRASE_SELECT_SPECIAL');
|
||||
}
|
||||
|
||||
const specials = this._renderSpecials(this.props, this.context);
|
||||
/**
|
||||
* pnellesen - 05/28/2018 - added additional checks for specials.length below to ensure menus
|
||||
* display correctly in cases where there are no specials (ex: AFMUs.)
|
||||
*/
|
||||
const showBlueprintsMenu = blueprintMenuOpened;
|
||||
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened;
|
||||
const showSpecialsMenu = specialMenuOpened && specials.length;
|
||||
const showRolls = haveBlueprint && !blueprintMenuOpened && (!specialMenuOpened || !specials.length);
|
||||
const showReset = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
|
||||
const showMods = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
|
||||
if (haveBlueprint) {
|
||||
this.firstBPLabel = blueprintLabel;
|
||||
} else {
|
||||
this.firstBPLabel = 'selectBP';
|
||||
}
|
||||
return (
|
||||
<div
|
||||
className={cn('select', this.props.className)}
|
||||
onClick={(e) => e.stopPropagation() }
|
||||
onContextMenu={stopCtxPropagation}
|
||||
ref={modItem => this.modItems['modMainDiv'] = modItem}
|
||||
renderComponents.push(
|
||||
<div style={{ cursor: 'pointer' }} key="blueprintsMenu"
|
||||
className="section-menu button-inline-menu"
|
||||
onMouseOver={termtip.bind(null, blueprintTt)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
onClick={this._toggleBlueprintsMenu}
|
||||
>
|
||||
{ showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ?
|
||||
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{blueprintLabel}</div> :
|
||||
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> }
|
||||
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
|
||||
{ showSpecial & !showSpecialsMenu ? <div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu} onKeyDown={ this._keyDown }>{specialLabel}</div> : null }
|
||||
{ showSpecialsMenu ? specials : null }
|
||||
{ showReset ? <div tabIndex="0" className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
|
||||
{ showRolls ?
|
||||
{translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
|
||||
</div>
|
||||
);
|
||||
|
||||
if (m.getApplicableExperimentals().length) {
|
||||
let specialLabel = translate('PHRASE_SELECT_SPECIAL');
|
||||
let specialTt;
|
||||
if (appliedExperimental) {
|
||||
specialLabel = appliedExperimental;
|
||||
specialTt = specialToolTip(language, m, appliedExperimental);
|
||||
}
|
||||
renderComponents.push(
|
||||
<div className="section-menu button-inline-menu"
|
||||
style={{ cursor: 'pointer' }}
|
||||
onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
|
||||
onMouseOut={specialTt ? tooltip.bind(null, null) : null}
|
||||
onClick={this._toggleSpecialsMenu}
|
||||
>{specialLabel}</div>
|
||||
);
|
||||
}
|
||||
|
||||
renderComponents.push(
|
||||
<div
|
||||
className="section-menu button-inline-menu warning"
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.resetEngineering();
|
||||
this.selectedModRef = null;
|
||||
this.selectedSpecialRef = null;
|
||||
tooltip(null);
|
||||
this.setState({
|
||||
blueprintMenuOpened: true,
|
||||
blueprintProgress: undefined,
|
||||
});
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('reset')}</div>,
|
||||
<table style={{ width: '100%', backgroundColor: 'transparent' }}>
|
||||
<tbody>
|
||||
{ showRolls ?
|
||||
<tr>
|
||||
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: false }) }> { translate('mroll') }: </td>
|
||||
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 }) } style={{ cursor: 'pointer' }} onClick={_rollWorst} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td>
|
||||
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td>
|
||||
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td>
|
||||
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td>
|
||||
</tr> : null }
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: false },
|
||||
)}
|
||||
>{translate('mroll')}:</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 0 },
|
||||
)} style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(0);
|
||||
this.setState({ blueprintProgress: 0 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('0%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 0.5 },
|
||||
)} style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(0.5);
|
||||
this.setState({ blueprintProgress: 0.5 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('50%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 1 },
|
||||
)}
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(1);
|
||||
this.setState({ blueprintProgress: 1 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('100%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress % 0.5 !== 0 },
|
||||
)}
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
const blueprintProgress = Math.random();
|
||||
m.setBlueprintProgress(blueprintProgress);
|
||||
this.setState({ blueprintProgress });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('random')}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table> : null }
|
||||
{ showMods ? <hr /> : null }
|
||||
{ showMods ?
|
||||
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} >
|
||||
{ this._renderModifications(this.props) }
|
||||
</span> : null }
|
||||
</table>,
|
||||
<hr />,
|
||||
<span
|
||||
onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<table style={{ width: '100%' }}>
|
||||
<tbody>
|
||||
{this._renderModifications()}
|
||||
</tbody>
|
||||
</table>
|
||||
</span>
|
||||
);
|
||||
}
|
||||
|
||||
return (
|
||||
<div className={cn('select', this.props.className)}
|
||||
onClick={(e) => e.stopPropagation()}
|
||||
onContextMenu={stopCtxPropagation}
|
||||
>
|
||||
{renderComponents}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,36 +1,28 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
|
||||
|
||||
/**
|
||||
* Movement
|
||||
*/
|
||||
export default class Movement extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
cargo: PropTypes.number.isRequired
|
||||
pips: PropTypes.object.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render movement
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { ship, boost, eng, cargo, fuel } = this.props;
|
||||
const { ship, boost } = this.props;
|
||||
const { language } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { formats } = language;
|
||||
|
||||
return (
|
||||
<span id='movement'>
|
||||
@@ -57,14 +49,10 @@ export default class Movement extends TranslatedComponent {
|
||||
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
|
||||
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
|
||||
|
||||
{/* Speed */}
|
||||
<text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text>
|
||||
{/* Pitch */}
|
||||
<text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
{/* Roll */}
|
||||
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
{/* Yaw */}
|
||||
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
<text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text>
|
||||
<text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text>
|
||||
<text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text>
|
||||
<text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text>
|
||||
</svg>
|
||||
</span>);
|
||||
}
|
||||
|
||||
@@ -1,103 +1,37 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import PieChart from './PieChart';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import { Ship } from 'ed-forge';
|
||||
import autoBind from 'auto-bind';
|
||||
import { DAMAGE_METRICS } from 'ed-forge/lib/src/ship-stats';
|
||||
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
|
||||
|
||||
/**
|
||||
* Generates an internationalization friendly weapon comparator that will
|
||||
* sort by specified property (if provided) then by name/group, class, rating
|
||||
* @param {function} translate Translation function
|
||||
* @param {function} propComparator Optional property comparator
|
||||
* @param {boolean} desc Use descending order
|
||||
* @return {function} Comparator function for names
|
||||
* Turns an object into a tooltip.
|
||||
* @param {function} translate Translate function
|
||||
* @param {object} o Map to make the tooltip from
|
||||
* @returns {React.Component} Tooltip
|
||||
*/
|
||||
export function weaponComparator(translate, propComparator, desc) {
|
||||
return (a, b) => {
|
||||
if (!desc) { // Flip A and B if ascending order
|
||||
let t = a;
|
||||
a = b;
|
||||
b = t;
|
||||
}
|
||||
|
||||
// If a property comparator is provided use it first
|
||||
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
|
||||
|
||||
if (diff) {
|
||||
return diff;
|
||||
}
|
||||
|
||||
// Property matches so sort by name / group, then class, rating
|
||||
if (a.name === b.name && a.grp === b.grp) {
|
||||
if(a.class == b.class) {
|
||||
return a.rating > b.rating ? 1 : -1;
|
||||
}
|
||||
return a.class - b.class;
|
||||
}
|
||||
|
||||
return nameComparator(translate, a, b);
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a tooltip that shows damage by type.
|
||||
* @param {function} translate Translation function
|
||||
* @param {Object} formats Object that holds format functions
|
||||
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
|
||||
* @returns {Array} Tooltip
|
||||
*/
|
||||
function getSDpsTooltip(translate, formats, sdpsObject) {
|
||||
return Object.keys(sdpsObject).filter(key => sdpsObject[key])
|
||||
.map(key => {
|
||||
return (
|
||||
<div key={key}>
|
||||
{translate(key) + ' ' + formats.f1(sdpsObject[key])}
|
||||
</div>
|
||||
);
|
||||
});
|
||||
function objToTooltip(translate, o) {
|
||||
return toPairs(o)
|
||||
.filter(([k, v]) => Boolean(v))
|
||||
.map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>);
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns a data object used by {@link PieChart} that shows damage by type.
|
||||
* @param {function} translate Translation function
|
||||
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
|
||||
* @param {Calc.SDps} o Object that holds sdps split up by type
|
||||
* @returns {Object} Data object
|
||||
*/
|
||||
function getSDpsData(translate, sdpsObject) {
|
||||
return Object.keys(sdpsObject).map(key => {
|
||||
return {
|
||||
value: Math.round(sdpsObject[key]),
|
||||
label: translate(key)
|
||||
};
|
||||
function objToPie(translate, o) {
|
||||
return toPairs(o).map(([k, value]) => {
|
||||
return { label: translate(k), value };
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds all damage of `add` onto `addOn`.
|
||||
* @param {Calc.SDps} addOn Object that holds sdps split up by type (will be mutated)
|
||||
* @param {Calc.SDps} add Object that holds sdps split up by type
|
||||
*/
|
||||
function addSDps(addOn, add) {
|
||||
Object.keys(addOn).map(k => addOn[k] += (add[k] ? add[k] : 0));
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculates the overall sdps of an sdps object.
|
||||
* @param {Calc.SDps} sdpsObject Object that holds sdps spluit up by type
|
||||
*/
|
||||
function sumSDps(sdpsObject) {
|
||||
if (sdpsObject.total) {
|
||||
return sdpsObject.total;
|
||||
}
|
||||
|
||||
return Object.keys(sdpsObject).reduce(
|
||||
(acc, k) => acc + (sdpsObject[k] ? sdpsObject[k] : 0),
|
||||
0
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Offence information
|
||||
* Offence information consists of four panels:
|
||||
@@ -108,12 +42,10 @@ function sumSDps(sdpsObject) {
|
||||
*/
|
||||
export default class Offence extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
engagementrange: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
opponentSys: PropTypes.number.isRequired
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
opponent: PropTypes.instanceOf(Ship).isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -122,151 +54,234 @@ export default class Offence extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
|
||||
this._sort = this._sort.bind(this);
|
||||
|
||||
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
|
||||
this.state = {
|
||||
predicate: 'n',
|
||||
predicate: 'classRating',
|
||||
desc: true,
|
||||
damage
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our properties change
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps) {
|
||||
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
|
||||
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
|
||||
this.setState({ damage });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the sort order and sort
|
||||
* @param {string} predicate Sort predicate
|
||||
*/
|
||||
_sortOrder(predicate) {
|
||||
let desc = this.state.desc;
|
||||
|
||||
if (predicate == this.state.predicate) {
|
||||
desc = !desc;
|
||||
} else {
|
||||
desc = true;
|
||||
}
|
||||
|
||||
this._sort(predicate, desc);
|
||||
let desc = predicate == this.state.predicate ? !this.state.desc : true;
|
||||
this.setState({ predicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sorts the weapon list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort order descending
|
||||
*/
|
||||
_sort(predicate, desc) {
|
||||
let comp = weaponComparator.bind(null, this.context.language.translate);
|
||||
|
||||
switch (predicate) {
|
||||
case 'n': comp = comp(null, desc); break;
|
||||
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
|
||||
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
|
||||
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
|
||||
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
|
||||
}
|
||||
|
||||
this.state.damage.sort(comp);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render offence
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { ship, opponent, wep, engagementrange } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { damage } = this.state;
|
||||
const sortOrder = this._sortOrder;
|
||||
|
||||
const pd = ship.standard[4].m;
|
||||
const {
|
||||
drained, sustained, rangeMultiplier, hardnessMultiplier, timeToDrain
|
||||
} = ship.getMetrics(DAMAGE_METRICS);
|
||||
const portions = {
|
||||
Absolute: sustained.types.abs,
|
||||
Explosive: sustained.types.expl,
|
||||
Kinetic: sustained.types.kin,
|
||||
Thermic: sustained.types.therm,
|
||||
};
|
||||
|
||||
const opponentShields = Calc.shieldMetrics(opponent, 4);
|
||||
const opponentArmour = Calc.armourMetrics(opponent);
|
||||
const oppShield = ship.getOpponent().getShield();
|
||||
const shieldMults = {
|
||||
Absolute: 1,
|
||||
Explosive: oppShield.explosive.damageMultiplier,
|
||||
Kinetic: oppShield.kinetic.damageMultiplier,
|
||||
Thermic: oppShield.thermal.damageMultiplier,
|
||||
};
|
||||
|
||||
const timeToDrain = Calc.timeToDrainWep(ship, wep);
|
||||
const oppArmour = ship.getOpponent().getArmour();
|
||||
const armourMults = {
|
||||
Absolute: 1,
|
||||
Explosive: oppArmour.explosive.damageMultiplier,
|
||||
Kinetic: oppArmour.kinetic.damageMultiplier,
|
||||
Thermic: oppArmour.thermal.damageMultiplier,
|
||||
};
|
||||
|
||||
const weapons = sortBy(ship.getHardpoints(), (m) => m.get('distributordraw'));
|
||||
let rows = weapons.map((weapon) => {
|
||||
const sdps = weapon.get('sustaineddamagepersecond');
|
||||
const byRange = weapon.getRangeEffectiveness();
|
||||
const weaponPortions = {
|
||||
Absolute: weapon.get('absolutedamageportion'),
|
||||
Explosive: weapon.get('explosivedamageportion'),
|
||||
Kinetic: weapon.get('kineticdamageportion'),
|
||||
Thermic: weapon.get('thermicdamageportion'),
|
||||
};
|
||||
const baseSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
|
||||
);
|
||||
|
||||
let totalSEps = 0;
|
||||
let totalSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
|
||||
let shieldsSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
|
||||
let armourSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
|
||||
const bySys = oppShield.absolute.bySys;
|
||||
const shieldResEfts = mergeWith(
|
||||
clone(weaponPortions),
|
||||
shieldMults,
|
||||
(objV, srcV) => objV * srcV
|
||||
);
|
||||
const byShieldRes = sum(values(shieldResEfts));
|
||||
const shieldsSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(
|
||||
shieldResEfts,
|
||||
(mult) => formats.f1(byRange * mult * bySys * sdps),
|
||||
),
|
||||
);
|
||||
const shieldsEftTooltip = objToTooltip(
|
||||
translate,
|
||||
{
|
||||
range: formats.pct1(byRange),
|
||||
resistance: formats.pct1(byShieldRes),
|
||||
'power distributor': formats.pct1(bySys),
|
||||
},
|
||||
);
|
||||
const shieldEft = byRange * byShieldRes * bySys;
|
||||
|
||||
const rows = [];
|
||||
for (let i = 0; i < damage.length; i++) {
|
||||
const weapon = damage[i];
|
||||
const byHardness = weapon.getArmourEffectiveness();
|
||||
const armourResEfts = mergeWith(
|
||||
clone(weaponPortions),
|
||||
armourMults,
|
||||
(objV, srcV) => objV * srcV,
|
||||
);
|
||||
const byArmourRes = sum(values(armourResEfts));
|
||||
const armourSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(
|
||||
armourResEfts,
|
||||
(mult) => formats.f1(byRange * mult * byHardness * sdps)
|
||||
),
|
||||
);
|
||||
const armourEftTooltip = objToTooltip(
|
||||
translate,
|
||||
{
|
||||
range: formats.pct1(byRange),
|
||||
resistance: formats.pct1(byArmourRes),
|
||||
hardness: formats.pct1(byHardness),
|
||||
},
|
||||
);
|
||||
const armourEft = byRange * byArmourRes * byHardness;
|
||||
|
||||
totalSEps += weapon.seps;
|
||||
addSDps(totalSDpsObject, weapon.sdps.base);
|
||||
addSDps(shieldsSDpsObject, weapon.sdps.shields);
|
||||
addSDps(armourSDpsObject, weapon.sdps.armour);
|
||||
const bp = weapon.getBlueprint();
|
||||
const grade = weapon.getBlueprintGrade();
|
||||
const exp = weapon.getExperimental();
|
||||
let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`;
|
||||
if (exp) {
|
||||
bpTitle += `, ${translate(exp)}`;
|
||||
}
|
||||
return {
|
||||
slot: weapon.getSlot(),
|
||||
mount: weapon.mount,
|
||||
classRating: weapon.getClassRating(),
|
||||
type: weapon.readMeta('type'),
|
||||
bpTitle: bp ? ` (${bpTitle})` : null,
|
||||
sdps,
|
||||
baseSdpsTooltip,
|
||||
shieldSdps: sdps * shieldEft,
|
||||
shieldEft,
|
||||
shieldsSdpsTooltip,
|
||||
shieldsEftTooltip,
|
||||
armourSdps: sdps * armourEft,
|
||||
armourEft,
|
||||
armourSdpsTooltip,
|
||||
armourEftTooltip,
|
||||
};
|
||||
});
|
||||
|
||||
const baseSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.base);
|
||||
|
||||
const effectivenessShieldsTooltipDetails = [];
|
||||
effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>);
|
||||
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>);
|
||||
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>);
|
||||
|
||||
const effectiveShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
|
||||
|
||||
const effectivenessArmourTooltipDetails = [];
|
||||
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>);
|
||||
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>);
|
||||
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>);
|
||||
|
||||
const effectiveArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
|
||||
|
||||
rows.push(
|
||||
<tr key={weapon.id}>
|
||||
<td className='ri'>
|
||||
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
|
||||
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
|
||||
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
|
||||
{weapon.classRating} {translate(weapon.name)}
|
||||
{weapon.engineering ? ' (' + weapon.engineering + ')' : null }
|
||||
</td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, baseSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.base.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
|
||||
|
||||
<td className='ri'><span>{formats.f1(weapon.effectiveness.shields.dpe)}</span></td>
|
||||
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
|
||||
|
||||
<td className='ri'><span>{formats.f1(weapon.effectiveness.armour.dpe)}</span></td>
|
||||
</tr>);
|
||||
const { predicate, desc } = this.state;
|
||||
rows = sortBy(rows, (row) => row[predicate]);
|
||||
if (desc) {
|
||||
reverse(rows);
|
||||
}
|
||||
|
||||
const totalSDps = sumSDps(totalSDpsObject);
|
||||
const totalSDpsTooltipDetails = getSDpsTooltip(translate, formats, totalSDpsObject);
|
||||
const totalSDpsData = getSDpsData(translate, totalSDpsObject);
|
||||
const sdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(portions, (p) => formats.f1(sustained.dps * p)),
|
||||
);
|
||||
const sdpsPie = objToPie(
|
||||
translate,
|
||||
mapValues(portions, (p) => Math.round(sustained.dps * p)),
|
||||
);
|
||||
|
||||
const totalShieldsSDps = sumSDps(shieldsSDpsObject);
|
||||
const totalShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, shieldsSDpsObject);
|
||||
const shieldsSDpsData = getSDpsData(translate, shieldsSDpsObject);
|
||||
const shieldSdpsSrcs = mergeWith(
|
||||
clone(portions),
|
||||
shieldMults,
|
||||
(objV, srcV) => sustained.dps * oppShield.absolute.bySys *
|
||||
rangeMultiplier * objV * srcV,
|
||||
);
|
||||
const shieldsSdps = sum(values(shieldSdpsSrcs));
|
||||
const shieldsSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
|
||||
);
|
||||
const shieldsSdpsPie = objToPie(
|
||||
translate,
|
||||
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
|
||||
);
|
||||
|
||||
const totalArmourSDps = sumSDps(armourSDpsObject);
|
||||
const totalArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, armourSDpsObject);
|
||||
const armourSDpsData = getSDpsData(translate, armourSDpsObject);
|
||||
const armourSdpsSrcs = mergeWith(
|
||||
clone(portions),
|
||||
armourMults,
|
||||
(objV, srcV) => sustained.dps * hardnessMultiplier * rangeMultiplier *
|
||||
objV * srcV,
|
||||
);
|
||||
const armourSdps = sum(values(armourSdpsSrcs));
|
||||
const totalArmourSDpsTooltipDetails = objToTooltip(
|
||||
translate,
|
||||
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
|
||||
);
|
||||
const armourSDpsData = objToPie(
|
||||
translate,
|
||||
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
|
||||
);
|
||||
|
||||
const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
const drainedPortions = {
|
||||
Absolute: drained.types.abs,
|
||||
Explosive: drained.types.expl,
|
||||
Kinetic: drained.types.kin,
|
||||
Thermic: drained.types.therm,
|
||||
};
|
||||
|
||||
// How much damage do we deal, before the capacitor is empty?
|
||||
const armourLeft = oppArmour.armour - (timeToDrain * armourSdps);
|
||||
// If we can't kill the enemy on one capacitor, factor in drained damage
|
||||
let timeToDepleteArmour;
|
||||
if (armourLeft > 0) {
|
||||
const effectiveDrainedDps = sum(values(mergeWith(
|
||||
clone(drainedPortions),
|
||||
armourMults,
|
||||
(objV, srcV) => objV * srcV,
|
||||
))) * drained.dps * rangeMultiplier *
|
||||
hardnessMultiplier;
|
||||
timeToDepleteArmour = effectiveDrainedDps === 0 ? Infinity :
|
||||
timeToDrain + (armourLeft / effectiveDrainedDps);
|
||||
} else {
|
||||
timeToDepleteArmour = oppArmour.armour / armourSdps;
|
||||
}
|
||||
|
||||
// How much damage do we deal, before the capacitor is empty?
|
||||
const shieldsLeft = oppShield.withSCBs - (timeToDrain * shieldsSdps);
|
||||
// If we can't kill the enemy on one capacitor, factor in drained damage
|
||||
let timeToDepleteShields;
|
||||
if (shieldsLeft > 0) {
|
||||
const effectiveDrainedDps = sum(values(mergeWith(
|
||||
clone(drainedPortions),
|
||||
shieldMults,
|
||||
(objV, srcV) => objV * srcV,
|
||||
))) * drained.dps * rangeMultiplier;
|
||||
timeToDepleteShields = effectiveDrainedDps === 0 ? Infinity :
|
||||
timeToDrain + (shieldsLeft / effectiveDrainedDps);
|
||||
} else {
|
||||
timeToDepleteShields = oppShield.withSCBs / shieldsSdps;
|
||||
}
|
||||
|
||||
return (
|
||||
<span id='offence'>
|
||||
@@ -274,34 +289,75 @@ export default class Offence extends TranslatedComponent {
|
||||
<table>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th>
|
||||
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th>
|
||||
<th colSpan='1'>{translate('overall')}</th>
|
||||
<th colSpan='3'>{translate('opponent\'s shields')}</th>
|
||||
<th colSpan='3'>{translate('opponent\'s armour')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th>
|
||||
|
||||
<th className='sortable'>{'dpe'}</th>
|
||||
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th>
|
||||
|
||||
<th className='sortable'>{'dpe'}</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')}
|
||||
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
{rows.map((row) => (
|
||||
<tr key={row.slot}>
|
||||
<td className='ri'>
|
||||
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
|
||||
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
|
||||
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
|
||||
{row.classRating} {translate(row.type)}
|
||||
{row.bpTitle}
|
||||
</td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.sdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.shieldSdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.pct1(row.shieldEft)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.armourSdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.pct1(row.armourEft)}</span></td>
|
||||
</tr>
|
||||
))}
|
||||
{rows.length > 0 &&
|
||||
<tr>
|
||||
<td></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, totalSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalSDps)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, totalShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalShieldsSDps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(sustained.dps)}
|
||||
</span>
|
||||
</td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(shieldsSdps)}
|
||||
</span>
|
||||
</td>
|
||||
<td></td>
|
||||
<td></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalArmourSDps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(armourSdps)}
|
||||
</span>
|
||||
</td>
|
||||
<td></td>
|
||||
<td></td>
|
||||
</tr>
|
||||
@@ -311,22 +367,51 @@ export default class Offence extends TranslatedComponent {
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('offence metrics')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>
|
||||
{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
|
||||
{formats.f1(shieldsSdps)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
|
||||
{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
|
||||
{formats.f1(armourSdps)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
|
||||
{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}
|
||||
</h2>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('overall damage')}</h2>
|
||||
<PieChart data={totalSDpsData} />
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('overall damage')}
|
||||
</h2>
|
||||
<PieChart data={sdpsPie} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2>
|
||||
<PieChart data={shieldsSDpsData} />
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('shield damage sources')}
|
||||
</h2>
|
||||
<PieChart data={shieldsSdpsPie} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('armour damage sources')}
|
||||
</h2>
|
||||
<PieChart data={armourSDpsData} />
|
||||
</div>
|
||||
</span>);
|
||||
|
||||
@@ -11,29 +11,24 @@ import Movement from './Movement';
|
||||
import Offence from './Offence';
|
||||
import Defence from './Defence';
|
||||
import WeaponDamageChart from './WeaponDamageChart';
|
||||
import Pips from '../components/Pips';
|
||||
import Boost from '../components/Boost';
|
||||
import Fuel from '../components/Fuel';
|
||||
import Cargo from '../components/Cargo';
|
||||
import ShipPicker from '../components/ShipPicker';
|
||||
import EngagementRange from '../components/EngagementRange';
|
||||
import autoBind from 'auto-bind';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
|
||||
|
||||
/**
|
||||
* Outfitting subpages
|
||||
*/
|
||||
export default class OutfittingSubpages extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
buildName: PropTypes.string,
|
||||
sys: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
opponentBuild: PropTypes.string,
|
||||
opponentSys: PropTypes.number.isRequired,
|
||||
opponentEng: PropTypes.number.isRequired,
|
||||
opponentWep: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -42,13 +37,17 @@ export default class OutfittingSubpages extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._powerTab = this._powerTab.bind(this);
|
||||
this._profilesTab = this._profilesTab.bind(this);
|
||||
this._offenceTab = this._offenceTab.bind(this);
|
||||
this._defenceTab = this._defenceTab.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
this.props.ship.setOpponent(this.props.ship);
|
||||
this.state = {
|
||||
boost: false,
|
||||
cargo: props.ship.get(CARGO_CAPACITY),
|
||||
fuel: props.ship.get(FUEL_CAPACITY),
|
||||
pips: props.ship.getDistributorSettingsObject(),
|
||||
tab: Persist.getOutfittingTab() || 'power',
|
||||
engagementRange: 1000,
|
||||
opponent: this.props.ship,
|
||||
};
|
||||
}
|
||||
|
||||
@@ -57,128 +56,113 @@ export default class OutfittingSubpages extends TranslatedComponent {
|
||||
* @param {string} tab Tab name
|
||||
*/
|
||||
_showTab(tab) {
|
||||
Persist.setOutfittingTab(tab);
|
||||
this.setState({ tab });
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the power tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_powerTab() {
|
||||
let { ship, buildName, code, onChange } = this.props;
|
||||
Persist.setOutfittingTab('power');
|
||||
|
||||
const powerMarker = `${ship.toString()}`;
|
||||
const costMarker = `${ship.toString().split('.')[0]}`;
|
||||
|
||||
return <div>
|
||||
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
|
||||
<CostSection ship={ship} buildName={buildName} code={costMarker} />
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the profiles tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_profilesTab() {
|
||||
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
let realBoost = boost && ship.canBoost(cargo, fuel);
|
||||
Persist.setOutfittingTab('profiles');
|
||||
|
||||
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
|
||||
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
|
||||
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
|
||||
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
|
||||
|
||||
return <div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('engine profile')}</h1>
|
||||
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
|
||||
</div>
|
||||
|
||||
<div className='group third'>
|
||||
<h1>{translate('fsd profile')}</h1>
|
||||
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
|
||||
</div>
|
||||
|
||||
<div className='group third'>
|
||||
<h1>{translate('movement profile')}</h1>
|
||||
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
|
||||
</div>
|
||||
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s shields')}</h1>
|
||||
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
|
||||
</div>
|
||||
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s hull')}</h1>
|
||||
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the offence tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_offenceTab() {
|
||||
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
|
||||
Persist.setOutfittingTab('offence');
|
||||
|
||||
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
|
||||
|
||||
return <div>
|
||||
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the defence tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_defenceTab() {
|
||||
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
|
||||
Persist.setOutfittingTab('defence');
|
||||
|
||||
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
|
||||
|
||||
return <div>
|
||||
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the section
|
||||
* @return {React.Component} Contents
|
||||
*/
|
||||
render() {
|
||||
const tab = this.state.tab;
|
||||
const translate = this.context.language.translate;
|
||||
let tabSection;
|
||||
|
||||
switch (tab) {
|
||||
case 'power': tabSection = this._powerTab(); break;
|
||||
case 'profiles': tabSection = this._profilesTab(); break;
|
||||
case 'offence': tabSection = this._offenceTab(); break;
|
||||
case 'defence': tabSection = this._defenceTab(); break;
|
||||
}
|
||||
const { buildName, code, ship } = this.props;
|
||||
const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state;
|
||||
const { translate } = this.context.language;
|
||||
|
||||
const cargoCapacity = ship.get(CARGO_CAPACITY);
|
||||
const showCargoSlider = cargoCapacity > 0;
|
||||
return (
|
||||
<div>
|
||||
{/* Control of ship and opponent */}
|
||||
<div className="group quarter">
|
||||
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
|
||||
{translate('ship control')}
|
||||
</h2>
|
||||
<Boost boost={boost} onChange={(boost) => this.setState({ boost })} />
|
||||
</div>
|
||||
<div className="group quarter">
|
||||
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
|
||||
{translate('opponent')}
|
||||
</h2>
|
||||
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
|
||||
</div>
|
||||
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
|
||||
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
|
||||
onChange={(fuel) => this.setState({ fuel })} />
|
||||
</div>
|
||||
{showCargoSlider ?
|
||||
<div className="group quarter">
|
||||
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
|
||||
onChange={(cargo) => this.setState({ cargo })} />
|
||||
</div> : null}
|
||||
<div className="group half">
|
||||
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
|
||||
</div>
|
||||
<div className="group half">
|
||||
<EngagementRange ship={ship} engagementRange={engagementRange}
|
||||
onChange={(engagementRange) => this.setState({ engagementRange })} />
|
||||
</div>
|
||||
<div className='group full' style={{ minHeight: '1000px' }}>
|
||||
<table className='tabs'>
|
||||
{/* Select tab section */}
|
||||
<thead>
|
||||
<tr>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('tab_defence')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
|
||||
onClick={this._showTab.bind(this, 'power')}>
|
||||
{translate('power and costs')}
|
||||
</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
|
||||
onClick={this._showTab.bind(this, 'profiles')}>
|
||||
{translate('profiles')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
|
||||
onClick={this._showTab.bind(this, 'offence')}>
|
||||
{translate('offence')}
|
||||
</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
|
||||
onClick={this._showTab.bind(this, 'defence')}>
|
||||
{translate('tab_defence')}
|
||||
</th>
|
||||
</tr>
|
||||
</thead>
|
||||
</table>
|
||||
{tabSection}
|
||||
{/* Show selected tab */}
|
||||
{tab == 'power' ?
|
||||
<div>
|
||||
<PowerManagement ship={ship} code={code} />
|
||||
<CostSection ship={ship} buildName={buildName} code={code} />
|
||||
</div> : null}
|
||||
{tab == 'profiles' ?
|
||||
<div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('engine profile')}</h1>
|
||||
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
|
||||
</div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('fsd profile')}</h1>
|
||||
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
|
||||
</div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('movement profile')}</h1>
|
||||
<Movement code={code} ship={ship} boost={boost} pips={pips} />
|
||||
</div>
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s shields')}</h1>
|
||||
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
|
||||
</div>
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s hull')}</h1>
|
||||
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
|
||||
</div>
|
||||
</div> : null}
|
||||
{tab == 'offence' ?
|
||||
<div>
|
||||
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
|
||||
</div> : null}
|
||||
{tab == 'defence' ?
|
||||
<div>
|
||||
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
|
||||
</div> : null}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -10,7 +10,6 @@ const LABEL_COLOUR = '#000000';
|
||||
* A pie chart
|
||||
*/
|
||||
export default class PieChart extends Component {
|
||||
|
||||
static propTypes = {
|
||||
data : PropTypes.array.isRequired
|
||||
};
|
||||
|
||||
@@ -2,7 +2,8 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Pip } from './SvgIcons';
|
||||
import autoBind from 'auto-bind';
|
||||
import { autoBind } from 'react-extras';
|
||||
import { Ship } from 'ed-forge';
|
||||
|
||||
/**
|
||||
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
|
||||
@@ -10,13 +11,9 @@ import autoBind from 'auto-bind';
|
||||
*/
|
||||
export default class Pips extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
sys: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
mcSys: PropTypes.number.isRequired,
|
||||
mcEng: PropTypes.number.isRequired,
|
||||
mcWep: PropTypes.number.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
pips: PropTypes.object.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -27,6 +24,12 @@ export default class Pips extends TranslatedComponent {
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
|
||||
const { ship } = props;
|
||||
this._incSys = this._change(ship.incSys);
|
||||
this._incEng = this._change(ship.incEng);
|
||||
this._incWep = this._change(ship.incWep);
|
||||
this._reset = this._change(ship.pipsReset);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -71,153 +74,42 @@ export default class Pips extends TranslatedComponent {
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset the capacitor
|
||||
*/
|
||||
_reset(isMc) {
|
||||
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
|
||||
if (isMc) {
|
||||
if (mcSys || mcEng || mcWep) {
|
||||
sys -= mcSys;
|
||||
eng -= mcEng;
|
||||
wep -= mcWep;
|
||||
this.props.onChange(sys, eng, wep, 0, 0, 0);
|
||||
}
|
||||
} else if (sys != 2 || eng != 2 || wep != 2) {
|
||||
sys = eng = wep = 2;
|
||||
this.props.onChange(sys + mcSys, eng + mcEng, wep + mcWep, mcSys, mcEng, mcWep);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the SYS capacitor
|
||||
*/
|
||||
_incSys() {
|
||||
this._inc('sys', false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the ENG capacitor
|
||||
*/
|
||||
_incEng() {
|
||||
this._inc('eng', false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the WEP capacitor
|
||||
*/
|
||||
_incWep() {
|
||||
this._inc('wep', false);
|
||||
}
|
||||
|
||||
_wrapMcClick(key) {
|
||||
return (event) => {
|
||||
event.stopPropagation();
|
||||
event.preventDefault();
|
||||
if (key == 'rst') {
|
||||
this._reset(true);
|
||||
} else {
|
||||
this._inc(key, true);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Increases a given capacitor
|
||||
* @param {String} key Pip name to increase (one of 'sys', 'eng', 'wep')
|
||||
* Creates a function that handles pip assignment and call `onChance`.
|
||||
* @param {String} cb Callback that handles the actual pip assignment
|
||||
* @param {Boolean} isMc True when increase is by multi crew
|
||||
* @returns {Function} Function that handles pip assigment
|
||||
*/
|
||||
_inc(key, isMc) {
|
||||
if (!['sys', 'eng', 'wep'].includes(key)) {
|
||||
return;
|
||||
}
|
||||
|
||||
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
|
||||
let mc = key == 'sys' ? mcSys : (key == 'eng' ? mcEng : mcWep);
|
||||
let pips = this.props[key] - mc;
|
||||
let other1 = key == 'sys' ? eng - mcEng : sys - mcSys;
|
||||
let other2 = key == 'wep' ? eng - mcEng : wep - mcWep;
|
||||
|
||||
const required = Math.min(1, 4 - mc - pips);
|
||||
if (isMc) {
|
||||
// We can only set full pips in multi-crew also we can only set two pips
|
||||
if (required > 0.5 && mcSys + mcEng + mcWep < 2) {
|
||||
if (key == 'sys') {
|
||||
mcSys += 1;
|
||||
} else if (key == 'eng') {
|
||||
mcEng += 1;
|
||||
} else {
|
||||
mcWep += 1;
|
||||
}
|
||||
}
|
||||
} else if (required > 0) {
|
||||
if (required == 0.5) {
|
||||
// Take from whichever is larger
|
||||
if (other1 > other2) {
|
||||
other1 -= 0.5;
|
||||
} else {
|
||||
other2 -= 0.5;
|
||||
}
|
||||
pips += 0.5;
|
||||
} else {
|
||||
// Required is 1 - take from both if possible
|
||||
if (other1 == 0) {
|
||||
other2 -= 1;
|
||||
} else if (other2 == 0) {
|
||||
other1 -= 1;
|
||||
} else {
|
||||
other1 -= 0.5;
|
||||
other2 -= 0.5;
|
||||
}
|
||||
pips += 1;
|
||||
}
|
||||
}
|
||||
|
||||
sys = mcSys + (key == 'sys' ? pips : other1);
|
||||
eng = mcEng + (key == 'eng' ? pips : (key == 'sys' ? other1 : other2));
|
||||
wep = mcWep + (key == 'wep' ? pips : other2);
|
||||
this.props.onChange(sys, eng, wep, mcSys, mcEng, mcWep);
|
||||
_change(cb, isMc) {
|
||||
return () => {
|
||||
cb(isMc);
|
||||
this.props.onChange(this.props.ship.getDistributorSettingsObject());
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Set up the rendering for pips
|
||||
* @param {Number} sys the SYS pips
|
||||
* @param {Number} eng the ENG pips
|
||||
* @param {Number} wep the WEP pips
|
||||
* @param {Number} mcSys SYS pips from multi-crew
|
||||
* @param {Number} mcEng ENG pips from multi-crew
|
||||
* @param {Number} mcWep WEP pips from multi-crew
|
||||
* @returns {Object} Object containing the rendering for the pips
|
||||
*/
|
||||
_renderPips(sys, eng, wep, mcSys, mcEng, mcWep) {
|
||||
_renderPips() {
|
||||
const pipsSvg = {
|
||||
SYS: [],
|
||||
ENG: [],
|
||||
WEP: [],
|
||||
Sys: [],
|
||||
Eng: [],
|
||||
Wep: [],
|
||||
};
|
||||
|
||||
// Multi-crew pipsSettings actually are included in the overall pip count therefore
|
||||
// we can consider [0, sys - mcSys] as normal pipsSettings whilst [sys - mcSys, sys]
|
||||
// are the multi-crew pipsSettings in what follows.
|
||||
|
||||
let pipsSettings = {
|
||||
SYS: [sys, mcSys],
|
||||
ENG: [eng, mcEng],
|
||||
WEP: [wep, mcWep],
|
||||
};
|
||||
|
||||
for (let pipName in pipsSettings) {
|
||||
let [pips, mcPips] = pipsSettings[pipName];
|
||||
for (let i = 0; i < Math.floor(pips - mcPips); i++) {
|
||||
pipsSvg[pipName].push(<Pip key={i} className='full' />);
|
||||
for (let k in this.props.pips) {
|
||||
let { base, mc } = this.props.pips[k];
|
||||
for (let i = 0; i < Math.floor(base); i++) {
|
||||
pipsSvg[k].push(<Pip key={i} className='full' />);
|
||||
}
|
||||
if (pips > Math.floor(pips)) {
|
||||
pipsSvg[pipName].push(<Pip className='half' key={'half'} />);
|
||||
if (base > Math.floor(base)) {
|
||||
pipsSvg[k].push(<Pip className='half' key={'half'} />);
|
||||
}
|
||||
for (let i = pips - mcPips; i < Math.floor(pips); i++) {
|
||||
pipsSvg[pipName].push(<Pip key={i} className='mc' />);
|
||||
for (let i = 0; i < mc; i++) {
|
||||
pipsSvg[k].push(<Pip key={base + i} className='mc' />);
|
||||
}
|
||||
for (let i = Math.floor(pips + 0.5); i < 4; i++) {
|
||||
pipsSvg[pipName].push(<Pip className='empty' key={i} />);
|
||||
for (let i = Math.ceil(base + mc); i < 4; i++) {
|
||||
pipsSvg[k].push(<Pip className='empty' key={i} />);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -229,11 +121,10 @@ export default class Pips extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = this.context.language;
|
||||
const { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
|
||||
const pipsSvg = this._renderPips(sys, eng, wep, mcSys, mcEng, mcWep);
|
||||
const pipsSvg = this._renderPips();
|
||||
return (
|
||||
<span id='pips'>
|
||||
<table>
|
||||
@@ -241,38 +132,40 @@ export default class Pips extends TranslatedComponent {
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={() => this._inc('eng')}
|
||||
onContextMenu={this._wrapMcClick('eng')}>{pipsSvg['ENG']}</td>
|
||||
<td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={this._incSys}
|
||||
onContextMenu={this._wrapMcClick('sys')}>{pipsSvg['SYS']}</td>
|
||||
<td className='clickable' onClick={this._incEng}
|
||||
onContextMenu={this._wrapMcClick('eng')}>{translate('ENG')}</td>
|
||||
<td className='clickable' onClick={this._incWep}
|
||||
onContextMenu={this._wrapMcClick('wep')}>{pipsSvg['WEP']}</td>
|
||||
<td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td>
|
||||
<td className='clickable' onClick={this._incEng}>
|
||||
{translate('ENG')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={this._incSys}
|
||||
onContextMenu={this._wrapMcClick('sys')}>{translate('SYS')}</td>
|
||||
<td className='clickable' onClick={this._reset.bind(this, false)}>
|
||||
<td className='clickable' onClick={this._incSys}>
|
||||
{translate('SYS')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._reset}>
|
||||
{translate('RST')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._incWep}
|
||||
onContextMenu={this._wrapMcClick('wep')}>{translate('WEP')}</td>
|
||||
<td className='clickable' onClick={this._incWep}>
|
||||
{translate('WEP')}
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td> </td>
|
||||
<td className='clickable secondary' onClick={this._wrapMcClick('rst')}
|
||||
onMouseEnter={termtip.bind(null, 'PHRASE_MULTI_CREW_CAPACITOR_POINTS')}
|
||||
onMouseLeave={tooltip.bind(null, null)}>
|
||||
{translate('RST')}
|
||||
<td className='clickable' onClick={this._change(ship.incSys, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
<td className='clickable' onClick={this._change(ship.incEng, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
<td className='clickable' onClick={this._change(ship.incWep, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
@@ -4,27 +4,25 @@ import * as d3 from 'd3';
|
||||
import cn from 'classnames';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { Ship } from 'ed-forge';
|
||||
import { POWER_METRICS } from 'ed-forge/lib/src/ship-stats';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Round to avoid floating point precision errors
|
||||
* Get the band-class.
|
||||
* @param {Boolean} selected Band selected
|
||||
* @param {number} sum Band power sum
|
||||
* @param {number} avail Total available power
|
||||
* @param {Number} relDraw Relative amount of power drawn by this band and
|
||||
* all prior
|
||||
* @return {string} CSS Class name
|
||||
*/
|
||||
function getClass(selected, sum, avail) {
|
||||
return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary';
|
||||
function getClass(selected, relDraw) {
|
||||
if (selected) {
|
||||
return 'secondary';
|
||||
} else if (relDraw >= 1) {
|
||||
return 'warning';
|
||||
} else {
|
||||
return 'primary';
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the # label for a Priority band
|
||||
* @param {number} val Priority Band Watt value
|
||||
* @param {number} index Priority Band index
|
||||
* @param {Function} wattScale Watt Scale function
|
||||
* @return {number} label / text
|
||||
*/
|
||||
function bandText(val, index, wattScale) {
|
||||
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -33,10 +31,9 @@ function bandText(val, index, wattScale) {
|
||||
*/
|
||||
export default class PowerBands extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
bands: PropTypes.array.isRequired,
|
||||
available: PropTypes.number.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
width: PropTypes.number.isRequired,
|
||||
code: PropTypes.string,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -46,20 +43,16 @@ export default class PowerBands extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
this.wattScale = d3.scaleLinear();
|
||||
this.pctScale = d3.scaleLinear().domain([0, 1]);
|
||||
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
|
||||
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
|
||||
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
this._updateScales = this._updateScales.bind(this);
|
||||
this._selectNone = this._selectNone.bind(this);
|
||||
this._hidetip = () => this.context.tooltip();
|
||||
|
||||
let maxBand = props.bands[props.bands.length - 1];
|
||||
|
||||
this.profile = props.ship.getMetrics(POWER_METRICS);
|
||||
this.state = {
|
||||
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
|
||||
ret: {},
|
||||
dep: {}
|
||||
};
|
||||
@@ -83,8 +76,6 @@ export default class PowerBands extends TranslatedComponent {
|
||||
let mRight = Math.round(140 * scale);
|
||||
let innerWidth = props.width - mLeft - mRight;
|
||||
|
||||
this._updateScales(innerWidth, this.state.maxPwr, props.available);
|
||||
|
||||
this.setState({
|
||||
barHeight,
|
||||
innerHeight,
|
||||
@@ -140,41 +131,67 @@ export default class PowerBands extends TranslatedComponent {
|
||||
this.setState({ dep: Object.assign({}, dep) });
|
||||
}
|
||||
|
||||
/**
|
||||
* Update scale
|
||||
* @param {number} innerWidth SVG innerwidth
|
||||
* @param {number} maxPwr Maximum power level MJ (deployed or available)
|
||||
* @param {number} available Available power MJ
|
||||
*/
|
||||
_updateScales(innerWidth, maxPwr, available) {
|
||||
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
|
||||
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state based on property and context changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next context
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
let { innerWidth, maxPwr } = this.state;
|
||||
let { language, sizeRatio } = this.context;
|
||||
let maxBand = nextProps.bands[nextProps.bands.length - 1];
|
||||
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
|
||||
|
||||
if (language !== nextContext.language) {
|
||||
this.wattAxis.tickFormat(nextContext.language.formats.r2);
|
||||
this.pctAxis.tickFormat(nextContext.language.formats.rPct);
|
||||
}
|
||||
|
||||
if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed
|
||||
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
|
||||
this.setState({ maxPwr: nextMaxPwr });
|
||||
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
|
||||
if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
|
||||
this._updateDimensions(nextProps, nextContext.sizeRatio);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Assemble bands for relative consumption array.
|
||||
* @param {Number[]} consumed Array of relative-consumption numbers
|
||||
* @param {object} selected Object mapping selected bands to 1
|
||||
* @param {Number} yOffset Offset in y-direction of the bar
|
||||
* @param {Function} onClick onClick callback
|
||||
* @returns {React.Component} Bands
|
||||
*/
|
||||
_consumedToBands(consumed, selected, yOffset, onClick) {
|
||||
const { state, wattScale } = this;
|
||||
const bands = [];
|
||||
let consumesPrev = 0;
|
||||
for (let i = 0; i < consumed.length; i++) {
|
||||
consumesPrev = consumed[i - 1] || consumesPrev;
|
||||
const consumes = consumed[i];
|
||||
|
||||
if (!consumes) {
|
||||
continue;
|
||||
}
|
||||
|
||||
bands.push(<rect
|
||||
key={'b' + i}
|
||||
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
|
||||
height={state.barHeight}
|
||||
x={wattScale(consumesPrev)}
|
||||
y={yOffset + 1}
|
||||
onClick={onClick.bind(this, i)}
|
||||
className={getClass(selected[i], consumes)}
|
||||
/>);
|
||||
|
||||
bands.push(<text
|
||||
key={'t' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
|
||||
y={yOffset + (state.barHeight / 2)}
|
||||
onClick={onClick.bind(this, i)}
|
||||
className='primary-bg'>{i + 1}</text>
|
||||
);
|
||||
}
|
||||
return bands;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the power bands
|
||||
* @return {React.Component} Power bands
|
||||
@@ -184,78 +201,27 @@ export default class PowerBands extends TranslatedComponent {
|
||||
return null;
|
||||
}
|
||||
|
||||
let { wattScale, pctScale, context, props, state } = this;
|
||||
let { pctScale, context, props, state } = this;
|
||||
let { translate, formats } = context.language;
|
||||
let { f2, pct1 } = formats; // wattFmt, pctFmt
|
||||
let { available, bands } = props;
|
||||
let { innerWidth, ret, dep } = state;
|
||||
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
|
||||
let deployed = [];
|
||||
let retracted = [];
|
||||
let { ship } = props;
|
||||
let { innerWidth, ret, dep, barHeight } = state;
|
||||
|
||||
let {
|
||||
consumed, generated, relativeConsumed, relativeConsumedRetracted
|
||||
} = ship.getMetrics(POWER_METRICS);
|
||||
let maxPwr = Math.max(consumed, generated);
|
||||
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
|
||||
let depSum = relativeConsumed[relativeConsumed.length - 1];
|
||||
|
||||
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
|
||||
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
|
||||
|
||||
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
|
||||
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
|
||||
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
|
||||
let retSelected = Object.keys(ret).length > 0;
|
||||
let depSelected = Object.keys(dep).length > 0;
|
||||
let retSum = 0;
|
||||
let depSum = 0;
|
||||
|
||||
for (let i = 0; i < bands.length; i++) {
|
||||
let b = bands[i];
|
||||
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
|
||||
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
|
||||
|
||||
if (b.retracted > 0) {
|
||||
let retLbl = bandText(b.retracted, i, wattScale);
|
||||
|
||||
retracted.push(<rect
|
||||
key={'rB' + i}
|
||||
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
|
||||
height={state.barHeight}
|
||||
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
|
||||
y={1}
|
||||
onClick={this._selectRet.bind(this, i)}
|
||||
className={getClass(ret[i], b.retractedSum, available)}
|
||||
/>);
|
||||
|
||||
if (retLbl) {
|
||||
retracted.push(<text
|
||||
key={'rT' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
|
||||
y={state.retY}
|
||||
onClick={this._selectRet.bind(this, i)}
|
||||
className='primary-bg'>{retLbl}</text>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
if (b.retracted > 0 || b.deployed > 0) {
|
||||
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
|
||||
|
||||
deployed.push(<rect
|
||||
key={'dB' + i}
|
||||
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
|
||||
height={state.barHeight}
|
||||
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
|
||||
y={state.barHeight + 1}
|
||||
onClick={this._selectDep.bind(this, i)}
|
||||
className={getClass(dep[i], b.deployedSum, available)}
|
||||
/>);
|
||||
|
||||
if (depLbl) {
|
||||
deployed.push(<text
|
||||
key={'dT' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
|
||||
y={state.depY}
|
||||
onClick={this._selectDep.bind(this, i)}
|
||||
className='primary-bg'>{depLbl}</text>
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return (
|
||||
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
|
||||
@@ -271,8 +237,8 @@ export default class PowerBands extends TranslatedComponent {
|
||||
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
|
||||
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
|
||||
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text>
|
||||
</g>
|
||||
</svg>
|
||||
);
|
||||
|
||||
@@ -3,24 +3,49 @@ import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import PowerBands from './PowerBands';
|
||||
import { slotName, slotComparator } from '../utils/SlotFunctions';
|
||||
import { Power, NoPower } from './SvgIcons';
|
||||
import autoBind from 'auto-bind';
|
||||
import { Ship, Module } from 'ed-forge';
|
||||
|
||||
const POWER = [
|
||||
null,
|
||||
null,
|
||||
<NoPower className='icon warning' />,
|
||||
<Power className='secondary-disabled' />
|
||||
];
|
||||
/**
|
||||
* Makes a comparison based on the order `false < undefined < true` (fut) and
|
||||
* maps it to `[-1, 0, 1]`.
|
||||
* @param {boolean} a Bool or undefined
|
||||
* @param {boolean} b Bool or undefined
|
||||
* @returns {number} Comparison
|
||||
*/
|
||||
function futComp(a, b) {
|
||||
switch (a) {
|
||||
case false: return (b === false ? 0 : 1);
|
||||
// The next else-expression maps false to -1 and true to 1
|
||||
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
|
||||
case true: return (b === true ? 0 : -1);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the enabled-icon.
|
||||
* @param {boolean} enabled Is the module enabled?
|
||||
* @returns {React.Component} Enabled icon.
|
||||
*/
|
||||
function getPowerIcon(enabled) {
|
||||
if (enabled === undefined) {
|
||||
return null;
|
||||
}
|
||||
if (enabled) {
|
||||
return <Power className='secondary-disabled' />;
|
||||
} else {
|
||||
return <NoPower className='icon warning' />;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Power Management Section
|
||||
*/
|
||||
export default class PowerManagement extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -29,19 +54,17 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._renderPowerRows = this._renderPowerRows.bind(this);
|
||||
this._updateWidth = this._updateWidth.bind(this);
|
||||
this._sort = this._sort.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
this.state = {
|
||||
predicate: 'pwr',
|
||||
desc: false,
|
||||
desc: true,
|
||||
width: 0
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the sort order and sort
|
||||
* Set the sort order
|
||||
* @param {string} predicate Sort predicate
|
||||
*/
|
||||
_sortOrder(predicate) {
|
||||
@@ -53,50 +76,51 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
desc = true;
|
||||
}
|
||||
|
||||
this._sort(this.props.ship, predicate, desc);
|
||||
this.setState({ predicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sorts the power list
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort order descending
|
||||
* @param {Module[]} modules Modules to sort
|
||||
* @returns {Module[]} Sorted modules
|
||||
*/
|
||||
_sort(ship, predicate, desc) {
|
||||
let powerList = ship.powerList;
|
||||
let comp = slotComparator.bind(null, this.context.language.translate);
|
||||
|
||||
_sortAndFilter(modules) {
|
||||
modules = modules.filter((m) => m.get('powerdraw') >= 0);
|
||||
let { translate } = this.context.language;
|
||||
const { predicate, desc } = this.state;
|
||||
let comp;
|
||||
switch (predicate) {
|
||||
case 'n': comp = comp(null, desc); break;
|
||||
case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
|
||||
case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break;
|
||||
case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break;
|
||||
case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break;
|
||||
case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break;
|
||||
case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare(
|
||||
translate(b.readMeta('type'))
|
||||
); break;
|
||||
// case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
|
||||
case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break;
|
||||
case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break;
|
||||
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
|
||||
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
|
||||
}
|
||||
|
||||
powerList.sort(comp);
|
||||
modules.sort(comp);
|
||||
if (desc) {
|
||||
modules.reverse();
|
||||
}
|
||||
return modules;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update slot priority
|
||||
* @param {Object} slot Slot model
|
||||
* @param {number} inc increment / decrement
|
||||
* Creates a callback that changes the power priority for the given module
|
||||
* based on the given delta.
|
||||
* @param {Module} m Module to set the priority for
|
||||
* @param {Number} delta Delta to set
|
||||
* @returns {Function} Callback
|
||||
*/
|
||||
_priority(slot, inc) {
|
||||
if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) {
|
||||
this.props.onChange();
|
||||
_prioCb(m, delta) {
|
||||
return () => {
|
||||
const prio = m.getPowerPriority();
|
||||
const newPrio = Math.max(0, prio + delta);
|
||||
if (0 <= newPrio) {
|
||||
m.setPowerPriority(newPrio);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle slot active/inactive
|
||||
* @param {Object} slot Slot model
|
||||
*/
|
||||
_toggleEnabled(slot) {
|
||||
this.props.ship.setSlotEnabled(slot, !slot.enabled);
|
||||
this.props.onChange();
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -110,54 +134,36 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
_renderPowerRows(ship, translate, pwr, pct) {
|
||||
let powerRows = [];
|
||||
|
||||
for (let i = 0, l = ship.powerList.length; i < l; i++) {
|
||||
let slot = ship.powerList[i];
|
||||
|
||||
if (slot.m && slot.m.getPowerUsage() > 0) {
|
||||
let m = slot.m;
|
||||
let toggleEnabled = this._toggleEnabled.bind(this, slot);
|
||||
let modules = this._sortAndFilter(ship.getModules());
|
||||
for (let m of modules) {
|
||||
let retractedElem = null, deployedElem = null;
|
||||
|
||||
if (slot.enabled) {
|
||||
retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>;
|
||||
deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>;
|
||||
const flipEnabled = () => m.setEnabled();
|
||||
if (m.isEnabled()) {
|
||||
let powered = m.isPowered();
|
||||
retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
|
||||
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
|
||||
} else {
|
||||
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>;
|
||||
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
|
||||
}
|
||||
|
||||
// If this is a Guardian Shield Reinforcement Package or Guardian Hull Reinforcement Package, or Guardian Module Reinforcement Package, it cannot change priority
|
||||
console.log(slot);
|
||||
let priorityField;
|
||||
if (m.symbol) {
|
||||
if (m.symbol.match(/GuardianShield/i) || m.symbol.match(/GuardianHull/i) || m.symbol.match(/GuardianModule/i)) {
|
||||
priorityField = <td>1</td>;
|
||||
} else {
|
||||
priorityField = <td>
|
||||
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>►</span>
|
||||
{' ' + (slot.priority + 1) + ' '}
|
||||
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>►</span>
|
||||
</td>;
|
||||
}
|
||||
}
|
||||
else {
|
||||
priorityField = <td>
|
||||
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>►</span>
|
||||
{' ' + (slot.priority + 1) + ' '}
|
||||
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>►</span>
|
||||
</td>;
|
||||
}
|
||||
powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td>
|
||||
<td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td>
|
||||
<td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td>
|
||||
{priorityField}
|
||||
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
|
||||
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
|
||||
const slot = m.getSlot();
|
||||
powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td>
|
||||
<td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td>
|
||||
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
|
||||
<td>
|
||||
<span className='flip ptr btn' onClick={this._prioCb(m, -1)}>►</span>
|
||||
{' ' + (m.getPowerPriority() + 1) + ' '}
|
||||
<span className='ptr btn' onClick={this._prioCb(m, 1)}>►</span>
|
||||
</td>
|
||||
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td>
|
||||
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
|
||||
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u>
|
||||
</td>
|
||||
{retractedElem}
|
||||
{deployedElem}
|
||||
</tr>);
|
||||
}
|
||||
}
|
||||
return powerRows;
|
||||
}
|
||||
|
||||
@@ -172,7 +178,6 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
* Add listeners when about to mount and sort power list
|
||||
*/
|
||||
componentWillMount() {
|
||||
this._sort(this.props.ship, this.state.predicate, this.state.desc);
|
||||
this.resizeListener = this.context.onWindowResize(this._updateWidth);
|
||||
}
|
||||
|
||||
@@ -183,17 +188,6 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
this._updateWidth();
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort power list if the ship instance has changed
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextState Incoming/Next state
|
||||
*/
|
||||
componentWillUpdate(nextProps, nextState) {
|
||||
if (this.props.ship != nextProps.ship) {
|
||||
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove listeners on unmount
|
||||
*/
|
||||
@@ -208,39 +202,38 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
render() {
|
||||
let { ship, code } = this.props;
|
||||
let { translate, formats } = this.context.language;
|
||||
let pwr = formats.f2;
|
||||
let pp = ship.standard[0].m;
|
||||
let sortOrder = this._sortOrder;
|
||||
let pp = ship.getPowerPlant();
|
||||
|
||||
return (
|
||||
<div ref={node => this.node = node} className='group half' id='componentPriority'>
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th>
|
||||
<th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th>
|
||||
<th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th>
|
||||
{/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */}
|
||||
<th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th>
|
||||
<th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{pp.class + pp.rating}</td>
|
||||
<td>{String(pp.getClass()) + pp.getRating()}</td>
|
||||
<td className='le shorten cap' >{translate('pp')}</td>
|
||||
<td><u >{translate('SYS')}</u></td>
|
||||
<td>1</td>
|
||||
<td className='ri'>{pwr(pp.getPowerGeneration())}</td>
|
||||
<td className='ri'>{formats.f2(pp.get('powercapacity'))}</td>
|
||||
<td className='ri'><u>100%</u></td>
|
||||
<td></td>
|
||||
<td></td>
|
||||
</tr>
|
||||
<tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr>
|
||||
{this._renderPowerRows(ship, translate, pwr, formats.pct1)}
|
||||
<tr><td style={{ lineHeight:0 }} colSpan='8'>
|
||||
<hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} />
|
||||
</td></tr>
|
||||
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
|
||||
</tbody>
|
||||
</table>
|
||||
<PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} />
|
||||
<PowerBands width={this.state.width} ship={ship} code={code} />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,10 +1,12 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { Rocket } from './SvgIcons';
|
||||
import Persist from '../stores/Persist';
|
||||
import cn from 'classnames';
|
||||
import { Factory, Ship } from 'ed-forge';
|
||||
import autoBind from 'auto-bind';
|
||||
import { isEqual } from 'lodash';
|
||||
|
||||
/**
|
||||
* Ship picker
|
||||
@@ -13,40 +15,49 @@ import cn from 'classnames';
|
||||
export default class ShipPicker extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
onChange: PropTypes.func.isRequired,
|
||||
ship: PropTypes.string.isRequired,
|
||||
build: PropTypes.string
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
};
|
||||
|
||||
static defaultProps = {
|
||||
ship: 'eagle'
|
||||
}
|
||||
|
||||
/**
|
||||
* constructor
|
||||
* @param {object} props Properties react
|
||||
* @param {object} context react context
|
||||
*/
|
||||
constructor(props, context) { // eslint-disable-line
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this.shipOrder = Object.keys(Ships).sort();
|
||||
this._toggleMenu = this._toggleMenu.bind(this);
|
||||
this._closeMenu = this._closeMenu.bind(this);
|
||||
|
||||
this.state = { menuOpen: false };
|
||||
autoBind(this);
|
||||
this.state = {
|
||||
menuOpen: false,
|
||||
opponent: {
|
||||
self: true,
|
||||
type: props.ship.getShipType(),
|
||||
stock: false,
|
||||
id: undefined,
|
||||
},
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update ship
|
||||
* @param {object} ship the ship
|
||||
* @param {string} build the build, if present
|
||||
* @param {boolean} self True to compare with ship itself
|
||||
* @param {object} type The ship type
|
||||
* @param {boolean} stock True to compare with a stock version of given type
|
||||
* @param {string} id The build's stored ID
|
||||
*/
|
||||
_shipChange(ship, build) {
|
||||
this._closeMenu();
|
||||
|
||||
// Ensure that the ship has changed
|
||||
if (ship !== this.props.ship || build !== this.props.build) {
|
||||
this.props.onChange(ship, build);
|
||||
_shipChange(self, type, stock = false, id = null) {
|
||||
const opponent = { self, type, stock, id };
|
||||
if (isEqual(opponent, this.state.opponent)) {
|
||||
this.setState({ menuOpen: false });
|
||||
} else {
|
||||
const { onChange } = this.props;
|
||||
if (self) {
|
||||
onChange(this.props.ship);
|
||||
} else if (stock) {
|
||||
onChange(Factory.newShip(type));
|
||||
} else {
|
||||
onChange(new Ship(Persist.getBuild(type, id)));
|
||||
}
|
||||
this.setState({ menuOpen: false, opponent });
|
||||
}
|
||||
}
|
||||
|
||||
@@ -55,26 +66,41 @@ export default class ShipPicker extends TranslatedComponent {
|
||||
* @returns {object} the picker menu
|
||||
*/
|
||||
_renderPickerMenu() {
|
||||
const { ship, build } = this.props;
|
||||
const _shipChange = this._shipChange;
|
||||
const builds = Persist.getBuilds();
|
||||
const buildList = [];
|
||||
for (let shipId of this.shipOrder) {
|
||||
const shipBuilds = [];
|
||||
// Add stock build
|
||||
const stockSelected = (ship == shipId && !build);
|
||||
shipBuilds.push(<li key={shipId} className={ cn({ 'selected': stockSelected })} onClick={_shipChange.bind(this, shipId, null)}>Stock</li>);
|
||||
if (builds[shipId]) {
|
||||
let buildNameOrder = Object.keys(builds[shipId]).sort();
|
||||
for (let buildName of buildNameOrder) {
|
||||
const buildSelected = ship === shipId && build === buildName;
|
||||
shipBuilds.push(<li key={shipId + '-' + buildName} className={ cn({ 'selected': buildSelected })} onClick={_shipChange.bind(this, shipId, buildName)}>{buildName}</li>);
|
||||
}
|
||||
}
|
||||
buildList.push(<ul key={shipId} className='block'>{Ships[shipId].properties.name}{shipBuilds}</ul>);
|
||||
const { menuOpen } = this.state;
|
||||
if (!menuOpen) {
|
||||
return null;
|
||||
}
|
||||
|
||||
return buildList;
|
||||
const { translate } = this.context.language;
|
||||
const { self, type, stock, id } = this.state.opponent;
|
||||
return <div className='menu-list' onClick={(e) => e.stopPropagation()}>
|
||||
<div className='quad'>
|
||||
{Factory.getAllShipTypes().sort().map((shipType) =>
|
||||
<ul key={shipType} className='block'>
|
||||
{translate(shipType)}
|
||||
{/* Add stock build */}
|
||||
<li key={shipType}
|
||||
onClick={this._shipChange.bind(this, false, shipType, true)}
|
||||
className={cn({ selected: stock && type === shipType })}>
|
||||
{translate('stock')}
|
||||
</li>
|
||||
{Persist.getBuildsNamesFor(shipType).sort().map((storedId) =>
|
||||
<li key={`${shipType}-${storedId}`}
|
||||
onClick={this._shipChange.bind(this, false, shipType, false, storedId)}
|
||||
className={ cn({ selected: type === shipType && id === storedId })}>
|
||||
{storedId}
|
||||
</li>)}
|
||||
{/* Add ship itself */}
|
||||
{(this.props.ship.getShipType() === shipType ?
|
||||
<li key='self'
|
||||
onClick={this._shipChange.bind(this, true, shipType)}
|
||||
className={cn({ selected: self })}>
|
||||
{translate('THIS_SHIP')}
|
||||
</li> :
|
||||
null)}
|
||||
</ul>)}
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -85,41 +111,36 @@ export default class ShipPicker extends TranslatedComponent {
|
||||
this.setState({ menuOpen: !menuOpen });
|
||||
}
|
||||
|
||||
/**
|
||||
* Close the menu
|
||||
*/
|
||||
_closeMenu() {
|
||||
const { menuOpen } = this.state;
|
||||
if (menuOpen) {
|
||||
this._toggleMenu();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Render picker
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship, build } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
const { ship } = this.props;
|
||||
const { menuOpen } = this.state;
|
||||
const { self, type, stock, id } = this.state.opponent;
|
||||
|
||||
let label;
|
||||
if (self) {
|
||||
label = translate('THIS_SHIP');
|
||||
} else if (stock) {
|
||||
label = translate('stock');
|
||||
} else {
|
||||
label = id;
|
||||
}
|
||||
|
||||
const shipString = ship + ': ' + (build ? build : translate('stock'));
|
||||
return (
|
||||
<div className='shippicker' onClick={ (e) => e.stopPropagation() }>
|
||||
<div className='menu'>
|
||||
<div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}>
|
||||
<span><Rocket className='warning' /></span>
|
||||
<span className='menu-item-label'>{shipString}</span>
|
||||
<span className='menu-item-label'>
|
||||
{`${translate(type)}: ${label}`}
|
||||
</span>
|
||||
</div>
|
||||
{ menuOpen ?
|
||||
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
|
||||
<div className='quad'>
|
||||
{this._renderPickerMenu()}
|
||||
</div>
|
||||
</div> : null }
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,21 +1,25 @@
|
||||
import autoBind from 'auto-bind';
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import { Warning } from './SvgIcons';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
|
||||
import { ShipProps } from 'ed-forge';
|
||||
import { BOOST_INTERVAL, MINIMUM_MASS } from 'ed-forge/lib/src/ship-stats';
|
||||
const {
|
||||
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
|
||||
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, LADEN_MASS,
|
||||
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
|
||||
} = ShipProps;
|
||||
|
||||
/**
|
||||
* Ship Summary Table / Stats
|
||||
*/
|
||||
export default class ShipSummaryTable extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired,
|
||||
pips: PropTypes.object.isRequired
|
||||
code: PropTypes.string.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -24,7 +28,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.didContextChange = this.didContextChange.bind(this);
|
||||
autoBind(this);
|
||||
this.state = {
|
||||
shieldColour: 'blue'
|
||||
};
|
||||
@@ -35,46 +39,53 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
* @return {React.Component} Summary table
|
||||
*/
|
||||
render() {
|
||||
const { ship, cargo, fuel, pips } = this.props;
|
||||
const { ship } = this.props;
|
||||
let { language, tooltip, termtip } = this.context;
|
||||
let translate = language.translate;
|
||||
let u = language.units;
|
||||
let formats = language.formats;
|
||||
let { time, int, round, f1, f2 } = formats;
|
||||
let { time, int, f1, f2 } = formats;
|
||||
let hide = tooltip.bind(null, null);
|
||||
const shieldGenerator = ship.findInternalByGroup('sg') || ship.findInternalByGroup('psg');
|
||||
const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator });
|
||||
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
|
||||
const timeToDrain = Calc.timeToDrainWep(ship, 4);
|
||||
const canThrust = ship.canThrust(cargo, ship.fuelCapacity);
|
||||
|
||||
const speed = ship.get(SPEED);
|
||||
const shipBoost = ship.get(BOOST_SPEED);
|
||||
const boostInterval = ship.get(BOOST_INTERVAL);
|
||||
const canThrust = 0 < speed;
|
||||
const canBoost = canThrust && !isNaN(shipBoost);
|
||||
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
|
||||
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
|
||||
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
|
||||
const canJump = ship.getSlotStatus(ship.standard[2]) == 3;
|
||||
const sgMetrics = Calc.shieldMetrics(ship, pips.sys);
|
||||
const distBoost = canBoost ? Calc.calcBoost(ship) : 'No Boost';
|
||||
//const shipBoost = ship.boostInterval(ship)
|
||||
const restingHeat = Math.sqrt(((ship.standard[0].m.pgen * ship.standard[0].m.eff) / ship.heatCapacity) / 0.2);
|
||||
const armourMetrics = Calc.armourMetrics(ship);
|
||||
|
||||
const sgMetrics = ship.get(SHIELD_METRICS);
|
||||
const armourMetrics = ship.get(ARMOUR_METRICS);
|
||||
const damageMetrics = ship.get(DAMAGE_METRICS);
|
||||
const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
|
||||
const timeToDrain = damageMetrics.timeToDrain;
|
||||
|
||||
const shieldGenerator = ship.getShieldGenerator();
|
||||
const sgClassNames = cn({
|
||||
warning: shieldGenerator && !shieldGenerator.isEnabled(),
|
||||
muted: !shieldGenerator,
|
||||
});
|
||||
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
|
||||
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined;
|
||||
let shieldColour = 'blue';
|
||||
if (shieldGenerator && shieldGenerator.m.grp === 'psg') {
|
||||
shieldColour = 'green';
|
||||
} else if (shieldGenerator && shieldGenerator.m.grp === 'bsg') {
|
||||
shieldColour = 'purple';
|
||||
switch (sgType) {
|
||||
case 'biweaveshieldgen': shieldColour = 'purple'; break;
|
||||
case 'prismaticshieldgen': shieldColour = 'green'; break;
|
||||
}
|
||||
this.state = {
|
||||
shieldColour
|
||||
};
|
||||
this.state = { shieldColour };
|
||||
|
||||
const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS);
|
||||
|
||||
return <div id='summary'>
|
||||
<div style={{display: "table", width: "100%"}}>
|
||||
<div style={{display: "table-row"}}>
|
||||
<div style={{ display: 'table', width: '100%' }}>
|
||||
<div style={{ display: 'table-row' }}>
|
||||
<table className={'summaryTable'}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVALS', { cap: 0 })}colSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost int')}</th>
|
||||
<th colSpan={5} className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('jump range')}</th>
|
||||
<th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRangeCurrent == 0 }) }>{translate('jump range')}</th>
|
||||
<th rowSpan={2}>{translate('shield')}</th>
|
||||
<th rowSpan={2}>{translate('integrity')}</th>
|
||||
<th rowSpan={2}>{translate('DPS')}</th>
|
||||
@@ -88,16 +99,16 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
<th onMouseEnter={termtip.bind(null, 'hull hardness', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('hrd')}</th>
|
||||
<th rowSpan={2}>{translate('crew')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
|
||||
<th rowSpan={2}>{translate('resting heat (Beta)')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th>
|
||||
{/* TODO: Resting heat */}
|
||||
{/* <th rowSpan={2}>{translate('resting heat (Beta)')}</th> */}
|
||||
</tr>
|
||||
<tr>
|
||||
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide}>{translate('distro')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_SHIP_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide}>{translate('ship')}</th>
|
||||
<th className={ cn({ 'lft': true, 'bg-warning-disabled': !canJump }) }>{translate('max')}</th>
|
||||
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('unladen')}</th>
|
||||
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('laden')}</th>
|
||||
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total unladen')}</th>
|
||||
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total laden')}</th>
|
||||
<th className="lft">{translate('max')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
<th>{translate('total unladen')}</th>
|
||||
<th>{translate('total laden')}</th>
|
||||
<th className='lft'>{translate('hull')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
@@ -105,31 +116,68 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td>{distBoost !== 'No Boost' ? formats.time(distBoost) : 'No Boost'}</td>
|
||||
<td>{ship.boostInt && ship.boostInt !== 'undefined' ? formats.time(ship.boostInt) : 0 }</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{ f2(Calc.jumpRange(ship.unladenMass + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump(), ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canThrust ?
|
||||
<span>{int(speed)}{u['m/s']}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canBoost ?
|
||||
<span>{int(shipBoost)}{u['m/s']}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{<span>{f2(jumpRangeMetrics.jumpRangeMax)}{u.LY}</span>}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{<span>{f2(jumpRangeMetrics.jumpRangeUnladen)}{u.LY}</span>}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{<span>{f2(jumpRangeMetrics.jumpRangeLaden)}{u.LY}</span>}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{<span>{f2(jumpRangeMetrics.totalRangeUnladen)}{u.LY}</span>}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{<span>{f2(jumpRangeMetrics.totalRangeLaden)}{u.LY}</span>}</td>
|
||||
<td className={sgClassNames}
|
||||
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(armourMetrics.armour)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{f1(damageMetrics.dps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{f1(damageMetrics.eps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
|
||||
{/* <td>{f1(ship.totalHps)}</td> */}
|
||||
<td>{round(ship.cargoCapacity)}{u.T}</td>
|
||||
<td>{ship.passengerCapacity}</td>
|
||||
<td>{round(ship.fuelCapacity)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td>
|
||||
<td>{int(ship.hardness)}</td>
|
||||
<td>{ship.crew}</td>
|
||||
<td>{ship.masslock}</td>
|
||||
<td>{formats.pct(restingHeat)}</td>
|
||||
<td>{ship.get(CARGO_CAPACITY)}{u.T}</td>
|
||||
<td>{ship.get(PASSENGER_CAPACITY)}</td>
|
||||
<td>{ship.get(FUEL_CAPACITY)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{ship.readProp('hullmass')}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(ship.get(MINIMUM_MASS))}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(ship.get(LADEN_MASS))}{u.T}</td>
|
||||
<td>{int(ship.readProp('hardness'))}</td>
|
||||
<td>{ship.readMeta('crew')}</td>
|
||||
<td>{ship.readProp('masslock')}</td>
|
||||
<td>{time(boostInterval)}</td>
|
||||
{/* TODO: resting heat */}
|
||||
{/* <td>{NaN}</td> */}
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -158,19 +206,19 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{translate(shieldGenerator && shieldGenerator.m.grp || 'No Shield')}</td>
|
||||
<td>{formats.pct1(ship.shieldExplRes)}</td>
|
||||
<td>{formats.pct1(ship.shieldKinRes)}</td>
|
||||
<td>{formats.pct1(ship.shieldThermRes)}</td>
|
||||
<td>{translate(sgType || 'No Shield')}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td>
|
||||
<td></td>
|
||||
|
||||
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary : 0)}{u.MJ}</td>
|
||||
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary / sgMetrics.explosive.base : 0)}{u.MJ}</td>
|
||||
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.kinetic.base : 0)}{u.MJ}</td>
|
||||
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.thermal.base : 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td></td>
|
||||
<td>{sgMetrics && sgMetrics.recover === Math.Inf ? translate('Never') : formats.time(sgMetrics.recover)}</td>
|
||||
<td>{sgMetrics && sgMetrics.recharge === Math.Inf ? translate('Never') : formats.time(sgMetrics.recharge)}</td>
|
||||
<td>{isNaN(sgMetrics.recover) ? translate('Never') : formats.time(sgMetrics.recover)}</td>
|
||||
<td>{isNaN(sgMetrics.recharge) ? translate('Never') : formats.time(sgMetrics.recharge)}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
<thead>
|
||||
@@ -197,19 +245,18 @@ export default class ShipSummaryTable extends TranslatedComponent {
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{translate(ship && ship.bulkheads && ship.bulkheads.m && ship.bulkheads.m.name || 'No Armour')}</td>
|
||||
<td>{formats.pct1(ship.hullExplRes)}</td>
|
||||
<td>{formats.pct1(ship.hullKinRes)}</td>
|
||||
<td>{formats.pct1(ship.hullThermRes)}</td>
|
||||
<td>{formats.pct1(ship.hullCausRes)}</td>
|
||||
<td>{int(armourMetrics.total)}</td>
|
||||
<td>{int(armourMetrics.total / armourMetrics.explosive.total)}</td>
|
||||
<td>{int(armourMetrics.total/ armourMetrics.kinetic.total)}</td>
|
||||
<td>{int(armourMetrics.total / armourMetrics.thermal.total)}</td>
|
||||
<td>{int(armourMetrics.total/ armourMetrics.caustic.total)}</td>
|
||||
<td>{int(armourMetrics.modulearmour)}</td>
|
||||
<td>{int(armourMetrics.moduleprotection * 100) + '%'}</td>
|
||||
|
||||
<td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td>
|
||||
<td>{int(moduleProtectionMetrics.moduleArmour)}</td>
|
||||
<td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
const MARGIN_LR = 8; // Left/ Right margin
|
||||
|
||||
@@ -7,7 +8,6 @@ const MARGIN_LR = 8; // Left/ Right margin
|
||||
* Horizontal Slider
|
||||
*/
|
||||
export default class Slider extends React.Component {
|
||||
|
||||
static defaultProps = {
|
||||
axis: false,
|
||||
min: 0,
|
||||
@@ -32,16 +32,7 @@ export default class Slider extends React.Component {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._down = this._down.bind(this);
|
||||
this._move = this._move.bind(this);
|
||||
this._up = this._up.bind(this);
|
||||
this._keyup = this._keyup.bind(this);
|
||||
this._keydown = this._keydown.bind(this);
|
||||
this._touchstart = this._touchstart.bind(this);
|
||||
this._touchend = this._touchend.bind(this);
|
||||
|
||||
this._updatePercent = this._updatePercent.bind(this);
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
this.state = { width: 0 };
|
||||
}
|
||||
@@ -55,7 +46,6 @@ export default class Slider extends React.Component {
|
||||
this.left = rect.left;
|
||||
this.width = rect.width;
|
||||
this._move(event);
|
||||
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -75,70 +65,11 @@ export default class Slider extends React.Component {
|
||||
* @param {Event} event DOM Event
|
||||
*/
|
||||
_up(event) {
|
||||
this.sliderInputBox.sliderVal.focus();
|
||||
clearTimeout(this.touchStartTimer);
|
||||
event.preventDefault();
|
||||
this.left = null;
|
||||
this.width = null;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Key up handler for keyboard.
|
||||
* display the number field then set focus to it
|
||||
* when "Enter" key is pressed
|
||||
* @param {Event} event Keyboard event
|
||||
*/
|
||||
_keyup(event) {
|
||||
switch (event.key) {
|
||||
case 'Enter':
|
||||
event.preventDefault();
|
||||
this.sliderInputBox._setDisplay('block');
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Key down handler
|
||||
* increment slider position by +/- 1 when right/left arrow key is pressed or held
|
||||
* @param {Event} event Keyboard even
|
||||
*/
|
||||
_keydown(event) {
|
||||
let newVal = this.props.percent * this.props.max;
|
||||
switch (event.key) {
|
||||
case 'ArrowRight':
|
||||
newVal += 1;
|
||||
if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
|
||||
return;
|
||||
case 'ArrowLeft':
|
||||
newVal -= 1;
|
||||
if (newVal >= 0) this.props.onChange(newVal / this.props.max);
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Touch start handler
|
||||
* @param {Event} event DOM Event
|
||||
*
|
||||
*/
|
||||
_touchstart(event) {
|
||||
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
|
||||
}
|
||||
|
||||
/**
|
||||
* Touch end handler
|
||||
* @param {Event} event DOM Event
|
||||
*
|
||||
*/
|
||||
_touchend(event) {
|
||||
this.sliderInputBox.sliderVal.focus();
|
||||
clearTimeout(this.touchStartTimer);
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if the user is still dragging
|
||||
* @param {SyntheticEvent} event Event
|
||||
@@ -213,7 +144,7 @@ export default class Slider extends React.Component {
|
||||
let width = outerWidth - (margin * 2);
|
||||
let pctPos = width * this.props.percent;
|
||||
return <div><svg
|
||||
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0">
|
||||
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} style={style} ref={node => this.node = node} tabIndex="0">
|
||||
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
|
||||
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
|
||||
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
|
||||
@@ -224,163 +155,6 @@ export default class Slider extends React.Component {
|
||||
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
|
||||
</g>}
|
||||
</svg>
|
||||
<TextInputBox ref={(tb) => this.sliderInputBox = tb}
|
||||
onChange={this.props.onChange}
|
||||
percent={this.props.percent}
|
||||
axisUnit={this.props.axisUnit}
|
||||
scale={this.props.scale}
|
||||
max={this.props.max}
|
||||
/>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
|
||||
**/
|
||||
class TextInputBox extends React.Component {
|
||||
static propTypes = {
|
||||
axisUnit: PropTypes.string,// units (T, M, etc.)
|
||||
max: PropTypes.number,
|
||||
onChange: PropTypes.func.isRequired,// function which determins percent value
|
||||
percent: PropTypes.number.isRequired,// value of slider
|
||||
scale: PropTypes.number
|
||||
};
|
||||
/**
|
||||
* Determine if the user is still dragging
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._handleFocus = this._handleFocus.bind(this);
|
||||
this._handleBlur = this._handleBlur.bind(this);
|
||||
this._handleChange = this._handleChange.bind(this);
|
||||
this._keyup = this._keyup.bind(this);
|
||||
this.state = this._getInitialState();
|
||||
}
|
||||
/**
|
||||
* Update input value if slider changes will change props/state
|
||||
* @param {Object} nextProps React Component properites
|
||||
* @param {Object} nextState React Component state values
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextState) {
|
||||
let nextValue = nextProps.percent * nextProps.max;
|
||||
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
|
||||
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
|
||||
this.setState({ inputValue: nextValue });
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Update slider textbox visibility/values if changes are made to slider
|
||||
* @param {Object} prevProps React Component properites
|
||||
* @param {Object} prevState React Component state values
|
||||
*/
|
||||
componentDidUpdate(prevProps, prevState) {
|
||||
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
|
||||
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
|
||||
}
|
||||
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
|
||||
// they chose a different module
|
||||
this.setState({ inputValue: this.props.max });
|
||||
}
|
||||
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
|
||||
this.props.onChange(this.state.inputValue / this.props.max);
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Set initial state for the textbox.
|
||||
* We may want to rethink this to
|
||||
* try and make it a stateless component
|
||||
* @returns {object} React state object with initial values set
|
||||
*/
|
||||
_getInitialState() {
|
||||
return {
|
||||
divStyle: { display:'none' },
|
||||
inputStyle: { width:'4em' },
|
||||
labelStyle: { marginLeft: '.1em' },
|
||||
maxLength:5,
|
||||
size:5,
|
||||
min:0,
|
||||
tabIndex:-1,
|
||||
type:'number',
|
||||
readOnly: true,
|
||||
inputValue: this.props.percent * this.props.max
|
||||
};
|
||||
}
|
||||
/**
|
||||
*
|
||||
* @param {string} val block or none
|
||||
*/
|
||||
_setDisplay(val) {
|
||||
this.setState({
|
||||
divStyle: { display:val }
|
||||
});
|
||||
}
|
||||
/**
|
||||
* Update the input value
|
||||
* when textbox gets focus
|
||||
*/
|
||||
_handleFocus() {
|
||||
this.setState({
|
||||
inputValue:this._getValue()
|
||||
});
|
||||
}
|
||||
/**
|
||||
* Update inputValue when textbox loses focus
|
||||
*/
|
||||
_handleBlur() {
|
||||
this._setDisplay('none');
|
||||
if (this.state.inputValue !== '') {
|
||||
this.props.onChange(this.state.inputValue / this.props.max);
|
||||
} else {
|
||||
this.setState({
|
||||
inputValue: this.props.percent * this.props.max
|
||||
});
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Get the value in the text box
|
||||
* @returns {number} inputValue Value of the input box
|
||||
*/
|
||||
_getValue() {
|
||||
return this.state.inputValue;
|
||||
}
|
||||
/**
|
||||
* Update and set limits on input box
|
||||
* values depending on what user
|
||||
* has selected
|
||||
*
|
||||
* @param {SyntheticEvent} event ReactJs onChange event
|
||||
*/
|
||||
_handleChange(event) {
|
||||
if (event.target.value < 0) {
|
||||
this.setState({ inputValue: 0 });
|
||||
} else if (event.target.value <= this.props.max) {
|
||||
this.setState({ inputValue: event.target.value });
|
||||
} else {
|
||||
this.setState({ inputValue: this.props.max });
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Key up handler for input field.
|
||||
* If user hits Enter key, blur/close the input field
|
||||
* @param {Event} event Keyboard event
|
||||
*/
|
||||
_keyup(event) {
|
||||
switch (event.key) {
|
||||
case 'Enter':
|
||||
this.sliderVal.blur();
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Get the value in the text box
|
||||
* @return {React.Component} Text Input component for Slider
|
||||
*/
|
||||
render() {
|
||||
let { axisUnit, onChange, percent, scale } = this.props;
|
||||
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -2,30 +2,37 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import AvailableModulesMenu from './AvailableModulesMenu';
|
||||
import ModificationsMenu from './ModificationsMenu';
|
||||
import { diffDetails } from '../utils/SlotFunctions';
|
||||
import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
import { Module } from 'ed-forge';
|
||||
import { TYPES } from 'ed-forge/lib/src/data/slots';
|
||||
import autoBind from 'auto-bind';
|
||||
import { toPairs } from 'lodash';
|
||||
|
||||
const HARDPOINT_SLOT_LABELS = {
|
||||
1: 'S',
|
||||
2: 'M',
|
||||
3: 'L',
|
||||
4: 'H',
|
||||
};
|
||||
|
||||
/**
|
||||
* Abstract Slot
|
||||
*/
|
||||
export default class Slot extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
availableModules: PropTypes.func.isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
onOpen: PropTypes.func.isRequired,
|
||||
maxClass: PropTypes.number.isRequired,
|
||||
selected: PropTypes.bool,
|
||||
m: PropTypes.object,
|
||||
enabled: PropTypes.bool.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
eligible: PropTypes.object,
|
||||
currentMenu: PropTypes.any,
|
||||
hideSearch: PropTypes.bool,
|
||||
m: PropTypes.instanceOf(Module),
|
||||
warning: PropTypes.func,
|
||||
drag: PropTypes.func,
|
||||
drop: PropTypes.func,
|
||||
dropClass: PropTypes.string
|
||||
dropClass: PropTypes.string,
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -34,25 +41,122 @@ export default class Slot extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
this._modificationsSelected = false;
|
||||
|
||||
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
|
||||
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this.slotDiv = null;
|
||||
autoBind(this);
|
||||
this.state = { menuIndex: 0 };
|
||||
}
|
||||
|
||||
// Must be implemented by subclasses:
|
||||
// _getSlotDetails()
|
||||
/**
|
||||
* Opens a menu while setting state.
|
||||
* @param {Object} newMenuIndex New menu index
|
||||
* @param {Event} event Event object
|
||||
*/
|
||||
_openMenu(newMenuIndex, event) {
|
||||
const slotName = this.props.m.getSlot();
|
||||
if (
|
||||
this.props.currentMenu === slotName &&
|
||||
newMenuIndex === this.state.menuIndex
|
||||
) {
|
||||
this.context.closeMenu();
|
||||
} {
|
||||
this.setState({ menuIndex: newMenuIndex });
|
||||
this.context.openMenu(slotName);
|
||||
}
|
||||
// If we don't stop event propagation, the underlying divs also might
|
||||
// get clicked which would open up other menus
|
||||
event.stopPropagation();
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the CSS class name for the slot. Can/should be overriden
|
||||
* as necessary.
|
||||
* @return {string} CSS Class name
|
||||
* Generate the slot contents
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getClassNames() {
|
||||
_getSlotDetails() {
|
||||
const { m, propsToShow } = this.props;
|
||||
let { termtip, tooltip, language } = this.context;
|
||||
const { translate, units, formats } = language;
|
||||
|
||||
if (m.isEmpty()) {
|
||||
return <div className="empty">
|
||||
{translate(
|
||||
m.isOnSlot(TYPES.MILITARY) ? 'emptyrestricted' : 'empty'
|
||||
)}
|
||||
</div>;
|
||||
} else {
|
||||
let classRating = m.getClassRating();
|
||||
let { drag, drop } = this.props;
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
const blueprint = m.getBlueprint();
|
||||
const experimental = m.getExperimental();
|
||||
const grade = m.getBlueprintGrade();
|
||||
if (blueprint) {
|
||||
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
|
||||
if (experimental) {
|
||||
modTT += `, ${translate(experimental)}`;
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(language, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
|
||||
return (
|
||||
<div
|
||||
className={cn('details', { disabled: !m.isEnabled() })}
|
||||
draggable="true"
|
||||
onDragStart={drag}
|
||||
onDragEnd={drop}
|
||||
>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>
|
||||
{classRating} {translate(m.readMeta('type'))}
|
||||
{blueprint && (
|
||||
<span
|
||||
onMouseOver={termtip.bind(null, modTT)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<Modified />
|
||||
</span>
|
||||
)}
|
||||
</div>
|
||||
{propsToShow.mass ?
|
||||
<div className={'r'}>
|
||||
{formats.round(mass)}
|
||||
{units.T}
|
||||
</div> : null}
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{toPairs(propsToShow).sort().map(([prop, show]) => {
|
||||
const { unit, value } = m.getFormatted(prop, true);
|
||||
// Don't show mass again; it's already shown on the top right
|
||||
// corner of a slot
|
||||
if (!show || isNaN(value) || prop == 'mass') {
|
||||
return null;
|
||||
} else {
|
||||
return (<div className='l'>
|
||||
{translate(prop)}: {formats.round(value)}{unit}
|
||||
</div>);
|
||||
}
|
||||
})}
|
||||
{(m.getApplicableBlueprints() || []).length > 0 ? (
|
||||
<div className="r">
|
||||
<button onClick={this._openMenu.bind(this, 1)}
|
||||
onContextMenu={stopCtxPropagation}
|
||||
onMouseOver={termtip.bind(null, translate('modifications'))}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<ListModifications />
|
||||
</button>
|
||||
</div>
|
||||
) : null}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -61,7 +165,19 @@ export default class Slot extends TranslatedComponent {
|
||||
* @return {string} label
|
||||
*/
|
||||
_getMaxClassLabel() {
|
||||
return this.props.maxClass;
|
||||
const { m } = this.props;
|
||||
let size = m.getSizeNum();
|
||||
switch (true) {
|
||||
case m.getSlot() === 'armour':
|
||||
return '';
|
||||
case size === 0:
|
||||
// This can also happen for armour but that case was handled above
|
||||
return 'U';
|
||||
case m.isOnSlot(TYPES.HARDPOINT):
|
||||
return HARDPOINT_SLOT_LABELS[size];
|
||||
default:
|
||||
return size;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -71,25 +187,15 @@ export default class Slot extends TranslatedComponent {
|
||||
_contextMenu(event) {
|
||||
event.stopPropagation();
|
||||
event.preventDefault();
|
||||
this.props.onSelect(null,null);
|
||||
const { m } = this.props;
|
||||
m.reset();
|
||||
if (this.props.currentMenu === m.getSlot()) {
|
||||
this.context.closeMenu();
|
||||
} else {
|
||||
this.forceUpdate();
|
||||
}
|
||||
}
|
||||
|
||||
/** Key Down handler
|
||||
* @param {SyntheticEvent} event Event
|
||||
* ToDo: see if this can be moved up
|
||||
* we do more or less the same thing
|
||||
* in every section when Enter key is pressed
|
||||
* on a focusable item
|
||||
*
|
||||
*/
|
||||
_keyDown(event) {
|
||||
if (event.key == 'Enter') {
|
||||
if(event.target.className == 'r') {
|
||||
this._toggleModifications();
|
||||
}
|
||||
this.props.onOpen(event);
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Render the slot
|
||||
* @return {React.Component} The slot
|
||||
@@ -97,73 +203,41 @@ export default class Slot extends TranslatedComponent {
|
||||
render() {
|
||||
let language = this.context.language;
|
||||
let translate = language.translate;
|
||||
let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props;
|
||||
let slotDetails, modificationsMarker, menu;
|
||||
let missing = false;
|
||||
|
||||
if (!selected) {
|
||||
// If not selected then sure that modifications flag is unset
|
||||
this._modificationsSelected = false;
|
||||
}
|
||||
|
||||
if (m) {
|
||||
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
|
||||
modificationsMarker = JSON.stringify(m);
|
||||
if(typeof m.grp !== 'undefined' || m.grp !== null) {
|
||||
if(m.grp == "mh" || m.grp == "mm") {
|
||||
missing = true;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
|
||||
modificationsMarker = '';
|
||||
}
|
||||
|
||||
if (selected) {
|
||||
if (this._modificationsSelected) {
|
||||
menu = <ModificationsMenu
|
||||
className={this._getClassNames()}
|
||||
onChange={onChange}
|
||||
ship={ship}
|
||||
m={m}
|
||||
marker={modificationsMarker}
|
||||
modButton = {this.modButton}
|
||||
/>;
|
||||
} else {
|
||||
menu = <AvailableModulesMenu
|
||||
className={this._getClassNames()}
|
||||
modules={availableModules()}
|
||||
m={m}
|
||||
ship={ship}
|
||||
onSelect={onSelect}
|
||||
warning={warning}
|
||||
diffDetails={diffDetails.bind(ship, this.context.language)}
|
||||
slotDiv = {this.slotDiv}
|
||||
/>;
|
||||
}
|
||||
}
|
||||
let {
|
||||
currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow,
|
||||
onPropToggle,
|
||||
} = this.props;
|
||||
const { menuIndex } = this.state;
|
||||
|
||||
// TODO: implement touch dragging
|
||||
|
||||
const selected = currentMenu === m.getSlot();
|
||||
return (
|
||||
<div className={cn('slot', dropClass, { selected })} onClick={onOpen} onKeyDown={this._keyDown} onContextMenu={this._contextMenu} onDragOver={dragOver} tabIndex="0" ref={slotDiv => this.slotDiv = slotDiv}>
|
||||
{
|
||||
// If missing module/hardpoint, set the div container to warning status.
|
||||
}
|
||||
<div className={ missing === true ? 'details-container warning' : 'details-container'}>
|
||||
<div className='sz'>{this._getMaxClassLabel(translate)}</div>
|
||||
{slotDetails}
|
||||
<div
|
||||
className={cn('slot', dropClass, { selected })}
|
||||
onContextMenu={this._contextMenu}
|
||||
onDragOver={dragOver} tabIndex="0"
|
||||
onClick={this._openMenu.bind(this, 0)}
|
||||
>
|
||||
<div className={cn(
|
||||
'details-container',
|
||||
{ warning: warning && warning(m) },
|
||||
)}>
|
||||
<div className="sz">{this._getMaxClassLabel(translate)}</div>
|
||||
{this._getSlotDetails()}
|
||||
</div>
|
||||
{menu}
|
||||
{selected && menuIndex === 0 &&
|
||||
<AvailableModulesMenu
|
||||
m={m} hideSearch={hideSearch}
|
||||
onSelect={(item) => {
|
||||
m.setItem(item);
|
||||
this.context.closeMenu();
|
||||
}}
|
||||
warning={warning}
|
||||
/>}
|
||||
{selected && menuIndex === 1 &&
|
||||
<ModificationsMenu m={m} propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle} />}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Toggle the modifications flag when selecting the modifications icon
|
||||
*/
|
||||
_toggleModifications() {
|
||||
this._modificationsSelected = !this._modificationsSelected;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,50 +2,35 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { canMount } from '../utils/SlotFunctions';
|
||||
import { Equalizer } from '../components/SvgIcons';
|
||||
import cn from 'classnames';
|
||||
import { Ship } from 'ed-forge';
|
||||
import autoBind from 'auto-bind';
|
||||
const browser = require('detect-browser');
|
||||
|
||||
/**
|
||||
* Abstract Slot Section
|
||||
*/
|
||||
export default class SlotSection extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
onCargoChange: PropTypes.func.isRequired,
|
||||
onFuelChange: PropTypes.func.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship),
|
||||
code: PropTypes.string.isRequired,
|
||||
togglePwr: PropTypes.func,
|
||||
sectionMenuRefs: PropTypes.object
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
* @param {string} sectionId Section DOM Id
|
||||
* @param {string} sectionName Section name
|
||||
*/
|
||||
constructor(props, context, sectionId, sectionName) {
|
||||
constructor(props, sectionName) {
|
||||
super(props);
|
||||
this.sectionId = sectionId;
|
||||
this.sectionName = sectionName;
|
||||
this.ssHeadRef = null;
|
||||
autoBind(this);
|
||||
|
||||
this.sectionName = sectionName;
|
||||
|
||||
this.sectionRefArr = this.props.sectionMenuRefs[this.sectionId] = [];
|
||||
this.sectionRefArr['selectedRef'] = null;
|
||||
this._getSlots = this._getSlots.bind(this);
|
||||
this._selectModule = this._selectModule.bind(this);
|
||||
this._getSectionMenu = this._getSectionMenu.bind(this);
|
||||
this._contextMenu = this._contextMenu.bind(this);
|
||||
this._drop = this._drop.bind(this);
|
||||
this._dragOverNone = this._dragOverNone.bind(this);
|
||||
this._close = this._close.bind(this);
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this._handleSectionFocus = this._handleSectionFocus.bind(this);
|
||||
this.state = {};
|
||||
}
|
||||
|
||||
@@ -55,82 +40,6 @@ export default class SlotSection extends TranslatedComponent {
|
||||
// _contextMenu()
|
||||
// componentDidUpdate(prevProps)
|
||||
|
||||
/**
|
||||
* TODO: May either need to send the function to be triggered when Enter key is pressed, or else
|
||||
* may need a separate keyDown handler for each subclass (StandardSlotSection, HardpointSlotSection, etc.)
|
||||
* ex: _keyDown(_keyDownfn, event)
|
||||
*
|
||||
* @param {SyntheticEvent} event KeyDown event
|
||||
*/
|
||||
_keyDown(event) {
|
||||
if (event.key == 'Enter') {
|
||||
event.stopPropagation();
|
||||
if (event.currentTarget.nodeName === 'H1') {
|
||||
this._openMenu(this.sectionName, event);
|
||||
} else {
|
||||
event.currentTarget.click();
|
||||
}
|
||||
return;
|
||||
}
|
||||
if (event.key == 'Tab') {
|
||||
if (event.shiftKey) {
|
||||
if ((event.currentTarget === this.sectionRefArr[this.firstRefId]) && this.sectionRefArr[this.lastRefId]) {
|
||||
event.preventDefault();
|
||||
this.sectionRefArr[this.lastRefId].focus();
|
||||
}
|
||||
} else {
|
||||
if ((event.currentTarget === this.sectionRefArr[this.lastRefId]) && this.sectionRefArr[this.firstRefId]) {
|
||||
event.preventDefault();
|
||||
this.sectionRefArr[this.firstRefId].focus();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Set focus on appropriate Slot Section Menu element
|
||||
* @param {Object} focusPrevProps prevProps for componentDidUpdate() from ...SlotSection.jsx
|
||||
* @param {String} firstRef id of the first ref in ...SlotSection.jsx
|
||||
* @param {String} lastRef id of the last ref in ...SlotSection.jsx
|
||||
*
|
||||
*/
|
||||
_handleSectionFocus(focusPrevProps, firstRef, lastRef) {
|
||||
if (this.selectedRefId !== null && this.sectionRefArr[this.selectedRefId]) {
|
||||
// set focus on the previously selected option for the currently open section menu
|
||||
this.sectionRefArr[this.selectedRefId].focus();
|
||||
} else if (this.sectionRefArr[firstRef] && this.sectionRefArr[firstRef] != null) {
|
||||
// set focus on the first option in the currently open section menu if none have been selected previously
|
||||
this.sectionRefArr[firstRef].focus();
|
||||
} else if (this.props.currentMenu == null && focusPrevProps.currentMenu == this.sectionName && this.sectionRefArr['ssHeadRef']) {
|
||||
// set focus on the section menu header when section menu is closed
|
||||
this.sectionRefArr['ssHeadRef'].focus();
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Open a menu
|
||||
* @param {string} menu Menu name
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_openMenu(menu, event) {
|
||||
event.preventDefault();
|
||||
event.stopPropagation();
|
||||
if (this.props.currentMenu === menu) {
|
||||
menu = null;
|
||||
}
|
||||
this.context.openMenu(menu);
|
||||
}
|
||||
|
||||
/**
|
||||
* Mount/Use the specified module in the slot
|
||||
* @param {Object} slot Slot
|
||||
* @param {Object} m Selected module
|
||||
*/
|
||||
_selectModule(slot, m) {
|
||||
this.props.ship.use(slot, m, false);
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Slot Drag Handler
|
||||
* @param {object} originSlot Origin slot model
|
||||
@@ -207,7 +116,6 @@ export default class SlotSection extends TranslatedComponent {
|
||||
// Copy power info
|
||||
targetSlot.enabled = originSlot.enabled;
|
||||
targetSlot.priority = originSlot.priority;
|
||||
this.props.onChange();
|
||||
}
|
||||
} else {
|
||||
// Store power info
|
||||
@@ -236,7 +144,6 @@ export default class SlotSection extends TranslatedComponent {
|
||||
targetSlot.enabled = targetEnabled;
|
||||
targetSlot.priority = targetPriority;
|
||||
}
|
||||
this.props.onChange();
|
||||
this.props.ship
|
||||
.updatePowerGenerated()
|
||||
.updatePowerUsed()
|
||||
@@ -282,6 +189,17 @@ export default class SlotSection extends TranslatedComponent {
|
||||
return 'ineligible'; // Cannot be dropped / invalid drop slot
|
||||
}
|
||||
|
||||
_open(newMenu, event) {
|
||||
event.preventDefault();
|
||||
event.stopPropagation();
|
||||
const { currentMenu } = this.props;
|
||||
if (currentMenu === newMenu) {
|
||||
this.context.closeMenu();
|
||||
} else {
|
||||
this.context.openMenu(newMenu);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Close current menu
|
||||
*/
|
||||
@@ -298,14 +216,13 @@ export default class SlotSection extends TranslatedComponent {
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
let sectionMenuOpened = this.props.currentMenu === this.sectionName;
|
||||
let open = this._openMenu.bind(this, this.sectionName);
|
||||
let ctx = wrapCtxMenu(this._contextMenu);
|
||||
|
||||
return (
|
||||
<div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}>
|
||||
<div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}>
|
||||
<h1 tabIndex="0" onKeyDown={this._keyDown} ref={ssHead => this.sectionRefArr['ssHeadRef'] = ssHead}>{translate(this.sectionName)} <Equalizer/></h1>
|
||||
{sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null }
|
||||
<div className="group" onDragLeave={this._dragOverNone}>
|
||||
<div className={cn('section-menu', { selected: sectionMenuOpened })}
|
||||
onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}>
|
||||
<h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1>
|
||||
{sectionMenuOpened && this._getSectionMenu()}
|
||||
</div>
|
||||
{this._getSlots()}
|
||||
</div>
|
||||
|
||||
@@ -1,168 +0,0 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import Persist from '../stores/Persist';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { diffDetails } from '../utils/SlotFunctions';
|
||||
import AvailableModulesMenu from './AvailableModulesMenu';
|
||||
import ModificationsMenu from './ModificationsMenu';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
/**
|
||||
* Standard Slot
|
||||
*/
|
||||
export default class StandardSlot extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
slot: PropTypes.object,
|
||||
modules: PropTypes.array.isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
onOpen: PropTypes.func.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
selected: PropTypes.bool,
|
||||
warning: PropTypes.func,
|
||||
};
|
||||
|
||||
/**
|
||||
* Construct the slot
|
||||
* @param {object} props Object properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._modificationsSelected = false;
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this.modButton = null;
|
||||
this.slotDiv = null;
|
||||
}
|
||||
/**
|
||||
* Handle Enter key
|
||||
* @param {SyntheticEvent} event KeyDown event
|
||||
*/
|
||||
_keyDown(event) {
|
||||
if (event.key == 'Enter') {
|
||||
if(event.target.className == 'r') {
|
||||
this._toggleModifications();
|
||||
}
|
||||
this.props.onOpen(event);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the slot
|
||||
* @return {React.Component} Slot component
|
||||
*/
|
||||
render() {
|
||||
let { termtip, tooltip } = this.context;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
|
||||
let m = slot.m;
|
||||
let classRating = m.class + m.rating;
|
||||
let menu;
|
||||
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
|
||||
if (m && m.name && m.name === 'Guardian Hybrid Power Plant') {
|
||||
validMods = [];
|
||||
}
|
||||
if (m && m.name && m.name === 'Guardian Power Distributor') {
|
||||
validMods = [];
|
||||
}
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
let mass = m.getMass() || m.cargo || m.fuel || 0;
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
if (!selected) {
|
||||
// If not selected then sure that modifications flag is unset
|
||||
this._modificationsSelected = false;
|
||||
}
|
||||
|
||||
// If this is a missing module, therefore has the 'info' field, set the warning value on the module to be true when loaded.
|
||||
if (m.info) {
|
||||
warning = () => true;
|
||||
}
|
||||
|
||||
const modificationsMarker = JSON.stringify(m);
|
||||
|
||||
if (selected) {
|
||||
if (this._modificationsSelected) {
|
||||
menu = <ModificationsMenu
|
||||
className='standard'
|
||||
onChange={onChange}
|
||||
ship={ship}
|
||||
m={m}
|
||||
marker={modificationsMarker}
|
||||
modButton = {this.modButton}
|
||||
/>;
|
||||
} else {
|
||||
menu = <AvailableModulesMenu
|
||||
className='standard'
|
||||
modules={modules}
|
||||
m={m}
|
||||
ship={ship}
|
||||
onSelect={onSelect}
|
||||
warning={warning}
|
||||
diffDetails={diffDetails.bind(ship, this.context.language)}
|
||||
slotDiv = {this.slotDiv}
|
||||
/>;
|
||||
}
|
||||
}
|
||||
|
||||
return (
|
||||
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onKeyDown={this._keyDown} onContextMenu={stopCtxPropagation} tabIndex="0" ref={ slotDiv => this.slotDiv = slotDiv }>
|
||||
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
|
||||
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
|
||||
<div>
|
||||
<div className={'l'}>{classRating} {m.getInfo() ? translate(m.ukName) : translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
|
||||
<div className={'r'}>{formats.round(mass)}{units.T}</div>
|
||||
<div/>
|
||||
<div className={'cb'}>
|
||||
{ m.getMinMass() ? <div className='l'>{translate('minmass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
|
||||
{ m.getOptMass() ? <div className='l'>{translate('optmass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
|
||||
{ m.getMaxMass() ? <div className='l'>{translate('maxmass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
|
||||
{ m.getOptMul() ? <div className='l'>{translate('optmul')}: {formats.rPct(m.getOptMul())}</div> : null }
|
||||
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
|
||||
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
|
||||
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
|
||||
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
|
||||
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
|
||||
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
|
||||
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
|
||||
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
|
||||
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
|
||||
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
|
||||
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
|
||||
{ m.getInfo() ? <div className='r'></div> : validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
{menu}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the modifications flag when selecting the modifications icon
|
||||
*/
|
||||
_toggleModifications() {
|
||||
this._modificationsSelected = !this._modificationsSelected;
|
||||
}
|
||||
}
|
||||
@@ -1,132 +1,67 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import SlotSection from './SlotSection';
|
||||
import StandardSlot from './StandardSlot';
|
||||
import Module from '../shipyard/Module';
|
||||
import * as ShipRoles from '../shipyard/ShipRoles';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import Slot from './Slot';
|
||||
import autoBind from 'auto-bind';
|
||||
import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions';
|
||||
import { ShipProps, Module } from 'ed-forge';
|
||||
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
|
||||
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* Standard Slot section
|
||||
*/
|
||||
export default class StandardSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'standard', 'core internal');
|
||||
this._optimizeStandard = this._optimizeStandard.bind(this);
|
||||
this._selectBulkhead = this._selectBulkhead.bind(this);
|
||||
this.selectedRefId = null;
|
||||
this.firstRefId = 'maxjump';
|
||||
this.lastRefId = 'racer';
|
||||
}
|
||||
/**
|
||||
* Handle focus if the component updates
|
||||
* @param {Object} prevProps React Component properties
|
||||
*/
|
||||
componentDidUpdate(prevProps) {
|
||||
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
|
||||
constructor(props) {
|
||||
super(props, 'core internal');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Use the lightest/optimal available standard modules
|
||||
* Resets all modules of the ship
|
||||
*/
|
||||
_optimizeStandard() {
|
||||
this.selectedRefId = 'maxjump';
|
||||
this.props.ship.useLightestStandard();
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
_emptyAll() {
|
||||
this.props.ship.getModules().forEach((slot) => slot.reset());
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Fill all standard slots with the specificed rating (using max class)
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
|
||||
* Sets all modules to a specific rating
|
||||
* @param {string} rating Module rating to set
|
||||
* @param {string} fsdPPException Custom rating for FSD
|
||||
*/
|
||||
_multiPurpose(shielded, bulkheadIndex) {
|
||||
this.selectedRefId = 'multipurpose';
|
||||
if (bulkheadIndex === 2) this.selectedRefId = 'combat';
|
||||
ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
_nRated(rating, fsdPPException) {
|
||||
const { ship } = this.props;
|
||||
const pp = ship.getPowerPlant();
|
||||
pp.setItem('powerplant', pp.getSize(), fsdPPException || rating);
|
||||
const eng = ship.getThrusters();
|
||||
eng.setItem('thrusters', eng.getSize(), rating);
|
||||
const fsd = ship.getFSD();
|
||||
fsd.setItem('fsd', fsd.getSize(), fsdPPException || rating);
|
||||
const ls = ship.getLifeSupport();
|
||||
ls.setItem('lifesupport', ls.getSize(), rating);
|
||||
const pd = ship.getPowerDistributor();
|
||||
pd.setItem('powerdistributor', pd.getSize(), rating);
|
||||
const sen = ship.getSensors();
|
||||
sen.setItem('sensors', sen.getSize(), rating);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Trader Build
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
* Creates a new slot for a given module.
|
||||
* @param {Module} m Module to create the slot for
|
||||
* @param {function} warning Warning callback
|
||||
* @return {React.Component} Slot component
|
||||
*/
|
||||
_optimizeCargo(shielded) {
|
||||
this.selectedRefId = 'trader';
|
||||
ShipRoles.trader(this.props.ship, shielded);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Miner Build
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
*/
|
||||
_optimizeMiner(shielded) {
|
||||
this.selectedRefId = 'miner';
|
||||
ShipRoles.miner(this.props.ship, shielded);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Explorer role
|
||||
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
|
||||
*/
|
||||
_optimizeExplorer(planetary) {
|
||||
this.selectedRefId = 'explorer';
|
||||
if (planetary) this.selectedRefId = 'planetary';
|
||||
ShipRoles.explorer(this.props.ship, planetary);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Racer role
|
||||
*/
|
||||
_optimizeRacer() {
|
||||
this.selectedRefId = 'racer';
|
||||
ShipRoles.racer(this.props.ship);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Use the specified bulkhead
|
||||
* @param {Object} bulkhead Bulkhead module details
|
||||
*/
|
||||
_selectBulkhead(bulkhead) {
|
||||
this.props.ship.useBulkhead(bulkhead.index);
|
||||
this.context.tooltip();
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* On right click optimize the standard modules
|
||||
*/
|
||||
_contextMenu() {
|
||||
this._optimizeStandard();
|
||||
_mkSlot(m, warning) {
|
||||
const { currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true}
|
||||
currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle}
|
||||
/>;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -134,108 +69,30 @@ export default class StandardSlotSection extends SlotSection {
|
||||
* @return {Array} Array of Slots
|
||||
*/
|
||||
_getSlots() {
|
||||
let { ship, currentMenu, cargo, fuel } = this.props;
|
||||
let slots = new Array(8);
|
||||
let open = this._openMenu;
|
||||
let select = this._selectModule;
|
||||
let st = ship.standard;
|
||||
let avail = ship.getAvailableModules().standard;
|
||||
let bh = ship.bulkheads;
|
||||
|
||||
slots[0] = <StandardSlot
|
||||
key='bh'
|
||||
slot={bh}
|
||||
modules={ship.getAvailableModules().bulkheads}
|
||||
onOpen={open.bind(this, bh)}
|
||||
onSelect={this._selectBulkhead}
|
||||
selected={currentMenu == bh}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
/>;
|
||||
|
||||
slots[1] = <StandardSlot
|
||||
key='pp'
|
||||
slot={st[0]}
|
||||
modules={avail[0]}
|
||||
onOpen={open.bind(this, st[0])}
|
||||
onSelect={select.bind(this, st[0])}
|
||||
selected={currentMenu == st[0]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
|
||||
/>;
|
||||
|
||||
slots[2] = <StandardSlot
|
||||
key='th'
|
||||
slot={st[1]}
|
||||
modules={avail[1]}
|
||||
onOpen={open.bind(this, st[1])}
|
||||
onSelect={select.bind(this, st[1])}
|
||||
selected={currentMenu == st[1]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
|
||||
/>;
|
||||
|
||||
|
||||
slots[3] = <StandardSlot
|
||||
key='fsd'
|
||||
slot={st[2]}
|
||||
modules={avail[2]}
|
||||
onOpen={open.bind(this, st[2])}
|
||||
onSelect={select.bind(this, st[2])}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
selected={currentMenu == st[2]}
|
||||
/>;
|
||||
|
||||
slots[4] = <StandardSlot
|
||||
key='ls'
|
||||
slot={st[3]}
|
||||
modules={avail[3]}
|
||||
onOpen={open.bind(this, st[3])}
|
||||
onSelect={select.bind(this, st[3])}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
selected={currentMenu == st[3]}
|
||||
/>;
|
||||
|
||||
slots[5] = <StandardSlot
|
||||
key='pd'
|
||||
slot={st[4]}
|
||||
modules={avail[4]}
|
||||
onOpen={open.bind(this, st[4])}
|
||||
onSelect={select.bind(this, st[4])}
|
||||
selected={currentMenu == st[4]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getEnginesCapacity() < ship.boostEnergy : m.engcap < ship.boostEnergy}
|
||||
/>;
|
||||
|
||||
slots[6] = <StandardSlot
|
||||
key='ss'
|
||||
slot={st[5]}
|
||||
modules={avail[5]}
|
||||
onOpen={open.bind(this, st[5])}
|
||||
onSelect={select.bind(this, st[5])}
|
||||
selected={currentMenu == st[5]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
/>;
|
||||
|
||||
slots[7] = <StandardSlot
|
||||
key='ft'
|
||||
slot={st[6]}
|
||||
modules={avail[6]}
|
||||
onOpen={open.bind(this, st[6])}
|
||||
onSelect={select.bind(this, st[6])}
|
||||
selected={currentMenu == st[6]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
|
||||
/>;
|
||||
|
||||
return slots;
|
||||
const { ship } = this.props;
|
||||
const fsd = ship.getFSD();
|
||||
return [
|
||||
this._mkSlot(ship.getAlloys()),
|
||||
this._mkSlot(
|
||||
ship.getPowerPlant(),
|
||||
(m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR),
|
||||
),
|
||||
this._mkSlot(
|
||||
ship.getThrusters(),
|
||||
(m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS),
|
||||
),
|
||||
this._mkSlot(fsd),
|
||||
this._mkSlot(
|
||||
ship.getPowerDistributor(),
|
||||
(m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'),
|
||||
),
|
||||
this._mkSlot(ship.getLifeSupport()),
|
||||
this._mkSlot(ship.getSensors()),
|
||||
this._mkSlot(
|
||||
ship.getCoreFuelTank(),
|
||||
(m) => moduleGet(m, 'fuel') < fsd.get('maxfuel')
|
||||
),
|
||||
];
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -243,23 +100,18 @@ export default class StandardSlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
let planetaryDisabled = this.props.ship.internal.length < 4;
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeStandard} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['maxjump'] = smRef}>{translate('Maximize Jump Range')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._emptyAll}>{translate('empty all slots')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('roles')}</div>
|
||||
<div className='select-group cap'>{translate('core')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['multipurpose'] = smRef}>{translate('Multi-purpose')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['combat'] = smRef}>{translate('Combat')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['trader'] = smRef}>{translate('Trader')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['explorer'] = smRef}>{translate('Explorer')}</li>
|
||||
<li className={cn('lc', { disabled: planetaryDisabled })} tabIndex={planetaryDisabled ? '' : '0'} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['planetary'] = smRef}>{translate('Planetary Explorer')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['miner'] = smRef}>{translate('Miner')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['racer'] = smRef}>{translate('Racer')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '5', undefined)}>{translate('A-rated')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', undefined)}>{translate('D-rated')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', '5')}>{translate('D-rated + A-rated FSD/PP')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -247,8 +247,7 @@ export class OrbisIcon extends SvgIcon {
|
||||
<path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/>
|
||||
<path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" />
|
||||
<rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" />
|
||||
</g>
|
||||
);
|
||||
</g>);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -263,7 +262,7 @@ export class MatIcon extends SvgIcon {
|
||||
*/
|
||||
svg() {
|
||||
return<g xmlns="http://www.w3.org/2000/svg">
|
||||
<path fill="#FF7100" d="M 24.86,4.18
|
||||
<path d="M 24.86,4.18
|
||||
C 24.86,4.18 17.17,7.82 17.17,7.82
|
||||
17.17,7.82 15.35,14.55 15.35,14.55
|
||||
15.35,14.55 24.70,9.75 24.70,9.75
|
||||
|
||||
@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Document Root Tooltip
|
||||
*/
|
||||
export default class Tooltip extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
rect: PropTypes.object.isRequired,
|
||||
options: PropTypes.object
|
||||
@@ -127,5 +126,4 @@ export default class Tooltip extends TranslatedComponent {
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -6,7 +6,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Abstract Translated Component
|
||||
*/
|
||||
export default class TranslatedComponent extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
language: PropTypes.object.isRequired,
|
||||
sizeRatio: PropTypes.number.isRequired,
|
||||
|
||||
@@ -1,7 +1,8 @@
|
||||
import React from 'react';
|
||||
import SlotSection from './SlotSection';
|
||||
import HardpointSlot from './HardpointSlot';
|
||||
import Slot from './Slot';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Utility Slot Section
|
||||
@@ -10,54 +11,34 @@ export default class UtilitySlotSection extends SlotSection {
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'utility', 'utility mounts');
|
||||
this._empty = this._empty.bind(this);
|
||||
this.selectedRefId = null;
|
||||
this.firstRefId = 'emptyall';
|
||||
this.lastRefId = 'po';
|
||||
}
|
||||
/**
|
||||
* Handle focus if the component updates
|
||||
* @param {Object} prevProps React Component properties
|
||||
*/
|
||||
componentDidUpdate(prevProps) {
|
||||
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
|
||||
constructor(props) {
|
||||
super(props, 'utility mounts');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all utility slots and close the menu
|
||||
*/
|
||||
_empty() {
|
||||
this.selectedRefId = this.firstRefId;
|
||||
this.props.ship.emptyUtility();
|
||||
this.props.onChange();
|
||||
this.props.ship.getUtilities().forEach((slot) => slot.reset());
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Mount module in utility slot, replace all if Alt is held
|
||||
* @param {string} group Module Group name
|
||||
* @param {string} type Module type
|
||||
* @param {string} rating Module Rating
|
||||
* @param {string} name Module name
|
||||
* @param {Synthetic} event Event
|
||||
*/
|
||||
_use(group, rating, name, event) {
|
||||
this.selectedRefId = group;
|
||||
if (rating !== null) this.selectedRefId += '-' + rating;
|
||||
|
||||
this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt'));
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
_use(type, rating, event) {
|
||||
const fillAll = event.getModifierState('Alt');
|
||||
for (const slot of this.props.ship.getUtilities(undefined, true)) {
|
||||
if (slot.isEmpty() || fillAll) {
|
||||
slot.setItem(type, '', rating);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all utility slots on right-click
|
||||
*/
|
||||
_contextMenu() {
|
||||
this._empty();
|
||||
}
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -66,32 +47,23 @@ export default class UtilitySlotSection extends SlotSection {
|
||||
*/
|
||||
_getSlots() {
|
||||
let slots = [];
|
||||
let { ship, currentMenu } = this.props;
|
||||
let hardpoints = ship.hardpoints;
|
||||
let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = hardpoints.length; i < l; i++) {
|
||||
let h = hardpoints[i];
|
||||
if (h.maxClass === 0) {
|
||||
slots.push(<HardpointSlot
|
||||
key={i}
|
||||
maxClass={h.maxClass}
|
||||
availableModules={() => availableModules.getHps(h.maxClass)}
|
||||
onOpen={this._openMenu.bind(this,h)}
|
||||
onSelect={this._selectModule.bind(this, h)}
|
||||
onChange={this.props.onChange}
|
||||
selected={currentMenu == h}
|
||||
for (let h of ship.getUtilities(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={h.object.Slot}
|
||||
currentMenu={currentMenu}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
ship={ship}
|
||||
m={h.m}
|
||||
m={h}
|
||||
enabled={h.enabled ? true : false}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
}
|
||||
|
||||
return slots;
|
||||
}
|
||||
@@ -101,33 +73,34 @@ export default class UtilitySlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
let _use = this._use;
|
||||
|
||||
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('sb')}</div>
|
||||
<ul>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-A'] = smRef}>A</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-B'] = smRef}>B</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-C'] = smRef}>C</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-D'] = smRef}>D</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-E'] = smRef}>E</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '5')}>A</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '4')}>B</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '3')}>C</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '2')}>D</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '1')}>E</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('hs')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hs'] = smRef}>{translate('Heat Sink Launcher')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'heatsinklauncher', '')}>{translate('Heat Sink Launcher')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('ch')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ch'] = smRef}>{translate('Chaff Launcher')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'chafflauncher', '')}>{translate('Chaff Launcher')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('po')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['po'] = smRef}>{translate('Point Defence')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'pointdefence', '')}>{translate('Point Defence')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
@@ -2,194 +2,99 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import LineChart from '../components/LineChart';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import { moduleReduce } from 'ed-forge/lib/src/helper';
|
||||
import { chain, keys, mapValues, values } from 'lodash';
|
||||
|
||||
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
|
||||
const PORTION_MAPPINGS = {
|
||||
'absolute': 'absolutedamageportion',
|
||||
'explosive': 'explosivedamageportion',
|
||||
'kinetic': 'kineticdamageportion',
|
||||
'thermal': 'thermicdamageportion',
|
||||
};
|
||||
const MULTS = keys(PORTION_MAPPINGS);
|
||||
|
||||
// TODO: help with this in ed-forge
|
||||
/**
|
||||
* .
|
||||
* @param {Object} opponentDefence .
|
||||
* @returns {Object} .
|
||||
*/
|
||||
function defenceToMults(opponentDefence) {
|
||||
return chain(opponentDefence)
|
||||
.pick(MULTS)
|
||||
.mapKeys((v, k) => PORTION_MAPPINGS[k])
|
||||
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
|
||||
.value();
|
||||
}
|
||||
|
||||
/**
|
||||
* Weapon damage chart
|
||||
*/
|
||||
export default class WeaponDamageChart extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
hull: PropTypes.bool.isRequired,
|
||||
opponentDefence: PropTypes.object.isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
opponentSys: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the initial weapons state
|
||||
*/
|
||||
componentWillMount() {
|
||||
const weaponNames = this._weaponNames(this.props.ship, this.context);
|
||||
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
|
||||
const opponentArmour = Calc.armourMetrics(this.props.opponent);
|
||||
const maxRange = this._calcMaxRange(this.props.ship);
|
||||
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
|
||||
|
||||
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the updated weapons state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
|
||||
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
|
||||
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
|
||||
const maxRange = this._calcMaxRange(nextProps.ship);
|
||||
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
|
||||
this.setState({ weaponNames,
|
||||
opponentShields,
|
||||
opponentArmour,
|
||||
maxRange,
|
||||
maxDps,
|
||||
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
|
||||
});
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum range of a ship's weapons
|
||||
* @param {Object} ship The ship
|
||||
* @returns {int} The maximum range, in metres
|
||||
*/
|
||||
_calcMaxRange(ship) {
|
||||
let maxRange = 1000; // Minimum
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const thisRange = ship.hardpoints[i].m.getRange();
|
||||
if (thisRange > maxRange) {
|
||||
maxRange = thisRange;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return maxRange;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum sustained single-weapon DPS for this ship
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} opponent The opponent ship
|
||||
* @param {Object} opponentShields The opponent's shields
|
||||
* @param {Object} opponentArmour The opponent's armour
|
||||
* @return {number} The maximum sustained single-weapon DPS
|
||||
*/
|
||||
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
|
||||
// Additional information to allow effectiveness calculations
|
||||
let maxSDps = 0;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
|
||||
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
|
||||
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
|
||||
if (thisSDps > maxSDps) {
|
||||
maxSDps = thisSDps;
|
||||
}
|
||||
}
|
||||
}
|
||||
return maxSDps;
|
||||
}
|
||||
|
||||
/**
|
||||
* Obtain the weapon names for this ship
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} context The context
|
||||
* @return {array} The weapon names
|
||||
*/
|
||||
_weaponNames(ship, context) {
|
||||
const translate = context.language.translate;
|
||||
let names = [];
|
||||
let num = 1;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
|
||||
let engineering;
|
||||
if (m.blueprint && m.blueprint.name) {
|
||||
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id) {
|
||||
engineering += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
}
|
||||
if (engineering) {
|
||||
name = name + ' (' + engineering + ')';
|
||||
}
|
||||
names.push(name);
|
||||
}
|
||||
}
|
||||
return names;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
|
||||
* @param {Object} opponent The target
|
||||
* @param {Object} opponentShields The opponent's shields
|
||||
* @param {Object} opponentArmour The opponent's armour
|
||||
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
|
||||
* @param {Object} engagementRange The engagement range
|
||||
* @return {array} The array of weapon DPS
|
||||
*/
|
||||
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
|
||||
let results = {};
|
||||
let weaponNum = 0;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
|
||||
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
|
||||
}
|
||||
}
|
||||
return results;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render damage dealt
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { maxRange } = this.state;
|
||||
const { ship, opponent, engagementRange } = this.props;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship, opponentDefence, engagementRange } = this.props;
|
||||
|
||||
const sortOrder = this._sortOrder;
|
||||
const onCollapseExpand = this._onCollapseExpand;
|
||||
|
||||
const code = `${ship.toString()}:${opponent.toString()}`;
|
||||
const hardpoints = ship.getHardpoints();
|
||||
const hardpointsMap = chain(hardpoints)
|
||||
.map((m) => [m.getSlot(), m])
|
||||
.fromPairs()
|
||||
.value();
|
||||
const mults = defenceToMults(opponentDefence);
|
||||
const cb = (range) => {
|
||||
return mapValues(
|
||||
hardpointsMap,
|
||||
(m) => {
|
||||
const sdps = m.get('sustaineddamagepersecond', true);
|
||||
const resistanceMul = chain(mults)
|
||||
.toPairs()
|
||||
.map((pair) => {
|
||||
const [k, mul] = pair;
|
||||
return m.get(k, true) * mul;
|
||||
})
|
||||
.sum()
|
||||
.value();
|
||||
|
||||
const falloff = m.get('damagefalloffrange', true);
|
||||
const rangeMul = Math.min(1, Math.max(0,
|
||||
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
|
||||
));
|
||||
return sdps * resistanceMul * rangeMul;
|
||||
}
|
||||
);
|
||||
};
|
||||
return (
|
||||
<div>
|
||||
<LineChart
|
||||
xMax={maxRange}
|
||||
yMax={this.state.maxDps}
|
||||
xMin={0}
|
||||
xMax={moduleReduce(
|
||||
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
|
||||
)}
|
||||
yMin={0}
|
||||
// Factor in highest damage multiplier to get a safe upper bound
|
||||
yMax={Math.max(1, ...values(mults)) * moduleReduce(
|
||||
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
|
||||
)}
|
||||
xLabel={translate('range')}
|
||||
xUnit={translate('m')}
|
||||
yLabel={translate('sdps')}
|
||||
series={this.state.weaponNames}
|
||||
xMark={this.props.engagementRange}
|
||||
yLabel={translate('sustaineddamagepersecond')}
|
||||
series={hardpoints.map((m) => m.getSlot())}
|
||||
xMark={engagementRange}
|
||||
colors={DAMAGE_DEALT_COLORS}
|
||||
func={this.state.calcSDpsFunc}
|
||||
func={cb}
|
||||
points={200}
|
||||
code={code}
|
||||
/>
|
||||
|
||||
@@ -8,7 +8,6 @@ import * as RU from './ru';
|
||||
import * as PL from './pl';
|
||||
import * as PT from './pt';
|
||||
import * as CN from './cn';
|
||||
import * as KO from './ko';
|
||||
import * as d3 from 'd3';
|
||||
|
||||
let fallbackTerms = EN.terms;
|
||||
@@ -30,7 +29,6 @@ export function getLanguage(langCode) {
|
||||
case 'pl': lang = PL; break;
|
||||
case 'pt': lang = PT; break;
|
||||
case 'cn': lang = CN; break;
|
||||
case 'ko': lang = KO; break;
|
||||
default:
|
||||
lang = EN;
|
||||
}
|
||||
@@ -99,6 +97,5 @@ export const Languages = {
|
||||
ru: 'ру́сский',
|
||||
pl: 'polski',
|
||||
pt: 'português',
|
||||
cn: '中文',
|
||||
ko: '한국어'
|
||||
cn: '中文'
|
||||
};
|
||||
|
||||
@@ -398,7 +398,6 @@
|
||||
"No modded components.": "没有改装的部件",
|
||||
"Sending...": "发送中...",
|
||||
"Send to EDEngineer": "发送至EDEngineer",
|
||||
"Send to EDOMH": "发送至EDOMH",
|
||||
"PHASE_UPLOAD_ORBIS": "上传到orbis.zone(测试阶段)",
|
||||
"orbis username": "orbis.zone的Email或用户名",
|
||||
"orbis password": "orbis.zone的密码",
|
||||
|
||||
@@ -26,9 +26,6 @@
|
||||
"PHRASE_NO_SPECIAL": "No experimental effect",
|
||||
"PHRASE_SHOPPING_LIST": "Stations that sell this build",
|
||||
"PHRASE_SHOPPING_MATS": "Materials needed for this build",
|
||||
"PHRASE_DIFFERENT_ROLLS": "Material requirements will differ, based on the number of rolls per grade, per module.",
|
||||
"PHRASE_FOR_FINER_CONTROL": "For finer control over rolls per grade/module, a more accurate list of required mats and help in finding those mats, please consider using the export options below to ED Odyssey Materials Helper, or ED Engineer, or use the Crafting Lists feature on inara.cz.",
|
||||
"PHRASE_ALL_MODULES_ALL_ROLLS": "The list below, assumes standard to G5 Engineered (approx 80% - 90%) with the rolls above, for ALL engineered modules in the build. You can adjust the number of rolls above for each grade, however it will still apply to all engineered modules in the build.",
|
||||
"PHRASE_REFIT_SHOPPING_LIST": "Stations that sell required modules",
|
||||
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Total amount of damage that can be taken from each damage type, if using all shield cells",
|
||||
"PHRASE_TIME_TO_LOSE_SHIELDS": "Shields will hold for",
|
||||
@@ -66,9 +63,7 @@
|
||||
"TT_SUMMARY_SPEED": "With full fuel tank and 4 pips to ENG",
|
||||
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "Thrusters powered off or over maximum mass with full fuel and cargo loads",
|
||||
"TT_SUMMARY_BOOST": "With full fuel tank and 4 pips to ENG",
|
||||
"TT_SUMMARY_SHIP_BOOST_INTERVAL": "Time each boost lasts on this ship",
|
||||
"TT_SUMMARY_BOOST_INTERVAL": "Time between boosts with 4 pips to ENG",
|
||||
"TT_SUMMARY_BOOST_INTERVALS": "If DISTRO is less than or equal to SHIP, the ship can boost continuously",
|
||||
"TT_SUMMARY_BOOST_INTERVAL": "Time between each boost with 4 pips to ENG",
|
||||
"TT_SUMMARY_BOOST_NONFUNCTIONAL": "Power distributor not able to supply enough power to boost",
|
||||
"TT_SUMMARY_SHIELDS": "Raw shield strength, including boosters",
|
||||
"TT_SUMMARY_SHIELDS_SCB": "Raw shield strength, including boosters and SCBs",
|
||||
@@ -86,10 +81,8 @@
|
||||
"TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Farthest possible range with no cargo, a full fuel tank, and jumping as far as possible each time",
|
||||
"TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time",
|
||||
"HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes",
|
||||
"PHRASE_ENSURE_EDOMH": "Ensure ED Odyssey Material Helper is installed and registered to handle edomh:// urls, else this button will do nothing!",
|
||||
"PHRASE_FIREFOX_EDENGINEER": "Sending to EDEngineer is not compatible with Firefox's security settings. Please try again with Chrome.",
|
||||
"PHRASE_FAILED_TO_FIND_EDENGINEER": "Failed to find ED Engineer API. Please ensure it is running and try again.",
|
||||
"MISSING_MODULES": "Missing Modules",
|
||||
"PHRASE_FAIL_EDENGINEER": "Failed to send to EDEngineer (Launch EDEngineer and make sure the API is started then refresh the page.)",
|
||||
"PHRASE_FIREFOX_EDENGINEER": "Send to EDEngineer is incompatible with Firefox.",
|
||||
"am": "Auto Field-Maintenance Unit",
|
||||
"bh": "Bulkheads",
|
||||
"bl": "Beam Laser",
|
||||
@@ -100,7 +93,6 @@
|
||||
"ch": "Chaff Launcher",
|
||||
"cr": "Cargo Rack",
|
||||
"cs": "Manifest Scanner",
|
||||
"csl": "Caustic Sink Launcher",
|
||||
"dc": "Docking Computer",
|
||||
"ec": "Electronic Countermeasure",
|
||||
"fc": "Fragment Cannon",
|
||||
@@ -116,18 +108,10 @@
|
||||
"kw": "Kill Warrant Scanner",
|
||||
"ls": "Life Support",
|
||||
"mc": "Multi-cannon",
|
||||
"mh": "Missing Weapon/Utility",
|
||||
"mm": "Missing Module",
|
||||
"advmc": "Multi-cannon (Advanced)",
|
||||
"axmc": "AX Multi-cannon",
|
||||
"axmce": "AX Multi-cannon (Enhanced)",
|
||||
"ml": "Mining Laser",
|
||||
"mlc": "Multi Limpet Controller",
|
||||
"mr": "Missile Rack",
|
||||
"amr": "Missile Rack (Advanced)",
|
||||
"axmr": "AX Missile Rack",
|
||||
"axmre": "AX Missile Rack (Enhanced)",
|
||||
"ews": "Experimental Weapon Stabilizer",
|
||||
"mrp": "Module Reinforcement Package",
|
||||
"nl": "Mine Launcher",
|
||||
"pa": "Plasma Accelerator",
|
||||
@@ -172,10 +156,8 @@
|
||||
"sua": "Supercruise Assist",
|
||||
"t": "thrusters",
|
||||
"tp": "Torpedo Pylon",
|
||||
"ntp": "Nanite Torpedo Pylon",
|
||||
"ul": "Burst Laser",
|
||||
"Send To EDEngineer": "Send To EDEngineer",
|
||||
"Send To EDOMH": "Send To EDOMH",
|
||||
"ws": "Frame Shift Wake Scanner",
|
||||
"rpl": "Repair Limpet Controller",
|
||||
"rcpl": "Recon Limpet Controller",
|
||||
@@ -226,7 +208,6 @@
|
||||
"boost interval": "Boost interval",
|
||||
"total": "Total",
|
||||
"ammo": "Ammunition maximum",
|
||||
"info": "Info",
|
||||
"boot": "Boot time",
|
||||
"hacktime": "Hack time",
|
||||
"brokenregen": "Broken regeneration rate",
|
||||
@@ -276,10 +257,8 @@
|
||||
"thermres": "Thermal resistance",
|
||||
"wepcap": "Weapons capacity",
|
||||
"weprate": "Weapons recharge rate",
|
||||
"minmass": "Minimum mass",
|
||||
"minmass_sg": "Minimum hull mass",
|
||||
"optmass_sg": "Optimal hull mass",
|
||||
"maxmass": "Maximum mass",
|
||||
"maxmass_sg": "Maximum hull mass",
|
||||
"minmul_sg": "Minimum strength",
|
||||
"optmul_sg": "Optimal strength",
|
||||
|
||||
@@ -1,16 +0,0 @@
|
||||
export const formats = {
|
||||
decimal: '.',
|
||||
thousands: ',',
|
||||
grouping: [3],
|
||||
currency: ['₩', ''],
|
||||
dateTime: '%a %b %e %X %Y',
|
||||
date: '%Y/%m/%d',
|
||||
time: '%H:%M:%S',
|
||||
periods: ['오전', '오후'],
|
||||
days: ['일요일', '월요일', '화요일', '수요일', '목요일', '금요일', '토요일'],
|
||||
shortDays: ['일', '월', '화', '수', '목', '금', '토'],
|
||||
months: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월'],
|
||||
shortMonths: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월']
|
||||
};
|
||||
|
||||
export { default as terms } from './ko.json';
|
||||
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
@@ -13,7 +13,7 @@
|
||||
"PHRASE_SG_RECOVER": "Восстановление с 0% до 50% объема щита, учитывая полный аккумулятор СИС в начале",
|
||||
"PHRASE_UNLADEN": "Масса корабля без учета топлива и грузов",
|
||||
"PHRASE_UPDATE_RDY": "Доступна новая версия. Нажмите для обновления.",
|
||||
"PHRASE_ENGAGEMENT_RANGE": "Дистанция между кораблём и целью",
|
||||
"PHRASE_ENGAGEMENT_RANGE": "Дистанция между кораблем и целью",
|
||||
"PHRASE_SELECT_BLUEPRINT": "Нажмите чтобы выбрать чертеж",
|
||||
"PHRASE_BLUEPRINT_WORST": "Худшие основные значения для чертежа",
|
||||
"PHRASE_BLUEPRINT_FIFTY": "50% значения для чертежа",
|
||||
@@ -24,9 +24,9 @@
|
||||
"PHRASE_BLUEPRINT_RESET": "Сбросить все модификаторы и чертеж",
|
||||
"PHRASE_SELECT_SPECIAL": "Нажмите, чтобы выбрать экспериментальный эффект",
|
||||
"PHRASE_NO_SPECIAL": "Без экспериментального эффекта",
|
||||
"PHRASE_SHOPPING_LIST": "Станции, на которых продают эту сборку",
|
||||
"PHRASE_SHOPPING_LIST": "Станции, что продают эту сборку",
|
||||
"PHRASE_SHOPPING_MATS": "Материалы которые нужны для сборки",
|
||||
"PHRASE_REFIT_SHOPPING_LIST": "Станции, на которых продают необходимые модули",
|
||||
"PHRASE_REFIT_SHOPPING_LIST": "Станции, что продают необходимые модули",
|
||||
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Общий урон, что может быть нанесен в каждым типе, если используются все щитонакопители",
|
||||
"PHRASE_TIME_TO_LOSE_SHIELDS": "Щиты продержатся",
|
||||
"PHRASE_TIME_TO_RECOVER_SHIELDS": "Щиты восстановятся за",
|
||||
@@ -37,36 +37,36 @@
|
||||
"PHRASE_EFFECTIVE_ARMOUR": "Эффективная сила брони против разных типов урона",
|
||||
"PHRASE_DAMAGE_TAKEN": "% общих повреждений полученных в разных типах урона",
|
||||
"PHRASE_TIME_TO_LOSE_ARMOUR": "Броня продержится",
|
||||
"PHRASE_MODULE_PROTECTION_EXTERNAL": "Защита гнёзд",
|
||||
"PHRASE_MODULE_PROTECTION_EXTERNAL": "Защита гнезд",
|
||||
"PHRASE_MODULE_PROTECTION_INTERNAL": "Защита всех остальных модулей",
|
||||
"PHRASE_OVERALL_DAMAGE": "Разбивка источников устойчивого УвС",
|
||||
"PHRASE_SHIELD_DAMAGE": "Подробности источников поддерживаемого УвС против щитов",
|
||||
"PHRASE_ARMOUR_DAMAGE": "Подробности источников поддерживаемого УвС против брони",
|
||||
"PHRASE_OVERALL_DAMAGE": "Разбивка источников устойчивого ДПС",
|
||||
"PHRASE_SHIELD_DAMAGE": "Подробности источников поддерживаемого ДПС против щитов",
|
||||
"PHRASE_ARMOUR_DAMAGE": "Подробности источников поддерживаемого ДПС против брони",
|
||||
"PHRASE_TIME_TO_REMOVE_SHIELDS": "Снимет щиты за",
|
||||
"PHRASE_MULTI_CREW_CAPACITOR_POINTS": "Щелкните правой кновкой мыши чтобы объединить в группу.",
|
||||
"TT_TIME_TO_REMOVE_SHIELDS": "Непрерывным огнём из всех орудий",
|
||||
"TT_TIME_TO_REMOVE_SHIELDS": "Непрерывным огнем из всех орудий",
|
||||
"PHRASE_TIME_TO_REMOVE_ARMOUR": "Снимет броню за",
|
||||
"TT_TIME_TO_REMOVE_ARMOUR": "Непрерывным огнём из всех орудий",
|
||||
"TT_TIME_TO_REMOVE_ARMOUR": "Непрерывным огнем из всех орудий",
|
||||
"PHRASE_TIME_TO_DRAIN_WEP": "Опустошит ОРУ за",
|
||||
"TT_TIME_TO_DRAIN_WEP": "Время, за которое опустошится аккумулятор ОРУ при стрельбе из всех орудий",
|
||||
"TT_TIME_TO_LOSE_SHIELDS": "Против поддерживаемой стрельбы из всех орудий противника",
|
||||
"TT_TIME_TO_LOSE_ARMOUR": "Против поддерживаемой стрельбы из всех орудий противника",
|
||||
"TT_MODULE_ARMOUR": "Броня, защищающая модули от урона",
|
||||
"TT_MODULE_PROTECTION_EXTERNAL": "Процент урона, перенаправленного от гнезд на наборы для усиления модулей",
|
||||
"TT_MODULE_PROTECTION_INTERNAL": "Процент урона, перенаправленного от модулей вне гнёзд на наборы для усиления модулей",
|
||||
"TT_EFFECTIVE_SDPS_SHIELDS": "Реальный поддерживаемый УвС пока ёмкость ОРУ не пуста",
|
||||
"TT_MODULE_PROTECTION_INTERNAL": "Процент урона, перенаправленного от модулей вне гнезд на наборы для усиления модулей",
|
||||
"TT_EFFECTIVE_SDPS_SHIELDS": "Реальный поддерживаемый ДПС пока аккумулятор ОРУ не пуст",
|
||||
"TT_EFFECTIVENESS_SHIELDS": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью без пунктов в СИС на 0 метрах",
|
||||
"TT_EFFECTIVE_SDPS_ARMOUR": "Реальный поддерживаемый УвС пока аккумулятор ОРУ не пуст",
|
||||
"TT_EFFECTIVE_SDPS_ARMOUR": "Реальный поддерживаемый ДПС пока аккумулятор ОРУ не пуст",
|
||||
"TT_EFFECTIVENESS_ARMOUR": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью на 0 метрах",
|
||||
"PHRASE_EFFECTIVE_SDPS_SHIELDS": "ПУвС против щитов",
|
||||
"PHRASE_EFFECTIVE_SDPS_ARMOUR": "ПУвС против брони",
|
||||
"PHRASE_EFFECTIVE_SDPS_SHIELDS": "ПДПС против щитов",
|
||||
"PHRASE_EFFECTIVE_SDPS_ARMOUR": "ПДПС против брони",
|
||||
"TT_SUMMARY_SPEED": "С полным топливным баком и 4 пунктами в ДВГ",
|
||||
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "Маневровые двигатели выключены или превышена максимальная масса с топливом и грузом",
|
||||
"TT_SUMMARY_BOOST": "С полным топливным баком и 4 пунктами в ДВГ",
|
||||
"TT_SUMMARY_BOOST_INTERVAL": "Время заполнения с 4 пунктами в СИС",
|
||||
"TT_SUMMARY_BOOST_NONFUNCTIONAL": "Распределитель питания не может обеспечить достаточно энергии для форсажа",
|
||||
"TT_SUMMARY_SHIELDS": "Чистая сила щита, включая усилители",
|
||||
"TT_SUMMARY_SHIELDS_SCB": "Прочность щита, включая бустеры и щитонакопители",
|
||||
"TT_SUMMARY_SHIELDS_SCB": "Прочность щита, включая бустеры и SCB",
|
||||
"TT_SUMMARY_SHIELDS_NONFUNCTIONAL": "Шитогенератор отсутствует или выключен",
|
||||
"TT_SUMMARY_INTEGRITY": "Целостность корабля, включая переборки и наборы для усиления корпуса",
|
||||
"TT_SUMMARY_HULL_MASS": "Масса корпуса без каких-либо модулей",
|
||||
@@ -88,23 +88,22 @@
|
||||
"bl": "Пучковый лазер",
|
||||
"bsg": "Двухпоточный щитогенератор",
|
||||
"c": "Пушка",
|
||||
"causres": "Сопротивление едк.урону",
|
||||
"Caustic resistance": "Сопротивление едк.урону",
|
||||
"cc": "Контроллер дронов-сборщиков",
|
||||
"causres": "Каустическое сопротивление",
|
||||
"Caustic resistance": "Каустическое сопротивление",
|
||||
"cc": "Контроллер магнитного снаряда для сбора",
|
||||
"ch": "Разбрасыватель дипольных отражателей",
|
||||
"cr": "Грузовой стеллаж",
|
||||
"cs": "Сканер содержимого",
|
||||
"csl": "Антикор катапульта",
|
||||
"dc": "Стыковочный компьютер",
|
||||
"ec": "Радиоэлектронное подавление",
|
||||
"ec": "Электр. противодействие",
|
||||
"fc": "Залповое орудие",
|
||||
"fh": "Ангар для истребителя",
|
||||
"fi": "FSD-перехватчик",
|
||||
"fs": "Топливозаборник",
|
||||
"fsd": "Рамочно-сместительный двигатель",
|
||||
"ft": "Топливный бак",
|
||||
"fx": "Контроллер дронов-заправщиков",
|
||||
"hb": "Контроллер дронов-взломщиков трюмов",
|
||||
"fx": "Контроллер магнитного снаряда для топлива",
|
||||
"hb": "Контроллер магнитного снаряда для взлома трюма",
|
||||
"hr": "Набор для усиления корпуса",
|
||||
"hs": "Теплоотводная катапульта",
|
||||
"kw": "Сканер преступников",
|
||||
@@ -112,14 +111,13 @@
|
||||
"mc": "Многоствольное орудие",
|
||||
"axmc": "Многоствольное орудие АИ",
|
||||
"ml": "Проходочный лазер",
|
||||
"mr": "Блок ракет",
|
||||
"mr": "Ракетный лоток",
|
||||
"axmr": "Блок ракет АИ",
|
||||
"ews": "Стабилизатор экспериментального вооружения",
|
||||
"mrp": "Набор для усиления модуля",
|
||||
"nl": "Мины",
|
||||
"pa": "Ускоритель плазмы",
|
||||
"pas": "Комплект для сближения с планетой",
|
||||
"pc": "Контроллер дронов-геологоразведчиков",
|
||||
"pc": "Контроллер магнитного снаряда для геологоразведки",
|
||||
"pce": "Каюта пассажира эконом-класса",
|
||||
"passenger capacity": "Количество пассажиров",
|
||||
"pci": "Каюта пассажира бизнес-класса",
|
||||
@@ -145,38 +143,36 @@
|
||||
"gsc": "Осколочное орудие Стражей",
|
||||
"psg": "Призматический щитогенератор",
|
||||
"pv": "Гараж для планетарного транспорта",
|
||||
"rf": "Очиститель",
|
||||
"rf": "Устройство переработки",
|
||||
"rfl": "Зенитная установка (снаряды с дистанционным подрывом)",
|
||||
"rg": "Рельсотрон",
|
||||
"rsl": "Контроллер дронов-исследователей",
|
||||
"rg": "Электромагнитная пушка",
|
||||
"rsl": "Дроны-исследователи",
|
||||
"s": "Сенсоры",
|
||||
"sb": "Усилитель щита",
|
||||
"sc": "Сканер обнаружения",
|
||||
"scb": "Щитонакопитель",
|
||||
"sfn": "Нейтрализатор отключающего поля",
|
||||
"sfn": "Нейтрализатор глушащего поля",
|
||||
"sg": "Щитогенератор",
|
||||
"ss": "Сканер поверхностей",
|
||||
"sua": "Помощь в гиперкрейсерском режиме",
|
||||
"t": "Маневровые двигатели",
|
||||
"tp": "Торпедная установка",
|
||||
"ul": "Пульсирующий лазер",
|
||||
"tp": "Торпедная стойка",
|
||||
"ul": "Пульсирующие лазеры",
|
||||
"Send To EDEngineer": "Отправить в EDEngineer",
|
||||
"Send To EDOMH": "Отправить в EDOMH",
|
||||
"ws": "Сканер следа FSD",
|
||||
"rpl": "Контроллер дронов-ремонтников",
|
||||
"rcpl": "Контроллер дронов-разведчиков",
|
||||
"xs": "Ксено-сканер",
|
||||
"rpl": "Дроны-ремонтники",
|
||||
"rcpl": "Дроны-разведчики",
|
||||
"xs": "Сканер «инопланетянин»",
|
||||
"tbem": "Блок энзимных ракет",
|
||||
"tbrfl": "Установка для стрельбы стреловидными снарядами с дистанционным подрывом",
|
||||
"dtl": "Контроллер дронов-очистителей",
|
||||
"mlc": "Мультиконтроллер",
|
||||
"mahr": "Метасплавное усиление корпуса",
|
||||
"dtl": "Дроны-очистители",
|
||||
"mahr": "Набор для усиления корпуса из Метасплава",
|
||||
"emptyrestricted": "пусто (ограниченно)",
|
||||
"damage dealt to": "Урон нанесён",
|
||||
"damage dealt to": "Урон нанесен",
|
||||
"damage received from": "Урон получен от",
|
||||
"against shields": "Против щитов",
|
||||
"against hull": "Против корпуса",
|
||||
"total effective shield": "Общая эффективность щита",
|
||||
"total effective shield": "Общие эффективные щиты",
|
||||
"ammunition": "Припасы",
|
||||
"secs": "с",
|
||||
"bays": "Ячейки",
|
||||
@@ -205,7 +201,7 @@
|
||||
"shield cells": "Щитонакопители",
|
||||
"recovery": "включение",
|
||||
"recharge": "перезарядка",
|
||||
"engine pips": "Ячейки питания на ДВГ",
|
||||
"engine pips": "Пункты в двигателе",
|
||||
"4b": "4 пункта и Форсаж",
|
||||
"speed": "скорость",
|
||||
"pitch": "Тангаж",
|
||||
@@ -291,12 +287,12 @@
|
||||
"explosive": "Взрывч.",
|
||||
"kinetic": "Механич.",
|
||||
"thermal": "Тепл.",
|
||||
"caustic": "Едкий",
|
||||
"caustic": "Каустич.",
|
||||
"generator": "Генератор",
|
||||
"boosters": "Усилители",
|
||||
"cells": "Ячейки",
|
||||
"shield addition": "Добавления к щиту",
|
||||
"jump addition": "Добавления к прыжку",
|
||||
"shield addition": "ДОбавления к щиту",
|
||||
"jump addition": "ДОбавления к прыжку",
|
||||
"bulkheads": "Переборки",
|
||||
"reinforcement": "Усилители",
|
||||
"power and costs": "Энергия и стоимость",
|
||||
@@ -378,9 +374,9 @@
|
||||
"/s": "/с",
|
||||
"/min": "/мин",
|
||||
"m/s": "м/с",
|
||||
"Ls": "Св.с",
|
||||
"Ls": "Св.сек",
|
||||
"LY": "Св.лет",
|
||||
"CR": "КР.",
|
||||
"CR": "кр.",
|
||||
"S": "М",
|
||||
"M": "С",
|
||||
"L": "Б",
|
||||
@@ -439,7 +435,7 @@
|
||||
"deployed": "Открыты",
|
||||
"disabled": "Отключено",
|
||||
"discount": "Скидка",
|
||||
"DPS": "УвС",
|
||||
"DPS": "УВС",
|
||||
"efficiency": "Эффективность",
|
||||
"empty": "пусто",
|
||||
"ENG": "ДВГ",
|
||||
@@ -453,7 +449,7 @@
|
||||
"jumps": "Прыжков",
|
||||
"laden": "Груж",
|
||||
"language": "Язык",
|
||||
"maneuverability": "Манёвренность",
|
||||
"maneuverability": "Маневренность",
|
||||
"max": "Макс",
|
||||
"no": "Нет",
|
||||
"pen": "ПБ",
|
||||
@@ -466,7 +462,7 @@
|
||||
"repair": "Починка",
|
||||
"ret": "Убр",
|
||||
"retracted": "Убрано",
|
||||
"ROF": "В\/с",
|
||||
"ROF": "В\/сек",
|
||||
"save": "Сохранить",
|
||||
"sell": "Продать",
|
||||
"settings": "Настройки",
|
||||
@@ -496,7 +492,7 @@
|
||||
"module": "модуль",
|
||||
"announcements": "объявления",
|
||||
"resistance": "сопротивление",
|
||||
"Lightweight Alloy": "Лёгкие сплавы",
|
||||
"Lightweight Alloy": "Легкие сплавы",
|
||||
"base": "базовые",
|
||||
"core module classes": "основные модули",
|
||||
"Group highlighted ships": "Сгруппировать выделенные корабли",
|
||||
@@ -515,7 +511,7 @@
|
||||
"maximum speed": "максимальная скорость",
|
||||
"maximum range": "максимальная дальность",
|
||||
"shortlink": "короткая ссылка",
|
||||
"guardian": "Стражи",
|
||||
"guardian": "стражи",
|
||||
"engineers": "инженеры",
|
||||
"component": "компонент",
|
||||
"amount": "кол-во",
|
||||
@@ -524,35 +520,35 @@
|
||||
"Heat Sink Launcher": "Теплоотводная катапульта",
|
||||
"scanners": "сканеры",
|
||||
"experimental": "экспериментальное",
|
||||
"mining": "добыча ресурсов",
|
||||
"mining": "шахтерство",
|
||||
"lasers": "лазеры",
|
||||
"ordnance": "артиллерия",
|
||||
"projectiles": "с боеприпасами",
|
||||
"hangars": "ангары",
|
||||
"limpet controllers": "контроллеры дронов",
|
||||
"limpet controllers": "контроллеры снарядов",
|
||||
"passenger cabins": "каюты пассажиров",
|
||||
"structural reinforcement": "усиление конструктива",
|
||||
"flight assists": "помощь в полёте",
|
||||
"structural reinforcement": "структурные усиления",
|
||||
"flight assists": "помощники в полете",
|
||||
"modifications": "модификации",
|
||||
"wep_reload": "перезарядка",
|
||||
"optimal multiplier": "оптимальный усилитель",
|
||||
"Cargo Hatch": "Грузовой люк",
|
||||
"Chaff Launcher": "Разбрасыватель дипольных отражателей",
|
||||
"Point Defence": "Точечная оборона",
|
||||
"Electronic Countermeasure": "Радиоэлектронное подавление",
|
||||
"Xeno Scanner": "Ксено-сканер",
|
||||
"Shutdown Field Neutraliser": "Нейтрализатор отключающего поля",
|
||||
"Disruptor": "«Диверсант»",
|
||||
"Pacifier": "«Миротворец»",
|
||||
"Electronic Countermeasure": "Электронное противодействие",
|
||||
"Xeno Scanner": "Сканер «инопланетянин»",
|
||||
"Shutdown Field Neutraliser": "Нейтрализатор глушащего поля",
|
||||
"Disruptor": "Диверсант",
|
||||
"Pacifier": "Миротворец",
|
||||
"Advanced Plasma Accelerator": "Улучшенный ускоритель плазмы",
|
||||
"Cytoscrambler": "«Дезинтегратор»",
|
||||
"Retributor": "«Каратель»",
|
||||
"Enforcer": "«Убийца»",
|
||||
"Imperial Hammer": "«Имперский молот»",
|
||||
"Cytoscrambler": "Дезинтегратор",
|
||||
"Retributor": "Каратель",
|
||||
"Enforcer": "Убийца",
|
||||
"Imperial Hammer": "Имперский молот",
|
||||
"Rocket Propelled FSD Disruptor": "Ракетный FSD-разрушитель",
|
||||
"Pack-Hound": "«Гончие»",
|
||||
"Pack-Hound": "Гончие",
|
||||
"Shock Mine Launcher": "Установщик шоковых мин",
|
||||
"Mining Lance": "«Копьё шахтера»",
|
||||
"Mining Lance": "Копье шахтера",
|
||||
"Corrosion Resistant": "Коррозийно-устойчивый стеллаж",
|
||||
"Standard Docking Computer": "Стандартный стыковочный компьютер",
|
||||
"Advanced Docking Computer": "Улучшенный стыковочный компьютер",
|
||||
@@ -561,20 +557,20 @@
|
||||
"Guardian Power Distributor": "Рапределитель питания Стражей",
|
||||
"Enhanced Performance": "Усиленные маневровые двигатели",
|
||||
"Guardian Hybrid Power Plant": "Гибридная силовая установка Стражей",
|
||||
"Reinforced Alloy": "Укреплённые сплавы",
|
||||
"Reinforced Alloy": "Укрепленные сплавы",
|
||||
"Military Grade Composite": "Композит военного класса",
|
||||
"Mirrored Surface Composite": "Композит с зеркальной поверхностью",
|
||||
"Reactive Surface Composite": "Композит с реактивной поверхностью",
|
||||
"Proto Light Alloys": "Опытные лёгкие сплавы",
|
||||
"Proto Light Alloys": "Опытные легкие сплавы",
|
||||
"Ammo capacity": "Вместимость магазина",
|
||||
"Lightweight": "Облегчённый",
|
||||
"Lightweight": "Облегченный",
|
||||
"Reinforced": "Усиленный",
|
||||
"Shielded": "Защищённый",
|
||||
"Shielded": "Защищенный",
|
||||
"Fast scan": "Быстрое сканирование",
|
||||
"Long range": "Дальнего действия",
|
||||
"Wide angle": "Широкоугольный",
|
||||
"Blast resistant": "Взрывостойкий",
|
||||
"Heavy duty": "Надёжный",
|
||||
"Heavy duty": "Надежный",
|
||||
"Kinetic resistant": "Противокинетический",
|
||||
"Resistance augmented": "С универсальной защитой",
|
||||
"Thermal resistant": "Термостойкий",
|
||||
@@ -626,7 +622,7 @@
|
||||
"Penetrator Munitions": "Бронебойные боеголовки",
|
||||
"Mass lock munition": "Боеприпасы с гравитационным захватом",
|
||||
"Mass Lock Munition": "Боеприпасы с гравитационным захватом",
|
||||
"Reverberating cascade": "Отражённый залп",
|
||||
"Reverberating cascade": "Отраженный залп",
|
||||
"Shift-lock canister": "Рамоблокирующая кассета",
|
||||
"Ion disruptor": "Ионный дестабилизатор",
|
||||
"Radiant Canister": "Светящаяся кассета",
|
||||
@@ -643,7 +639,7 @@
|
||||
"Reflective Plating": "Отражающая броня",
|
||||
"Angled Plating": "Угловая броня",
|
||||
"Layered Plating": "Многослойная броня",
|
||||
"Deep Plating": "Утолщённая броня",
|
||||
"Deep Plating": "Утолщенная броня",
|
||||
"Expanded Probe Scanning Radius": "Увеличение радиуса сканирования зондов",
|
||||
"High charge capacity": "Высокоёмкий",
|
||||
"Charge enhanced": "Быстрозаряжающийся",
|
||||
@@ -670,8 +666,8 @@
|
||||
"Combat": "Боец",
|
||||
"Trader": "Торговец",
|
||||
"Explorer": "Исследователь",
|
||||
"Planetary Explorer": "Исследователь планет",
|
||||
"Miner": "Старатель",
|
||||
"Planetary Explorer": "Планетарный исследователь",
|
||||
"Miner": "Шахтер",
|
||||
"Racer": "Гонщик",
|
||||
|
||||
"Aberrant Shield Pattern Analysis": "Анализ аномального поведения щита",
|
||||
@@ -695,7 +691,7 @@
|
||||
"Chemical Manipulators": "Манипуляторы для работы с химикатами",
|
||||
"Chemical Processors": "Оборудование для химобработки",
|
||||
"Chromium": "Хром",
|
||||
"Classified Scan Databanks": "Засекреченные базы данных сканирования",
|
||||
"Classified Scan Databanks": "Засекреченные базы данных сканированоя",
|
||||
"Classified Scan Fragment": "Засекреченные фрагменты данных сканирования",
|
||||
"Compound Shielding": "Многоступенчатая защита",
|
||||
"Conductive Ceramics": "Проводящая керамика",
|
||||
@@ -706,7 +702,7 @@
|
||||
"Cracked Industrial Firmware": "Взломанные промышленные микропрограммы",
|
||||
"Datamined Wake Exceptions": "Исключения из глубинного анализа данных следа",
|
||||
"Decoded Emission Data": "Расшифрованные данные об излучении",
|
||||
"Distorted Shield Cycle Recordings": "Повреждённые цикличные записи щита",
|
||||
"Distorted Shield Cycle Recordings": "Поврежденные цикличные записи щита",
|
||||
"Divergent Scan Data": "Неформатные данные сканирования",
|
||||
"Eccentric Hyperspace Trajectories": "Аномальные траектории в гиперпространстве",
|
||||
"Electrochemical Arrays": "Электрохимические массивы",
|
||||
@@ -721,7 +717,7 @@
|
||||
"Heat Dispersion Plate": "Теплорассеивающая пластина",
|
||||
"Heat Exchangers": "Теплообменные агрегаты",
|
||||
"Heat Vanes": "Тепловые заслонки",
|
||||
"High Density Composites": "Высокоплотностные композиты",
|
||||
"High Density Composites": "Высокоплотные композиты",
|
||||
"Hybrid Capacitors": "Гибридные конденсаторы",
|
||||
"Imperial Shielding": "Имперская защита",
|
||||
"Improvised Components": "Кустарные компоненты",
|
||||
@@ -735,8 +731,8 @@
|
||||
"Mercury": "Ртуть",
|
||||
"Military Grade Alloys": "Сплавы военного назначения",
|
||||
"Military Supercapacitors": "Военные суперконденсаторы",
|
||||
"Modified Consumer Firmware": "Изменённые пользовательские микропрограммы",
|
||||
"Modified Embedded Firmware": "Изменённые встроенные микропрограммы",
|
||||
"Modified Consumer Firmware": "Измененные пользовательские микропрограммы",
|
||||
"Modified Embedded Firmware": "Измененные встроенные микропрограммы",
|
||||
"Molybdenum": "Молибден",
|
||||
"Nickel": "Никель",
|
||||
"Niobium": "Ниобий",
|
||||
@@ -745,7 +741,7 @@
|
||||
"Phase Alloys": "Фазовые сплавы",
|
||||
"Phosphorus": "Фосфор",
|
||||
"Polymer Capacitors": "Полимерные конденсаторы",
|
||||
"Precipitated Alloys": "Осаждённые сплавы",
|
||||
"Precipitated Alloys": "Осажденные сплавы",
|
||||
"Proprietary Composites": "Патентованные композиты",
|
||||
"Proto Heat Radiators": "Прототипы теплоизлучателей",
|
||||
"Proto Radiolic Alloys": "Сплавы для изготовления зондов",
|
||||
@@ -753,15 +749,15 @@
|
||||
"Ruthenium": "Рутений",
|
||||
"Salvaged Alloys": "Захваченные сплавы",
|
||||
"Security Firmware Patch": "Обновление для защитной микропрограммы",
|
||||
"Selenium": "Селен",
|
||||
"Selenium": "Селениум",
|
||||
"Shield Emitters": "Щитоизлучатели",
|
||||
"Shielding Sensors": "Сенсоры системы экранирования",
|
||||
"Specialised Legacy Firmware": "Специальные микропрограммы предыдущего поколения",
|
||||
"Strange Wake Solutions": "Странные расчёты следа",
|
||||
"Strange Wake Solutions": "Странные расчеты следа",
|
||||
"Sulphur": "Сера",
|
||||
"Tagged Encryption Codes": "Меченные шифровальные коды",
|
||||
"Technetium": "Технеций",
|
||||
"Tellurium": "Теллур",
|
||||
"Tellurium": "Теллурий",
|
||||
"Thermic Alloys": "Термические сплавы",
|
||||
"Tin": "Олово",
|
||||
"Tungsten": "Вольфрам",
|
||||
|
||||
@@ -1,6 +1,12 @@
|
||||
import '@babel/polyfill';
|
||||
import React from 'react';
|
||||
import { render } from 'react-dom';
|
||||
import '../less/app.less';
|
||||
import Coriolis from './Coriolis';
|
||||
// import TapEventPlugin from 'react/lib/TapEventPlugin';
|
||||
// import EventPluginHub from 'react/lib/EventPluginHub';
|
||||
|
||||
// onTouchTap not ready for primetime yet, too many issues with preventing default
|
||||
// EventPluginHub.injection.injectEventPluginsByName({ TapEventPlugin });
|
||||
|
||||
render(<Coriolis />, document.getElementById('coriolis'));
|
||||
|
||||
@@ -1,627 +0,0 @@
|
||||
import React from 'react';
|
||||
import Page from './Page';
|
||||
import Router from '../Router';
|
||||
import cn from 'classnames';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import { fromComparison, toComparison } from '../shipyard/Serializer';
|
||||
import Persist from '../stores/Persist';
|
||||
import { SizeMap, ShipFacets } from '../shipyard/Constants';
|
||||
import ComparisonTable from '../components/ComparisonTable';
|
||||
import BarChart from '../components/BarChart';
|
||||
import ModalCompare from '../components/ModalCompare';
|
||||
import ModalExport from '../components/ModalExport';
|
||||
import ModalPermalink from '../components/ModalPermalink';
|
||||
import ModalImport from '../components/ModalImport';
|
||||
import {
|
||||
FloppyDisk,
|
||||
Bin,
|
||||
Download,
|
||||
Embed,
|
||||
Rocket,
|
||||
LinkIcon
|
||||
} from '../components/SvgIcons';
|
||||
import ShortenUrl from '../utils/ShortenUrl';
|
||||
import { comparisonBBCode } from '../utils/BBCode';
|
||||
const browser = require('detect-browser');
|
||||
|
||||
/**
|
||||
* Creates a comparator based on the specified predicate
|
||||
* @param {string} predicate Predicate / propterty name
|
||||
* @return {Function} Comparator
|
||||
*/
|
||||
function sortBy(predicate) {
|
||||
return (a, b) => {
|
||||
if (a[predicate] === b[predicate]) {
|
||||
if (a.name == b.name) {
|
||||
a.buildName.toLowerCase() > b.buildName.toLowerCase() ? 1 : -1;
|
||||
}
|
||||
return a.name.toLowerCase() > b.name.toLowerCase() ? 1 : -1;
|
||||
}
|
||||
if (typeof a[predicate] == 'string') {
|
||||
return a[predicate].toLowerCase() > b[predicate].toLowerCase() ? 1 : -1;
|
||||
}
|
||||
return a[predicate] > b[predicate] ? 1 : -1;
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Comparison Page
|
||||
*/
|
||||
export default class ComparisonPage extends Page {
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context);
|
||||
this._sortShips = this._sortShips.bind(this);
|
||||
this._buildsSelected = this._buildsSelected.bind(this);
|
||||
this._updateDiscounts = this._updateDiscounts.bind(this);
|
||||
this.state = this._initState(context);
|
||||
}
|
||||
|
||||
/**
|
||||
* [Re]Create initial state from context
|
||||
* @param {context} context React component context
|
||||
* @return {Object} New state object
|
||||
*/
|
||||
_initState(context) {
|
||||
let defaultFacets = [13, 12, 11, 9, 6, 4, 1, 3, 2]; // Reverse order of Armour, Shields, Speed, Jump Range, Cargo Capacity, Cost, DPS, EPS, HPS
|
||||
let params = context.route.params;
|
||||
let code = params.code;
|
||||
let name = params.name ? decodeURIComponent(params.name) : null;
|
||||
let newName = '';
|
||||
let compareMode = !code;
|
||||
let builds = [];
|
||||
let saved = false;
|
||||
let predicate = 'name';
|
||||
let desc = false;
|
||||
let importObj = {};
|
||||
|
||||
if (compareMode) {
|
||||
if (name == 'all') {
|
||||
let allBuilds = Persist.getBuilds();
|
||||
newName = name;
|
||||
for (let shipId in allBuilds) {
|
||||
for (let buildName in allBuilds[shipId]) {
|
||||
if (buildName && allBuilds[shipId][buildName]) {
|
||||
builds.push(
|
||||
this._createBuild(
|
||||
shipId,
|
||||
buildName,
|
||||
allBuilds[shipId][buildName]
|
||||
)
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
let comparisonData = Persist.getComparison(name);
|
||||
if (comparisonData) {
|
||||
defaultFacets = comparisonData.facets;
|
||||
comparisonData.builds.forEach(b =>
|
||||
builds.push(this._createBuild(b.shipId, b.buildName))
|
||||
);
|
||||
saved = true;
|
||||
newName = name;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
try {
|
||||
let comparisonData = toComparison(code);
|
||||
defaultFacets = comparisonData.f;
|
||||
newName = name = comparisonData.n;
|
||||
predicate = comparisonData.p;
|
||||
desc = comparisonData.d;
|
||||
comparisonData.b.forEach(build => {
|
||||
builds.push(this._createBuild(build.s, build.n, build.c));
|
||||
if (!importObj[build.s]) {
|
||||
importObj[build.s] = {};
|
||||
}
|
||||
importObj[build.s][build.n] = build.c;
|
||||
});
|
||||
} catch (e) {
|
||||
throw { type: 'bad-comparison', message: e.message, details: e };
|
||||
}
|
||||
}
|
||||
|
||||
let facets = [];
|
||||
let selectedLength = defaultFacets.length;
|
||||
let selectedFacets = new Array(selectedLength);
|
||||
|
||||
for (let i = 0; i < ShipFacets.length; i++) {
|
||||
let facet = Object.assign({}, ShipFacets[i]);
|
||||
let defaultIndex = defaultFacets.indexOf(facet.i);
|
||||
if (defaultIndex == -1) {
|
||||
facets.push(facet);
|
||||
} else {
|
||||
facet.active = true;
|
||||
selectedFacets[selectedLength - defaultIndex - 1] = facet;
|
||||
}
|
||||
}
|
||||
|
||||
facets = selectedFacets.concat(facets);
|
||||
builds.sort(sortBy(predicate));
|
||||
|
||||
return {
|
||||
title: 'Coriolis EDCD Edition - Compare',
|
||||
predicate,
|
||||
desc,
|
||||
facets,
|
||||
builds,
|
||||
compareMode,
|
||||
code,
|
||||
name,
|
||||
newName,
|
||||
saved,
|
||||
importObj
|
||||
};
|
||||
}
|
||||
/**
|
||||
* Create a Ship instance / build
|
||||
* @param {string} id Ship Id
|
||||
* @param {name} name Build name
|
||||
* @param {string} code Optional - Serialized ship code
|
||||
* @return {Object} Ship instance with build name
|
||||
*/
|
||||
_createBuild(id, name, code) {
|
||||
code = code ? code : Persist.getBuild(id, name); // Retrieve build code if not passed
|
||||
|
||||
if (!code) {
|
||||
// No build found
|
||||
return;
|
||||
}
|
||||
|
||||
let data = Ships[id]; // Get ship properties
|
||||
let b = new Ship(id, data.properties, data.slots); // Create a new Ship instance
|
||||
b.buildFrom(code); // Populate components from code
|
||||
b.buildName = name;
|
||||
b.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
|
||||
return b;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state with the specified sort predicates
|
||||
* @param {String} predicate Sort predicate - property name
|
||||
*/
|
||||
_sortShips(predicate) {
|
||||
let { builds, desc } = this.state;
|
||||
if (this.state.predicate == predicate) {
|
||||
desc = !desc;
|
||||
}
|
||||
|
||||
builds.sort(sortBy(predicate));
|
||||
|
||||
if (desc) {
|
||||
builds.reverse();
|
||||
}
|
||||
|
||||
this.setState({ predicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Show selected builds modal
|
||||
*/
|
||||
_selectBuilds() {
|
||||
this.context.showModal(
|
||||
<ModalCompare
|
||||
onSelect={this._buildsSelected}
|
||||
builds={this.state.builds}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update selected builds with new list
|
||||
* @param {Array} newBuilds List of new builds
|
||||
*/
|
||||
_buildsSelected(newBuilds) {
|
||||
this.context.hideModal();
|
||||
let builds = [];
|
||||
|
||||
for (let b of newBuilds) {
|
||||
builds.push(this._createBuild(b.id, b.buildName));
|
||||
}
|
||||
|
||||
this.setState({ builds, saved: false });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle facet display
|
||||
* @param {string} facet Facet / Ship Property
|
||||
*/
|
||||
_toggleFacet(facet) {
|
||||
facet.active = !facet.active;
|
||||
this.setState({ facets: [].concat(this.state.facets), saved: false });
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle facet drag
|
||||
* @param {Event} e Drag Event
|
||||
*/
|
||||
_facetDrag(e) {
|
||||
this.nodeAfter = false;
|
||||
this.dragged = e.currentTarget;
|
||||
let placeholder = (this.placeholder = document.createElement('li'));
|
||||
placeholder.style.width = Math.round(this.dragged.offsetWidth) + 'px';
|
||||
placeholder.className = 'facet-placeholder';
|
||||
if (!browser || (browser.name !== 'edge' && browser.name !== 'ie')) {
|
||||
e.dataTransfer.effectAllowed = 'move';
|
||||
e.dataTransfer.setData('text/html', e.currentTarget);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle facet drop
|
||||
* @param {Event} e Drop Event
|
||||
*/
|
||||
_facetDrop(e) {
|
||||
this.dragged.parentNode.removeChild(this.placeholder);
|
||||
let facets = this.state.facets;
|
||||
let frm = Number(this.dragged.dataset.i);
|
||||
let to = Number(this.over.dataset.i);
|
||||
|
||||
if (frm < to) {
|
||||
to--;
|
||||
}
|
||||
if (this.nodeAfter) {
|
||||
to++;
|
||||
}
|
||||
|
||||
facets.splice(to, 0, facets.splice(frm, 1)[0]);
|
||||
this.dragged.style.display = null;
|
||||
this.setState({ facets: [].concat(facets), saved: false });
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle facet drag over
|
||||
* @param {Event} e Drag over Event
|
||||
*/
|
||||
_facetDragOver(e) {
|
||||
e.preventDefault();
|
||||
|
||||
if (e.target.className == 'facet-placeholder') {
|
||||
return;
|
||||
} else if (e.target != e.currentTarget) {
|
||||
this.over = e.target;
|
||||
this.dragged.style.display = 'none';
|
||||
let relX = e.clientX - this.over.getBoundingClientRect().left;
|
||||
let width = this.over.offsetWidth / 2;
|
||||
let parent = e.target.parentNode;
|
||||
|
||||
if (parent == e.currentTarget) {
|
||||
if (relX > width && this.dragged != e.target) {
|
||||
this.nodeAfter = true;
|
||||
parent.insertBefore(this.placeholder, e.target.nextElementSibling);
|
||||
} else {
|
||||
this.nodeAfter = false;
|
||||
parent.insertBefore(this.placeholder, e.target);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Handle name change and update state
|
||||
* @param {SyntheticEvent} e Event
|
||||
*/
|
||||
_onNameChange(e) {
|
||||
this.setState({ newName: e.target.value, saved: false });
|
||||
}
|
||||
|
||||
/**
|
||||
* Delete the current comparison
|
||||
*/
|
||||
_delete() {
|
||||
Persist.deleteComparison(this.state.name);
|
||||
Router.go('/compare');
|
||||
}
|
||||
|
||||
/**
|
||||
* Import the comparison builds
|
||||
*/
|
||||
_import() {
|
||||
let builds = {};
|
||||
|
||||
for (let ship of this.state.builds) {
|
||||
if (!builds[ship.id]) {
|
||||
builds[ship.id] = {};
|
||||
}
|
||||
builds[ship.id][ship.buildName] = ship.toString();
|
||||
}
|
||||
|
||||
this.context.showModal(<ModalImport builds={builds} />);
|
||||
}
|
||||
|
||||
/**
|
||||
* Save the current comparison
|
||||
*/
|
||||
_save() {
|
||||
let { newName, builds, facets } = this.state;
|
||||
let selectedFacets = [];
|
||||
|
||||
facets.forEach(f => {
|
||||
if (f.active) {
|
||||
selectedFacets.unshift(f.i);
|
||||
}
|
||||
});
|
||||
|
||||
Persist.saveComparison(newName, builds, selectedFacets);
|
||||
Router.replace(`/compare/${encodeURIComponent(this.state.newName)}`);
|
||||
this.setState({ name: newName, saved: true });
|
||||
}
|
||||
|
||||
/**
|
||||
* Serialize and generate a long URL for the current comparison
|
||||
* @return {string} URL for serialized comparison
|
||||
*/
|
||||
_buildUrl() {
|
||||
let { facets, builds, name, predicate, desc } = this.state;
|
||||
let selectedFacets = [];
|
||||
|
||||
for (let f of facets) {
|
||||
if (f.active) {
|
||||
selectedFacets.unshift(f.i);
|
||||
}
|
||||
}
|
||||
|
||||
let code = fromComparison(name, builds, selectedFacets, predicate, desc);
|
||||
let loc = window.location;
|
||||
return (
|
||||
loc.protocol +
|
||||
'//' +
|
||||
loc.host +
|
||||
'/comparison?code=' +
|
||||
encodeURIComponent(code)
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generates the long permalink URL
|
||||
*/
|
||||
_genPermalink() {
|
||||
this.context.showModal(<ModalPermalink url={this._buildUrl()} />);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate E:D Forum BBCode and show in the export modal
|
||||
*/
|
||||
_genBBcode() {
|
||||
let { translate, formats } = this.context.language;
|
||||
let { facets, builds } = this.state;
|
||||
|
||||
let generator = callback => {
|
||||
let url = this._buildUrl();
|
||||
ShortenUrl(
|
||||
url,
|
||||
shortenedUrl =>
|
||||
callback(
|
||||
comparisonBBCode(translate, formats, facets, builds, shortenedUrl)
|
||||
),
|
||||
error =>
|
||||
callback(comparisonBBCode(translate, formats, facets, builds, url))
|
||||
);
|
||||
};
|
||||
|
||||
this.context.showModal(
|
||||
<ModalExport
|
||||
title={translate('forum') + ' BBCode'}
|
||||
generator={generator}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update dimenions from rendered DOM
|
||||
*/
|
||||
_updateDimensions() {
|
||||
this.setState({
|
||||
chartWidth: this.chartRef.offsetWidth
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Update all ship costs on disount change
|
||||
*/
|
||||
_updateDiscounts() {
|
||||
let shipDiscount = Persist.getShipDiscount();
|
||||
let moduleDiscount = Persist.getModuleDiscount();
|
||||
let builds = [];
|
||||
|
||||
for (let b of this.state.builds) {
|
||||
builds.push(b.applyDiscounts(shipDiscount, moduleDiscount));
|
||||
}
|
||||
|
||||
this.setState({ builds });
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state based on context changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (this.context.route !== nextContext.route) {
|
||||
// Only reinit state if the route has changed
|
||||
this.setState(this._initState(nextContext));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Add listeners when about to mount
|
||||
*/
|
||||
componentWillMount() {
|
||||
this.resizeListener = this.context.onWindowResize(this._updateDimensions);
|
||||
this.persistListener = Persist.addListener(
|
||||
'discounts',
|
||||
this._updateDiscounts
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Trigger DOM updates on mount
|
||||
*/
|
||||
componentDidMount() {
|
||||
this._updateDimensions();
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove listeners on unmount
|
||||
*/
|
||||
componentWillUnmount() {
|
||||
this.resizeListener.remove();
|
||||
this.persistListener.remove();
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the Page
|
||||
* @return {React.Component} The page contents
|
||||
*/
|
||||
renderPage() {
|
||||
let translate = this.context.language.translate;
|
||||
let compareHeader;
|
||||
let {
|
||||
newName,
|
||||
name,
|
||||
saved,
|
||||
builds,
|
||||
facets,
|
||||
predicate,
|
||||
desc,
|
||||
chartWidth
|
||||
} = this.state;
|
||||
|
||||
if (this.state.compareMode) {
|
||||
compareHeader = (
|
||||
<tr>
|
||||
<td className="head">{translate('comparison')}</td>
|
||||
<td>
|
||||
<input
|
||||
value={newName}
|
||||
onChange={this._onNameChange}
|
||||
placeholder={translate('Enter Name')}
|
||||
maxLength="50"
|
||||
/>
|
||||
<button
|
||||
onClick={this._save}
|
||||
disabled={!newName || newName == 'all' || saved}
|
||||
>
|
||||
<FloppyDisk className="lg" />
|
||||
<span className="button-lbl">{translate('save')}</span>
|
||||
</button>
|
||||
<button onClick={this._delete} disabled={name == 'all' || !saved}>
|
||||
<Bin className="lg warning" />
|
||||
</button>
|
||||
<button onClick={this._selectBuilds}>
|
||||
<Rocket className="lg" />
|
||||
<span className="button-lbl">{translate('builds')}</span>
|
||||
</button>
|
||||
<button
|
||||
className="r"
|
||||
onClick={this._genPermalink}
|
||||
disabled={builds.length == 0}
|
||||
>
|
||||
<LinkIcon className="lg" />
|
||||
<span className="button-lbl">{translate('permalink')}</span>
|
||||
</button>
|
||||
<button
|
||||
className="r"
|
||||
onClick={this._genBBcode}
|
||||
disabled={builds.length == 0}
|
||||
>
|
||||
<Embed className="lg" />
|
||||
<span className="button-lbl">{translate('forum')}</span>
|
||||
</button>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
} else {
|
||||
compareHeader = (
|
||||
<tr>
|
||||
<td className="head">{translate('comparison')}</td>
|
||||
<td>
|
||||
<h3>{name}</h3>
|
||||
<button className="r" onClick={this._import}>
|
||||
<Download className="lg" />
|
||||
{translate('import')}
|
||||
</button>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
|
||||
return (
|
||||
<div
|
||||
className={'page'}
|
||||
style={{ fontSize: this.context.sizeRatio + 'em' }}
|
||||
>
|
||||
<table id="comparison">
|
||||
<tbody>
|
||||
{compareHeader}
|
||||
<tr key="facets">
|
||||
<td className="head">{translate('compare')}</td>
|
||||
<td>
|
||||
<ul id="facet-container" onDragOver={this._facetDragOver}>
|
||||
{facets.map((f, i) => (
|
||||
<li
|
||||
key={f.title}
|
||||
data-i={i}
|
||||
draggable="true"
|
||||
onDragStart={this._facetDrag}
|
||||
onDragEnd={this._facetDrop}
|
||||
className={cn('facet', { active: f.active })}
|
||||
onClick={this._toggleFacet.bind(this, f)}
|
||||
>
|
||||
{'↔ ' + translate(f.title)}
|
||||
</li>
|
||||
))}
|
||||
</ul>
|
||||
</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
<ComparisonTable
|
||||
builds={builds}
|
||||
facets={facets}
|
||||
onSort={this._sortShips}
|
||||
predicate={predicate}
|
||||
desc={desc}
|
||||
/>
|
||||
|
||||
{!builds.length ? (
|
||||
<div className="chart" ref={node => (this.chartRef = node)}>
|
||||
{translate('PHRASE_NO_BUILDS')}
|
||||
</div>
|
||||
) : (
|
||||
facets.filter(f => f.active).map((f, i) => (
|
||||
<div
|
||||
key={f.title}
|
||||
className="chart"
|
||||
ref={i == 0 ? node => (this.chartRef = node) : null}
|
||||
>
|
||||
<h3
|
||||
className="ptr"
|
||||
onClick={this._sortShips.bind(this, f.props[0])}
|
||||
>
|
||||
{translate(f.title)}
|
||||
</h3>
|
||||
<BarChart
|
||||
width={chartWidth}
|
||||
data={builds}
|
||||
properties={f.props}
|
||||
labels={f.lbls}
|
||||
unit={translate(f.unit)}
|
||||
format={f.fmt}
|
||||
title={translate(f.title)}
|
||||
predicate={predicate}
|
||||
desc={desc}
|
||||
/>
|
||||
</div>
|
||||
))
|
||||
)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -5,7 +5,6 @@ import PropTypes from 'prop-types';
|
||||
* Unexpected Error page / block
|
||||
*/
|
||||
export default class ErrorDetails extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
route: PropTypes.object.isRequired,
|
||||
language: PropTypes.object.isRequired
|
||||
@@ -45,9 +44,6 @@ export default class ErrorDetails extends React.Component {
|
||||
return <div className='error'>
|
||||
<h1>Jameson, we have a problem..</h1>
|
||||
<h1><small>{error.message}</small></h1>
|
||||
Import Error handling has been improved, but still isn't perfect. <br/>MOST Import failures are a result of missing modules in Coriolis, <br />OR incorrect import strings generated by third party apps. If you're seeing this page, we may have failed to handle the errors in your import correctly. Please see the data output below, specifically the 'scriptUrl:' section if it's there and then if you feel confident enough, please check the github issues page linked below and see if there is a similar issue already logged. If not, please create a new issue with the data below. If you're not confident, please ask for help on the Coriolis Channel of the EDCD Discord server.
|
||||
<br/>
|
||||
<br/>
|
||||
<br/>
|
||||
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
|
||||
<br/>
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Abstract/Base Page
|
||||
*/
|
||||
export default class Page extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
closeMenu: PropTypes.func.isRequired,
|
||||
hideModal: PropTypes.func.isRequired,
|
||||
@@ -92,5 +91,4 @@ export default class Page extends React.Component {
|
||||
}
|
||||
return this.renderPage();
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,102 +1,81 @@
|
||||
import React from 'react';
|
||||
import Page from './Page';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import cn from 'classnames';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { Factory } from 'ed-forge';
|
||||
import { JUMP_METRICS } from 'ed-forge/lib/src/ship-stats';
|
||||
import { SizeMap } from '../shipyard/Constants';
|
||||
import Link from '../components/Link';
|
||||
|
||||
/**
|
||||
* Counts the hardpoints by class/size
|
||||
* @param {Object} slot Hardpoint Slot model
|
||||
*/
|
||||
function countHp(slot) {
|
||||
this.hp[slot.maxClass]++;
|
||||
this.hpCount++;
|
||||
}
|
||||
|
||||
/**
|
||||
* Counts the internal slots and aggregated properties
|
||||
* @param {Object} slot Internal Slots
|
||||
*/
|
||||
function countInt(slot) {
|
||||
let crEligible = !slot.eligible || slot.eligible.cr;
|
||||
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
|
||||
this.intCount++;
|
||||
this.maxCargo += crEligible ?
|
||||
ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo :
|
||||
0;
|
||||
|
||||
// if no eligiblity, then assume pce
|
||||
let passSlotType = null;
|
||||
let passSlotRating = null;
|
||||
if (!slot.eligible || slot.eligible.pce) {
|
||||
passSlotType = 'pce';
|
||||
passSlotRating = 'E';
|
||||
} else if (slot.eligible.pci) {
|
||||
passSlotType = 'pci';
|
||||
passSlotRating = 'D';
|
||||
} else if (slot.eligible.pcm) {
|
||||
passSlotType = 'pcm';
|
||||
passSlotRating = 'C';
|
||||
} else if (slot.eligible.pcq) {
|
||||
passSlotType = 'pcq';
|
||||
passSlotRating = 'B';
|
||||
}
|
||||
let passengerBay = passSlotType ?
|
||||
ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) :
|
||||
null;
|
||||
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate Ship summary and aggregated properties
|
||||
* @param {String} shipId Ship Id
|
||||
* @param {Object} shipData Ship Default Data
|
||||
* @return {Object} Ship summary and aggregated properties
|
||||
*/
|
||||
function shipSummary(shipId, shipData) {
|
||||
function shipSummary(shipId) {
|
||||
// Build Ship
|
||||
let ship = Factory.newShip(shipId);
|
||||
|
||||
let coreSizes = ship.readMeta('coreSizes');
|
||||
let { jumpRangeLaden, totalRange } = ship.getMetrics(JUMP_METRICS);
|
||||
let summary = {
|
||||
agility: ship.readProp('pitch') + ship.readProp('yaw') + ship.readProp('roll'),
|
||||
baseArmour: ship.readProp('basearmour'),
|
||||
baseShieldStrength: ship.readProp('baseshieldstrength'),
|
||||
boost: ship.readProp('boost'),
|
||||
class: ship.readMeta('class'),
|
||||
crew: ship.readMeta('crew'),
|
||||
id: shipId,
|
||||
hardness: ship.readProp('hardness'),
|
||||
hpCount: 0,
|
||||
hullMass: ship.readProp('hullmass'),
|
||||
intCount: 0,
|
||||
beta: shipData.beta,
|
||||
maxCargo: 0,
|
||||
maxPassengers: 0,
|
||||
masslock: ship.readProp('masslock'),
|
||||
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
|
||||
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
|
||||
standard: shipData.slots.standard,
|
||||
agility:
|
||||
shipData.properties.pitch +
|
||||
shipData.properties.yaw +
|
||||
shipData.properties.roll
|
||||
jumpRangeLaden,
|
||||
pitch: ship.readProp('pitch'),
|
||||
retailCost: ship.readMeta('retailCost'),
|
||||
roll: ship.readProp('roll'),
|
||||
speed: ship.readProp('speed'),
|
||||
standard: [
|
||||
'powerplant',
|
||||
'mainengines',
|
||||
'frameshiftdrive',
|
||||
'lifesupport',
|
||||
'powerdistributor',
|
||||
'radar',
|
||||
'fueltank'
|
||||
].map(k => coreSizes[k]),
|
||||
totalRange,
|
||||
yaw: ship.readProp('yaw'),
|
||||
};
|
||||
Object.assign(summary, shipData.properties);
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
|
||||
// Build Ship
|
||||
ship.buildWith(shipData.defaults); // Populate with stock/default components
|
||||
ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class
|
||||
ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class
|
||||
summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost
|
||||
ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range
|
||||
summary.maxJumpRange = ship.unladenRange; // Record Jump Range
|
||||
// Count Hardpoints by class
|
||||
ship.getHardpoints(undefined, true).forEach(hardpoint => {
|
||||
summary.hp[hardpoint.getSizeNum()]++;
|
||||
summary.hpCount++;
|
||||
});
|
||||
// Count Internal Compartments by class
|
||||
let maxCargo = 0, maxPassengers = 0;
|
||||
ship.getInternals(undefined, true).forEach(internal => {
|
||||
const size = String(internal.getSizeNum());
|
||||
summary.int[size]++;
|
||||
summary.intCount++;
|
||||
|
||||
// Best thrusters
|
||||
let th;
|
||||
if (ship.standard[1].maxClass === 3) {
|
||||
th = 'tz';
|
||||
} else if (ship.standard[1].maxClass === 2) {
|
||||
th = 'u0';
|
||||
} else {
|
||||
th = ship.standard[1].maxClass + 'A';
|
||||
}
|
||||
// Try cargo racks
|
||||
try {
|
||||
internal.setItem('cargorack', size);
|
||||
maxCargo += internal.get('cargo');
|
||||
} catch {}
|
||||
// Try economy cabins
|
||||
try {
|
||||
internal.setItem('passengercabins', size < '6' ? size : '6', '1');
|
||||
maxPassengers += internal.get('cabincapacity');
|
||||
} catch {}
|
||||
});
|
||||
|
||||
ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters
|
||||
summary.topSpeed = ship.topSpeed;
|
||||
summary.topBoost = ship.topBoost;
|
||||
summary.baseArmour = ship.armour;
|
||||
summary.maxCargo = maxCargo;
|
||||
summary.maxPassengers = maxPassengers;
|
||||
|
||||
return summary;
|
||||
}
|
||||
@@ -117,14 +96,14 @@ export default class ShipyardPage extends Page {
|
||||
|
||||
if (!ShipyardPage.cachedShipSummaries) {
|
||||
ShipyardPage.cachedShipSummaries = [];
|
||||
for (let s in Ships) {
|
||||
ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s]));
|
||||
for (let s of Factory.getAllShipTypes()) {
|
||||
ShipyardPage.cachedShipSummaries.push(shipSummary(s));
|
||||
}
|
||||
}
|
||||
|
||||
this.state = {
|
||||
title: 'Coriolis EDCD Edition - Shipyard',
|
||||
shipPredicate: 'name',
|
||||
shipPredicate: 'id',
|
||||
shipDesc: true,
|
||||
shipSummaries: ShipyardPage.cachedShipSummaries,
|
||||
compare: {},
|
||||
@@ -157,7 +136,7 @@ export default class ShipyardPage extends Page {
|
||||
* @private
|
||||
*/
|
||||
_toggleGroupCompared() {
|
||||
this.setState({groupCompared: !this.state.groupCompared})
|
||||
this.setState({ groupCompared: !this.state.groupCompared });
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -209,16 +188,18 @@ export default class ShipyardPage extends Page {
|
||||
<td className="ri cap">{translate(SizeMap[s.class])}</td>
|
||||
<td className="ri">{fInt(s.crew)}</td>
|
||||
<td className="ri">{s.masslock}</td>
|
||||
<td className="ri">{fInt(s.agility)}</td>
|
||||
<td className="ri">{fInt(s.hardness)}</td>
|
||||
<td className="ri">{fInt(s.hullMass)}</td>
|
||||
<td className="ri">{fInt(s.agility)}</td>
|
||||
<td className="ri">{fInt(s.speed)}</td>
|
||||
<td className="ri">{fInt(s.boost)}</td>
|
||||
<td className="ri">{fInt(s.pitch)}</td>
|
||||
<td className="ri">{fInt(s.yaw)}</td>
|
||||
<td className="ri">{fInt(s.roll)}</td>
|
||||
<td className="ri">{fRound(s.jumpRangeLaden)}</td>
|
||||
<td className="ri">{fRound(s.totalRange)}</td>
|
||||
<td className="ri">{fInt(s.hardness)}</td>
|
||||
<td className="ri">{fInt(s.baseArmour)}</td>
|
||||
<td className="ri">{fInt(s.baseShieldStrength)}</td>
|
||||
<td className="ri">{fInt(s.topSpeed)}</td>
|
||||
<td className="ri">{fInt(s.topBoost)}</td>
|
||||
<td className="ri">{fRound(s.maxJumpRange)}</td>
|
||||
<td className="ri">{fInt(s.maxCargo)}</td>
|
||||
<td className="ri">{fInt(s.maxPassengers)}</td>
|
||||
<td className="cn">{s.standard[0]}</td>
|
||||
@@ -254,7 +235,6 @@ export default class ShipyardPage extends Page {
|
||||
let { translate, formats, units } = language;
|
||||
let hide = this.context.tooltip.bind(null, null);
|
||||
let fInt = formats.int;
|
||||
let fRound = formats.round;
|
||||
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
|
||||
let sortShips = (predicate, index) =>
|
||||
this._sortShips.bind(this, predicate, index);
|
||||
@@ -298,7 +278,7 @@ export default class ShipyardPage extends Page {
|
||||
}
|
||||
|
||||
if (valA == valB) {
|
||||
if (a.name > b.name) {
|
||||
if (a.id > b.id) {
|
||||
return 1;
|
||||
} else {
|
||||
return -1;
|
||||
@@ -334,7 +314,7 @@ export default class ShipyardPage extends Page {
|
||||
onClick={() => this._toggleCompare(s.id)}
|
||||
>
|
||||
<td className="le">
|
||||
<Link href={'/outfit/' + s.id}>{s.name} {s.beta === true ? '(Beta)' : null}</Link>
|
||||
<Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
@@ -351,7 +331,7 @@ export default class ShipyardPage extends Page {
|
||||
<th className="le rgt"> </th>
|
||||
</tr>
|
||||
<tr className="main">
|
||||
<th className="sortable le rgt" onClick={sortShips('name')}>
|
||||
<th className="sortable le rgt" onClick={sortShips('id')}>
|
||||
{translate('ship')}
|
||||
</th>
|
||||
</tr>
|
||||
@@ -367,103 +347,87 @@ export default class ShipyardPage extends Page {
|
||||
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
|
||||
<thead>
|
||||
<tr className="main">
|
||||
{/* First all headers that spread out over three rows */}
|
||||
{/* cost placeholder */}
|
||||
<th> </th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('class')}
|
||||
>
|
||||
<th rowSpan={3} className="sortable" onClick={sortShips('class')}>
|
||||
{translate('size')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('crew')}
|
||||
>
|
||||
<th rowSpan={3} className="sortable" onClick={sortShips('crew')}>
|
||||
{translate('crew')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
<th rowSpan={3} className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'mass lock factor')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('masslock')}
|
||||
>
|
||||
onMouseLeave={hide} onClick={sortShips('masslock')}>
|
||||
{translate('MLF')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('agility')}
|
||||
>
|
||||
{translate('agility')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'hardness')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('hardness')}
|
||||
>
|
||||
{translate('hrd')}
|
||||
</th>
|
||||
{/* hull mass placeholder */}
|
||||
<th> </th>
|
||||
<th colSpan={6}>{translate('agility')}</th>
|
||||
<th colSpan={2}>{translate('travel')}</th>
|
||||
<th colSpan={3}>{translate('defence')}</th>
|
||||
{/* cargo placeholder */}
|
||||
<th> </th>
|
||||
{/* pax placeholder */}
|
||||
<th> </th>
|
||||
<th colSpan={4}>{translate('base')}</th>
|
||||
<th colSpan={5}>{translate('max')}</th>
|
||||
<th className="lft" colSpan={7} />
|
||||
<th className="lft" colSpan={5} />
|
||||
<th className="lft" colSpan={8} />
|
||||
</tr>
|
||||
<tr>
|
||||
<th
|
||||
className="sortable lft"
|
||||
onClick={sortShips('retailCost')}
|
||||
>
|
||||
{/* Now all headers in a second-row */}
|
||||
<th className="sortable lft" onClick={sortShips('retailCost')}>
|
||||
{translate('cost')}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('hullMass')}>
|
||||
{translate('hull')}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('speed')}>
|
||||
<th className="sortable lft" onClick={sortShips('agility')}>
|
||||
{translate('rating')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('speed')}>
|
||||
{translate('speed')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('boost')}>
|
||||
{translate('boost')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('pitch')}>
|
||||
{translate('pitch')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('yaw')}>
|
||||
{translate('yaw')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('roll')}>
|
||||
{translate('roll')}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
|
||||
{translate('jump')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('totalRange')}>
|
||||
{translate('range')}
|
||||
</th>
|
||||
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'hardness')}
|
||||
onMouseLeave={hide} onClick={sortShips('hardness')}>
|
||||
{translate('hrd')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('baseArmour')}>
|
||||
{translate('armour')}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onClick={sortShips('baseShieldStrength')}
|
||||
>
|
||||
<th className="sortable" onClick={sortShips('baseShieldStrength')}>
|
||||
{translate('shields')}
|
||||
</th>
|
||||
|
||||
<th className="sortable lft" onClick={sortShips('topSpeed')}>
|
||||
{translate('speed')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('topBoost')}>
|
||||
{translate('boost')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxJumpRange')}>
|
||||
{translate('jump')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxCargo')}>
|
||||
<th className="sortable lft" onClick={sortShips('maxCargo')}>
|
||||
{translate('cargo')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')}
|
||||
onMouseLeave={hide}>
|
||||
<th className="sortable lft" onClick={sortShips('maxPassengers')}
|
||||
onMouseEnter={termtip.bind(null, 'passenger capacity')} onMouseLeave={hide}>
|
||||
{translate('pax')}
|
||||
</th>
|
||||
<th className="lft" colSpan={7}>
|
||||
{translate('core module classes')}
|
||||
</th>
|
||||
<th
|
||||
colSpan={5}
|
||||
className="sortable lft"
|
||||
onClick={sortShips('hpCount')}
|
||||
>
|
||||
<th colSpan={5} className="sortable lft" onClick={sortShips('hpCount')}>
|
||||
{translate('hardpoints')}
|
||||
</th>
|
||||
<th
|
||||
@@ -475,6 +439,7 @@ export default class ShipyardPage extends Page {
|
||||
</th>
|
||||
</tr>
|
||||
<tr>
|
||||
{/* Third row headers, i.e., units */}
|
||||
<th
|
||||
className="sortable lft"
|
||||
onClick={sortShips('retailCost')}
|
||||
@@ -484,12 +449,31 @@ export default class ShipyardPage extends Page {
|
||||
<th className="sortable lft" onClick={sortShips('hullMass')}>
|
||||
{units.T}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('speed')}>
|
||||
{/* agility rating placeholder */}
|
||||
<th className="lft"> </th>
|
||||
<th className="sortable" onClick={sortShips('speed')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('boost')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('pitch')}>
|
||||
{units['°/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('yaw')}>
|
||||
{units['°/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('roll')}>
|
||||
{units['°/s']}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
|
||||
{units.LY}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('totalRange')}>
|
||||
{units.LY}
|
||||
</th>
|
||||
<th className="lft"> </th>
|
||||
{/* armour placeholder */}
|
||||
<th> </th>
|
||||
<th
|
||||
className="sortable"
|
||||
@@ -497,73 +481,37 @@ export default class ShipyardPage extends Page {
|
||||
>
|
||||
{units.MJ}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('topSpeed')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('topBoost')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxJumpRange')}>
|
||||
{units.LY}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxCargo')}>
|
||||
<th className="sortable lft" onClick={sortShips('maxCargo')}>
|
||||
{units.T}
|
||||
</th>
|
||||
<th> </th>
|
||||
<th
|
||||
className="sortable lft"
|
||||
onMouseEnter={termtip.bind(null, 'power plant')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 0)}
|
||||
>
|
||||
{/* pax placeholder */}
|
||||
<th className="lft"> </th>
|
||||
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'power plant')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 0)}>
|
||||
{'pp'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'thrusters')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 1)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'thrusters')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 1)}>
|
||||
{'th'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'frame shift drive')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 2)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'frame shift drive')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 2)}>
|
||||
{'fsd'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'life support')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 3)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'life support')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 3)}>
|
||||
{'ls'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'power distributor')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 4)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'power distriubtor')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 4)}>
|
||||
{'pd'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'sensors')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 5)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'sensors')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 5)}>
|
||||
{'s'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'fuel tank')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 6)}
|
||||
>
|
||||
<th className="sortable" onMouseEnter={termtip.bind(null, 'fuel tank')}
|
||||
onMouseLeave={hide} onClick={sortShips('standard', 6)}>
|
||||
{'ft'}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('hp', 1)}>
|
||||
@@ -615,7 +563,7 @@ export default class ShipyardPage extends Page {
|
||||
</div>
|
||||
</div>
|
||||
<div className="table-tools" >
|
||||
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>{translate('Group highlighted ships')}</label>
|
||||
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -25,6 +25,7 @@ export const ModuleGroupToName = {
|
||||
pd: 'Power Distributor',
|
||||
s: 'Sensors',
|
||||
ft: 'Fuel Tank',
|
||||
pas: 'Planetary Approach Suite',
|
||||
|
||||
// Internal
|
||||
fs: 'Fuel Scoop',
|
||||
@@ -57,9 +58,6 @@ export const ModuleGroupToName = {
|
||||
gmrp: 'Guardian Module Reinforcement Package',
|
||||
mahr: 'Meta Alloy Hull Reinforcement Package',
|
||||
sua: 'Supercruise Assist',
|
||||
mlc: "Multi Limpet Controller",
|
||||
rpl: "Repair Limpet Controller",
|
||||
pas: 'Planetary Approach Suite',
|
||||
|
||||
// Hard Points
|
||||
bl: 'Beam Laser',
|
||||
@@ -77,15 +75,11 @@ export const ModuleGroupToName = {
|
||||
nl: 'Mine Launcher',
|
||||
ml: 'Mining Laser',
|
||||
mr: 'Missile Rack',
|
||||
amr: 'Missile Rack (Advanced)',
|
||||
axmr: 'AX Missile Rack',
|
||||
axmre: 'AX Missile Rack (Enhanced)',
|
||||
pa: 'Plasma Accelerator',
|
||||
po: 'Point Defence',
|
||||
mc: 'Multi-cannon',
|
||||
advmc: 'Multi-cannon (Advanced)',
|
||||
axmc: 'AX Multi-cannon',
|
||||
axmce: 'AX Multi-cannon (Enhanced)',
|
||||
pl: 'Pulse Laser',
|
||||
rg: 'Rail Gun',
|
||||
sb: 'Shield Booster',
|
||||
|
||||
@@ -1,13 +0,0 @@
|
||||
/**
|
||||
* Modification - a modification and its value
|
||||
*/
|
||||
export default class Modification {
|
||||
/**
|
||||
* @param {String} id Unique modification ID
|
||||
* @param {Number} value Value of the modification
|
||||
*/
|
||||
constructor(id, value) {
|
||||
this.id = id;
|
||||
this.value = value;
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user