Compare commits

..

107 Commits

Author SHA1 Message Date
Felix Linker
25c30e46a6 Update detailed export to SLEF 2021-12-28 19:11:49 +01:00
Felix Linker
870c033c64 Make damage charts larger 2021-12-28 19:01:19 +01:00
Felix Linker
46b0200b28 Merge branch 'develop' into ed-forge 2021-12-28 18:58:52 +01:00
Felix Linker
e8bcb18f12 Dependency management 2021-12-28 18:41:47 +01:00
Felix Linker
68ca24ef96 Add module selection tooltip 2021-12-28 17:52:26 +01:00
Felix Linker
7ca2754934 Remove some NaNs from ship summary 2021-12-28 15:10:39 +01:00
Felix Linker
e82ab0aec0 Update multiple-slot actions to ed-forge 2021-12-28 00:38:51 +01:00
Felix Linker
d406018f0b Migrate ed-forge API change 2021-12-28 00:38:51 +01:00
Felix Linker
2438aa1f48 Remove tests 2021-12-27 16:16:41 +01:00
Felix Linker
c5bbeacc6a Update ed-forge import paths 2021-12-27 16:14:50 +01:00
Felix Linker
d9763f2db7 Remove unused code 2021-12-26 23:17:45 +01:00
Felix Linker
5692cc6fe3 Remove unused setting module resistances 2021-12-26 23:12:41 +01:00
Felix Linker
22cdfcdecf Fix settings menu 2021-12-26 23:09:23 +01:00
Felix Linker
3db3b09c22 Remove comparison page 2021-12-26 23:01:17 +01:00
Felix Linker
23c264e321 Drop calculations made redundant by ed-forge 2021-12-26 21:48:29 +01:00
Felix Linker
d2c3787165 Disable announcements 2021-12-26 18:13:06 +01:00
Felix Linker
1e18d6e463 Update header 2021-12-26 18:09:36 +01:00
Felix Linker
044fea2d33 Update material button 2021-12-26 16:16:36 +01:00
Felix Linker
bc865f534b Don't give material icon fill color in svg 2021-12-26 15:01:54 +01:00
Felix Linker
796694a4e0 Fix station that sells this build 2021-12-25 17:57:37 +01:00
Felix Linker
829815a40b Fix export 2021-12-25 17:50:53 +01:00
Felix Linker
7a2c849ece Show module tooltips using Module.try 2021-12-25 17:12:31 +01:00
Felix Linker
873dfaa305 Merge pull request #676 from stephendavidmarsh/feature/fix-dpe
Fix DPE calculations on offense tab
2021-09-26 17:21:49 +02:00
Felix Linker
7050356bce Merge pull request #675 from alexeygorb/feature/fix-inara-slef-import
Fix for engineered modules in SLEF imports from Inara.
2021-09-10 16:44:11 +02:00
Alexey Gorb
88c9bb0254 Fix for engineered modules in SLEF imports from Inara. Restored the deleted code. 2021-09-06 23:46:55 +02:00
Alexey Gorb
45f1dd2da9 Fix for engineered modules in SLEF imports from Inara. 2021-08-16 00:04:14 +02:00
Alexey Gorb
46bcc2313f Moved the resistance modifiers value calculation to the setModValue of a Module class. 2021-08-15 14:37:45 +02:00
Stephen Marsh
9e012c1490 Fix DPE calculations on offense tab 2021-08-11 10:15:23 -04:00
Alexey Gorb
50f9c0faa1 Fix for engineered modules in SLEF imports from Inara. Unused function removed. 2021-08-11 12:04:25 +02:00
Alexey Gorb
74829a09c0 Fix for engineered modules in SLEF imports from Inara. 2021-08-11 11:55:24 +02:00
Felix Linker
45508ba2d4 Merge pull request #673 from alexeygorb/feature/fix-inara-slef-import
Fix for engineered modules in SLEF imports from Inara.
2021-08-10 12:57:42 +02:00
Alexey Gorb
624adf2b64 Fix for engineered modules in SLEF imports from Inara. 2021-08-10 11:35:44 +02:00
Felix Linker
821daefeb8 Merge branch 'develop' 2021-08-08 11:24:07 +02:00
Felix Linker
86b95981f1 Merge pull request #666 from Athanasius/enhancement/readme-mention-npm-run-build
README: Call out `npm run build` alternative in developer instructions
2021-08-04 10:37:42 +02:00
Felix Linker
688eebb9ea Merge pull request #668 from gopstr/improve_russian
Update Russian translation
2021-08-04 10:36:09 +02:00
Pavel Strybuk
d719da2cde Translate 3 forgotten items 2021-06-12 22:22:37 +03:00
Pavel Strybuk
19c1851e14 Improve Russian translation 2021-06-12 21:59:29 +03:00
Pavel Strybuk
414bf4cb20 Translate selected experimental effect in dropdown 2021-06-12 21:59:25 +03:00
Pavel Strybuk
c674459376 Fix misprint 2021-06-12 21:59:21 +03:00
Athanasius
fd009fe567 README: Make a 'Deployment' section and move instructions there. 2021-05-28 11:41:04 +01:00
Athanasius
e28eccb6fb README: Call out npm run build alternative in developer instructions 2021-05-28 10:29:59 +01:00
Felix Linker
301c97db58 Merge pull request #663 from leonardofelin/master
Update pt.json
2021-05-22 15:48:51 +02:00
Felix Linker
2eed1bc85b Add time to deplete armour/shields 2021-05-15 20:21:00 +02:00
Felix Linker
3469af10b6 Update ShipPicker 2021-05-15 15:23:36 +02:00
Felix Linker
629ba35bc5 Update engagement range and slider 2021-05-15 14:58:10 +02:00
Felix Linker
c19ca6648d Update README 2021-05-14 10:37:16 +02:00
Felix Linker
e453ff73b7 Migrate changes to slot-representation 2021-05-14 10:22:28 +02:00
leonardofelin
cfdb92ecc6 Update pt.json 2021-05-12 16:49:56 -03:00
Felix Linker
de5ca7b5e6 Revert "Corrected calculations of modification values"
This reverts commit 49c827b2c8.
2021-05-12 08:49:00 +02:00
Felix Linker
c73ce1c234 Fix: don't cast mount symbol in available modules to string 2021-05-10 21:13:02 +02:00
Felix Linker
8676deba7d Merge branch 'develop' 2021-05-10 20:18:34 +02:00
Felix Linker
d3ce8d4f7c Remove unused hosting and CI files 2021-05-10 20:18:07 +02:00
Felix Linker
00d3a93b91 Re-design shipyard page
Closes #577
2021-05-09 20:09:15 +02:00
Felix Linker
d4e612cb61 Display module selection for alloys correctly
Closes #579
2021-05-09 18:42:37 +02:00
Felix Linker
c07cfc6e70 Don't round integers 2021-02-01 22:52:04 +01:00
Felix Linker
c4c6d32a5d Skip properties that do not apply to a module in blueprint tooltip 2021-02-01 22:41:41 +01:00
Felix Linker
a65bb06754 Implement tooltips for experimental effects 2021-02-01 22:40:01 +01:00
Felix Linker
23548e7c5c Remove redundant code 2021-02-01 22:14:22 +01:00
Felix Linker
74e6f54e19 Improve blueprint tooltips 2021-02-01 22:10:09 +01:00
Felix Linker
a46f8f97f6 Show blueprint grade in ascending order 2021-02-01 22:02:37 +01:00
Felix Linker
44dbdb1703 Don't show mass twice and allow to disable showing mass 2021-02-01 21:56:35 +01:00
Felix Linker
187c5dae4a Implement blueprint tooltips 2021-01-10 22:57:33 +01:00
Felix Linker
07d324a3fa Add key to property header in ModificationsMenu 2021-01-10 22:02:00 +01:00
Felix Linker
5c63afd96c Add stats mapper to show certain synthetic props in ModificationsMenu 2021-01-10 22:01:21 +01:00
Felix Linker
53c40ac9c4 Fix indentation 2021-01-10 21:59:22 +01:00
Felix Linker
a180cbfdd4 Fix: showProp is not required in <Modification> 2021-01-10 21:58:35 +01:00
Felix Linker
fc1524a943 Support non-percent modifiers 2021-01-03 12:32:01 +01:00
Felix Linker
c3747e4e5e Add toggle for properties in overview 2021-01-03 10:17:10 +01:00
Felix Linker
ab153981c9 Rework Modifictaions(Menu) 2021-01-02 10:59:58 +01:00
Felix Linker
a970e052c1 Update react-number-editor
Mitigates a bug where non-rounded numbers were shown to the user.
2021-01-02 10:55:16 +01:00
Felix Linker
df7e264a02 Use package-lock.json
Otherwise `npm audit` does not work.
2021-01-02 10:54:44 +01:00
Felix Linker
cdcda004f3 Implement units in modifications menu 2020-12-31 18:54:36 +01:00
Felix Linker
20e448fc0a Optimize constructors 2020-12-29 16:39:18 +01:00
Felix Linker
436e626c42 Group module selection by category 2020-12-29 16:37:28 +01:00
Felix Linker
3dd4675a0b Hide searchbar for core internal modules 2020-12-29 16:36:43 +01:00
Felix Linker
d3766d9e17 Migrate ed-forge API change 2020-12-29 13:18:57 +01:00
Felix Linker
d987c08ac8 Ship summary key for ship type is id 2020-12-29 12:23:23 +01:00
Felix Linker
f865ef6c6c Fix retrofit cost 2020-11-01 19:54:48 +01:00
Felix Linker
f2b7daac82 MovementProfile code includes pips for re-render on state change 2020-11-01 18:29:04 +01:00
Felix Linker
832bc488b6 Fix excluding modules from costs 2020-11-01 18:25:28 +01:00
Felix Linker
f513166d6c Rework boost button 2020-11-01 17:56:33 +01:00
Felix Linker
61fd0eb991 Rework profiles section 2020-11-01 16:01:53 +01:00
Felix Linker
1e51e7d4a6 Rework WeaponDamageChart 2020-11-01 15:58:28 +01:00
Felix Linker
4943d36bb8 Rework FSD profile 2020-11-01 02:59:37 +01:00
Felix Linker
9271d1fa09 Rework Movement graph 2020-11-01 02:32:52 +01:00
Felix Linker
8a09d94dfa Rework EngineProfile 2020-11-01 02:19:59 +01:00
Felix Linker
c44925dd62 Show normal speed in summary 2020-10-31 13:03:10 +01:00
Felix Linker
d006bbcb0f Handle no shield 2020-10-31 13:02:51 +01:00
Felix Linker
14453f6b80 Rework defence tab 2020-10-24 17:47:17 +02:00
felixlinker
8c267150a9 Rework Offence tab 2020-08-13 20:20:22 +02:00
felixlinker
ed60a78be0 Priority groups are zero indexed 2020-08-09 19:00:57 +02:00
felixlinker
82142b0cb1 Use Module.setEnabled in Power Management table 2020-08-09 19:00:45 +02:00
felixlinker
d8949fedb2 Rework PIP menu 2020-08-09 18:39:39 +02:00
felixlinker
cf72bd11a8 Replace manual bind(this) calls with auto-bind 2020-08-09 17:41:15 +02:00
Felix Linker
16ef7ea389 Rework cost section 2020-04-30 14:25:07 +02:00
Felix Linker
ff455e349e Implement coding standards 2020-04-16 15:22:07 +02:00
Felix Linker
ba9e7f1a32 Add code props variable as ship hash to update changes 2020-04-16 15:12:38 +02:00
Felix Linker
904498b20c Make power stats working 2020-04-15 19:59:50 +02:00
Felix Linker
409be7374c Make outfitting page working 2020-04-10 13:19:53 +02:00
Felix Linker
00c525e6ab Update shipyard-page to ed-forge 2020-04-10 12:50:56 +02:00
felixlinker
a2f52c03a1 Move hardpoint class for module selection into leaves of HTML tree 2019-10-10 18:18:18 +02:00
felixlinker
037df6b166 Remove InternalSlot component 2019-10-10 16:42:14 +02:00
felixlinker
90ab5b4b0a Remove component HardpointSlot 2019-10-10 16:30:51 +02:00
felixlinker
7bbfa8c43f Remove component StandardSlot 2019-10-10 16:11:54 +02:00
felixlinker
2fbcd158cc Rewrite ModificationsMenu 2019-10-10 16:06:41 +02:00
felixlinker
33c201800e Rewrite AvailableModulesMenu.jsx 2019-10-08 22:53:31 +02:00
Felix Linker
9797a8d781 First steps towards ed-forge rewrite 2019-10-08 15:02:16 +02:00
105 changed files with 35502 additions and 23797 deletions

1
.gitignore vendored
View File

@@ -10,4 +10,3 @@ env
.project .project
.vscode/ .vscode/
docs/ docs/
package-lock.json

1
.npmrc
View File

@@ -1 +0,0 @@
package-lock=false

View File

@@ -1,16 +0,0 @@
language: node_js
notifications:
email: false
sudo: false
node_js:
- "4.8.1"
cache:
directories:
- node_modules
before_install:
- git clone https://github.com/EDCD/coriolis-data.git ../coriolis-data
script:
- npm run lint
- npm test

View File

@@ -1,4 +1,4 @@
![Latest Release](https://img.shields.io/github/release/EDCD/coriolis.svg) [![Build Status](https://travis-ci.org/EDCD/coriolis.svg?branch=master)](https://travis-ci.org/EDCD/coriolis) [![Chat to us on Discord](https://img.shields.io/badge/Discord-EDCD%20%23coriolis-blue.svg?style=social)](https://discord.gg/0uwCh6R62aPRjk9w) [![Chat to us on Discord](https://img.shields.io/badge/Discord-EDCD%20%23coriolis-blue.svg?style=social)](https://discord.gg/0uwCh6R62aPRjk9w)
## About ## About
@@ -8,46 +8,41 @@ Coriolis was created using assets and imagery from Elite: Dangerous, with the pe
## Contributing ## Contributing
Please [submit issues](https://github.com/EDCD/coriolis/issues), or better yet [pull requests](https://github.com/EDCD/coriolis/pulls) for any corrections or additions to the database or the code. - [Submit issues](https://github.com/EDCD/coriolis/issues)
- [Submit pull requests](https://github.com/EDCD/coriolis/pulls) targetting `develop` branch
### Feature Requests, Suggestions & Bugs - Chat to us on [Discord](https://discord.gg/0uwCh6R62aPRjk9w)!
Chat to us on [Discord](https://discord.gg/0uwCh6R62aPRjk9w)!
## Development ## Development
See the [Developer's Guide](https://github.com/EDCD/coriolis/wiki/Developing-for-Coriolis) in the wiki. To get a local instance of coriolis running, perform the following steps in a shell:
```sh
> git clone https://github.com/EDCD/coriolis.git
> git clone https://github.com/EDCD/coriolis-data.git
> cd ./coriolis-data
> npm install
> cd ../coriolis
> npm install
> npm start
```
You will then have a development server running on `localhost:3300`.
### Ship and Module Database ### Ship and Module Database
See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc. See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc.
You can find hosted and compiled versions of these data-jsons under https://coriolis.io/data/ and https://beta.coriolis.io/data/. ## Deployment
You might want to load these as depedency instead of reyling on the npm-dependency.
## License Follow the steps for [Development](#development) as above, but instead
of `npm start` you'll want to:
All Data and [associated JSON](https://github.com/EDCD/coriolis-data) files are intellectual property and copyright of Frontier Developments plc ('Frontier', 'Frontier Developments') and are subject to their ```sh
[terms and conditions](https://www.frontierstore.net/terms-and-conditions/). > npm run build
```
The code (Javascript, CSS, HTML, and SVG files only) specificially for Coriolis.io is released under the MIT License. this will result in a `build/` directory being created containing all the necessary files.
Copyright (c) 2015 Coriolis.io, Colin McLeod After this you need to serve the files in some manner.
Either configure your webserver to make the actual `build/` directory
Permission is hereby granted, free of charge, to any person obtaining a copy visible on the web, or alternatively copy it to somewhere to serve it
of this software (Javascript, CSS, HTML, and SVG files only), and associated documentation files (the "Software"), to deal from.
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in
all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
THE SOFTWARE.

View File

@@ -1,30 +0,0 @@
{
"adder": {
"t3": {"speed": 205, "boost": 298, "pitch": 35.37, "roll": 93.09, "yaw": 13.03},
"t2": {"speed": 209, "boost": 304, "pitch": 36.06, "roll": 94.90, "yaw": 13.29},
"t1": {"speed": 213, "boost": 310, "pitch": 36.80, "roll": 96.84, "yaw": 13.56},
"t0": {"speed": 218, "boost": 317, "pitch": 37.70, "roll": 99.20, "yaw": 13.89},
"t9": {"speed": 220, "boost": 321, "pitch": 38.08, "roll": 100.21, "yaw": 14.03},
"t8": {"speed": 225, "boost": 327, "pitch": 38.86, "roll": 102.26, "yaw": 14.32},
"t7": {"speed": 230, "boost": 334, "pitch": 39.69, "roll": 104.44, "yaw": 14.62},
"t6": {"speed": 234, "boost": 340, "pitch": 40.41, "roll": 106.34, "yaw": 14.89},
"t5": {"speed": 242, "boost": 351, "pitch": 41.71, "roll": 109.78, "yaw": 15.37}
},
"eagle": {
"t2": {"speed": 223, "boost": 325, "pitch": 46.45, "roll": 111.48, "yaw": 16.72},
"t1": {"speed": 229, "boost": 334, "pitch": 47.69, "roll": 114.46, "yaw": 17.17},
"t0": {"speed": 235, "boost": 343, "pitch": 49.00, "roll": 117.60, "yaw": 17.64},
"t9": {"speed": 239, "boost": 349, "pitch": 49.80, "roll": 119.53, "yaw": 17.93},
"t8": {"speed": 243, "boost": 355, "pitch": 50.70, "roll": 121.69, "yaw": 18.25},
"t7": {"speed": 248, "boost": 361, "pitch": 51.62, "roll": 123.89, "yaw": 18.58},
"t6": {"speed": 252, "boost": 367, "pitch": 52.46, "roll": 125.91, "yaw": 18.89},
"t5": {"speed": 259, "boost": 378, "pitch": 53.99, "roll": 129.56, "yaw": 19.43}
},
"hauler": {
"t4": {"speed": 203, "boost": 305, "pitch": 36.61, "roll": 101.71, "yaw": 14.24},
"t3": {"speed": 209, "boost": 314, "pitch": 37.63, "roll": 104.54, "yaw": 14.64},
"t2": {"speed": 216, "boost": 324, "pitch": 38.89, "roll": 108.03, "yaw": 15.12},
"t1": {"speed": 222, "boost": 333, "pitch": 39.97, "roll": 111.02, "yaw": 15.54},
"t0": {"speed": 232, "boost": 348, "pitch": 41.76, "roll": 116.00, "yaw": 16.24}
}
}

View File

@@ -1,289 +0,0 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/3.json#",
"name": "Test My Ship",
"ship": "Anaconda",
"references": [
{
"name": "Coriolis.io",
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA?bn=Test%20My%20Ship",
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
"shipId": "anaconda"
}
],
"components": {
"standard": {
"bulkheads": "Reactive Surface Composite",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"thrusters": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1
},
"frameShiftDrive": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 3
},
"lifeSupport": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"group": "Plasma Accelerator",
"mount": "Fixed"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
}
],
"utility": [
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
null,
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Kill Warrant Scanner"
},
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Cargo Scanner"
},
{
"class": 0,
"rating": "F",
"enabled": false,
"priority": 1,
"group": "Countermeasure",
"name": "Electronic Countermeasure"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Countermeasure",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 2,
"group": "Countermeasure",
"name": "Point Defence"
}
],
"internal": [
{
"class": 7,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Cell Bank"
},
{
"class": 6,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"group": "Hull Reinforcement Package"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
null,
null,
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Frame Shift Drive Interdictor"
}
]
},
"stats": {
"class": 3,
"hullCost": 141889930,
"speed": 180,
"topSpeed": 186.5,
"boost": 240,
"boostEnergy": 29,
"topBoost": 248.66,
"agility": 2,
"baseShieldStrength": 350,
"baseArmour": 945,
"hullMass": 400,
"masslock": 23,
"pipSpeed": 0.14,
"moduleCostMultiplier": 1,
"fuelCapacity": 32,
"cargoCapacity": 128,
"ladenMass": 1339.2,
"armour": 2228,
"armourAdded": 390,
"armourMultiplier": 1.95,
"shieldMultiplier": 1.4,
"totalCost": 882362060,
"unladenMass": 1179.2,
"totalDps": 29,
"powerAvailable": 36,
"powerRetracted": 23.33,
"powerDeployed": 34.76,
"unladenRange": 18.49,
"fullTankRange": 18.12,
"ladenRange": 16.39,
"unladenFastestRange": 73.21,
"ladenFastestRange": 66.15,
"maxJumpCount": 4,
"shieldStrength": 833
}
}

View File

@@ -1,325 +0,0 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Test My Ship",
"ship": "Anaconda",
"references": [
{
"name": "Coriolis.io",
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==?bn=Test%20My%20Ship",
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
"shipId": "anaconda"
}
],
"components": {
"standard": {
"bulkheads": "Reactive Surface Composite",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"pgen": 1000
}
},
"thrusters": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1
},
"frameShiftDrive": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 3
},
"lifeSupport": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"group": "Plasma Accelerator",
"mount": "Fixed"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
}
],
"utility": [
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
null,
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Kill Warrant Scanner"
},
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Cargo Scanner"
},
{
"class": 0,
"rating": "F",
"enabled": false,
"priority": 1,
"group": "Electronic Countermeasure",
"name": "Electronic Countermeasure"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Chaff Launcher",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 2,
"group": "Point Defence",
"name": "Point Defence"
}
],
"internal": [
{
"class": 7,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Cell Bank"
},
{
"class": 6,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"group": "Hull Reinforcement Package"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
null,
null,
null,
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Frame Shift Drive Interdictor"
}
]
},
"stats": {
"class": 3,
"fighterHangars": 1,
"hullCost": 141889930,
"speed": 180,
"topSpeed": 186.5,
"boost": 240,
"boostEnergy": 27,
"topBoost": 249.34,
"topPitch": 25.97,
"topRoll": 62.34,
"topYaw": 10.39,
"topSpeed": 187.01,
"totalCost": 882362058,
"totalDpe": 142.68,
"totalDps": 101.13,
"totalEps": 18.71,
"totalExplDpe": 0,
"totalExplDps": 0,
"totalExplSDps": 0,
"totalAbsDpe": 3.57,
"totalAbsDps": 18.78,
"totalAbsSDps": 14.45,
"totalHps": 28.28,
"totalKinDpe": 117.48,
"totalKinDps": 22.27,
"totalKinSDps": 16.91,
"totalSDps": 89.99,
"totalThermDpe": 21.63,
"totalThermDps": 60.08,
"totalThermSDps": 58.64,
"baseShieldStrength": 350,
"baseArmour": 945,
"hullExplRes": 0.22,
"hullKinRes": 0.27,
"hullMass": 400,
"hullThermRes": -0.36,
"masslock": 23,
"pipSpeed": 0.14,
"pitch": 25,
"moduleCostMultiplier": 1,
"modulearmour": 0,
"moduleprotection": 0,
"fuelCapacity": 32,
"cargoCapacity": 128,
"ladenMass": 1323.2,
"armour": 2227.5,
"baseArmour": 525,
"unladenMass": 1163.2,
"powerAvailable": 39.6,
"powerRetracted": 23.33,
"powerDeployed": 34.13,
"roll": 60,
"unladenRange": 18.74,
"yaw": 10,
"fullTankRange": 18.36,
"hardness": 65,
"ladenRange": 16.59,
"unladenFastestRange": 74.2,
"ladenFastestRange": 66.96,
"maxJumpCount": 4,
"shield": 833,
"shieldCells": 1840,
"shieldExplRes": 0.5,
"shieldKinRes": 0.4,
"shieldThermRes": -0.2,
"crew": 3
}
}

View File

@@ -1,255 +0,0 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Multi-purpose Asp Explorer",
"ship": "Asp Explorer",
"references": [
{
"name": "Coriolis.io",
"url": "https://coriolis.edcd.io/outfit/asp?code=0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FAwDFxwtofAAAAA%3D%3D&bn=Multi-purpose%20Asp%20Explorer",
"code": "0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx/78YG5AltB7I/8/0TwImJboDSPJ/+/f/v/KlX///i3AwMTBIfARK/Gf+JwVSxArStVAYqOjvz///JVo5GRhE2IBc4SKQSSz/DGEmCa398P8//2+gTf//AwDFxwtofAAAAA==",
"shipId": "asp"
}
],
"components": {
"standard": {
"bulkheads": "Lightweight Alloy",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 2,
"modifications": {
"eff": -1850,
"pgen": 6,
"mass": 431
},
"blueprint": {
"id": 64,
"name": "Low emissions",
"grade": 1
}
},
"thrusters": {
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"modifications": {
"optmul": 440,
"integrity": -266,
"thermload": -1326,
"optmass": 520,
"power": 241
},
"blueprint": {
"id": 24,
"name": "Clean",
"grade": 1
}
},
"frameShiftDrive": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": 5025,
"integrity": -1539,
"power": 2437,
"optmass": 4870,
"maxfuel": 370
},
"blueprint": {
"id": 26,
"name": "Increased range",
"grade": 5
}
},
"lifeSupport": {
"class": 4,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": -3923,
"integrity": -1797
},
"blueprint": {
"id": 49,
"name": "Lightweight",
"grade": 1
}
},
"powerDistributor": {
"class": 3,
"rating": "D",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
null,
null,
null,
null,
null,
null
],
"utility": [
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Point Defence",
"name": "Point Defence"
}
],
"internal": [
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Fuel Scoop"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 3,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 2,
"rating": "G",
"enabled": true,
"priority": 1,
"group": "Planetary Vehicle Hangar"
},
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Advanced Discovery Scanner"
},
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Detailed Surface Scanner"
}
]
},
"stats": {
"class": 2,
"hullCost": 6135660,
"speed": 250,
"boost": 340,
"boostEnergy": 13,
"agility": 6,
"baseShieldStrength": 140,
"baseArmour": 210,
"hullMass": 280,
"masslock": 11,
"pipSpeed": 0.13,
"moduleCostMultiplier": 1,
"fuelCapacity": 32,
"cargoCapacity": 40,
"ladenMass": 435.26,
"armour": 378,
"shield": 113.43,
"shieldCells": 0,
"totalCost": 48402550,
"unladenMass": 363.26,
"totalDpe": 0,
"totalExplDpe": 0,
"totalKinDpe": 0,
"totalThermDpe": 0,
"totalDps": 0,
"totalExplDps": 0,
"totalKinDps": 0,
"totalThermDps": 0,
"totalSDps": 0,
"totalExplSDps": 0,
"totalKinSDps": 0,
"totalThermSDps": 0,
"totalEps": 1.2,
"totalHps": 1,
"shieldExplRes": 0.5,
"shieldKinRes": 0.6,
"shieldThermRes": 1.2,
"hullExplRes": 1.4,
"hullKinRes": 1.2,
"hullThermRes": 1,
"powerAvailable": 20.41,
"powerRetracted": 11.91,
"powerDeployed": 11.91,
"unladenRange": 50.45,
"fullTankRange": 47.03,
"ladenRange": 42.71,
"unladenFastestRange": 317.24,
"ladenFastestRange": 287.02,
"maxJumpCount": 7,
"topSpeed": 274.01,
"topBoost": 372.65
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,552 +0,0 @@
{
"cargo": {
"capacity": 32
},
"free": false,
"fuel": {
"main": {
"capacity": 128
},
"reserve": {
"capacity": 0.81
}
},
"id": 31,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049346,
"name": "BelugaLiner_Armour_Grade1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Bobble01": [],
"Bobble02": [],
"Bobble03": [],
"Bobble04": [],
"Bobble05": [],
"Bobble06": [],
"Bobble07": [],
"Bobble08": [],
"Bobble09": [],
"Bobble10": [],
"Decal1": {
"module": {
"free": false,
"id": 128667757,
"name": "Decal_Explorer_Ranger",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal2": {
"module": {
"free": false,
"id": 128667742,
"name": "Decal_Combat_Deadly",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal3": {
"module": {
"free": false,
"id": 128667750,
"name": "Decal_Trade_Tycoon",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"EngineColour": [],
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064132,
"modifiers": {
"engineerID": 300100,
"id": 175,
"modifiers": [
{
"name": "mod_mass",
"type": 1,
"value": 0.4457540512085
},
{
"name": "mod_health",
"type": 1,
"value": -0.24584779143333
},
{
"name": "mod_passive_power",
"type": 1,
"value": 0.24457727372646
},
{
"name": "mod_fsd_optimised_mass",
"type": 1,
"value": 0.49257898330688
},
{
"name": "mod_fsd_max_fuel_per_jump",
"type": 2,
"value": 0.028505677357316
},
{
"name": "mod_fsd_heat_rate",
"type": 2,
"value": -0.079360365867615
}
],
"moduleTags": [
16
],
"recipeID": 128673694,
"slotIndex": 53
},
"name": "Int_Hyperdrive_Size7_Class5",
"on": true,
"priority": 0,
"recipeLevel": 5,
"recipeName": "FSD_LongRange",
"recipeValue": 0,
"unloaned": 0,
"value": 46160201
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064352,
"name": "Int_FuelTank_Size7_Class3",
"on": true,
"priority": 1,
"unloaned": 1602822,
"value": 1602822
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064174,
"name": "Int_LifeSupport_Size8_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1569565
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064094,
"modifiers": {
"engineerID": 300100,
"id": 253,
"modifiers": [
{
"name": "mod_engine_mass_curve_multiplier",
"type": 1,
"value": 0.098235413432121
},
{
"name": "mod_engine_heat",
"type": 1,
"value": 0.18069696426392
},
{
"name": "mod_passive_power",
"type": 1,
"value": 0.033788848668337
},
{
"name": "mod_health",
"type": 1,
"value": -0.056404989212751
},
{
"name": "mod_engine_mass_curve",
"type": 1,
"value": -0.027384582906961
},
{
"name": "mod_engine_heat",
"type": 2,
"value": -0.072683908045292
}
],
"moduleTags": [
17
],
"recipeID": 128673655,
"slotIndex": 52
},
"name": "Int_Engine_Size7_Class2",
"on": true,
"priority": 0,
"recipeLevel": 1,
"recipeName": "Engine_Dirty",
"recipeValue": 0,
"unloaned": 0,
"value": 1709638
}
},
"MediumHardpoint1": {
"module": {
"free": false,
"id": 128049436,
"name": "Hpt_BeamLaser_Turret_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1889910
}
},
"MediumHardpoint2": {
"module": {
"free": false,
"id": 128049436,
"name": "Hpt_BeamLaser_Turret_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1889910
}
},
"MediumHardpoint3": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"MediumHardpoint4": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"MediumHardpoint5": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128732290,
"name": "PaintJob_BelugaLiner_Tactical_White",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"unloaned": 450,
"value": 450
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064207,
"name": "Int_PowerDistributor_Size6_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 3128120
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064057,
"modifiers": {
"engineerID": 300100,
"id": 277,
"modifiers": [
{
"name": "mod_powerplant_power",
"type": 1,
"value": 0.054692290723324
},
{
"name": "mod_health",
"type": 1,
"value": -0.033690698444843
},
{
"name": "mod_powerplant_heat",
"type": 1,
"value": 0.027470717206597
},
{
"name": "mod_powerplant_heat",
"type": 2,
"value": -0.056317910552025
}
],
"moduleTags": [
18
],
"recipeID": 128673765,
"slotIndex": 51
},
"name": "Int_Powerplant_Size6_Class5",
"on": true,
"priority": 1,
"recipeLevel": 1,
"recipeName": "PowerPlant_Boosted",
"recipeValue": 0,
"unloaned": 0,
"value": 14561578
}
},
"Radar": {
"module": {
"free": false,
"id": 128064239,
"name": "Int_Sensors_Size5_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 71500
}
},
"Slot01_Size6": {
"module": {
"free": false,
"id": 128666681,
"name": "Int_FuelScoop_Size6_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 25887249
}
},
"Slot02_Size6": {
"module": {
"free": false,
"id": 128064287,
"name": "Int_ShieldGenerator_Size6_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 14561578
}
},
"Slot03_Size6": {
"module": {
"free": false,
"id": 128727927,
"name": "Int_PassengerCabin_Size6_Class2",
"on": true,
"priority": 1,
"unloaned": 165808,
"value": 165808
}
},
"Slot04_Size6": {
"module": {
"free": false,
"id": 128727928,
"name": "Int_PassengerCabin_Size6_Class3",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 497429
}
},
"Slot05_Size5": {
"module": {
"free": false,
"id": 128727925,
"name": "Int_PassengerCabin_Size5_Class4",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1492286
}
},
"Slot06_Size5": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 100409,
"value": 100409
}
},
"Slot07_Size4": {
"module": {
"free": false,
"id": 128727922,
"name": "Int_PassengerCabin_Size4_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 17059
}
},
"Slot08_Size3": {
"module": {
"free": false,
"id": 128667632,
"name": "Int_Repairer_Size3_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 2361960
}
},
"Slot09_Size3": {
"module": {
"free": false,
"id": 128672289,
"name": "Int_BuggyBay_Size2_Class2",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 19440
}
},
"Slot10_Size3": {
"module": {
"free": false,
"id": 128666634,
"name": "Int_DetailedSurfaceScanner_Tiny",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 225000
}
},
"Slot11_Size3": {
"module": {
"free": false,
"id": 128663561,
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1390500
}
},
"TinyHardpoint1": {
"module": {
"free": false,
"id": 128049513,
"name": "Hpt_ChaffLauncher_Tiny",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 7650
}
},
"TinyHardpoint2": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 252900
}
},
"TinyHardpoint3": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 252900
}
},
"TinyHardpoint4": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint5": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint6": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"WeaponColour": {
"module": {
"free": false,
"id": 128732194,
"name": "WeaponCustomisation_Purple",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
}
},
"name": "BelugaLiner",
"value": {
"hull": 71688743,
"modules": 120812762,
"unloaned": 1869489
}
}

View File

@@ -1,314 +0,0 @@
{
"cargo": {
"capacity": 264
},
"free": false,
"fuel": {
"main": {
"capacity": 32
},
"reserve": {
"capacity": 0.52
}
},
"id": 4,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049298,
"name": "Type7_Armour_Grade1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Bobble01": [],
"Bobble02": [],
"Bobble03": [],
"Bobble04": [],
"Bobble05": [],
"Bobble06": [],
"Bobble07": [],
"Bobble08": [],
"Bobble09": [],
"Bobble10": [],
"Decal1": {
"module": {
"free": false,
"id": 128667746,
"name": "Decal_Trade_Dealer",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal2": {
"module": {
"free": false,
"id": 128667738,
"name": "Decal_Combat_Competent",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal3": {
"module": {
"free": false,
"id": 128667753,
"name": "Decal_Explorer_Scout",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"EngineColour": [],
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064122,
"name": "Int_Hyperdrive_Size5_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 5103953
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064350,
"name": "Int_FuelTank_Size5_Class3",
"on": true,
"priority": 1,
"unloaned": 97754,
"value": 97754
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064154,
"name": "Int_LifeSupport_Size4_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 28373
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064087,
"name": "Int_Engine_Size5_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 5103953
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128671422,
"name": "PaintJob_Type7_Tactical_White",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"unloaned": 500,
"value": 500
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064192,
"name": "Int_PowerDistributor_Size3_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 158331
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064047,
"name": "Int_Powerplant_Size4_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1610080
}
},
"Radar": {
"module": {
"free": false,
"id": 128064229,
"name": "Int_Sensors_Size3_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 10133
}
},
"Slot01_Size6": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot02_Size6": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot03_Size5": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot04_Size5": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 111566,
"value": 111566
}
},
"Slot05_Size4": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 111566,
"value": 111566
}
},
"Slot06_Size4": {
"module": {
"free": false,
"id": 128064279,
"name": "Int_ShieldGenerator_Size5_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 189035
}
},
"Slot07_Size2": {
"module": {
"free": false,
"id": 128049549,
"name": "Int_DockingComputer_Standard",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 4500
}
},
"Slot08_Size2": {
"module": {
"free": false,
"id": 128064340,
"name": "Int_CargoRack_Size3_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 10563
}
},
"SmallHardpoint1": [],
"SmallHardpoint2": [],
"SmallHardpoint3": [],
"SmallHardpoint4": [],
"TinyHardpoint1": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint2": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint3": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint4": {
"module": {
"free": false,
"id": 128049513,
"name": "Hpt_ChaffLauncher_Tiny",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 8500
}
},
"WeaponColour": []
},
"name": "Type7",
"value": {
"hull": 16780009,
"modules": 14479580,
"unloaned": 321386
}
}

View File

@@ -1,225 +0,0 @@
{
"free": false,
"id": 2,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049280,
"name": "CobraMkIII_Armour_Grade1",
"on": true,
"priority": 1,
"value": 0
}
},
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064117,
"name": "Int_Hyperdrive_Size4_Class5",
"on": true,
"priority": 4,
"value": 1610080
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064349,
"name": "Int_FuelTank_Size4_Class3",
"on": true,
"priority": 1,
"value": 24734
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064149,
"name": "Int_LifeSupport_Size3_Class2",
"on": true,
"priority": 0,
"value": 10133
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064079,
"name": "Int_Engine_Size4_Class2",
"on": true,
"priority": 0,
"value": 59633
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128741033,
"name": "PaintJob_CobraMKIII_Corrosive_05",
"on": true,
"priority": 1,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"value": 500
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064179,
"name": "Int_PowerDistributor_Size1_Class2",
"on": true,
"priority": 2,
"value": 1293
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064037,
"name": "Int_Powerplant_Size2_Class5",
"on": true,
"priority": 1,
"value": 160224
}
},
"Radar": {
"module": {
"free": false,
"id": 128064229,
"name": "Int_Sensors_Size3_Class2",
"on": true,
"priority": 0,
"value": 10133
}
},
"ShipID0": {
"module": {
"free": false,
"id": 128758976,
"name": "Nameplate_ShipID_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipID1": {
"module": {
"free": false,
"id": 128758976,
"name": "Nameplate_ShipID_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitBumper": {
"module": {
"free": false,
"id": 128740698,
"name": "CobraMkIII_ShipkitRaider1_Bumper1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitSpoiler": {
"module": {
"free": false,
"id": 128740701,
"name": "CobraMkIII_ShipkitRaider1_Spoiler1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitTail": {
"module": {
"free": false,
"id": 128740705,
"name": "CobraMkIII_ShipkitRaider1_Tail2",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitWings": {
"module": {
"free": false,
"id": 128740707,
"name": "CobraMkIII_ShipkitRaider1_Wings1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipName0": {
"module": {
"free": false,
"id": 128758944,
"name": "Nameplate_Explorer01_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipName1": {
"module": {
"free": false,
"id": 128758944,
"name": "Nameplate_Explorer01_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"Slot01_Size4": {
"module": {
"free": false,
"id": 128666663,
"name": "Int_FuelScoop_Size4_Class3",
"on": true,
"priority": 2,
"value": 178898
}
},
"Slot02_Size4": [],
"Slot03_Size4": [],
"Slot04_Size2": [],
"Slot05_Size2": {
"module": {
"free": false,
"id": 128663561,
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
"on": true,
"priority": 2,
"value": 1545000
}
},
"Slot06_Size2": {
"module": {
"free": false,
"id": 128666634,
"name": "Int_DetailedSurfaceScanner_Tiny",
"on": true,
"priority": 2,
"value": 250000
}
}
},
"name": "CobraMkIII",
"value": {
"hull": 205287,
"modules": 3850628,
"unloaned": 1751109
}
}

View File

@@ -1,327 +0,0 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Multi-purpose Imperial Courier",
"ship": "Imperial Courier",
"references": [
{
"name": "Coriolis.io",
"url": "https://coriolis.edcd.io/outfit/imperial_courier?code=0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ%3D.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s%2FkIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA%2B%2Fz%2Bz3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ%2BLgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ%2F0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g%2F6v0TTdbxJ2KhdEIaCw15MF%2FNB0L%2BS2hwEwyFM8KgP%2BqEpWWA3Qu9Z3z9kPWHzakt7Dt%2BAeD7ghSTgEAAA%3D%3D&bn=Multi-purpose%20Imperial%20Courier",
"code": "0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ=.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s/kIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA+/z+z3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ+LgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ/0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g/6v0TTdbxJ2KhdEIaCw15MF/NB0L+S2hwEwyFM8KgP+qEpWWA3Qu9Z3z9kPWHzakt7Dt+AeD7ghSTgEAAA==",
"shipId": "imperial_courier"
}
],
"components": {
"standard": {
"bulkheads": "Lightweight Alloy",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"modifications": {
"pgen": 1052,
"integrity": -482,
"eff": 974
},
"blueprint": {
"id": 63,
"name": "Overcharged",
"grade": 1
}
},
"thrusters": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"name": "Enhanced Performance",
"modifications": {
"optmul": 2476,
"thermload": 7023,
"power": 1763,
"integrity": 165,
"optmass": -667
},
"blueprint": {
"id": 22,
"name": "Dirty",
"grade": 4
}
},
"frameShiftDrive": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": 4082,
"integrity": -2422,
"power": 1782,
"optmass": 4927
},
"blueprint": {
"id": 26,
"name": "Increased range",
"grade": 5
}
},
"lifeSupport": {
"class": 1,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 2,
"rating": "D",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 3,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Pulse Laser",
"mount": "Fixed",
"modifications": {
"rof": 5931,
"damage": -184,
"jitter": 50,
"distdraw": -4689,
"piercing": 3328
},
"blueprint": {
"id": 89,
"name": "Rapid fire",
"grade": 5
}
},
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Pulse Laser",
"mount": "Fixed",
"modifications": {
"rof": 4715,
"damage": -97,
"jitter": 30,
"distdraw": -4548,
"piercing": 1057,
"integrity": 319
},
"blueprint": {
"id": 89,
"name": "Rapid fire",
"grade": 5
}
},
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Multi-cannon",
"mount": "Gimballed",
"modifications": {
"damage": 2437,
"distdraw": 5487,
"rof": 1120,
"jitter": 58,
"thermload": 1346,
"power": 1009,
"integrity": -202,
"ammo": -2000
},
"blueprint": {
"id": 88,
"name": "Overcharged",
"grade": 3,
"special": {
"id": 3,
"name": "Corrosive shell"
}
}
}
],
"utility": [
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher",
"modifications": {
"ammo": 5000,
"mass": 17684,
"reload": 9707
},
"blueprint": {
"id": 37,
"name": "Ammo capacity",
"grade": 3
}
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher",
"modifications": {
"ammo": 5000,
"mass": 18520,
"reload": 8715
},
"blueprint": {
"id": 37,
"name": "Ammo capacity",
"grade": 3
}
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Chaff Launcher",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Frame Shift Wake Scanner"
}
],
"internal": [
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator",
"modifications": {
"optmul": 1888,
"explres": 455,
"kinres": 546,
"thermres": 1092,
"brokenregen": -2614,
"regen": -876,
"distdraw": 463
},
"blueprint": {
"id": 77,
"name": "Reinforced",
"grade": 3
}
},
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
null,
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Advanced Discovery Scanner"
}
]
},
"stats": {
"class": 1,
"hullCost": 2481550,
"speed": 280,
"boost": 380,
"boostEnergy": 10,
"agility": 6,
"baseShieldStrength": 200,
"baseArmour": 80,
"hullMass": 35,
"masslock": 7,
"pipSpeed": 0.05,
"moduleCostMultiplier": 1,
"fuelCapacity": 8,
"cargoCapacity": 8,
"ladenMass": 104.25,
"armour": 144,
"shield": 404.19,
"shieldCells": 0,
"totalCost": 14059860,
"unladenMass": 88.25,
"totalDpe": 32.25,
"totalExplDpe": 0,
"totalKinDpe": 9.41,
"totalThermDpe": 22.84,
"totalDps": 53.8,
"totalExplDps": 0,
"totalKinDps": 17.44,
"totalThermDps": 36.35,
"totalSDps": 48.99,
"totalExplSDps": 0,
"totalKinSDps": 12.64,
"totalThermSDps": 36.35,
"totalEps": 9.84,
"totalHps": 12.28,
"shieldExplRes": 0.48,
"shieldKinRes": 0.55,
"shieldThermRes": 1.09,
"hullExplRes": 1.4,
"hullKinRes": 1.2,
"hullThermRes": 1,
"powerAvailable": 17.24,
"powerRetracted": 11.3,
"powerDeployed": 16.41,
"unladenRange": 25.57,
"fullTankRange": 23.92,
"ladenRange": 22.09,
"unladenFastestRange": 116.23,
"ladenFastestRange": 107,
"maxJumpCount": 5,
"topSpeed": 386.56,
"topBoost": 524.62
}
}

View File

@@ -1,22 +0,0 @@
[
{
"buildText": "[Imaginary Ship]\nbla bla",
"errorMsg": "No such ship found: \"Imaginary Ship\""
},
{
"buildText": "[Viper]\nS: 1F/F Pulse Laser\nsome un-parseable nonsense\nS: 1F/F Pulse Laser\n",
"errorMsg": "Error parsing: \"some un-parseable nonsense\""
},
{
"buildText": "[Sidewinder]\nS: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
"errorMsg": "2F Pulse Laser exceeds slot size: \"S: 2F/F Pulse Laser\""
},
{
"buildText": "[Sidewinder]\nL: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
"errorMsg": "No hardpoint slot available for: \"L: 2F/F Pulse Laser\""
},
{
"buildText": "[Sidewinder]\nS: 1F/F Magic Thing\nS: 1F/F Pulse Laser\n",
"errorMsg": "Unknown component: \"S: 1F/F Magic Thing\""
}
]

View File

@@ -1,32 +0,0 @@
[
{
"shipId": "anaconda",
"buildName": "Imported Anaconda",
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
"buildText": "[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
},
{
"shipId": "anaconda",
"buildName": "Imported Anaconda",
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
"buildText": "\n\n \t[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
},
{
"shipId": "cobra_mk_iii",
"buildName": "Imported Cobra Mk III",
"buildCode": "0patcFeldd5sdf41712222503040202490f242h.Iw1-kA==.Aw1-kA==.",
"buildText": "[Cobra Mk III]\nM: 1F/F Pulse Laser\nM: 1G/G Burst Laser\nS: 1E/T Fragment Cannon\nS: 1G/T Multi-cannon\nU: 0I Point Defence\nU: 0A Shield Booster\n\nBH: 1I Lightweight Alloy\nRB: 4A Power Plant\nTM: 4C Thrusters\nFH: 4E Frame Shift Drive\nEC: 3D Life Support\nPC: 2A Power Distributor\nSS: 3D Sensors\nFS: 4C Fuel Tank (Capacity: 16)\n\n4: 3E Cargo Rack (Capacity: 8)\n4: 3E Cargo Rack (Capacity: 8)\n4: 4E Shield Generator\n2: 2C Auto Field-Maintenance Unit\n2: 1E Standard Docking Computer\n2: 1E Basic Discovery Scanner\n---\nShield: 112.29 MJ\nPower : 10.45 MW retracted (67%)\n 12.16 MW deployed (78%)\n 15.60 MW available\nCargo : 16 T\nFuel : 16 T\nMass : 235.5 T empty\n 267.5 T full\nRange : 10.69 LY unladen\n 10.05 LY laden\nPrice : 2,929,040 CR\nRe-Buy: 146,452 CR @ 95% insurance\n"
},
{
"shipId": "type_9_heavy",
"buildName": "Imported Type-9 Heavy",
"buildCode": "3pftsFklkdisif57e2k2f2h110001020306054j03022f01242i.Iw18eQ==.Aw18eQ==.",
"buildText": "[Type-9 Heavy]\nM: 2D/G Fragment Cannon\nM: 2I/F Mine Launcher\nM: 2B/FD Missile Rack\nS: 1I/FS Torpedo Pylon\nS: 1F/F Burst Laser\nU: 0I Chaff Launcher\nU: 0F Electronic Countermeasure\nU: 0I Heat Sink Launcher\nU: 0I Point Defence\n\nBH: 1I Mirrored Surface Composite\nRB: 5A Power Plant\nTM: 7D Thrusters\nFH: 6A Frame Shift Drive\nEC: 5A Life Support\nPC: 4D Power Distributor\nSS: 4D Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n8: 7E Cargo Rack (Capacity: 128)\n7: 6E Cargo Rack (Capacity: 64)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 3E Cargo Rack (Capacity: 8)\n4: 1C Advanced Discovery Scanner\n3: 2E Cargo Rack (Capacity: 4)\n3: 1E Standard Docking Computer\n2: 1C Detailed Surface Scanner\n"
},
{
"shipId": "vulture",
"buildName": "Imported Vulture",
"buildCode": "4patfFalddksif31e1e0e0j04044a0n532jf1.Iw19kA==.Aw19kA==.",
"buildText": "[Vulture]\nL: 3E/G Pulse Laser\nL: 3E/G Pulse Laser\nU: 0A Frame Shift Wake Scanner\nU: 0A Kill Warrant Scanner\nU: 0A Shield Booster\nU: 0A Shield Booster\n\nBH: 1I Reactive Surface Composite\nRB: 4A Power Plant\nTM: 5A Thrusters\nFH: 4A Frame Shift Drive\nEC: 3D Life Support\nPC: 5A Power Distributor\nSS: 4D Sensors\nFS: 3C Fuel Tank (Capacity: 8)\n\n5: 5A Shield Generator\n4: 4A Auto Field-Maintenance Unit\n2: 2A Shield Cell Bank\n1: 1A Fuel Scoop\n1: 1C Fuel Tank (Capacity: 2)"
}
]

View File

@@ -1,50 +0,0 @@
{
"type_6_transporter": {
"Cargo": "A0p0tdFal8d8s8f4-----04040303430101-.Iw18UA==.Aw18UA==.",
"Miner": "A0p5tdFal8d8s8f42l2l---040403451q0101-.Iw18UA==.Aw18UA==.",
"Hopper": "A0p0tdFal8d0s8f41717---030302024300--.Iw18UA==.Aw18UA==."
},
"type_7_transport": {
"Cargo": "A0p0tiFfliddsdf5--------0505040403480101--.Iw18eQ==.Aw18eQ==.",
"Miner": "A0pdtiFflid8sdf5--2l2l----0505041v03450000--.Iw18eQ==.Aw18eQ==."
},
"federal_dropship": {
"Cargo": "A0pdtiFflnddsif4-1717------05040448--020201-.Iw18RQ==.Aw18RQ==."
},
"asp": {
"Miner": "A2pftfFflidfskf50s0s24242l2l---04054a1q02022o27-.Iw18eQ==.Aw18eQ==."
},
"imperial_clipper": {
"Cargo": "A0p5tiFflndisnf4--0s0s----0605450302020101-.Iw18WQ==.Aw18WQ==.",
"Dream": "A2pktkFflndpskf40v0v0s0s0404040n4k5n5d2b29292o--.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA.",
"Current": "A0patkFflndfskf4-----------------.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA."
},
"type_9_heavy": {
"Current": "A0patsFklndnsif6---------0706054a0303020224--.AwRj4yo5iA==.EwBhEYy6d6g=."
},
"python": {
"Cargo": "A0patnFflidsssf5---------050505040448020201-.Iw18eAMQ.Aw18RQ==.",
"Miner": "A0pktkFflidpspf50v0v0v2m2m0404--050505Ce4a1v02022o-.Iw18eAMQ.IwBhBYy6dkCYRA==.",
"Dream": "A2pptkFfliduspf50v0v0v27270404040m5n5n4f2d2d032t0201-.Iw1+gDByUA==.EwBhEYy6e0VEA===.",
"Missile": "A0pttoFjljdystf52f2g2d2ePh----04044j03---00--.Iw18eAMQ.Aw18RQ==."
},
"anaconda": {
"Dream": "A4putpFklndzsuf52c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d04-0303326b-.AwRj4yo5dzhA.MwBhCYy6duvARhEA.",
"Cargo": "A0patnFklndnsxf5----------------06050505040404-45030301-.Iw18ZUAxA===.Aw18ZXEA.",
"Current": "A0patnFklndksxf5----------------06050505040404-03034524-.Iw18ZUAxA===.Aw18ZXEA.",
"Explorer": "A0patnFklndksxf5--------0202------f7050505040s37--2i4524-.AwRj4yVKJ9jCA===.AwhMIyumQRgkA===.",
"Test": "A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.Iw18ZUAxA===.Aw18ZXEA."
},
"diamondback_explorer": {
"Explorer": "A0p0tdFfldddsdf5---0202--320p432i----.AwRj4zTZaA==.AwiMIyqo."
},
"vulture": {
"Bounty Hunter": "A3patcFalddksff31e1e0404-0l4a-5d27662j--.AwRj4z2Gg===.MwBhBYy6oJmAjLMQ."
},
"fer_de_lance": {
"Attack": "A2pfthFalidpsff31r0s0s0s0s000404-04-4a-5d27--.Iw18aAMQ.CwBhrSu8EZxEA===."
},
"eagle": {
"Figther": "A4p0t5F5l3d5s5f20p0p24-4053-2j---.Iw18gDJQ.Aw19kA==."
}
}

View File

@@ -1,50 +0,0 @@
{
"builds": {
"type_6_transporter": {
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
},
"type_7_transport": {
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
},
"federal_dropship": {
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
},
"asp": {
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
},
"imperial_clipper": {
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
"Dream": "26A6A5A5D6A5A4C0v0v0s0s0404040n4k5n5d2b29292o-.AwRj4yWU1I==.CwBhCYy6YRigzLIA",
"Current": "04A6A5A5D4A5A4C----------------.AwRj4yWU1I==.CwBhCYy6YRigzLIA"
},
"type_9_heavy": {
"Current": "04A7D6A5D5D4D6C---------0706054a0303020224.AwRj4yoo.EwBhEYy6dsg="
},
"python": {
"Cargo": "04A6D5A4D6D6D5C---------050505040448020201.Iw18eQ==.Aw18eQ==",
"Miner": "06A6A5A4D6A6A5C0v0v0v2m2m0404--050505Ce4a1v02022o.Iw18eQ==.IwBhBYy6dkCYg===",
"Dream": "27A6A5A4D7A6A5C0v0v0v27270404040m5n5n4f2d2d032t0201.Iw1+gDBxA===.EwBhEYy6e0WEA==="
},
"anaconda": {
"Dream": "48A7A6A5D8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d040303326b.AwRj4yo5dig=.MwBhCYy6du3ARiA=",
"Cargo": "04A6D6A5D5D8D5C----------------0605050504040445030301.Iw18ZlA=.Aw18ZlA=",
"Current": "04A6D6A5D5A8D5C----------------0605050504040403034524.Iw18ZlA=.Aw18ZlA=",
"Explorer": "04A6D6A5D5A8D5C--------0202------f7050505040s372f2i4524.AwRj4yVKJthA.AwhMIyungRhEA==="
},
"diamondback_explorer": {
"Explorer": "02A4D5A3D3D3D5C---0202--320p432i2f.AwRj4zTI.AwiMIypI"
},
"vulture": {
"Bounty Hunter": "34A4C4A3D5A4A3C1e1e0404-0l4a5d27662j.AwRj4y2I.MwBhBYy6wJmAjLIA"
},
"fer_de_lance": {
"Attack": "25A5C4A4D6A4A3C1r0s0s0s0s000404-04-4a-5d27-.Iw18aQ==.CwBhrSu8EZyA"
},
"eagle": {
"Figther": "42A3A3A1D2A2A2C0p0p24-40532j.AwRj49iA.AwgsIkEZigmIA==="
}
}
}

View File

@@ -1,366 +0,0 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
},
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "diamondbackxl",
"ShipID": 11,
"ShipName": "star Hopper",
"ShipIdent": "PH-02",
"HullValue": 1615649,
"ModulesValue": 16981039,
"Rebuy": 929837,
"Modules": [
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true,
"Value": 3072
},
{
"Slot": "slot01_size4",
"Item": "int_fuelscoop_size4_class5",
"On": true,
"Priority": 3,
"Value": 2862364
},
{
"Slot": "slot02_size4",
"Item": "int_guardianfsdbooster_size4",
"On": true,
"Value": 2847499
},
{
"Slot": "slot03_size3",
"Item": "int_shieldgenerator_size3_class2",
"On": true,
"Value": 18812,
"Engineering": {
"BlueprintName": "shieldgenerator_thermic",
"Level": 3,
"Quality": 1,
"ExperimentalEffect": "special_shield_health"
}
},
{
"Slot": "slot04_size3",
"Item": "int_repairer_size3_class5",
"On": true,
"Value": 2302911
},
{
"Slot": "slot05_size2",
"Item": "int_buggybay_size2_class2",
"On": true,
"Priority": 3,
"Value": 21600
},
{
"Slot": "slot06_size2",
"Item": "int_cargorack_size2_class1",
"On": true,
"Priority": 1,
"Value": 2852
},
{
"Slot": "slot07_size1",
"Item": "int_supercruiseassist",
"On": true,
"Priority": 3,
"Value": 9121
},
{
"Slot": "slot08_size1",
"Item": "int_detailedsurfacescanner_tiny",
"On": true,
"Value": 250000,
"Engineering": {
"BlueprintName": "sensor_expanded",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size4_class5",
"On": true,
"Priority": 1,
"Value": 1441233,
"Engineering": {
"BlueprintName": "powerplant_boosted",
"Level": 1,
"Quality": 1
}
},
{
"Slot": "mainengines",
"Item": "int_engine_size4_class5",
"On": true,
"Value": 1610080,
"Engineering": {
"BlueprintName": "engine_dirty",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_engine_lightweight"
}
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Value": 5103953,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_fsd_lightweight"
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "misc_lightweight",
"Level": 3,
"Quality": 1
}
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size4_class5",
"On": true,
"Value": 389022,
"Engineering": {
"BlueprintName": "powerdistributor_highfrequency",
"Level": 4,
"Quality": 1
}
},
{
"Slot": "radar",
"Item": "int_sensors_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "sensor_lightweight",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1,
"Value": 97754
},
{
"Slot": "armour",
"Item": "diamondbackxl_armour_grade1",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -1,8 +0,0 @@
{
"krait_mkii": {
"Imported pancake hammer": "A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ==.AwRgzKIkA===."
},
"diamondback_explorer": {
"Imported star Hopper": "A0pataFflddfsdf5---02---321P430iv6013w2i.Iw18SQ==.AwRm44GYpKg=."
}
}

View File

@@ -1,188 +0,0 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -1,67 +0,0 @@
{
"builds": {
"type_6_transporter": {
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
},
"type_7_transport": {
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
},
"federal_dropship": {
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
},
"asp": {
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
},
"cobra_mk_iii": {
"Example": "24A4A4A3D3A3A4C0s0s2d2d0m0445032b2o2753.AwRj4yKA.CwBhEYyrKhmMQ==="
},
"imperial_clipper": {
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
"Multi-purpose": "26A4A5A5D6A5A4C0v0v272704090j0h064f2c0302020101",
"Current": "05A6D5A5D6A5A4C0v0v27270404050n4m05035d29292o01.AwRj4yrI.AwhMIyuBGNiA",
"Dream": "26A6A5A5D6A5A4C0v0v0s0s04040c0n064f5d2b02022o0d.AwRj49UlmI==.AwiMIyuo"
},
"type_9_heavy": {
"Cargo": "04A6D6A5D4D4D5C---------07064f040303010201.AwRj4yoo.EwBhEYy6dsg="
},
"python": {
"Cargo": "04A6D5A4D6D6D5C---------050505044a03020201",
"Miner": "04A6D5A4D6D6D5C---2m2m----050505044d1v02022o"
},
"anaconda": {
"Dream": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100034k5n05050404040303326b.AwRj4yo5dig=.MwBhEYy6duwEziA=",
"Cargo": "03A7D6A5D4D8D5C----------------060505054d040403030301.AwRj4yuqg===.Aw18ZlA=",
"Modified": "0pyttFolodDsyf5------1717--------05044j-03----2h00.Iw18ZlA=.Aw18ZlA=.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA=="
},
"diamondback_explorer": {
"Explorer": "02A4D5A3D3D3D5C-------320p432i2f.AwRj4zTI.AwiMIypI"
}
},
"comparisons": {
"Test": {
"facets": [ 9, 6, 4, 1, 3, 2 ],
"builds": [
{
"shipId": "anaconda",
"buildName": "Dream"
},
{
"shipId": "asp",
"buildName": "Miner"
},
{
"shipId": "diamondback_explorer",
"buildName": "Explorer"
}
]
}
},
"insurance": "Beta",
"discounts": [
1,
1
]
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,90 +0,0 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
describe("Agility", function() {
it("correctly calculates speed", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.topSpeed)).toBe(thrusterData.speed);
}
}
});
it("correctly calculates boost", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
// Turn off internals to ensure we have enough power to boost
for (let internal in ship.internal) {
ship.internal[internal].enabled = 0;
}
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.topBoost)).toBe(thrusterData.boost);
}
}
});
it("correctly calculates pitch", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.pitches[4] * 100) / 100).toBeCloseTo(thrusterData.pitch, 1);
}
}
});
it("correctly calculates roll", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.rolls[4] * 100) / 100).toBeCloseTo(thrusterData.roll, 1);
}
}
});
it("correctly calculates yaw", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.yaws[4] * 100) / 100).toBeCloseTo(thrusterData.yaw, 1);
}
}
});
});

View File

@@ -1,368 +0,0 @@
jest.unmock('../src/app/stores/Persist');
jest.unmock('../src/app/components/TranslatedComponent');
jest.unmock('../src/app/components/ModalImport');
jest.unmock('prop-types');
import React from 'react';
import PropTypes from 'prop-types';
import ReactDOM from 'react-dom';
import TU from 'react-testutils-additions';
import Utils from './testUtils';
import { getLanguage } from '../src/app/i18n/Language';
describe('Import Modal', function() {
let MockRouter = require('../src/app/Router').default;
const Persist = require('../src/app/stores/Persist').default;
const ModalImport = require('../src/app/components/ModalImport').default;
const mockContext = {
language: getLanguage('en'),
sizeRatio: 1,
openMenu: jest.fn(),
closeMenu: jest.fn(),
showModal: jest.fn(),
hideModal: jest.fn(),
tooltip: jest.fn(),
termtip: jest.fn(),
onWindowResize: jest.fn()
};
let modal, render, ContextProvider = Utils.createContextProvider(mockContext);
/**
* Clear saved builds, and reset React DOM
*/
function reset() {
MockRouter.go.mockClear();
Persist.deleteAll();
render = TU.renderIntoDocument(<ContextProvider><ModalImport /></ContextProvider>);
modal = TU.findRenderedComponentWithType(render, ModalImport);
}
/**
* Simulate user import text entry / paste
* @param {string} text Import text / raw data
*/
function pasteText(text) {
let textarea = TU.findRenderedDOMComponentWithTag(render, 'textarea');
TU.Simulate.change(textarea, { target: { value: text } });
}
/**
* Simulate click on Proceed button
*/
function clickProceed() {
let proceedButton = TU.findRenderedDOMComponentWithId(render, 'proceed');
TU.Simulate.click(proceedButton);
}
/**
* Simulate click on Import button
*/
function clickImport() {
let importButton = TU.findRenderedDOMComponentWithId(render, 'import');
TU.Simulate.click(importButton);
}
describe('Import Backup', function() {
beforeEach(reset);
it('imports a valid backup', function() {
let importData = require('./fixtures/valid-backup');
let importString = JSON.stringify(importData);
expect(modal.state.importValid).toEqual(false);
expect(modal.state.errorMsg).toEqual(null);
pasteText(importString);
expect(modal.state.importValid).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.builds).toEqual(importData.builds);
expect(modal.state.comparisons).toEqual(importData.comparisons);
expect(modal.state.shipDiscount).toEqual(importData.discounts[0]);
expect(modal.state.moduleDiscount).toEqual(importData.discounts[1]);
expect(modal.state.insurance).toBe(importData.insurance.toLowerCase());
clickProceed();
expect(modal.state.processed).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickImport();
expect(Persist.getBuilds()).toEqual(importData.builds);
expect(Persist.getComparisons()).toEqual(importData.comparisons);
expect(Persist.getInsurance()).toEqual(importData.insurance.toLowerCase());
expect(Persist.getShipDiscount()).toEqual(importData.discounts[0]);
expect(Persist.getModuleDiscount()).toEqual(importData.discounts[1]);
});
it('imports an old valid backup', function() {
const importData = require('./fixtures/old-valid-export');
const importStr = JSON.stringify(importData);
pasteText(importStr);
expect(modal.state.builds).toEqual(importData.builds);
expect(modal.state.importValid).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
expect(Persist.getBuilds()).toEqual(importData.builds);
});
it('catches an invalid backup', function() {
const importData = require('./fixtures/valid-backup');
let invalidImportData = Object.assign({}, importData);
// Remove Asp Miner build used in comparison
delete(invalidImportData.builds.asp);
pasteText('"this is not valid"');
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('Must be an object or array!');
pasteText('{ "builds": "Should not be a string" }');
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('builds must be an object!');
pasteText(JSON.stringify(importData).replace(/anaconda/g, 'invalid_ship'));
expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds)).not.toContain('anaconda');
pasteText(JSON.stringify(importData).replace('Dream', ''));
expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds.imperial_clipper).length).toEqual(3);
pasteText(JSON.stringify(invalidImportData));
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('asp build "Miner" data is missing!');
});
});
describe('Import Detailed V3 Build', function() {
beforeEach(reset);
it('imports a valid v3 build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.&bn=Test%20My%20Ship');
});
it('catches an invalid build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
pasteText(JSON.stringify(importData).replace('references', 'refs'));
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('Anaconda Build "Test My Ship": Invalid data');
});
});
describe('Import Detailed V4 Build', function() {
beforeEach(reset);
it('imports a valid v4 build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.H4sIAAAAAAAAE2MUe8HMwPD%2FPwMAAGvB0AkAAAA%3D&bn=Test%20My%20Ship');
});
});
describe('Import Detailed Engineered V4 Build', function() {
beforeEach(reset);
it('imports a valid v4 build', function() {
const importData = require('./fixtures/asp-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/asp?code=A0pftiFflfddsnf5------020202033c044002v6-2i-.AwRj4yvYg%3D%3D%3D.CwRgDBldHn5A.H4sIAAAAAAAAE2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FA7kMAExxqlSAAAAA&bn=Multi-purpose%20Asp%20Explorer');
});
it('imports a valid v4 build with modifications', function() {
const importData = require('./fixtures/courier-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/imperial_courier?code=A0patzF5l0das8f31a1a270202000e402t0101----.AwRj4zOYg%3D%3D%3D.CwRgDBldLuZA.H4sIAAAAAAAAE12OPUvDYBSFT1OTfkRJjUkbbC3Yj8mlODgUISAtdOlety5ODv0Vgji7O7kJ%2FgzBQX%2BEY7Gg0NKhfY%2FnHQLFDBdynufe9%2BRMCmCb06g29oCgacjiRx6gY6oWKUT8UgLaszqQfHmSnpVFN1uSeXNsJVcj%2FA2EHlZkspIUpUc6UjTXGT85qwHuSEuVc%2F16r99kDQeSSjvSbSjpyUpNK10uJJ3aYqk6smwm1lQ9bOxw71TMm8VanEqq9JW1r3Qo%2BREOLnQHvbWmb7rZIu5VLIyGQGOukPv%2F0WQk5LeEAjPOUDwtAP6bShy2HKAz0HPO%2B5KsP25I79O2I7LvD%2Bz4Il1XAQAA&bn=Multi-purpose%20Imperial%20Courier');
});
});
describe('Import Detailed Builds Array', function() {
beforeEach(reset);
it('imports all builds', function() {
const importData = require('./fixtures/valid-detailed-export');
const expectedBuilds = require('./fixtures/expected-builds');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
let builds = Persist.getBuilds();
for (let s in builds) {
for (let b in builds[s]) {
expect(builds[s][b]).toEqual(expectedBuilds[s][b]);
}
}
});
});
describe('Import Companion API Build', function() {
beforeEach(reset);
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-1');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/federal_corvette?code=A2putsFklndzsxf50x0x7l28281919040404040402020l06p05sf63c5ifr--v66g--.AwRj4zNapI%3D%3D.CwRgDBldUExuBiIlWIA%3D.&bn=Imported%20Federal%20Corvette');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-2');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/beluga?code=A0pktsFplCdpsnf70t0t2727270004040404043c4fmimlmm04mc0iv62i--.AwRj4yusg%3D%3D%3D.CwRgDBldHi8IWIA%3D.&bn=Imported%20Beluga%20Liner');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-3');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/type_7_transport?code=A0patfFflidasdf5----0404040005050504044d2402--.AwRj4yoo.CwRgDBlVK7HjEA%3D%3D.&bn=Imported%20Type-7%20Transporter');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/cobra_mk_iii?code=A0p0tdFaldd3sdf4------34----2i--.AwRj4yqA.CwRgDMYExrezBig%3D.&bn=Imported%20Cobra%20Mk%20III');
});
});
describe('Import E:D Shipyard Builds', function() {
// it('imports a valid build', function() {
// const imports = require('./fixtures/ed-shipyard-import-valid');
//
// for (let i = 0; i < imports.length; i++ ) {
// reset();
// let fixture = imports[i];
// pasteText(fixture.buildText);
// expect(modal.state.importValid).toBeTruthy();
// expect(modal.state.errorMsg).toEqual(null);
// clickProceed();
// expect(MockRouter.go.mock.calls.length).toBe(1);
// expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/' + fixture.shipId + '?code=' + encodeURIComponent(fixture.buildCode) + '&bn=' + encodeURIComponent(fixture.buildName));
// }
// });
it('catches invalid builds', function() {
const imports = require('./fixtures/ed-shipyard-import-invalid');
for (let i = 0; i < imports.length; i++ ) {
reset();
pasteText(imports[i].buildText);
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual(imports[i].errorMsg);
}
});
});
describe('Imports from a Comparison', function() {
it('imports a valid comparison', function() {
const importBuilds = require('./fixtures/valid-backup').builds;
Persist.deleteAll();
render = TU.renderIntoDocument(<ContextProvider><ModalImport builds={importBuilds} /></ContextProvider>);
modal = TU.findRenderedComponentWithType(render, ModalImport);
expect(modal.state.processed).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickImport();
expect(Persist.getBuilds()).toEqual(importBuilds);
});
});
describe('Imports SLEF data', () => {
beforeEach(reset);
it('imports a single valid SLEF build', () => {
const importData = require('./fixtures/slef-single-build.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/krait_mkii?code=A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ%3D%3D.AwRgzKIkA%3D%3D%3D.&bn=Imported%20pancake%20hammer');
});
it('imports multiple SLEF builds', () => {
const importData = require('./fixtures/slef-multiple-builds.json');
const expectedBuilds = require('./fixtures/slef-multiple-expected-builds.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(false);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
const builds = Persist.getBuilds();
for (const shipModel in builds) {
for (const buildName in builds[shipModel]) {
expect(builds[shipModel][buildName])
.toEqual(expectedBuilds[shipModel][buildName]);
}
}
});
});
});

View File

@@ -1,143 +0,0 @@
jest.unmock('../src/app/stores/Persist');
import React from 'react';
import ReactDOM from 'react-dom';
import TU from 'react-testutils-additions';
let origAddEventListener = window.addEventListener;
let storageListener;
let ls = {};
// Implment mock localStorage
let localStorage = {
getItem: function(key) {
return ls[key];
},
setItem: function(key, value) {
ls[key] = value;
},
removeItem: function(key) {
delete ls[key];
},
clear: function() {
ls = {};
}
}
window.addEventListener = function(eventName, listener) {
if(eventName == 'storage') {
storageListener = listener; // Keep track of latest storage listener
} else {
origAddEventListener.apply(arguments);
}
}
describe('Persist', function() {
const Persist = require('../src/app/stores/Persist').Persist;
describe('Multi tab/window', function() {
it("syncs builds", function() {
window.localStorage = localStorage;
ls = {};
let p = new Persist();
let newBuilds = {
anaconda: { test: '1234' }
};
storageListener({ key: 'builds', newValue: JSON.stringify(newBuilds) });
expect(p.getBuild('anaconda', 'test')).toBe('1234');
});
});
describe('General and Settings', function() {
it("has defaults", function() {
window.localStorage = localStorage;
ls = {};
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getSizeRatio()).toBe(1);
});
it("loads from localStorage correctly", function() {
window.localStorage = localStorage;
let savedData = require('./fixtures/valid-backup');
ls = {};
ls.builds = JSON.stringify(savedData.builds);
ls.NG_TRANSLATE_LANG_KEY = 'de';
ls.insurance = 'Standard';
ls.shipDiscount = 0.25;
ls.moduleDiscount = 0.15;
let p = new Persist();
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0.25);
expect(p.getModuleDiscount()).toBe(0.15);
expect(p.getLangCode()).toEqual('de');
expect(p.getBuilds('anaconda')).toEqual(savedData.builds.anaconda);
expect(p.getBuilds('python')).toEqual(savedData.builds.python);
expect(p.getBuildsNamesFor('imperial_clipper')).toEqual(['Cargo', 'Current', 'Dream', 'Multi-purpose']);
expect(p.getBuild('type_7_transport', 'Cargo')).toEqual('02A5D5A4D3D3D5C--------0505040403480101');
});
it("uses defaults from a corrupted localStorage", function() {
window.localStorage = localStorage;
ls = {};
ls.builds = "not valid json";
ls.comparisons = "1, 3, 4";
ls.insurance = 'this insurance does not exist';
ls.shipDiscount = 'this is not a number';
ls.moduleDiscount = 10; // Way to big
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getBuilds()).toEqual({});
expect(p.getComparisons()).toEqual({});
});
it("works without localStorage", function() {
window.localStorage = null;
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getSizeRatio()).toBe(1);
p.saveBuild('anaconda', 'test', '12345');
expect(p.getBuild('anaconda', 'test')).toBe('12345');
p.deleteBuild('anaconda', 'test');
expect(p.hasBuilds()).toBe(false);
});
it("generates the backup", function() {
window.localStorage = localStorage;
let savedData = require('./fixtures/valid-backup');
ls = {};
ls.builds = JSON.stringify(savedData.builds);
ls.insurance = 'Beta';
ls.shipDiscount = 0.25;
ls.moduleDiscount = 0.15;
let p = new Persist();
let backup = p.getAll();
expect(backup.insurance).toBe('beta');
expect(backup.shipDiscount).toBe(0.25);
expect(backup.moduleDiscount).toBe(0.15);
expect(backup.builds).toEqual(savedData.builds);
expect(backup.comparisons).toEqual({});
});
});
})

View File

@@ -1,63 +0,0 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as Serializer from '../src/app/shipyard/Serializer';
import jsen from 'jsen';
describe("Serializer", function() {
const anacondaTestExport = require.requireActual('./fixtures/anaconda-test-detailed-export-v4');
const code = anacondaTestExport.references[0].code;
const anaconda = Ships.anaconda;
const validate = jsen(require('../src/schemas/ship-loadout/4'));
describe("To Detailed Build", function() {
let testBuild = new Ship('anaconda', anaconda.properties, anaconda.slots).buildFrom(code);
let exportData = Serializer.toDetailedBuild('Test My Ship', testBuild);
it("conforms to the v4 ship-loadout schema", function() {
expect(validate(exportData)).toBe(true);
});
it("contains the correct components and stats", function() {
expect(exportData.components).toEqual(anacondaTestExport.components);
expect(exportData.stats).toEqual(anacondaTestExport.stats);
expect(exportData.ship).toEqual(anacondaTestExport.ship);
expect(exportData.name).toEqual(anacondaTestExport.name);
});
});
describe("Export Detailed Builds", function() {
const expectedExport = require('./fixtures/valid-detailed-export');
const builds = require('./fixtures/expected-builds');
const exportData = Serializer.toDetailedExport(builds);
it("conforms to the v4 ship-loadout schema", function() {
expect(exportData instanceof Array).toBe(true);
for (let detailedBuild of exportData) {
expect(validate(detailedBuild)).toBe(true);
}
});
});
describe("From Detailed Build", function() {
it("builds the ship correctly", function() {
let testBuildA = new Ship('anaconda', anaconda.properties, anaconda.slots);
testBuildA.buildFrom(code);
let testBuildB = Serializer.fromDetailedBuild(anacondaTestExport);
for(var p in testBuildB) {
if (p == 'availCS') {
continue;
}
expect(testBuildB[p]).toEqual(testBuildA[p], p + ' does not match');
}
});
});
});

View File

@@ -1,156 +0,0 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
describe("Ship", function() {
it("can build all ships", function() {
for (let s in Ships) {
let shipData = Ships[s];
let ship = new Ship(s, shipData.properties, shipData.slots);
for (let p in shipData.properties) {
expect(ship[p]).toEqual(shipData.properties[p], s + ' property [' + p + '] does not match when built');
}
ship.buildWith(shipData.defaults);
expect(ship.totalCost).toEqual(shipData.retailCost, s + ' retail cost does not match default build cost');
expect(ship.cargoCapacity).toBeDefined();
expect(ship.priorityBands[0].retracted).toBeGreaterThan(0, s + ' priorityBands');
expect(ship.powerAvailable).toBeGreaterThan(0, s + ' powerAvailable');
expect(ship.unladenRange).toBeGreaterThan(0, s + ' unladenRange');
expect(ship.ladenRange).toBeGreaterThan(0, s + ' ladenRange');
expect(ship.fuelCapacity).toBeGreaterThan(0, s + ' fuelCapacity');
expect(ship.unladenFastestRange).toBeGreaterThan(0, s + ' unladenFastestRange');
expect(ship.ladenFastestRange).toBeGreaterThan(0, s + ' ladenFastestRange');
expect(ship.shield).toBeGreaterThan(0, s + ' shield');
expect(ship.armour).toBeGreaterThan(0, s + ' armour');
expect(ship.topSpeed).toBeGreaterThan(0, s + ' topSpeed');
}
});
it("resets and rebuilds properly", function() {
var id = 'cobra_mk_iii';
var cobra = Ships[id];
var shipA = new Ship(id, cobra.properties, cobra.slots);
var shipB = new Ship(id, cobra.properties, cobra.slots);
var testShip = new Ship(id, cobra.properties, cobra.slots);
var buildA = cobra.defaults;
var buildB = {
standard:['4A', '4A', '4A', '3D', '3A', '3A', '4C'],
hardpoints: ['0s', '0s', '2d', '2d', 0, '04'],
internal: ['45', '03', '2b', '2o', '27', '53']
};
shipA.buildWith(buildA); // Build A
shipB.buildWith(buildB);// Build B
testShip.buildWith(buildA);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
}
testShip.buildWith(buildB);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipB[p], p + ' does not match');
}
testShip.buildWith(buildA);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
}
});
it("discounts hull and components properly", function() {
var id = 'cobra_mk_iii';
var cobra = Ships[id];
var testShip = new Ship(id, cobra.properties, cobra.slots);
testShip.buildWith(cobra.defaults);
var originalHullCost = testShip.hullCost;
var originalTotalCost = testShip.totalCost;
var discount = 0.1;
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
testShip.applyDiscounts(discount, discount);
// Floating point errors cause miniscule decimal places which are handled in the app by rounding/formatting
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.floor(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
expect(Math.floor(testShip.totalCost)).toEqual(Math.floor(originalTotalCost * (1 - discount)), 'Discounted Total cost does not match');
testShip.applyDiscounts(0, 0); // No discount, 100% of cost
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
expect(testShip.totalCost).toEqual(originalTotalCost, 'Total cost does not match');
testShip.applyDiscounts(discount, 0); // Only discount hull
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.round(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
expect(testShip.totalCost).toEqual(originalTotalCost - originalHullCost + testShip.m.discountedCost, 'Total cost does not match');
});
it("enforces a single shield generator", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
expect(anaconda.internal[2].m.grp).toEqual('sg', 'Anaconda default shield generator slot');
anaconda.use(anaconda.internal[1], ModuleUtils.internal('4j')); // 6E Shield Generator
expect(anaconda.internal[2].m).toEqual(null, 'Anaconda default shield generator slot is empty');
expect(anaconda.internal[1].m.id).toEqual('4j', 'Slot 1 should have SG 4j in it');
expect(anaconda.internal[1].m.grp).toEqual('sg','Slot 1 should have SG 4j in it');
});
it("enforces a single shield fuel scoop", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
anaconda.use(anaconda.internal[4], ModuleUtils.internal('32')); // 4A Fuel Scoop
expect(anaconda.internal[4].m.grp).toEqual('fs', 'Anaconda fuel scoop slot');
anaconda.use(anaconda.internal[3], ModuleUtils.internal('32'));
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original fuel scoop slot is empty');
expect(anaconda.internal[3].m.id).toEqual('32', 'Slot 1 should have FS 32 in it');
expect(anaconda.internal[3].m.grp).toEqual('fs','Slot 1 should have FS 32 in it');
});
it("enforces a single refinery", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
anaconda.use(anaconda.internal[4], ModuleUtils.internal('23')); // 4E Refinery
expect(anaconda.internal[4].m.grp).toEqual('rf', 'Anaconda refinery slot');
anaconda.use(anaconda.internal[3], ModuleUtils.internal('23'));
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original refinery slot is empty');
expect(anaconda.internal[3].m.id).toEqual('23', 'Slot 1 should have RF 23 in it');
expect(anaconda.internal[3].m.grp).toEqual('rf','Slot 1 should have RF 23 in it');
});
});

View File

@@ -1,25 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
const TestUtils = {
createContextProvider: function(context) {
var _contextTypes = {};
Object.keys(context).forEach(function(key) {
_contextTypes[key] = PropTypes.any;
});
return React.createClass({
displayName: 'ContextProvider',
childContextTypes: _contextTypes,
getChildContext() { return context; },
render() {
return React.Children.only(this.props.children);
}
});
}
};
export default TestUtils;

30544
package-lock.json generated Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -15,45 +15,12 @@
"clean": "rimraf build", "clean": "rimraf build",
"start": "node devServer.js", "start": "node devServer.js",
"lint": "eslint --ext .js,.jsx src", "lint": "eslint --ext .js,.jsx src",
"test": "jest",
"prod-serve": "nginx -p $(pwd) -c nginx.conf", "prod-serve": "nginx -p $(pwd) -c nginx.conf",
"prod-stop": "kill -QUIT $(cat nginx.pid)", "prod-stop": "kill -QUIT $(cat nginx.pid)",
"build": "npm run clean && cross-env NODE_ENV=production webpack -p --config webpack.config.prod.js", "build": "npm run clean && cross-env NODE_ENV=production webpack -p --config webpack.config.prod.js",
"rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws", "rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws",
"deploy": "npm run lint && npm test && npm run build && npm run rsync" "deploy": "npm run lint && npm test && npm run build && npm run rsync"
}, },
"jest": {
"transform": {
".*": "<rootDir>/node_modules/babel-jest"
},
"testRegex": "(/__tests__/test-.*|\\.(test|spec))\\.js$",
"moduleFileExtensions": [
"js",
"json",
"jsx"
],
"automock": true,
"bail": false,
"unmockedModulePathPatterns": [
"<rootDir>/node_modules/lodash",
"<rootDir>/node_modules/react",
"<rootDir>/node_modules/react-dom",
"<rootDir>/node_modules/react-transition-group",
"<rootDir>/node_modules/react-testutils-additions",
"<rootDir>/node_modules/fbjs",
"<rootDir>/node_modules/fbemitter",
"<rootDir>/node_modules/classnames",
"<rootDir>/node_modules/d3",
"<rootDir>/node_modules/lz-string",
"<rootDir>/node_modules/jsen",
"coriolis-data",
"<rootDir>/src/app/shipyard",
"<rootDir>/src/app/i18n",
"<rootDir>/src/app/utils",
"<rootDir>/src/schemas",
"<rootDir>/__tests__"
]
},
"devDependencies": { "devDependencies": {
"@babel/core": "^7.0.0", "@babel/core": "^7.0.0",
"@babel/plugin-proposal-class-properties": "^7.0.0", "@babel/plugin-proposal-class-properties": "^7.0.0",
@@ -77,7 +44,6 @@
"appcache-webpack-plugin": "^1.4.0", "appcache-webpack-plugin": "^1.4.0",
"babel-core": "^7.0.0-bridge.0", "babel-core": "^7.0.0-bridge.0",
"babel-eslint": "^10.0.1", "babel-eslint": "^10.0.1",
"babel-jest": "^23.6.0",
"babel-loader": "^8.0.0", "babel-loader": "^8.0.0",
"copy-webpack-plugin": "^4.5.2", "copy-webpack-plugin": "^4.5.2",
"create-react-class": "^15.6.3", "create-react-class": "^15.6.3",
@@ -98,7 +64,6 @@
"extract-text-webpack-plugin": "^4.0.0-beta.0", "extract-text-webpack-plugin": "^4.0.0-beta.0",
"file-loader": "^2.0.0", "file-loader": "^2.0.0",
"html-webpack-plugin": "^3.0.7", "html-webpack-plugin": "^3.0.7",
"jest-cli": "^23.6.0",
"jsen": "^0.6.4", "jsen": "^0.6.4",
"json-loader": "^0.5.4", "json-loader": "^0.5.4",
"less": "^3.8.1", "less": "^3.8.1",
@@ -123,11 +88,12 @@
"sideEffects": false, "sideEffects": false,
"dependencies": { "dependencies": {
"@babel/polyfill": "^7.0.0", "@babel/polyfill": "^7.0.0",
"auto-bind": "^2.1.1",
"browserify-zlib-next": "^1.0.1", "browserify-zlib-next": "^1.0.1",
"classnames": "^2.2.6", "classnames": "^2.2.6",
"coriolis-data": "../coriolis-data",
"d3": "^5.7.0", "d3": "^5.7.0",
"detect-browser": "^3.0.1", "detect-browser": "^3.0.1",
"ed-forge": "../ed-forge",
"fbemitter": "^2.1.1", "fbemitter": "^2.1.1",
"lodash": "^4.17.11", "lodash": "^4.17.11",
"lz-string": "^1.4.4", "lz-string": "^1.4.4",
@@ -138,7 +104,7 @@
"react-extras": "^0.7.1", "react-extras": "^0.7.1",
"react-fuzzy": "^0.5.2", "react-fuzzy": "^0.5.2",
"react-ga": "^2.5.3", "react-ga": "^2.5.3",
"react-number-editor": "Athanasius/react-number-editor.git#miggy", "react-number-editor": "^4.0.3",
"recharts": "^1.2.0", "recharts": "^1.2.0",
"register-service-worker": "^1.5.2", "register-service-worker": "^1.5.2",
"superagent": "^3.8.3" "superagent": "^3.8.3"

View File

@@ -5,27 +5,20 @@ import { register } from 'register-service-worker';
import { EventEmitter } from 'fbemitter'; import { EventEmitter } from 'fbemitter';
import { getLanguage } from './i18n/Language'; import { getLanguage } from './i18n/Language';
import Persist from './stores/Persist'; import Persist from './stores/Persist';
import { Ship } from 'ed-forge';
import Announcement from './components/Announcement'; import Announcement from './components/Announcement';
import Header from './components/Header'; import Header from './components/Header';
import Tooltip from './components/Tooltip'; import Tooltip from './components/Tooltip';
import ModalExport from './components/ModalExport';
import ModalHelp from './components/ModalHelp'; import ModalHelp from './components/ModalHelp';
import ModalImport from './components/ModalImport'; import ModalImport from './components/ModalImport';
import ModalPermalink from './components/ModalPermalink'; import ModalPermalink from './components/ModalPermalink';
import * as CompanionApiUtils from './utils/CompanionApiUtils';
import * as JournalUtils from './utils/JournalUtils';
import AboutPage from './pages/AboutPage'; import AboutPage from './pages/AboutPage';
import NotFoundPage from './pages/NotFoundPage'; import NotFoundPage from './pages/NotFoundPage';
import OutfittingPage from './pages/OutfittingPage'; import OutfittingPage from './pages/OutfittingPage';
import ComparisonPage from './pages/ComparisonPage';
import ShipyardPage from './pages/ShipyardPage'; import ShipyardPage from './pages/ShipyardPage';
import ErrorDetails from './pages/ErrorDetails'; import ErrorDetails from './pages/ErrorDetails';
const zlib = require('pako');
const request = require('superagent');
/** /**
* Coriolis App * Coriolis App
*/ */
@@ -62,7 +55,6 @@ export default class Coriolis extends React.Component {
this._onLanguageChange = this._onLanguageChange.bind(this); this._onLanguageChange = this._onLanguageChange.bind(this);
this._onSizeRatioChange = this._onSizeRatioChange.bind(this); this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
this._keyDown = this._keyDown.bind(this); this._keyDown = this._keyDown.bind(this);
this._importBuild = this._importBuild.bind(this);
this.emitter = new EventEmitter(); this.emitter = new EventEmitter();
this.state = { this.state = {
@@ -73,15 +65,14 @@ export default class Coriolis extends React.Component {
route: {}, route: {},
sizeRatio: Persist.getSizeRatio() sizeRatio: Persist.getSizeRatio()
}; };
// TODO: New mechanism for announcements
// this._getAnnouncements();
Router('', (r) => this._setPage(ShipyardPage, r)); Router('', (r) => this._setPage(ShipyardPage, r));
Router('/import?', (r) => this._importBuild(r)); Router('/import?', (r) => this._importBuild(r));
Router('/import/:data', (r) => this._importBuild(r)); Router('/import/:data', (r) => this._importBuild(r));
Router('/outfit/?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/?', (r) => this._setPage(OutfittingPage, r));
Router('/outfit/:ship/?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/:ship/?', (r) => this._setPage(OutfittingPage, r));
Router('/outfit/:ship/:code?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/:ship/:code?', (r) => this._setPage(OutfittingPage, r));
Router('/compare/:name?', (r) => this._setPage(ComparisonPage, r));
Router('/comparison?', (r) => this._setPage(ComparisonPage, r));
Router('/comparison/:code', (r) => this._setPage(ComparisonPage, r));
Router('/about', (r) => this._setPage(AboutPage, r)); Router('/about', (r) => this._setPage(AboutPage, r));
Router('*', (r) => this._setPage(null, r)); Router('*', (r) => this._setPage(null, r));
} }
@@ -93,39 +84,25 @@ export default class Coriolis extends React.Component {
_importBuild(r) { _importBuild(r) {
try { try {
// Need to decode and gunzip the data, then build the ship // Need to decode and gunzip the data, then build the ship
const data = zlib.inflate(new Buffer(r.params.data, 'base64'), { to: 'string' }); let ship = new Ship(r.params.data);
const json = JSON.parse(data); r.params.ship = ship.getShipType();
console.info('Ship import data: '); r.params.code = ship.compress();
console.info(json); this._setPage(OutfittingPage, r);
let ship, importString;
if (json) {
if (json.length && json[0].data) { // SLEF
if (json.length > 1) { // Multiple builds, open modal
importString = data;
} else { // Single build, import directly
ship = JournalUtils.shipFromLoadoutJSON(json[0].data);
}
} else { // not SLEF
if (json.modules) {
ship = CompanionApiUtils.shipFromJson(json);
} else if (json.Modules) {
ship = JournalUtils.shipFromLoadoutJSON(json);
}
}
}
if (ship) {
r.params.ship = ship.id;
r.params.code = ship.toString();
this._setPage(OutfittingPage, r);
} else if (importString) {
this._setPage(ShipyardPage, r);
this._showModal(<ModalImport importString={data}/>);
}
} catch (err) { } catch (err) {
this._onError('Failed to import ship', r.path, 0, 0, err); this._onError('Failed to import ship', r.path, 0, 0, err);
} }
} }
// async _getAnnouncements() {
// try {
// const announces = await request.get('https://orbis.zone/api/announcement')
// .query({ showInCoriolis: true });
// this.setState({ announcements: announces.body });
// } catch (err) {
// console.error(err)
// }
// }
/** /**
* Updates / Sets the page and route context * Updates / Sets the page and route context
* @param {[type]} page The page to be shown * @param {[type]} page The page to be shown
@@ -400,11 +377,12 @@ export default class Coriolis extends React.Component {
render() { render() {
let currentMenu = this.state.currentMenu; let currentMenu = this.state.currentMenu;
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu} return <div style={{ minHeight: '100%' }} onClick={this._closeMenu}
className={this.state.noTouch ? 'no-touch' : null}> className={this.state.noTouch ? 'no-touch' : null}
>
<Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate} <Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate}
currentMenu={currentMenu}/> currentMenu={currentMenu}/>
<div className="announcement-container">{this.state.announcements.map(a => <Announcement {/* <div className="announcement-container">{this.state.announcements.map(a => <Announcement
text={a.text}/>)}</div> text={a.message}/>)}</div> */}
{this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) : {this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) :
<NotFoundPage/>} <NotFoundPage/>}
{this.state.modal} {this.state.modal}
@@ -413,7 +391,7 @@ export default class Coriolis extends React.Component {
<div className="right cap"> <div className="right cap">
<a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer" <a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer"
title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a> title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a>
<br/> <br/>
<a <a
href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'} href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'}

View File

@@ -6,7 +6,6 @@ import { autoBind } from 'react-extras';
* Announcement component * Announcement component
*/ */
export default class Announcement extends React.Component { export default class Announcement extends React.Component {
static propTypes = { static propTypes = {
text: PropTypes.string text: PropTypes.string
}; };
@@ -27,5 +26,4 @@ export default class Announcement extends React.Component {
render() { render() {
return <div className="announcement" >{this.props.text}</div>; return <div className="announcement" >{this.props.text}</div>;
} }
} }

View File

@@ -1,120 +1,22 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import FuzzySearch from 'react-fuzzy'; import FuzzySearch from 'react-fuzzy';
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
import { get, groupBy, mapValues, sortBy, zip, zipWith } from 'lodash';
import autoBind from 'auto-bind';
import MODULE_STATS from 'ed-forge/lib/src/module-stats';
import { SHOW } from '../shipyard/StatsMapping';
const PRESS_THRESHOLD = 500; // mouse/touch down threshold const PRESS_THRESHOLD = 500; // mouse/touch down threshold
/* const MOUNT_MAP = {
* Categorisation of module groups fixed: <MountFixed className={'lg'} />,
*/ gimbal: <MountGimballed className={'lg'} />,
const GRPCAT = { turret: <MountTurret className={'lg'} />,
'sg': 'shields',
'bsg': 'shields',
'psg': 'shields',
'scb': 'shields',
'cc': 'limpet controllers',
'fx': 'limpet controllers',
'hb': 'limpet controllers',
'pc': 'limpet controllers',
'rpl': 'limpet controllers',
'pce': 'passenger cabins',
'pci': 'passenger cabins',
'pcm': 'passenger cabins',
'pcq': 'passenger cabins',
'fh': 'hangars',
'pv': 'hangars',
'fs': 'fuel',
'ft': 'fuel',
'hr': 'structural reinforcement',
'mrp': 'structural reinforcement',
'bl': 'lasers',
'pl': 'lasers',
'ul': 'lasers',
'ml': 'lasers',
'c': 'projectiles',
'mc': 'projectiles',
'axmc': 'experimental',
'fc': 'projectiles',
'rfl': 'experimental',
'pa': 'projectiles',
'rg': 'projectiles',
'mr': 'ordnance',
'axmr': 'experimental',
'rcpl': 'experimental',
'dtl': 'experimental',
'tbsc': 'experimental',
'tbem': 'experimental',
'tbrfl': 'experimental',
'mahr': 'experimental',
'rsl': 'experimental',
'tp': 'ordnance',
'nl': 'ordnance',
'sc': 'scanners',
'ss': 'scanners',
// Utilities
'cs': 'scanners',
'kw': 'scanners',
'ws': 'scanners',
'xs': 'scanners',
'ch': 'defence',
'po': 'defence',
'ec': 'defence',
'sfn': 'defence',
// Guardian
'gpp': 'guardian',
'gpc': 'guardian',
'gsrp': 'guardian',
'ggc': 'guardian',
'gfsb': 'guardian',
'gmrp': 'guardian',
'gsc': 'guardian',
'ghrp': 'guardian',
// Mining
'scl': 'mining',
'pwa': 'mining',
'sdm': 'mining',
// Assists
'dc': 'flight assists',
'sua': 'flight assists',
};
// Order here is the order in which items will be shown in the modules menu
const CATEGORIES = {
// Internals
'am': ['am'],
'cr': ['cr'],
'fi': ['fi'],
'fuel': ['ft', 'fs'],
'hangars': ['fh', 'pv'],
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl'],
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
'rf': ['rf'],
'shields': ['sg', 'bsg', 'psg', 'scb'],
'structural reinforcement': ['hr', 'mrp'],
'flight assists': ['dc', 'sua'],
// Hardpoints
'lasers': ['pl', 'ul', 'bl'],
'projectiles': ['mc', 'c', 'fc', 'pa', 'rg'],
'ordnance': ['mr', 'tp', 'nl'],
// Utilities
'sb': ['sb'],
'hs': ['hs'],
'defence': ['ch', 'po', 'ec'],
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
// Experimental
'experimental': ['axmc', 'axmr', 'rfl', 'tbrfl', 'tbsc', 'tbem', 'xs', 'sfn', 'rcpl', 'dtl', 'rsl', 'mahr',],
// Guardian
'guardian': ['gpp', 'gpd', 'gpc', 'ggc', 'gsrp', 'gfsb', 'ghrp', 'gmrp', 'gsc'],
'mining': ['ml', 'scl', 'pwa', 'sdm', 'abl'],
}; };
/** /**
@@ -122,15 +24,10 @@ const CATEGORIES = {
*/ */
export default class AvailableModulesMenu extends TranslatedComponent { export default class AvailableModulesMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
diffDetails: PropTypes.func, hideSearch: PropTypes.bool,
m: PropTypes.object, m: PropTypes.object,
ship: PropTypes.object.isRequired,
warning: PropTypes.func, warning: PropTypes.func,
firstSlotId: PropTypes.string,
lastSlotId: PropTypes.string,
activeSlotId: PropTypes.string,
slotDiv: PropTypes.object slotDiv: PropTypes.object
}; };
@@ -141,10 +38,8 @@ export default class AvailableModulesMenu extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this._hideDiff = this._hideDiff.bind(this); autoBind(this);
this._showSearch = this._showSearch.bind(this);
this.state = this._initState(props, context); this.state = this._initState(props, context);
this.slotItems = [];// Array to hold <li> refs.
} }
/** /**
@@ -154,232 +49,204 @@ export default class AvailableModulesMenu extends TranslatedComponent {
* @return {Object} list: Array of React Components, currentGroup Component if any * @return {Object} list: Array of React Components, currentGroup Component if any
*/ */
_initState(props, context) { _initState(props, context) {
let translate = context.language.translate; const { translate } = context.language;
let { m, warning, onSelect, modules, ship } = props; const { m } = props;
let list, currentGroup; const list = [], fuzzy = [];
let currentGroup;
let buildGroup = this._buildGroup.bind( const modules = m.getApplicableItems().map(getModuleInfo);
this, const groups = mapValues(
ship, groupBy(modules, (info) => info.meta.group),
translate, (infos) => groupBy(infos, (info) => info.meta.type),
m,
warning,
(m, event) => {
this._hideDiff(event);
onSelect(m);
}
); );
let fuzzy = []; // Build categories sorted by translated category name
if (modules instanceof Array) { const groupKeys = sortBy(Object.keys(groups), translate);
list = buildGroup(modules[0].grp, modules); for (const group of groupKeys) {
} else { const groupName = translate(group);
list = []; if (groupKeys.length > 1) {
// At present time slots with grouped options (Hardpoints and Internal) can be empty list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>);
if (m) {
let emptyId = 'empty';
if (this.firstSlotId == null) this.firstSlotId = emptyId;
let keyDown = this._keyDown.bind(this, onSelect);
list.push(<div className='empty-c upp' key={emptyId} data-id={emptyId} onClick={onSelect.bind(null, null)}
onKeyDown={keyDown} tabIndex="0"
ref={slotItem => this.slotItems[emptyId] = slotItem}>{translate('empty')}</div>);
} }
// Need to regroup the modules by our own categorisation const categories = groups[group];
let catmodules = {}; const categoryKeys = sortBy(Object.keys(categories), translate);
// Pre-create to preserve ordering for (const category of categoryKeys) {
for (let cat in CATEGORIES) { const categoryName = translate(category);
catmodules[cat] = []; const infos = categories[category];
} if (categoryKeys.length > 1) {
for (let g in modules) { list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>);
const moduleCategory = GRPCAT[g] || g;
const existing = catmodules[moduleCategory] || [];
catmodules[moduleCategory] = existing.concat(modules[g]);
}
for (let category in catmodules) {
let categoryHeader = false;
// Order through CATEGORIES if present
const categories = CATEGORIES[category] || [category];
if (categories && categories.length) {
for (let n in categories) {
const grp = categories[n];
// We now have the group and the category. We might not have any modules, though...
if (modules[grp]) {
// Decide if we need a category header as well as a group header
if (categories.length === 1) {
// Show category header instead of group header
if (m && grp == m.grp) {
list.push(<div ref={(elem) => this.groupElem = elem} key={category}
className={'select-category upp'}>{translate(category)}</div>);
} else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
}
} else {
// Show category header as well as group header
if (!categoryHeader) {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
categoryHeader = true;
}
if (m && grp == m.grp) {
list.push(<div ref={(elem) => this.groupElem = elem} key={grp}
className={'select-group cap'}>{translate(grp)}</div>);
} else {
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
}
}
list.push(buildGroup(grp, modules[grp]));
for (const i of modules[grp]) {
let mount = '';
if (i.mount === 'F') {
mount = 'Fixed';
} else if (i.mount === 'G') {
mount = 'Gimballed';
} else if (i.mount === 'T') {
mount = 'Turreted';
}
const fuzz = { grp, m: i, name: `${i.class}${i.rating}${mount ? ' ' + mount : ''} ${translate(grp)}` };
fuzzy.push(fuzz);
}
}
}
} }
list.push(
this._buildGroup(
m,
category,
infos,
),
);
fuzzy.push(
...infos.map((info) => {
const { meta } = info;
const mount = meta.mount ? ' ' + translate(meta.mount) : '';
return {
grp: groupName,
cat: categoryName,
m: info.proto.Item,
name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
};
}),
);
} }
} }
let trackingFocus = false; return { list, currentGroup, fuzzy, trackingFocus: false };
return { list, currentGroup, fuzzy, trackingFocus };
} }
/** /**
* Generate React Components for Module Group * Generate React Components for Module Group
* @param {Ship} ship Ship the selection is for
* @param {Function} translate Translate function
* @param {Object} mountedModule Mounted Module * @param {Object} mountedModule Mounted Module
* @param {Function} warningFunc Warning function * @param {String} category Category key
* @param {function} onSelect Select/Mount callback
* @param {string} grp Group name
* @param {Array} modules Available modules * @param {Array} modules Available modules
* @return {React.Component} Available Module Group contents * @return {React.Component} Available Module Group contents
*/ */
_buildGroup(ship, translate, mountedModule, warningFunc, onSelect, grp, modules) { _buildGroup(mountedModule, category, modules) {
let prevClass = null, prevRating = null, prevName; const { warning } = this.props;
let elems = []; const ship = mountedModule.getShip();
const classMapping = groupBy(modules, (info) => info.meta.class);
const sortedModules = modules.sort(this._moduleOrder); const itemsPerClass = Math.max(
...Object.values(classMapping).map((l) => l.length),
);
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
// Nested array of <li> elements; will be flattened before being rendered.
// Each sub-array represents one row in the final view.
const elems = [[]];
// Calculate the number of items per class. Used so we don't have long lists with only a few items in each row // Reverse sort for descending order of module class
const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => { for (const clazz of Object.keys(classMapping).sort().reverse()) {
count[cls] = ++count[cls] || 1; for (let info of sortBy(
return count; classMapping[clazz],
}, {}); (info) => info.meta.mount || info.meta.rating,
const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key])); )) {
const { meta } = info;
const { Item } = info.proto;
let itemsOnThisRow = 0; // Can only be true if shieldgenmaximalmass is defined, i.e. this
for (let i = 0; i < sortedModules.length; i++) { // module must be a shield generator
let m = sortedModules[i]; let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass');
let mount = null; if (meta.experimental && !mountedModule.readMeta('experimental')) {
let disabled = false; disabled =
prevName = m.name; 4 <=
if (ModuleUtils.isShieldGenerator(m.grp)) { ship.getHardpoints().filter((m) => m.readMeta('experimental'))
// Shield generators care about maximum hull mass .length;
disabled = ship.hullMass > m.maxmass; }
// If the mounted module is experimental as well, we can replace it so
// the maximum does not apply // Default event handlers for objects that are disabled
} else if (m.experimental && (!mountedModule || !mountedModule.experimental)) { let eventHandlers = {};
disabled = 4 <= ship.hardpoints.filter(o => o.m && o.m.experimental).length; if (!disabled) {
const showDiff = this._showDiff.bind(this, mountedModule, info);
const select = (event) => {
this._hideDiff(event);
this.props.onSelect(Item);
};
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
};
}
const mountSymbol = MOUNT_MAP[meta.mount];
const li = (
<li key={Item} data-id={Item}
ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
className={cn(meta.type === 'armour' ? 'lc' : 'c', {
warning: !disabled && warning && warning(info),
active: mountedModule.getItem() === Item,
disabled,
hardpoint: mountSymbol,
})}
{...eventHandlers}
>{mountSymbol}{meta.type === 'armour' ? Item : `${meta.class}${meta.rating}`}</li>
);
const tail = elems.pop();
let newTail = [tail];
if (tail.length < itemsPerRow) {
// If the row has not grown too long, the new <li> element can be
// added to the row itself
tail.push(li);
} else {
// Otherwise, the last row gets a line break element added and this
// item is put into a new row
tail.push(<br key={elems.length}/>);
newTail.push([li]);
}
elems.push(...newTail);
} }
let active = mountedModule && mountedModule.id === m.id;
let classes = cn(m.name ? 'lc' : 'c', {
warning: !disabled && warningFunc && warningFunc(m),
active,
disabled
});
let eventHandlers;
if (disabled) {
eventHandlers = {
onKeyDown: this._keyDown.bind(this, null),
onKeyUp: this._keyUp.bind(this, null)
};
} else {
/**
* Get the ids of the first and last <li> elements in the <ul> that are focusable (i.e. are not active or disabled)
* Will be used to keep focus inside the <ul> on Tab and Shift-Tab while it is visible
*/
if (this.firstSlotId == null) this.firstSlotId = sortedModules[i].id;
if (active) this.activeSlotId = sortedModules[i].id;
this.lastSlotId = sortedModules[i].id;
let showDiff = this._showDiff.bind(this, mountedModule, m);
let select = onSelect.bind(null, m);
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
onKeyDown: this._keyDown.bind(this, select),
onKeyUp: this._keyUp.bind(this, select)
};
}
switch (m.mount) {
case 'F':
mount = <MountFixed className={'lg'}/>;
break;
case 'G':
mount = <MountGimballed className={'lg'}/>;
break;
case 'T':
mount = <MountTurret className={'lg'}/>;
break;
}
if (m.name && m.name === prevName) {
// elems.push(<br key={'b' + m.grp + i} />);
itemsOnThisRow = 0;
}
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
elems.push(<br key={'b' + m.grp + i}/>);
itemsOnThisRow = 0;
}
let tbIdx = (classes.indexOf('disabled') < 0) ? 0 : undefined;
elems.push(
<li key={m.id} data-id={m.id} className={classes} {...eventHandlers} tabIndex={tbIdx}
ref={slotItem => this.slotItems[m.id] = slotItem}>
{mount}
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
</li>
);
itemsOnThisRow++;
prevClass = m.class;
prevRating = m.rating;
prevName = m.name;
} }
return <ul key={'modules' + grp}>{elems}</ul>;
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>;
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @param {Object} mm The module mounet currently * @param {Object} mountedModule The module mounted currently
* @param {Object} m The hovered module * @param {Object} hoveringModule The hovered module
* @param {DOMRect} rect DOMRect for target element * @param {DOMRect} rect DOMRect for target element
*/ */
_showDiff(mm, m, rect) { _showDiff(mountedModule, hoveringModule, rect) {
if (this.props.diffDetails) { const { tooltip, language } = this.context;
this.touchTimeout = null; const { formats, translate, units } = language;
this.context.tooltip(this.props.diffDetails(m, mm), rect); this.touchTimeout = null;
} const mountedIsEmpty = mountedModule.isEmpty();
const props = (
mountedIsEmpty ? ['mass'] : Object.keys(hoveringModule.props)
).map((prop) => SHOW[prop] ? SHOW[prop].as : prop);
const oldProps = mountedIsEmpty ?
[{ value: 0 }] :
props.map((prop) => mountedModule.getFormatted(prop, false));
const newProps = mountedModule.try(() => {
mountedModule.setItem(hoveringModule.proto.Item);
return props.map((prop) => mountedModule.getFormatted(prop, false));
});
const diffs = zipWith(oldProps, newProps, (oldVal, newVal) => {
const { unit, value } = newVal;
if (!oldVal.value) {
return undefined;
}
return { value, diff: value - oldVal.value, unit };
});
const namedDiffs = zip(props, diffs).filter(([_, stat]) => stat !== undefined);
namedDiffs.push(['cost', {
value: hoveringModule.meta.cost,
diff: hoveringModule.meta.cost - (mountedIsEmpty ? 0 : mountedModule.readMeta('cost')),
unit: units.CR,
}]);
const tt = <div className='cap' style={{ whiteSpace: 'nowrap' }}>
{sortBy(namedDiffs, ([prop, _]) => prop).map(([prop, stats]) => {
const { unit, value, diff } = stats;
const beneficial = get(MODULE_STATS, [prop, 'higherbetter'], false) === diff > 0;
return <div key={prop}>
{translate(prop)}: <span className={diff === 0 ? 'disabled' : beneficial ? 'secondary' : 'warning'}>
{formats.round(value)} {diff !== 0 && ` (${diff > 0 ? '+' : ''}${formats.round(diff)})`}{unit}
</span>
</div>;
})}
</div>;
tooltip(tt, rect);
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @returns {React.Component} Search component if available
*/ */
_showSearch() { _showSearch() {
if (this.props.modules instanceof Array) { if (this.props.hideSearch) {
return; return;
} }
return ( return (
@@ -442,41 +309,6 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this._hideDiff(); this._hideDiff();
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {Function} select Select module callback
* @param {SyntheticEvent} event Event
*/
_keyDown(select, event) {
let className = event.currentTarget.attributes['class'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
select();
return;
}
let elemId = event.currentTarget.attributes['data-id'].value;
if (className.indexOf('disabled') < 0 && event.key == 'Tab') {
if (event.shiftKey && elemId == this.firstSlotId) {
event.preventDefault();
this.slotItems[this.lastSlotId].focus();
return;
}
if (!event.shiftKey && elemId == this.lastSlotId) {
event.preventDefault();
this.slotItems[this.firstSlotId].focus();
return;
}
}
}
/**
* Key Up
* @param {Function} select Select module callback
* @param {SytheticEvent} event Event
*/
_keyUp(select, event) {
// nothing here yet
}
/** /**
* Hide diff tooltip * Hide diff tooltip
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -487,60 +319,12 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this.context.tooltip(); this.context.tooltip();
} }
/**
* Order two modules suitably for display in module selection
* @param {Object} a the first module
* @param {Object} b the second module
* @return {int} -1 if the first module should go first, 1 if the second module should go first
*/
_moduleOrder(a, b) {
// Named modules go last
if (!a.name && b.name) {
return -1;
}
if (a.name && !b.name) {
return 1;
}
// Class ordered from highest (8) to lowest (1)
if (a.class < b.class) {
return 1;
}
if (a.class > b.class) {
return -1;
}
// Mount type, if applicable
if (a.mount && b.mount && a.mount !== b.mount) {
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
return -1;
} else {
return 1;
}
}
// Rating ordered from highest (A) to lowest (E)
if (a.rating < b.rating) {
return -1;
}
if (a.rating > b.rating) {
return 1;
}
// Do not attempt to order by name at this point, as that mucks up the order of armour
return 0;
}
/** /**
* Scroll to mounted (if it exists) module group on mount * Scroll to mounted (if it exists) module group on mount
*/ */
componentDidMount() { componentDidMount() {
if (this.groupElem) { // Scroll to currently selected group if (this.activeSlotRef) {
this.node.scrollTop = this.groupElem.offsetTop; this.activeSlotRef.focus();
}
/**
* Set focus on active or first slot element, if applicable.
*/
if (this.slotItems[this.activeSlotId]) {
this.slotItems[this.activeSlotId].focus();
} else if (this.slotItems[this.firstSlotId]) {
this.slotItems[this.firstSlotId].focus();
} }
} }
@@ -570,10 +354,10 @@ export default class AvailableModulesMenu extends TranslatedComponent {
render() { render() {
return ( return (
<div ref={node => this.node = node} <div ref={node => this.node = node}
className={cn('select', this.props.className)} className={cn('select', this.props.className)}
onScroll={this._hideDiff} onScroll={this._hideDiff}
onClick={(e) => e.stopPropagation()} onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation} onContextMenu={stopCtxPropagation}
> >
{this._showSearch()} {this._showSearch()}
{this.state.list} {this.state.list}

View File

@@ -1,6 +1,7 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
/** /**
* Boost displays a boost button that toggles bosot * Boost displays a boost button that toggles bosot
@@ -8,8 +9,6 @@ import TranslatedComponent from './TranslatedComponent';
*/ */
export default class Boost extends TranslatedComponent { export default class Boost extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
onChange: PropTypes.func.isRequired onChange: PropTypes.func.isRequired
}; };
@@ -19,12 +18,9 @@ export default class Boost extends TranslatedComponent {
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
const { ship, boost } = props; autoBind(this);
this._keyDown = this._keyDown.bind(this);
this._toggleBoost = this._toggleBoost.bind(this);
} }
/** /**
@@ -70,13 +66,12 @@ export default class Boost extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { ship, boost } = this.props;
// TODO disable if ship cannot boost
return ( return (
<span id='boost'> <span id='boost'>
<button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button> <button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}>
{translate('boost')}
</button>
</span> </span>
); );
} }

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Cargo slider * Cargo slider
@@ -21,8 +22,7 @@ export default class Cargo extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._cargoChange = this._cargoChange.bind(this);
} }
/** /**

View File

@@ -1,13 +1,14 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import Ship from '../shipyard/Ship'; import { Factory, Ship } from 'ed-forge';
import { Insurance } from '../shipyard/Constants'; import { Insurance } from '../shipyard/Constants';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShoppingIcon } from '../components/SvgIcons'; import { ShoppingIcon } from './SvgIcons';
import autoBind from 'auto-bind';
import { assign, differenceBy, sortBy, reverse } from 'lodash';
import { FUEL_CAPACITY } from 'ed-forge/lib/src/ship-stats';
/** /**
* Cost Section * Cost Section
@@ -16,7 +17,7 @@ export default class CostSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
buildName: PropTypes.string buildName: PropTypes.string,
}; };
/** /**
@@ -25,71 +26,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._costsTab = this._costsTab.bind(this); autoBind(this);
this._sortCost = this._sortCost.bind(this);
this._sortAmmo = this._sortAmmo.bind(this);
this._sortRetrofit = this._sortRetrofit.bind(this);
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
this._eddbShoppingList = this._eddbShoppingList.bind(this);
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
const { ship, buildName } = props;
this.shipType = ship.getShipType();
this.state = { this.state = {
retrofitShip, retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null,
retrofitName, shipDiscount: Persist.getShipDiscount(),
shipDiscount, moduleDiscount: Persist.getModuleDiscount(),
moduleDiscount,
insurance: Insurance[Persist.getInsurance()], insurance: Insurance[Persist.getInsurance()],
tab: Persist.getCostTab(), tab: Persist.getCostTab(),
buildOptions: Persist.getBuildsNamesFor(props.ship.id), buildOptions: Persist.getBuildsNamesFor(ship.getShipType()),
ammoPredicate: 'cr', predicate: 'cr',
ammoDesc: true, desc: true,
costPredicate: 'cr', excluded: {},
costDesc: true,
retroPredicate: 'cr',
retroDesc: true
}; };
} }
/** /**
* Create a ship instance to base/reference retrofit changes from * Create a ship instance to base/reference retrofit changes from
* @param {string} shipId Ship Id
* @param {string} name Build name
* @param {Ship} retrofitShip Existing retrofit ship
* @return {Ship} Retrofit ship * @return {Ship} Retrofit ship
*/ */
_buildRetrofitShip(shipId, name, retrofitShip) { _buildRetrofitShip() {
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults const { retrofitName } = this.state;
if (Persist.hasBuild(this.shipType, retrofitName)) {
if (!retrofitShip) { // Don't create a new instance unless needed return new Ship(Persist.getBuild(this.shipType, retrofitName));
retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
}
if (Persist.hasBuild(shipId, name)) {
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
} else { } else {
retrofitShip.buildWith(data.defaults); // Populate with default components return Factory.newShip(this.shipType);
} }
return retrofitShip;
}
/**
* Get the default retrofit build name if it exists
* @param {string} shipId Ship Id
* @param {string} name Build name
* @return {string} Build name or null
*/
_defaultRetrofitName(shipId, name) {
return Persist.hasBuild(shipId, name) ? name : null;
} }
/** /**
@@ -107,9 +71,6 @@ export default class CostSection extends TranslatedComponent {
_onDiscountChanged() { _onDiscountChanged() {
let shipDiscount = Persist.getShipDiscount(); let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount(); let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this.setState({ shipDiscount, moduleDiscount }); this.setState({ shipDiscount, moduleDiscount });
} }
@@ -126,156 +87,33 @@ export default class CostSection extends TranslatedComponent {
* @param {SyntheticEvent} event Build name to base the retrofit ship on * @param {SyntheticEvent} event Build name to base the retrofit ship on
*/ */
_onBaseRetrofitChange(event) { _onBaseRetrofitChange(event) {
let retrofitName = event.target.value; this.setState({ retrofitName: event.target.value });
let ship = this.props.ship;
if (retrofitName) {
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
} else {
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
}
this._updateRetrofit(ship, this.state.retrofitShip);
this.setState({ retrofitName });
} }
/** /**
* On builds changed check to see if the retrofit ship needs * Toggle item cost inclusion
* to be updated * @param {String} key Key of the row to toggle
*/ */
_onBuildsChanged() { _toggleExcluded(key) {
let update = false; let { excluded } = this.state;
let ship = this.props.ship; excluded = assign({}, excluded);
let { retrofitName, retrofitShip } = this.state; const slotExcluded = excluded[key];
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
if(!Persist.hasBuild(ship.id, retrofitName)) { this.setState({ excluded });
retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
this.setState({ retrofitName: null });
update = true;
} else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
update = true;
}
if (update) { // Update retrofit comparison
this._updateRetrofit(ship, retrofitShip);
}
// Update list of retrofit base build options
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
} }
/** /**
* Toggle item cost inclusion in overall total * Set list sort predicate
* @param {Object} item Cost item * @param {string} newPredicate sort predicate
*/ */
_toggleCost(item) { _sortBy(newPredicate) {
this.props.ship.setCostIncluded(item, !item.incCost); let { predicate, desc } = this.state;
this.forceUpdate();
}
/** if (newPredicate == predicate) {
* Toggle item cost inclusion in retrofit total desc = !desc;
* @param {Object} item Cost item
*/
_toggleRetrofitCost(item) {
let retrofitTotal = this.state.retrofitTotal;
item.retroItem.incCost = !item.retroItem.incCost;
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
this.setState({ retrofitTotal });
}
/**
* Set cost list sort predicate
* @param {string} predicate sort predicate
*/
_sortCostBy(predicate) {
let { costPredicate, costDesc } = this.state;
if (costPredicate == predicate) {
costDesc = !costDesc;
} }
this.setState({ costPredicate: predicate, costDesc }); this.setState({ predicate: newPredicate, desc });
}
/**
* Sort cost list
* @param {Ship} ship Ship instance
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortCost(ship, predicate, desc) {
let costList = ship.costList;
let translate = this.context.language.translate;
if (predicate == 'm') {
costList.sort(slotComparator(translate, null, desc));
} else {
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
}
}
/**
* Set ammo list sort predicate
* @param {string} predicate sort predicate
*/
_sortAmmoBy(predicate) {
let { ammoPredicate, ammoDesc } = this.state;
if (ammoPredicate == predicate) {
ammoDesc = !ammoDesc;
}
this.setState({ ammoPredicate: predicate, ammoDesc });
}
/**
* Sort ammo cost list
* @param {Array} ammoCosts Ammo cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortAmmo(ammoCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'm') {
ammoCosts.sort(slotComparator(translate, null, desc));
} else {
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
}
}
/**
* Set retrofit list sort predicate
* @param {string} predicate sort predicate
*/
_sortRetrofitBy(predicate) {
let { retroPredicate, retroDesc } = this.state;
if (retroPredicate == predicate) {
retroDesc = !retroDesc;
}
this.setState({ retroPredicate: predicate, retroDesc });
}
/**
* Sort retrofit cost list
* @param {Array} retrofitCosts Retrofit cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortRetrofit(retrofitCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'cr') {
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
} else {
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
}
if (!desc) {
retrofitCosts.reverse();
}
} }
/** /**
@@ -284,18 +122,34 @@ export default class CostSection extends TranslatedComponent {
*/ */
_costsTab() { _costsTab() {
let { ship } = this.props; let { ship } = this.props;
let { shipDiscount, moduleDiscount, insurance } = this.state; let {
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
} = this.state;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let rows = []; let rows = [];
for (let i = 0, l = ship.costList.length; i < l; i++) { let modules = sortBy(
let item = ship.costList[i]; ship.getModules(),
if (item.m && item.m.cost) { (predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost'))
let toggle = this._toggleCost.bind(this, item); );
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}> if (desc) {
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td> reverse(modules);
<td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td> }
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
let totalCost = 0;
for (let module of modules) {
const cost = module.readMeta('cost');
const slot = module.getSlot();
if (cost) {
let toggle = this._toggleExcluded.bind(this, slot);
const disabled = excluded[slot];
if (!disabled) {
totalCost += cost;
}
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
</tr>); </tr>);
} }
} }
@@ -304,23 +158,23 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%', borderCollapse: 'collapse' }}> <table style={{ width: '100%', borderCollapse: 'collapse' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>
{translate('module')} {translate('module')}
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null} {shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null}
</th> </th>
<th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl' >{translate('total')}</td> <td colSpan='2' className='lbl' >{translate('total')}</td>
<td className='val'>{formats.int(ship.totalCost)}{units.CR}</td> <td className='val'>{formats.int(totalCost)}{units.CR}</td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl'>{translate('insurance')}</td> <td colSpan='2' className='lbl'>{translate('insurance')}</td>
<td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td> <td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -331,14 +185,63 @@ export default class CostSection extends TranslatedComponent {
* Open up a window for EDDB with a shopping list of our retrofit components * Open up a window for EDDB with a shopping list of our retrofit components
*/ */
_eddbShoppingList() { _eddbShoppingList() {
const { retrofitCosts } = this.state; const {} = this.state;
const { ship } = this.props; const { ship } = this.props;
// Provide unique list of non-PP module EDDB IDs to buy // Provide unique list of non-PP module EDDB IDs to buy
const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i); // const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
// Open up the relevant URL // Open up the relevant URL
window.open('https://eddb.io/station?m=' + modIds.join(',')); // TODO:
// window.open('https://eddb.io/station?m=' + modIds.join(','));
}
/**
*
*/
_retrofitInfo() {
const { ship } = this.props;
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
const retrofitShip = this._buildRetrofitShip();
const currentModules = ship.getModules();
const oldModules = retrofitShip.getModules();
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
let modules = [];
let totalCost = 0;
const addModule = (m, costFactor) => {
const key = `${m.getItem()}@${m.getSlot()}`;
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
modules.push({
key, cost,
rating: m.getClassRating(),
item: m.readMeta('type'),
});
if (!excluded[key]) {
totalCost += cost;
}
};
for (let m of buyModules) {
addModule(m, 1);
}
for (let m of sellModules) {
addModule(m, -1);
}
let _sortF = undefined;
switch (predicate) {
case 'cr': _sortF = (o) => o.cost; break;
case 'm':
default: _sortF = (o) => o.item; break;
};
modules = sortBy(modules, _sortF);
if (desc) {
reverse(modules);
}
return [totalCost, modules];
} }
/** /**
@@ -346,59 +249,52 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_retrofitTab() { _retrofitTab() {
let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state; let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state;
const { termtip, tooltip } = this.context; const { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let int = formats.int; let int = formats.int;
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
for (let opt of this.state.buildOptions) {
options.push(<option key={opt} value={opt}>{opt}</option>);
}
if (retrofitCosts.length) {
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
let item = retrofitCosts[i];
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
</tr>);
}
} else {
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
}
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
return <div> return <div>
<div className='scroll-x'> <div className='scroll-x'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
{translate('net cost')} {translate('net cost')}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {retrofitInfo.length ?
retrofitInfo.map((info) => (
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
onClick={() => this._toggleExcluded(info.key)}>
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
<td className='le ptr shorten cap'>{translate(info.item)}</td>
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
{int(info.cost)}{units.CR}
</td>
</tr>
)) : (
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
)}
<tr className='ri'> <tr className='ri'>
<td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td> <td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
<td colSpan='3' className='lbl' >{translate('cost')}</td> <td className='lbl' >{translate('cost')}</td>
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}> <td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
{int(retrofitTotal)}{units.CR} {int(retrofitTotal)}{units.CR}
</td> </td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td> <td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td>
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td> <td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td>
<td className='val' style={{ borderLeft:'none', padding: 0 }}> <td className='val' style={{ borderLeft:'none', padding: 0 }}>
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}> <select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
{options} <option key='stock' value=''>{translate('Stock')}</option>
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
</select> </select>
</td> </td>
</tr> </tr>
@@ -408,63 +304,50 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/** /**
* Update retrofit costs *
* @param {Ship} ship Ship instance * @param {*} modules
* @param {Ship} retrofitShip Retrofit Ship instance
*/ */
_updateRetrofit(ship, retrofitShip) { _ammoInfo() {
let retrofitCosts = []; const { ship } = this.props;
let retrofitTotal = 0, i, l, item; const { desc, predicate } = this.state;
if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) { let info = [{
item = { key: 'fuel',
buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating, item: 'Fuel',
buyId: ship.bulkheads.m.eddbID, qty: ship.get(FUEL_CAPACITY),
buyPp: ship.bulkheads.m.pp, unitCost: 50,
buyName: ship.bulkheads.m.name, cost: 50 * ship.get(FUEL_CAPACITY),
sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating, }];
sellName: retrofitShip.bulkheads.m.name, for (let m of ship.getModules()) {
netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost, const rebuilds = m.get('bays') * m.get('rebuildsperbay');
retroItem: retrofitShip.bulkheads const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds;
}; if (ammo) {
retrofitCosts.push(item); const unitCost = m.readMeta('ammocost');
if (retrofitShip.bulkheads.incCost) { info.push({
retrofitTotal += item.netCost; key: `restock_${m.getSlot()}`,
rating: m.getClassRating(),
item: m.readMeta('type'),
qty: ammo,
unitCost, cost: unitCost * ammo,
});
} }
} }
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) { let _sortF = undefined;
let retroSlotGroup = retrofitShip[g]; switch (predicate) {
let slotGroup = ship[g]; case 'cr': _sortF = (o) => o.cost; break;
for (i = 0, l = slotGroup.length; i < l; i++) { case 'qty': _sortF = (o) => o.qty; break;
const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null; case 'cost': _sortF = (o) => o.unitCost; break;
const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null; case 'm':
if (modId != retroModId) { default: _sortF = (o) => o.item;
item = { netCost: 0, retroItem: retroSlotGroup[i] }; }
if (slotGroup[i].m) { info = sortBy(info, _sortF);
item.buyId = slotGroup[i].m.eddbID, if (desc) {
item.buyPp = slotGroup[i].m.pp, reverse(info);
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
item.netCost = slotGroup[i].discountedCost;
}
if (retroSlotGroup[i].m) {
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
item.netCost -= retroSlotGroup[i].discountedCost;
}
retrofitCosts.push(item);
if (retroSlotGroup[i].incCost) {
retrofitTotal += item.netCost;
}
}
}
} }
this.setState({ retrofitCosts, retrofitTotal }); return info;
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
} }
/** /**
@@ -472,20 +355,24 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_ammoTab() { _ammoTab() {
let { ammoTotal, ammoCosts } = this.state; const { excluded } = this.state;
let { translate, formats, units } = this.context.language; const { translate, formats, units } = this.context.language;
let int = formats.int; const int = formats.int;
let rows = []; const rows = [];
for (let i = 0, l = ammoCosts.length; i < l; i++) { const ammoInfo = this._ammoInfo();
let item = ammoCosts[i]; let total = 0;
rows.push(<tr key={i} className='highlight'> for (let i of ammoInfo) {
<td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td> const disabled = excluded[i.key];
<td className='le shorten cap'>{slotName(translate, item)}</td> rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)}
<td className='ri'>{int(item.max)}</td> className={cn('highlight', { disabled })}>
<td className='ri'>{int(item.cost)}{units.CR}</td> <td style={{ width: '1em' }}>{i.rating}</td>
<td className='ri'>{int(item.total)}{units.CR}</td> <td className='le shorten cap'>{translate(i.item)}</td>
<td className='ri'>{int(i.qty)}</td>
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
<td className='ri'>{int(i.cost)}{units.CR}</td>
</tr>); </tr>);
total += disabled ? 0 : i.cost;
} }
return <div> return <div>
@@ -493,17 +380,17 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th>
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th> <th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th>
<th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th> <th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl' >{translate('total')}</td> <td colSpan='4' className='lbl' >{translate('total')}</td>
<td className='val'>{int(ammoTotal)}{units.CR}</td> <td className='val'>{int(total)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -511,103 +398,6 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/**
* Recalculate all ammo costs
* @param {Ship} ship Ship instance
*/
_updateAmmoCosts(ship) {
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
let slotGroup = ship[g];
for (let i = 0, l = slotGroup.length; i < l; i++) {
if (slotGroup[i].m) {
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
q = 0;
switch (slotGroup[i].m.grp) {
case 'fs': // Skip fuel calculation if scoop present
scoop = true;
break;
case 'scb':
q = slotGroup[i].m.getAmmo() + 1;
break;
case 'am':
q = slotGroup[i].m.getAmmo();
break;
case 'pv':
srvs += slotGroup[i].m.getBays();
break;
case 'fx': case 'hb': case 'cc': case 'pc':
limpets = ship.cargoCapacity;
break;
default:
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
}
// Calculate ammo costs only if a cost is specified
if (slotGroup[i].m.ammocost > 0) {
item = {
m: slotGroup[i].m,
max: q,
cost: slotGroup[i].m.ammocost,
total: q * slotGroup[i].m.ammocost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Add fighters
if (slotGroup[i].m.grp === 'fh') {
item = {
m: slotGroup[i].m,
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
cost: slotGroup[i].m.fightercost,
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
}
}
}
// Limpets if controllers exist and cargo space available
if (limpets > 0) {
item = {
m: { name: 'limpets', class: '', rating: '' },
max: ship.cargoCapacity,
cost: 101,
total: ship.cargoCapacity * 101
};
ammoCosts.push(item);
ammoTotal += item.total;
}
if (srvs > 0) {
item = {
m: { name: 'SRVs', class: '', rating: '' },
max: srvs,
cost: 1030,
total: srvs * 1030
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Calculate refuel costs if no scoop present
if (!scoop) {
item = {
m: { name: 'fuel', class: '', rating: '' },
max: ship.fuelCapacity,
cost: 50,
total: ship.fuelCapacity * 50
};
ammoCosts.push(item);
ammoTotal += item.total;
}
this.setState({ ammoTotal, ammoCosts });
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
}
/** /**
* Add listeners on mount and update costs * Add listeners on mount and update costs
*/ */
@@ -615,64 +405,7 @@ export default class CostSection extends TranslatedComponent {
this.listeners = [ this.listeners = [
Persist.addListener('discounts', this._onDiscountChanged.bind(this)), Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)), Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
]; ];
this._updateAmmoCosts(this.props.ship);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this._sortCost(this.props.ship);
}
/**
* Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context
*/
componentWillReceiveProps(nextProps, nextContext) {
let retrofitShip = this.state.retrofitShip;
if (nextProps.ship != this.props.ship) { // Ship has changed
let nextId = nextProps.ship.id;
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
this.setState({
retrofitShip,
retrofitName,
buildOptions: Persist.getBuildsNamesFor(nextId)
});
}
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
this._updateAmmoCosts(nextProps.ship);
this._updateRetrofit(nextProps.ship, retrofitShip);
this._sortCost(nextProps.ship);
}
}
/**
* Sort lists before render
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
let state = this.state;
switch (nextState.tab) {
case 'ammo':
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
}
break;
case 'retrofit':
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
}
break;
default:
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
}
}
} }
/** /**

View File

@@ -1,9 +1,10 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import VerticalBarChart from './VerticalBarChart'; import VerticalBarChart from './VerticalBarChart';
import autoBind from 'auto-bind';
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/src/ship-stats';
/** /**
* Defence information * Defence information
@@ -15,12 +16,10 @@ import VerticalBarChart from './VerticalBarChart';
*/ */
export default class Defence extends TranslatedComponent { export default class Defence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.object.isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
sys: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired
}; };
/** /**
@@ -29,22 +28,7 @@ export default class Defence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
this.state = { shield, armour, shielddamage, armourdamage };
}
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
this.setState({ shield, armour, shielddamage, armourdamage });
}
return true;
} }
/** /**
@@ -52,187 +36,104 @@ export default class Defence extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { opponent, sys, opponentWep } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { shield, armour, shielddamage, armourdamage } = this.state;
const pd = opponent.standard[4].m; const shields = ship.get(SHIELD_METRICS);
const shieldSourcesData = []; // Data for pie chart (absolute MJ)
const effectiveShieldData = []; const shieldSourcesData = [
const shieldDamageTakenData = []; 'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs',
const shieldSourcesTt = []; ].map((key) => { return { label: key, value: Math.round(shields[key]) }; });
const shieldDamageTakenAbsoluteTt = [];
const shieldDamageTakenExplosiveTt = [];
const shieldDamageTakenKineticTt = [];
const shieldDamageTakenThermalTt = [];
const effectiveShieldAbsoluteTt = [];
const effectiveShieldExplosiveTt = [];
const effectiveShieldKineticTt = [];
const effectiveShieldThermalTt = [];
let maxEffectiveShield = 0;
if (shield.total) {
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
shieldSourcesData.push({ value: Math.round(shield.addition), label: translate('shield addition') });
if (shield.generator > 0) { // Data for tooltip
shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); const shieldSourcesTt = shieldSourcesData.map((o) => {
effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); let { label, value } = o;
effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); return <div key={label}>
effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); {translate(label)} {formats.int(value)}{units.MJ}
effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>); </div>;
if (shield.boosters > 0) { });
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
}
if (shield.cells > 0) { // Shield resistances
shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const shieldDamageTakenData = [
effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); 'absolute', 'explosive', 'kinetic', 'thermal',
effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); ].map((label) => {
effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const dmgMult = shields[label];
effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>); const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
} (label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
});
// Add effective shield from resistances // Effective MJ
const rawMj = shield.generator + shield.boosters + shield.cells; const effectiveShieldData = [
const explosiveMj = rawMj / (shield.explosive.base) - rawMj; 'absolute', 'explosive', 'kinetic', 'thermal'
if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>); ].map((label) => {
const kineticMj = rawMj / (shield.kinetic.base) - rawMj; const dmgMult = shields[label];
if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>); const raw = shields.withSCBs;
const thermalMj = rawMj / (shield.thermal.base) - rawMj; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>); (label) => <div key={label}>
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
</div>
);
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
});
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
// Add effective shield from power distributor SYS pips const armour = ship.get(ARMOUR_METRICS);
if (shield.absolute.sys != 1) { const moduleProtection = ship.get(MODULE_PROTECTION_METRICS);
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.total - rawMj)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.total - rawMj / shield.explosive.base)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.total - rawMj / shield.kinetic.base)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.total - rawMj / shield.thermal.base)}{units.MJ}</div>);
}
}
shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>); // Data for pie chart (absolute HP)
shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>); const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map(
shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>); (key) => { return { label: key, value: Math.round(armour[key]) }; }
);
shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>); // Data for tooltip
shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>); const armourSourcesTt = armourSourcesData.map((o) => {
shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>); let { label, value } = o;
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
});
shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>); // Armour resistances
shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>); const armourDamageTakenData = [
shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal', 'caustic',
].map((label) => {
const dmgMult = armour[label];
const tooltip = ['byAlloys', 'byHRPs'].map(
(label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
});
shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>); // Effective HP
shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>); const effectiveArmourData = [
shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>); 'absolute', 'explosive', 'kinetic', 'thermal'
].map((label) => {
const effectiveAbsoluteShield = shield.total / shield.absolute.total; const dmgMult = armour[label];
effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt }); const raw = armour.armour;
const effectiveExplosiveShield = shield.total / shield.explosive.total; const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt }); (label) => <div key={label}>
const effectiveKineticShield = shield.total / shield.kinetic.total; {translate(label)} {formats.int(raw * dmgMult[label])}
effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt }); </div>
const effectiveThermalShield = shield.total / shield.thermal.total; );
effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt }); return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip };
});
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
}
const armourSourcesData = [];
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
const armourSourcesTt = [];
const effectiveArmourAbsoluteTt = [];
const effectiveArmourExplosiveTt = [];
const effectiveArmourKineticTt = [];
const effectiveArmourThermalTt = [];
const effectiveArmourCausticTt = [];
if (armour.bulkheads > 0) {
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
if (armour.reinforcement > 0) {
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
}
}
const rawArmour = armour.bulkheads + armour.reinforcement;
const armourDamageTakenTt = [];
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
const armourDamageTakenExplosiveTt = [];
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
if (armour.explosive.total != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.explosive.total - rawArmour)}</div>);
const armourDamageTakenKineticTt = [];
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
if (armour.kinetic.total != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.kinetic.total - rawArmour)}</div>);
const armourDamageTakenThermalTt = [];
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.thermal.total - rawArmour)}</div>);
const armourDamageTakenCausticTt = [];
armourDamageTakenCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.caustic.bulkheads)}</div>);
armourDamageTakenCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.caustic.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourCausticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.caustic.total - rawArmour)}</div>);
const effectiveArmourData = [];
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
const effectiveKineticArmour = armour.total / armour.kinetic.total;
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
const effectiveThermalArmour = armour.total / armour.thermal.total;
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
const effectiveCausticArmour = armour.total / armour.caustic.total;
effectiveArmourData.push({ value: Math.round(effectiveCausticArmour), label: translate('caustic'), tooltip: effectiveArmourCausticTt });
const armourDamageTakenData = [];
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
armourDamageTakenData.push({ value: Math.round(armour.caustic.total * 100), label: translate('caustic'), tooltip: armourDamageTakenCausticTt });
return ( return (
<span id='defence'> <span id='defence'>
{shield.total ? <span> {shields.withSCBs ? <span>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('shield metrics')}</h2> <h2>{translate('shield metrics')}</h2>
<br/> <br/>
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2> <h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
@@ -250,11 +151,11 @@ export default class Defence extends TranslatedComponent {
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('armour metrics')}</h2> <h2>{translate('armour metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2> <h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2>
<br/> <br/>
</div> </div>
<div className='group quarter'> <div className='group quarter'>

View File

@@ -0,0 +1,134 @@
import React from 'react';
import autoBind from 'auto-bind';
import Persist from '../stores/Persist';
import PropTypes from 'prop-types';
import { getBlueprintUuid, getExperimentalUuid } from 'ed-forge/lib/src/data/blueprints';
import { Loader, MatIcon } from '../components/SvgIcons';
import request from 'superagent';
import { chain, entries } from 'lodash';
import TranslatedComponent from './TranslatedComponent';
const STATE = {
READY: 0,
LOADING: 1,
ERROR: 2,
DONE: 3,
};
/**
*
*/
export default class EDEngineerButton extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
autoBind(this);
const { ship } = props;
const uuids = chain(ship.getModules())
.filter((m) => m.getBlueprint())
.map((m) => {
const uuids = [getBlueprintUuid(m.getBlueprint(), m.getBlueprintGrade())];
const exp = m.getExperimental();
if (exp) {
uuids.push(getExperimentalUuid(exp));
}
return uuids;
})
.flatMap()
.groupBy()
.mapValues((v) => v.length)
.value();
this.state = {
status: STATE.READY,
uuids,
};
}
/**
* Generates the shopping list
*/
_sendToEDEngineer() {
const { uuids } = this.state;
this.setState({ status: STATE.LOADING });
request.get('http://localhost:44405/commanders')
.then((data) => {
const [cmdr] = JSON.parse(data.text);
return Promise.all(
entries(uuids).map(
(entry) => {
const [uuid, n] = entry;
return new Promise((resolve, reject) => {
request.patch(`http://localhost:44405/${cmdr}/shopping-list`)
.field('uuid', uuid)
.field('size', n)
.end((err, res) => {
console.log('request goes out!');
if (err) {
reject(err);
} else {
resolve(res);
}
});
});
},
),
);
})
.then(() => this.setState({ status: STATE.DONE }))
.catch((err) => {
console.error(err);
this.setState({ status: STATE.ERROR });
});
}
/**
* Checks for browser compatibility of sending to ED Engineer.
* @returns {boolean} True if browser is compatible
*/
_browserIsCompatible() {
// !== Firefox 1.0+
// TODO: Double check if this really doesn't work in firefox
return typeof InstallTrigger === 'undefined';
}
/**
*
* @returns
*/
render() {
const { termtip, tooltip } = this.context;
const hide = tooltip.bind(null, null);
const { status } = this.state;
let msg = 'PHRASE_FIREFOX_EDENGINEER';
if (this._browserIsCompatible()) {
switch (status) {
case STATE.READY: msg = 'Send to EDEngineer'; break;
case STATE.LOADING: msg = 'Sending...'; break;
case STATE.ERROR: msg = 'Error sending to EDEngineer'; break;
case STATE.DONE: msg = 'Success! Clicking sends again.'; break;
}
}
return (<button
disabled={!this._browserIsCompatible()}
onClick={status !== STATE.LOADING && this._sendToEDEngineer}
onMouseOver={termtip.bind(null, msg)}
onMouseOut={hide}
>
{status === STATE.LOADING ?
<Loader className="lg" /> :
<MatIcon className="lg" />
}
</button>);
}
}

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import { moduleReduce } from 'ed-forge/lib/src/helper';
/** /**
* Engagement range slider * Engagement range slider
@@ -21,35 +22,18 @@ export default class EngagementRange extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
const { ship } = props;
const maxRange = Math.round(this._calcMaxRange(ship));
this.state = { this.state = {
maxRange maxRange: moduleReduce(
this.props.ship.getHardpoints(),
'maximumrange',
true,
// Don't use plain `Math.max` because callback will be passed four args
(a, v) => Math.max(a, v),
1000,
),
}; };
} }
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/** /**
* Update range * Update range
* @param {number} rangeLevel percentage level from 0 to 1 * @param {number} rangeLevel percentage level from 0 to 1
@@ -61,7 +45,9 @@ export default class EngagementRange extends TranslatedComponent {
const range = Math.round(rangeLevel * maxRange); const range = Math.round(rangeLevel * maxRange);
if (range !== this.props.engagementRange) { if (range !== this.props.engagementRange) {
this.props.onChange(range); const { onChange, ship } = this.props;
ship.setEngagementRange(range);
onChange(range);
} }
} }
@@ -70,8 +56,8 @@ export default class EngagementRange extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language, onWindowResize, sizeRatio } = this.context;
const { formats, translate, units } = language; const { formats, translate } = language;
const { engagementRange } = this.props; const { engagementRange } = this.props;
const { maxRange } = this.state; const { maxRange } = this.state;

View File

@@ -2,98 +2,58 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/src/stats/SpeedProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* Engine profile for a given ship * Engine profile for a given ship
*/ */
export default class EngineProfile extends TranslatedComponent { export default class EngineProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
}
return true;
}
/**
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
* @param {Object} ship The ship
* @param {Object} eng The number of pips to ENG
* @param {Object} boost If boost is enabled
* @param {Object} mass The mass at which to calculate the top speed
* @return {number} The maximum speed
*/
calcMaxSpeed(ship, eng, boost, mass) {
// Obtain the top speed
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
}
/** /**
* Render engine profile * Render engine profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, eng, fuel, boost } = this.props; const { code, ship, pips, boost } = this.props;
// Calculate bounds for our line chart // Calculate bounds for our line chart
const thrusters = ship.standard[1].m; const minMass = ship.readProp('hullmass');
const minMass = ship.calcLowestPossibleMass({ th: thrusters }); const maxMass = ship.getThrusters().get('enginemaximalmass');
const maxMass = thrusters.getMaxMass(); const baseSpeed = ship.readProp('speed');
const mass = ship.unladenMass + fuel + cargo; const baseBoost = getBoostMultiplier(ship);
const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false); const cb = (eng, boost, mass) => {
const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true); const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5];
// Add a mark at our current mass return baseSpeed * (boost ? baseBoost : 1) * mult;
const mark = Math.min(mass, maxMass); };
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother // This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minSpeed} yMin={cb(0, false, maxMass)}
yMax={maxSpeed} yMax={cb(4, true, minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum speed')} yLabel={translate('maximum speed')}
yUnit={translate('m/s')} yUnit={translate('m/s')}
func={this.state.calcMaxSpeedFunc} func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)}
points={1000} points={1000}
code={code} // Encode boost in code to re-render on state change
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
aspect={0.7} aspect={0.7}
/> />
); );

View File

@@ -2,94 +2,47 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import { calculateJumpRange } from 'ed-forge/lib/src/stats/JumpRangeProfile';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* FSD profile for a given ship * FSD profile for a given ship
*/ */
export default class FSDProfile extends TranslatedComponent { export default class FSDProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
}
return true;
}
/**
* Calculate the maximum range for this ship across its applicable mass
* @param {Object} ship The ship
* @param {Object} fuel The fuel on the ship
* @param {Object} mass The mass at which to calculate the maximum range
* @return {number} The maximum range
*/
_calcMaxRange(ship, fuel, mass) {
// Obtain the maximum range
return Calc.jumpRange(mass, ship.standard[2].m, Math.min(fuel, ship.standard[2].m.getMaxFuelPerJump()), ship);
}
/** /**
* Render FSD profile * Render FSD profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { ship, cargo, fuel } = this.props; const { code, ship } = this.props;
// Calculate bounds for our line chart - use thruster info for X
const thrusters = ship.standard[1].m;
const fsd = ship.standard[2].m;
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
const maxMass = thrusters.getMaxMass();
const mass = ship.unladenMass + fuel + cargo;
const minRange = 0;
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump(), ship);
// Add a mark at our current mass
const mark = Math.min(mass, maxMass);
const code = ship.name + ship.toString() + '.' + fuel;
const minMass = ship.readProp('hullmass');
const maxMass = ship.getThrusters().get('enginemaximalmass');
const mass = ship.get(LADEN_MASS);
const cb = (mass) => calculateJumpRange(ship.getFSD(), 0, mass, Infinity, true);
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={minRange} yMin={0}
yMax={maxRange} yMax={cb(minMass)}
xMark={mark} // Add a mark at our current mass
xMark={Math.min(mass, maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum range')} yLabel={translate('maximum range')}
yUnit={translate('LY')} yUnit={translate('LY')}
func={this.state.calcMaxRangeFunc} func={cb}
points={200} points={200}
code={code} code={code}
aspect={0.7} aspect={0.7}

View File

@@ -2,6 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Fuel slider * Fuel slider
@@ -21,8 +22,7 @@ export default class Fuel extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._fuelChange = this._fuelChange.bind(this);
} }
/** /**

View File

@@ -1,151 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import {
DamageAbsolute,
DamageKinetic,
DamageThermal,
DamageExplosive,
MountFixed,
MountGimballed,
MountTurret,
ListModifications,
Modified
} from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Hardpoint / Utility Slot
*/
export default class HardpointSlot extends Slot {
/**
* Get the CSS class name for the slot.
* @return {string} CSS Class name
*/
_getClassNames() {
return this.props.maxClass > 0 ? 'hardpoint' : null;
}
/**
* Get the label for the slot
* @param {Function} translate Translate function
* @return {string} Label
*/
_getMaxClassLabel(translate) {
return translate(['U', 'S', 'M', 'L', 'H'][this.props.maxClass]);
}
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
let { drag, drop } = this.props;
let { termtip, tooltip } = this.context;
let validMods = Modifications.modules[m.grp].modifications || [];
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')}
onMouseOut={tooltip.bind(null, null)}><MountFixed/></span> : ''}
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')}
onMouseOut={tooltip.bind(null, null)}><MountGimballed/></span> : ''}
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')}
onMouseOut={tooltip.bind(null, null)}><MountTurret/></span> : ''}
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')}
onMouseOut={tooltip.bind(null, null)}><DamageKinetic/></span> : ''}
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')}
onMouseOut={tooltip.bind(null, null)}><DamageThermal/></span> : ''}
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')}
onMouseOut={tooltip.bind(null, null)}><DamageExplosive/></span> : ''}
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')}
onMouseOut={tooltip.bind(null, null)}><DamageAbsolute/></span> : ''}
{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r'
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}><Modified/></span> : null}
</div>
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
</div>
<div className={'cb'}>
{m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} {m.getClip() ?
<span>({formats.round1(m.getSDps())})</span> : null}</div> : null}
{m.getDamage() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getDamage() ? 'shotdmg' : 'shotdmg')}
onMouseOut={tooltip.bind(null, null)}>{translate('shotdmg')}: {formats.round1(m.getDamage())}</div> : null}
{m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')}
onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} {m.getClip() ?
<span>({formats.round1(m.getEps() * m.getSustainedFactor())}{u.MW})</span> : null}</div> : null}
{m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')}
onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} {m.getClip() ?
<span>({formats.round1(m.getHps() * m.getSustainedFactor())})</span> : null}</div> : null}
{m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null}
{m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')}
onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null}
{m.getRange() ? <div
className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null}
{m.getScanTime() ? <div
className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null}
{m.getFalloff() ? <div
className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null}
{m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null}
{m.getAmmo() ? <div
className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null}
{m.getReload() ? <div className={'l'}>{translate('wep_reload')}: {formats.round(m.getReload())}{u.s}</div> : null}
{m.getShotSpeed() ? <div
className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null}
{m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null}
{m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null}
{m.getScanAngle() ? <div className={'l'}>{translate('scan angle')}: {formats.f2(m.getScanAngle())}°</div> : null}
{m.getScanRange() ? <div className={'l'}>{translate('scan range')}: {formats.int(m.getScanRange())}{u.m}</div> : null}
{m.getMaxAngle() ? <div className={'l'}>{translate('max angle')}: {formats.f2(m.getMaxAngle())}°</div> : null}
{showModuleResistances && m.getExplosiveResistance() ? <div
className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null}
{showModuleResistances && m.getKineticResistance() ? <div
className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null}
{showModuleResistances && m.getThermalResistance() ? <div
className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null}
{m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null}
{m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={modButton => this.modButton = modButton}>
<button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}>
<ListModifications/></button>
</div> : null}
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,96 +1,82 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
const SIZE_ORDER = ['huge', 'large', 'medium', 'small'];
/** /**
* Hardpoint slot section * Hardpoint slot section
*/ */
export default class HardpointSlotSection extends SlotSection { export default class HardpointSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'hardpoints', 'hardpoints'); super(props, 'hardpoints');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'nl-F';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; this.props.ship.getHardpoints(undefined, true).forEach((slot) => slot.reset());
this.props.ship.emptyWeapons();
this.props.onChange();
this._close(); this._close();
} }
/** /**
* Fill slots with specified module * Fill slots with specified module
* @param {string} group Group name * @param {string} type Type of item
* @param {string} mount Mount Type - F, G, T * @param {string} rating Mount Type - (fixed, gimbal, turret)
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fill(group, mount, event) { _fill(type, rating, event) {
this.selectedRefId = group + '-' + mount; const fillAll = event.getModifierState('Alt');
this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt')); this.props.ship.getHardpoints(undefined, true).forEach((slot) => {
this.props.onChange(); if (slot.isEmpty() || fillAll) {
const slotSize = slot.getSize();
const fittingSizes = SIZE_ORDER.slice(SIZE_ORDER.findIndex((e) => e === slotSize));
for (const size of fittingSizes) {
try {
slot.setItem(type, size, rating);
} catch (err) {
// Try next item if this doesn't fit/exist
continue;
}
// If still here, we were able to apply the module
break;
}
}
});
this._close(); this._close();
} }
/**
* Empty all on section header right click
*/
_contextMenu() {
this._empty();
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let slots = []; let slots = [];
let hardpoints = ship.hardpoints;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getHardpoints(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass) { key={h.object.Slot}
slots.push(<HardpointSlot currentMenu={currentMenu}
key={i} drag={this._drag.bind(this, h)}
maxClass={h.maxClass} dragOver={this._dragOverSlot.bind(this, h)}
availableModules={() => availableModules.getHps(h.maxClass)} drop={this._drop}
onOpen={this._openMenu.bind(this, h)} dropClass={this._dropClass(h, originSlot, targetSlot)}
onSelect={this._selectModule.bind(this, h)} m={h}
onChange={this.props.onChange} enabled={h.enabled ? true : false}
selected={currentMenu == h} propsToShow={propsToShow}
drag={this._drag.bind(this, h)} onPropToggle={onPropToggle}
dragOver={this._dragOverSlot.bind(this, h)} />);
drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -101,68 +87,68 @@ export default class HardpointSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _fill = this._fill; let _fill = this._fill;
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex="0" onClick={this._empty}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('pl')}</div> <div className='select-group cap'>{translate('pulselaser')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('ul')}</div> <div className='select-group cap'>{translate('burstlaser')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('bl')}</div> <div className='select-group cap'>{translate('beamlaser')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('mc')}</div> <div className='select-group cap'>{translate('multicannon')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('c')}</div> <div className='select-group cap'>{translate('cannon')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('fc')}</div> <div className='select-group cap'>{translate('fragcannon')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-G'] = smRef}><MountGimballed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'gimbal')}><MountGimballed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('pa')}</div> <div className='select-group cap'>{translate('plasmaacc')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'pa', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pa-F'] = smRef}>{translate('pa')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'plasmaacc', 'fixed')}>{translate('pa')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rg')}</div> <div className='select-group cap'>{translate('railgun')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'rg', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rg-F'] = smRef}>{translate('rg')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'railgun', 'fixed')}>{translate('rg')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('nl')}</div> <div className='select-group cap'>{translate('minelauncher')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_fill.bind(this, 'nl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['nl-F'] = smRef}>{translate('nl')}</li> <li className='lc' tabIndex="0" onClick={_fill.bind(this, 'minelauncher', 'fixed')}>{translate('nl')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('rfl')}</div> <div className='select-group cap'>{translate('flaklauncher')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-F'] = smRef}><MountFixed className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'fixed')}><MountFixed className='lg'/></li>
<li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-T'] = smRef}><MountTurret className='lg'/></li> <li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'turret')}><MountTurret className='lg'/></li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -6,10 +6,7 @@ import Link from './Link';
import ActiveLink from './ActiveLink'; import ActiveLink from './ActiveLink';
import cn from 'classnames'; import cn from 'classnames';
import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons'; import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import { toDetailedExport } from '../shipyard/Serializer';
import Ship from '../shipyard/Ship';
import ModalDeleteAll from './ModalDeleteAll'; import ModalDeleteAll from './ModalDeleteAll';
import ModalExport from './ModalExport'; import ModalExport from './ModalExport';
import ModalHelp from './ModalHelp'; import ModalHelp from './ModalHelp';
@@ -17,6 +14,9 @@ import ModalImport from './ModalImport';
import Slider from './Slider'; import Slider from './Slider';
import Announcement from './Announcement'; import Announcement from './Announcement';
import { outfitURL } from '../utils/UrlGenerators'; import { outfitURL } from '../utils/UrlGenerators';
import autoBind from 'auto-bind';
import { Factory, Ship } from 'ed-forge';
import { chain, entries } from 'lodash';
const SIZE_MIN = 0.65; const SIZE_MIN = 0.65;
const SIZE_RANGE = 0.55; const SIZE_RANGE = 0.55;
@@ -55,32 +55,21 @@ function selectAll(e) {
* Coriolis App Header section / menus * Coriolis App Header section / menus
*/ */
export default class Header extends TranslatedComponent { export default class Header extends TranslatedComponent {
/**
/** * Constructor
* Constructor * @param {Object} props React Component properties
* @param {Object} props React Component properties * @param {Object} context React Component context
* @param {Object} context React Component context */
*/
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this.shipOrder = Object.keys(Ships).sort(); autoBind(this);
this.ships = Factory.getAllShipTypes().sort();
this._setLanguage = this._setLanguage.bind(this);
this._setInsurance = this._setInsurance.bind(this);
this._setShipDiscount = this._setShipDiscount.bind(this);
this._changeShipDiscount = this._changeShipDiscount.bind(this);
this._kpShipDiscount = this._kpShipDiscount.bind(this);
this._setModuleDiscount = this._setModuleDiscount.bind(this);
this._changeModuleDiscount = this._changeModuleDiscount.bind(this);
this._kpModuleDiscount = this._kpModuleDiscount.bind(this);
this._openShips = this._openMenu.bind(this, 's'); this._openShips = this._openMenu.bind(this, 's');
this._openBuilds = this._openMenu.bind(this, 'b'); this._openBuilds = this._openMenu.bind(this, 'b');
this._openComp = this._openMenu.bind(this, 'comp'); this._openComp = this._openMenu.bind(this, 'comp');
this._openAnnounce = this._openMenu.bind(this, 'announce'); this._openAnnounce = this._openMenu.bind(this, 'announce');
this._getAnnouncementsMenu = this._getAnnouncementsMenu.bind(this);
this._openSettings = this._openMenu.bind(this, 'settings'); this._openSettings = this._openMenu.bind(this, 'settings');
this._showHelp = this._showHelp.bind(this);
this.update = this.update.bind(this);
this.languageOptions = []; this.languageOptions = [];
this.insuranceOptions = []; this.insuranceOptions = [];
this.state = { this.state = {
@@ -210,13 +199,6 @@ export default class Header extends TranslatedComponent {
Persist.showTooltips(!Persist.showTooltips()); Persist.showTooltips(!Persist.showTooltips());
} }
/**
* Toggle module resistances setting
*/
_toggleModuleResistances() {
Persist.showModuleResistances(!Persist.showModuleResistances());
}
/** /**
* Show delete all modal * Show delete all modal
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} e Event
@@ -226,20 +208,6 @@ export default class Header extends TranslatedComponent {
this.context.showModal(<ModalDeleteAll />); this.context.showModal(<ModalDeleteAll />);
}; };
/**
* Show export modal with backup data
* @param {SyntheticEvent} e Event
*/
_showBackup(e) {
let translate = this.context.language.translate;
e.preventDefault();
this.context.showModal(<ModalExport
title={translate('backup')}
description={translate('PHRASE_BACKUP_DESC')}
data={Persist.getAll()}
/>);
};
/** /**
* Show export modal with detailed export * Show export modal with detailed export
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} e Event
@@ -248,10 +216,22 @@ export default class Header extends TranslatedComponent {
let translate = this.context.language.translate; let translate = this.context.language.translate;
e.preventDefault(); e.preventDefault();
const builds = chain(Persist.getBuilds())
.values()
.map((builds) => Object.values(builds))
.flatMap()
.map((code) => new Ship(code))
.value();
this.context.showModal(<ModalExport this.context.showModal(<ModalExport
title={translate('detailed export')} title={translate('detailed export')}
description={translate('PHRASE_EXPORT_DESC')} description={translate('PHRASE_EXPORT_DESC')}
data={toDetailedExport(Persist.getBuilds())} data={JSON.stringify(builds.map((build) => {
return {
header: { appName: 'Inara', 'appVersion': '1.0' },
data: build.toJSON(),
};
}))}
/>); />);
} }
@@ -309,15 +289,10 @@ export default class Header extends TranslatedComponent {
* @return {React.Component} Menu * @return {React.Component} Menu
*/ */
_getShipsMenu() { _getShipsMenu() {
let shipList = []; const { translate } = this.context.language;
for (let s of this.shipOrder) {
shipList.push(<ActiveLink key={s} href={outfitURL(s)} className='block'>{Ships[s].properties.name}</ActiveLink>);
}
return ( return (
<div className='menu-list dbl no-wrap' onClick={ (e) => e.stopPropagation() }> <div className='menu-list dbl no-wrap' onClick={ (e) => e.stopPropagation() }>
{shipList} {this.ships.map((s) => <ActiveLink key={s} href={outfitURL(s)} className='block'>{translate(s)}</ActiveLink>)}
</div> </div>
); );
} }
@@ -327,9 +302,10 @@ export default class Header extends TranslatedComponent {
* @return {React.Component} Menu * @return {React.Component} Menu
*/ */
_getBuildsMenu() { _getBuildsMenu() {
const { translate } = this.context.language;
let builds = Persist.getBuilds(); let builds = Persist.getBuilds();
let buildList = []; let buildList = [];
for (let shipId of this.shipOrder) { for (let shipId of this.ships) {
if (builds[shipId]) { if (builds[shipId]) {
let shipBuilds = []; let shipBuilds = [];
let buildNameOrder = Object.keys(builds[shipId]).sort(); let buildNameOrder = Object.keys(builds[shipId]).sort();
@@ -337,7 +313,7 @@ export default class Header extends TranslatedComponent {
let href = outfitURL(shipId, builds[shipId][buildName], buildName); let href = outfitURL(shipId, builds[shipId][buildName], buildName);
shipBuilds.push(<li key={shipId + '-' + buildName} ><ActiveLink href={href} className='block'>{buildName}</ActiveLink></li>); shipBuilds.push(<li key={shipId + '-' + buildName} ><ActiveLink href={href} className='block'>{buildName}</ActiveLink></li>);
} }
buildList.push(<ul key={shipId}>{Ships[shipId].properties.name}{shipBuilds}</ul>); buildList.push(<ul key={shipId}>{translate(shipId)}{shipBuilds}</ul>);
} }
} }
@@ -410,7 +386,6 @@ export default class Header extends TranslatedComponent {
_getSettingsMenu() { _getSettingsMenu() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let tips = Persist.showTooltips(); let tips = Persist.showTooltips();
let moduleResistances = Persist.showModuleResistances();
return ( return (
<div className='menu-list no-wrap cap' onClick={ (e) => e.stopPropagation() }> <div className='menu-list no-wrap cap' onClick={ (e) => e.stopPropagation() }>
@@ -428,10 +403,6 @@ export default class Header extends TranslatedComponent {
<td>{translate('tooltips')}</td> <td>{translate('tooltips')}</td>
<td className={cn('ri', { disabled: !tips, 'primary-disabled': tips })}>{(tips ? '✓' : '✗')}</td> <td className={cn('ri', { disabled: !tips, 'primary-disabled': tips })}>{(tips ? '✓' : '✗')}</td>
</tr> </tr>
<tr className='cap ptr' onClick={this._toggleModuleResistances} >
<td>{translate('module resistances')}</td>
<td className={cn('ri', { disabled: !moduleResistances, 'primary-disabled': moduleResistances })}>{(moduleResistances ? '✓' : '✗')}</td>
</tr>
<tr> <tr>
<td>{translate('insurance')}</td> <td>{translate('insurance')}</td>
<td className='ri'> <td className='ri'>
@@ -459,10 +430,9 @@ export default class Header extends TranslatedComponent {
<hr /> <hr />
<ul style={{ width: '100%' }}> <ul style={{ width: '100%' }}>
{translate('builds')} & {translate('comparisons')} {translate('builds')} & {translate('comparisons')}
<li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li> <li><Link href="#" className='block' onClick={this._showDetailedExport}>{translate('detailed export')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li> <li><Link href="#" className='block' onClick={this._showImport}>{translate('import')}</Link></li>
<li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li> <li><Link href="#" className='block' onClick={this._showDeleteAll}>{translate('delete all')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li>
</ul> </ul>
<hr /> <hr />
<table style={{ width: 300, backgroundColor: 'transparent' }}> <table style={{ width: 300, backgroundColor: 'transparent' }}>
@@ -473,7 +443,7 @@ export default class Header extends TranslatedComponent {
<td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td> <td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td>
</tr> </tr>
<tr> <tr>
<td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td> <td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -494,7 +464,6 @@ export default class Header extends TranslatedComponent {
Persist.addListener('deletedAll', update); Persist.addListener('deletedAll', update);
Persist.addListener('builds', update); Persist.addListener('builds', update);
Persist.addListener('tooltips', update); Persist.addListener('tooltips', update);
Persist.addListener('moduleresistances', update);
} }
/** /**
@@ -564,19 +533,13 @@ export default class Header extends TranslatedComponent {
{openedMenu == 'b' ? this._getBuildsMenu() : null} {openedMenu == 'b' ? this._getBuildsMenu() : null}
</div> </div>
<div className='l menu'> {/* TODO: Enable */}
<div className={cn('menu-header', { selected: openedMenu == 'comp', disabled: !hasBuilds })} onClick={hasBuilds && this._openComp}> {/* <div className='l menu'>
<StatsBars className={cn('warning', { 'warning-disabled': !hasBuilds })} /><span className='menu-item-label'>{translate('compare')}</span> <div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0 })} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
</div>
{openedMenu == 'comp' ? this._getComparisonsMenu() : null}
</div>
<div className='l menu'>
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0})} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
<span className='menu-item-label'>{translate('announcements')}</span> <span className='menu-item-label'>{translate('announcements')}</span>
</div> </div>
{openedMenu == 'announce' ? this._getAnnouncementsMenu() : null} {openedMenu == 'announce' ? this._getAnnouncementsMenu() : null}
</div> </div> */}
{window.location.origin.search('.edcd.io') >= 0 ? {window.location.origin.search('.edcd.io') >= 0 ?
<div className='l menu'> <div className='l menu'>
@@ -603,5 +566,4 @@ export default class Header extends TranslatedComponent {
</header> </header>
); );
} }
} }

View File

@@ -1,98 +0,0 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Internal Slot
*/
export default class InternalSlot extends Slot {
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = m.class + m.rating;
let { drag, drop, ship } = this.props;
let { termtip, tooltip } = this.context;
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
let mass = m.getMass() || m.cargo || m.fuel || 0;
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
<div className={'r'}>{formats.round(mass)}{u.T}</div>
</div>
<div className={'cb'}>
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs}&nbsp;&nbsp;&nbsp;{translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
{ m.grp === 'gsrp' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.grp === 'gfsb' ? <div className={'l'}>{translate('jump addition')}: {formats.f1(m.getJumpBoost())}{u.LY}</div> : null }
{ m.grp === 'gs' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
{ m.rangeLS === null ? <div className={'l'}>{u.Ls}</div> : null }
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ showModuleResistances && m.getCausticResistance() ? <div className='l'>{translate('causres')}: {formats.pct(m.getCausticResistance())}</div> : null }
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,52 +1,46 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import InternalSlot from './InternalSlot'; import Slot from './Slot';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions'; import autoBind from 'auto-bind';
import { TYPES } from 'ed-forge/lib/src/data/slots';
/**
* Sets all empty slots of a ship to a item of the given size.
* @param {Ship} ship Ship to set items for
* @param {boolean} fillAll True to also fill occupied
* @param {string} type Item type
* @param {string} rating Item rating
*/
function setAllEmpty(ship, fillAll, type, rating = '') {
ship.getModules(TYPES.ANY_INTERNAL, undefined, true).forEach((slot) => {
if (slot.isEmpty() || fillAll) {
try {
// Maybe the item does not exist. Simply catch this error.
slot.setItem(type, slot.getSize(), rating);
} catch (e) {}
}
});
}
/** /**
* Internal slot section * Internal slot section
*/ */
export default class InternalSlotSection extends SlotSection { export default class InternalSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'internal', 'optional internal'); super(props, 'optional internal');
this._empty = this._empty.bind(this); autoBind(this);
this._fillWithCargo = this._fillWithCargo.bind(this);
this._fillWithCells = this._fillWithCells.bind(this);
this._fillWithArmor = this._fillWithArmor.bind(this);
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = this.sectionRefArr['pcq'] ? 'pcq' : 'pcm';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.selectedRefId = 'emptyall'; this.props.ship.getModules(TYPES.ANY_INTERNAL).forEach((slot) => slot.reset());
this.props.ship.emptyInternal();
this.props.onChange();
this._close(); this._close();
} }
@@ -55,15 +49,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCargo(event) { _fillWithCargo(event) {
this.selectedRefId = 'cargo'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'cargorack');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'cr')) {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -72,15 +59,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFuelTanks(event) { _fillWithFuelTanks(event) {
this.selectedRefId = 'ft'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'fueltank', '3');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'ft')) {
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -89,15 +69,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithLuxuryCabins(event) { _fillWithLuxuryCabins(event) {
this.selectedRefId = 'pcq'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'passengercabins', '4');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pcq')) {
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -106,15 +79,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFirstClassCabins(event) { _fillWithFirstClassCabins(event) {
this.selectedRefId = 'pcm'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'passengercabins', '3');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pcm')) {
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -123,15 +89,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithBusinessClassCabins(event) { _fillWithBusinessClassCabins(event) {
this.selectedRefId = 'pci'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'passengercabins', '2');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pci')) {
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -140,15 +99,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithEconomyClassCabins(event) { _fillWithEconomyClassCabins(event) {
this.selectedRefId = 'pce'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'passengercabins', '1');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pce')) {
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -157,18 +109,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCells(event) { _fillWithCells(event) {
this.selectedRefId = 'scb'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'scb', '5');
let ship = this.props.ship;
let chargeCap = 0; // Capacity of single activation
ship.internal.forEach(function(slot) {
if ((clobber && !(slot.m && ModuleUtils.isShieldGenerator(slot.m.grp)) || !slot.m) && canMount(ship, slot, 'scb')) {
ship.use(slot, ModuleUtils.findInternal('scb', slot.maxClass, 'A'));
ship.setSlotEnabled(slot, chargeCap <= ship.shieldStrength); // Don't waste cell capacity on overcharge
chargeCap += slot.m.recharge;
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -177,15 +119,8 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithArmor(event) { _fillWithArmor(event) {
this.selectedRefId = 'hr'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'hrp', '2');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'hr')) {
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -194,56 +129,31 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithModuleReinforcementPackages(event) { _fillWithModuleReinforcementPackages(event) {
this.selectedRefId = 'mrp'; const fillAll = event.getModifierState('Alt');
let clobber = event.getModifierState('Alt'); setAllEmpty(this.props.ship, fillAll, 'mrp', '2');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'mrp')) {
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
}
});
this.props.onChange();
this._close(); this._close();
} }
/**
* Empty all on section header right click
*/
_contextMenu() {
this._empty();
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { currentMenu, ship } = this.props; let { currentMenu, ship, propsToShow, onPropToggle } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let { internal, fuelCapacity } = ship;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = internal.length; i < l; i++) { for (const m of ship.getInternals(undefined, true)) {
let s = internal[i]; slots.push(<Slot
key={m.object.Slot}
slots.push(<InternalSlot currentMenu={currentMenu}
key={i} m={m}
maxClass={s.maxClass} drag={this._drag.bind(this, m)}
availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)} dragOver={this._dragOverSlot.bind(this, m)}
onOpen={this._openMenu.bind(this,s)}
onChange={this.props.onChange}
onSelect={this._selectModule.bind(this, s)}
selected={currentMenu == s}
eligible={s.eligible}
m={s.m}
drag={this._drag.bind(this, s)}
dragOver={this._dragOverSlot.bind(this, s)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(s, originSlot, targetSlot)} dropClass={this._dropClass(m, originSlot, targetSlot)}
fuel={fuelCapacity} propsToShow={propsToShow}
ship={ship} onPropToggle={onPropToggle}
enabled={s.enabled ? true : false}
/>); />);
} }
@@ -256,22 +166,23 @@ export default class InternalSlotSection extends SlotSection {
* @param {Function} ship The ship * @param {Function} ship The ship
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate, ship) { _getSectionMenu() {
const { ship } = this.props;
const { translate } = this.context.language;
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCargo} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['cargo'] = smRef}>{translate('cargo')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCells} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['scb'] = smRef}>{translate('scb')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithArmor} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hr'] = smRef}>{translate('hr')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mrp'] = smRef}>{translate('mrp')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ft'] = smRef}>{translate('ft')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pce'] = smRef}>{translate('pce')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pci'] = smRef}>{translate('pci')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown} ref={smRef => this.sectionRefArr['pcm'] = smRef}>{translate('pcm')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li>
{ ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pcq'] = smRef}>{translate('pcq')}</li> : ''} { ship.readMeta('luxuryCabins') ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -1,120 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart';
import Slider from '../components/Slider';
import * as Calc from '../shipyard/Calculations';
/**
* Jump range for a given ship
*/
export default class JumpRange extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
fuelLevel: 1,
calcJumpRangeFunc: this._calcJumpRange.bind(this, ship)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.code != this.props.code) {
this.setState({ fuelLevel: 1,
calcJumpRangeFunc: this._calcJumpRange.bind(this, nextProps.ship) });
}
return true;
}
/**
* Calculate the jump range this ship at a given cargo
* @param {Object} ship The ship
* @param {Object} cargo The cargo
* @return {number} The jump range
*/
_calcJumpRange(ship, cargo) {
// Obtain the FSD for this ship
const fsd = ship.standard[2].m;
const fuel = this.state.fuelLevel * ship.fuelCapacity;
// Obtain the jump range
return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel, ship);
}
/**
* Update fuel level
* @param {number} fuelLevel Fuel level 0 - 1
*/
_fuelChange(fuelLevel) {
this.setState({
fuelLevel,
});
}
/**
* Render engine profile
* @return {React.Component} contents
*/
render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { formats, translate, units } = language;
const { ship } = this.props;
const { fuelLevel } = this.state;
const code = ship.toString() + '.' + ship.getModificationsString() + '.' + fuelLevel;
return (
<span>
<h1>{translate('jump range')}</h1>
<LineChart
xMax={ship.cargoCapacity}
yMax={ship.unladenRange}
xLabel={translate('cargo')}
xUnit={translate('T')}
yLabel={translate('jump range')}
yUnit={translate('LY')}
func={this.state.calcJumpRangeFunc}
points={200}
code={code}
/>
<h3>{translate('fuel carried')}: {formats.f2(fuelLevel * ship.fuelCapacity)}{units.T}</h3>
<table style={{ width: '100%', lineHeight: '1em', backgroundColor: 'transparent' }}>
<tbody >
<tr>
<td>
<Slider
axis={true}
onChange={this._fuelChange.bind(this)}
axisUnit={translate('T')}
percent={fuelLevel}
max={ship.fuelCapacity}
scale={sizeRatio}
onResize={onWindowResize}
/>
</td>
</tr>
</tbody>
</table>
</span>
);
}
}

View File

@@ -3,6 +3,7 @@ import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 }; const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
@@ -10,7 +11,6 @@ const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
* Line Chart * Line Chart
*/ */
export default class LineChart extends TranslatedComponent { export default class LineChart extends TranslatedComponent {
static defaultProps = { static defaultProps = {
code: '', code: '',
xMin: 0, xMin: 0,
@@ -45,13 +45,7 @@ export default class LineChart extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateSeries = this._updateSeries.bind(this);
this._tooltip = this._tooltip.bind(this);
this._showTip = this._showTip.bind(this);
this._hideTip = this._hideTip.bind(this);
this._moveTip = this._moveTip.bind(this);
const series = props.series; const series = props.series;

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Link wrapper component * Link wrapper component
*/ */
export default class Link extends React.Component { export default class Link extends React.Component {
static propTypes = { static propTypes = {
children: PropTypes.any, children: PropTypes.any,
href: PropTypes.string.isRequired, href: PropTypes.string.isRequired,
@@ -56,5 +55,4 @@ export default class Link extends React.Component {
render() { render() {
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>; return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
} }
} }

View File

@@ -21,7 +21,6 @@ function buildComparator(a, b) {
* Compare builds modal * Compare builds modal
*/ */
export default class ModalCompare extends TranslatedComponent { export default class ModalCompare extends TranslatedComponent {
static propTypes = { static propTypes = {
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
builds: PropTypes.array builds: PropTypes.array
@@ -105,8 +104,8 @@ export default class ModalCompare extends TranslatedComponent {
let selectedBuilds = usedBuilds.map((build, i) => let selectedBuilds = usedBuilds.map((build, i) =>
<tr key={i} onClick={this._removeBuild.bind(this, i)}> <tr key={i} onClick={this._removeBuild.bind(this, i)}>
<td className='tl'>{build.name}</td>< <td className='tl'>{build.name}</td>
td className='tl'>{build.buildName}</td> <td className='tl'>{build.buildName}</td>
</tr> </tr>
); );

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Export Modal * Export Modal
*/ */
export default class ModalExport extends TranslatedComponent { export default class ModalExport extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string, title: PropTypes.string,
generator: PropTypes.func, generator: PropTypes.func,

View File

@@ -7,19 +7,10 @@ import TranslatedComponent from './TranslatedComponent';
* Help Modal * Help Modal
*/ */
export default class ModalHelp extends TranslatedComponent { export default class ModalHelp extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string title: PropTypes.string
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render the modal * Render the modal
* @return {React.Component} Modal Content * @return {React.Component} Modal Content

View File

@@ -2,92 +2,21 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Router from '../Router';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import { Ships } from 'coriolis-data/dist'; import autoBind from 'auto-bind';
import Ship from '../shipyard/Ship'; import { isArray } from 'lodash';
import { ModuleNameToGroup, Insurance } from '../shipyard/Constants'; import { Ship } from 'ed-forge';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { fromDetailedBuild } from '../shipyard/Serializer';
import { Download } from './SvgIcons';
import { outfitURL } from '../utils/UrlGenerators';
import { shipFromJson, shipModelFromJson } from '../utils/CompanionApiUtils';
import { shipFromLoadoutJSON } from '../utils/JournalUtils';
const zlib = require('pako'); const STATE = {
READY: 0,
const textBuildRegex = new RegExp('^\\[([\\w \\-]+)\\]\n'); PARSED: 1,
const lineRegex = new RegExp('^([\\dA-Z]{1,2}): (\\d)([A-I])[/]?([FGT])?([SD])? ([\\w\\- ]+)'); ERROR: 2,
const mountMap = { 'H': 4, 'L': 3, 'M': 2, 'S': 1, 'U': 0 }; };
const standardMap = { 'RB': 0, 'TM': 1, 'FH': 2, 'EC': 3, 'PC': 4, 'SS': 5, 'FS': 6 };
const bhMap = { 'lightweight alloy': 0, 'reinforced alloy': 1, 'military grade composite': 2, 'mirrored surface composite': 3, 'reactive surface composite': 4 };
/**
* Check is slot is empty
* @param {Object} slot Slot model
* @return {Boolean} True if empty
*/
function isEmptySlot(slot) {
return slot.maxClass == this && slot.m === null;
}
/**
* Determine if a build is valid
* @param {string} shipId Ship ID
* @param {string} code Serialzied ship build 'code'
* @param {string} name Build name
* @throws {string} If build is not valid
*/
function validateBuild(shipId, code, name) {
let shipData = Ships[shipId];
if (!shipData) {
throw '"' + shipId + '" is not a valid Ship Id!';
}
if (typeof name != 'string' || name.length == 0) {
throw shipData.properties.name + ' build "' + name + '" must be a string at least 1 character long!';
}
if (typeof code != 'string' || code.length < 10) {
throw shipData.properties.name + ' build "' + name + '" is not valid!';
}
try {
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildFrom(code);
} catch (e) {
throw shipData.properties.name + ' build "' + name + '" is not valid!';
}
}
/**
* Convert a ship-loadout JSON object to a Coriolis build
* @param {Object} detailedBuild ship-loadout
* @return {Object} Coriolis build
*/
function detailedJsonToBuild(detailedBuild) {
let ship;
if (!detailedBuild.name) {
throw 'Build Name missing!';
}
if (!detailedBuild.name.trim()) {
throw 'Build Name must be a string at least 1 character long!';
}
try {
ship = fromDetailedBuild(detailedBuild);
} catch (e) {
throw detailedBuild.ship + ' Build "' + detailedBuild.name + '": Invalid data';
}
return { shipId: ship.id, name: detailedBuild.name, code: ship.toString() };
}
/** /**
* Import Modal * Import Modal
*/ */
export default class ModalImport extends TranslatedComponent { export default class ModalImport extends TranslatedComponent {
static propTypes = { static propTypes = {
importString: PropTypes.string, // Optional: Default data for import modal importString: PropTypes.string, // Optional: Default data for import modal
builds: PropTypes.object, // Optional: Import object builds: PropTypes.object, // Optional: Import object
@@ -99,228 +28,12 @@ export default class ModalImport extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this.state = { this.state = {
builds: props.builds, status: STATE.READY,
canEdit: !props.builds, builds: props.builds || [],
loadoutEvent: null,
comparisons: null,
shipDiscount: null,
moduleDiscount: null,
errorMsg: null,
importString: props.importString || null,
importValid: false,
insurance: null
}; };
this._process = this._process.bind(this);
this._import = this._import.bind(this);
this._importBackup = this._importBackup.bind(this);
this._importLoadout = this._importLoadout.bind(this);
this._importDetailedArray = this._importDetailedArray.bind(this);
this._importTextBuild = this._importTextBuild.bind(this);
this._importCompanionApiBuild = this._importCompanionApiBuild.bind(this);
this._validateImport = this._validateImport.bind(this);
}
/**
* Import a Loadout event from Elite: Dangerous journal files
* @param {Object} data Loadout event
* @throws {string} If import fails
*/
_importLoadout(data) {
if (data && data.Ship && data.Modules) {
const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' });
let compressed = btoa(deflated);
this.setState({loadoutEvent: compressed});
} else {
throw 'Loadout event must contain Ship and Modules';
}
}
/**
* Import a Coriolis backup
* @param {Object} importData Backup Data
* @throws {string} If import fails
*/
_importBackup(importData) {
if (importData.builds && typeof importData.builds == 'object') {
for (let shipId in importData.builds) {
for (let buildName in importData.builds[shipId]) {
try {
validateBuild(shipId, importData.builds[shipId][buildName], buildName);
} catch (err) {
delete importData.builds[shipId][buildName];
}
}
}
this.setState({ builds: importData.builds });
} else {
throw 'builds must be an object!';
}
if (importData.comparisons) {
for (let compName in importData.comparisons) {
let comparison = importData.comparisons[compName];
for (let i = 0, l = comparison.builds.length; i < l; i++) {
let build = comparison.builds[i];
if (!importData.builds[build.shipId] || !importData.builds[build.shipId][build.buildName]) {
throw build.shipId + ' build "' + build.buildName + '" data is missing!';
}
}
}
this.setState({ comparisons: importData.comparisons });
}
// Check for old/deprecated discounts
if (importData.discounts instanceof Array && importData.discounts.length == 2) {
this.setState({ shipDiscount: importData.discounts[0], moduleDiscount: importData.discounts[1] });
}
// Check for ship discount
if (!isNaN(importData.shipDiscount)) {
this.setState({ shipDiscount: importData.shipDiscount * 1 });
}
// Check for module discount
if (!isNaN(importData.moduleDiscount)) {
this.setState({ moduleDiscount: importData.moduleDiscount * 1 });
}
if (typeof importData.insurance == 'string') {
let insurance = importData.insurance.toLowerCase();
if (Insurance[insurance] !== undefined) {
this.setState({ insurance });
} else {
throw 'Invalid insurance type: ' + insurance;
}
}
}
/**
* Import an array of ship-loadout objects / builds
* @param {Array} importArr Array of ship-loadout JSON Schema builds
*/
_importDetailedArray(importArr) {
let builds = {};
for (let i = 0, l = importArr.length; i < l; i++) {
let build = detailedJsonToBuild(importArr[i]);
if (!builds[build.shipId]) {
builds[build.shipId] = {};
}
builds[build.shipId][build.name] = build.code;
}
this.setState({ builds });
}
/**
* Import a build direct from the companion API
* @param {string} build JSON from the companion API information
* @throws {string} if parse/import fails
*/
_importCompanionApiBuild(build) {
const shipModel = shipModelFromJson(build);
const ship = shipFromJson(build);
let builds = {};
builds[shipModel] = {};
builds[shipModel]['Imported ' + Ships[shipModel].properties.name] = ship.toString();
this.setState({ builds, singleBuild: true });
}
/**
* Import a text build from ED Shipyard
* @param {string} buildStr Build string
* @throws {string} If parse / import fails
*/
_importTextBuild(buildStr) {
let buildName = textBuildRegex.exec(buildStr)[1].trim();
let shipName = buildName.toLowerCase();
let shipId = null;
for (let sId in Ships) {
if (Ships[sId].properties.name.toLowerCase() == shipName) {
shipId = sId;
break;
}
}
if (!shipId) {
throw 'No such ship found: "' + buildName + '"';
}
let lines = buildStr.split('\n');
let ship = new Ship(shipId, Ships[shipId].properties, Ships[shipId].slots);
ship.buildWith(null);
for (let i = 1; i < lines.length; i++) {
let line = lines[i].trim();
if (!line) { continue; }
if (line.substring(0, 3) == '---') { break; }
let parts = lineRegex.exec(line);
if (!parts) { throw 'Error parsing: "' + line + '"'; }
let typeSize = parts[1];
let cl = parts[2];
let rating = parts[3];
let mount = parts[4];
let missile = parts[5];
let name = parts[6].trim();
let slot, group;
if (isNaN(typeSize)) { // Standard or Hardpoint
if (typeSize.length == 1) { // Hardpoint
let slotClass = mountMap[typeSize];
if (cl > slotClass) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
slot = ship.hardpoints.find(isEmptySlot, slotClass);
if (!slot) { throw 'No hardpoint slot available for: "' + line + '"'; }
group = ModuleNameToGroup[name.toLowerCase()];
let hp = ModuleUtils.findHardpoint(group, cl, rating, group ? null : name, mount, missile);
if (!hp) { throw 'Unknown component: "' + line + '"'; }
ship.use(slot, hp, true);
} else if (typeSize == 'BH') {
let bhId = bhMap[name.toLowerCase()];
if (bhId === undefined) { throw 'Unknown bulkhead: "' + line + '"'; }
ship.useBulkhead(bhId, true);
} else if (standardMap[typeSize] != undefined) {
let standardIndex = standardMap[typeSize];
if (ship.standard[standardIndex].maxClass < cl) { throw name + ' exceeds max class for the ' + ship.name; }
ship.use(ship.standard[standardIndex], ModuleUtils.standard(standardIndex, cl + rating), true);
} else {
throw 'Unknown component: "' + line + '"';
}
} else {
if (cl > typeSize) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
slot = ship.internal.find(isEmptySlot, typeSize);
if (!slot) { throw 'No internal slot available for: "' + line + '"'; }
group = ModuleNameToGroup[name.toLowerCase()];
let intComp = ModuleUtils.findInternal(group, cl, rating, group ? null : name);
if (!intComp) { throw 'Unknown component: "' + line + '"'; }
ship.use(slot, intComp);
}
}
let builds = {};
builds[shipId] = {};
builds[shipId]['Imported ' + buildName] = ship.toString();
this.setState({ builds, singleBuild: true });
} }
/** /**
@@ -352,166 +65,50 @@ export default class ModalImport extends TranslatedComponent {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
* @throws {string} If validation fails * @throws {string} If validation fails
*/ */
_validateImport(event) { _parse(event) {
let importData = null; const importString = event.target.value.trim();
let importString = event.target.value.trim();
this.setState({
builds: null,
comparisons: null,
shipDiscount: null,
moduleDiscount: null,
errorMsg: null,
importValid: false,
insurance: null,
singleBuild: false,
importString,
});
if (!importString) {
return;
}
try { try {
if (textBuildRegex.test(importString)) { // E:D Shipyard build text let data = JSON.parse(importString);
this._importTextBuild(importString); if (!isArray(data)) {
} else { // JSON Build data data = [data];
importData = JSON.parse(importString);
if (!importData || typeof importData != 'object') {
throw 'Must be an object or array!';
}
if (importData?.[0]?.header?.appName) { // has SLEF envelope?
this._importSlefBuilds(importData);
} else if (importData.modules != null && importData.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData); // Single ship definition
} else if (importData.ship != null && importData.ship.modules != null && importData.ship.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData.ship); // Complete API dump
} else if (importData instanceof Array) { // Must be detailed export json
this._importDetailedArray(importData);
} else if (importData.ship && typeof importData.name !== undefined) { // Using JSON from a single ship build export
this._importDetailedArray([importData]); // Convert to array with singleobject
this.setState({ singleBuild: true });
} else if (importData.Modules != null && importData.Modules[0] != null) {
this._importLoadout(importData);
} else { // Using Backup JSON
this._importBackup(importData);
}
} }
} catch (e) {
console.log(e);
this.setState({ errorMsg: (typeof e == 'string') ? e : 'Cannot Parse the data!' });
return;
}
this.setState({ importValid: true }); const ships = data.map((item) => {
}; try {
return new Ship(item.data ? item.data : item);
} catch (err) {
return err;
}
});
this.setState({ ships, status: STATE.PARSED });
} catch (err) {
this.setState({ err, status: STATE.ERROR });
}
}
/** /**
* Process imported data * Process imported data
*/ */
_process() { _process() {
let builds = null, comparisons = null; for (const build of this.state.builds) {
if (!build instanceof Error) {
if (this.state.loadoutEvent) { Persist.saveBuild(build.Ship, build.CoriolisBuildName || build.ShipName, build.compress());
return Router.go(`/import?data=${this.state.loadoutEvent}`);
}
// If only importing a single build go straight to the outfitting page
if (this.state.singleBuild) {
builds = this.state.builds;
let shipId = Object.keys(builds)[0];
let name = Object.keys(builds[shipId])[0];
Router.go(outfitURL(shipId, builds[shipId][name], name));
return;
}
if (this.state.builds) {
builds = {}; // Create new builds object such that orginal name retained, but can be renamed
for (let shipId in this.state.builds) {
let shipbuilds = this.state.builds[shipId];
builds[shipId] = {};
for (let buildName in shipbuilds) {
builds[shipId][buildName] = {
code: shipbuilds[buildName],
useName: buildName
};
}
} }
} }
this.setState({ builds: [], status: STATE.READY });
if (this.state.comparisons) { }
comparisons = {};
for (let name in this.state.comparisons) {
comparisons[name] = Object.assign({ useName: name }, this.state.comparisons[name]);
}
}
this.setState({ processed: true, builds, comparisons });
};
/**
* Import parsed, processed data and save
*/
_import() {
let state = this.state;
if (state.builds) {
let builds = state.builds;
for (let shipId in builds) {
for (let buildName in builds[shipId]) {
let build = builds[shipId][buildName];
let name = build.useName.trim();
if (name) {
Persist.saveBuild(shipId, name, build.code);
}
}
}
}
if (state.comparisons) {
let comparisons = state.comparisons;
for (let comp in comparisons) {
let comparison = comparisons[comp];
let useName = comparison.useName.trim();
if (useName) {
Persist.saveComparison(useName, comparison.builds, comparison.facets);
}
}
}
if (state.shipDiscount !== undefined) {
Persist.setShipDiscount(state.shipDiscount);
}
if (state.moduleDiscount !== undefined) {
Persist.setModuleDiscount(state.moduleDiscount);
}
if (state.insurance) {
Persist.setInsurance(state.insurance);
}
this.context.hideModal();
};
/** /**
* Capture build name changes * Capture build name changes
* @param {Object} item Build/Comparison import object * @param {Object} index Build/Comparison import object
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} event Event
*/ */
_changeName(item, e) { _changeName(index, event) {
item.useName = e.target.value; const { builds } = this.state;
this.forceUpdate(); builds[index].CoriolisBuildName = event.target.value.trim();
this.setState({ builds });
} }
/**
* If imported data is already provided process immediately on mount
*/
componentWillMount() {
if (this.props.builds) {
this._process();
}
}
/** /**
* If textarea is shown focus on mount * If textarea is shown focus on mount
*/ */
@@ -526,100 +123,54 @@ export default class ModalImport extends TranslatedComponent {
* @return {React.Component} Modal contents * @return {React.Component} Modal contents
*/ */
render() { render() {
let translate = this.context.language.translate; const { translate } = this.context.language;
let state = this.state; const { status, builds, err } = this.state;
let importStage;
if (!state.processed) { const buildRows = builds.map((build, i) => {
importStage = ( if (build instanceof Error) {
<div> return <tr key={i} className='cb'>
<textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._validateImport} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} /> <td colSpan={3} className='warning'>Error: {build.name}</td>
<button id='proceed' className='l cap' onClick={this._process} disabled={!state.importValid} >{translate('proceed')}</button> </tr>;
<div className='l warning' style={{ marginLeft:'3em' }}>{state.errorMsg}</div>
</div>
);
} else {
let comparisonTable, edit, buildRows = [];
if (state.comparisons) {
let comparisonRows = [];
for (let name in state.comparisons) {
let comparison = state.comparisons[name];
let hasComparison = Persist.hasComparison(comparison.useName);
comparisonRows.push(
<tr key={name} className='cb'>
<td>
<input type='text' onChange={this._changeName.bind(this, comparison)} value={comparison.useName}/>
</td>
<td style={{ textAlign:'center' }} className={ cn('cap', { warning: hasComparison, disabled: comparison.useName == '' }) }>
{translate(comparison.useName == '' ? 'skip' : (hasComparison ? 'overwrite' : 'create'))}
</td>
</tr>
);
}
comparisonTable = (
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }} >
<thead>
<tr>
<th style={{ textAlign:'left' }}>{translate('comparison')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{comparisonRows}
</tbody>
</table>
);
} }
if(this.state.canEdit) { const exists = Persist.hasBuild(build.Ship, build.CoriolisBuildName);
edit = <button className='l cap' style={{ marginLeft: '2em' }} onClick={() => this.setState({ processed: false })}>{translate('edit data')}</button>; const saveName = build.CoriolisBuildName || build.ShipName;
} return <tr key={i} className='cb'>
<td>{translate(build.Ship)}</td>
let builds = this.state.builds; <td><input type='text' onChange={this._changeName.bind(this, i)} value={saveName}/></td>
for (let shipId in builds) { <td style={{ textAlign: 'center' }} className={cn('cap', { warning: exists, disabled: saveName === '' })}>
let shipBuilds = builds[shipId]; {translate(saveName === '' ? 'skip' : (exists ? 'overwrite' : 'create'))}
for (let buildName in shipBuilds) { </td>
let b = shipBuilds[buildName]; </tr>;
let hasBuild = Persist.hasBuild(shipId, b.useName); });
buildRows.push(
<tr key={shipId + buildName} className='cb'>
<td>{Ships[shipId].properties.name}</td>
<td><input type='text' onChange={this._changeName.bind(this, b)} value={b.useName}/></td>
<td style={{ textAlign: 'center' }} className={cn('cap', { warning: hasBuild, disabled: b.useName == '' })}>
{translate(b.useName == '' ? 'skip' : (hasBuild ? 'overwrite' : 'create'))}
</td>
</tr>
);
}
}
importStage = (
<div>
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }}>
<thead>
<tr>
<th style={{ textAlign: 'left' }} >{translate('ship')}</th>
<th style={{ textAlign: 'left' }} >{translate('build name')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{buildRows}
</tbody>
</table>
{comparisonTable}
<button id='import' className='cl l' onClick={this._import}><Download/> {translate('import')}</button>
{edit}
</div>
);
}
return <div className='modal' onClick={ (e) => e.stopPropagation() }> return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h2 >{translate('import')}</h2> <h2 >{translate('import')}</h2>
{importStage} <div>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button> <textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._parse} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
{status === STATE.ERROR && <div className='l warning' style={{ marginLeft:'3em' }}>{err.toString()}</div>}
</div>
{builds.length && <div>
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }}>
<thead>
<tr>
<th style={{ textAlign: 'left' }} >{translate('ship')}</th>
<th style={{ textAlign: 'left' }} >{translate('build name')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{buildRows}
</tbody>
</table>
</div>}
<button id='proceed' className='l cap' onClick={this._process}
disabled={status !== STATE.PARSED} >
{translate('proceed')}
</button>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>
{translate('close')}
</button>
</div>; </div>;
} }
} }

View File

@@ -7,7 +7,6 @@ import ShortenUrl from '../utils/ShortenUrl';
* Permalink modal * Permalink modal
*/ */
export default class ModalPermalink extends TranslatedComponent { export default class ModalPermalink extends TranslatedComponent {
static propTypes = { static propTypes = {
url: PropTypes.string.isRequired url: PropTypes.string.isRequired
}; };

View File

@@ -1,263 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent';
import request from 'superagent';
import Persist from '../stores/Persist';
/**
* Permalink modal
*/
export default class ModalShoppingList extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this.state = {
matsList: '',
mats: {},
failed: false,
cmdrName: Persist.getCmdr().selected,
cmdrs: Persist.getCmdr().cmdrs,
matsPerGrade: Persist.getRolls(),
blueprints: []
};
}
/**
* React component did mount
*/
componentDidMount() {
this.renderMats();
if (this.checkBrowserIsCompatible()) {
this.getCommanders();
this.registerBPs();
}
}
/**
* Find all blueprints needed to make a build.
*/
registerBPs() {
const ship = this.props.ship;
let blueprints = [];
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
if (module.m.blueprint.special) {
console.log(module.m.blueprint.special);
blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 });
}
for (const g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
if (g > module.m.blueprint.grade) {
continue;
}
blueprints.push({ uuid: module.m.blueprint.grades[g].uuid, number: this.state.matsPerGrade[g] });
}
}
}
this.setState({ blueprints });
}
/**
* Check browser isn't firefox.
* @return {boolean} true if compatible, false if not.
*/
checkBrowserIsCompatible() {
// Firefox 1.0+
return typeof InstallTrigger === 'undefined';
}
/**
* Get a list of commanders from EDEngineer.
*/
getCommanders() {
request
.get('http://localhost:44405/commanders')
.end((err, res) => {
if (err) {
console.log(err);
return this.setState({ failed: true });
}
const cmdrs = JSON.parse(res.text);
if (!this.state.cmdrName) {
this.setState({ cmdrName: cmdrs[0] });
}
this.setState({ cmdrs }, () => {
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs });
});
});
}
/**
* Send all blueprints to ED Engineer
* @param {Event} event React event
*/
sendToEDEng(event) {
event.preventDefault();
let translate = this.context.language.translate;
const target = event.target;
target.disabled = this.state.blueprints.length > 0;
if (this.state.blueprints.length === 0) {
target.innerText = translate('No modded components.');
target.disabled = true;
setTimeout(() => {
target.innerText = translate('Send to EDEngineer');
target.disabled = false;
}, 3000);
} else {
target.innerText = translate('Sending...');
}
let countSent = 0;
let countTotal = this.state.blueprints.length;
for (const i of this.state.blueprints) {
request
.patch(`http://localhost:44405/${this.state.cmdrName}/shopping-list`)
.field('uuid', i.uuid)
.field('size', i.number)
.end(err => {
if (err) {
console.log(err);
if (err.message !== 'Bad Request') {
this.setState({ failed: true });
}
}
countSent++;
if (countSent === countTotal) {
target.disabled = false;
target.innerText = translate('Send to EDEngineer');
}
});
}
}
/**
* Convert mats object to string
*/
renderMats() {
const ship = this.props.ship;
let mats = {};
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
for (const g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
if (g > module.m.blueprint.grade) {
continue;
}
for (const i in module.m.blueprint.grades[g].components) {
if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) {
continue;
}
if (mats[i]) {
mats[i] += module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
} else {
mats[i] = module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
}
}
}
}
}
let matsString = '';
for (const i in mats) {
if (!mats.hasOwnProperty(i)) {
continue;
}
if (mats[i] === 0) {
delete mats[i];
continue;
}
matsString += `${i}: ${mats[i]}\n`;
}
this.setState({ matsList: matsString, mats });
}
/**
* Handler for changing roll amounts
* @param {SyntheticEvent} e React Event
*/
changeHandler(e) {
let grade = e.target.id;
let newState = this.state.matsPerGrade;
newState[grade] = parseInt(e.target.value);
this.setState({ matsPerGrade: newState });
Persist.setRolls(newState);
this.renderMats();
this.registerBPs();
}
/**
* Handler for changing cmdr name
* @param {SyntheticEvent} e React Event
*/
cmdrChangeHandler(e) {
let cmdrName = e.target.value;
this.setState({ cmdrName }, () => {
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs: this.state.cmdrs });
});
}
/**
* Render the modal
* @return {React.Component} Modal Content
*/
render() {
let translate = this.context.language.translate;
this.changeHandler = this.changeHandler.bind(this);
const compatible = this.checkBrowserIsCompatible();
this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this);
this.sendToEDEng = this.sendToEDEng.bind(this);
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h2>{translate('PHRASE_SHOPPING_MATS')}</h2>
<label>{translate('Grade 1 rolls ')}</label>
<input id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 2 rolls ')}</label>
<input id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 3 rolls ')}</label>
<input id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 4 rolls ')}</label>
<input id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
<br/>
<label>{translate('Grade 5 rolls ')}</label>
<input id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
<div>
<textarea className='cb json' readOnly value={this.state.matsList} />
</div>
<label hidden={!compatible} className={'l cap'}>{translate('CMDR Name')}</label>
<br/>
<select hidden={!compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}>
{this.state.cmdrs.map(e => <option key={e}>{e}</option>)}
</select>
<br/>
<p hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAIL_EDENGINEER')}</p>
<p hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</p>
<button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>;
}
}

View File

@@ -3,131 +3,106 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import NumberEditor from 'react-number-editor'; import NumberEditor from 'react-number-editor';
import { isChangeValueBeneficial } from '../utils/BlueprintFunctions'; import { Module } from 'ed-forge';
import { Modifications } from 'coriolis-data/dist';
/** /**
* Modification * Modification
*/ */
export default class Modification extends TranslatedComponent { export default class Modification extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, highlight: PropTypes.bool,
m: PropTypes.object.isRequired, m: PropTypes.instanceOf(Module).isRequired,
name: PropTypes.string.isRequired, property: PropTypes.string.isRequired,
value: PropTypes.number.isRequired, onSet: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired, showProp: PropTypes.object,
onKeyDown: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modItems: PropTypes.array.isRequired,
handleModChange: PropTypes.func.isRequired
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props); super(props);
this.state = {}; const { m, property, showProp } = props;
this.state.value = props.value; const { beneficial, unit, value } = m.getFormatted(property, true);
this.state = { beneficial, unit, value, showProp };
} }
/** /**
* Update modification given a value. * Notify listeners that a new value has been entered and commited.
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
* in a value by hand
*/
_updateValue(value) {
this.setState({ value });
let reCast = String(Number(value));
if (reCast.endsWith(value) || reCast.startsWith(value)) {
let { m, name, ship } = this.props;
value = Math.max(Math.min(value, 50000), -50000);
ship.setModification(m, name, value, true, true);
}
}
/**
* Triggered when a key is pressed down with focus on the number editor.
* @param {SyntheticEvent} event Key down event
*/
_keyDown(event) {
if (event.key == 'Enter') {
this._updateFinished();
}
this.props.onKeyDown(event);
}
/**
* Triggered when an update to slider value is finished i.e. when losing focus
*
* pnellesen (24/05/2018): added value check below - this should prevent experimental effects from being recalculated
* with each onBlur event, even when no change has actually been made to the field.
*/ */
_updateFinished() { _updateFinished() {
if (this.props.value != this.state.value) { const { onSet, m, property } = this.props;
this.props.handleModChange(true); const { inputValue } = this.state;
this.props.onChange(); const numValue = Number(inputValue);
if (!isNaN(numValue) && this.state.value !== numValue) {
onSet(property, numValue);
const { beneficial, unit, value } = m.getFormatted(property, true);
this.setState({ beneficial, unit, value });
} }
} }
_toggleProperty() {
const { onPropToggle, property } = this.props;
const showProp = !this.state.showProp;
// TODO: defer until menu closed
onPropToggle(property, showProp);
this.setState({ showProp });
}
/** /**
* Render the modification * Render the modification
* @return {React.Component} modification * @return {React.Component} modification
*/ */
render() { render() {
let { translate, formats, units } = this.context.language; const { formats } = this.context.language;
let { m, name } = this.props; const { highlight, m, property } = this.props;
let modValue = m.getChange(name); const { beneficial, unit, value, inputValue, showProp } = this.state;
let isOverwrite = Modifications.modifications[name].method === 'overwrite';
if (name === 'damagedist') { // Some features only apply to specific modules; these features will be
// We don't show damage distribution // undefined on items that do not belong to the same class. Filter these
// features here
if (value === undefined) {
return null; return null;
} }
let inputClassNames = { const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property);
'cb': true,
'greyed-out': !this.props.highlight
};
return ( return (
<div onBlur={this._updateFinished.bind(this)} key={name} <tr>
className={cn('cb', 'modification-container')} <td>
ref={ modItem => this.props.modItems[name] = modItem }> <span>
<span className={'cb'}>{translate(name, m.grp)}</span> <input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/>
<span className={'header-adjuster'}></span> </span>
<table style={{ width: '100%' }}> </td>
<tbody> <td className="input-container">
<tr> <span>
<td className={'input-container'}> <NumberEditor value={inputValue || value} stepModifier={1}
<span> decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }}
{this.props.editable ? className={cn('cb', { 'greyed-out': !highlight })}
<NumberEditor className={cn(inputClassNames)} value={this.state.value} onKeyDown={(event) => {
decimals={2} style={{ textAlign: 'right' }} step={0.01} if (event.key == 'Enter') {
stepModifier={1} onKeyDown={this._keyDown.bind(this)} this._updateFinished();
onValueChange={this._updateValue.bind(this)} /> : event.stopPropagation();
<input type="text" value={formats.f2(this.state.value)} }
disabled className={cn('number-editor', 'greyed-out')} }}
style={{ textAlign: 'right', cursor: 'inherit' }}/> onValueChange={(inputValue) => {
} if (inputValue.length <= 15) {
<span className={'unit-container'}> this.setState({ inputValue });
{units[m.getStoredUnitFor(name)]} }
</span> }} />
</span> </span>
</td> </td>
<td style={{ textAlign: 'center' }} className={ <td style={{ textAlign: 'left' }}>
modValue ? <span className="unit-container">{unit}</span>
isChangeValueBeneficial(name, modValue) ? 'secondary' : 'warning' : </td>
'' <td style={{ textAlign: 'center' }}
}> className={cn({
{formats.f2(modValue / 100) || 0}{isOverwrite ? '' : '%'} secondary: beneficial,
</td> warning: beneficial === false,
</tr> })}
</tbody> >{formats.f2(modifierValue)}{modifierUnit || ''}</td>
</table> </tr>
</div>
); );
} }
} }

View File

@@ -1,34 +1,27 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as _ from 'lodash'; import { chain, flatMap, keys } from 'lodash';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { Modifications } from 'coriolis-data/dist';
import Modification from './Modification'; import Modification from './Modification';
import { import {
getBlueprint,
blueprintTooltip, blueprintTooltip,
setPercent,
getPercent,
setRandom,
specialToolTip specialToolTip
} from '../utils/BlueprintFunctions'; } from '../utils/BlueprintFunctions';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/src/data/blueprints';
const MODIFICATIONS_COMPARATOR = (mod1, mod2) => { import { getModuleInfo } from 'ed-forge/lib/src/data/items';
return mod1.props.name.localeCompare(mod2.props.name); import { SHOW } from '../shipyard/StatsMapping';
};
/** /**
* Modifications menu * Modifications menu
*/ */
export default class ModificationsMenu extends TranslatedComponent { export default class ModificationsMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, className: PropTypes.string,
m: PropTypes.object.isRequired, m: PropTypes.object.isRequired,
marker: PropTypes.string.isRequired, propsToShow: PropTypes.object.isRequired,
onChange: PropTypes.func.isRequired, onPropToggle: PropTypes.func.isRequired,
modButton:PropTypes.object
}; };
/** /**
@@ -41,327 +34,177 @@ export default class ModificationsMenu extends TranslatedComponent {
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this); this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this); this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
this._rollFifty = this._rollFifty.bind(this); this.selectedModRef = null;
this._rollRandom = this._rollRandom.bind(this); this.selectedSpecialRef = null;
this._rollBest = this._rollBest.bind(this);
this._rollWorst = this._rollWorst.bind(this);
this._reset = this._reset.bind(this);
this._keyDown = this._keyDown.bind(this);
this.modItems = [];// Array to hold various element refs (<li>, <div>, <ul>, etc.)
this.firstModId = null;
this.firstBPLabel = null;// First item in mod menu
this.lastModId = null;
this.selectedModId = null;
this.selectedSpecialId = null;
this.lastNeId = null;// Last number editor id. Used to set focus to last number editor when shift-tab pressed on first element in mod menu.
this.modValDidChange = false; // used to determine if component update was caused by change in modification value.
this._handleModChange = this._handleModChange.bind(this);
const { m } = props;
this.state = { this.state = {
blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name), blueprintProgress: m.getBlueprintProgress(),
blueprintMenuOpened: !m.getBlueprint(),
specialMenuOpened: false specialMenuOpened: false
}; };
} }
/** /**
* Render the blueprints * Render the blueprints
* @param {Object} props React component properties
* @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderBlueprints(props, context) { _renderBlueprints() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const { translate } = language;
const blueprints = [];
for (const blueprintName in Modifications.modules[m.grp].blueprints) { const blueprints = m.getApplicableBlueprints().map(blueprint => {
const blueprint = getBlueprint(blueprintName, m); const info = getBlueprintInfo(blueprint);
let blueprintGrades = []; let blueprintGrades = keys(info.features).map(grade => {
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
// Grade is a string in the JSON so make it a number // Grade is a string in the JSON so make it a number
grade = Number(grade); grade = Number(grade);
const classes = cn('c', { const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade;
active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade const key = blueprint + ':' + grade;
}); return <li key={key} data-id={key} className={cn('c', { active })}
const close = this._blueprintSelected.bind(this, blueprintName, grade); style={{ width: '2em' }}
const key = blueprintName + ':' + grade; onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))}
const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp); onMouseOut={tooltip.bind(null, null)}
if (classes.indexOf('active') >= 0) this.selectedModId = key; onClick={() => {
blueprintGrades.unshift(<li key={key} tabIndex="0" data-id={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close} onKeyDown={this._keyDown} ref={modItem => this.modItems[key] = modItem}>{grade}</li>); m.setBlueprint(blueprint, grade, 1);
} this.setState({
if (blueprintGrades) { blueprintMenuOpened: false,
const thisLen = blueprintGrades.length; specialMenuOpened: true,
if (this.firstModId == null) this.firstModId = blueprintGrades[0].key; });
this.lastModId = blueprintGrades[thisLen - 1].key; }}
blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>); ref={active ? (ref) => { this.selectedModRef = ref; } : undefined}
blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>); >{grade}</li>;
} });
}
return blueprints; return [
<div key={'div' + blueprint} className={'select-group cap'}>
{translate(blueprint)}
</div>,
<ul key={'ul' + blueprint}>{blueprintGrades}</ul>
];
});
return flatMap(blueprints);
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {SyntheticEvent} event Event
*
*/
_keyDown(event) {
let className = null;
let elemId = null;
if (event.currentTarget.attributes['class']) className = event.currentTarget.attributes['class'].value;
if (event.currentTarget.attributes['data-id']) elemId = event.currentTarget.attributes['data-id'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
event.stopPropagation();
if (elemId != null) {
this.modItems[elemId].click();
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
// Shift-Tab
if(event.shiftKey) {
if (elemId == this.firstModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.lastModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null && this.lastNeId != null && this.modItems[this.lastNeId] != null) {
// shift-tab on first element in modifications menu. set focus to last number editor field if open
event.preventDefault();
this.modItems[this.lastNeId].lastChild.focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null) {
// shift-tab on button-inline-menu with no number editor
event.preventDefault();
event.currentTarget.parentElement.lastElementChild.focus();
}
} else {
if (elemId == this.lastModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.firstModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.nextSibling == null && event.currentTarget.nodeName != 'TD') {
// Experimental menu
event.preventDefault();
event.currentTarget.parentElement.firstElementChild.focus();
return;
} else if (event.currentTarget.className == 'cb' && event.currentTarget.parentElement.nextSibling == null) {
event.preventDefault();
this.modItems[this.firstBPLabel].focus();
}
}
}
}
/** /**
* Render the specials * Render the specials
* @param {Object} props React component properties * @param {Object} props React component properties
* @param {Object} context React component context * @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderSpecials(props, context) { _renderSpecials() {
const { m } = props; const { m } = this.props;
const { language, tooltip, termtip } = context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const specials = [];
const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials'; const applied = m.getExperimental();
if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) { const experimentals = [];
const close = this._specialSelected.bind(this, null); for (const experimental of m.getApplicableExperimentals()) {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } data-id={ 'none' } onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems['none'] = modItem}>{translate('PHRASE_NO_SPECIAL')}</div>); const active = experimental === applied;
for (const specialName of Modifications.modules[m.grp][specialsId]) { let specialTt = specialToolTip(language, m, experimental);
if (Modifications.specials[specialName].name.search('Legacy') >= 0) { experimentals.push(
continue; <div key={experimental} data-id={experimental}
} style={{ cursor: 'pointer' }}
const classes = cn('button-inline-menu', { className={cn('button-inline-menu', { active })}
active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName onClick={this._specialSelected(experimental)}
}); ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
if (classes.indexOf('active') >= 0) this.selectedSpecialId = specialName; onMouseOver={termtip.bind(null, specialTt)}
const close = this._specialSelected.bind(this, specialName); onMouseOut={tooltip.bind(null, null)}
if (m.blueprint && m.blueprint.name) { >{translate(experimental)}</div>
let tmp = {}; );
if (m.blueprint.special) {
tmp = m.blueprint.special;
} else {
tmp = undefined;
}
m.blueprint.special = Modifications.specials[specialName];
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName);
m.blueprint.special = tmp;
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
} else {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName }onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
}
}
} }
return specials;
if (experimentals.length) {
experimentals.unshift(
<div style={{ cursor: 'pointer', fontWeight: 'bold' }}
className="button-inline-menu warning" key="none" data-id="none"
// Setting the special effect to undefined clears it
onClick={this._specialSelected(undefined)}
ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
>{translate('PHRASE_NO_SPECIAL')}</div>
);
}
return experimentals;
}
/**
* Create a modification component
*/
_mkModification(property, highlight) {
const { translate } = this.context.language;
const { m, propsToShow, onPropToggle } = this.props;
let onSet = m.set.bind(m);
// Show resistance instead of effectiveness
const mapped = SHOW[property];
if (mapped) {
property = mapped.as;
onSet = mapped.setter.bind(undefined, m);
}
return [
<tr key={`th-${property}`}>
<th colSpan="4">
<span className="cb">{translate(property)}</span>
</th>
</tr>,
<Modification key={property} m={m} property={property}
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
onPropToggle={onPropToggle} />
];
} }
/** /**
* Render the modifications * Render the modifications
* @param {Object} props React Component properties * @return {Array} Array of React Components
* @return {Object} list: Array of React Components
*/ */
_renderModifications(props) { _renderModifications() {
const { m, onChange, ship } = props; const { m } = this.props;
const modifiableModifications = [];
const modifications = [];
for (const modName of Modifications.modules[m.grp].modifications) {
if (!Modifications.modifications[modName].hidden) {
const key = modName + (m.getModValue(modName) / 100 || 0);
const editable = modName !== 'fallofffromrange';
const highlight = m.blueprint.grades[m.blueprint.grade].features[modName];
this.lastNeId = modName;
(editable && highlight ? modifiableModifications : modifications).push(
<Modification key={ key } ship={ ship } m={ m } highlight={highlight}
value={m.getPretty(modName) || 0} modItems={this.modItems}
onChange={onChange} onKeyDown={this._keyDown} name={modName}
editable={editable} handleModChange = {this._handleModChange} />
);
}
}
modifiableModifications.sort(MODIFICATIONS_COMPARATOR); const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[
modifications.sort(MODIFICATIONS_COMPARATOR); m.getBlueprintGrade()
return modifiableModifications.concat(modifications); ];
const blueprintModifications = chain(keys(blueprintFeatures))
.map((feature) => this._mkModification(feature, true))
.filter(([_, mod]) => Boolean(mod))
.flatMap()
.value();
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
.filter((prop) => !blueprintFeatures[prop])
.map((prop) => this._mkModification(prop, false))
.flatMap()
.value();
return blueprintModifications.concat(moduleModifications);
} }
/** /**
* Toggle the blueprints menu * Toggle the blueprints menu
*/ */
_toggleBlueprintsMenu() { _toggleBlueprintsMenu() {
const blueprintMenuOpened = !this.state.blueprintMenuOpened; this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened });
this.setState({ blueprintMenuOpened });
}
/**
* Activated when a blueprint is selected
* @param {int} fdname The Frontier name of the blueprint
* @param {int} grade The grade of the selected blueprint
*/
_blueprintSelected(fdname, grade) {
this.context.tooltip(null);
const { m, ship } = this.props;
const blueprint = getBlueprint(fdname, m);
blueprint.grade = grade;
ship.setModuleBlueprint(m, blueprint);
setPercent(ship, m, 100);
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
this.props.onChange();
} }
/** /**
* Toggle the specials menu * Toggle the specials menu
*/ */
_toggleSpecialsMenu() { _toggleSpecialsMenu() {
const specialMenuOpened = !this.state.specialMenuOpened; this.setState({ specialMenuOpened: !this.state.specialMenuOpened });
this.setState({ specialMenuOpened });
} }
/** /**
* Activated when a special is selected * Creates a callback for when a special effect is being selected
* @param {int} special The name of the selected special * @param {string} special The name of the selected special
* @returns {function} Callback
*/ */
_specialSelected(special) { _specialSelected(special) {
this.context.tooltip(null); return () => {
const { m, ship } = this.props; const { m } = this.props;
m.setExperimental(special);
if (special === null) { this.setState({ specialMenuOpened: false });
ship.clearModuleSpecial(m); };
} else {
ship.setModuleSpecial(m, Modifications.specials[special]);
}
this.setState({ specialMenuOpened: false });
this.props.onChange();
}
/**
* Provide a '50%' roll within the information we have
*/
_rollFifty() {
const { m, ship } = this.props;
setPercent(ship, m, 50);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a random roll within the information we have
*/
_rollRandom() {
const { m, ship } = this.props;
setRandom(ship, m);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'best' roll within the information we have
*/
_rollBest() {
const { m, ship } = this.props;
setPercent(ship, m, 100);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'worst' roll within the information we have
*/
_rollWorst() {
const { m, ship } = this.props;
setPercent(ship, m, 0);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Reset modification information
*/
_reset() {
const { m, ship } = this.props;
ship.clearModifications(m);
ship.clearModuleBlueprint(m);
this.selectedModId = null;
this.selectedSpecialId = null;
this.props.onChange();
}
/**
* set mod did change boolean
* @param {boolean} b Boolean to determine if a change has been made to a module
*/
_handleModChange(b) {
this.modValDidChange = b;
}
/**
* Set focus on first element in modifications menu
* after it first mounts
*/
componentDidMount() {
let firstEleCn = this.modItems['modMainDiv'].children.length > 0 ? this.modItems['modMainDiv'].children[0].className : null;
if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
} else {
this.modItems['modMainDiv'].firstElementChild.focus();
}
} }
/** /**
@@ -370,32 +213,12 @@ export default class ModificationsMenu extends TranslatedComponent {
* in a modification * in a modification
*/ */
componentDidUpdate() { componentDidUpdate() {
if (!this.modValDidChange) { if (this.selectedModRef) {
if (this.modItems['modMainDiv'].children.length > 0) { this.selectedModRef.focus();
if (this.modItems[this.selectedModId]) { return;
this.modItems[this.selectedModId].focus(); } else if (this.selectedSpecialRef) {
return; this.selectedSpecialRef.focus();
} else if (this.modItems[this.selectedSpecialId]) { return;
this.modItems[this.selectedSpecialId].focus();
return;
}
let firstEleCn = this.modItems['modMainDiv'].children[0].className;
if (firstEleCn.indexOf('button-inline-menu') >= 0) {
this.modItems['modMainDiv'].firstElementChild.focus();
} else if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
}
}
} else {
this._handleModChange(false);// Need to reset if component update due to value change
}
}
/**
* set focus to the modification menu icon after mod menu is unmounted.
*/
componentWillUnmount() {
if (this.props.modButton) {
this.props.modButton.focus();
} }
} }
@@ -407,90 +230,155 @@ export default class ModificationsMenu extends TranslatedComponent {
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const { m } = this.props; const { m } = this.props;
const { blueprintMenuOpened, specialMenuOpened } = this.state; const {
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
} = this.state;
const _toggleBlueprintsMenu = this._toggleBlueprintsMenu; const appliedBlueprint = m.getBlueprint();
const _toggleSpecialsMenu = this._toggleSpecialsMenu; const appliedGrade = m.getBlueprintGrade();
const _rollFull = this._rollBest; const appliedExperimental = m.getExperimental();
const _rollWorst = this._rollWorst;
const _rollFifty = this._rollFifty;
const _rollRandom = this._rollRandom;
const _reset = this._reset;
let blueprintLabel; let renderComponents = [];
let haveBlueprint = false; switch (true) {
let blueprintTt; case !appliedBlueprint || blueprintMenuOpened:
let blueprintCv; renderComponents = this._renderBlueprints();
// TODO: Fix this to actually find the correct blueprint. break;
if (!m.blueprint || !m.blueprint.name || !m.blueprint.fdname || !Modifications.modules[m.grp].blueprints || !Modifications.modules[m.grp].blueprints[m.blueprint.fdname]) { case specialMenuOpened:
this.props.ship.clearModuleBlueprint(m); renderComponents = this._renderSpecials();
this.props.ship.clearModuleSpecial(m); break;
} default:
if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade]) { // Since the first case didn't apply, there is a blueprint applied so
blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade; // we render the modifications
haveBlueprint = true; let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade);
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade].engineers, m.grp);
blueprintCv = getPercent(m);
}
let specialLabel; renderComponents.push(
let specialTt; <div style={{ cursor: 'pointer' }} key="blueprintsMenu"
if (m.blueprint && m.blueprint.special) { className="section-menu button-inline-menu"
specialLabel = m.blueprint.special.name; onMouseOver={termtip.bind(null, blueprintTt)}
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname); onMouseOut={tooltip.bind(null, null)}
} else { onClick={this._toggleBlueprintsMenu}
specialLabel = translate('PHRASE_SELECT_SPECIAL'); >
} {translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
</div>
);
const specials = this._renderSpecials(this.props, this.context); if (m.getApplicableExperimentals().length) {
/** let specialLabel = translate('PHRASE_SELECT_SPECIAL');
* pnellesen - 05/28/2018 - added additional checks for specials.length below to ensure menus let specialTt;
* display correctly in cases where there are no specials (ex: AFMUs.) if (appliedExperimental) {
*/ specialLabel = appliedExperimental;
const showBlueprintsMenu = blueprintMenuOpened; specialTt = specialToolTip(language, m, appliedExperimental);
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened; }
const showSpecialsMenu = specialMenuOpened && specials.length; renderComponents.push(
const showRolls = haveBlueprint && !blueprintMenuOpened && (!specialMenuOpened || !specials.length); <div className="section-menu button-inline-menu"
const showReset = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint; style={{ cursor: 'pointer' }}
const showMods = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint; onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
if (haveBlueprint) { onMouseOut={specialTt ? tooltip.bind(null, null) : null}
this.firstBPLabel = blueprintLabel; onClick={this._toggleSpecialsMenu}
} else { >{specialLabel}</div>
this.firstBPLabel = 'selectBP'; );
} }
return (
<div
className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation() }
onContextMenu={stopCtxPropagation}
ref={modItem => this.modItems['modMainDiv'] = modItem}
>
{ showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ?
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{blueprintLabel}</div> :
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> }
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
{ showSpecial & !showSpecialsMenu ? <div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu} onKeyDown={ this._keyDown }>{specialLabel}</div> : null }
{ showSpecialsMenu ? specials : null }
{ showReset ? <div tabIndex="0" className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
{ showRolls ?
renderComponents.push(
<div
className="section-menu button-inline-menu warning"
style={{ cursor: 'pointer' }}
onClick={() => {
m.resetEngineering();
this.selectedModRef = null;
this.selectedSpecialRef = null;
tooltip(null);
this.setState({
blueprintMenuOpened: true,
blueprintProgress: undefined,
});
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
onMouseOut={tooltip.bind(null, null)}
>{translate('reset')}</div>,
<table style={{ width: '100%', backgroundColor: 'transparent' }}> <table style={{ width: '100%', backgroundColor: 'transparent' }}>
<tbody> <tbody>
{ showRolls ? <tr>
<tr> <td
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: false }) }> { translate('mroll') }: </td> className={cn(
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 }) } style={{ cursor: 'pointer' }} onClick={_rollWorst} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td> 'section-menu button-inline-menu',
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td> { active: false },
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td> )}
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td> >{translate('mroll')}:</td>
</tr> : null } <td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0);
this.setState({ blueprintProgress: 0 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('0%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0.5 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0.5);
this.setState({ blueprintProgress: 0.5 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
onMouseOut={tooltip.bind(null, null)}
>{translate('50%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 1 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(1);
this.setState({ blueprintProgress: 1 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('100%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress % 0.5 !== 0 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
const blueprintProgress = Math.random();
m.setBlueprintProgress(blueprintProgress);
this.setState({ blueprintProgress });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
onMouseOut={tooltip.bind(null, null)}
>{translate('random')}</td>
</tr>
</tbody> </tbody>
</table> : null } </table>,
{ showMods ? <hr /> : null } <hr />,
{ showMods ? <span
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} > onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
{ this._renderModifications(this.props) } onMouseOut={tooltip.bind(null, null)}
</span> : null } >
<table style={{ width: '100%' }}>
<tbody>
{this._renderModifications()}
</tbody>
</table>
</span>
);
}
return (
<div className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation}
>
{renderComponents}
</div> </div>
); );
} }

View File

@@ -1,36 +1,28 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShipProps } from 'ed-forge';
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
/** /**
* Movement * Movement
*/ */
export default class Movement extends TranslatedComponent { export default class Movement extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
fuel: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render movement * Render movement
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, boost, eng, cargo, fuel } = this.props; const { ship, boost } = this.props;
const { language } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { formats } = language;
return ( return (
<span id='movement'> <span id='movement'>
@@ -57,14 +49,10 @@ export default class Movement extends TranslatedComponent {
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/> <path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/> <path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
{/* Speed */} <text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text>
<text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text> <text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text>
{/* Pitch */} <text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text>
<text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text> <text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text>
{/* Roll */}
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
{/* Yaw */}
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
</svg> </svg>
</span>); </span>);
} }

View File

@@ -1,103 +1,37 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import { nameComparator } from '../utils/SlotFunctions';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { DAMAGE_METRICS } from 'ed-forge/lib/src/ship-stats';
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
/** /**
* Generates an internationalization friendly weapon comparator that will * Turns an object into a tooltip.
* sort by specified property (if provided) then by name/group, class, rating * @param {function} translate Translate function
* @param {function} translate Translation function * @param {object} o Map to make the tooltip from
* @param {function} propComparator Optional property comparator * @returns {React.Component} Tooltip
* @param {boolean} desc Use descending order
* @return {function} Comparator function for names
*/ */
export function weaponComparator(translate, propComparator, desc) { function objToTooltip(translate, o) {
return (a, b) => { return toPairs(o)
if (!desc) { // Flip A and B if ascending order .filter(([k, v]) => Boolean(v))
let t = a; .map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>);
a = b;
b = t;
}
// If a property comparator is provided use it first
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
if (diff) {
return diff;
}
// Property matches so sort by name / group, then class, rating
if (a.name === b.name && a.grp === b.grp) {
if(a.class == b.class) {
return a.rating > b.rating ? 1 : -1;
}
return a.class - b.class;
}
return nameComparator(translate, a, b);
};
}
/**
* Creates a tooltip that shows damage by type.
* @param {function} translate Translation function
* @param {Object} formats Object that holds format functions
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
* @returns {Array} Tooltip
*/
function getSDpsTooltip(translate, formats, sdpsObject) {
return Object.keys(sdpsObject).filter(key => sdpsObject[key])
.map(key => {
return (
<div key={key}>
{translate(key) + ' ' + formats.f1(sdpsObject[key])}
</div>
);
});
} }
/** /**
* Returns a data object used by {@link PieChart} that shows damage by type. * Returns a data object used by {@link PieChart} that shows damage by type.
* @param {function} translate Translation function * @param {function} translate Translation function
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type * @param {Calc.SDps} o Object that holds sdps split up by type
* @returns {Object} Data object * @returns {Object} Data object
*/ */
function getSDpsData(translate, sdpsObject) { function objToPie(translate, o) {
return Object.keys(sdpsObject).map(key => { return toPairs(o).map(([k, value]) => {
return { return { label: translate(k), value };
value: Math.round(sdpsObject[key]),
label: translate(key)
};
}); });
} }
/**
* Adds all damage of `add` onto `addOn`.
* @param {Calc.SDps} addOn Object that holds sdps split up by type (will be mutated)
* @param {Calc.SDps} add Object that holds sdps split up by type
*/
function addSDps(addOn, add) {
Object.keys(addOn).map(k => addOn[k] += (add[k] ? add[k] : 0));
}
/**
* Calculates the overall sdps of an sdps object.
* @param {Calc.SDps} sdpsObject Object that holds sdps spluit up by type
*/
function sumSDps(sdpsObject) {
if (sdpsObject.total) {
return sdpsObject.total;
}
return Object.keys(sdpsObject).reduce(
(acc, k) => acc + (sdpsObject[k] ? sdpsObject[k] : 0),
0
);
}
/** /**
* Offence information * Offence information
* Offence information consists of four panels: * Offence information consists of four panels:
@@ -108,12 +42,10 @@ function sumSDps(sdpsObject) {
*/ */
export default class Offence extends TranslatedComponent { export default class Offence extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.instanceOf(Ship).isRequired,
engagementrange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired
}; };
/** /**
@@ -122,151 +54,234 @@ export default class Offence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._sort = this._sort.bind(this);
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
this.state = { this.state = {
predicate: 'n', predicate: 'classRating',
desc: true, desc: true,
damage
}; };
} }
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
this.setState({ damage });
}
return true;
}
/** /**
* Set the sort order and sort * Set the sort order and sort
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
let desc = this.state.desc; let desc = predicate == this.state.predicate ? !this.state.desc : true;
if (predicate == this.state.predicate) {
desc = !desc;
} else {
desc = true;
}
this._sort(predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/**
* Sorts the weapon list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort order descending
*/
_sort(predicate, desc) {
let comp = weaponComparator.bind(null, this.context.language.translate);
switch (predicate) {
case 'n': comp = comp(null, desc); break;
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
}
this.state.damage.sort(comp);
}
/** /**
* Render offence * Render offence
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, opponent, wep, engagementrange } = this.props; const { ship } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { damage } = this.state;
const sortOrder = this._sortOrder; const sortOrder = this._sortOrder;
const pd = ship.standard[4].m; const {
drained, sustained, rangeMultiplier, hardnessMultiplier, timeToDrain
} = ship.getMetrics(DAMAGE_METRICS);
const portions = {
Absolute: sustained.types.abs,
Explosive: sustained.types.expl,
Kinetic: sustained.types.kin,
Thermic: sustained.types.therm,
};
const opponentShields = Calc.shieldMetrics(opponent, 4); const oppShield = ship.getOpponent().getShield();
const opponentArmour = Calc.armourMetrics(opponent); const shieldMults = {
Absolute: 1,
Explosive: oppShield.explosive.damageMultiplier,
Kinetic: oppShield.kinetic.damageMultiplier,
Thermic: oppShield.thermal.damageMultiplier,
};
const timeToDrain = Calc.timeToDrainWep(ship, wep); const oppArmour = ship.getOpponent().getArmour();
const armourMults = {
Absolute: 1,
Explosive: oppArmour.explosive.damageMultiplier,
Kinetic: oppArmour.kinetic.damageMultiplier,
Thermic: oppArmour.thermal.damageMultiplier,
};
const weapons = sortBy(ship.getHardpoints(), (m) => m.get('distributordraw'));
let rows = weapons.map((weapon) => {
const sdps = weapon.get('sustaineddamagepersecond');
const byRange = weapon.getRangeEffectiveness();
const weaponPortions = {
Absolute: weapon.get('absolutedamageportion'),
Explosive: weapon.get('explosivedamageportion'),
Kinetic: weapon.get('kineticdamageportion'),
Thermic: weapon.get('thermicdamageportion'),
};
const baseSdpsTooltip = objToTooltip(
translate,
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
);
let totalSEps = 0; const bySys = oppShield.absolute.bySys;
let totalSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; const shieldResEfts = mergeWith(
let shieldsSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; clone(weaponPortions),
let armourSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 }; shieldMults,
(objV, srcV) => objV * srcV
);
const byShieldRes = sum(values(shieldResEfts));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(
shieldResEfts,
(mult) => formats.f1(byRange * mult * bySys * sdps),
),
);
const shieldsEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byShieldRes),
'power distributor': formats.pct1(bySys),
},
);
const shieldEft = byRange * byShieldRes * bySys;
const rows = []; const byHardness = weapon.getArmourEffectiveness();
for (let i = 0; i < damage.length; i++) { const armourResEfts = mergeWith(
const weapon = damage[i]; clone(weaponPortions),
armourMults,
(objV, srcV) => objV * srcV,
);
const byArmourRes = sum(values(armourResEfts));
const armourSdpsTooltip = objToTooltip(
translate,
mapValues(
armourResEfts,
(mult) => formats.f1(byRange * mult * byHardness * sdps)
),
);
const armourEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byArmourRes),
hardness: formats.pct1(byHardness),
},
);
const armourEft = byRange * byArmourRes * byHardness;
totalSEps += weapon.seps; const bp = weapon.getBlueprint();
addSDps(totalSDpsObject, weapon.sdps.base); const grade = weapon.getBlueprintGrade();
addSDps(shieldsSDpsObject, weapon.sdps.shields); const exp = weapon.getExperimental();
addSDps(armourSDpsObject, weapon.sdps.armour); let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`;
if (exp) {
bpTitle += `, ${translate(exp)}`;
}
return {
slot: weapon.getSlot(),
mount: weapon.mount,
classRating: weapon.getClassRating(),
type: weapon.readMeta('type'),
bpTitle: bp ? ` (${bpTitle})` : null,
sdps,
baseSdpsTooltip,
shieldSdps: sdps * shieldEft,
shieldEft,
shieldsSdpsTooltip,
shieldsEftTooltip,
armourSdps: sdps * armourEft,
armourEft,
armourSdpsTooltip,
armourEftTooltip,
};
});
const baseSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.base); const { predicate, desc } = this.state;
rows = sortBy(rows, (row) => row[predicate]);
const effectivenessShieldsTooltipDetails = []; if (desc) {
effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>); reverse(rows);
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>);
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>);
const effectiveShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
const effectivenessArmourTooltipDetails = [];
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>);
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>);
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>);
const effectiveArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
rows.push(
<tr key={weapon.id}>
<td className='ri'>
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{weapon.classRating} {translate(weapon.name)}
{weapon.engineering ? ' (' + weapon.engineering + ')' : null }
</td>
<td className='ri'><span onMouseOver={termtip.bind(null, baseSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.base.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.shields.dpe)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.armour.dpe)}</span></td>
</tr>);
} }
const totalSDps = sumSDps(totalSDpsObject); const sdpsTooltip = objToTooltip(
const totalSDpsTooltipDetails = getSDpsTooltip(translate, formats, totalSDpsObject); translate,
const totalSDpsData = getSDpsData(translate, totalSDpsObject); mapValues(portions, (p) => formats.f1(sustained.dps * p)),
);
const sdpsPie = objToPie(
translate,
mapValues(portions, (p) => Math.round(sustained.dps * p)),
);
const totalShieldsSDps = sumSDps(shieldsSDpsObject); const shieldSdpsSrcs = mergeWith(
const totalShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, shieldsSDpsObject); clone(portions),
const shieldsSDpsData = getSDpsData(translate, shieldsSDpsObject); shieldMults,
(objV, srcV) => sustained.dps * oppShield.absolute.bySys *
rangeMultiplier * objV * srcV,
);
const shieldsSdps = sum(values(shieldSdpsSrcs));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
);
const shieldsSdpsPie = objToPie(
translate,
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
);
const totalArmourSDps = sumSDps(armourSDpsObject); const armourSdpsSrcs = mergeWith(
const totalArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, armourSDpsObject); clone(portions),
const armourSDpsData = getSDpsData(translate, armourSDpsObject); armourMults,
(objV, srcV) => sustained.dps * hardnessMultiplier * rangeMultiplier *
objV * srcV,
);
const armourSdps = sum(values(armourSdpsSrcs));
const totalArmourSDpsTooltipDetails = objToTooltip(
translate,
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
);
const armourSDpsData = objToPie(
translate,
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
);
const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); const drainedPortions = {
const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4)); Absolute: drained.types.abs,
Explosive: drained.types.expl,
Kinetic: drained.types.kin,
Thermic: drained.types.therm,
};
// How much damage do we deal, before the capacitor is empty?
const armourLeft = oppArmour.armour - (timeToDrain * armourSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteArmour;
if (armourLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
armourMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier *
hardnessMultiplier;
timeToDepleteArmour = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (armourLeft / effectiveDrainedDps);
} else {
timeToDepleteArmour = oppArmour.armour / armourSdps;
}
// How much damage do we deal, before the capacitor is empty?
const shieldsLeft = oppShield.withSCBs - (timeToDrain * shieldsSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteShields;
if (shieldsLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
shieldMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier;
timeToDepleteShields = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (shieldsLeft / effectiveDrainedDps);
} else {
timeToDepleteShields = oppShield.withSCBs / shieldsSdps;
}
return ( return (
<span id='offence'> <span id='offence'>
@@ -274,34 +289,75 @@ export default class Offence extends TranslatedComponent {
<table> <table>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th> <th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th>
<th colSpan='1'>{translate('overall')}</th> <th colSpan='1'>{translate('overall')}</th>
<th colSpan='3'>{translate('opponent\'s shields')}</th> <th colSpan='3'>{translate('opponent\'s shields')}</th>
<th colSpan='3'>{translate('opponent\'s armour')}</th> <th colSpan='3'>{translate('opponent\'s armour')}</th>
</tr> </tr>
<tr> <tr>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
<th className='sortable'>{'dpe'}</th> <th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')}
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')}
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th> onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
<th className='sortable'>{'dpe'}</th> onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows.map((row) => (
<tr key={row.slot}>
<td className='ri'>
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{row.classRating} {translate(row.type)}
{row.bpTitle}
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.sdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.shieldSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.shieldEft)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.armourSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.armourEft)}</span></td>
</tr>
))}
{rows.length > 0 && {rows.length > 0 &&
<tr> <tr>
<td></td> <td></td>
<td className='ri'><span onMouseOver={termtip.bind(null, totalSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalSDps)}</span></td> <td className='ri'>
<td className='ri'><span onMouseOver={termtip.bind(null, totalShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalShieldsSDps)}</span></td> <span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(sustained.dps)}
</span>
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(shieldsSdps)}
</span>
</td>
<td></td> <td></td>
<td></td> <td className='ri'>
<td className='ri'><span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalArmourSDps)}</span></td> <span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(armourSdps)}
</span>
</td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
@@ -311,22 +367,51 @@ export default class Offence extends TranslatedComponent {
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('offence metrics')}</h2> <h2>{translate('offence metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))}
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2> onMouseOut={tooltip.bind(null, null)}>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2> {translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2> {timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2> </h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
{formats.f1(shieldsSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
{formats.f1(armourSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}
</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('overall damage')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))}
<PieChart data={totalSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('overall damage')}
</h2>
<PieChart data={sdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))}
<PieChart data={shieldsSDpsData} /> onMouseOut={tooltip.bind(null, null)}>
{translate('shield damage sources')}
</h2>
<PieChart data={shieldsSdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('armour damage sources')}
</h2>
<PieChart data={armourSDpsData} /> <PieChart data={armourSDpsData} />
</div> </div>
</span>); </span>);

View File

@@ -11,29 +11,24 @@ import Movement from './Movement';
import Offence from './Offence'; import Offence from './Offence';
import Defence from './Defence'; import Defence from './Defence';
import WeaponDamageChart from './WeaponDamageChart'; import WeaponDamageChart from './WeaponDamageChart';
import Pips from '../components/Pips';
import Boost from '../components/Boost';
import Fuel from '../components/Fuel';
import Cargo from '../components/Cargo';
import ShipPicker from '../components/ShipPicker';
import EngagementRange from '../components/EngagementRange';
import autoBind from 'auto-bind';
import { ShipProps } from 'ed-forge';
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
/** /**
* Outfitting subpages * Outfitting subpages
*/ */
export default class OutfittingSubpages extends TranslatedComponent { export default class OutfittingSubpages extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired,
buildName: PropTypes.string, buildName: PropTypes.string,
sys: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired,
opponent: PropTypes.object.isRequired,
opponentBuild: PropTypes.string,
opponentSys: PropTypes.number.isRequired,
opponentEng: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired,
}; };
/** /**
@@ -42,13 +37,17 @@ export default class OutfittingSubpages extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._powerTab = this._powerTab.bind(this); autoBind(this);
this._profilesTab = this._profilesTab.bind(this);
this._offenceTab = this._offenceTab.bind(this);
this._defenceTab = this._defenceTab.bind(this);
this.props.ship.setOpponent(this.props.ship);
this.state = { this.state = {
boost: false,
cargo: props.ship.get(CARGO_CAPACITY),
fuel: props.ship.get(FUEL_CAPACITY),
pips: props.ship.getDistributorSettingsObject(),
tab: Persist.getOutfittingTab() || 'power', tab: Persist.getOutfittingTab() || 'power',
engagementRange: 1000,
opponent: this.props.ship,
}; };
} }
@@ -57,128 +56,113 @@ export default class OutfittingSubpages extends TranslatedComponent {
* @param {string} tab Tab name * @param {string} tab Tab name
*/ */
_showTab(tab) { _showTab(tab) {
Persist.setOutfittingTab(tab);
this.setState({ tab }); this.setState({ tab });
} }
/**
* Render the power tab
* @return {React.Component} Tab contents
*/
_powerTab() {
let { ship, buildName, code, onChange } = this.props;
Persist.setOutfittingTab('power');
const powerMarker = `${ship.toString()}`;
const costMarker = `${ship.toString().split('.')[0]}`;
return <div>
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
<CostSection ship={ship} buildName={buildName} code={costMarker} />
</div>;
}
/**
* Render the profiles tab
* @return {React.Component} Tab contents
*/
_profilesTab() {
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
const { translate } = this.context.language;
let realBoost = boost && ship.canBoost(cargo, fuel);
Persist.setOutfittingTab('profiles');
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
return <div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
</div>
</div>;
}
/**
* Render the offence tab
* @return {React.Component} Tab contents
*/
_offenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
Persist.setOutfittingTab('offence');
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
return <div>
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
</div>;
}
/**
* Render the defence tab
* @return {React.Component} Tab contents
*/
_defenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
Persist.setOutfittingTab('defence');
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
return <div>
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
</div>;
}
/** /**
* Render the section * Render the section
* @return {React.Component} Contents * @return {React.Component} Contents
*/ */
render() { render() {
const tab = this.state.tab; const { buildName, code, ship } = this.props;
const translate = this.context.language.translate; const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state;
let tabSection; const { translate } = this.context.language;
switch (tab) {
case 'power': tabSection = this._powerTab(); break;
case 'profiles': tabSection = this._profilesTab(); break;
case 'offence': tabSection = this._offenceTab(); break;
case 'defence': tabSection = this._defenceTab(); break;
}
const cargoCapacity = ship.get(CARGO_CAPACITY);
const showCargoSlider = cargoCapacity > 0;
return ( return (
<div className='group full' style={{ minHeight: '1000px' }}> <div>
<table className='tabs'> {/* Control of ship and opponent */}
<thead> <div className="group quarter">
<tr> <h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th> {translate('ship control')}
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th> </h2>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th> <Boost boost={boost} onChange={(boost) => this.setState({ boost })} />
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('tab_defence')}</th> </div>
</tr> <div className="group quarter">
</thead> <h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
</table> {translate('opponent')}
{tabSection} </h2>
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
</div>
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
onChange={(fuel) => this.setState({ fuel })} />
</div>
{showCargoSlider ?
<div className="group quarter">
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
onChange={(cargo) => this.setState({ cargo })} />
</div> : null}
<div className="group half">
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
</div>
<div className="group half">
<EngagementRange ship={ship} engagementRange={engagementRange}
onChange={(engagementRange) => this.setState({ engagementRange })} />
</div>
<div className='group full' style={{ minHeight: '1000px' }}>
<table className='tabs'>
{/* Select tab section */}
<thead>
<tr>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
onClick={this._showTab.bind(this, 'power')}>
{translate('power and costs')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
onClick={this._showTab.bind(this, 'profiles')}>
{translate('profiles')}</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
onClick={this._showTab.bind(this, 'offence')}>
{translate('offence')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
onClick={this._showTab.bind(this, 'defence')}>
{translate('tab_defence')}
</th>
</tr>
</thead>
</table>
{/* Show selected tab */}
{tab == 'power' ?
<div>
<PowerManagement ship={ship} code={code} />
<CostSection ship={ship} buildName={buildName} code={code} />
</div> : null}
{tab == 'profiles' ?
<div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement code={code} ship={ship} boost={boost} pips={pips} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
</div>
</div> : null}
{tab == 'offence' ?
<div>
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
{tab == 'defence' ?
<div>
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
</div>
</div> </div>
); );
} }

View File

@@ -10,7 +10,6 @@ const LABEL_COLOUR = '#000000';
* A pie chart * A pie chart
*/ */
export default class PieChart extends Component { export default class PieChart extends Component {
static propTypes = { static propTypes = {
data : PropTypes.array.isRequired data : PropTypes.array.isRequired
}; };

View File

@@ -3,6 +3,7 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Pip } from './SvgIcons'; import { Pip } from './SvgIcons';
import { autoBind } from 'react-extras'; import { autoBind } from 'react-extras';
import { Ship } from 'ed-forge';
/** /**
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area. * Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
@@ -10,13 +11,9 @@ import { autoBind } from 'react-extras';
*/ */
export default class Pips extends TranslatedComponent { export default class Pips extends TranslatedComponent {
static propTypes = { static propTypes = {
sys: PropTypes.number.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
eng: PropTypes.number.isRequired, pips: PropTypes.object.isRequired,
wep: PropTypes.number.isRequired, onChange: PropTypes.func.isRequired,
mcSys: PropTypes.number.isRequired,
mcEng: PropTypes.number.isRequired,
mcWep: PropTypes.number.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -27,6 +24,12 @@ export default class Pips extends TranslatedComponent {
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); autoBind(this);
const { ship } = props;
this._incSys = this._change(ship.incSys);
this._incEng = this._change(ship.incEng);
this._incWep = this._change(ship.incWep);
this._reset = this._change(ship.pipsReset);
} }
/** /**
@@ -71,153 +74,42 @@ export default class Pips extends TranslatedComponent {
} }
/** /**
* Reset the capacitor * Creates a function that handles pip assignment and call `onChance`.
*/ * @param {String} cb Callback that handles the actual pip assignment
_reset(isMc) {
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
if (isMc) {
if (mcSys || mcEng || mcWep) {
sys -= mcSys;
eng -= mcEng;
wep -= mcWep;
this.props.onChange(sys, eng, wep, 0, 0, 0);
}
} else if (sys != 2 || eng != 2 || wep != 2) {
sys = eng = wep = 2;
this.props.onChange(sys + mcSys, eng + mcEng, wep + mcWep, mcSys, mcEng, mcWep);
}
}
/**
* Increment the SYS capacitor
*/
_incSys() {
this._inc('sys', false);
}
/**
* Increment the ENG capacitor
*/
_incEng() {
this._inc('eng', false);
}
/**
* Increment the WEP capacitor
*/
_incWep() {
this._inc('wep', false);
}
_wrapMcClick(key) {
return (event) => {
event.stopPropagation();
event.preventDefault();
if (key == 'rst') {
this._reset(true);
} else {
this._inc(key, true);
}
};
}
/**
* Increases a given capacitor
* @param {String} key Pip name to increase (one of 'sys', 'eng', 'wep')
* @param {Boolean} isMc True when increase is by multi crew * @param {Boolean} isMc True when increase is by multi crew
* @returns {Function} Function that handles pip assigment
*/ */
_inc(key, isMc) { _change(cb, isMc) {
if (!['sys', 'eng', 'wep'].includes(key)) { return () => {
return; cb(isMc);
} this.props.onChange(this.props.ship.getDistributorSettingsObject());
};
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
let mc = key == 'sys' ? mcSys : (key == 'eng' ? mcEng : mcWep);
let pips = this.props[key] - mc;
let other1 = key == 'sys' ? eng - mcEng : sys - mcSys;
let other2 = key == 'wep' ? eng - mcEng : wep - mcWep;
const required = Math.min(1, 4 - mc - pips);
if (isMc) {
// We can only set full pips in multi-crew also we can only set two pips
if (required > 0.5 && mcSys + mcEng + mcWep < 2) {
if (key == 'sys') {
mcSys += 1;
} else if (key == 'eng') {
mcEng += 1;
} else {
mcWep += 1;
}
}
} else if (required > 0) {
if (required == 0.5) {
// Take from whichever is larger
if (other1 > other2) {
other1 -= 0.5;
} else {
other2 -= 0.5;
}
pips += 0.5;
} else {
// Required is 1 - take from both if possible
if (other1 == 0) {
other2 -= 1;
} else if (other2 == 0) {
other1 -= 1;
} else {
other1 -= 0.5;
other2 -= 0.5;
}
pips += 1;
}
}
sys = mcSys + (key == 'sys' ? pips : other1);
eng = mcEng + (key == 'eng' ? pips : (key == 'sys' ? other1 : other2));
wep = mcWep + (key == 'wep' ? pips : other2);
this.props.onChange(sys, eng, wep, mcSys, mcEng, mcWep);
} }
/** /**
* Set up the rendering for pips * Set up the rendering for pips
* @param {Number} sys the SYS pips
* @param {Number} eng the ENG pips
* @param {Number} wep the WEP pips
* @param {Number} mcSys SYS pips from multi-crew
* @param {Number} mcEng ENG pips from multi-crew
* @param {Number} mcWep WEP pips from multi-crew
* @returns {Object} Object containing the rendering for the pips * @returns {Object} Object containing the rendering for the pips
*/ */
_renderPips(sys, eng, wep, mcSys, mcEng, mcWep) { _renderPips() {
const pipsSvg = { const pipsSvg = {
SYS: [], Sys: [],
ENG: [], Eng: [],
WEP: [], Wep: [],
}; };
// Multi-crew pipsSettings actually are included in the overall pip count therefore for (let k in this.props.pips) {
// we can consider [0, sys - mcSys] as normal pipsSettings whilst [sys - mcSys, sys] let { base, mc } = this.props.pips[k];
// are the multi-crew pipsSettings in what follows. for (let i = 0; i < Math.floor(base); i++) {
pipsSvg[k].push(<Pip key={i} className='full' />);
let pipsSettings = {
SYS: [sys, mcSys],
ENG: [eng, mcEng],
WEP: [wep, mcWep],
};
for (let pipName in pipsSettings) {
let [pips, mcPips] = pipsSettings[pipName];
for (let i = 0; i < Math.floor(pips - mcPips); i++) {
pipsSvg[pipName].push(<Pip key={i} className='full' />);
} }
if (pips > Math.floor(pips)) { if (base > Math.floor(base)) {
pipsSvg[pipName].push(<Pip className='half' key={'half'} />); pipsSvg[k].push(<Pip className='half' key={'half'} />);
} }
for (let i = pips - mcPips; i < Math.floor(pips); i++) { for (let i = 0; i < mc; i++) {
pipsSvg[pipName].push(<Pip key={i} className='mc' />); pipsSvg[k].push(<Pip key={base + i} className='mc' />);
} }
for (let i = Math.floor(pips + 0.5); i < 4; i++) { for (let i = Math.ceil(base + mc); i < 4; i++) {
pipsSvg[pipName].push(<Pip className='empty' key={i} />); pipsSvg[k].push(<Pip className='empty' key={i} />);
} }
} }
@@ -229,11 +121,10 @@ export default class Pips extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { tooltip, termtip } = this.context; const { ship } = this.props;
const { formats, translate, units } = this.context.language; const { translate } = this.context.language;
const { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
const pipsSvg = this._renderPips(sys, eng, wep, mcSys, mcEng, mcWep); const pipsSvg = this._renderPips();
return ( return (
<span id='pips'> <span id='pips'>
<table> <table>
@@ -241,38 +132,40 @@ export default class Pips extends TranslatedComponent {
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={() => this._inc('eng')} <td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td>
onContextMenu={this._wrapMcClick('eng')}>{pipsSvg['ENG']}</td>
<td>&nbsp;</td> <td>&nbsp;</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td>
onContextMenu={this._wrapMcClick('sys')}>{pipsSvg['SYS']}</td> <td className='clickable' onClick={this._incEng}>
<td className='clickable' onClick={this._incEng} {translate('ENG')}
onContextMenu={this._wrapMcClick('eng')}>{translate('ENG')}</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td>
onContextMenu={this._wrapMcClick('wep')}>{pipsSvg['WEP']}</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys} <td className='clickable' onClick={this._incSys}>
onContextMenu={this._wrapMcClick('sys')}>{translate('SYS')}</td> {translate('SYS')}
<td className='clickable' onClick={this._reset.bind(this, false)}> </td>
<td className='clickable' onClick={this._reset}>
{translate('RST')} {translate('RST')}
</td> </td>
<td className='clickable' onClick={this._incWep} <td className='clickable' onClick={this._incWep}>
onContextMenu={this._wrapMcClick('wep')}>{translate('WEP')}</td> {translate('WEP')}
</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td className='clickable' onClick={this._change(ship.incSys, true)}>
<td className='clickable secondary' onClick={this._wrapMcClick('rst')} <Pip className='mc' />
onMouseEnter={termtip.bind(null, 'PHRASE_MULTI_CREW_CAPACITOR_POINTS')} </td>
onMouseLeave={tooltip.bind(null, null)}> <td className='clickable' onClick={this._change(ship.incEng, true)}>
{translate('RST')} <Pip className='mc' />
</td>
<td className='clickable' onClick={this._change(ship.incWep, true)}>
<Pip className='mc' />
</td> </td>
<td>&nbsp;</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -4,27 +4,25 @@ import * as d3 from 'd3';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { Ship } from 'ed-forge';
import { POWER_METRICS } from 'ed-forge/lib/src/ship-stats';
import autoBind from 'auto-bind';
/** /**
* Round to avoid floating point precision errors * Get the band-class.
* @param {Boolean} selected Band selected * @param {Boolean} selected Band selected
* @param {number} sum Band power sum * @param {Number} relDraw Relative amount of power drawn by this band and
* @param {number} avail Total available power * all prior
* @return {string} CSS Class name * @return {string} CSS Class name
*/ */
function getClass(selected, sum, avail) { function getClass(selected, relDraw) {
return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary'; if (selected) {
} return 'secondary';
} else if (relDraw >= 1) {
/** return 'warning';
* Get the # label for a Priority band } else {
* @param {number} val Priority Band Watt value return 'primary';
* @param {number} index Priority Band index }
* @param {Function} wattScale Watt Scale function
* @return {number} label / text
*/
function bandText(val, index, wattScale) {
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
} }
/** /**
@@ -33,10 +31,9 @@ function bandText(val, index, wattScale) {
*/ */
export default class PowerBands extends TranslatedComponent { export default class PowerBands extends TranslatedComponent {
static propTypes = { static propTypes = {
bands: PropTypes.array.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
available: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
width: PropTypes.number.isRequired, width: PropTypes.number.isRequired,
code: PropTypes.string,
}; };
/** /**
@@ -46,20 +43,16 @@ export default class PowerBands extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this.wattScale = d3.scaleLinear(); this.wattScale = d3.scaleLinear();
this.pctScale = d3.scaleLinear().domain([0, 1]); this.pctScale = d3.scaleLinear().domain([0, 1]);
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2); this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct); this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateScales = this._updateScales.bind(this);
this._selectNone = this._selectNone.bind(this);
this._hidetip = () => this.context.tooltip(); this._hidetip = () => this.context.tooltip();
let maxBand = props.bands[props.bands.length - 1]; this.profile = props.ship.getMetrics(POWER_METRICS);
this.state = { this.state = {
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
ret: {}, ret: {},
dep: {} dep: {}
}; };
@@ -83,8 +76,6 @@ export default class PowerBands extends TranslatedComponent {
let mRight = Math.round(140 * scale); let mRight = Math.round(140 * scale);
let innerWidth = props.width - mLeft - mRight; let innerWidth = props.width - mLeft - mRight;
this._updateScales(innerWidth, this.state.maxPwr, props.available);
this.setState({ this.setState({
barHeight, barHeight,
innerHeight, innerHeight,
@@ -140,41 +131,67 @@ export default class PowerBands extends TranslatedComponent {
this.setState({ dep: Object.assign({}, dep) }); this.setState({ dep: Object.assign({}, dep) });
} }
/**
* Update scale
* @param {number} innerWidth SVG innerwidth
* @param {number} maxPwr Maximum power level MJ (deployed or available)
* @param {number} available Available power MJ
*/
_updateScales(innerWidth, maxPwr, available) {
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
}
/** /**
* Update state based on property and context changes * Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties * @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context * @param {Object} nextContext Incoming/Next context
*/ */
componentWillReceiveProps(nextProps, nextContext) { componentWillReceiveProps(nextProps, nextContext) {
let { innerWidth, maxPwr } = this.state;
let { language, sizeRatio } = this.context; let { language, sizeRatio } = this.context;
let maxBand = nextProps.bands[nextProps.bands.length - 1];
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
if (language !== nextContext.language) { if (language !== nextContext.language) {
this.wattAxis.tickFormat(nextContext.language.formats.r2); this.wattAxis.tickFormat(nextContext.language.formats.r2);
this.pctAxis.tickFormat(nextContext.language.formats.rPct); this.pctAxis.tickFormat(nextContext.language.formats.rPct);
} }
if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
this.setState({ maxPwr: nextMaxPwr });
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateDimensions(nextProps, nextContext.sizeRatio); this._updateDimensions(nextProps, nextContext.sizeRatio);
} }
} }
/**
* Assemble bands for relative consumption array.
* @param {Number[]} consumed Array of relative-consumption numbers
* @param {object} selected Object mapping selected bands to 1
* @param {Number} yOffset Offset in y-direction of the bar
* @param {Function} onClick onClick callback
* @returns {React.Component} Bands
*/
_consumedToBands(consumed, selected, yOffset, onClick) {
const { state, wattScale } = this;
const bands = [];
let consumesPrev = 0;
for (let i = 0; i < consumed.length; i++) {
consumesPrev = consumed[i - 1] || consumesPrev;
const consumes = consumed[i];
if (!consumes) {
continue;
}
bands.push(<rect
key={'b' + i}
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
height={state.barHeight}
x={wattScale(consumesPrev)}
y={yOffset + 1}
onClick={onClick.bind(this, i)}
className={getClass(selected[i], consumes)}
/>);
bands.push(<text
key={'t' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
y={yOffset + (state.barHeight / 2)}
onClick={onClick.bind(this, i)}
className='primary-bg'>{i + 1}</text>
);
}
return bands;
}
/** /**
* Render the power bands * Render the power bands
* @return {React.Component} Power bands * @return {React.Component} Power bands
@@ -184,78 +201,27 @@ export default class PowerBands extends TranslatedComponent {
return null; return null;
} }
let { wattScale, pctScale, context, props, state } = this; let { pctScale, context, props, state } = this;
let { translate, formats } = context.language; let { translate, formats } = context.language;
let { f2, pct1 } = formats; // wattFmt, pctFmt let { f2, pct1 } = formats; // wattFmt, pctFmt
let { available, bands } = props; let { ship } = props;
let { innerWidth, ret, dep } = state; let { innerWidth, ret, dep, barHeight } = state;
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
let deployed = []; let {
let retracted = []; consumed, generated, relativeConsumed, relativeConsumedRetracted
} = ship.getMetrics(POWER_METRICS);
let maxPwr = Math.max(consumed, generated);
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
let depSum = relativeConsumed[relativeConsumed.length - 1];
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
let retSelected = Object.keys(ret).length > 0; let retSelected = Object.keys(ret).length > 0;
let depSelected = Object.keys(dep).length > 0; let depSelected = Object.keys(dep).length > 0;
let retSum = 0;
let depSum = 0;
for (let i = 0; i < bands.length; i++) {
let b = bands[i];
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
if (b.retracted > 0) {
let retLbl = bandText(b.retracted, i, wattScale);
retracted.push(<rect
key={'rB' + i}
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
y={1}
onClick={this._selectRet.bind(this, i)}
className={getClass(ret[i], b.retractedSum, available)}
/>);
if (retLbl) {
retracted.push(<text
key={'rT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
y={state.retY}
onClick={this._selectRet.bind(this, i)}
className='primary-bg'>{retLbl}</text>
);
}
}
if (b.retracted > 0 || b.deployed > 0) {
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
deployed.push(<rect
key={'dB' + i}
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
y={state.barHeight + 1}
onClick={this._selectDep.bind(this, i)}
className={getClass(dep[i], b.deployedSum, available)}
/>);
if (depLbl) {
deployed.push(<text
key={'dT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
y={state.depY}
onClick={this._selectDep.bind(this, i)}
className='primary-bg'>{depLbl}</text>
);
}
}
}
return ( return (
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}> <svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
@@ -271,8 +237,8 @@ export default class PowerBands extends TranslatedComponent {
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} /> <line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text> <text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text> <text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text>
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text>
</g> </g>
</svg> </svg>
); );

View File

@@ -3,24 +3,49 @@ import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import PowerBands from './PowerBands'; import PowerBands from './PowerBands';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import { Power, NoPower } from './SvgIcons'; import { Power, NoPower } from './SvgIcons';
import autoBind from 'auto-bind';
import { Ship, Module } from 'ed-forge';
const POWER = [ /**
null, * Makes a comparison based on the order `false < undefined < true` (fut) and
null, * maps it to `[-1, 0, 1]`.
<NoPower className='icon warning' />, * @param {boolean} a Bool or undefined
<Power className='secondary-disabled' /> * @param {boolean} b Bool or undefined
]; * @returns {number} Comparison
*/
function futComp(a, b) {
switch (a) {
case false: return (b === false ? 0 : 1);
// The next else-expression maps false to -1 and true to 1
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
case true: return (b === true ? 0 : -1);
}
}
/**
* Get the enabled-icon.
* @param {boolean} enabled Is the module enabled?
* @returns {React.Component} Enabled icon.
*/
function getPowerIcon(enabled) {
if (enabled === undefined) {
return null;
}
if (enabled) {
return <Power className='secondary-disabled' />;
} else {
return <NoPower className='icon warning' />;
}
}
/** /**
* Power Management Section * Power Management Section
*/ */
export default class PowerManagement extends TranslatedComponent { export default class PowerManagement extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -29,19 +54,17 @@ export default class PowerManagement extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._renderPowerRows = this._renderPowerRows.bind(this); autoBind(this);
this._updateWidth = this._updateWidth.bind(this);
this._sort = this._sort.bind(this);
this.state = { this.state = {
predicate: 'pwr', predicate: 'pwr',
desc: false, desc: true,
width: 0 width: 0
}; };
} }
/** /**
* Set the sort order and sort * Set the sort order
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
@@ -53,50 +76,51 @@ export default class PowerManagement extends TranslatedComponent {
desc = true; desc = true;
} }
this._sort(this.props.ship, predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/** /**
* Sorts the power list * Sorts the power list
* @param {Ship} ship Ship instance * @param {Module[]} modules Modules to sort
* @param {string} predicate Sort predicate * @returns {Module[]} Sorted modules
* @param {Boolean} desc Sort order descending
*/ */
_sort(ship, predicate, desc) { _sortAndFilter(modules) {
let powerList = ship.powerList; modules = modules.filter((m) => m.get('powerdraw') >= 0);
let comp = slotComparator.bind(null, this.context.language.translate); let { translate } = this.context.language;
const { predicate, desc } = this.state;
let comp;
switch (predicate) { switch (predicate) {
case 'n': comp = comp(null, desc); break; case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare(
case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break; translate(b.readMeta('type'))
case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break; ); break;
case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break; // case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break; case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break;
case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break; case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break;
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
} }
modules.sort(comp);
powerList.sort(comp); if (desc) {
modules.reverse();
}
return modules;
} }
/** /**
* Update slot priority * Creates a callback that changes the power priority for the given module
* @param {Object} slot Slot model * based on the given delta.
* @param {number} inc increment / decrement * @param {Module} m Module to set the priority for
* @param {Number} delta Delta to set
* @returns {Function} Callback
*/ */
_priority(slot, inc) { _prioCb(m, delta) {
if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) { return () => {
this.props.onChange(); const prio = m.getPowerPriority();
} const newPrio = Math.max(0, prio + delta);
} if (0 <= newPrio) {
m.setPowerPriority(newPrio);
/** }
* Toggle slot active/inactive };
* @param {Object} slot Slot model
*/
_toggleEnabled(slot) {
this.props.ship.setSlotEnabled(slot, !slot.enabled);
this.props.onChange();
} }
/** /**
@@ -110,36 +134,35 @@ export default class PowerManagement extends TranslatedComponent {
_renderPowerRows(ship, translate, pwr, pct) { _renderPowerRows(ship, translate, pwr, pct) {
let powerRows = []; let powerRows = [];
for (let i = 0, l = ship.powerList.length; i < l; i++) { let modules = this._sortAndFilter(ship.getModules());
let slot = ship.powerList[i]; for (let m of modules) {
let retractedElem = null, deployedElem = null;
if (slot.m && slot.m.getPowerUsage() > 0) { const flipEnabled = () => m.setEnabled();
let m = slot.m; if (m.isEnabled()) {
let toggleEnabled = this._toggleEnabled.bind(this, slot); let powered = m.isPowered();
let retractedElem = null, deployedElem = null; retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
if (slot.enabled) { } else {
retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>; retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>;
} else {
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>;
}
powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td>
<td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td>
<td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td>
<td>
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>&#9658;</span>
{' ' + (slot.priority + 1) + ' '}
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>&#9658;</span>
</td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
{retractedElem}
{deployedElem}
</tr>);
} }
const slot = m.getSlot();
powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}>
<td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td>
<td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td>
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
<td>
<span className='flip ptr btn' onClick={this._prioCb(m, -1)}>&#9658;</span>
{' ' + (m.getPowerPriority() + 1) + ' '}
<span className='ptr btn' onClick={this._prioCb(m, 1)}>&#9658;</span>
</td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u>
</td>
{retractedElem}
{deployedElem}
</tr>);
} }
return powerRows; return powerRows;
} }
@@ -155,7 +178,6 @@ export default class PowerManagement extends TranslatedComponent {
* Add listeners when about to mount and sort power list * Add listeners when about to mount and sort power list
*/ */
componentWillMount() { componentWillMount() {
this._sort(this.props.ship, this.state.predicate, this.state.desc);
this.resizeListener = this.context.onWindowResize(this._updateWidth); this.resizeListener = this.context.onWindowResize(this._updateWidth);
} }
@@ -166,17 +188,6 @@ export default class PowerManagement extends TranslatedComponent {
this._updateWidth(); this._updateWidth();
} }
/**
* Sort power list if the ship instance has changed
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
if (this.props.ship != nextProps.ship) {
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
}
}
/** /**
* Remove listeners on unmount * Remove listeners on unmount
*/ */
@@ -191,39 +202,38 @@ export default class PowerManagement extends TranslatedComponent {
render() { render() {
let { ship, code } = this.props; let { ship, code } = this.props;
let { translate, formats } = this.context.language; let { translate, formats } = this.context.language;
let pwr = formats.f2; let pp = ship.getPowerPlant();
let pp = ship.standard[0].m;
let sortOrder = this._sortOrder;
return ( return (
<div ref={node => this.node = node} className='group half' id='componentPriority'> <div ref={node => this.node = node} className='group half' id='componentPriority'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th> {/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */}
<th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th> <th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th>
<th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th> <th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th> <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{pp.class + pp.rating}</td> <td>{String(pp.getClass()) + pp.getRating()}</td>
<td className='le shorten cap' >{translate('pp')}</td> <td className='le shorten cap' >{translate('pp')}</td>
<td><u >{translate('SYS')}</u></td>
<td>1</td> <td>1</td>
<td className='ri'>{pwr(pp.getPowerGeneration())}</td> <td className='ri'>{formats.f2(pp.get('powercapacity'))}</td>
<td className='ri'><u>100%</u></td> <td className='ri'><u>100%</u></td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
<tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr> <tr><td style={{ lineHeight:0 }} colSpan='8'>
{this._renderPowerRows(ship, translate, pwr, formats.pct1)} <hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} />
</td></tr>
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
</tbody> </tbody>
</table> </table>
<PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} /> <PowerBands width={this.state.width} ship={ship} code={code} />
</div> </div>
); );
} }

View File

@@ -1,10 +1,12 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Ships } from 'coriolis-data/dist';
import { Rocket } from './SvgIcons'; import { Rocket } from './SvgIcons';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import cn from 'classnames'; import cn from 'classnames';
import { Factory, Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { isEqual } from 'lodash';
/** /**
* Ship picker * Ship picker
@@ -13,40 +15,49 @@ import cn from 'classnames';
export default class ShipPicker extends TranslatedComponent { export default class ShipPicker extends TranslatedComponent {
static propTypes = { static propTypes = {
onChange: PropTypes.func.isRequired, onChange: PropTypes.func.isRequired,
ship: PropTypes.string.isRequired, ship: PropTypes.instanceOf(Ship).isRequired,
build: PropTypes.string
}; };
static defaultProps = {
ship: 'eagle'
}
/** /**
* constructor * constructor
* @param {object} props Properties react * @param {object} props Properties react
* @param {object} context react context * @param {object} context react context
*/ */
constructor(props, context) { // eslint-disable-line constructor(props, context) {
super(props); super(props);
autoBind(this);
this.shipOrder = Object.keys(Ships).sort(); this.state = {
this._toggleMenu = this._toggleMenu.bind(this); menuOpen: false,
this._closeMenu = this._closeMenu.bind(this); opponent: {
self: true,
this.state = { menuOpen: false }; type: props.ship.getShipType(),
stock: false,
id: undefined,
},
};
} }
/** /**
* Update ship * Update ship
* @param {object} ship the ship * @param {boolean} self True to compare with ship itself
* @param {string} build the build, if present * @param {object} type The ship type
* @param {boolean} stock True to compare with a stock version of given type
* @param {string} id The build's stored ID
*/ */
_shipChange(ship, build) { _shipChange(self, type, stock = false, id = null) {
this._closeMenu(); const opponent = { self, type, stock, id };
if (isEqual(opponent, this.state.opponent)) {
// Ensure that the ship has changed this.setState({ menuOpen: false });
if (ship !== this.props.ship || build !== this.props.build) { } else {
this.props.onChange(ship, build); const { onChange } = this.props;
if (self) {
onChange(this.props.ship);
} else if (stock) {
onChange(Factory.newShip(type));
} else {
onChange(new Ship(Persist.getBuild(type, id)));
}
this.setState({ menuOpen: false, opponent });
} }
} }
@@ -55,26 +66,41 @@ export default class ShipPicker extends TranslatedComponent {
* @returns {object} the picker menu * @returns {object} the picker menu
*/ */
_renderPickerMenu() { _renderPickerMenu() {
const { ship, build } = this.props; const { menuOpen } = this.state;
const _shipChange = this._shipChange; if (!menuOpen) {
const builds = Persist.getBuilds(); return null;
const buildList = [];
for (let shipId of this.shipOrder) {
const shipBuilds = [];
// Add stock build
const stockSelected = (ship == shipId && !build);
shipBuilds.push(<li key={shipId} className={ cn({ 'selected': stockSelected })} onClick={_shipChange.bind(this, shipId, null)}>Stock</li>);
if (builds[shipId]) {
let buildNameOrder = Object.keys(builds[shipId]).sort();
for (let buildName of buildNameOrder) {
const buildSelected = ship === shipId && build === buildName;
shipBuilds.push(<li key={shipId + '-' + buildName} className={ cn({ 'selected': buildSelected })} onClick={_shipChange.bind(this, shipId, buildName)}>{buildName}</li>);
}
}
buildList.push(<ul key={shipId} className='block'>{Ships[shipId].properties.name}{shipBuilds}</ul>);
} }
return buildList; const { translate } = this.context.language;
const { self, type, stock, id } = this.state.opponent;
return <div className='menu-list' onClick={(e) => e.stopPropagation()}>
<div className='quad'>
{Factory.getAllShipTypes().sort().map((shipType) =>
<ul key={shipType} className='block'>
{translate(shipType)}
{/* Add stock build */}
<li key={shipType}
onClick={this._shipChange.bind(this, false, shipType, true)}
className={cn({ selected: stock && type === shipType })}>
{translate('stock')}
</li>
{Persist.getBuildsNamesFor(shipType).sort().map((storedId) =>
<li key={`${shipType}-${storedId}`}
onClick={this._shipChange.bind(this, false, shipType, false, storedId)}
className={ cn({ selected: type === shipType && id === storedId })}>
{storedId}
</li>)}
{/* Add ship itself */}
{(this.props.ship.getShipType() === shipType ?
<li key='self'
onClick={this._shipChange.bind(this, true, shipType)}
className={cn({ selected: self })}>
{translate('THIS_SHIP')}
</li> :
null)}
</ul>)}
</div>
</div>;
} }
/** /**
@@ -85,40 +111,35 @@ export default class ShipPicker extends TranslatedComponent {
this.setState({ menuOpen: !menuOpen }); this.setState({ menuOpen: !menuOpen });
} }
/**
* Close the menu
*/
_closeMenu() {
const { menuOpen } = this.state;
if (menuOpen) {
this._toggleMenu();
}
}
/** /**
* Render picker * Render picker
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { translate } = this.context.language;
const { formats, translate, units } = language; const { ship } = this.props;
const { ship, build } = this.props;
const { menuOpen } = this.state; const { menuOpen } = this.state;
const { self, type, stock, id } = this.state.opponent;
let label;
if (self) {
label = translate('THIS_SHIP');
} else if (stock) {
label = translate('stock');
} else {
label = id;
}
const shipString = ship + ': ' + (build ? build : translate('stock'));
return ( return (
<div className='shippicker' onClick={ (e) => e.stopPropagation() }> <div className='shippicker' onClick={ (e) => e.stopPropagation() }>
<div className='menu'> <div className='menu'>
<div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}> <div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}>
<span><Rocket className='warning' /></span> <span><Rocket className='warning' /></span>
<span className='menu-item-label'>{shipString}</span> <span className='menu-item-label'>
{`${translate(type)}: ${label}`}
</span>
</div> </div>
{ menuOpen ? {this._renderPickerMenu()}
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
<div className='quad'>
{this._renderPickerMenu()}
</div>
</div> : null }
</div> </div>
</div> </div>
); );

View File

@@ -1,21 +1,25 @@
import autoBind from 'auto-bind';
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { Warning } from './SvgIcons'; import { Warning } from './SvgIcons';
import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
import { BOOST_INTERVAL, MINIMUM_MASS } from 'ed-forge/lib/src/ship-stats';
const {
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, LADEN_MASS,
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
} = ShipProps;
/** /**
* Ship Summary Table / Stats * Ship Summary Table / Stats
*/ */
export default class ShipSummaryTable extends TranslatedComponent { export default class ShipSummaryTable extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, code: PropTypes.string.isRequired,
fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired,
pips: PropTypes.object.isRequired
}; };
/** /**
@@ -24,7 +28,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this.didContextChange = this.didContextChange.bind(this); autoBind(this);
this.state = { this.state = {
shieldColour: 'blue' shieldColour: 'blue'
}; };
@@ -35,44 +39,53 @@ export default class ShipSummaryTable extends TranslatedComponent {
* @return {React.Component} Summary table * @return {React.Component} Summary table
*/ */
render() { render() {
const { ship, cargo, fuel, pips } = this.props; const { ship } = this.props;
let { language, tooltip, termtip } = this.context; let { language, tooltip, termtip } = this.context;
let translate = language.translate; let translate = language.translate;
let u = language.units; let u = language.units;
let formats = language.formats; let formats = language.formats;
let { time, int, round, f1, f2 } = formats; let { time, int, f1, f2 } = formats;
let hide = tooltip.bind(null, null); let hide = tooltip.bind(null, null);
const shieldGenerator = ship.findInternalByGroup('sg') || ship.findInternalByGroup('psg');
const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator }); const speed = ship.get(SPEED);
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL'; const shipBoost = ship.get(BOOST_SPEED);
const timeToDrain = Calc.timeToDrainWep(ship, 4); const boostInterval = ship.get(BOOST_INTERVAL);
const canThrust = ship.canThrust(cargo, ship.fuelCapacity); const canThrust = 0 < speed;
const canBoost = canThrust && !isNaN(shipBoost);
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL'; const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canJump = ship.getSlotStatus(ship.standard[2]) == 3;
const sgMetrics = Calc.shieldMetrics(ship, pips.sys); const sgMetrics = ship.get(SHIELD_METRICS);
const shipBoost = canBoost ? Calc.calcBoost(ship) : 'No Boost'; const armourMetrics = ship.get(ARMOUR_METRICS);
const restingHeat = Math.sqrt(((ship.standard[0].m.pgen * ship.standard[0].m.eff) / ship.heatCapacity) / 0.2); const damageMetrics = ship.get(DAMAGE_METRICS);
const armourMetrics = Calc.armourMetrics(ship); const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
const timeToDrain = damageMetrics.timeToDrain;
const shieldGenerator = ship.getShieldGenerator();
const sgClassNames = cn({
warning: shieldGenerator && !shieldGenerator.isEnabled(),
muted: !shieldGenerator,
});
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined;
let shieldColour = 'blue'; let shieldColour = 'blue';
if (shieldGenerator && shieldGenerator.m.grp === 'psg') { switch (sgType) {
shieldColour = 'green'; case 'biweaveshieldgen': shieldColour = 'purple'; break;
} else if (shieldGenerator && shieldGenerator.m.grp === 'bsg') { case 'prismaticshieldgen': shieldColour = 'green'; break;
shieldColour = 'purple';
} }
this.state = { this.state = { shieldColour };
shieldColour
}; const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS);
return <div id='summary'> return <div id='summary'>
<div style={{display: "table", width: "100%"}}> <div style={{ display: 'table', width: '100%' }}>
<div style={{display: "table-row"}}> <div style={{ display: 'table-row' }}>
<table className={'summaryTable'}> <table className={'summaryTable'}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
<th colSpan={5} className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('jump range')}</th> <th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRangeCurrent == 0 }) }>{translate('jump range')}</th>
<th rowSpan={2}>{translate('shield')}</th> <th rowSpan={2}>{translate('shield')}</th>
<th rowSpan={2}>{translate('integrity')}</th> <th rowSpan={2}>{translate('integrity')}</th>
<th rowSpan={2}>{translate('DPS')}</th> <th rowSpan={2}>{translate('DPS')}</th>
@@ -87,14 +100,15 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2}>{translate('crew')}</th> <th rowSpan={2}>{translate('crew')}</th>
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th> <th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th> <th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th>
<th rowSpan={2}>{translate('resting heat (Beta)')}</th> {/* TODO: Resting heat */}
{/* <th rowSpan={2}>{translate('resting heat (Beta)')}</th> */}
</tr> </tr>
<tr> <tr>
<th className={ cn({ 'lft': true, 'bg-warning-disabled': !canJump }) }>{translate('max')}</th> <th className="lft">{translate('max')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('laden')}</th> <th>{translate('laden')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total unladen')}</th> <th>{translate('total unladen')}</th>
<th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total laden')}</th> <th>{translate('total laden')}</th>
<th className='lft'>{translate('hull')}</th> <th className='lft'>{translate('hull')}</th>
<th>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th>{translate('laden')}</th> <th>{translate('laden')}</th>
@@ -102,30 +116,68 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })}
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{ f2(Calc.jumpRange(ship.unladenMass + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump(), ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> >{canThrust ?
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <span>{int(speed)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td> <td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })}
<td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td> >{canBoost ?
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td> <span>{int(shipBoost)}{u['m/s']}</span> :
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td> <span className='warning'>0<Warning/></span>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td> }</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeMax)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeUnladen)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeLaden)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.totalRangeUnladen)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.totalRangeLaden)}{u.LY}</span>}</td>
<td className={sgClassNames}
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
onMouseLeave={hide}
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
onMouseLeave={hide}
>{int(armourMetrics.armour)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.dps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.eps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
onMouseLeave={hide}
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
{/* <td>{f1(ship.totalHps)}</td> */} {/* <td>{f1(ship.totalHps)}</td> */}
<td>{round(ship.cargoCapacity)}{u.T}</td> <td>{ship.get(CARGO_CAPACITY)}{u.T}</td>
<td>{ship.passengerCapacity}</td> <td>{ship.get(PASSENGER_CAPACITY)}</td>
<td>{round(ship.fuelCapacity)}{u.T}</td> <td>{ship.get(FUEL_CAPACITY)}{u.T}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td> onMouseLeave={hide}
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td> >{ship.readProp('hullmass')}{u.T}</td>
<td>{int(ship.hardness)}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })}
<td>{ship.crew}</td> onMouseLeave={hide}
<td>{ship.masslock}</td> >{int(ship.get(MINIMUM_MASS))}{u.T}</td>
<td>{shipBoost !== 'No Boost' ? formats.time(shipBoost) : 'No Boost'}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })}
<td>{formats.pct(restingHeat)}</td> onMouseLeave={hide}
>{int(ship.get(LADEN_MASS))}{u.T}</td>
<td>{int(ship.readProp('hardness'))}</td>
<td>{ship.readMeta('crew')}</td>
<td>{ship.readProp('masslock')}</td>
<td>{time(boostInterval)}</td>
{/* TODO: resting heat */}
{/* <td>{NaN}</td> */}
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -153,21 +205,21 @@ export default class ShipSummaryTable extends TranslatedComponent {
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(shieldGenerator && shieldGenerator.m.grp || 'No Shield')}</td> <td>{translate(sgType || 'No Shield')}</td>
<td>{formats.pct1(ship.shieldExplRes)}</td> <td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldKinRes)}</td> <td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.shieldThermRes)}</td> <td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td>
<td></td> <td></td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary / sgMetrics.explosive.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.kinetic.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td>
<td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.thermal.base : 0)}{u.MJ}</td> <td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td>
<td></td> <td></td>
<td>{sgMetrics && sgMetrics.recover === Math.Inf ? translate('Never') : formats.time(sgMetrics.recover)}</td> <td>{isNaN(sgMetrics.recover) ? translate('Never') : formats.time(sgMetrics.recover)}</td>
<td>{sgMetrics && sgMetrics.recharge === Math.Inf ? translate('Never') : formats.time(sgMetrics.recharge)}</td> <td>{isNaN(sgMetrics.recharge) ? translate('Never') : formats.time(sgMetrics.recharge)}</td>
</tr> </tr>
</tbody> </tbody>
<thead> <thead>
<tr> <tr>
@@ -179,7 +231,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th> <th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th>
</tr> </tr>
<tr> <tr>
<th>{`${translate('explosive')}`}</th> <th>{`${translate('explosive')}`}</th>
<th>{`${translate('kinetic')}`}</th> <th>{`${translate('kinetic')}`}</th>
<th>{`${translate('thermal')}`}</th> <th>{`${translate('thermal')}`}</th>
<th>{`${translate('caustic')}`}</th> <th>{`${translate('caustic')}`}</th>
@@ -193,19 +245,18 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(ship && ship.bulkheads && ship.bulkheads.m && ship.bulkheads.m.name || 'No Armour')}</td> <td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td>
<td>{formats.pct1(ship.hullExplRes)}</td> <td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullKinRes)}</td> <td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullThermRes)}</td> <td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td>
<td>{formats.pct1(ship.hullCausRes)}</td> <td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.total)}</td> <td>{int(armourMetrics.armour)}</td>
<td>{int(armourMetrics.total / armourMetrics.explosive.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.kinetic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td>
<td>{int(armourMetrics.total / armourMetrics.thermal.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td>
<td>{int(armourMetrics.total/ armourMetrics.caustic.total)}</td> <td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td>
<td>{int(armourMetrics.modulearmour)}</td> <td>{int(moduleProtectionMetrics.moduleArmour)}</td>
<td>{int(armourMetrics.moduleprotection * 100) + '%'}</td> <td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -1,5 +1,6 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import autoBind from 'auto-bind';
const MARGIN_LR = 8; // Left/ Right margin const MARGIN_LR = 8; // Left/ Right margin
@@ -7,7 +8,6 @@ const MARGIN_LR = 8; // Left/ Right margin
* Horizontal Slider * Horizontal Slider
*/ */
export default class Slider extends React.Component { export default class Slider extends React.Component {
static defaultProps = { static defaultProps = {
axis: false, axis: false,
min: 0, min: 0,
@@ -32,16 +32,7 @@ export default class Slider extends React.Component {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
this._down = this._down.bind(this); autoBind(this);
this._move = this._move.bind(this);
this._up = this._up.bind(this);
this._keyup = this._keyup.bind(this);
this._keydown = this._keydown.bind(this);
this._touchstart = this._touchstart.bind(this);
this._touchend = this._touchend.bind(this);
this._updatePercent = this._updatePercent.bind(this);
this._updateDimensions = this._updateDimensions.bind(this);
this.state = { width: 0 }; this.state = { width: 0 };
} }
@@ -55,7 +46,6 @@ export default class Slider extends React.Component {
this.left = rect.left; this.left = rect.left;
this.width = rect.width; this.width = rect.width;
this._move(event); this._move(event);
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
} }
/** /**
@@ -75,70 +65,11 @@ export default class Slider extends React.Component {
* @param {Event} event DOM Event * @param {Event} event DOM Event
*/ */
_up(event) { _up(event) {
this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer);
event.preventDefault(); event.preventDefault();
this.left = null; this.left = null;
this.width = null; this.width = null;
} }
/**
* Key up handler for keyboard.
* display the number field then set focus to it
* when "Enter" key is pressed
* @param {Event} event Keyboard event
*/
_keyup(event) {
switch (event.key) {
case 'Enter':
event.preventDefault();
this.sliderInputBox._setDisplay('block');
return;
default:
return;
}
}
/**
* Key down handler
* increment slider position by +/- 1 when right/left arrow key is pressed or held
* @param {Event} event Keyboard even
*/
_keydown(event) {
let newVal = this.props.percent * this.props.max;
switch (event.key) {
case 'ArrowRight':
newVal += 1;
if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
return;
case 'ArrowLeft':
newVal -= 1;
if (newVal >= 0) this.props.onChange(newVal / this.props.max);
return;
default:
return;
}
}
/**
* Touch start handler
* @param {Event} event DOM Event
*
*/
_touchstart(event) {
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
}
/**
* Touch end handler
* @param {Event} event DOM Event
*
*/
_touchend(event) {
this.sliderInputBox.sliderVal.focus();
clearTimeout(this.touchStartTimer);
}
/** /**
* Determine if the user is still dragging * Determine if the user is still dragging
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -212,8 +143,8 @@ export default class Slider extends React.Component {
let margin = MARGIN_LR * scale; let margin = MARGIN_LR * scale;
let width = outerWidth - (margin * 2); let width = outerWidth - (margin * 2);
let pctPos = width * this.props.percent; let pctPos = width * this.props.percent;
return <div><svg return <div><svg
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0"> onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} style={style} ref={node => this.node = node} tabIndex="0">
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' /> <rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' /> <rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} /> <circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
@@ -224,163 +155,6 @@ export default class Slider extends React.Component {
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text> <text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
</g>} </g>}
</svg> </svg>
<TextInputBox ref={(tb) => this.sliderInputBox = tb} </div>;
onChange={this.props.onChange}
percent={this.props.percent}
axisUnit={this.props.axisUnit}
scale={this.props.scale}
max={this.props.max}
/>
</div>;
} }
} }
/**
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
**/
class TextInputBox extends React.Component {
static propTypes = {
axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value
percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number
};
/**
* Determine if the user is still dragging
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this._handleFocus = this._handleFocus.bind(this);
this._handleBlur = this._handleBlur.bind(this);
this._handleChange = this._handleChange.bind(this);
this._keyup = this._keyup.bind(this);
this.state = this._getInitialState();
}
/**
* Update input value if slider changes will change props/state
* @param {Object} nextProps React Component properites
* @param {Object} nextState React Component state values
*/
componentWillReceiveProps(nextProps, nextState) {
let nextValue = nextProps.percent * nextProps.max;
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
this.setState({ inputValue: nextValue });
}
}
/**
* Update slider textbox visibility/values if changes are made to slider
* @param {Object} prevProps React Component properites
* @param {Object} prevState React Component state values
*/
componentDidUpdate(prevProps, prevState) {
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
}
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
// they chose a different module
this.setState({ inputValue: this.props.max });
}
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
this.props.onChange(this.state.inputValue / this.props.max);
}
}
/**
* Set initial state for the textbox.
* We may want to rethink this to
* try and make it a stateless component
* @returns {object} React state object with initial values set
*/
_getInitialState() {
return {
divStyle: { display:'none' },
inputStyle: { width:'4em' },
labelStyle: { marginLeft: '.1em' },
maxLength:5,
size:5,
min:0,
tabIndex:-1,
type:'number',
readOnly: true,
inputValue: this.props.percent * this.props.max
};
}
/**
*
* @param {string} val block or none
*/
_setDisplay(val) {
this.setState({
divStyle: { display:val }
});
}
/**
* Update the input value
* when textbox gets focus
*/
_handleFocus() {
this.setState({
inputValue:this._getValue()
});
}
/**
* Update inputValue when textbox loses focus
*/
_handleBlur() {
this._setDisplay('none');
if (this.state.inputValue !== '') {
this.props.onChange(this.state.inputValue / this.props.max);
} else {
this.setState({
inputValue: this.props.percent * this.props.max
});
}
}
/**
* Get the value in the text box
* @returns {number} inputValue Value of the input box
*/
_getValue() {
return this.state.inputValue;
}
/**
* Update and set limits on input box
* values depending on what user
* has selected
*
* @param {SyntheticEvent} event ReactJs onChange event
*/
_handleChange(event) {
if (event.target.value < 0) {
this.setState({ inputValue: 0 });
} else if (event.target.value <= this.props.max) {
this.setState({ inputValue: event.target.value });
} else {
this.setState({ inputValue: this.props.max });
}
}
/**
* Key up handler for input field.
* If user hits Enter key, blur/close the input field
* @param {Event} event Keyboard event
*/
_keyup(event) {
switch (event.key) {
case 'Enter':
this.sliderVal.blur();
return;
default:
return;
}
}
/**
* Get the value in the text box
* @return {React.Component} Text Input component for Slider
*/
render() {
let { axisUnit, onChange, percent, scale } = this.props;
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
}
}

View File

@@ -2,30 +2,37 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { ListModifications, Modified } from './SvgIcons';
import AvailableModulesMenu from './AvailableModulesMenu'; import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu'; import ModificationsMenu from './ModificationsMenu';
import { diffDetails } from '../utils/SlotFunctions'; import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { blueprintTooltip } from '../utils/BlueprintFunctions';
import { Module } from 'ed-forge';
import { TYPES } from 'ed-forge/lib/src/data/slots';
import autoBind from 'auto-bind';
import { toPairs } from 'lodash';
const HARDPOINT_SLOT_LABELS = {
1: 'S',
2: 'M',
3: 'L',
4: 'H',
};
/** /**
* Abstract Slot * Abstract Slot
*/ */
export default class Slot extends TranslatedComponent { export default class Slot extends TranslatedComponent {
static propTypes = { static propTypes = {
availableModules: PropTypes.func.isRequired, currentMenu: PropTypes.any,
onSelect: PropTypes.func.isRequired, hideSearch: PropTypes.bool,
onOpen: PropTypes.func.isRequired, m: PropTypes.instanceOf(Module),
maxClass: PropTypes.number.isRequired,
selected: PropTypes.bool,
m: PropTypes.object,
enabled: PropTypes.bool.isRequired,
ship: PropTypes.object.isRequired,
eligible: PropTypes.object,
warning: PropTypes.func, warning: PropTypes.func,
drag: PropTypes.func, drag: PropTypes.func,
drop: PropTypes.func, drop: PropTypes.func,
dropClass: PropTypes.string dropClass: PropTypes.string,
propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
@@ -34,25 +41,122 @@ export default class Slot extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._modificationsSelected = false; this.state = { menuIndex: 0 };
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
this._keyDown = this._keyDown.bind(this);
this.slotDiv = null;
} }
// Must be implemented by subclasses: /**
// _getSlotDetails() * Opens a menu while setting state.
* @param {Object} newMenuIndex New menu index
* @param {Event} event Event object
*/
_openMenu(newMenuIndex, event) {
const slotName = this.props.m.getSlot();
if (
this.props.currentMenu === slotName &&
newMenuIndex === this.state.menuIndex
) {
this.context.closeMenu();
} {
this.setState({ menuIndex: newMenuIndex });
this.context.openMenu(slotName);
}
// If we don't stop event propagation, the underlying divs also might
// get clicked which would open up other menus
event.stopPropagation();
}
/** /**
* Get the CSS class name for the slot. Can/should be overriden * Generate the slot contents
* as necessary. * @return {React.Component} Slot contents
* @return {string} CSS Class name
*/ */
_getClassNames() { _getSlotDetails() {
return null; const { m, propsToShow } = this.props;
let { termtip, tooltip, language } = this.context;
const { translate, units, formats } = language;
if (m.isEmpty()) {
return <div className="empty">
{translate(
m.isOnSlot(TYPES.MILITARY) ? 'emptyrestricted' : 'empty'
)}
</div>;
} else {
let classRating = m.getClassRating();
let { drag, drop } = this.props;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
const blueprint = m.getBlueprint();
const experimental = m.getExperimental();
const grade = m.getBlueprintGrade();
if (blueprint) {
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
if (experimental) {
modTT += `, ${translate(experimental)}`;
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(language, m)}
</div>
);
}
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
return (
<div
className={cn('details', { disabled: !m.isEnabled() })}
draggable="true"
onDragStart={drag}
onDragEnd={drop}
>
<div className={'cb'}>
<div className={'l'}>
{classRating} {translate(m.readMeta('type'))}
{blueprint && (
<span
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}
>
<Modified />
</span>
)}
</div>
{propsToShow.mass ?
<div className={'r'}>
{formats.round(mass)}
{units.T}
</div> : null}
</div>
<div className={'cb'}>
{toPairs(propsToShow).sort().map(([prop, show]) => {
const { unit, value } = m.getFormatted(prop, true);
// Don't show mass again; it's already shown on the top right
// corner of a slot
if (!show || isNaN(value) || prop == 'mass') {
return null;
} else {
return (<div className='l'>
{translate(prop)}: {formats.round(value)}{unit}
</div>);
}
})}
{(m.getApplicableBlueprints() || []).length > 0 ? (
<div className="r">
<button onClick={this._openMenu.bind(this, 1)}
onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, translate('modifications'))}
onMouseOut={tooltip.bind(null, null)}
>
<ListModifications />
</button>
</div>
) : null}
</div>
</div>
);
}
} }
/** /**
@@ -61,7 +165,19 @@ export default class Slot extends TranslatedComponent {
* @return {string} label * @return {string} label
*/ */
_getMaxClassLabel() { _getMaxClassLabel() {
return this.props.maxClass; const { m } = this.props;
let size = m.getSizeNum();
switch (true) {
case m.getSlot() === 'armour':
return '';
case size === 0:
// This can also happen for armour but that case was handled above
return 'U';
case m.isOnSlot(TYPES.HARDPOINT):
return HARDPOINT_SLOT_LABELS[size];
default:
return size;
}
} }
/** /**
@@ -71,25 +187,15 @@ export default class Slot extends TranslatedComponent {
_contextMenu(event) { _contextMenu(event) {
event.stopPropagation(); event.stopPropagation();
event.preventDefault(); event.preventDefault();
this.props.onSelect(null,null); const { m } = this.props;
} m.reset();
if (this.props.currentMenu === m.getSlot()) {
/** Key Down handler this.context.closeMenu();
* @param {SyntheticEvent} event Event } else {
* ToDo: see if this can be moved up this.forceUpdate();
* we do more or less the same thing
* in every section when Enter key is pressed
* on a focusable item
*
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
} }
} }
/** /**
* Render the slot * Render the slot
* @return {React.Component} The slot * @return {React.Component} The slot
@@ -97,64 +203,41 @@ export default class Slot extends TranslatedComponent {
render() { render() {
let language = this.context.language; let language = this.context.language;
let translate = language.translate; let translate = language.translate;
let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props; let {
let slotDetails, modificationsMarker, menu; currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow,
onPropToggle,
if (!selected) { } = this.props;
// If not selected then sure that modifications flag is unset const { menuIndex } = this.state;
this._modificationsSelected = false;
}
if (m) {
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
modificationsMarker = JSON.stringify(m);
} else {
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
modificationsMarker = '';
}
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className={this._getClassNames()}
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className={this._getClassNames()}
modules={availableModules()}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
// TODO: implement touch dragging // TODO: implement touch dragging
const selected = currentMenu === m.getSlot();
return ( return (
<div className={cn('slot', dropClass, { selected })} onClick={onOpen} onKeyDown={this._keyDown} onContextMenu={this._contextMenu} onDragOver={dragOver} tabIndex="0" ref={slotDiv => this.slotDiv = slotDiv}> <div
<div className='details-container'> className={cn('slot', dropClass, { selected })}
<div className='sz'>{this._getMaxClassLabel(translate)}</div> onContextMenu={this._contextMenu}
{slotDetails} onDragOver={dragOver} tabIndex="0"
</div> onClick={this._openMenu.bind(this, 0)}
{menu} >
<div className={cn(
'details-container',
{ warning: warning && warning(m) },
)}>
<div className="sz">{this._getMaxClassLabel(translate)}</div>
{this._getSlotDetails()}
</div>
{selected && menuIndex === 0 &&
<AvailableModulesMenu
m={m} hideSearch={hideSearch}
onSelect={(item) => {
m.setItem(item);
this.context.closeMenu();
}}
warning={warning}
/>}
{selected && menuIndex === 1 &&
<ModificationsMenu m={m} propsToShow={propsToShow}
onPropToggle={onPropToggle} />}
</div> </div>
); );
} }
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
} }

View File

@@ -2,50 +2,35 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions';
import { Equalizer } from '../components/SvgIcons'; import { Equalizer } from '../components/SvgIcons';
import cn from 'classnames'; import cn from 'classnames';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
const browser = require('detect-browser'); const browser = require('detect-browser');
/** /**
* Abstract Slot Section * Abstract Slot Section
*/ */
export default class SlotSection extends TranslatedComponent { export default class SlotSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.instanceOf(Ship),
onChange: PropTypes.func.isRequired,
onCargoChange: PropTypes.func.isRequired,
onFuelChange: PropTypes.func.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
togglePwr: PropTypes.func, togglePwr: PropTypes.func,
sectionMenuRefs: PropTypes.object propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
* @param {string} sectionId Section DOM Id
* @param {string} sectionName Section name * @param {string} sectionName Section name
*/ */
constructor(props, context, sectionId, sectionName) { constructor(props, sectionName) {
super(props); super(props);
this.sectionId = sectionId; autoBind(this);
this.sectionName = sectionName;
this.ssHeadRef = null; this.sectionName = sectionName;
this.sectionRefArr = this.props.sectionMenuRefs[this.sectionId] = [];
this.sectionRefArr['selectedRef'] = null;
this._getSlots = this._getSlots.bind(this);
this._selectModule = this._selectModule.bind(this);
this._getSectionMenu = this._getSectionMenu.bind(this);
this._contextMenu = this._contextMenu.bind(this);
this._drop = this._drop.bind(this);
this._dragOverNone = this._dragOverNone.bind(this);
this._close = this._close.bind(this);
this._keyDown = this._keyDown.bind(this);
this._handleSectionFocus = this._handleSectionFocus.bind(this);
this.state = {}; this.state = {};
} }
@@ -55,82 +40,6 @@ export default class SlotSection extends TranslatedComponent {
// _contextMenu() // _contextMenu()
// componentDidUpdate(prevProps) // componentDidUpdate(prevProps)
/**
* TODO: May either need to send the function to be triggered when Enter key is pressed, or else
* may need a separate keyDown handler for each subclass (StandardSlotSection, HardpointSlotSection, etc.)
* ex: _keyDown(_keyDownfn, event)
*
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
event.stopPropagation();
if (event.currentTarget.nodeName === 'H1') {
this._openMenu(this.sectionName, event);
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
if (event.shiftKey) {
if ((event.currentTarget === this.sectionRefArr[this.firstRefId]) && this.sectionRefArr[this.lastRefId]) {
event.preventDefault();
this.sectionRefArr[this.lastRefId].focus();
}
} else {
if ((event.currentTarget === this.sectionRefArr[this.lastRefId]) && this.sectionRefArr[this.firstRefId]) {
event.preventDefault();
this.sectionRefArr[this.firstRefId].focus();
}
}
}
}
/**
* Set focus on appropriate Slot Section Menu element
* @param {Object} focusPrevProps prevProps for componentDidUpdate() from ...SlotSection.jsx
* @param {String} firstRef id of the first ref in ...SlotSection.jsx
* @param {String} lastRef id of the last ref in ...SlotSection.jsx
*
*/
_handleSectionFocus(focusPrevProps, firstRef, lastRef) {
if (this.selectedRefId !== null && this.sectionRefArr[this.selectedRefId]) {
// set focus on the previously selected option for the currently open section menu
this.sectionRefArr[this.selectedRefId].focus();
} else if (this.sectionRefArr[firstRef] && this.sectionRefArr[firstRef] != null) {
// set focus on the first option in the currently open section menu if none have been selected previously
this.sectionRefArr[firstRef].focus();
} else if (this.props.currentMenu == null && focusPrevProps.currentMenu == this.sectionName && this.sectionRefArr['ssHeadRef']) {
// set focus on the section menu header when section menu is closed
this.sectionRefArr['ssHeadRef'].focus();
}
}
/**
* Open a menu
* @param {string} menu Menu name
* @param {SyntheticEvent} event Event
*/
_openMenu(menu, event) {
event.preventDefault();
event.stopPropagation();
if (this.props.currentMenu === menu) {
menu = null;
}
this.context.openMenu(menu);
}
/**
* Mount/Use the specified module in the slot
* @param {Object} slot Slot
* @param {Object} m Selected module
*/
_selectModule(slot, m) {
this.props.ship.use(slot, m, false);
this.props.onChange();
this._close();
}
/** /**
* Slot Drag Handler * Slot Drag Handler
* @param {object} originSlot Origin slot model * @param {object} originSlot Origin slot model
@@ -207,7 +116,6 @@ export default class SlotSection extends TranslatedComponent {
// Copy power info // Copy power info
targetSlot.enabled = originSlot.enabled; targetSlot.enabled = originSlot.enabled;
targetSlot.priority = originSlot.priority; targetSlot.priority = originSlot.priority;
this.props.onChange();
} }
} else { } else {
// Store power info // Store power info
@@ -236,7 +144,6 @@ export default class SlotSection extends TranslatedComponent {
targetSlot.enabled = targetEnabled; targetSlot.enabled = targetEnabled;
targetSlot.priority = targetPriority; targetSlot.priority = targetPriority;
} }
this.props.onChange();
this.props.ship this.props.ship
.updatePowerGenerated() .updatePowerGenerated()
.updatePowerUsed() .updatePowerUsed()
@@ -282,6 +189,17 @@ export default class SlotSection extends TranslatedComponent {
return 'ineligible'; // Cannot be dropped / invalid drop slot return 'ineligible'; // Cannot be dropped / invalid drop slot
} }
_open(newMenu, event) {
event.preventDefault();
event.stopPropagation();
const { currentMenu } = this.props;
if (currentMenu === newMenu) {
this.context.closeMenu();
} else {
this.context.openMenu(newMenu);
}
}
/** /**
* Close current menu * Close current menu
*/ */
@@ -298,14 +216,13 @@ export default class SlotSection extends TranslatedComponent {
render() { render() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let sectionMenuOpened = this.props.currentMenu === this.sectionName; let sectionMenuOpened = this.props.currentMenu === this.sectionName;
let open = this._openMenu.bind(this, this.sectionName);
let ctx = wrapCtxMenu(this._contextMenu);
return ( return (
<div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}> <div className="group" onDragLeave={this._dragOverNone}>
<div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}> <div className={cn('section-menu', { selected: sectionMenuOpened })}
<h1 tabIndex="0" onKeyDown={this._keyDown} ref={ssHead => this.sectionRefArr['ssHeadRef'] = ssHead}>{translate(this.sectionName)} <Equalizer/></h1> onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}>
{sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null } <h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1>
{sectionMenuOpened && this._getSectionMenu()}
</div> </div>
{this._getSlots()} {this._getSlots()}
</div> </div>

View File

@@ -1,162 +0,0 @@
import React from 'react';
import PropTypes from 'prop-types';
import cn from 'classnames';
import Persist from '../stores/Persist';
import TranslatedComponent from './TranslatedComponent';
import { diffDetails } from '../utils/SlotFunctions';
import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Standard Slot
*/
export default class StandardSlot extends TranslatedComponent {
static propTypes = {
slot: PropTypes.object,
modules: PropTypes.array.isRequired,
onSelect: PropTypes.func.isRequired,
onOpen: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired,
ship: PropTypes.object.isRequired,
selected: PropTypes.bool,
warning: PropTypes.func,
};
/**
* Construct the slot
* @param {object} props Object properties
*/
constructor(props) {
super(props);
this._modificationsSelected = false;
this._keyDown = this._keyDown.bind(this);
this.modButton = null;
this.slotDiv = null;
}
/**
* Handle Enter key
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/**
* Render the slot
* @return {React.Component} Slot component
*/
render() {
let { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language;
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
let m = slot.m;
let classRating = m.class + m.rating;
let menu;
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
if (m && m.name && m.name === 'Guardian Hybrid Power Plant') {
validMods = [];
}
if (m && m.name && m.name === 'Guardian Power Distributor') {
validMods = [];
}
let showModuleResistances = Persist.showModuleResistances();
let mass = m.getMass() || m.cargo || m.fuel || 0;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
if (!selected) {
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
const modificationsMarker = JSON.stringify(m);
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className='standard'
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className='standard'
modules={modules}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
return (
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onKeyDown={this._keyDown} onContextMenu={stopCtxPropagation} tabIndex="0" ref={ slotDiv => this.slotDiv = slotDiv }>
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
<div>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
<div className={'r'}>{formats.round(mass)}{units.T}</div>
<div/>
<div className={'cb'}>
{ m.getMinMass() ? <div className='l'>{translate('minimum mass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
{ m.getOptMass() ? <div className='l'>{translate('optimal mass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
{ m.getMaxMass() ? <div className='l'>{translate('max mass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
{ m.getOptMul() ? <div className='l'>{translate('optimal multiplier')}: {formats.rPct(m.getOptMul())}</div> : null }
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>
</div>
{menu}
</div>
);
}
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
}

View File

@@ -1,132 +1,67 @@
import React from 'react'; import React from 'react';
import cn from 'classnames';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import StandardSlot from './StandardSlot'; import Slot from './Slot';
import Module from '../shipyard/Module'; import autoBind from 'auto-bind';
import * as ShipRoles from '../shipyard/ShipRoles'; import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { ShipProps, Module } from 'ed-forge';
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
/** /**
* Standard Slot section * Standard Slot section
*/ */
export default class StandardSlotSection extends SlotSection { export default class StandardSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'standard', 'core internal'); super(props, 'core internal');
this._optimizeStandard = this._optimizeStandard.bind(this); autoBind(this);
this._selectBulkhead = this._selectBulkhead.bind(this);
this.selectedRefId = null;
this.firstRefId = 'maxjump';
this.lastRefId = 'racer';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Use the lightest/optimal available standard modules * Resets all modules of the ship
*/ */
_optimizeStandard() { _emptyAll() {
this.selectedRefId = 'maxjump'; this.props.ship.getModules().forEach((slot) => slot.reset());
this.props.ship.useLightestStandard();
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
/** /**
* Fill all standard slots with the specificed rating (using max class) * Sets all modules to a specific rating
* @param {Boolean} shielded True if shield generator should be included * @param {string} rating Module rating to set
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames * @param {string} fsdPPException Custom rating for FSD
*/ */
_multiPurpose(shielded, bulkheadIndex) { _nRated(rating, fsdPPException) {
this.selectedRefId = 'multipurpose'; const { ship } = this.props;
if (bulkheadIndex === 2) this.selectedRefId = 'combat'; const pp = ship.getPowerPlant();
ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex); pp.setItem('powerplant', pp.getSize(), fsdPPException || rating);
this.props.onChange(); const eng = ship.getThrusters();
this.props.onCargoChange(this.props.ship.cargoCapacity); eng.setItem('thrusters', eng.getSize(), rating);
this.props.onFuelChange(this.props.ship.fuelCapacity); const fsd = ship.getFSD();
fsd.setItem('fsd', fsd.getSize(), fsdPPException || rating);
const ls = ship.getLifeSupport();
ls.setItem('lifesupport', ls.getSize(), rating);
const pd = ship.getPowerDistributor();
pd.setItem('powerdistributor', pd.getSize(), rating);
const sen = ship.getSensors();
sen.setItem('sensors', sen.getSize(), rating);
this._close(); this._close();
} }
/** /**
* Trader Build * Creates a new slot for a given module.
* @param {Boolean} shielded True if shield generator should be included * @param {Module} m Module to create the slot for
* @param {function} warning Warning callback
* @return {React.Component} Slot component
*/ */
_optimizeCargo(shielded) { _mkSlot(m, warning) {
this.selectedRefId = 'trader'; const { currentMenu, propsToShow, onPropToggle } = this.props;
ShipRoles.trader(this.props.ship, shielded); return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true}
this.props.onChange(); currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle}
this.props.onCargoChange(this.props.ship.cargoCapacity); />;
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Miner Build
* @param {Boolean} shielded True if shield generator should be included
*/
_optimizeMiner(shielded) {
this.selectedRefId = 'miner';
ShipRoles.miner(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Explorer role
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
*/
_optimizeExplorer(planetary) {
this.selectedRefId = 'explorer';
if (planetary) this.selectedRefId = 'planetary';
ShipRoles.explorer(this.props.ship, planetary);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Racer role
*/
_optimizeRacer() {
this.selectedRefId = 'racer';
ShipRoles.racer(this.props.ship);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Use the specified bulkhead
* @param {Object} bulkhead Bulkhead module details
*/
_selectBulkhead(bulkhead) {
this.props.ship.useBulkhead(bulkhead.index);
this.context.tooltip();
this.props.onChange();
this._close();
}
/**
* On right click optimize the standard modules
*/
_contextMenu() {
this._optimizeStandard();
} }
/** /**
@@ -134,108 +69,30 @@ export default class StandardSlotSection extends SlotSection {
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu, cargo, fuel } = this.props; const { ship } = this.props;
let slots = new Array(8); const fsd = ship.getFSD();
let open = this._openMenu; return [
let select = this._selectModule; this._mkSlot(ship.getAlloys()),
let st = ship.standard; this._mkSlot(
let avail = ship.getAvailableModules().standard; ship.getPowerPlant(),
let bh = ship.bulkheads; (m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR),
),
slots[0] = <StandardSlot this._mkSlot(
key='bh' ship.getThrusters(),
slot={bh} (m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS),
modules={ship.getAvailableModules().bulkheads} ),
onOpen={open.bind(this, bh)} this._mkSlot(fsd),
onSelect={this._selectBulkhead} this._mkSlot(
selected={currentMenu == bh} ship.getPowerDistributor(),
onChange={this.props.onChange} (m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'),
ship={ship} ),
/>; this._mkSlot(ship.getLifeSupport()),
this._mkSlot(ship.getSensors()),
slots[1] = <StandardSlot this._mkSlot(
key='pp' ship.getCoreFuelTank(),
slot={st[0]} (m) => moduleGet(m, 'fuel') < fsd.get('maxfuel')
modules={avail[0]} ),
onOpen={open.bind(this, st[0])} ];
onSelect={select.bind(this, st[0])}
selected={currentMenu == st[0]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
/>;
slots[2] = <StandardSlot
key='th'
slot={st[1]}
modules={avail[1]}
onOpen={open.bind(this, st[1])}
onSelect={select.bind(this, st[1])}
selected={currentMenu == st[1]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
/>;
slots[3] = <StandardSlot
key='fsd'
slot={st[2]}
modules={avail[2]}
onOpen={open.bind(this, st[2])}
onSelect={select.bind(this, st[2])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[2]}
/>;
slots[4] = <StandardSlot
key='ls'
slot={st[3]}
modules={avail[3]}
onOpen={open.bind(this, st[3])}
onSelect={select.bind(this, st[3])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[3]}
/>;
slots[5] = <StandardSlot
key='pd'
slot={st[4]}
modules={avail[4]}
onOpen={open.bind(this, st[4])}
onSelect={select.bind(this, st[4])}
selected={currentMenu == st[4]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getEnginesCapacity() <= ship.boostEnergy : m.engcap <= ship.boostEnergy}
/>;
slots[6] = <StandardSlot
key='ss'
slot={st[5]}
modules={avail[5]}
onOpen={open.bind(this, st[5])}
onSelect={select.bind(this, st[5])}
selected={currentMenu == st[5]}
onChange={this.props.onChange}
ship={ship}
/>;
slots[7] = <StandardSlot
key='ft'
slot={st[6]}
modules={avail[6]}
onOpen={open.bind(this, st[6])}
onSelect={select.bind(this, st[6])}
selected={currentMenu == st[6]}
onChange={this.props.onChange}
ship={ship}
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
/>;
return slots;
} }
/** /**
@@ -243,23 +100,18 @@ export default class StandardSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
let planetaryDisabled = this.props.ship.internal.length < 4; const { translate } = this.context.language;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._optimizeStandard} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['maxjump'] = smRef}>{translate('Maximize Jump Range')}</li> <li className='lc' tabIndex="0" onClick={this._emptyAll}>{translate('empty all slots')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('roles')}</div> <div className='select-group cap'>{translate('core')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['multipurpose'] = smRef}>{translate('Multi-purpose')}</li> <li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '5', undefined)}>{translate('A-rated')}</li>
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['combat'] = smRef}>{translate('Combat')}</li> <li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', undefined)}>{translate('D-rated')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['trader'] = smRef}>{translate('Trader')}</li> <li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', '5')}>{translate('D-rated + A-rated FSD/PP')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['explorer'] = smRef}>{translate('Explorer')}</li>
<li className={cn('lc', { disabled: planetaryDisabled })} tabIndex={planetaryDisabled ? '' : '0'} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['planetary'] = smRef}>{translate('Planetary Explorer')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['miner'] = smRef}>{translate('Miner')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['racer'] = smRef}>{translate('Racer')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -247,8 +247,7 @@ export class OrbisIcon extends SvgIcon {
<path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/> <path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/>
<path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" /> <path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" />
<rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" /> <rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" />
</g> </g>);
);
} }
} }
@@ -263,7 +262,7 @@ export class MatIcon extends SvgIcon {
*/ */
svg() { svg() {
return<g xmlns="http://www.w3.org/2000/svg"> return<g xmlns="http://www.w3.org/2000/svg">
<path fill="#FF7100" d="M 24.86,4.18 <path d="M 24.86,4.18
C 24.86,4.18 17.17,7.82 17.17,7.82 C 24.86,4.18 17.17,7.82 17.17,7.82
17.17,7.82 15.35,14.55 15.35,14.55 17.17,7.82 15.35,14.55 15.35,14.55
15.35,14.55 24.70,9.75 24.70,9.75 15.35,14.55 24.70,9.75 24.70,9.75
@@ -742,9 +741,9 @@ export class Modified extends SvgIcon {
*/ */
svg() { svg() {
return <g> return <g>
<path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/> <path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/>
<path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/> <path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/>
</g>; </g>;
} }
} }

View File

@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
* Document Root Tooltip * Document Root Tooltip
*/ */
export default class Tooltip extends TranslatedComponent { export default class Tooltip extends TranslatedComponent {
static propTypes = { static propTypes = {
rect: PropTypes.object.isRequired, rect: PropTypes.object.isRequired,
options: PropTypes.object options: PropTypes.object
@@ -127,5 +126,4 @@ export default class Tooltip extends TranslatedComponent {
</div> </div>
</div>; </div>;
} }
} }

View File

@@ -6,7 +6,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract Translated Component * Abstract Translated Component
*/ */
export default class TranslatedComponent extends React.Component { export default class TranslatedComponent extends React.Component {
static contextTypes = { static contextTypes = {
language: PropTypes.object.isRequired, language: PropTypes.object.isRequired,
sizeRatio: PropTypes.number.isRequired, sizeRatio: PropTypes.number.isRequired,

View File

@@ -1,7 +1,8 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import HardpointSlot from './HardpointSlot'; import Slot from './Slot';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Utility Slot Section * Utility Slot Section
@@ -10,87 +11,58 @@ export default class UtilitySlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props) {
super(props, context, 'utility', 'utility mounts'); super(props, 'utility mounts');
this._empty = this._empty.bind(this); autoBind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'po';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all utility slots and close the menu * Empty all utility slots and close the menu
*/ */
_empty() { _empty() {
this.selectedRefId = this.firstRefId; this.props.ship.getUtilities().forEach((slot) => slot.reset());
this.props.ship.emptyUtility();
this.props.onChange();
this._close(); this._close();
} }
/** /**
* Mount module in utility slot, replace all if Alt is held * Mount module in utility slot, replace all if Alt is held
* @param {string} group Module Group name * @param {string} type Module type
* @param {string} rating Module Rating * @param {string} rating Module Rating
* @param {string} name Module name
* @param {Synthetic} event Event * @param {Synthetic} event Event
*/ */
_use(group, rating, name, event) { _use(type, rating, event) {
this.selectedRefId = group; const fillAll = event.getModifierState('Alt');
if (rating !== null) this.selectedRefId += '-' + rating; for (const slot of this.props.ship.getUtilities(undefined, true)) {
if (slot.isEmpty() || fillAll) {
this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt')); slot.setItem(type, '', rating);
this.props.onChange(); }
}
this._close(); this._close();
} }
/**
* Empty all utility slots on right-click
*/
_contextMenu() {
this._empty();
}
/** /**
* Create all HardpointSlots (React component) for the slots * Create all HardpointSlots (React component) for the slots
* @return {Array} Array of HardpointSlots * @return {Array} Array of HardpointSlots
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { ship, currentMenu } = this.props; let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
let hardpoints = ship.hardpoints;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let availableModules = ship.getAvailableModules();
for (let i = 0, l = hardpoints.length; i < l; i++) { for (let h of ship.getUtilities(undefined, true)) {
let h = hardpoints[i]; slots.push(<Slot
if (h.maxClass === 0) { key={h.object.Slot}
slots.push(<HardpointSlot currentMenu={currentMenu}
key={i} drag={this._drag.bind(this, h)}
maxClass={h.maxClass} dragOver={this._dragOverSlot.bind(this, h)}
availableModules={() => availableModules.getHps(h.maxClass)} drop={this._drop}
onOpen={this._openMenu.bind(this,h)} dropClass={this._dropClass(h, originSlot, targetSlot)}
onSelect={this._selectModule.bind(this, h)} m={h}
onChange={this.props.onChange} enabled={h.enabled ? true : false}
selected={currentMenu == h} propsToShow={propsToShow}
drag={this._drag.bind(this, h)} onPropToggle={onPropToggle}
dragOver={this._dragOverSlot.bind(this, h)} />);
drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -101,33 +73,34 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu(translate) { _getSectionMenu() {
const { translate } = this.context.language;
let _use = this._use; let _use = this._use;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('sb')}</div> <div className='select-group cap'>{translate('sb')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-A'] = smRef}>A</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '5')}>A</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-B'] = smRef}>B</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '4')}>B</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-C'] = smRef}>C</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '3')}>C</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-D'] = smRef}>D</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '2')}>D</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-E'] = smRef}>E</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '1')}>E</li>
</ul> </ul>
<div className='select-group cap'>{translate('hs')}</div> <div className='select-group cap'>{translate('hs')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hs'] = smRef}>{translate('Heat Sink Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'heatsinklauncher', '')}>{translate('Heat Sink Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('ch')}</div> <div className='select-group cap'>{translate('ch')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ch'] = smRef}>{translate('Chaff Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'chafflauncher', '')}>{translate('Chaff Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('po')}</div> <div className='select-group cap'>{translate('po')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['po'] = smRef}>{translate('Point Defence')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'pointdefence', '')}>{translate('Point Defence')}</li>
</ul> </ul>
</div>; </div>;
} }

View File

@@ -2,194 +2,99 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import * as Calc from '../shipyard/Calculations'; import { moduleReduce } from 'ed-forge/lib/src/helper';
import { chain, keys, mapValues, values } from 'lodash';
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777']; const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
const PORTION_MAPPINGS = {
'absolute': 'absolutedamageportion',
'explosive': 'explosivedamageportion',
'kinetic': 'kineticdamageportion',
'thermal': 'thermicdamageportion',
};
const MULTS = keys(PORTION_MAPPINGS);
// TODO: help with this in ed-forge
/**
* .
* @param {Object} opponentDefence .
* @returns {Object} .
*/
function defenceToMults(opponentDefence) {
return chain(opponentDefence)
.pick(MULTS)
.mapKeys((v, k) => PORTION_MAPPINGS[k])
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
.value();
}
/** /**
* Weapon damage chart * Weapon damage chart
*/ */
export default class WeaponDamageChart extends TranslatedComponent { export default class WeaponDamageChart extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponentDefence: PropTypes.object.isRequired,
hull: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
}
/**
* Set the initial weapons state
*/
componentWillMount() {
const weaponNames = this._weaponNames(this.props.ship, this.context);
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
const opponentArmour = Calc.armourMetrics(this.props.opponent);
const maxRange = this._calcMaxRange(this.props.ship);
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
}
/**
* Set the updated weapons state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
const maxRange = this._calcMaxRange(nextProps.ship);
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
this.setState({ weaponNames,
opponentShields,
opponentArmour,
maxRange,
maxDps,
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
});
}
return true;
}
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000; // Minimum
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/**
* Calculate the maximum sustained single-weapon DPS for this ship
* @param {Object} ship The ship
* @param {Object} opponent The opponent ship
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @return {number} The maximum sustained single-weapon DPS
*/
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
// Additional information to allow effectiveness calculations
let maxSDps = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
if (thisSDps > maxSDps) {
maxSDps = thisSDps;
}
}
}
return maxSDps;
}
/**
* Obtain the weapon names for this ship
* @param {Object} ship The ship
* @param {Object} context The context
* @return {array} The weapon names
*/
_weaponNames(ship, context) {
const translate = context.language.translate;
let names = [];
let num = 1;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
let engineering;
if (m.blueprint && m.blueprint.name) {
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id) {
engineering += ', ' + translate(m.blueprint.special.name);
}
}
if (engineering) {
name = name + ' (' + engineering + ')';
}
names.push(name);
}
}
return names;
}
/**
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
* @param {Object} ship The ship
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
* @param {Object} opponent The target
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
* @param {Object} engagementRange The engagement range
* @return {array} The array of weapon DPS
*/
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
let results = {};
let weaponNum = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
}
}
return results;
}
/** /**
* Render damage dealt * Render damage dealt
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context; const { language } = this.context;
const { formats, translate, units } = language; const { translate } = language;
const { maxRange } = this.state; const { code, ship, opponentDefence, engagementRange } = this.props;
const { ship, opponent, engagementRange } = this.props;
const sortOrder = this._sortOrder; const hardpoints = ship.getHardpoints();
const onCollapseExpand = this._onCollapseExpand; const hardpointsMap = chain(hardpoints)
.map((m) => [m.getSlot(), m])
const code = `${ship.toString()}:${opponent.toString()}`; .fromPairs()
.value();
const mults = defenceToMults(opponentDefence);
const cb = (range) => {
return mapValues(
hardpointsMap,
(m) => {
const sdps = m.get('sustaineddamagepersecond', true);
const resistanceMul = chain(mults)
.toPairs()
.map((pair) => {
const [k, mul] = pair;
return m.get(k, true) * mul;
})
.sum()
.value();
const falloff = m.get('damagefalloffrange', true);
const rangeMul = Math.min(1, Math.max(0,
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
));
return sdps * resistanceMul * rangeMul;
}
);
};
return ( return (
<div> <div>
<LineChart <LineChart
xMax={maxRange} xMin={0}
yMax={this.state.maxDps} xMax={moduleReduce(
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
)}
yMin={0}
// Factor in highest damage multiplier to get a safe upper bound
yMax={Math.max(1, ...values(mults)) * moduleReduce(
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
)}
xLabel={translate('range')} xLabel={translate('range')}
xUnit={translate('m')} xUnit={translate('m')}
yLabel={translate('sdps')} yLabel={translate('sustaineddamagepersecond')}
series={this.state.weaponNames} series={hardpoints.map((m) => m.getSlot())}
xMark={this.props.engagementRange} xMark={engagementRange}
colors={DAMAGE_DEALT_COLORS} colors={DAMAGE_DEALT_COLORS}
func={this.state.calcSDpsFunc} func={cb}
points={200} points={200}
code={code} code={code}
/> />

File diff suppressed because one or more lines are too long

View File

@@ -82,7 +82,7 @@
"TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time", "TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time",
"HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes", "HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes",
"PHRASE_FAIL_EDENGINEER": "Failed to send to EDEngineer (Launch EDEngineer and make sure the API is started then refresh the page.)", "PHRASE_FAIL_EDENGINEER": "Failed to send to EDEngineer (Launch EDEngineer and make sure the API is started then refresh the page.)",
"PHRASE_FIREFOX_EDENGINEER": "Sending to EDEngineer is not compatible with Firefox's security settings. Please try again with Chrome.", "PHRASE_FIREFOX_EDENGINEER": "Send to EDEngineer is incompatible with Firefox.",
"am": "Auto Field-Maintenance Unit", "am": "Auto Field-Maintenance Unit",
"bh": "Bulkheads", "bh": "Bulkheads",
"bl": "Beam Laser", "bl": "Beam Laser",

File diff suppressed because one or more lines are too long

File diff suppressed because it is too large Load Diff

View File

@@ -1,627 +0,0 @@
import React from 'react';
import Page from './Page';
import Router from '../Router';
import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Ship from '../shipyard/Ship';
import { fromComparison, toComparison } from '../shipyard/Serializer';
import Persist from '../stores/Persist';
import { SizeMap, ShipFacets } from '../shipyard/Constants';
import ComparisonTable from '../components/ComparisonTable';
import BarChart from '../components/BarChart';
import ModalCompare from '../components/ModalCompare';
import ModalExport from '../components/ModalExport';
import ModalPermalink from '../components/ModalPermalink';
import ModalImport from '../components/ModalImport';
import {
FloppyDisk,
Bin,
Download,
Embed,
Rocket,
LinkIcon
} from '../components/SvgIcons';
import ShortenUrl from '../utils/ShortenUrl';
import { comparisonBBCode } from '../utils/BBCode';
const browser = require('detect-browser');
/**
* Creates a comparator based on the specified predicate
* @param {string} predicate Predicate / propterty name
* @return {Function} Comparator
*/
function sortBy(predicate) {
return (a, b) => {
if (a[predicate] === b[predicate]) {
if (a.name == b.name) {
a.buildName.toLowerCase() > b.buildName.toLowerCase() ? 1 : -1;
}
return a.name.toLowerCase() > b.name.toLowerCase() ? 1 : -1;
}
if (typeof a[predicate] == 'string') {
return a[predicate].toLowerCase() > b[predicate].toLowerCase() ? 1 : -1;
}
return a[predicate] > b[predicate] ? 1 : -1;
};
}
/**
* Comparison Page
*/
export default class ComparisonPage extends Page {
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props, context);
this._sortShips = this._sortShips.bind(this);
this._buildsSelected = this._buildsSelected.bind(this);
this._updateDiscounts = this._updateDiscounts.bind(this);
this.state = this._initState(context);
}
/**
* [Re]Create initial state from context
* @param {context} context React component context
* @return {Object} New state object
*/
_initState(context) {
let defaultFacets = [13, 12, 11, 9, 6, 4, 1, 3, 2]; // Reverse order of Armour, Shields, Speed, Jump Range, Cargo Capacity, Cost, DPS, EPS, HPS
let params = context.route.params;
let code = params.code;
let name = params.name ? decodeURIComponent(params.name) : null;
let newName = '';
let compareMode = !code;
let builds = [];
let saved = false;
let predicate = 'name';
let desc = false;
let importObj = {};
if (compareMode) {
if (name == 'all') {
let allBuilds = Persist.getBuilds();
newName = name;
for (let shipId in allBuilds) {
for (let buildName in allBuilds[shipId]) {
if (buildName && allBuilds[shipId][buildName]) {
builds.push(
this._createBuild(
shipId,
buildName,
allBuilds[shipId][buildName]
)
);
}
}
}
} else {
let comparisonData = Persist.getComparison(name);
if (comparisonData) {
defaultFacets = comparisonData.facets;
comparisonData.builds.forEach(b =>
builds.push(this._createBuild(b.shipId, b.buildName))
);
saved = true;
newName = name;
}
}
} else {
try {
let comparisonData = toComparison(code);
defaultFacets = comparisonData.f;
newName = name = comparisonData.n;
predicate = comparisonData.p;
desc = comparisonData.d;
comparisonData.b.forEach(build => {
builds.push(this._createBuild(build.s, build.n, build.c));
if (!importObj[build.s]) {
importObj[build.s] = {};
}
importObj[build.s][build.n] = build.c;
});
} catch (e) {
throw { type: 'bad-comparison', message: e.message, details: e };
}
}
let facets = [];
let selectedLength = defaultFacets.length;
let selectedFacets = new Array(selectedLength);
for (let i = 0; i < ShipFacets.length; i++) {
let facet = Object.assign({}, ShipFacets[i]);
let defaultIndex = defaultFacets.indexOf(facet.i);
if (defaultIndex == -1) {
facets.push(facet);
} else {
facet.active = true;
selectedFacets[selectedLength - defaultIndex - 1] = facet;
}
}
facets = selectedFacets.concat(facets);
builds.sort(sortBy(predicate));
return {
title: 'Coriolis EDCD Edition - Compare',
predicate,
desc,
facets,
builds,
compareMode,
code,
name,
newName,
saved,
importObj
};
}
/**
* Create a Ship instance / build
* @param {string} id Ship Id
* @param {name} name Build name
* @param {string} code Optional - Serialized ship code
* @return {Object} Ship instance with build name
*/
_createBuild(id, name, code) {
code = code ? code : Persist.getBuild(id, name); // Retrieve build code if not passed
if (!code) {
// No build found
return;
}
let data = Ships[id]; // Get ship properties
let b = new Ship(id, data.properties, data.slots); // Create a new Ship instance
b.buildFrom(code); // Populate components from code
b.buildName = name;
b.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
return b;
}
/**
* Update state with the specified sort predicates
* @param {String} predicate Sort predicate - property name
*/
_sortShips(predicate) {
let { builds, desc } = this.state;
if (this.state.predicate == predicate) {
desc = !desc;
}
builds.sort(sortBy(predicate));
if (desc) {
builds.reverse();
}
this.setState({ predicate, desc });
}
/**
* Show selected builds modal
*/
_selectBuilds() {
this.context.showModal(
<ModalCompare
onSelect={this._buildsSelected}
builds={this.state.builds}
/>
);
}
/**
* Update selected builds with new list
* @param {Array} newBuilds List of new builds
*/
_buildsSelected(newBuilds) {
this.context.hideModal();
let builds = [];
for (let b of newBuilds) {
builds.push(this._createBuild(b.id, b.buildName));
}
this.setState({ builds, saved: false });
}
/**
* Toggle facet display
* @param {string} facet Facet / Ship Property
*/
_toggleFacet(facet) {
facet.active = !facet.active;
this.setState({ facets: [].concat(this.state.facets), saved: false });
}
/**
* Handle facet drag
* @param {Event} e Drag Event
*/
_facetDrag(e) {
this.nodeAfter = false;
this.dragged = e.currentTarget;
let placeholder = (this.placeholder = document.createElement('li'));
placeholder.style.width = Math.round(this.dragged.offsetWidth) + 'px';
placeholder.className = 'facet-placeholder';
if (!browser || (browser.name !== 'edge' && browser.name !== 'ie')) {
e.dataTransfer.effectAllowed = 'move';
e.dataTransfer.setData('text/html', e.currentTarget);
}
}
/**
* Handle facet drop
* @param {Event} e Drop Event
*/
_facetDrop(e) {
this.dragged.parentNode.removeChild(this.placeholder);
let facets = this.state.facets;
let frm = Number(this.dragged.dataset.i);
let to = Number(this.over.dataset.i);
if (frm < to) {
to--;
}
if (this.nodeAfter) {
to++;
}
facets.splice(to, 0, facets.splice(frm, 1)[0]);
this.dragged.style.display = null;
this.setState({ facets: [].concat(facets), saved: false });
}
/**
* Handle facet drag over
* @param {Event} e Drag over Event
*/
_facetDragOver(e) {
e.preventDefault();
if (e.target.className == 'facet-placeholder') {
return;
} else if (e.target != e.currentTarget) {
this.over = e.target;
this.dragged.style.display = 'none';
let relX = e.clientX - this.over.getBoundingClientRect().left;
let width = this.over.offsetWidth / 2;
let parent = e.target.parentNode;
if (parent == e.currentTarget) {
if (relX > width && this.dragged != e.target) {
this.nodeAfter = true;
parent.insertBefore(this.placeholder, e.target.nextElementSibling);
} else {
this.nodeAfter = false;
parent.insertBefore(this.placeholder, e.target);
}
}
}
}
/**
* Handle name change and update state
* @param {SyntheticEvent} e Event
*/
_onNameChange(e) {
this.setState({ newName: e.target.value, saved: false });
}
/**
* Delete the current comparison
*/
_delete() {
Persist.deleteComparison(this.state.name);
Router.go('/compare');
}
/**
* Import the comparison builds
*/
_import() {
let builds = {};
for (let ship of this.state.builds) {
if (!builds[ship.id]) {
builds[ship.id] = {};
}
builds[ship.id][ship.buildName] = ship.toString();
}
this.context.showModal(<ModalImport builds={builds} />);
}
/**
* Save the current comparison
*/
_save() {
let { newName, builds, facets } = this.state;
let selectedFacets = [];
facets.forEach(f => {
if (f.active) {
selectedFacets.unshift(f.i);
}
});
Persist.saveComparison(newName, builds, selectedFacets);
Router.replace(`/compare/${encodeURIComponent(this.state.newName)}`);
this.setState({ name: newName, saved: true });
}
/**
* Serialize and generate a long URL for the current comparison
* @return {string} URL for serialized comparison
*/
_buildUrl() {
let { facets, builds, name, predicate, desc } = this.state;
let selectedFacets = [];
for (let f of facets) {
if (f.active) {
selectedFacets.unshift(f.i);
}
}
let code = fromComparison(name, builds, selectedFacets, predicate, desc);
let loc = window.location;
return (
loc.protocol +
'//' +
loc.host +
'/comparison?code=' +
encodeURIComponent(code)
);
}
/**
* Generates the long permalink URL
*/
_genPermalink() {
this.context.showModal(<ModalPermalink url={this._buildUrl()} />);
}
/**
* Generate E:D Forum BBCode and show in the export modal
*/
_genBBcode() {
let { translate, formats } = this.context.language;
let { facets, builds } = this.state;
let generator = callback => {
let url = this._buildUrl();
ShortenUrl(
url,
shortenedUrl =>
callback(
comparisonBBCode(translate, formats, facets, builds, shortenedUrl)
),
error =>
callback(comparisonBBCode(translate, formats, facets, builds, url))
);
};
this.context.showModal(
<ModalExport
title={translate('forum') + ' BBCode'}
generator={generator}
/>
);
}
/**
* Update dimenions from rendered DOM
*/
_updateDimensions() {
this.setState({
chartWidth: this.chartRef.offsetWidth
});
}
/**
* Update all ship costs on disount change
*/
_updateDiscounts() {
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
let builds = [];
for (let b of this.state.builds) {
builds.push(b.applyDiscounts(shipDiscount, moduleDiscount));
}
this.setState({ builds });
}
/**
* Update state based on context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
*/
componentWillReceiveProps(nextProps, nextContext) {
if (this.context.route !== nextContext.route) {
// Only reinit state if the route has changed
this.setState(this._initState(nextContext));
}
}
/**
* Add listeners when about to mount
*/
componentWillMount() {
this.resizeListener = this.context.onWindowResize(this._updateDimensions);
this.persistListener = Persist.addListener(
'discounts',
this._updateDiscounts
);
}
/**
* Trigger DOM updates on mount
*/
componentDidMount() {
this._updateDimensions();
}
/**
* Remove listeners on unmount
*/
componentWillUnmount() {
this.resizeListener.remove();
this.persistListener.remove();
}
/**
* Render the Page
* @return {React.Component} The page contents
*/
renderPage() {
let translate = this.context.language.translate;
let compareHeader;
let {
newName,
name,
saved,
builds,
facets,
predicate,
desc,
chartWidth
} = this.state;
if (this.state.compareMode) {
compareHeader = (
<tr>
<td className="head">{translate('comparison')}</td>
<td>
<input
value={newName}
onChange={this._onNameChange}
placeholder={translate('Enter Name')}
maxLength="50"
/>
<button
onClick={this._save}
disabled={!newName || newName == 'all' || saved}
>
<FloppyDisk className="lg" />
<span className="button-lbl">{translate('save')}</span>
</button>
<button onClick={this._delete} disabled={name == 'all' || !saved}>
<Bin className="lg warning" />
</button>
<button onClick={this._selectBuilds}>
<Rocket className="lg" />
<span className="button-lbl">{translate('builds')}</span>
</button>
<button
className="r"
onClick={this._genPermalink}
disabled={builds.length == 0}
>
<LinkIcon className="lg" />
<span className="button-lbl">{translate('permalink')}</span>
</button>
<button
className="r"
onClick={this._genBBcode}
disabled={builds.length == 0}
>
<Embed className="lg" />
<span className="button-lbl">{translate('forum')}</span>
</button>
</td>
</tr>
);
} else {
compareHeader = (
<tr>
<td className="head">{translate('comparison')}</td>
<td>
<h3>{name}</h3>
<button className="r" onClick={this._import}>
<Download className="lg" />
{translate('import')}
</button>
</td>
</tr>
);
}
return (
<div
className={'page'}
style={{ fontSize: this.context.sizeRatio + 'em' }}
>
<table id="comparison">
<tbody>
{compareHeader}
<tr key="facets">
<td className="head">{translate('compare')}</td>
<td>
<ul id="facet-container" onDragOver={this._facetDragOver}>
{facets.map((f, i) => (
<li
key={f.title}
data-i={i}
draggable="true"
onDragStart={this._facetDrag}
onDragEnd={this._facetDrop}
className={cn('facet', { active: f.active })}
onClick={this._toggleFacet.bind(this, f)}
>
{'↔ ' + translate(f.title)}
</li>
))}
</ul>
</td>
</tr>
</tbody>
</table>
<ComparisonTable
builds={builds}
facets={facets}
onSort={this._sortShips}
predicate={predicate}
desc={desc}
/>
{!builds.length ? (
<div className="chart" ref={node => (this.chartRef = node)}>
{translate('PHRASE_NO_BUILDS')}
</div>
) : (
facets.filter(f => f.active).map((f, i) => (
<div
key={f.title}
className="chart"
ref={i == 0 ? node => (this.chartRef = node) : null}
>
<h3
className="ptr"
onClick={this._sortShips.bind(this, f.props[0])}
>
{translate(f.title)}
</h3>
<BarChart
width={chartWidth}
data={builds}
properties={f.props}
labels={f.lbls}
unit={translate(f.unit)}
format={f.fmt}
title={translate(f.title)}
predicate={predicate}
desc={desc}
/>
</div>
))
)}
</div>
);
}
}

View File

@@ -5,7 +5,6 @@ import PropTypes from 'prop-types';
* Unexpected Error page / block * Unexpected Error page / block
*/ */
export default class ErrorDetails extends React.Component { export default class ErrorDetails extends React.Component {
static contextTypes = { static contextTypes = {
route: PropTypes.object.isRequired, route: PropTypes.object.isRequired,
language: PropTypes.object.isRequired language: PropTypes.object.isRequired
@@ -46,7 +45,7 @@ export default class ErrorDetails extends React.Component {
<h1>Jameson, we have a problem..</h1> <h1>Jameson, we have a problem..</h1>
<h1><small>{error.message}</small></h1> <h1><small>{error.message}</small></h1>
<br/> <br/>
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null } {importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
<br/> <br/>
<div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div> <div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div>
<br/> <br/>

File diff suppressed because it is too large Load Diff

View File

@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract/Base Page * Abstract/Base Page
*/ */
export default class Page extends React.Component { export default class Page extends React.Component {
static contextTypes = { static contextTypes = {
closeMenu: PropTypes.func.isRequired, closeMenu: PropTypes.func.isRequired,
hideModal: PropTypes.func.isRequired, hideModal: PropTypes.func.isRequired,
@@ -92,5 +91,4 @@ export default class Page extends React.Component {
} }
return this.renderPage(); return this.renderPage();
} }
} }

View File

@@ -1,102 +1,81 @@
import React from 'react'; import React from 'react';
import Page from './Page'; import Page from './Page';
import { Ships } from 'coriolis-data/dist';
import cn from 'classnames'; import cn from 'classnames';
import Ship from '../shipyard/Ship'; import { Factory } from 'ed-forge';
import * as ModuleUtils from '../shipyard/ModuleUtils'; import { JUMP_METRICS } from 'ed-forge/lib/src/ship-stats';
import { SizeMap } from '../shipyard/Constants'; import { SizeMap } from '../shipyard/Constants';
import Link from '../components/Link'; import Link from '../components/Link';
/**
* Counts the hardpoints by class/size
* @param {Object} slot Hardpoint Slot model
*/
function countHp(slot) {
this.hp[slot.maxClass]++;
this.hpCount++;
}
/**
* Counts the internal slots and aggregated properties
* @param {Object} slot Internal Slots
*/
function countInt(slot) {
let crEligible = !slot.eligible || slot.eligible.cr;
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
this.intCount++;
this.maxCargo += crEligible ?
ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo :
0;
// if no eligiblity, then assume pce
let passSlotType = null;
let passSlotRating = null;
if (!slot.eligible || slot.eligible.pce) {
passSlotType = 'pce';
passSlotRating = 'E';
} else if (slot.eligible.pci) {
passSlotType = 'pci';
passSlotRating = 'D';
} else if (slot.eligible.pcm) {
passSlotType = 'pcm';
passSlotRating = 'C';
} else if (slot.eligible.pcq) {
passSlotType = 'pcq';
passSlotRating = 'B';
}
let passengerBay = passSlotType ?
ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) :
null;
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
}
/** /**
* Generate Ship summary and aggregated properties * Generate Ship summary and aggregated properties
* @param {String} shipId Ship Id * @param {String} shipId Ship Id
* @param {Object} shipData Ship Default Data
* @return {Object} Ship summary and aggregated properties * @return {Object} Ship summary and aggregated properties
*/ */
function shipSummary(shipId, shipData) { function shipSummary(shipId) {
// Build Ship
let ship = Factory.newShip(shipId);
let coreSizes = ship.readMeta('coreSizes');
let { jumpRangeLaden, totalRange } = ship.getMetrics(JUMP_METRICS);
let summary = { let summary = {
agility: ship.readProp('pitch') + ship.readProp('yaw') + ship.readProp('roll'),
baseArmour: ship.readProp('basearmour'),
baseShieldStrength: ship.readProp('baseshieldstrength'),
boost: ship.readProp('boost'),
class: ship.readMeta('class'),
crew: ship.readMeta('crew'),
id: shipId, id: shipId,
hardness: ship.readProp('hardness'),
hpCount: 0, hpCount: 0,
hullMass: ship.readProp('hullmass'),
intCount: 0, intCount: 0,
beta: shipData.beta, masslock: ship.readProp('masslock'),
maxCargo: 0,
maxPassengers: 0,
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8 int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
standard: shipData.slots.standard, jumpRangeLaden,
agility: pitch: ship.readProp('pitch'),
shipData.properties.pitch + retailCost: ship.readMeta('retailCost'),
shipData.properties.yaw + roll: ship.readProp('roll'),
shipData.properties.roll speed: ship.readProp('speed'),
standard: [
'powerplant',
'mainengines',
'frameshiftdrive',
'lifesupport',
'powerdistributor',
'radar',
'fueltank'
].map(k => coreSizes[k]),
totalRange,
yaw: ship.readProp('yaw'),
}; };
Object.assign(summary, shipData.properties);
let ship = new Ship(shipId, shipData.properties, shipData.slots);
// Build Ship // Count Hardpoints by class
ship.buildWith(shipData.defaults); // Populate with stock/default components ship.getHardpoints(undefined, true).forEach(hardpoint => {
ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class summary.hp[hardpoint.getSizeNum()]++;
ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class summary.hpCount++;
summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost });
ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range // Count Internal Compartments by class
summary.maxJumpRange = ship.unladenRange; // Record Jump Range let maxCargo = 0, maxPassengers = 0;
ship.getInternals(undefined, true).forEach(internal => {
const size = String(internal.getSizeNum());
summary.int[size]++;
summary.intCount++;
// Best thrusters // Try cargo racks
let th; try {
if (ship.standard[1].maxClass === 3) { internal.setItem('cargorack', size);
th = 'tz'; maxCargo += internal.get('cargo');
} else if (ship.standard[1].maxClass === 2) { } catch {}
th = 'u0'; // Try economy cabins
} else { try {
th = ship.standard[1].maxClass + 'A'; internal.setItem('passengercabins', size < '6' ? size : '6', '1');
} maxPassengers += internal.get('cabincapacity');
} catch {}
});
ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters summary.maxCargo = maxCargo;
summary.topSpeed = ship.topSpeed; summary.maxPassengers = maxPassengers;
summary.topBoost = ship.topBoost;
summary.baseArmour = ship.armour;
return summary; return summary;
} }
@@ -117,14 +96,14 @@ export default class ShipyardPage extends Page {
if (!ShipyardPage.cachedShipSummaries) { if (!ShipyardPage.cachedShipSummaries) {
ShipyardPage.cachedShipSummaries = []; ShipyardPage.cachedShipSummaries = [];
for (let s in Ships) { for (let s of Factory.getAllShipTypes()) {
ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s])); ShipyardPage.cachedShipSummaries.push(shipSummary(s));
} }
} }
this.state = { this.state = {
title: 'Coriolis EDCD Edition - Shipyard', title: 'Coriolis EDCD Edition - Shipyard',
shipPredicate: 'name', shipPredicate: 'id',
shipDesc: true, shipDesc: true,
shipSummaries: ShipyardPage.cachedShipSummaries, shipSummaries: ShipyardPage.cachedShipSummaries,
compare: {}, compare: {},
@@ -157,7 +136,7 @@ export default class ShipyardPage extends Page {
* @private * @private
*/ */
_toggleGroupCompared() { _toggleGroupCompared() {
this.setState({groupCompared: !this.state.groupCompared}) this.setState({ groupCompared: !this.state.groupCompared });
} }
/** /**
@@ -209,16 +188,18 @@ export default class ShipyardPage extends Page {
<td className="ri cap">{translate(SizeMap[s.class])}</td> <td className="ri cap">{translate(SizeMap[s.class])}</td>
<td className="ri">{fInt(s.crew)}</td> <td className="ri">{fInt(s.crew)}</td>
<td className="ri">{s.masslock}</td> <td className="ri">{s.masslock}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.hullMass)}</td> <td className="ri">{fInt(s.hullMass)}</td>
<td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.speed)}</td> <td className="ri">{fInt(s.speed)}</td>
<td className="ri">{fInt(s.boost)}</td> <td className="ri">{fInt(s.boost)}</td>
<td className="ri">{fInt(s.pitch)}</td>
<td className="ri">{fInt(s.yaw)}</td>
<td className="ri">{fInt(s.roll)}</td>
<td className="ri">{fRound(s.jumpRangeLaden)}</td>
<td className="ri">{fRound(s.totalRange)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.baseArmour)}</td> <td className="ri">{fInt(s.baseArmour)}</td>
<td className="ri">{fInt(s.baseShieldStrength)}</td> <td className="ri">{fInt(s.baseShieldStrength)}</td>
<td className="ri">{fInt(s.topSpeed)}</td>
<td className="ri">{fInt(s.topBoost)}</td>
<td className="ri">{fRound(s.maxJumpRange)}</td>
<td className="ri">{fInt(s.maxCargo)}</td> <td className="ri">{fInt(s.maxCargo)}</td>
<td className="ri">{fInt(s.maxPassengers)}</td> <td className="ri">{fInt(s.maxPassengers)}</td>
<td className="cn">{s.standard[0]}</td> <td className="cn">{s.standard[0]}</td>
@@ -254,7 +235,6 @@ export default class ShipyardPage extends Page {
let { translate, formats, units } = language; let { translate, formats, units } = language;
let hide = this.context.tooltip.bind(null, null); let hide = this.context.tooltip.bind(null, null);
let fInt = formats.int; let fInt = formats.int;
let fRound = formats.round;
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state; let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
let sortShips = (predicate, index) => let sortShips = (predicate, index) =>
this._sortShips.bind(this, predicate, index); this._sortShips.bind(this, predicate, index);
@@ -298,7 +278,7 @@ export default class ShipyardPage extends Page {
} }
if (valA == valB) { if (valA == valB) {
if (a.name > b.name) { if (a.id > b.id) {
return 1; return 1;
} else { } else {
return -1; return -1;
@@ -334,7 +314,7 @@ export default class ShipyardPage extends Page {
onClick={() => this._toggleCompare(s.id)} onClick={() => this._toggleCompare(s.id)}
> >
<td className="le"> <td className="le">
<Link href={'/outfit/' + s.id}>{s.name} {s.beta === true ? '(Beta)' : null}</Link> <Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link>
</td> </td>
</tr> </tr>
); );
@@ -342,281 +322,249 @@ export default class ShipyardPage extends Page {
} }
return ( return (
<div className="page" style={{fontSize: sizeRatio + 'em'}}> <div className="page" style={{ fontSize: sizeRatio + 'em' }}>
<div className="content-wrapper"> <div className="content-wrapper">
<div className="shipyard-table-wrapper"> <div className="shipyard-table-wrapper">
<table style={{width: '12em', position: 'absolute', zIndex: 1}} className="shipyard-table"> <table style={{ width: '12em', position: 'absolute', zIndex: 1 }} className="shipyard-table">
<thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main">
<th className="sortable le rgt" onClick={sortShips('name')}>
{translate('ship')}
</th>
</tr>
<tr>
<th className="le rgt invisible">{units['m/s']}</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{shipRows}
</tbody>
</table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead> <thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main"> <tr className="main">
<th>&nbsp;</th> <th className="sortable le rgt" onClick={sortShips('id')}>
<th {translate('ship')}
rowSpan={3}
className="sortable"
onClick={sortShips('class')}
>
{translate('size')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('crew')}
>
{translate('crew')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide}
onClick={sortShips('masslock')}
>
{translate('MLF')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('agility')}
>
{translate('agility')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide}
onClick={sortShips('hardness')}
>
{translate('hrd')}
</th>
<th>&nbsp;</th>
<th colSpan={4}>{translate('base')}</th>
<th colSpan={5}>{translate('max')}</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')}
onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th
colSpan={5}
className="sortable lft"
onClick={sortShips('hpCount')}
>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th> </th>
</tr> </tr>
<tr> <tr>
<th <th className="le rgt invisible">{units['m/s']}</th>
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{units.T}
</th>
<th>&nbsp;</th>
<th
className="sortable lft"
onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide}
onClick={sortShips('standard', 0)}
>
{'pp'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide}
onClick={sortShips('standard', 1)}
>
{'th'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide}
onClick={sortShips('standard', 2)}
>
{'fsd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide}
onClick={sortShips('standard', 3)}
>
{'ls'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'power distriubtor')}
onMouseLeave={hide}
onClick={sortShips('standard', 4)}
>
{'pd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide}
onClick={sortShips('standard', 5)}
>
{'s'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide}
onClick={sortShips('standard', 6)}
>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr> </tr>
</thead> </thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}> <tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{detailRows} {shipRows}
</tbody> </tbody>
</table> </table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead>
<tr className="main">
{/* First all headers that spread out over three rows */}
{/* cost placeholder */}
<th>&nbsp;</th>
<th rowSpan={3} className="sortable" onClick={sortShips('class')}>
{translate('size')}
</th>
<th rowSpan={3} className="sortable" onClick={sortShips('crew')}>
{translate('crew')}
</th>
<th rowSpan={3} className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide} onClick={sortShips('masslock')}>
{translate('MLF')}
</th>
{/* hull mass placeholder */}
<th>&nbsp;</th>
<th colSpan={6}>{translate('agility')}</th>
<th colSpan={2}>{translate('travel')}</th>
<th colSpan={3}>{translate('defence')}</th>
{/* cargo placeholder */}
<th>&nbsp;</th>
{/* pax placeholder */}
<th>&nbsp;</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
{/* Now all headers in a second-row */}
<th className="sortable lft" onClick={sortShips('retailCost')}>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('agility')}>
{translate('rating')}
</th>
<th className="sortable" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{translate('pitch')}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{translate('yaw')}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{translate('roll')}
</th>
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{translate('range')}
</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide} onClick={sortShips('hardness')}>
{translate('hrd')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th className="sortable" onClick={sortShips('baseShieldStrength')}>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable lft" onClick={sortShips('maxPassengers')}
onMouseEnter={termtip.bind(null, 'passenger capacity')} onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th colSpan={5} className="sortable lft" onClick={sortShips('hpCount')}>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th>
</tr>
<tr>
{/* Third row headers, i.e., units */}
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
{/* agility rating placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{units['°/s']}
</th>
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{units.LY}
</th>
<th className="lft">&nbsp;</th>
{/* armour placeholder */}
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{units.T}
</th>
{/* pax placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide} onClick={sortShips('standard', 0)}>
{'pp'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide} onClick={sortShips('standard', 1)}>
{'th'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide} onClick={sortShips('standard', 2)}>
{'fsd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide} onClick={sortShips('standard', 3)}>
{'ls'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'power distriubtor')}
onMouseLeave={hide} onClick={sortShips('standard', 4)}>
{'pd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide} onClick={sortShips('standard', 5)}>
{'s'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide} onClick={sortShips('standard', 6)}>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{detailRows}
</tbody>
</table>
</div>
</div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
</div> </div>
</div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
</div>
</div> </div>
</div> </div>
); );

File diff suppressed because it is too large Load Diff

View File

@@ -1,13 +0,0 @@
/**
* Modification - a modification and its value
*/
export default class Modification {
/**
* @param {String} id Unique modification ID
* @param {Number} value Value of the modification
*/
constructor(id, value) {
this.id = id;
this.value = value;
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,197 +0,0 @@
import Module from './Module';
import { BulkheadNames } from './Constants';
/**
* Filter eligble modules based on parameters
* @param {Array} arr Available modules array
* @param {number} maxClass Max class
* @param {number} minClass Minimum class
* @param {number} mass Mass
* @return {Array} Fitlered module subset
*/
function filter(arr, maxClass, minClass, mass) {
return arr.filter(m => m.class <= maxClass && m.class >= minClass && (m.maxmass === undefined || mass <= m.maxmass));
}
/**
* The available module set for a specific ship
*/
export default class ModuleSet {
/**
* Instantiate the module set
* @param {Object} modules All Modules
* @param {Object} shipData Ship Specifications Data (see coriolis-data/Ships)
*/
constructor(modules, shipData) {
let maxInternal = isNaN(shipData.slots.internal[0]) ? shipData.slots.internal[0].class : shipData.slots.internal[0];
let mass = shipData.properties.hullMass + 6.5;
let maxStandardArr = shipData.slots.standard;
let maxHardPoint = shipData.slots.hardpoints[0];
let stnd = modules.standard;
this.mass = mass;
this.standard = {};
this.internal = {};
this.hardpoints = {};
this.hpClass = {};
this.intClass = {};
this.bulkheads = shipData.bulkheads.map((b, i) => {
return Object.assign(new Module(), { grp: 'bh', id: i, name: BulkheadNames[i], index: i, class: '', rating: '' }, b);
});
this.standard[0] = filter(stnd.pp, maxStandardArr[0], 0, mass); // Power Plant
this.standard[2] = filter(stnd.fsd, maxStandardArr[2], 0, mass); // FSD
this.standard[4] = filter(stnd.pd, maxStandardArr[4], 0, mass); // Power Distributor
this.standard[6] = filter(stnd.ft, maxStandardArr[6], 0, mass); // Fuel Tank
// Thrusters, filter modules by class only (to show full list of ratings for that class)
let minThrusterClass = stnd.t.reduce((clazz, th) => (th.maxmass >= mass && th.class < clazz) ? th.class : clazz, maxStandardArr[1]);
this.standard[1] = filter(stnd.t, maxStandardArr[1], minThrusterClass, 0); // Thrusters
// Slots where module class must be equal to slot class
this.standard[3] = filter(stnd.ls, maxStandardArr[3], maxStandardArr[3], 0); // Life Supprt
this.standard[5] = filter(stnd.s, maxStandardArr[5], maxStandardArr[5], mass); // Sensors
for (let h in modules.hardpoints) {
this.hardpoints[h] = filter(modules.hardpoints[h], maxHardPoint, 0, mass);
}
for (let g in modules.internal) {
this.internal[g] = filter(modules.internal[g], maxInternal, 0, mass);
}
}
/**
* Get the specified bulkhead
* @param {integer} index Bulkhead index
* @return {Object} Bulkhead module details
*/
getBulkhead(index) {
return this.bulkheads[index] ? new Module({ template: this.bulkheads[index] }) : null;
}
/**
* Determine the modules that areeligible for an internal slot
* @param {Object} ship The ship
* @param {integer} c The max class module that can be mounted in the slot
* @param {Object} eligible) The map of eligible internal groups
* @return {object} A map of all eligible modules by group
*/
getInts(ship, c, eligible) {
let o = {};
for (let key in this.internal) {
if (eligible && !eligible[key]) {
continue;
}
if (key == 'pcq' && !(ship.luxuryCabins && ship.luxuryCabins === true)) {
continue;
}
if (key == 'fh' && !(ship.fighterHangars && ship.fighterHangars === true)) {
continue;
}
let data = filter(this.internal[key], c, 0, this.mass);
if (data.length) { // If group is not empty
o[key] = data;
}
}
return o;
}
/**
* Determining the modules that are eligible for an hardpoint slot
* @param {integer} c The max class module that can be mounted in the slot
* @param {Object} eligible) The map of eligible hardpoint groups
* @return {object} A map of all eligible modules by group
*/
getHps(c, eligible) {
let o = {};
for (let key in this.hardpoints) {
if (eligible && !eligible[key]) {
continue;
}
let data = filter(this.hardpoints[key], c, c ? 1 : 0, this.mass);
if (data.length) { // If group is not empty
o[key] = data;
}
}
return o;
}
/**
* Find the lightest Power Distributor that provides sufficient
* energy to boost.
* @param {number} boostEnergy The energy that is required to boost
* @return {Object} Power Distributor
*/
lightestPowerDist(boostEnergy) {
let pd = this.standard[4][0];
for (let p of this.standard[4]) {
if (p.mass < pd.mass && p.engcap > boostEnergy) {
pd = p;
}
}
return new Module({ template: pd });
};
/** Find the power distributor that matches the requirements
* @param {Object} requirements The requirements to be met (currently only support 'weprate')
* @return {Object} Power distributor
*/
matchingPowerDist(requirements) {
let pd = this.standard[4][0];
for (let p of this.standard[4]) {
if (p.weprate >= requirements.weprate || p.weprate >= pd.weprate) {
pd = p;
}
}
return new Module({ template: pd });
}
/**
* Finds the lightest Thruster that can handle the specified tonnage
* @param {number} ladenMass Ship laden mass (mass + cargo + fuel)
* @return {Object} Thruster
*/
lightestThruster(ladenMass) {
let th = this.standard[1][0];
for (let t of this.standard[1]) {
if (t.mass < th.mass && t.maxmass >= ladenMass) {
th = t;
}
}
return new Module({ template: th });
};
/**
* Finds the lightest usable Shield Generator
* @param {number} hullMass Ship hull mass
* @return {Object} Thruster
*/
lightestShieldGenerator(hullMass) {
let sg = this.internal.sg[0];
for (let s of this.internal.sg) {
if (s.mass < sg.mass && s.maxmass > hullMass) {
sg = s;
}
}
return new Module({ template: sg });
};
/**
* Find the lightest Power Plant that provides sufficient power
* @param {number} powerNeeded Power requirements in MJ
* @param {string} rating The optional rating of the power plant
* @return {Object} Power Plant
*/
lightestPowerPlant(powerNeeded, rating) {
let pp = this.standard[0][0];
for (let p of this.standard[0]) {
// Provides enough power, is lighter or the same mass as current power plant but better output/efficiency
if (p.pgen >= powerNeeded && (p.mass < pp.mass || (p.mass == pp.mass && p.pgen > pp.pgen)) && (!rating || rating == p.rating)) {
pp = p;
}
}
return new Module({ template: pp });
}
}

View File

@@ -1,336 +0,0 @@
import { ModuleNameToGroup, BulkheadNames, StandardArray } from './Constants';
import ModuleSet from './ModuleSet';
import Module from './Module';
import { Ships, Modules } from 'coriolis-data/dist';
/*
* All functions below must return a fresh Module rather than a definition or existing module, as
* the resultant object can be altered with modifications.
*/
/**
* Created a cargo hatch model
* @return {Object} Cargo hatch model
*/
export function cargoHatch() {
let hatch = new Module();
Object.assign(hatch, { name: 'Cargo Hatch', class: 1, rating: 'H', power: 0.6 });
return hatch;
};
/**
* Finds the module with the specific group and ID
* @param {String} grp Module group (pp - power plant, pl - pulse laser etc)
* @param {String} id The module ID
* @return {Object} The module or null
*/
export function findModule(grp, id) {
// See if it's a standard module
if (Modules.standard[grp]) {
let standardmod = Modules.standard[grp].find(e => e.id == id);
if (standardmod != null) {
return new Module({ template: standardmod });
}
}
// See if it's an internal module
if (Modules.internal[grp]) {
let internalmod = Modules.internal[grp].find(e => e.id == id);
if (internalmod != null) {
return new Module({ template: internalmod });
}
}
// See if it's a hardpoint module
if (Modules.hardpoints[grp]) {
let hardpointmod = Modules.hardpoints[grp].find(e => e.id == id);
if (hardpointmod != null) {
return new Module({ template: hardpointmod });
}
}
return null;
}
/**
* Finds the standard module type with the specified ID
* @param {String|Number} type Standard Module Type (0/pp - Power Plant, 1/t - Thrusters, etc)
* @param {String} id The module ID or '[Class][Rating]'
* @return {Object} The standard module or null
*/
export function standard(type, id) {
if (!isNaN(type)) {
type = StandardArray[type];
}
let s = Modules.standard[type].find(e => e.id === id);
if (!s) {
s = Modules.standard[type].find(e => (e.class == id.charAt(0) && e.rating == id.charAt(1)));
}
if (s) {
s = new Module({ template: s });
}
return s || null;
};
/**
* Finds the hardpoint with the specified ID
* @param {String} id Hardpoint ID
* @return {Object} Hardpoint module or null
*/
export function hardpoints(id) {
for (let n in Modules.hardpoints) {
let group = Modules.hardpoints[n];
for (let i = 0; i < group.length; i++) {
if (group[i].id == id) {
return new Module({ template: group[i] });
}
}
}
return null;
};
/**
* Finds the internal module with the specified ID
* @param {String} id Internal module ID
* @return {Object} Internal module or null
*/
export function internal(id) {
for (let n in Modules.internal) {
let group = Modules.internal[n];
for (let i = 0; i < group.length; i++) {
if (group[i].id == id) {
return new Module({ template: group[i] });
}
}
}
return null;
};
/**
* Finds a standard module based on Class, Rating, Group and/or name.
* At least one of Group name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Advanced Discover Scanner'
* @return {Object} The module if found, null if not found
*/
export function findStandard(groupName, clss, rating, name) {
let groups = {};
if (groupName) {
if (Modules.standard[groupName]) {
groups[groupName] = Modules.standard[groupName];
} else {
let grpCode = ModuleNameToGroup[groupName.toLowerCase()];
if (grpCode && Modules.standard[grpCode]) {
groups[grpCode] = Modules.standard[grpCode];
}
}
} else if (name) {
groups = Modules.standard;
}
for (let g in groups) {
let group = groups[g];
for (let i = 0, l = group.length; i < l; i++) {
if (group[i].class == clss && group[i].rating == rating && ((!name && !group[i].name) || group[i].name == name)) {
return group[i];
}
}
}
return null;
}
/**
* Finds a standard Module ID based on Class, Rating, Group and/or name.
* At least one of Group name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating Module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Advanced Discover Scanner'
* @return {String} The id of the module if found, null if not found
*/
export function findStandardId(groupName, clss, rating, name) {
let i = this.findStandard(groupName, clss, rating, name);
return i ? i.id : 0;
}
/**
* Finds an internal module based on Class, Rating, Group and/or name.
* At least one ofGroup name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Advanced Discover Scanner'
* @return {Object} The module if found, null if not found
*/
export function findInternal(groupName, clss, rating, name) {
let groups = {};
if (groupName) {
if (Modules.internal[groupName]) {
groups[groupName] = Modules.internal[groupName];
} else {
let grpCode = ModuleNameToGroup[groupName.toLowerCase()];
if (grpCode && Modules.internal[grpCode]) {
groups[grpCode] = Modules.internal[grpCode];
}
}
} else if (name) {
groups = Modules.internal;
}
for (let g in groups) {
let group = groups[g];
for (let i = 0, l = group.length; i < l; i++) {
if (group[i].class == clss && group[i].rating == rating && ((!name && !group[i].name) || group[i].name == name)) {
return group[i];
}
}
}
return null;
}
/**
* Finds an internal module based on Class, Rating, Group and/or name.
* At least one of Group name or unique module name must be provided.
* will start searching at specified class and proceed lower until a
* module is found or 0 is hit
* Uses findInternal internally
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Advanced Discover Scanner'
* @return {Object} The module if found, null if not found
*/
export function findMaxInternal(groupName, clss, rating, name) {
let foundModule = null;
let currentClss = clss;
while (currentClss > 0 && foundModule == null) {
foundModule = findInternal(groupName, currentClss, rating, name);
currentClss = currentClss - 1;
}
return foundModule;
}
/**
* Finds an internal Module ID based on Class, Rating, Group and/or name.
* At least one ofGroup name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating Module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Advanced Discover Scanner'
* @return {String} The id of the module if found, null if not found
*/
export function findInternalId(groupName, clss, rating, name) {
let i = this.findInternal(groupName, clss, rating, name);
return i ? i.id : 0;
}
/**
* Finds a hardpoint Module based on Class, Rating, Group and/or name.
* At least one ofGroup name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss Module Class
* @param {String} rating [Optional] module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Heat Sink Launcher'
* @param {String} mount Mount type - [F]ixed, [G]imballed, [T]urret
* @param {String} missile [Optional] Missile type - [D]umbfire, [S]eeker
* @return {String} The id of the module if found, null if not found
*/
export function findHardpoint(groupName, clss, rating, name, mount, missile) {
let groups = {};
if (groupName) {
if (Modules.hardpoints[groupName]) {
groups[groupName] = Modules.hardpoints[groupName];
} else {
let grpCode = ModuleNameToGroup[groupName.toLowerCase()];
if (grpCode && Modules.hardpoints[grpCode]) {
groups[grpCode] = Modules.hardpoints[grpCode];
}
}
} else if (name) {
groups = Modules.hardpoints;
}
for (let g in groups) {
let group = groups[g];
for (let h of group) {
if (h.class == clss && (!rating || h.rating == rating) && h.mount == mount && h.name == name && h.missile == missile) {
return h;
}
}
}
return null;
}
/**
* Finds a hardpoint module ID based on Class, Rating, Group and/or name.
* At least one of Group name or unique module name must be provided
*
* @param {String} groupName [Optional] Full name or abbreviated name for module group
* @param {integer} clss module Class
* @param {String} rating module Rating
* @param {String} name [Optional] Long/unique name for module -e.g. 'Heat Sink Launcher'
* @param {String} mount Mount type - [F]ixed, [G]imballed, [T]urret
* @param {String} missile [Optional] Missile type - [D]umbfire, [S]eeker
* @return {String} The id of the module if found, null if not found
*/
export function findHardpointId(groupName, clss, rating, name, mount, missile) {
let h = this.findHardpoint(groupName, clss, rating, name, mount, missile);
if (h) {
return h.id;
}
// Countermeasures used to be lumped in a single group but have been broken, out. If we have been given a groupName of 'Countermeasure' then
// rely on the unique name to find it
if (groupName === 'cm' || groupName === 'Countermeasure') {
h = this.findHardpoint(null, clss, rating, name, mount, missile);
}
return h ? h.id : 0;
}
/**
* Get the bulkhead index for the given bulkhead name
* @param {String} bulkheadName Bulkhead name in english
* @return {number} Bulkhead index
*/
export function bulkheadIndex(bulkheadName) {
return BulkheadNames.indexOf(bulkheadName);
}
/**
* Determine if a module group is a shield generator
* @param {String} g Module Group name
* @return {Boolean} True if the group is a shield generator
*/
export function isShieldGenerator(g) {
return g == 'sg' || g == 'psg' || g == 'bsg';
}
/**
* Creates a new ModuleSet that contains all available modules
* that the specified ship is eligible to use.
*
* 6.5 T is the lightest possible mass of standard components that any ship can use
*
* @param {String} shipId Unique ship Id/Key
* @return {ModuleSet} The set of modules the ship can install
*/
export function forShip(shipId) {
return new ModuleSet(Modules, Ships[shipId]);
}

View File

@@ -1,195 +0,0 @@
import { ModuleGroupToName, MountMap, BulkheadNames } from './Constants';
import { Ships } from 'coriolis-data/dist';
import Ship from './Ship';
import * as Utils from '../utils/UtilityFunctions';
import LZString from 'lz-string';
import { outfitURL } from '../utils/UrlGenerators';
/**
* Generates ship-loadout JSON Schema standard object
* @param {Object} standard model
* @return {Object} JSON Schema
*/
function standardToSchema(standard) {
if (standard.m) {
let o = {
class: standard.m.class,
rating: standard.m.rating,
enabled: Boolean(standard.enabled),
priority: standard.priority + 1
};
if (standard.m.name) {
o.name = standard.m.name;
}
if (standard.m.mods && Object.keys(standard.m.mods).length > 0) {
o.modifications = standard.m.mods;
}
if (standard.m.blueprint && Object.keys(standard.m.blueprint).length > 0) {
o.blueprint = standard.m.blueprint;
}
return o;
}
return null;
}
/**
* Generates ship-loadout JSON Schema slot object
* @param {Object} slot Slot model
* @return {Object} JSON Schema Slot
*/
function slotToSchema(slot) {
if (slot.m) {
let o = {
class: slot.m.class,
rating: slot.m.rating,
enabled: Boolean(slot.enabled),
priority: slot.priority + 1,
group: ModuleGroupToName[slot.m.grp]
};
if (slot.m.name) {
o.name = slot.m.name;
}
if (slot.m.mount) {
o.mount = MountMap[slot.m.mount];
}
if (slot.m.missile) {
o.missile = slot.m.missile;
}
if (slot.m.mods && Object.keys(slot.m.mods).length > 0) {
o.modifications = slot.m.mods;
}
if (slot.m.blueprint && Object.keys(slot.m.blueprint).length > 0) {
o.blueprint = slot.m.blueprint;
}
return o;
}
return null;
}
/**
* Generates an object conforming to the ship-loadout JSON schema from a Ship model
* @param {string} buildName The build name
* @param {Ship} ship Ship instance
* @return {Object} ship-loadout object
*/
export function toDetailedBuild(buildName, ship) {
let standard = ship.standard,
hardpoints = ship.hardpoints,
internal = ship.internal,
code = ship.toString();
let data = {
$schema: 'https://coriolis.io/schemas/ship-loadout/4.json#',
name: buildName,
ship: ship.name,
references: [{
name: 'Coriolis.io',
url: 'https://coriolis.io' + outfitURL(ship.id, code, buildName),
code,
shipId: ship.id
}],
components: {
standard: {
bulkheads: BulkheadNames[ship.bulkheads.m.index],
cargoHatch: { enabled: Boolean(ship.cargoHatch.enabled), priority: ship.cargoHatch.priority + 1 },
powerPlant: standardToSchema(standard[0]),
thrusters: standardToSchema(standard[1]),
frameShiftDrive: standardToSchema(standard[2]),
lifeSupport: standardToSchema(standard[3]),
powerDistributor: standardToSchema(standard[4]),
sensors: standardToSchema(standard[5]),
fuelTank: standardToSchema(standard[6])
},
hardpoints: hardpoints.filter(slot => slot.maxClass > 0).map(slotToSchema),
utility: hardpoints.filter(slot => slot.maxClass === 0).map(slotToSchema),
internal: internal.map(slotToSchema)
},
stats: {}
};
for (let stat in ship) {
if (!isNaN(ship[stat])) {
data.stats[stat] = Math.round(ship[stat] * 100) / 100;
}
}
return data;
};
/**
* Instantiates a ship from a ship-loadout object
* @param {Object} detailedBuild ship-loadout object
* @return {Ship} Ship instance
*/
export function fromDetailedBuild(detailedBuild) {
let shipId = Object.keys(Ships).find((shipId) => Ships[shipId].properties.name.toLowerCase() == detailedBuild.ship.toLowerCase());
if (!shipId) {
throw 'No such ship: ' + detailedBuild.ship;
}
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
if (!detailedBuild.references[0] || !detailedBuild.references[0].code) {
throw 'Missing reference code';
}
ship.buildFrom(detailedBuild.references[0].code);
return ship;
}
/**
* Generates an array of ship-loadout JSON Schema object for export
* @param {Array} builds Array of ship builds
* @return {Array} Array of of ship-loadout objects
*/
export function toDetailedExport(builds) {
let data = [];
for (let shipId in builds) {
for (let buildName in builds[shipId]) {
let code = builds[shipId][buildName];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildFrom(code);
data.push(toDetailedBuild(buildName, ship, code));
}
}
return data;
};
/**
* Serializes a comparion and all of the ships to zipped
* Base 64 encoded JSON.
* @param {string} name Comparison name
* @param {array} builds Array of ship builds
* @param {array} facets Selected facets
* @param {string} predicate sort predicate
* @param {boolean} desc sort order
* @return {string} Zipped Base 64 encoded JSON
*/
export function fromComparison(name, builds, facets, predicate, desc) {
return LZString.compressToBase64(JSON.stringify({
n: name,
b: builds.map((b) => { return { s: b.id, n: b.buildName, c: b.toString() }; }),
f: facets,
p: predicate,
d: desc ? 1 : 0
}));
};
/**
* Parses the comarison data string back to an object.
* @param {string} code Zipped Base 64 encoded JSON comparison data
* @return {Object} Comparison data object
*/
export function toComparison(code) {
return JSON.parse(LZString.decompressFromBase64(Utils.fromUrlSafe(code)));
};

File diff suppressed because it is too large Load Diff

View File

@@ -1,415 +0,0 @@
import * as ModuleUtils from './ModuleUtils';
import { canMount } from '../utils/SlotFunctions';
/**
* Standard / typical role for multi-purpose or combat (if shielded with better bulkheads)
* @param {Ship} ship Ship instance
* @param {Boolean} shielded True if shield generator should be included
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
*/
export function multiPurpose(ship, shielded, bulkheadIndex) {
ship.useStandard('A')
.use(ship.standard[3], ModuleUtils.standard(3, ship.standard[3].maxClass + 'D')) // D Life Support
.use(ship.standard[5], ModuleUtils.standard(5, ship.standard[5].maxClass + 'D')) // D Sensors
.useBulkhead(bulkheadIndex);
if (shielded) {
ship.internal.some(function(slot) {
if (canMount(ship, slot, 'sg')) { // Assuming largest slot can hold an eligible shield
ship.use(slot, ModuleUtils.findInternal('sg', slot.maxClass, 'A'));
ship.setSlotEnabled(slot, true);
return true;
}
});
}
}
/**
* Trader Role
* @param {Ship} ship Ship instance
* @param {Boolean} shielded True if shield generator should be included
* @param {Object} standardOpts [Optional] Standard module optional overrides
*/
export function trader(ship, shielded, standardOpts) {
let usedSlots = [];
let bstCount = 2;
let sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
ship.useStandard('A')
.use(ship.standard[3], ModuleUtils.standard(3, ship.standard[3].maxClass + 'D')) // D Life Support
.use(ship.standard[1], ModuleUtils.standard(1, ship.standard[1].maxClass + 'D')) // D Life Support
.use(ship.standard[4], ModuleUtils.standard(4, ship.standard[4].maxClass + 'D')) // D Life Support
.use(ship.standard[5], ModuleUtils.standard(5, ship.standard[5].maxClass + 'D')); // D Sensors
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sg)
.filter(a => a.maxClass >= sg.class)
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
shieldInternals.some(function(slot) {
if (canMount(ship, slot, 'sg')) { // Assuming largest slot can hold an eligible shield
const shield = ModuleUtils.findInternal('sg', slot.maxClass, 'A');
if (shield && shield.maxmass > ship.hullMass) {
ship.use(slot, shield);
ship.setSlotEnabled(slot, true);
usedSlots.push(slot);
return true;
}
}
});
// Fill the empty internals with cargo racks
for (let i = ship.internal.length; i--;) {
let slot = ship.internal[i];
if (usedSlots.indexOf(slot) == -1 && canMount(ship, slot, 'cr')) {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
}
}
// Empty the hardpoints
for (let s of ship.hardpoints) {
ship.use(s, null);
}
for (let s of ship.hardpoints) {
if (s.maxClass == 0 && bstCount) { // Mount up to 2 boosters
ship.use(s, ModuleUtils.hardpoints('04'));
bstCount--;
} else {
ship.use(s, null);
}
}
// ship.useLightestStandard(standardOpts);
}
/**
* Explorer Role
* @param {Ship} ship Ship instance
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
*/
export function explorer(ship, planetary) {
let standardOpts = { ppRating: 'A' },
heatSinkCount = 2, // Fit 2 heat sinks if possible
usedSlots = [],
sgSlot,
fuelScoopSlot,
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
if (!planetary) { // Non-planetary explorers don't really need to boost
standardOpts.pd = '1D';
}
// Cargo hatch can be disabled
ship.setSlotEnabled(ship.cargoHatch, false);
// Advanced Discovery Scanner - class 1 or higher
const adsOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const adsInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sc)
.sort((a, b) => adsOrder.indexOf(a.maxClass) - adsOrder.indexOf(b.maxClass));
for (let i = 0; i < adsInternals.length; i++) {
if (canMount(ship, adsInternals[i], 'sc')) {
ship.use(adsInternals[i], ModuleUtils.internal('2f'));
usedSlots.push(adsInternals[i]);
break;
}
}
if (planetary) {
// Planetary Vehicle Hangar - class 2 or higher
const pvhOrder = [2, 3, 4, 5, 6, 7, 8, 1];
const pvhInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.pv)
.sort((a, b) => pvhOrder.indexOf(a.maxClass) - pvhOrder.indexOf(b.maxClass));
for (let i = 0; i < pvhInternals.length; i++) {
if (canMount(ship, pvhInternals[i], 'pv')) {
// Planetary Vehical Hangar only has even classes
const pvhClass = pvhInternals[i].maxClass % 2 === 1 ? pvhInternals[i].maxClass - 1 : pvhInternals[i].maxClass;
ship.use(pvhInternals[i], ModuleUtils.findInternal('pv', pvhClass, 'G')); // G is lower mass
ship.setSlotEnabled(pvhInternals[i], false); // Disable power for Planetary Vehical Hangar
usedSlots.push(pvhInternals[i]);
break;
}
}
}
// Shield generator
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sg)
.filter(a => a.maxClass >= sg.class)
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
for (let i = 0; i < shieldInternals.length; i++) {
if (canMount(ship, shieldInternals[i], 'sg')) {
ship.use(shieldInternals[i], sg);
usedSlots.push(shieldInternals[i]);
sgSlot = shieldInternals[i];
break;
}
}
// Detailed Surface Scanner
const dssOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const dssInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sc)
.sort((a, b) => dssOrder.indexOf(a.maxClass) - dssOrder.indexOf(b.maxClass));
for (let i = 0; i < dssInternals.length; i++) {
if (canMount(ship, dssInternals[i], 'sc')) {
ship.use(dssInternals[i], ModuleUtils.internal('2i'));
usedSlots.push(dssInternals[i]);
break;
}
}
// Fuel scoop - best possible
const fuelScoopOrder = [8, 7, 6, 5, 4, 3, 2, 1];
const fuelScoopInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.fs)
.sort((a, b) => fuelScoopOrder.indexOf(a.maxClass) - fuelScoopOrder.indexOf(b.maxClass));
for (let i = 0; i < fuelScoopInternals.length; i++) {
if (canMount(ship, fuelScoopInternals[i], 'fs')) {
ship.use(fuelScoopInternals[i], ModuleUtils.findInternal('fs', fuelScoopInternals[i].maxClass, 'A'));
usedSlots.push(fuelScoopInternals[i]);
fuelScoopSlot = fuelScoopInternals[i];
break;
}
}
// AFMUs - fill as they are 0-weight
const afmuOrder = [8, 7, 6, 5, 4, 3, 2, 1];
const afmuInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.pc)
.sort((a, b) => afmuOrder.indexOf(a.maxClass) - afmuOrder.indexOf(b.maxClass));
for (let i = 0; i < afmuInternals.length; i++) {
if (canMount(ship, afmuInternals[i], 'am')) {
ship.use(afmuInternals[i], ModuleUtils.findInternal('am', afmuInternals[i].maxClass, 'A'));
usedSlots.push(afmuInternals[i]);
ship.setSlotEnabled(afmuInternals[i], false); // Disable power for AFM Unit
}
}
for (let s of ship.hardpoints) {
if (s.maxClass == 0 && heatSinkCount) { // Mount up to 2 heatsinks
ship.use(s, ModuleUtils.hardpoints('02'));
ship.setSlotEnabled(s, heatSinkCount == 2); // Only enable a single Heatsink
heatSinkCount--;
} else {
ship.use(s, null);
}
}
if (sgSlot && fuelScoopSlot) {
// The SG and Fuel scoop to not need to be powered at the same time
if (sgSlot.m.getPowerUsage() > fuelScoopSlot.m.getPowerUsage()) { // The Shield generator uses the most power
ship.setSlotEnabled(fuelScoopSlot, false);
} else { // The Fuel scoop uses the most power
ship.setSlotEnabled(sgSlot, false);
}
}
ship.useLightestStandard(standardOpts);
}
/**
* Miner Role
* @param {Ship} ship Ship instance
* @param {Boolean} shielded True if shield generator should be included
*/
export function miner(ship, shielded) {
shielded = true;
let standardOpts = { ppRating: 'A' },
miningLaserCount = 2,
usedSlots = [],
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
// Cargo hatch should be enabled
ship.setSlotEnabled(ship.cargoHatch, true);
// Largest possible refinery
const refineryOrder = [4, 5, 6, 7, 8, 3, 2, 1];
const refineryInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.rf)
.sort((a, b) => refineryOrder.indexOf(a.maxClass) - refineryOrder.indexOf(b.maxClass));
for (let i = 0; i < refineryInternals.length; i++) {
if (canMount(ship, refineryInternals[i], 'rf')) {
ship.use(refineryInternals[i], ModuleUtils.findInternal('rf', Math.min(refineryInternals[i].maxClass, 4), 'A'));
usedSlots.push(refineryInternals[i]);
break;
}
}
// Prospector limpet controller - 3A if possible
const prospectorOrder = [3, 4, 5, 6, 7, 8, 2, 1];
const prospectorInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.pc)
.sort((a, b) => prospectorOrder.indexOf(a.maxClass) - prospectorOrder.indexOf(b.maxClass));
for (let i = 0; i < prospectorInternals.length; i++) {
if (canMount(ship, prospectorInternals[i], 'pc')) {
// Prospector only has odd classes
const prospectorClass = prospectorInternals[i].maxClass % 2 === 0 ? prospectorInternals[i].maxClass - 1 : prospectorInternals[i].maxClass;
ship.use(prospectorInternals[i], ModuleUtils.findInternal('pc', prospectorClass, 'A'));
usedSlots.push(prospectorInternals[i]);
break;
}
}
// Shield generator if required
if (shielded) {
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sg)
.filter(a => a.maxClass >= sg.class)
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
for (let i = 0; i < shieldInternals.length; i++) {
if (canMount(ship, shieldInternals[i], 'sg')) {
ship.use(shieldInternals[i], sg);
usedSlots.push(shieldInternals[i]);
break;
}
}
}
// Dual mining lasers of highest possible class; remove anything else
const miningLaserOrder = [2, 3, 4, 1, 0];
const miningLaserHardpoints = ship.hardpoints.concat().sort(function(a, b) {
return miningLaserOrder.indexOf(a.maxClass) - miningLaserOrder.indexOf(b.maxClass);
});
for (let s of miningLaserHardpoints) {
if (s.maxClass >= 1 && miningLaserCount) {
ship.use(s, ModuleUtils.hardpoints(s.maxClass >= 2 ? '2m' : '2l'));
miningLaserCount--;
} else {
ship.use(s, null);
}
}
// Number of collector limpets required to be active is a function of the size of the ship and the power of the lasers
const miningLaserDps = ship.hardpoints.filter(h => h.m != null)
.reduce(function(a, b) {
return a + b.m.getDps();
}, 0);
// Find out how many internal slots we have, and their potential cargo size
const potentialCargo = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.cr)
.map(b => Math.pow(2, b.maxClass));
// One collector for each 1.25 DPS, multiply by 1.25 for medium ships and 1.5 for large ships as they have further to travel
// 0 if we only have 1 cargo slot, otherwise minium of 1 and maximum of 6 (excluding size modifier)
const sizeModifier = ship.class == 2 ? 1.2 : ship.class == 3 ? 1.5 : 1;
let collectorLimpetsRequired = potentialCargo.length == 1 ? 0 : Math.ceil(sizeModifier * Math.min(6, Math.floor(miningLaserDps / 1.25)));
if (collectorLimpetsRequired > 0) {
const collectorOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const collectorInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.cc)
.sort((a, b) => collectorOrder.indexOf(a.maxClass) - collectorOrder.indexOf(b.maxClass));
// Always keep at least 2 slots free for cargo racks (1 for shielded)
for (let i = 0; i < collectorInternals.length - (shielded ? 1 : 2) && collectorLimpetsRequired > 0; i++) {
if (canMount(ship, collectorInternals[i], 'cc')) {
// Collector only has odd classes
const collectorClass = collectorInternals[i].maxClass % 2 === 0 ? collectorInternals[i].maxClass - 1 : collectorInternals[i].maxClass;
ship.use(collectorInternals[i], ModuleUtils.findInternal('cc', collectorClass, 'D'));
usedSlots.push(collectorInternals[i]);
collectorLimpetsRequired -= collectorInternals[i].m.maximum;
}
}
}
// Power distributor to power the mining lasers indefinitely
const wepRateRequired = ship.hardpoints.filter(h => h.m != null)
.reduce(function(a, b) {
return a + b.m.getEps();
}, 0);
standardOpts.pd = ship.getAvailableModules().matchingPowerDist({ weprate: wepRateRequired }).id;
// Fill the empty internals with cargo racks
for (let i = ship.internal.length; i--;) {
let slot = ship.internal[i];
if (usedSlots.indexOf(slot) == -1 && canMount(ship, slot, 'cr')) {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
}
}
ship.useLightestStandard(standardOpts);
}
/**
* Racer Role
* @param {Ship} ship Ship instance
*/
export function racer(ship) {
let standardOpts = {},
usedSlots = [],
sgSlot,
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
// Cargo hatch can be disabled
ship.setSlotEnabled(ship.cargoHatch, false);
// Shield generator
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
.filter(a => (!a.eligible) || a.eligible.sg)
.filter(a => a.maxClass >= sg.class)
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
for (let i = 0; i < shieldInternals.length; i++) {
if (canMount(ship, shieldInternals[i], 'sg')) {
ship.use(shieldInternals[i], sg);
usedSlots.push(shieldInternals[i]);
sgSlot = shieldInternals[i];
break;
}
}
// Empty the hardpoints
for (let s of ship.hardpoints) {
ship.use(s, null);
}
// Empty the internals
for (let i = ship.internal.length; i--;) {
let slot = ship.internal[i];
if (usedSlots.indexOf(slot) == -1) {
ship.use(slot, null);
}
}
// Best thrusters
if (ship.standard[1].maxClass === 3) {
standardOpts.th = 'tz';
} else if (ship.standard[1].maxClass === 2) {
standardOpts.th = 'u0';
} else {
standardOpts.th = ship.standard[1].maxClass + 'A';
}
// Best power distributor for more boosting
standardOpts.pd = ship.standard[4].maxClass + 'A';
// Smallest possible FSD drive
standardOpts.fsd = '2D';
// Minimal fuel tank
standardOpts.ft = '1C';
// Disable nearly everything
standardOpts.fsdDisabled = true;
standardOpts.sDisabled = true;
standardOpts.pdDisabled = true;
standardOpts.lsDisabled = true;
ship.useLightestStandard(standardOpts);
// Apply engineering to each module
// ship.standard[1].m.blueprint = getBlueprint('Engine_Dirty', ship.standard[0]);
// ship.standard[1].m.blueprint.grade = 5;
// setBest(ship, ship.standard[1].m);
// ship.standard[3].m.blueprint = getBlueprint('LifeSupport_LightWeight', ship.standard[3]);
// ship.standard[3].m.blueprint.grade = 4;
// setBest(ship, ship.standard[3].m);
// ship.standard[4].m.blueprint = getBlueprint('PowerDistributor_PriorityEngines', ship.standard[4]);
// ship.standard[4].m.blueprint.grade = 3;
// setBest(ship, ship.standard[4].m);
// ship.standard[5].m.blueprint = getBlueprint('Sensor_Sensor_LightWeight', ship.standard[5]);
// ship.standard[5].m.blueprint.grade = 5;
// setBest(ship, ship.standard[5].m);
}

View File

@@ -1,83 +0,0 @@
export const SI_PREFIXES = {
'Y': 1e+24, // Yotta
'Z': 1e+21, // Zetta
'E': 1e+18, // Peta
'P': 1e+15, // Peta
'T': 1e+12, // Tera
'G': 1e+9, // Giga
'M': 1e+6, // Mega
'k': 1e+3, // Kilo
'h': 1e+2, // Hekto
'da': 1e+1, // Deka
'': 1,
'd': 1e-1, // Dezi
'c': 1e-2, // Zenti
'm': 1e-3, // Milli
'μ': 1e-6, // mikro not supported due to charset
'n': 10e-9, // Nano
'p': 1e-12, // Nano
'f': 1e-15, // Femto
'a': 1e-18, // Atto
'z': 1e-21, // Zepto
'y': 1e-24 // Yokto
};
export const STATS_FORMATTING = {
'ammo': { 'format': 'int', },
'boot': { 'format': 'int', 'unit': 'secs' },
'brokenregen': { 'format': 'round1', 'unit': 'ps' },
'burst': { 'format': 'int', 'change': 'additive' },
'burstrof': { 'format': 'round1', 'unit': 'ps', 'change': 'additive' },
'causres': { 'format': 'pct' },
'clip': { 'format': 'int' },
'damage': { 'format': 'round' },
'dps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getDps' },
'dpe': { 'format': 'round', 'units': 'ps', 'synthetic': 'getDpe' },
'distdraw': { 'format': 'round', 'unit': 'MW' },
'duration': { 'format': 'round1', 'unit': 's' },
'eff': { 'format': 'round2' },
'engcap': { 'format': 'round1', 'unit': 'MJ' },
'engrate': { 'format': 'round1', 'unit': 'MW' },
'eps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getEps' },
'explres': { 'format': 'pct' },
'facinglimit': { 'format': 'round1', 'unit': 'ang' },
'falloff': { 'format': 'round', 'unit': 'km', 'storedUnit': 'm' },
'fallofffromrange': { 'format': 'round', 'unit': 'km', 'storedUnit': 'm', 'synthetic': 'getFalloff' },
'hps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getHps' },
'hullboost': { 'format': 'pct1', 'change': 'additive' },
'hullreinforcement': { 'format': 'int' },
'integrity': { 'format': 'round1' },
'jitter': { 'format': 'round', 'unit': 'ang' },
'kinres': { 'format': 'pct' },
'mass': { 'format': 'round1', 'unit': 'T' },
'maxfuel': { 'format': 'round1', 'unit': 'T' },
'optmass': { 'format': 'int', 'unit': 'T' },
'optmul': { 'format': 'pct', 'change': 'additive' },
'pgen': { 'format': 'round1', 'unit': 'MW' },
'piercing': { 'format': 'int' },
'power': { 'format': 'round', 'unit': 'MW' },
'protection': { 'format': 'pct' },
'range': { 'format': 'f2', 'unit': 'km', 'storedUnit': 'm' },
'ranget': { 'format': 'f1', 'unit': 's' },
'regen': { 'format': 'round1', 'unit': 'ps' },
'reload': { 'format': 'int', 'unit': 's' },
'rof': { 'format': 'round1', 'unit': 'ps', 'synthetic': 'getRoF', 'higherbetter': true },
'angle': { 'format': 'round1', 'unit': 'ang' },
'scanrate': { 'format': 'int' },
'scantime': { 'format': 'round1', 'unit': 's' },
'sdps': { 'format': 'round1', 'units': 'ps', 'synthetic': 'getSDps' },
'shield': { 'format': 'int', 'unit': 'MJ' },
'shieldaddition': { 'format': 'round1', 'unit': 'MJ' },
'shieldboost': { 'format': 'pct1', 'change': 'additive' },
'shieldreinforcement': { 'format': 'round1', 'unit': 'MJ' },
'shotspeed': { 'format': 'int', 'unit': 'm/s' },
'spinup': { 'format': 'round1', 'unit': 's' },
'syscap': { 'format': 'round1', 'unit': 'MJ' },
'sysrate': { 'format': 'round1', 'unit': 'MW' },
'thermload': { 'format': 'round1' },
'thermres': { 'format': 'pct' },
'wepcap': { 'format': 'round1', 'unit': 'MJ' },
'weprate': { 'format': 'round1', 'unit': 'MW' },
'jumpboost': { 'format': 'round1', 'unit': 'LY' },
'proberadius': { 'format': 'pct1', 'unit': 'pct' },
};

View File

@@ -0,0 +1,33 @@
import { Module } from 'ed-forge';
/**
* Sets a resistance value of a module as
* @param {Module} module Module to set the property
* @param {string} prop Property name; must end with 'resistance'
* @param {number} val Resistance value to set
*/
function setterResToEff(module, prop, val) {
module.set(
prop.replace('resistance', 'effectiveness'),
1 - val / 100,
);
}
export const SHOW = {
causticeffectiveness: {
as: 'causticresistance',
setter: setterResToEff,
},
explosiveeffectiveness: {
as: 'explosiveresistance',
setter: setterResToEff,
},
kineticeffectiveness: {
as: 'kineticresistance',
setter: setterResToEff,
},
thermiceffectiveness: {
as: 'thermicresistance',
setter: setterResToEff,
},
};

View File

@@ -2,7 +2,6 @@ import { EventEmitter } from 'fbemitter';
import { Insurance } from '../shipyard/Constants'; import { Insurance } from '../shipyard/Constants';
const LS_KEY_BUILDS = 'builds'; const LS_KEY_BUILDS = 'builds';
const LS_KEY_COMPARISONS = 'comparisons';
const LS_KEY_LANG = 'NG_TRANSLATE_LANG_KEY'; const LS_KEY_LANG = 'NG_TRANSLATE_LANG_KEY';
const LS_KEY_COST_TAB = 'costTab'; const LS_KEY_COST_TAB = 'costTab';
const LS_KEY_CMDR_NAME = 'cmdrName'; const LS_KEY_CMDR_NAME = 'cmdrName';
@@ -13,7 +12,6 @@ const LS_KEY_MOD_DISCOUNT = 'moduleDiscount';
const LS_KEY_STATE = 'state'; const LS_KEY_STATE = 'state';
const LS_KEY_SIZE_RATIO = 'sizeRatio'; const LS_KEY_SIZE_RATIO = 'sizeRatio';
const LS_KEY_TOOLTIPS = 'tooltips'; const LS_KEY_TOOLTIPS = 'tooltips';
const LS_KEY_MODULE_RESISTANCES = 'moduleResistances';
const LS_KEY_ROLLS = 'matsPerGrade'; const LS_KEY_ROLLS = 'matsPerGrade';
let LS; let LS;
@@ -84,7 +82,6 @@ export class Persist extends EventEmitter {
LS = null; LS = null;
} }
let moduleResistances = _get(LS_KEY_MODULE_RESISTANCES);
let matsPerGrade = _get(LS_KEY_ROLLS); let matsPerGrade = _get(LS_KEY_ROLLS);
let cmdrName = _get(LS_KEY_CMDR_NAME); let cmdrName = _get(LS_KEY_CMDR_NAME);
let tips = _get(LS_KEY_TOOLTIPS); let tips = _get(LS_KEY_TOOLTIPS);
@@ -92,7 +89,6 @@ export class Persist extends EventEmitter {
let shipDiscount = _get(LS_KEY_SHIP_DISCOUNT); let shipDiscount = _get(LS_KEY_SHIP_DISCOUNT);
let moduleDiscount = _get(LS_KEY_MOD_DISCOUNT); let moduleDiscount = _get(LS_KEY_MOD_DISCOUNT);
let buildJson = _get(LS_KEY_BUILDS); let buildJson = _get(LS_KEY_BUILDS);
let comparisonJson = _get(LS_KEY_COMPARISONS);
this.onStorageChange = this.onStorageChange.bind(this); this.onStorageChange = this.onStorageChange.bind(this);
this.langCode = _getString(LS_KEY_LANG) || 'en'; this.langCode = _getString(LS_KEY_LANG) || 'en';
@@ -100,7 +96,6 @@ export class Persist extends EventEmitter {
this.shipDiscount = !isNaN(shipDiscount) && shipDiscount < 1 ? shipDiscount * 1 : 0; this.shipDiscount = !isNaN(shipDiscount) && shipDiscount < 1 ? shipDiscount * 1 : 0;
this.moduleDiscount = !isNaN(moduleDiscount) && moduleDiscount < 1 ? moduleDiscount * 1 : 0; this.moduleDiscount = !isNaN(moduleDiscount) && moduleDiscount < 1 ? moduleDiscount * 1 : 0;
this.builds = buildJson && typeof buildJson == 'object' ? buildJson : {}; this.builds = buildJson && typeof buildJson == 'object' ? buildJson : {};
this.comparisons = comparisonJson && typeof comparisonJson == 'object' ? comparisonJson : {};
this.costTab = _getString(LS_KEY_COST_TAB); this.costTab = _getString(LS_KEY_COST_TAB);
this.outfittingTab = _getString(LS_KEY_OUTFITTING_TAB); this.outfittingTab = _getString(LS_KEY_OUTFITTING_TAB);
this.state = _get(LS_KEY_STATE); this.state = _get(LS_KEY_STATE);
@@ -114,7 +109,6 @@ export class Persist extends EventEmitter {
}; };
this.cmdrName = cmdrName || { selected: '', cmdrs: [] }; this.cmdrName = cmdrName || { selected: '', cmdrs: [] };
this.tooltipsEnabled = tips === null ? true : tips; this.tooltipsEnabled = tips === null ? true : tips;
this.moduleResistancesEnabled = moduleResistances === null ? true : moduleResistances;
if (LS) { if (LS) {
window.addEventListener('storage', this.onStorageChange); window.addEventListener('storage', this.onStorageChange);
@@ -135,10 +129,6 @@ export class Persist extends EventEmitter {
this.builds = newValue ? JSON.parse(newValue) : {}; this.builds = newValue ? JSON.parse(newValue) : {};
this.emit('builds'); this.emit('builds');
break; break;
case LS_KEY_COMPARISONS:
this.comparisons = newValue ? JSON.parse(newValue) : {};
this.emit('comparisons');
break;
case LS_KEY_LANG: case LS_KEY_LANG:
this.langCode = newValue; this.langCode = newValue;
this.emit('language', newValue); this.emit('language', newValue);
@@ -159,10 +149,6 @@ export class Persist extends EventEmitter {
this.tooltipsEnabled = !!newValue && newValue.toLowerCase() == 'true'; this.tooltipsEnabled = !!newValue && newValue.toLowerCase() == 'true';
this.emit('tooltips', this.tooltipsEnabled); this.emit('tooltips', this.tooltipsEnabled);
break; break;
case LS_KEY_MODULE_RESISTANCES:
this.moduleResistancesEnabled = !!newValue && newValue.toLowerCase() == 'true';
this.emit('moduleresistances', this.moduleResistancesEnabled);
break;
case LS_KEY_ROLLS: case LS_KEY_ROLLS:
this.matsPerGrade = JSON.parse(newValue); this.matsPerGrade = JSON.parse(newValue);
this.emit('matsPerGrade', this.matsPerGrade); this.emit('matsPerGrade', this.matsPerGrade);
@@ -207,21 +193,6 @@ export class Persist extends EventEmitter {
return this.tooltipsEnabled; return this.tooltipsEnabled;
} }
/**
* Show module resistances setting
* @param {boolean} show Optional - update setting
* @return {boolean} True if module resistances should be shown
*/
showModuleResistances(show) {
if (show !== undefined) {
this.moduleResistancesEnabled = !!show;
_put(LS_KEY_MODULE_RESISTANCES, this.moduleResistancesEnabled);
this.emit('moduleresistances', this.moduleResistancesEnabled);
}
return this.moduleResistancesEnabled;
}
/** /**
* Persist a ship build in local storage. * Persist a ship build in local storage.
* *
@@ -310,97 +281,16 @@ export class Persist extends EventEmitter {
delete this.builds[shipId]; delete this.builds[shipId];
} }
_put(LS_KEY_BUILDS, this.builds); _put(LS_KEY_BUILDS, this.builds);
// Check if the build was used in existing comparisons
let comps = this.comparisons;
for (let c in comps) {
for (let i = 0; i < comps[c].builds.length; i++) { // For all builds in the current comparison
if (comps[c].builds[i].shipId == shipId && comps[c].builds[i].buildName == name) {
comps[c].builds.splice(i, 1);
break; // A build is unique per comparison
}
}
}
_put(LS_KEY_COMPARISONS, this.comparisons);
this.emit('builds'); this.emit('builds');
} }
} }
/** /**
* Persist a comparison in localstorage. * Delete all builds from localStorage
*
* @param {String} name The name of the comparison
* @param {array} builds Array of builds
* @param {array} facets Array of facet indices
*/
saveComparison(name, builds, facets) {
if (!this.comparisons[name]) {
this.comparisons[name] = {};
}
this.comparisons[name] = {
facets,
builds: builds.map(b => { return { shipId: b.id || b.shipId, buildName: b.buildName }; })
};
_put(LS_KEY_COMPARISONS, this.comparisons);
this.emit('comparisons');
}
/**
* Get a comparison
* @param {String} name Comparison name
* @return {Object} Object containing array of facets and ship id + build names
*/
getComparison(name) {
if (this.comparisons[name]) {
return this.comparisons[name];
}
return null;
}
/**
* Get all saved comparisons
* @return {Object} All comparisons
*/
getComparisons() {
return this.comparisons;
}
/**
* Check if a comparison has been saved
* @param {String} name Comparison name
* @return {Boolean} True if a comparison has been saved
*/
hasComparison(name) {
return !!this.comparisons[name];
}
/**
* Check if any comparisons have been saved
* @return {Boolean} True if any comparisons have been saved
*/
hasComparisons() {
return Object.keys(this.comparisons).length > 0;
}
/**
* Removes the comparison from localstorage.
* @param {String} name Comparison name
*/
deleteComparison(name) {
if (this.comparisons[name]) {
delete this.comparisons[name];
_put(LS_KEY_COMPARISONS, this.comparisons);
this.emit('comparisons');
}
}
/**
* Delete all builds and comparisons from localStorage
*/ */
deleteAll() { deleteAll() {
this.builds = {}; this.builds = {};
this.comparisons = {};
_put(LS_KEY_BUILDS, {}); _put(LS_KEY_BUILDS, {});
_put(LS_KEY_COMPARISONS, {});
this.emit('deletedAll'); this.emit('deletedAll');
} }
@@ -411,7 +301,6 @@ export class Persist extends EventEmitter {
getAll() { getAll() {
let data = {}; let data = {};
data[LS_KEY_BUILDS] = this.getBuilds(); data[LS_KEY_BUILDS] = this.getBuilds();
data[LS_KEY_COMPARISONS] = this.getComparisons();
data[LS_KEY_INSURANCE] = this.getInsurance(); data[LS_KEY_INSURANCE] = this.getInsurance();
data[LS_KEY_SHIP_DISCOUNT] = this.shipDiscount; data[LS_KEY_SHIP_DISCOUNT] = this.shipDiscount;
data[LS_KEY_MOD_DISCOUNT] = this.moduleDiscount; data[LS_KEY_MOD_DISCOUNT] = this.moduleDiscount;

View File

@@ -1,50 +0,0 @@
/**
* Generate a BBCode (Forum) compatible table from comparisons
* @param {Function} translate Translate language function
* @param {object} formats Number Formats
* @param {array} facets Ship Facets
* @param {object} builds Ship builds
* @param {string} link Link to the comparison
* @return {string} the BBCode
*/
export function comparisonBBCode(translate, formats, facets, builds, link) {
let colCount = 2, b, i, j, k, f, fl, p, pl, l = [];
for (i = 0; i < facets.length; i++) {
if (facets[i].active) {
f = facets[i];
p = f.props;
if (p.length == 1) {
l.push('[th][B][COLOR=#FF8C0D]', translate(f.title).toUpperCase(), '[/COLOR][/B][/th]');
colCount++;
} else {
for (j = 0; j < p.length; j++) {
l.push('[th][B][COLOR=#FF8C0D]', translate(f.title).toUpperCase(), '\n', translate(f.lbls[j]).toUpperCase(), '[/COLOR][/B][/th]');
colCount++;
}
}
}
}
l.push('[/tr]\n');
for (i = 0; i < builds.length; i++) {
b = builds[i];
l.push('[tr][td]', b.name, '[/td][td]', b.buildName, '[/td]');
for (j = 0, fl = facets.length; j < fl; j++) {
if (facets[j].active) {
f = facets[j];
p = f.props;
for (k = 0, pl = p.length; k < pl; k++) {
l.push('[td="align: right"]', formats[f.fmt](b[p[k]]), ' [size=-2]', translate(f.unit), '[/size][/td]');
}
}
}
l.push('[/tr]\n');
}
l.push('[tr][td="align: center, colspan:', colCount, '"][size=-3]\n[url=', link, ']Interactive Comparison at Coriolis.io[/url][/td][/tr]\n[/size][/table]');
l.unshift('[table="width:', colCount * 90, ',align: center"]\n[tr][th][B][COLOR=#FF8C0D]Ship[/COLOR][/B][/th][th][B][COLOR="#FF8C0D"]Build[/COLOR][/B][/th]');
return l.join('');
}

View File

@@ -1,61 +1,60 @@
import React from 'react'; import React from 'react';
import { Modifications } from 'coriolis-data/dist'; import { Module } from 'ed-forge';
import { STATS_FORMATTING } from '../shipyard/StatsFormatting'; import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/src/data/blueprints';
import { fromPairs, keys, uniq } from 'lodash';
/**
*
* @param {Module} module Module to get modifiers for
* @param {string[]} props Properties to get modifiers for
* @returns {React.Component[]} Table-cell modifiers
*/
function _getModifiers(formats, module, props) {
return fromPairs(props.map((prop) => {
const { value, unit, beneficial } = module.getModifierFormatted(prop);
return [
prop,
<td className={beneficial === undefined ? '' : beneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
{formats.round(value || 0)}{unit}
</td>
];
}));
}
/** /**
* Generate a tooltip with details of a blueprint's specials * Generate a tooltip with details of a blueprint's specials
* @param {Object} translate The translate object * @param {Object} language The translate object
* @param {Object} blueprint The blueprint at the required grade * @param {Module} m The module to compare with
* @param {string} grp The group of the module
* @param {Object} m The module to compare with
* @param {string} specialName The name of the special * @param {string} specialName The name of the special
* @returns {Object} The react components * @returns {Object} The react components
*/ */
export function specialToolTip(translate, blueprint, grp, m, specialName) { export function specialToolTip(language, m, specialName) {
const effects = []; const { formats, translate } = language;
if (!blueprint || !blueprint.features) { const features = keys(getExperimentalInfo(specialName).features);
return undefined; const currents = _getModifiers(formats, m, features);
} const thens = m.try(() => {
if (m) { m.setExperimental(specialName);
// We also add in any benefits from specials that aren't covered above return _getModifiers(formats, m, features);
if (m.blueprint) { });
for (const feature in Modifications.modifierActions[specialName]) {
// if (!blueprint.features[feature] && !m.mods.feature) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature) - m.getModValue(feature, true);
if (featureDef.type === 'percentage') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature + '_specialTT'}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'}
style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
}
return ( return (
<div> <div>
<table width='100%'> <table width='100%'>
<thead>
<tr>
<td>{translate('feature')}</td>
<td>{translate('current')}</td>
<td>{translate('then')}</td>
</tr>
</thead>
<tbody> <tbody>
{effects} {features.map((prop) => {
return <tr key={prop + '_specialTT'}>
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
{currents[prop]}
{thens[prop]}
</tr>;
}
)}
</tbody> </tbody>
</table> </table>
</div> </div>
@@ -63,154 +62,33 @@ export function specialToolTip(translate, blueprint, grp, m, specialName) {
} }
/** /**
* Generate a tooltip with details of a blueprint's effects * Generate a tooltip with details and preview of a blueprint's effects
* @param {Object} translate The translate object * @param {Object} language The language object
* @param {Object} blueprint The blueprint at the required grade * @param {Module} m The module to compare with
* @param {Array} engineers The engineers supplying this blueprint * @param {string} previewBP Blueprint to preview
* @param {string} grp The group of the module * @param {number} previewGrade Grade to preview
* @param {Object} m The module to compare with * @returns {Object} The react components
* @returns {Object} The react components
*/ */
export function blueprintTooltip(translate, blueprint, engineers, grp, m) { export function blueprintTooltip(language, m, previewBP, previewGrade) {
const effects = []; const { translate, formats } = language;
if (!blueprint || !blueprint.features) { const blueprint = previewBP || m.getBlueprint();
return undefined; const grade = previewGrade || m.getBlueprintGrade();
} if (!blueprint) {
for (const feature in blueprint.features) { return null;
const featureIsBeneficial = isBeneficial(feature, blueprint.features[feature]);
const featureDef = Modifications.modifications[feature];
if (!featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let lowerBound = blueprint.features[feature][0];
let upperBound = blueprint.features[feature][1];
if (featureDef.type === 'percentage') {
lowerBound = Math.round(lowerBound * 1000) / 10;
upperBound = Math.round(upperBound * 1000) / 10;
}
const lowerIsBeneficial = isValueBeneficial(feature, lowerBound);
const upperIsBeneficial = isValueBeneficial(feature, upperBound);
if (m) {
// We have a module - add in the current value
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
</tr>
);
} else {
// We do not have a module, no value
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
</tr>
);
}
}
}
if (m) {
// Because we have a module add in any benefits that aren't part of the primary blueprint
for (const feature in m.mods) {
if (!blueprint.features[feature]) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
// We also add in any benefits from specials that aren't covered above
if (m.blueprint && m.blueprint.special) {
for (const feature in Modifications.modifierActions[m.blueprint.special.edname]) {
if (!blueprint.features[feature] && !m.mods.feature) {
const featureDef = Modifications.modifications[feature];
if (featureDef && !featureDef.hidden) {
let symbol = '';
if (feature === 'jitter') {
symbol = '°';
} else if (featureDef.type === 'percentage') {
symbol = '%';
}
let current = m.getModValue(feature);
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
current = Math.round(current / 10) / 10;
} else if (featureDef.type === 'numeric') {
current /= 100;
}
const currentIsBeneficial = isValueBeneficial(feature, current);
effects.push(
<tr key={feature}>
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
<td>&nbsp;</td>
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
<td>&nbsp;</td>
</tr>
);
}
}
}
}
} }
let components; const features = uniq(m.getModifiedProperties().concat(
if (!m) { keys(getBlueprintInfo(blueprint).features[grade])
components = []; ));
for (const component in blueprint.components) { const mins = m.try(() => {
components.push( m.setBlueprint(blueprint, grade, 0);
<tr key={component}> return _getModifiers(formats, m, features);
<td style={{ textAlign: 'left' }}>{translate(component)}</td> });
<td style={{ textAlign: 'right' }}>{blueprint.components[component]}</td> const currents = _getModifiers(formats, m, features);
</tr> const maxs = m.try(() => {
); m.setBlueprint(blueprint, grade, 1);
} return _getModifiers(formats, m, features);
} });
let engineersList;
if (engineers) {
engineersList = [];
for (const engineer of engineers) {
engineersList.push(
<tr key={engineer}>
<td style={{ textAlign: 'left' }}>{engineer}</td>
</tr>
);
}
}
return ( return (
<div> <div>
@@ -219,217 +97,21 @@ export function blueprintTooltip(translate, blueprint, engineers, grp, m) {
<tr> <tr>
<td>{translate('feature')}</td> <td>{translate('feature')}</td>
<td>{translate('worst')}</td> <td>{translate('worst')}</td>
{m ? <td>{translate('current')}</td> : null } <td>{translate('current')}</td>
<td>{translate('best')}</td> <td>{translate('best')}</td>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{effects} {features.map((prop) => {
return (<tr key={prop}>
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
{mins[prop]}
{currents[prop]}
{maxs[prop]}
</tr>);
})}
</tbody> </tbody>
</table> </table>
{ components ? <table width='100%'>
<thead>
<tr>
<td>{translate('component')}</td>
<td>{translate('amount')}</td>
</tr>
</thead>
<tbody>
{components}
</tbody>
</table> : null }
{ engineersList ? <table width='100%'>
<thead>
<tr>
<td>{translate('engineers')}</td>
</tr>
</thead>
<tbody>
{engineersList}
</tbody>
</table> : null }
</div> </div>
); );
} }
/**
* Is this blueprint feature beneficial?
* @param {string} feature The name of the feature
* @param {array} values The value of the feature
* @returns {boolean} True if this feature is beneficial
*/
export function isBeneficial(feature, values) {
const fact = (values[0] < 0 || (values[0] === 0 && values[1] < 0));
if (Modifications.modifications[feature].higherbetter) {
return !fact;
} else {
return fact;
}
}
/**
* Is this feature value beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature
* @returns {boolean} True if this value is beneficial
*/
export function isValueBeneficial(feature, value) {
if (Modifications.modifications[feature].higherbetter) {
return value > 0;
} else {
return value < 0;
}
}
/**
* Is the change as shown beneficial?
* @param {string} feature The name of the feature
* @param {number} value The value of the feature as percentage change
* @returns True if the value is beneficial
*/
export function isChangeValueBeneficial(feature, value) {
let changeHigherBetter = STATS_FORMATTING[feature].higherbetter;
if (changeHigherBetter === undefined) {
return isValueBeneficial(feature, value);
}
if (changeHigherBetter) {
return value > 0;
} else {
return value < 0;
}
}
/**
* Get a blueprint with a given name and an optional module
* @param {string} name The name of the blueprint
* @param {Object} module The module for which to obtain this blueprint
* @returns {Object} The matching blueprint
*/
export function getBlueprint(name, module) {
// Start with a copy of the blueprint
const findMod = val => Object.keys(Modifications.blueprints).find(elem => elem.toString().toLowerCase().search(val.toString().toLowerCase().replace(/(OutfittingFieldType_|persecond)/igm, '')) >= 0);
const found = Modifications.blueprints[findMod(name)];
if (!found || !found.fdname) {
return {};
}
const blueprint = JSON.parse(JSON.stringify(found));
return blueprint;
}
/**
* Provide 'percent' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
* @param {Number} percent The percent to set values to of full.
*/
export function setPercent(ship, m, percent) {
ship.clearModifications(m);
// Pick given value as multiplier
const mult = percent / 100;
const features = m.blueprint.grades[m.blueprint.grade].features;
for (const featureName in features) {
let value;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
} else {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
} else {
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
}
}
_setValue(ship, m, featureName, value);
}
}
/**
* Provide 'random' primary modifications
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
*/
export function setRandom(ship, m) {
// Pick a single value for our randomness
setPercent(ship, m, Math.random() * 100);
}
/**
* Set a modification feature value
* @param {Object} ship The ship for which to perform the modifications
* @param {Object} m The module for which to perform the modifications
* @param {string} featureName The feature being set
* @param {number} value The value being set for the feature
*/
function _setValue(ship, m, featureName, value) {
if (Modifications.modifications[featureName].type == 'percentage') {
ship.setModification(m, featureName, value * 10000);
} else if (Modifications.modifications[featureName].type == 'numeric') {
ship.setModification(m, featureName, value * 100);
} else {
ship.setModification(m, featureName, value);
}
}
/**
* Provide 'percent' primary query
* @param {Object} m The module for which to perform the query
* @returns {Number} percent The percentage indicator of current applied values.
*/
export function getPercent(m) {
let result = null;
const features = m.blueprint.grades[m.blueprint.grade].features;
for (const featureName in features) {
if (features[featureName][0] === features[featureName][1]) {
continue;
}
let value = _getValue(m, featureName);
let mult;
if (Modifications.modifications[featureName].higherbetter) {
// Higher is better, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
} else {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
}
} else {
// Higher is worse, but is this making it better or worse?
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
} else {
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
}
}
if (result && result != mult) {
return null;
} else if (result != mult) {
result = mult;
}
}
return result;
}
/**
* Query a feature value
* @param {Object} m The module for which to perform the query
* @param {string} featureName The feature being queried
* @returns {number} The value of the modification as a %
*/
function _getValue(m, featureName) {
if (Modifications.modifications[featureName].type == 'percentage') {
return m.getModValue(featureName, true) / 10000;
} else if (Modifications.modifications[featureName].type == 'numeric') {
return m.getModValue(featureName, true) / 100;
} else {
return m.getModValue(featureName, true);
}
}

View File

@@ -1,470 +0,0 @@
import React from 'react';
import { Modifications, Modules, Ships } from 'coriolis-data/dist';
import Module from '../shipyard/Module';
import Ship from '../shipyard/Ship';
import { getBlueprint } from '../utils/BlueprintFunctions';
import * as ModuleUtils from '../shipyard/ModuleUtils';
// mapping from fd's ship model names to coriolis'
export const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
'Adder': 'adder',
'Anaconda': 'anaconda',
'Asp': 'asp',
'Asp_Scout': 'asp_scout',
'BelugaLiner': 'beluga',
'CobraMkIII': 'cobra_mk_iii',
'CobraMkIV': 'cobra_mk_iv',
'Cutter': 'imperial_cutter',
'DiamondBackXL': 'diamondback_explorer',
'DiamondBack': 'diamondback',
'Dolphin': 'dolphin',
'Eagle': 'eagle',
'Empire_Courier': 'imperial_courier',
'Empire_Eagle': 'imperial_eagle',
'Empire_Trader': 'imperial_clipper',
'Federation_Corvette': 'federal_corvette',
'Federation_Dropship': 'federal_dropship',
'Federation_Dropship_MkII': 'federal_assault_ship',
'Federation_Gunship': 'federal_gunship',
'FerDeLance': 'fer_de_lance',
'Hauler': 'hauler',
'Independant_Trader': 'keelback',
'Krait_MkII': 'krait_mkii',
'Mamba': 'mamba',
'Krait_Light': 'krait_phantom',
'Orca': 'orca',
'Python': 'python',
'SideWinder': 'sidewinder',
'Type6': 'type_6_transporter',
'Type7': 'type_7_transport',
'Type9': 'type_9_heavy',
'Type9_Military': 'type_10_defender',
'TypeX': 'alliance_chieftain',
'TypeX_2': 'alliance_crusader',
'TypeX_3': 'alliance_challenger',
'Viper': 'viper',
'Viper_MkIV': 'viper_mk_iv',
'Vulture': 'vulture'
};
// Mapping from hardpoint class to name in companion API
export const HARDPOINT_NUM_TO_CLASS = {
0: 'Tiny',
1: 'Small',
2: 'Medium',
3: 'Large',
4: 'Huge'
};
/**
* Obtain a module given its ED ID
* @param {Integer} edId the Elite ID of the module
* @return {Module} the module
*/
function _moduleFromEdId(edId) {
if (!edId) return null;
// Check standard modules
for (const grp in Modules.standard) {
if (Modules.standard.hasOwnProperty(grp)) {
for (const i in Modules.standard[grp]) {
if (Modules.standard[grp][i].edID === edId) {
// Found it
return new Module({ template: Modules.standard[grp][i] });
}
}
}
}
// Check hardpoint modules
for (const grp in Modules.hardpoints) {
if (Modules.hardpoints.hasOwnProperty(grp)) {
for (const i in Modules.hardpoints[grp]) {
if (Modules.hardpoints[grp][i].edID === edId) {
// Found it
return new Module({ template: Modules.hardpoints[grp][i] });
}
}
}
}
// Check internal modules
for (const grp in Modules.internal) {
if (Modules.internal.hasOwnProperty(grp)) {
for (const i in Modules.internal[grp]) {
if (Modules.internal[grp][i].edID === edId) {
// Found it
return new Module({ template: Modules.internal[grp][i] });
}
}
}
}
// Not found
return null;
}
/**
* Obtain the model of a ship given its ED name
* @param {string} edName the Elite name of the ship
* @return {string} the Coriolis model of the ship
*/
function _shipModelFromEDName(edName) {
return SHIP_FD_NAME_TO_CORIOLIS_NAME[Object.keys(SHIP_FD_NAME_TO_CORIOLIS_NAME).find(elem => elem.toLowerCase() === edName.toLowerCase())];
}
/**
* Obtain a ship's model from the companion API JSON
* @param {object} json the companion API JSON
* @return {string} the Coriolis model of the ship
*/
export function shipModelFromJson(json) {
return _shipModelFromEDName(json.name || json.Ship);
}
/**
* Build a ship from the companion API JSON
* @param {object} json the companion API JSON
* @return {Ship} the built ship
*/
export function shipFromJson(json) {
// Start off building a basic ship
const shipModel = shipModelFromJson(json);
if (!shipModel) {
throw 'No such ship found: "' + json.name + '"';
}
const shipTemplate = Ships[shipModel];
let ship = new Ship(shipModel, shipTemplate.properties, shipTemplate.slots);
ship.buildWith(null);
// Set the cargo hatch
if (json.modules.CargoHatch) {
ship.cargoHatch.enabled = json.modules.CargoHatch.module.on == true;
ship.cargoHatch.priority = json.modules.CargoHatch.module.priority;
} else {
// We don't have any information on it so guess it's priority 5 and disabled
ship.cargoHatch.enabled = false;
ship.cargoHatch.priority = 4;
}
let rootModule;
// Add the bulkheads
const armourJson = json.modules.Armour.module;
if (armourJson.name.toLowerCase().endsWith('_armour_grade1')) {
ship.useBulkhead(0, true);
} else if (armourJson.name.toLowerCase().endsWith('_armour_grade2')) {
ship.useBulkhead(1, true);
} else if (armourJson.name.toLowerCase().endsWith('_armour_grade3')) {
ship.useBulkhead(2, true);
} else if (armourJson.name.toLowerCase().endsWith('_armour_mirrored')) {
ship.useBulkhead(3, true);
} else if (armourJson.name.toLowerCase().endsWith('_armour_reactive')) {
ship.useBulkhead(4, true);
} else {
throw 'Unknown bulkheads "' + armourJson.name + '"';
}
ship.bulkheads.enabled = true;
rootModule = json.modules.Armour;
if (rootModule.WorkInProgress_modifications) _addModifications(ship.bulkheads.m, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
// Add the standard modules
// Power plant
const powerplantJson = json.modules.PowerPlant.module;
const powerplant = _moduleFromEdId(powerplantJson.id);
rootModule = json.modules.PowerPlant;
if (rootModule.WorkInProgress_modifications) _addModifications(powerplant, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[0], powerplant, true);
ship.standard[0].enabled = powerplantJson.on === true;
ship.standard[0].priority = powerplantJson.priority;
// Thrusters
const thrustersJson = json.modules.MainEngines.module;
const thrusters = _moduleFromEdId(thrustersJson.id);
rootModule = json.modules.MainEngines;
if (rootModule.WorkInProgress_modifications) _addModifications(thrusters, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[1], thrusters, true);
ship.standard[1].enabled = thrustersJson.on === true;
ship.standard[1].priority = thrustersJson.priority;
// FSD
const frameshiftdriveJson = json.modules.FrameShiftDrive.module;
const frameshiftdrive = _moduleFromEdId(frameshiftdriveJson.id);
rootModule = json.modules.FrameShiftDrive;
if (rootModule.WorkInProgress_modifications) _addModifications(frameshiftdrive, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[2], frameshiftdrive, true);
ship.standard[2].enabled = frameshiftdriveJson.on === true;
ship.standard[2].priority = frameshiftdriveJson.priority;
// Life support
const lifesupportJson = json.modules.LifeSupport.module;
const lifesupport = _moduleFromEdId(lifesupportJson.id);
rootModule = json.modules.LifeSupport;
if (rootModule.WorkInProgress_modifications) _addModifications(lifesupport, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[3], lifesupport, true);
ship.standard[3].enabled = lifesupportJson.on === true;
ship.standard[3].priority = lifesupportJson.priority;
// Power distributor
const powerdistributorJson = json.modules.PowerDistributor.module;
const powerdistributor = _moduleFromEdId(powerdistributorJson.id);
rootModule = json.modules.PowerDistributor;
if (rootModule.WorkInProgress_modifications) _addModifications(powerdistributor, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[4], powerdistributor, true);
ship.standard[4].enabled = powerdistributorJson.on === true;
ship.standard[4].priority = powerdistributorJson.priority;
// Sensors
const sensorsJson = json.modules.Radar.module;
const sensors = _moduleFromEdId(sensorsJson.id);
rootModule = json.modules.Radar;
if (rootModule.WorkInProgress_modifications) _addModifications(sensors, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.standard[5], sensors, true);
ship.standard[5].enabled = sensorsJson.on === true;
ship.standard[5].priority = sensorsJson.priority;
// Fuel tank
const fueltankJson = json.modules.FuelTank.module;
const fueltank = _moduleFromEdId(fueltankJson.id);
ship.use(ship.standard[6], fueltank, true);
ship.standard[6].enabled = true;
ship.standard[6].priority = 0;
// Add hardpoints
let hardpointClassNum = -1;
let hardpointSlotNum = -1;
let hardpointArrayNum = 0;
for (let i in shipTemplate.slots.hardpoints) {
if (shipTemplate.slots.hardpoints[i] === hardpointClassNum) {
// Another slot of the same class
hardpointSlotNum++;
} else {
// The first slot of a new class
hardpointClassNum = shipTemplate.slots.hardpoints[i];
hardpointSlotNum = 1;
}
// Now that we know what we're looking for, find it
const hardpointName = HARDPOINT_NUM_TO_CLASS[hardpointClassNum] + 'Hardpoint' + hardpointSlotNum;
const hardpointSlot = json.modules[hardpointName];
if (!hardpointSlot) {
// This can happen with old imports that don't contain new hardpoints
} else if (!hardpointSlot.module) {
// No module
} else {
const hardpointJson = hardpointSlot.module;
const hardpoint = _moduleFromEdId(hardpointJson.id);
rootModule = hardpointSlot;
if (rootModule.WorkInProgress_modifications) _addModifications(hardpoint, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel, rootModule.specialModifications);
ship.use(ship.hardpoints[hardpointArrayNum], hardpoint, true);
ship.hardpoints[hardpointArrayNum].enabled = hardpointJson.on === true;
ship.hardpoints[hardpointArrayNum].priority = hardpointJson.priority;
}
hardpointArrayNum++;
}
// Add internal compartments
let internalSlotNum = 1;
let militarySlotNum = 1;
for (let i in shipTemplate.slots.internal) {
const isMilitary = isNaN(shipTemplate.slots.internal[i]) ? shipTemplate.slots.internal[i].name == 'Military' : false;
// The internal slot might be a standard or a military slot. Military slots have a different naming system
let internalSlot = null;
if (isMilitary) {
const internalName = 'Military0' + militarySlotNum;
internalSlot = json.modules[internalName];
militarySlotNum++;
} else {
// Slot numbers are not contiguous so handle skips.
while (internalSlot === null && internalSlotNum < 99) {
// Slot sizes have no relationship to the actual size, either, so check all possibilities
for (let slotsize = 0; slotsize < 9; slotsize++) {
const internalName = 'Slot' + (internalSlotNum <= 9 ? '0' : '') + internalSlotNum + '_Size' + slotsize;
if (json.modules[internalName]) {
internalSlot = json.modules[internalName];
break;
}
}
internalSlotNum++;
}
}
if (!internalSlot) {
// This can happen with old imports that don't contain new slots
} else if (!internalSlot.module) {
// No module
} else {
const internalJson = internalSlot.module;
const internal = _moduleFromEdId(internalJson.id);
rootModule = internalSlot;
if (rootModule.WorkInProgress_modifications) _addModifications(internal, rootModule.WorkInProgress_modifications, rootModule.engineer.recipeName, rootModule.engineer.recipeLevel);
ship.use(ship.internal[i], internal, true);
ship.internal[i].enabled = internalJson.on === true;
ship.internal[i].priority = internalJson.priority;
}
}
// Now update the ship's codes before returning it
return ship.updatePowerPrioritesString().updatePowerEnabledString().updateModificationsString();
}
/**
* Add the modifications for a module
* @param {Module} module the module
* @param {Object} modifiers the modifiers
* @param {Object} blueprint the blueprint of the modification
* @param {Object} grade the grade of the modification
* @param {Object} specialModifications special modification
*/
function _addModifications(module, modifiers, blueprint, grade, specialModifications) {
if (!modifiers) return;
let special;
if (specialModifications) {
special = Modifications.specials[Object.keys(specialModifications)[0]];
}
for (const i in modifiers) {
// Some special modifications
if (modifiers[i].name === 'mod_weapon_clip_size_override') {
// This is a numeric addition to the clip size, but we need to work it out in terms of being a percentage so
// that it works the same as other modifications
const origClip = module.clip || 1;
module.setModValue('clip', ((modifiers[i].value - origClip) / origClip) * 10000);
} else if (modifiers[i].name === 'mod_weapon_burst_size') {
// This is an absolute number that acts as an override
module.setModValue('burst', modifiers[i].value * 100);
} else if (modifiers[i].name === 'mod_weapon_burst_rof') {
// This is an absolute number that acts as an override
module.setModValue('burstrof', modifiers[i].value * 100);
} else if (modifiers[i].name === 'mod_weapon_falloffrange_from_range') {
// Obtain the falloff value directly from the range
module.setModValue('fallofffromrange', 1);
} else if (modifiers[i].name && modifiers[i].name.startsWith('special_')) {
// We don't add special effects directly, but keep a note of them so they can be added when fetching values
special = Modifications.specials[modifiers[i].name];
} else {
// Look up the modifiers to find what we need to do
const modifierActions = Modifications.modifierActions[i];
let value;
if (i === 'OutfittingFieldType_DefenceModifierShieldMultiplier') {
value = modifiers[i].value - 1;
} else if (i === 'OutfittingFieldType_DefenceModifierHealthMultiplier' && blueprint.startsWith('Armour_')) {
value = (modifiers[i].value - module.hullboost) / module.hullboost;
} else if (i === 'OutfittingFieldType_DefenceModifierHealthMultiplier') {
value = modifiers[i].value / module.hullboost;
} else if (i === 'OutfittingFieldType_RateOfFire') {
value = (1 / Math.abs(modifiers[i].value));
} else {
value = modifiers[i].value - 1;
}
// Carry out the required changes
for (const action in modifierActions) {
if (isNaN(modifierActions[action])) {
module.setModValue(action, modifierActions[action]);
} else {
const actionValue = modifierActions[action] * value;
let mod = module.getModValue(action) / 10000;
if (!mod) {
mod = 0;
}
module.setModValue(action, ((1 + mod) * (1 + actionValue) - 1) * 10000);
}
}
}
}
// Add the blueprint definition, grade and special
if (blueprint) {
module.blueprint = getBlueprint(blueprint, module);
if (grade) {
module.blueprint.grade = Number(grade);
}
if (special) {
module.blueprint.special = special;
}
}
// Need to fix up a few items
// Shield boosters are treated internally as straight modifiers, so rather than (for example)
// being a 4% boost they are a 104% multiplier. Unfortunately this means that our % modification
// is incorrect so we fix it
if (module.grp === 'sb' && module.getModValue('shieldboost')) {
const alteredBoost = (1 + module.shieldboost) * (module.getModValue('shieldboost') / 10000);
module.setModValue('shieldboost', alteredBoost * 10000 / module.shieldboost);
}
// Shield booster resistance is actually a damage modifier, so needs to be inverted.
if (module.grp === 'sb') {
if (module.getModValue('explres')) {
module.setModValue('explres', ((module.getModValue('explres') / 10000) * -1) * 10000);
}
if (module.getModValue('kinres')) {
module.setModValue('kinres', ((module.getModValue('kinres') / 10000) * -1) * 10000);
}
if (module.getModValue('thermres')) {
module.setModValue('thermres', ((module.getModValue('thermres') / 10000) * -1) * 10000);
}
}
// Shield generator resistance is actually a damage modifier, so needs to be inverted.
// In addition, the modification is based off the inherent resistance of the module
if (ModuleUtils.isShieldGenerator(module.grp)) {
if (module.getModValue('explres')) {
module.setModValue('explres', ((1 - (1 - module.explres) * (1 + module.getModValue('explres') / 10000)) - module.explres) * 10000);
}
if (module.getModValue('kinres')) {
module.setModValue('kinres', ((1 - (1 - module.kinres) * (1 + module.getModValue('kinres') / 10000)) - module.kinres) * 10000);
}
if (module.getModValue('thermres')) {
module.setModValue('thermres', ((1 - (1 - module.thermres) * (1 + module.getModValue('thermres') / 10000)) - module.thermres) * 10000);
}
}
// Hull reinforcement package resistance is actually a damage modifier, so needs to be inverted.
// In addition, the modification is based off the inherent resistance of the module
if (module.grp === 'hr') {
if (module.getModValue('explres')) {
module.setModValue('explres', ((1 - (1 - module.explres) * (1 + module.getModValue('explres') / 10000)) - module.explres) * 10000);
}
if (module.getModValue('kinres')) {
module.setModValue('kinres', ((1 - (1 - module.kinres) * (1 + module.getModValue('kinres') / 10000)) - module.kinres) * 10000);
}
if (module.getModValue('thermres')) {
module.setModValue('thermres', ((1 - (1 - module.thermres) * (1 + module.getModValue('thermres') / 10000)) - module.thermres) * 10000);
}
}
// Bulkhead resistance is actually a damage modifier, so needs to be inverted.
// In addition, the modification is based off the inherent resistance of the module
if (module.grp == 'bh') {
if (module.getModValue('explres')) {
module.setModValue('explres', ((1 - (1 - module.explres) * (1 + module.getModValue('explres') / 10000)) - module.explres) * 10000);
}
if (module.getModValue('kinres')) {
module.setModValue('kinres', ((1 - (1 - module.kinres) * (1 + module.getModValue('kinres') / 10000)) - module.kinres) * 10000);
}
if (module.getModValue('thermres')) {
module.setModValue('thermres', ((1 - (1 - module.thermres) * (1 + module.getModValue('thermres') / 10000)) - module.thermres) * 10000);
}
}
// Bulkhead boost is based off the inherent boost of the module
if (module.grp == 'bh') {
const alteredBoost = (1 + module.hullboost) * (1 + module.getModValue('hullboost') / 10000) - 1;
module.setModValue('hullboost', (alteredBoost / module.hullboost - 1) * 1000);
}
// Jitter is an absolute number, so we need to divide it by 100
if (module.getModValue('jitter')) {
module.setModValue('jitter', module.getModValue('jitter') / 100);
}
// Clip size is rounded up so that the result is a whole number
if (module.getModValue('clip')) {
const individual = 1 / (module.clip || 1);
module.setModValue('clip', Math.ceil((module.getModValue('clip') / 10000) / individual) * individual * 10000);
}
}

Some files were not shown because too many files have changed in this diff Show More