Compare commits

..

116 Commits

Author SHA1 Message Date
Alex Williams
016994c2eb Removing automation code merged in by github 2024-07-08 20:04:32 +01:00
Alex Williams
d2e7708fc9 Merge branch 'live' into make_modal_export_better 2024-07-08 20:00:01 +01:00
Alex Williams
93dc446e58 Merge branch 'beta' into make_modal_export_better 2024-07-08 18:56:46 +01:00
Alex Williams
15fbf2c96d Improved Modal UI, updated text, restored roll boxes, fixed ED Engineer button hide/show/disable/enable 2024-07-08 18:55:08 +01:00
Alex Williams
b659606fff Beta to live (#25)
* Update pt.json - Brazilian Portuguese translations (#752)

* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation

* Updated PT-BR translation with Planetary Approach Suite

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fix changed files issue (#3)

* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files

* Adding workflow for autodeploy

* Improving workflow

* Changed deployment ordering

* Changing to clone single branch for deployment, not the whole repo

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4)

* Issue 754 imports need to be more graceful (#5)

* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR

* Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules

* Update PT-BR translations

Added translated strings for coriolis-data PRs 106 & 107

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

* Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Issue 703 edomh integration (#7)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

* Adding in buildname to EDOMH Export

* Issue 703 edomh integration (#8)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#9)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#10)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 764 unknown modules are selectable (#11)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Adding tag to manual dispatch of workflow

* Adding fix for broken Armour Module Selection

* Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH

* Removing Autodeploy from this branch, it was merged in by github

* Removing debugging console.log entries that are no longer needed for EDOMH fix

* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

* Making autodeploy aware of its target branch name (#16)

* Fixes for autodeploy (#17)

* Autodeploy fixes (#18)

* Fixes for autodeploy

* Adding npm start command to build dist from coriolis-data

* Removing unneccessary output lines from autodeploy (#19)

* Adding missing Constants for Advanced and Enhanced Weaponry (#20)

* Setting up definitive workflows, automatic for when coriolis is being updated, either on its own, or along with coriolis-data and manual, for when we've updated coriolis-data and need to re-deploy.

* Compartmentalising the build stages in the workflows.

* Fixed deployment steps

* deployment fix

* Deployment improvements and potential webpack fix

* Removing webpack change that made no difference.

* Changing deployment workflows to clear out old build before copying new build to web directory

* Supressing npm warnings in build process to avoid failure of the pipeline erroneously.

* Shifting node build to separate runner

* Fixing syntax in autodeploy

* issues with zipping

* Adding GCP Auth to download job

* Fixing unzipping process

* fixes for autodeploy

* zip path issues

* zip path

* rm command

* Fixes for broken EDEngineer button, plus styling changes to improve the modal popup for exporting builds. (#24)

---------

Co-authored-by: leonardofelin <33718368+leonardofelin@users.noreply.github.com>
Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-07-07 14:39:39 +01:00
Alex Williams
06a6048ec2 Fixes for broken EDEngineer button, plus styling changes to improve the modal popup for exporting builds. (#24) 2024-07-07 14:28:57 +01:00
David Sangrey
2362ded438 Merge pull request #768 from Brighter-Applications/develop
Fix missile rack glitch (#23)
2024-06-24 10:17:27 -04:00
Alex Williams
cb1612d828 Fix missile rack glitch (#23)
* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

* Adding autodeploy for live site

* Making autodeploy aware of its target branch name (#16)

* Fixes for autodeploy (#17)

* Autodeploy fixes (#18)

* Fixes for autodeploy

* Adding npm start command to build dist from coriolis-data

* Adding missing Constants for Advanced and Enhanced Weaponry

* Removing workflow code merged in by github
2024-06-22 17:55:16 +01:00
Alex Williams
bc1e332820 Beta (#22)
* Update pt.json - Brazilian Portuguese translations (#752)

* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation

* Updated PT-BR translation with Planetary Approach Suite

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fix changed files issue (#3)

* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files

* Adding workflow for autodeploy

* Improving workflow

* Changed deployment ordering

* Changing to clone single branch for deployment, not the whole repo

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4)

* Issue 754 imports need to be more graceful (#5)

* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR

* Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules

* Update PT-BR translations

Added translated strings for coriolis-data PRs 106 & 107

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

* Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Issue 703 edomh integration (#7)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

* Adding in buildname to EDOMH Export

* Issue 703 edomh integration (#8)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#9)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#10)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 764 unknown modules are selectable (#11)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Adding tag to manual dispatch of workflow

* Adding fix for broken Armour Module Selection

* Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH

* Removing Autodeploy from this branch, it was merged in by github

* Removing debugging console.log entries that are no longer needed for EDOMH fix

* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

* Making autodeploy aware of its target branch name (#16)

* Fixes for autodeploy (#17)

* Autodeploy fixes (#18)

* Fixes for autodeploy

* Adding npm start command to build dist from coriolis-data

* Removing unneccessary output lines from autodeploy (#19)

* Adding missing Constants for Advanced and Enhanced Weaponry (#20)

* Setting up definitive workflows, automatic for when coriolis is being updated, either on its own, or along with coriolis-data and manual, for when we've updated coriolis-data and need to re-deploy.

* Compartmentalising the build stages in the workflows.

* Fixed deployment steps

* deployment fix

* Deployment improvements and potential webpack fix

* Removing webpack change that made no difference.

* Changing deployment workflows to clear out old build before copying new build to web directory

* Supressing npm warnings in build process to avoid failure of the pipeline erroneously.

* Shifting node build to separate runner

* Fixing syntax in autodeploy

* issues with zipping

* Adding GCP Auth to download job

* Fixing unzipping process

* fixes for autodeploy

* zip path issues

* zip path

* rm command

---------

Co-authored-by: leonardofelin <33718368+leonardofelin@users.noreply.github.com>
Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-22 16:45:12 +01:00
Alex Williams
59d5ea0234 Merge branch 'live' into beta 2024-06-22 16:43:02 +01:00
Alex Williams
afd2bfe021 rm command 2024-06-22 16:28:26 +01:00
Alex Williams
cc177a9093 zip path 2024-06-22 16:25:32 +01:00
Alex Williams
4612500cef zip path issues 2024-06-22 16:17:49 +01:00
Alex Williams
9fadb721f3 fixes for autodeploy 2024-06-22 16:07:11 +01:00
Alex Williams
270394fed3 Fixing unzipping process 2024-06-22 15:56:24 +01:00
Alex Williams
b1c2b4efc1 Adding GCP Auth to download job 2024-06-22 15:51:22 +01:00
Alex Williams
108ac1ef18 issues with zipping 2024-06-22 15:40:16 +01:00
Alex Williams
31f15d9ae3 Fixing syntax in autodeploy 2024-06-22 15:28:22 +01:00
Alex Williams
e3aebd5a54 Shifting node build to separate runner 2024-06-22 15:20:48 +01:00
Alex Williams
c281cb8490 Supressing npm warnings in build process to avoid failure of the pipeline erroneously. 2024-06-22 11:14:25 +01:00
Alex Williams
2cb3dc02ae Changing deployment workflows to clear out old build before copying new build to web directory 2024-06-22 11:09:10 +01:00
Alex Williams
67012309aa Removing webpack change that made no difference. 2024-06-22 11:03:33 +01:00
Alex Williams
13d8423eb5 Deployment improvements and potential webpack fix 2024-06-22 10:48:20 +01:00
Alex Williams
f7cab2e96a deployment fix 2024-06-21 20:39:14 +01:00
Alex Williams
6b9969651c Fixed deployment steps 2024-06-21 20:36:25 +01:00
Alex Williams
fbee9e21a5 Compartmentalising the build stages in the workflows. 2024-06-21 20:19:36 +01:00
Alex Williams
2891130bad Setting up definitive workflows, automatic for when coriolis is being updated, either on its own, or along with coriolis-data and manual, for when we've updated coriolis-data and need to re-deploy. 2024-06-21 20:01:53 +01:00
Alex Williams
43b4eaa866 Beta (#21)
* Update pt.json - Brazilian Portuguese translations (#752)

* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation

* Updated PT-BR translation with Planetary Approach Suite

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fix changed files issue (#3)

* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files

* Adding workflow for autodeploy

* Improving workflow

* Changed deployment ordering

* Changing to clone single branch for deployment, not the whole repo

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4)

* Issue 754 imports need to be more graceful (#5)

* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR

* Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules

* Update PT-BR translations

Added translated strings for coriolis-data PRs 106 & 107

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

* Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Issue 703 edomh integration (#7)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

* Adding in buildname to EDOMH Export

* Issue 703 edomh integration (#8)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#9)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#10)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 764 unknown modules are selectable (#11)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Adding tag to manual dispatch of workflow

* Adding fix for broken Armour Module Selection

* Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH

* Removing Autodeploy from this branch, it was merged in by github

* Removing debugging console.log entries that are no longer needed for EDOMH fix

* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

* Making autodeploy aware of its target branch name (#16)

* Fixes for autodeploy (#17)

* Autodeploy fixes (#18)

* Fixes for autodeploy

* Adding npm start command to build dist from coriolis-data

* Removing unneccessary output lines from autodeploy (#19)

* Adding missing Constants for Advanced and Enhanced Weaponry (#20)

---------

Co-authored-by: leonardofelin <33718368+leonardofelin@users.noreply.github.com>
Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-21 13:15:06 +01:00
Alex Williams
d3a087f8df Merge branch 'live' into beta 2024-06-21 13:10:44 +01:00
Alex Williams
efc2972962 Adding missing Constants for Advanced and Enhanced Weaponry (#20) 2024-06-21 12:43:18 +01:00
Alex Williams
6c6b0f97a7 Removing unneccessary output lines from autodeploy (#19) 2024-06-21 09:36:56 +01:00
Alex Williams
8b0b50ff6c Autodeploy fixes (#18)
* Fixes for autodeploy

* Adding npm start command to build dist from coriolis-data
2024-06-21 09:32:20 +01:00
Alex Williams
36645fe18c Fixes for autodeploy (#17) 2024-06-21 09:24:15 +01:00
Alex Williams
b5b42ddb26 Making autodeploy aware of its target branch name (#16) 2024-06-21 09:09:05 +01:00
Alex Williams
b5f3693d0b Live, from Beta (#15)
* Update pt.json - Brazilian Portuguese translations (#752)

* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation

* Updated PT-BR translation with Planetary Approach Suite

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fix changed files issue (#3)

* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files

* Adding workflow for autodeploy

* Improving workflow

* Changed deployment ordering

* Changing to clone single branch for deployment, not the whole repo

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4)

* Issue 754 imports need to be more graceful (#5)

* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR

* Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules

* Update PT-BR translations

Added translated strings for coriolis-data PRs 106 & 107

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

* Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Issue 703 edomh integration (#7)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

* Adding in buildname to EDOMH Export

* Issue 703 edomh integration (#8)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#9)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#10)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 764 unknown modules are selectable (#11)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Adding tag to manual dispatch of workflow

* Adding fix for broken Armour Module Selection

* Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH

* Removing Autodeploy from this branch, it was merged in by github

* Removing debugging console.log entries that are no longer needed for EDOMH fix

* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

---------

Co-authored-by: leonardofelin <33718368+leonardofelin@users.noreply.github.com>
Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-21 00:09:16 +01:00
Alex Williams
b19a36e4e8 Merge Coriolis beta to live - beta.coriolis.io content to deploy on coriolis.io (#14)
* Update pt.json - Brazilian Portuguese translations (#752)

* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation

* Updated PT-BR translation with Planetary Approach Suite

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fix changed files issue (#3)

* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files

* Adding workflow for autodeploy

* Improving workflow

* Changed deployment ordering

* Changing to clone single branch for deployment, not the whole repo

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4)

* Issue 754 imports need to be more graceful (#5)

* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR

* Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules

* Update PT-BR translations

Added translated strings for coriolis-data PRs 106 & 107

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

* Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Issue 703 edomh integration (#7)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

* Adding in buildname to EDOMH Export

* Issue 703 edomh integration (#8)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#9)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 703 edomh integration (#10)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Issue 764 unknown modules are selectable (#11)

* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>

* Adding tag to manual dispatch of workflow

* Adding fix for broken Armour Module Selection

* Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH

* Removing Autodeploy from this branch, it was merged in by github

* Removing debugging console.log entries that are no longer needed for EDOMH fix

* Adding autodeploy for new 'beta' branch

* Fixing directory for beta deployment

* Updating beta autodeploy with nvm info

---------

Co-authored-by: leonardofelin <33718368+leonardofelin@users.noreply.github.com>
Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-20 23:55:46 +01:00
Alex Williams
69790d970a Merge branch 'live' into beta 2024-06-20 23:55:31 +01:00
Alex Williams
1fcacbd6dc Adding autodeploy for live site 2024-06-13 23:26:45 +01:00
Alex Williams
9443c85e1b Updating beta autodeploy with nvm info 2024-06-13 23:23:15 +01:00
Alex Williams
cf88c1655b Fixing directory for beta deployment 2024-06-13 23:16:39 +01:00
Alex Williams
213232a662 Adding autodeploy for new 'beta' branch 2024-06-13 23:13:46 +01:00
David Sangrey
4b5940e651 Merge pull request #767 from Brighter-Applications/Issue_703_EDOMH_integration
Issue 703 edomh integration
2024-06-09 17:24:50 -04:00
Alex Williams
06552dd860 Removing debugging console.log entries that are no longer needed for EDOMH fix 2024-06-07 18:24:57 +01:00
Alex Williams
ca91401507 Removing Autodeploy from this branch, it was merged in by github 2024-06-07 11:58:38 +01:00
Alex Williams
ed5ffbc9f8 Fixed issue with special blueprint item not being correctly jsonified for export to EDOMH 2024-06-07 11:58:38 +01:00
Alex Williams
45935b90e4 Adding fix for broken Armour Module Selection 2024-06-07 11:58:38 +01:00
Alex Williams
5d41575e66 Adding tag to manual dispatch of workflow 2024-06-07 11:58:38 +01:00
Alex Williams
b86e90de4b Issue 764 unknown modules are selectable (#11)
* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-07 11:58:38 +01:00
Alex Williams
105fc60f43 Issue 703 edomh integration (#10)
* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

* Removed console.log lines which were only needed for testing.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-07 11:58:11 +01:00
Alex Williams
7ccfa09ddd Issue 703 edomh integration (#9)
* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

* Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-07 11:58:11 +01:00
Alex Williams
ab3c93d52d Issue 703 edomh integration (#8)
* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

* Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-07 11:57:22 +01:00
Alex Williams
ee04416e2b Adding in buildname to EDOMH Export 2024-06-07 11:57:22 +01:00
Alex Williams
4efc47dff0 Removed console.log lines which were only needed for testing. 2024-06-07 11:56:42 +01:00
Alex Williams
bd2e6eaf51 Fixed miscalculation of mats and got rid of unhelpful 'rolls' table, as the mats are calculated for the whole build and some blueprints may not be all the way up to g5. 2024-06-07 11:56:42 +01:00
Alex Williams
42b2e39064 Issue 703 edomh integration (#7)
* Adds valid module checking to all types of modules on import

* Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo

* Changes as per comments on the PR

* Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads.

---------

Co-authored-by: David Sangrey <davidsangrey@gmail.com>
Co-authored-by: Felix Linker <linkerfelix@gmail.com>
2024-06-07 11:56:42 +01:00
Alex Williams
d1217439bd Fixed autodeploy to do latest coriolis-data dist. Fixed sendToEDOMH function to only send the blueprint at the selected grade, not each grade up to that grade. 2024-06-07 11:53:43 +01:00
Alex Williams
2a6ae0f2ff Modified export to EDOMH/EDEngineer page to be less 'bodged', allow EDOMH button to be clickable without checking for EDEngineer API (If they have EDOMH, they probably don't have EDEngineer...) and added a workaround for Coriolis sending bogus data for bulkheads. 2024-06-07 11:53:43 +01:00
Alex Williams
dedd2ddbba Merge pull request #766 from alex-williams/ISSUE_764_Previous_fix_fix_due_to_bug
Fixing bug introduced by the previous PR for ISSUE_764. The previous …
2024-06-06 22:41:51 +01:00
Alex Williams
f86ecede9b Fixing bug introduced by the previous PR for ISSUE_764. The previous fix introduced a bug which caused Armour Selection to error, due to Armour modules being completely different to other modules of any other type 2024-06-06 22:39:30 +01:00
David Sangrey
436a50cb45 Merge pull request #765 from alex-williams/ISSUE_764_Unknown_Modules_Are_Selectable
Issue 764 unknown modules are selectable
2024-06-03 11:04:25 -04:00
David Sangrey
f7cf39a9ae Merge branch 'develop' into ISSUE_764_Unknown_Modules_Are_Selectable 2024-06-03 11:04:14 -04:00
David Sangrey
680f3b10f3 Merge pull request #762 from alex-williams/issue_600_add_advanced_weapons
Added 'special' field to certain modules to allow for clearer …
2024-06-03 11:02:17 -04:00
Alex Williams
b31de9c37a Merge pull request #763 from leonardofelin/patch-2
Update PT-BR translations
2024-06-02 20:17:06 +01:00
Alex Williams
9ef054c271 Fixed 'Missing Module' category showing up in Optional Selection drop-down and fixed 'Missing Power Plant', 'Missing Power Distributor' and 'Missing Frameshift Drive' showing up in the Selection drop-downs for those module slots. 2024-06-02 20:03:12 +01:00
leonardofelin
aa620be113 Update PT-BR translations
Added translated strings for coriolis-data PRs 106 & 107
2024-05-27 19:45:44 -03:00
Alex Williams
27f19a72a6 Merge branch 'alpha' into issue_600_add_advanced_weapons 2024-05-27 17:02:42 +01:00
Alex Williams
634be1f197 Added 'special' field to certain modules to allow for clearer appearance in search results that they are the special type of module. Updated English descriptions of Advanced Modules and Special Modules 2024-05-27 15:50:32 +01:00
Felix Linker
f747b25f26 Merge pull request #759 from alex-williams/Issue_754_Imports_need_to_be_more_graceful
Adds valid module checking to all types of modules on import
2024-05-27 08:49:11 +02:00
Felix Linker
02bf133c98 Merge branch 'develop' into Issue_754_Imports_need_to_be_more_graceful 2024-05-27 08:48:49 +02:00
Alex Williams
6c34a26273 Issue 754 imports need to be more graceful (#5)
* Adds valid module checking to all types of modules on import

* Changes as per comments on the PR
2024-05-24 18:23:04 +01:00
Alex Williams
b0b5c82131 Merge branch 'alpha' into Issue_754_Imports_need_to_be_more_graceful 2024-05-24 18:22:53 +01:00
Alex Williams
ee92f2f2e4 Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo (#4) 2024-05-24 17:56:20 +01:00
Alex Williams
0d749202e2 Changing to clone single branch for deployment, not the whole repo 2024-05-24 17:41:27 +01:00
Alex Williams
4283b0b839 Changed deployment ordering 2024-05-24 17:38:47 +01:00
Alex Williams
fbd9c3d282 Improving workflow 2024-05-24 16:23:08 +01:00
Alex Williams
cd68199a41 Adding workflow for autodeploy 2024-05-24 16:23:08 +01:00
Alex Williams
f885fde04f Fix changed files issue (#3)
* Copied de.js contents to new file de-fix.js

* Copied de.js contents back from de-fix.js

* Copied contents of ko.js to ko-fix.js

* Copied ko.js contents back from ko-fix.js

* Copied contents from BlueprintFunctions.js to BlueprintFunctions-fix.js

* Copied contents back from BlueprintFunctions-fix.js to BlueprintFunctions.js

* Copied contents of LineChart.jsx to LineChart-fix.jsx

* Copied contents back from LineChart-fix.jsx to LineChart.jsx

* Copied contents of PieChart.jsx to PieChart-fix.jsx

* Copied contents back from PieChart-fix.jsx to PieChart.jsx

* Copied contents from Slider.jsx to Slider-fix.jsx

* Copied contents back from Slider-fix.jsx to Slider.jsx

* Copied contents from VerticalBarChart.jsx to VerticalBarChart-fix.jsx

* Copied contents back from VerticalBarChart-fix.jsx to VerticalBarChart.jsx

* Deleting 'fix' files
2024-05-24 16:03:03 +01:00
David Sangrey
8f5375f732 Merge pull request #760 from alex-williams/Issue_758_adding_ax_nanite_torps_and_enhanced_missile_racks
Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo
2024-05-20 12:49:53 -04:00
Alex Williams
5c8ff57d16 Changes as per comments on the PR 2024-05-17 15:24:29 +01:00
Alex Williams
3156b6a533 Adds the Advanced MC's, AX MC's, AX MR's and Nanite Torpedo 2024-05-17 08:45:15 +01:00
Alex Williams
14ffa26ef9 Adds valid module checking to all types of modules on import 2024-05-16 19:23:33 +01:00
Alex Williams
18d7ada65f Merge pull request #755 from leonardofelin/pt-br_translations
Updated PT-BR translation with Planetary Approach Suite
2024-05-14 17:18:40 +01:00
leonardofelin
8593e18de4 Updated PT-BR translation with Planetary Approach Suite 2024-05-14 13:13:56 -03:00
leonardofelin
284b0b3ce2 Update pt.json - Brazilian Portuguese translations (#752)
* Update pt.json

Update Brazilian Portuguese translations:
- Updated Modules
- Engineering & Experimental Effect
- Corrections

* Update Portuguese Brazilian

Fixed Tab/Spaces indentation
2024-05-14 13:25:51 +02:00
David Sangrey
c3cb2cfa3b Add SCO Module Check (#748)
* Add SCO Module Check

Goes hand-in-hand with https://github.com/EDCD/coriolis-data/pull/98

* [748] Updated Filter Function

This time, readable!
2024-05-12 13:51:17 +02:00
Alex Williams
5d54eb8862 Adding python_nx to SHIP_FD_NAME_TO_CORIOLIS_NAME to fix import issue with Python Mk II 2024-05-12 13:48:28 +02:00
Felix Linker
9fc6508be4 coriolis-data specified as relative dependency again 2024-04-29 08:24:34 +02:00
Aleksandr
ef82cf4a00 [744] add support of experimental weapon stabilizer (#745) 2024-04-29 08:23:20 +02:00
Felix Linker
9766f78e21 Move eddb.io links to inara.cz 2023-04-07 19:25:16 +01:00
Felix Linker
6d8bd6ca44 Dependency update 2023-04-07 19:18:28 +01:00
Sam Clayton
875af31ffe Update to Webpack 5 (fixes crypto error on build) (#738)
* Updating react-number-editor dependency from stale named branch

* Remove references to deprecated react-addons-perf package

* Issue #25 Webpack updated to current version, many
dependencies updated, Babel & Webpack configs updated.
Add dev & prod Dockerfiles and update README with Docker instructions
Created webpack.common.js.
Coriolis-data now specified as github dependency

* Bump bugfix versions of react & react-dom only

* Workbox dependency upgrade for webpack 5 compat

* Stab at upgrading workbox dep
Far more fatal webpack errors :(

* Automate reinstall/rebuild with npm script

* Working build again w updated deps
Disabled/commented out all bugsnag references
Added production-like Docker build for troubleshooting issues that don't
 appear in dev server

* Remove deprecated @babel/polyfill import & dependency

* Fix to service worker to v5 of workbox
and align with webpack 5 plugin

* Disabling recent round of polyfills. Don't think
they're necessary.

* Whitespace in package.json

* Add Buffer as Webpack plugin. Fix indenting.
Fix deprecated call to Buffer.

* Remove bugsnag and deprecated babel code that was
 commented out, per convo with Felix

---------

Co-authored-by: Sam Clayton <sam@goranku.com>
2023-03-01 21:55:23 +01:00
Felix Linker
93adcb3daf Merge pull request #730 from Sid127/edomh-v1
Initial EDOMH integration
2022-12-27 13:19:05 +01:00
Felix Linker
ec9a07b143 Merge pull request #732 from EDCD/dependabot/npm_and_yarn/decode-uri-component-0.2.2
Bump decode-uri-component from 0.2.0 to 0.2.2
2022-12-26 13:37:46 +01:00
dependabot[bot]
bb8eeb4d3f Bump decode-uri-component from 0.2.0 to 0.2.2
Bumps [decode-uri-component](https://github.com/SamVerschueren/decode-uri-component) from 0.2.0 to 0.2.2.
- [Release notes](https://github.com/SamVerschueren/decode-uri-component/releases)
- [Commits](https://github.com/SamVerschueren/decode-uri-component/compare/v0.2.0...v0.2.2)

---
updated-dependencies:
- dependency-name: decode-uri-component
  dependency-type: indirect
...

Signed-off-by: dependabot[bot] <support@github.com>
2022-12-09 17:17:50 +00:00
Sid Pranjale
8b7a7192a4 Initial EDOMH integration 2022-11-27 14:55:56 +05:30
Felix Linker
6688a1fbe3 Merge pull request #728 from AndricReal/patch-1
Update of russian localisation
2022-11-27 10:11:55 +01:00
AndricReal
2ea5fe5d58 Update ru.json
Corrected translation
2022-11-20 16:08:27 +05:00
Felix Linker
efd644c6f1 Merge pull request #726 from Sid127/matlist-fix
Matlist fix
2022-11-11 20:18:22 +01:00
Sid Pranjale
17c6ec1f97 Do nothing if a module has no experimentals
This fixes materials not being shown for modules that can be engineered but not having experimental effects
2022-11-09 21:19:02 +05:30
Felix Linker
9bc6e36f14 Remove/replace react 16 dependencies 2022-10-29 11:53:36 +02:00
Felix Linker
062815054c Add package-lock 2022-10-29 11:43:02 +02:00
Felix Linker
7bc40d24d8 Merge pull request #708 from Sid127/develop
Quick fix for missing group info in JSON exports
2022-10-21 17:13:11 +02:00
Felix Linker
d9da250f50 Merge pull request #709 from Sid127/uuids-fix
Add mats for experimental effects to mat list
2022-10-21 17:11:39 +02:00
Sid Pranjale
801969dc07 Add mats for experimental effects to mat list 2022-10-09 16:34:04 +05:30
Sid Pranjale
6bf820934f Quick fix for missing group info in JSON exports 2022-10-09 11:45:18 +05:30
Felix Linker
887dbc25f8 Merge remote-tracking branch 'unknowngamer/master' into develop 2022-10-02 11:53:56 +02:00
Felix Linker
50de77d613 Merge remote-tracking branch 'origin/master' into develop 2022-10-02 11:53:48 +02:00
Felix Linker
13561ee21a Merge pull request #704 from green1052/develop
Add Korean translate
2022-10-02 11:44:48 +02:00
green1052
333feaa6bf Add Korean translate
Co-authored-by: jackfrost <jackfrost5446@naver.com>
2022-10-01 15:35:56 +09:00
Rob
1e37fd15eb Fix link to data wiki 2022-08-26 07:28:17 +01:00
ItsUnknownGamer
f82b0212b5 shield recovery time depending on distributor draw 2022-03-04 17:44:49 +01:00
Felix Linker
32138f5546 Merge pull request #689 from Sid127/develop
Minor modifications for Multi-limpet Controllers
2022-01-05 10:53:54 +01:00
Sid
85ddce14a5 Minor modifications for Multi-limpet Controllers 2022-01-05 13:09:34 +05:30
Felix Linker
7e44772f2e Hotfix 2021-12-30 17:06:02 +01:00
Felix Linker
e90bfe9b68 Multi limpet controllers have max of 1 2021-12-30 14:21:21 +01:00
Felix Linker
64002e1ae0 Add translation for multi limpet controllers 2021-12-30 13:53:07 +01:00
126 changed files with 30572 additions and 27723 deletions

View File

@@ -7,6 +7,8 @@
"@babel/plugin-syntax-dynamic-import", "@babel/plugin-syntax-dynamic-import",
"@babel/plugin-syntax-import-meta", "@babel/plugin-syntax-import-meta",
["@babel/plugin-proposal-class-properties", { "loose": true }], ["@babel/plugin-proposal-class-properties", { "loose": true }],
"@babel/plugin-proposal-do-expressions",
"@babel/plugin-proposal-function-bind",
"@babel/plugin-proposal-json-strings", "@babel/plugin-proposal-json-strings",
[ [
"@babel/plugin-proposal-decorators", "@babel/plugin-proposal-decorators",
@@ -28,7 +30,7 @@
} }
], ],
"@babel/plugin-proposal-nullish-coalescing-operator", "@babel/plugin-proposal-nullish-coalescing-operator",
"@babel/plugin-proposal-do-expressions", ["@babel/plugin-proposal-private-methods", { "loose": true }],
"@babel/plugin-proposal-function-bind" ["@babel/plugin-proposal-private-property-in-object", { "loose": true }]
] ]
} }

7
.dockerignore Normal file
View File

@@ -0,0 +1,7 @@
Dockerfile
.dockerignore
.gitignore
README.md
build
node_modules

14
.gitattributes vendored Normal file
View File

@@ -0,0 +1,14 @@
# Set the default behavior, in case people don't have core.autocrlf set, in order to prevent line ending inconsistency.
* text=auto
# Explicitly declare text files you want to always be normalized and converted
# to native line endings on checkout.
*.jsx text
*.js text
# Declare files that will always have CRLF line endings on checkout.
# *.sln text eol=crlf
# Denote all files that are truly binary and should not be modified.
*.png binary
*.jpg binary

25
Dockerfile Normal file
View File

@@ -0,0 +1,25 @@
#syntax=docker/dockerfile:1.4
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
# docker buildx build --build-context data=../coriolis-data --tag coriolis .
FROM node:18-alpine
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source.
WORKDIR /app
ADD . .
COPY --from=data . /coriolis-data/
# Git is required before install if any modules (like coriolis-data) are loaded from github
RUN apk update
RUN apk add git
WORKDIR /app/coriolis-data
RUN npm install
WORKDIR /app
RUN npm install
# Bundle for production config with webpack & log
RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server.
CMD ["npm", "start"]
EXPOSE 3300

23
Dockerfile-dev Normal file
View File

@@ -0,0 +1,23 @@
#syntax=docker/dockerfile:1.4
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
# docker buildx build --build-context data=../coriolis-data --tag coriolis -f ./Dockerfile-dev .
FROM node:18-alpine
WORKDIR /app
ADD . .
COPY --from=data . /coriolis-data/
# Install git & any other desired in-container dev tools
# Git is required before install if any modules (like coriolis-data) are loaded from github
RUN apk update
RUN apk add git
WORKDIR /app/coriolis-data
RUN npm install
WORKDIR /app
RUN npm install
CMD ["npm", "start"]
EXPOSE 3300

32
Dockerfile-local-prod Normal file
View File

@@ -0,0 +1,32 @@
#syntax=docker/dockerfile:1.4
# Run this from within this directory. Change the location of coriolis-data repo and image name/tag as needed.
# docker buildx build --build-context data=../coriolis-data --tag coriolis:0.0.7-local-prod -f Dockerfile-local-prod .
# docker run -d -p 80:8080 coriolis:0.0.7-local-prod
FROM node:18-alpine
# TODO: For a production build, we may want to just build the bundle and copy that in. No need for local copy of source.
WORKDIR /app
ADD . .
# COPY --from=data . /coriolis-data/
# Git is required before install if any modules (like coriolis-data is now referenced in the package.json) are loaded from github
RUN apk update
RUN apk add git
# WORKDIR /app/coriolis-data
# RUN npm install
# WORKDIR /app
# RUN npm install
# Bundle for production config with webpack & log
# In this version of the dockerfile, I'm deferring automated webpack build so I can monitor a manual build
# RUN npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)
RUN npm install -g http-server
# Optimally, this will start a static asset server like nginx/apache. Currently, this will start dev webpack server.
# CMD ["http-server", "/app/build", "-c-1"]
CMD ["/bin/ash"]
# CMD [""]
EXPOSE 8080

View File

@@ -14,7 +14,16 @@ Coriolis was created using assets and imagery from Elite: Dangerous, with the pe
## Development ## Development
To get a local instance of coriolis running, perform the following steps in a shell: This release includes the ability to run the app as a Docker container.
```sh
> git clone https://github.com/EDCD/coriolis.git
> git clone https://github.com/EDCD/coriolis-data.git
> cd coriolis
> docker buildx build --build-context data=../coriolis-data --tag coriolis .
> docker run -d -p 3300:3300 coriolis
```
Or to run an instance of coriolis without Docker Desktop, perform the following steps in a shell:
```sh ```sh
> git clone https://github.com/EDCD/coriolis.git > git clone https://github.com/EDCD/coriolis.git
> git clone https://github.com/EDCD/coriolis-data.git > git clone https://github.com/EDCD/coriolis-data.git
@@ -29,7 +38,7 @@ You will then have a development server running on `localhost:3300`.
### Ship and Module Database ### Ship and Module Database
See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc. See the [Data wiki](https://github.com/EDCD/coriolis-data/wiki) for details on structure, etc.
## Deployment ## Deployment

View File

@@ -0,0 +1,30 @@
{
"adder": {
"t3": {"speed": 205, "boost": 298, "pitch": 35.37, "roll": 93.09, "yaw": 13.03},
"t2": {"speed": 209, "boost": 304, "pitch": 36.06, "roll": 94.90, "yaw": 13.29},
"t1": {"speed": 213, "boost": 310, "pitch": 36.80, "roll": 96.84, "yaw": 13.56},
"t0": {"speed": 218, "boost": 317, "pitch": 37.70, "roll": 99.20, "yaw": 13.89},
"t9": {"speed": 220, "boost": 321, "pitch": 38.08, "roll": 100.21, "yaw": 14.03},
"t8": {"speed": 225, "boost": 327, "pitch": 38.86, "roll": 102.26, "yaw": 14.32},
"t7": {"speed": 230, "boost": 334, "pitch": 39.69, "roll": 104.44, "yaw": 14.62},
"t6": {"speed": 234, "boost": 340, "pitch": 40.41, "roll": 106.34, "yaw": 14.89},
"t5": {"speed": 242, "boost": 351, "pitch": 41.71, "roll": 109.78, "yaw": 15.37}
},
"eagle": {
"t2": {"speed": 223, "boost": 325, "pitch": 46.45, "roll": 111.48, "yaw": 16.72},
"t1": {"speed": 229, "boost": 334, "pitch": 47.69, "roll": 114.46, "yaw": 17.17},
"t0": {"speed": 235, "boost": 343, "pitch": 49.00, "roll": 117.60, "yaw": 17.64},
"t9": {"speed": 239, "boost": 349, "pitch": 49.80, "roll": 119.53, "yaw": 17.93},
"t8": {"speed": 243, "boost": 355, "pitch": 50.70, "roll": 121.69, "yaw": 18.25},
"t7": {"speed": 248, "boost": 361, "pitch": 51.62, "roll": 123.89, "yaw": 18.58},
"t6": {"speed": 252, "boost": 367, "pitch": 52.46, "roll": 125.91, "yaw": 18.89},
"t5": {"speed": 259, "boost": 378, "pitch": 53.99, "roll": 129.56, "yaw": 19.43}
},
"hauler": {
"t4": {"speed": 203, "boost": 305, "pitch": 36.61, "roll": 101.71, "yaw": 14.24},
"t3": {"speed": 209, "boost": 314, "pitch": 37.63, "roll": 104.54, "yaw": 14.64},
"t2": {"speed": 216, "boost": 324, "pitch": 38.89, "roll": 108.03, "yaw": 15.12},
"t1": {"speed": 222, "boost": 333, "pitch": 39.97, "roll": 111.02, "yaw": 15.54},
"t0": {"speed": 232, "boost": 348, "pitch": 41.76, "roll": 116.00, "yaw": 16.24}
}
}

View File

@@ -0,0 +1,289 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/3.json#",
"name": "Test My Ship",
"ship": "Anaconda",
"references": [
{
"name": "Coriolis.io",
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA?bn=Test%20My%20Ship",
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA",
"shipId": "anaconda"
}
],
"components": {
"standard": {
"bulkheads": "Reactive Surface Composite",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"thrusters": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1
},
"frameShiftDrive": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 3
},
"lifeSupport": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"group": "Plasma Accelerator",
"mount": "Fixed"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
}
],
"utility": [
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
null,
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Kill Warrant Scanner"
},
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Cargo Scanner"
},
{
"class": 0,
"rating": "F",
"enabled": false,
"priority": 1,
"group": "Countermeasure",
"name": "Electronic Countermeasure"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Countermeasure",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 2,
"group": "Countermeasure",
"name": "Point Defence"
}
],
"internal": [
{
"class": 7,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Cell Bank"
},
{
"class": 6,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"group": "Hull Reinforcement Package"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
null,
null,
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Frame Shift Drive Interdictor"
}
]
},
"stats": {
"class": 3,
"hullCost": 141889930,
"speed": 180,
"topSpeed": 186.5,
"boost": 240,
"boostEnergy": 29,
"topBoost": 248.66,
"agility": 2,
"baseShieldStrength": 350,
"baseArmour": 945,
"hullMass": 400,
"masslock": 23,
"pipSpeed": 0.14,
"moduleCostMultiplier": 1,
"fuelCapacity": 32,
"cargoCapacity": 128,
"ladenMass": 1339.2,
"armour": 2228,
"armourAdded": 390,
"armourMultiplier": 1.95,
"shieldMultiplier": 1.4,
"totalCost": 882362060,
"unladenMass": 1179.2,
"totalDps": 29,
"powerAvailable": 36,
"powerRetracted": 23.33,
"powerDeployed": 34.76,
"unladenRange": 18.49,
"fullTankRange": 18.12,
"ladenRange": 16.39,
"unladenFastestRange": 73.21,
"ladenFastestRange": 66.15,
"maxJumpCount": 4,
"shieldStrength": 833
}
}

View File

@@ -0,0 +1,325 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Test My Ship",
"ship": "Anaconda",
"references": [
{
"name": "Coriolis.io",
"url": "http://localhost:3300/outfit/anaconda/48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==?bn=Test%20My%20Ship",
"old-code": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
"code": "4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04--0303326b.AwRj4zNKqA==.CwBhCYzBGW9qCTSqs5xA.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA==",
"shipId": "anaconda"
}
],
"components": {
"standard": {
"bulkheads": "Reactive Surface Composite",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"pgen": 1000
}
},
"thrusters": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1
},
"frameShiftDrive": {
"class": 6,
"rating": "A",
"enabled": true,
"priority": 3
},
"lifeSupport": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 8,
"rating": "A",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"group": "Plasma Accelerator",
"mount": "Fixed"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 3,
"rating": "D",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cannon",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
},
{
"class": 1,
"rating": "F",
"enabled": true,
"priority": 2,
"group": "Beam Laser",
"mount": "Turret"
}
],
"utility": [
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Booster"
},
null,
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Kill Warrant Scanner"
},
{
"class": 0,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Cargo Scanner"
},
{
"class": 0,
"rating": "F",
"enabled": false,
"priority": 1,
"group": "Electronic Countermeasure",
"name": "Electronic Countermeasure"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Chaff Launcher",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 2,
"group": "Point Defence",
"name": "Point Defence"
}
],
"internal": [
{
"class": 7,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Cell Bank"
},
{
"class": 6,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"group": "Hull Reinforcement Package"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
null,
null,
null,
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "E",
"enabled": true,
"priority": 1,
"group": "Cargo Rack"
},
{
"class": 4,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "A",
"enabled": true,
"priority": 3,
"group": "Frame Shift Drive Interdictor"
}
]
},
"stats": {
"class": 3,
"fighterHangars": 1,
"hullCost": 141889930,
"speed": 180,
"topSpeed": 186.5,
"boost": 240,
"boostEnergy": 27,
"topBoost": 249.34,
"topPitch": 25.97,
"topRoll": 62.34,
"topYaw": 10.39,
"topSpeed": 187.01,
"totalCost": 882362058,
"totalDpe": 142.68,
"totalDps": 101.13,
"totalEps": 18.71,
"totalExplDpe": 0,
"totalExplDps": 0,
"totalExplSDps": 0,
"totalAbsDpe": 3.57,
"totalAbsDps": 18.78,
"totalAbsSDps": 14.45,
"totalHps": 28.28,
"totalKinDpe": 117.48,
"totalKinDps": 22.27,
"totalKinSDps": 16.91,
"totalSDps": 89.99,
"totalThermDpe": 21.63,
"totalThermDps": 60.08,
"totalThermSDps": 58.64,
"baseShieldStrength": 350,
"baseArmour": 945,
"hullExplRes": 0.22,
"hullKinRes": 0.27,
"hullMass": 400,
"hullThermRes": -0.36,
"masslock": 23,
"pipSpeed": 0.14,
"pitch": 25,
"moduleCostMultiplier": 1,
"modulearmour": 0,
"moduleprotection": 0,
"fuelCapacity": 32,
"cargoCapacity": 128,
"ladenMass": 1323.2,
"armour": 2227.5,
"baseArmour": 525,
"unladenMass": 1163.2,
"powerAvailable": 39.6,
"powerRetracted": 23.33,
"powerDeployed": 34.13,
"roll": 60,
"unladenRange": 18.74,
"yaw": 10,
"fullTankRange": 18.36,
"hardness": 65,
"ladenRange": 16.59,
"unladenFastestRange": 74.2,
"ladenFastestRange": 66.96,
"maxJumpCount": 4,
"shield": 833,
"shieldCells": 1840,
"shieldExplRes": 0.5,
"shieldKinRes": 0.4,
"shieldThermRes": -0.2,
"crew": 3
}
}

View File

@@ -0,0 +1,255 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Multi-purpose Asp Explorer",
"ship": "Asp Explorer",
"references": [
{
"name": "Coriolis.io",
"url": "https://coriolis.edcd.io/outfit/asp?code=0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FAwDFxwtofAAAAA%3D%3D&bn=Multi-purpose%20Asp%20Explorer",
"code": "0pftiFflfddsnf5------020202033c044002v62f2i.AwRj4yvI.CwRgDBldHnJA.H4sIAAAAAAAAA2P858DAwPCXEUhwHPvx/78YG5AltB7I/8/0TwImJboDSPJ/+/f/v/KlX///i3AwMTBIfARK/Gf+JwVSxArStVAYqOjvz///JVo5GRhE2IBc4SKQSSz/DGEmCa398P8//2+gTf//AwDFxwtofAAAAA==",
"shipId": "asp"
}
],
"components": {
"standard": {
"bulkheads": "Lightweight Alloy",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 2,
"modifications": {
"eff": -1850,
"pgen": 6,
"mass": 431
},
"blueprint": {
"id": 64,
"name": "Low emissions",
"grade": 1
}
},
"thrusters": {
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1,
"modifications": {
"optmul": 440,
"integrity": -266,
"thermload": -1326,
"optmass": 520,
"power": 241
},
"blueprint": {
"id": 24,
"name": "Clean",
"grade": 1
}
},
"frameShiftDrive": {
"class": 5,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": 5025,
"integrity": -1539,
"power": 2437,
"optmass": 4870,
"maxfuel": 370
},
"blueprint": {
"id": 26,
"name": "Increased range",
"grade": 5
}
},
"lifeSupport": {
"class": 4,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": -3923,
"integrity": -1797
},
"blueprint": {
"id": 49,
"name": "Lightweight",
"grade": 1
}
},
"powerDistributor": {
"class": 3,
"rating": "D",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 5,
"rating": "D",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 5,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
null,
null,
null,
null,
null,
null
],
"utility": [
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher"
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Point Defence",
"name": "Point Defence"
}
],
"internal": [
{
"class": 6,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Fuel Scoop"
},
{
"class": 5,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator"
},
{
"class": 3,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 2,
"rating": "G",
"enabled": true,
"priority": 1,
"group": "Planetary Vehicle Hangar"
},
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Advanced Discovery Scanner"
},
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Detailed Surface Scanner"
}
]
},
"stats": {
"class": 2,
"hullCost": 6135660,
"speed": 250,
"boost": 340,
"boostEnergy": 13,
"agility": 6,
"baseShieldStrength": 140,
"baseArmour": 210,
"hullMass": 280,
"masslock": 11,
"pipSpeed": 0.13,
"moduleCostMultiplier": 1,
"fuelCapacity": 32,
"cargoCapacity": 40,
"ladenMass": 435.26,
"armour": 378,
"shield": 113.43,
"shieldCells": 0,
"totalCost": 48402550,
"unladenMass": 363.26,
"totalDpe": 0,
"totalExplDpe": 0,
"totalKinDpe": 0,
"totalThermDpe": 0,
"totalDps": 0,
"totalExplDps": 0,
"totalKinDps": 0,
"totalThermDps": 0,
"totalSDps": 0,
"totalExplSDps": 0,
"totalKinSDps": 0,
"totalThermSDps": 0,
"totalEps": 1.2,
"totalHps": 1,
"shieldExplRes": 0.5,
"shieldKinRes": 0.6,
"shieldThermRes": 1.2,
"hullExplRes": 1.4,
"hullKinRes": 1.2,
"hullThermRes": 1,
"powerAvailable": 20.41,
"powerRetracted": 11.91,
"powerDeployed": 11.91,
"unladenRange": 50.45,
"fullTankRange": 47.03,
"ladenRange": 42.71,
"unladenFastestRange": 317.24,
"ladenFastestRange": 287.02,
"maxJumpCount": 7,
"topSpeed": 274.01,
"topBoost": 372.65
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,552 @@
{
"cargo": {
"capacity": 32
},
"free": false,
"fuel": {
"main": {
"capacity": 128
},
"reserve": {
"capacity": 0.81
}
},
"id": 31,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049346,
"name": "BelugaLiner_Armour_Grade1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Bobble01": [],
"Bobble02": [],
"Bobble03": [],
"Bobble04": [],
"Bobble05": [],
"Bobble06": [],
"Bobble07": [],
"Bobble08": [],
"Bobble09": [],
"Bobble10": [],
"Decal1": {
"module": {
"free": false,
"id": 128667757,
"name": "Decal_Explorer_Ranger",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal2": {
"module": {
"free": false,
"id": 128667742,
"name": "Decal_Combat_Deadly",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal3": {
"module": {
"free": false,
"id": 128667750,
"name": "Decal_Trade_Tycoon",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"EngineColour": [],
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064132,
"modifiers": {
"engineerID": 300100,
"id": 175,
"modifiers": [
{
"name": "mod_mass",
"type": 1,
"value": 0.4457540512085
},
{
"name": "mod_health",
"type": 1,
"value": -0.24584779143333
},
{
"name": "mod_passive_power",
"type": 1,
"value": 0.24457727372646
},
{
"name": "mod_fsd_optimised_mass",
"type": 1,
"value": 0.49257898330688
},
{
"name": "mod_fsd_max_fuel_per_jump",
"type": 2,
"value": 0.028505677357316
},
{
"name": "mod_fsd_heat_rate",
"type": 2,
"value": -0.079360365867615
}
],
"moduleTags": [
16
],
"recipeID": 128673694,
"slotIndex": 53
},
"name": "Int_Hyperdrive_Size7_Class5",
"on": true,
"priority": 0,
"recipeLevel": 5,
"recipeName": "FSD_LongRange",
"recipeValue": 0,
"unloaned": 0,
"value": 46160201
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064352,
"name": "Int_FuelTank_Size7_Class3",
"on": true,
"priority": 1,
"unloaned": 1602822,
"value": 1602822
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064174,
"name": "Int_LifeSupport_Size8_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1569565
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064094,
"modifiers": {
"engineerID": 300100,
"id": 253,
"modifiers": [
{
"name": "mod_engine_mass_curve_multiplier",
"type": 1,
"value": 0.098235413432121
},
{
"name": "mod_engine_heat",
"type": 1,
"value": 0.18069696426392
},
{
"name": "mod_passive_power",
"type": 1,
"value": 0.033788848668337
},
{
"name": "mod_health",
"type": 1,
"value": -0.056404989212751
},
{
"name": "mod_engine_mass_curve",
"type": 1,
"value": -0.027384582906961
},
{
"name": "mod_engine_heat",
"type": 2,
"value": -0.072683908045292
}
],
"moduleTags": [
17
],
"recipeID": 128673655,
"slotIndex": 52
},
"name": "Int_Engine_Size7_Class2",
"on": true,
"priority": 0,
"recipeLevel": 1,
"recipeName": "Engine_Dirty",
"recipeValue": 0,
"unloaned": 0,
"value": 1709638
}
},
"MediumHardpoint1": {
"module": {
"free": false,
"id": 128049436,
"name": "Hpt_BeamLaser_Turret_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1889910
}
},
"MediumHardpoint2": {
"module": {
"free": false,
"id": 128049436,
"name": "Hpt_BeamLaser_Turret_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 1889910
}
},
"MediumHardpoint3": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"MediumHardpoint4": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"MediumHardpoint5": {
"module": {
"free": false,
"id": 128049460,
"name": "Hpt_MultiCannon_Gimbal_Medium",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 51300
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128732290,
"name": "PaintJob_BelugaLiner_Tactical_White",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"unloaned": 450,
"value": 450
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064207,
"name": "Int_PowerDistributor_Size6_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 3128120
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064057,
"modifiers": {
"engineerID": 300100,
"id": 277,
"modifiers": [
{
"name": "mod_powerplant_power",
"type": 1,
"value": 0.054692290723324
},
{
"name": "mod_health",
"type": 1,
"value": -0.033690698444843
},
{
"name": "mod_powerplant_heat",
"type": 1,
"value": 0.027470717206597
},
{
"name": "mod_powerplant_heat",
"type": 2,
"value": -0.056317910552025
}
],
"moduleTags": [
18
],
"recipeID": 128673765,
"slotIndex": 51
},
"name": "Int_Powerplant_Size6_Class5",
"on": true,
"priority": 1,
"recipeLevel": 1,
"recipeName": "PowerPlant_Boosted",
"recipeValue": 0,
"unloaned": 0,
"value": 14561578
}
},
"Radar": {
"module": {
"free": false,
"id": 128064239,
"name": "Int_Sensors_Size5_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 71500
}
},
"Slot01_Size6": {
"module": {
"free": false,
"id": 128666681,
"name": "Int_FuelScoop_Size6_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 25887249
}
},
"Slot02_Size6": {
"module": {
"free": false,
"id": 128064287,
"name": "Int_ShieldGenerator_Size6_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 14561578
}
},
"Slot03_Size6": {
"module": {
"free": false,
"id": 128727927,
"name": "Int_PassengerCabin_Size6_Class2",
"on": true,
"priority": 1,
"unloaned": 165808,
"value": 165808
}
},
"Slot04_Size6": {
"module": {
"free": false,
"id": 128727928,
"name": "Int_PassengerCabin_Size6_Class3",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 497429
}
},
"Slot05_Size5": {
"module": {
"free": false,
"id": 128727925,
"name": "Int_PassengerCabin_Size5_Class4",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1492286
}
},
"Slot06_Size5": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 100409,
"value": 100409
}
},
"Slot07_Size4": {
"module": {
"free": false,
"id": 128727922,
"name": "Int_PassengerCabin_Size4_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 17059
}
},
"Slot08_Size3": {
"module": {
"free": false,
"id": 128667632,
"name": "Int_Repairer_Size3_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 2361960
}
},
"Slot09_Size3": {
"module": {
"free": false,
"id": 128672289,
"name": "Int_BuggyBay_Size2_Class2",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 19440
}
},
"Slot10_Size3": {
"module": {
"free": false,
"id": 128666634,
"name": "Int_DetailedSurfaceScanner_Tiny",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 225000
}
},
"Slot11_Size3": {
"module": {
"free": false,
"id": 128663561,
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1390500
}
},
"TinyHardpoint1": {
"module": {
"free": false,
"id": 128049513,
"name": "Hpt_ChaffLauncher_Tiny",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 7650
}
},
"TinyHardpoint2": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 252900
}
},
"TinyHardpoint3": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 252900
}
},
"TinyHardpoint4": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint5": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint6": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"WeaponColour": {
"module": {
"free": false,
"id": 128732194,
"name": "WeaponCustomisation_Purple",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
}
},
"name": "BelugaLiner",
"value": {
"hull": 71688743,
"modules": 120812762,
"unloaned": 1869489
}
}

View File

@@ -0,0 +1,314 @@
{
"cargo": {
"capacity": 264
},
"free": false,
"fuel": {
"main": {
"capacity": 32
},
"reserve": {
"capacity": 0.52
}
},
"id": 4,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049298,
"name": "Type7_Armour_Grade1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Bobble01": [],
"Bobble02": [],
"Bobble03": [],
"Bobble04": [],
"Bobble05": [],
"Bobble06": [],
"Bobble07": [],
"Bobble08": [],
"Bobble09": [],
"Bobble10": [],
"Decal1": {
"module": {
"free": false,
"id": 128667746,
"name": "Decal_Trade_Dealer",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal2": {
"module": {
"free": false,
"id": 128667738,
"name": "Decal_Combat_Competent",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"Decal3": {
"module": {
"free": false,
"id": 128667753,
"name": "Decal_Explorer_Scout",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"EngineColour": [],
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064122,
"name": "Int_Hyperdrive_Size5_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 5103953
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064350,
"name": "Int_FuelTank_Size5_Class3",
"on": true,
"priority": 1,
"unloaned": 97754,
"value": 97754
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064154,
"name": "Int_LifeSupport_Size4_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 28373
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064087,
"name": "Int_Engine_Size5_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 5103953
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128671422,
"name": "PaintJob_Type7_Tactical_White",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"unloaned": 500,
"value": 500
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064192,
"name": "Int_PowerDistributor_Size3_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 158331
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064047,
"name": "Int_Powerplant_Size4_Class5",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 1610080
}
},
"Radar": {
"module": {
"free": false,
"id": 128064229,
"name": "Int_Sensors_Size3_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 10133
}
},
"Slot01_Size6": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot02_Size6": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot03_Size5": {
"module": {
"free": false,
"id": 128064343,
"name": "Int_CargoRack_Size6_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 362591
}
},
"Slot04_Size5": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 111566,
"value": 111566
}
},
"Slot05_Size4": {
"module": {
"free": false,
"id": 128064342,
"name": "Int_CargoRack_Size5_Class1",
"on": true,
"priority": 1,
"unloaned": 111566,
"value": 111566
}
},
"Slot06_Size4": {
"module": {
"free": false,
"id": 128064279,
"name": "Int_ShieldGenerator_Size5_Class2",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 189035
}
},
"Slot07_Size2": {
"module": {
"free": false,
"id": 128049549,
"name": "Int_DockingComputer_Standard",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 4500
}
},
"Slot08_Size2": {
"module": {
"free": false,
"id": 128064340,
"name": "Int_CargoRack_Size3_Class1",
"on": true,
"priority": 1,
"unloaned": 0,
"value": 10563
}
},
"SmallHardpoint1": [],
"SmallHardpoint2": [],
"SmallHardpoint3": [],
"SmallHardpoint4": [],
"TinyHardpoint1": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint2": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint3": {
"module": {
"free": false,
"id": 128668536,
"name": "Hpt_ShieldBooster_Size0_Class5",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 281000
}
},
"TinyHardpoint4": {
"module": {
"free": false,
"id": 128049513,
"name": "Hpt_ChaffLauncher_Tiny",
"on": true,
"priority": 0,
"unloaned": 0,
"value": 8500
}
},
"WeaponColour": []
},
"name": "Type7",
"value": {
"hull": 16780009,
"modules": 14479580,
"unloaned": 321386
}
}

View File

@@ -0,0 +1,225 @@
{
"free": false,
"id": 2,
"modules": {
"Armour": {
"module": {
"free": false,
"id": 128049280,
"name": "CobraMkIII_Armour_Grade1",
"on": true,
"priority": 1,
"value": 0
}
},
"FrameShiftDrive": {
"module": {
"free": false,
"id": 128064117,
"name": "Int_Hyperdrive_Size4_Class5",
"on": true,
"priority": 4,
"value": 1610080
}
},
"FuelTank": {
"module": {
"free": false,
"id": 128064349,
"name": "Int_FuelTank_Size4_Class3",
"on": true,
"priority": 1,
"value": 24734
}
},
"LifeSupport": {
"module": {
"free": false,
"id": 128064149,
"name": "Int_LifeSupport_Size3_Class2",
"on": true,
"priority": 0,
"value": 10133
}
},
"MainEngines": {
"module": {
"free": false,
"id": 128064079,
"name": "Int_Engine_Size4_Class2",
"on": true,
"priority": 0,
"value": 59633
}
},
"PaintJob": {
"module": {
"free": false,
"id": 128741033,
"name": "PaintJob_CobraMKIII_Corrosive_05",
"on": true,
"priority": 1,
"value": 0
}
},
"PlanetaryApproachSuite": {
"module": {
"free": false,
"id": 128672317,
"name": "Int_PlanetApproachSuite",
"on": true,
"priority": 1,
"value": 500
}
},
"PowerDistributor": {
"module": {
"free": false,
"id": 128064179,
"name": "Int_PowerDistributor_Size1_Class2",
"on": true,
"priority": 2,
"value": 1293
}
},
"PowerPlant": {
"module": {
"free": false,
"id": 128064037,
"name": "Int_Powerplant_Size2_Class5",
"on": true,
"priority": 1,
"value": 160224
}
},
"Radar": {
"module": {
"free": false,
"id": 128064229,
"name": "Int_Sensors_Size3_Class2",
"on": true,
"priority": 0,
"value": 10133
}
},
"ShipID0": {
"module": {
"free": false,
"id": 128758976,
"name": "Nameplate_ShipID_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipID1": {
"module": {
"free": false,
"id": 128758976,
"name": "Nameplate_ShipID_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitBumper": {
"module": {
"free": false,
"id": 128740698,
"name": "CobraMkIII_ShipkitRaider1_Bumper1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitSpoiler": {
"module": {
"free": false,
"id": 128740701,
"name": "CobraMkIII_ShipkitRaider1_Spoiler1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitTail": {
"module": {
"free": false,
"id": 128740705,
"name": "CobraMkIII_ShipkitRaider1_Tail2",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipKitWings": {
"module": {
"free": false,
"id": 128740707,
"name": "CobraMkIII_ShipkitRaider1_Wings1",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipName0": {
"module": {
"free": false,
"id": 128758944,
"name": "Nameplate_Explorer01_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"ShipName1": {
"module": {
"free": false,
"id": 128758944,
"name": "Nameplate_Explorer01_Black",
"on": true,
"priority": 1,
"value": 0
}
},
"Slot01_Size4": {
"module": {
"free": false,
"id": 128666663,
"name": "Int_FuelScoop_Size4_Class3",
"on": true,
"priority": 2,
"value": 178898
}
},
"Slot02_Size4": [],
"Slot03_Size4": [],
"Slot04_Size2": [],
"Slot05_Size2": {
"module": {
"free": false,
"id": 128663561,
"name": "Int_StellarBodyDiscoveryScanner_Advanced",
"on": true,
"priority": 2,
"value": 1545000
}
},
"Slot06_Size2": {
"module": {
"free": false,
"id": 128666634,
"name": "Int_DetailedSurfaceScanner_Tiny",
"on": true,
"priority": 2,
"value": 250000
}
}
},
"name": "CobraMkIII",
"value": {
"hull": 205287,
"modules": 3850628,
"unloaned": 1751109
}
}

View File

@@ -0,0 +1,327 @@
{
"$schema": "http://cdn.coriolis.io/schemas/ship-loadout/4.json#",
"name": "Multi-purpose Imperial Courier",
"ship": "Imperial Courier",
"references": [
{
"name": "Coriolis.io",
"url": "https://coriolis.edcd.io/outfit/imperial_courier?code=0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ%3D.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s%2FkIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA%2B%2Fz%2Bz3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ%2BLgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ%2F0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g%2F6v0TTdbxJ2KhdEIaCw15MF%2FNB0L%2BS2hwEwyFM8KgP%2BqEpWWA3Qu9Z3z9kPWHzakt7Dt%2BAeD7ghSTgEAAA%3D%3D&bn=Multi-purpose%20Imperial%20Courier",
"code": "0patzF5l0das8f31a1a270202000e402t0101-2f.AwRj4zKA.CwRgDBldLiQ=.H4sIAAAAAAAAA12OP0tCYRjFj9fuVbvF1du9ekkT8s/kIg4NElyIBBd321yaGvwUQTS3N7UFfYygIT9EoyQUJA36ns47XJCWA+/z+z3Pe3ImBbDNKaqNPSBoGrL4ngfomKpFGiJ+LgHteR1IPjxJT5pF11uSeXNsJVcRfgdC92syWUuK0iMdKZqrjJ/0aoA71lJ5oKf38knWcCiptCPdhJIerdS00vlK0qktlqoj983UmqqHjQ33VsW8eazFmaTyULP2hQ4lX8LBme6g/6v0TTdbxJ2KhdEIaCw15MF/NB0L+S2hwEwyFM8KgP+qEpWWA3Qu9Z3z9kPWHzakt7Dt+AeD7ghSTgEAAA==",
"shipId": "imperial_courier"
}
],
"components": {
"standard": {
"bulkheads": "Lightweight Alloy",
"cargoHatch": {
"enabled": false,
"priority": 5
},
"powerPlant": {
"class": 4,
"rating": "A",
"enabled": true,
"priority": 2,
"modifications": {
"pgen": 1052,
"integrity": -482,
"eff": 974
},
"blueprint": {
"id": 63,
"name": "Overcharged",
"grade": 1
}
},
"thrusters": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"name": "Enhanced Performance",
"modifications": {
"optmul": 2476,
"thermload": 7023,
"power": 1763,
"integrity": 165,
"optmass": -667
},
"blueprint": {
"id": 22,
"name": "Dirty",
"grade": 4
}
},
"frameShiftDrive": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"modifications": {
"mass": 4082,
"integrity": -2422,
"power": 1782,
"optmass": 4927
},
"blueprint": {
"id": 26,
"name": "Increased range",
"grade": 5
}
},
"lifeSupport": {
"class": 1,
"rating": "A",
"enabled": true,
"priority": 1
},
"powerDistributor": {
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1
},
"sensors": {
"class": 2,
"rating": "D",
"enabled": true,
"priority": 1
},
"fuelTank": {
"class": 3,
"rating": "C",
"enabled": true,
"priority": 1
}
},
"hardpoints": [
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Pulse Laser",
"mount": "Fixed",
"modifications": {
"rof": 5931,
"damage": -184,
"jitter": 50,
"distdraw": -4689,
"piercing": 3328
},
"blueprint": {
"id": 89,
"name": "Rapid fire",
"grade": 5
}
},
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Pulse Laser",
"mount": "Fixed",
"modifications": {
"rof": 4715,
"damage": -97,
"jitter": 30,
"distdraw": -4548,
"piercing": 1057,
"integrity": 319
},
"blueprint": {
"id": 89,
"name": "Rapid fire",
"grade": 5
}
},
{
"class": 2,
"rating": "F",
"enabled": true,
"priority": 1,
"group": "Multi-cannon",
"mount": "Gimballed",
"modifications": {
"damage": 2437,
"distdraw": 5487,
"rof": 1120,
"jitter": 58,
"thermload": 1346,
"power": 1009,
"integrity": -202,
"ammo": -2000
},
"blueprint": {
"id": 88,
"name": "Overcharged",
"grade": 3,
"special": {
"id": 3,
"name": "Corrosive shell"
}
}
}
],
"utility": [
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher",
"modifications": {
"ammo": 5000,
"mass": 17684,
"reload": 9707
},
"blueprint": {
"id": 37,
"name": "Ammo capacity",
"grade": 3
}
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Heat Sink Launcher",
"name": "Heat Sink Launcher",
"modifications": {
"ammo": 5000,
"mass": 18520,
"reload": 8715
},
"blueprint": {
"id": 37,
"name": "Ammo capacity",
"grade": 3
}
},
{
"class": 0,
"rating": "I",
"enabled": true,
"priority": 1,
"group": "Chaff Launcher",
"name": "Chaff Launcher"
},
{
"class": 0,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Frame Shift Wake Scanner"
}
],
"internal": [
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Shield Generator",
"modifications": {
"optmul": 1888,
"explres": 455,
"kinres": 546,
"thermres": 1092,
"brokenregen": -2614,
"regen": -876,
"distdraw": 463
},
"blueprint": {
"id": 77,
"name": "Reinforced",
"grade": 3
}
},
{
"class": 3,
"rating": "A",
"enabled": true,
"priority": 1,
"group": "Fuel Scoop"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
{
"class": 2,
"rating": "E",
"enabled": true,
"priority": 2,
"group": "Cargo Rack"
},
null,
{
"class": 1,
"rating": "C",
"enabled": true,
"priority": 2,
"group": "Scanner",
"name": "Advanced Discovery Scanner"
}
]
},
"stats": {
"class": 1,
"hullCost": 2481550,
"speed": 280,
"boost": 380,
"boostEnergy": 10,
"agility": 6,
"baseShieldStrength": 200,
"baseArmour": 80,
"hullMass": 35,
"masslock": 7,
"pipSpeed": 0.05,
"moduleCostMultiplier": 1,
"fuelCapacity": 8,
"cargoCapacity": 8,
"ladenMass": 104.25,
"armour": 144,
"shield": 404.19,
"shieldCells": 0,
"totalCost": 14059860,
"unladenMass": 88.25,
"totalDpe": 32.25,
"totalExplDpe": 0,
"totalKinDpe": 9.41,
"totalThermDpe": 22.84,
"totalDps": 53.8,
"totalExplDps": 0,
"totalKinDps": 17.44,
"totalThermDps": 36.35,
"totalSDps": 48.99,
"totalExplSDps": 0,
"totalKinSDps": 12.64,
"totalThermSDps": 36.35,
"totalEps": 9.84,
"totalHps": 12.28,
"shieldExplRes": 0.48,
"shieldKinRes": 0.55,
"shieldThermRes": 1.09,
"hullExplRes": 1.4,
"hullKinRes": 1.2,
"hullThermRes": 1,
"powerAvailable": 17.24,
"powerRetracted": 11.3,
"powerDeployed": 16.41,
"unladenRange": 25.57,
"fullTankRange": 23.92,
"ladenRange": 22.09,
"unladenFastestRange": 116.23,
"ladenFastestRange": 107,
"maxJumpCount": 5,
"topSpeed": 386.56,
"topBoost": 524.62
}
}

View File

@@ -0,0 +1,22 @@
[
{
"buildText": "[Imaginary Ship]\nbla bla",
"errorMsg": "No such ship found: \"Imaginary Ship\""
},
{
"buildText": "[Viper]\nS: 1F/F Pulse Laser\nsome un-parseable nonsense\nS: 1F/F Pulse Laser\n",
"errorMsg": "Error parsing: \"some un-parseable nonsense\""
},
{
"buildText": "[Sidewinder]\nS: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
"errorMsg": "2F Pulse Laser exceeds slot size: \"S: 2F/F Pulse Laser\""
},
{
"buildText": "[Sidewinder]\nL: 2F/F Pulse Laser\nS: 1F/F Pulse Laser\n",
"errorMsg": "No hardpoint slot available for: \"L: 2F/F Pulse Laser\""
},
{
"buildText": "[Sidewinder]\nS: 1F/F Magic Thing\nS: 1F/F Pulse Laser\n",
"errorMsg": "Unknown component: \"S: 1F/F Magic Thing\""
}
]

View File

@@ -0,0 +1,32 @@
[
{
"shipId": "anaconda",
"buildName": "Imported Anaconda",
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
"buildText": "[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
},
{
"shipId": "anaconda",
"buildName": "Imported Anaconda",
"buildCode": "0pyttFolodDsyf5------1717--------05044j-03--2h--00.Iw18ZlA=.Aw18ZlA=.",
"buildText": "\n\n \t[Anaconda]\nS: 1F/F Pulse Laser\nS: 1F/F Pulse Laser\n\nBH: 1I Lightweight Alloy\nRB: 8E Power Plant\nTM: 7E Thrusters\nFH: 6E Frame Shift Drive\nEC: 5E Life Support\nPC: 8E Power Distributor\nSS: 8E Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n7: 6E Cargo Rack (Capacity: 64)\n6: 5E Cargo Rack (Capacity: 32)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 1E Basic Discovery Scanner\n2: 1E Cargo Rack (Capacity: 2)\n"
},
{
"shipId": "cobra_mk_iii",
"buildName": "Imported Cobra Mk III",
"buildCode": "0patcFeldd5sdf41712222503040202490f242h.Iw1-kA==.Aw1-kA==.",
"buildText": "[Cobra Mk III]\nM: 1F/F Pulse Laser\nM: 1G/G Burst Laser\nS: 1E/T Fragment Cannon\nS: 1G/T Multi-cannon\nU: 0I Point Defence\nU: 0A Shield Booster\n\nBH: 1I Lightweight Alloy\nRB: 4A Power Plant\nTM: 4C Thrusters\nFH: 4E Frame Shift Drive\nEC: 3D Life Support\nPC: 2A Power Distributor\nSS: 3D Sensors\nFS: 4C Fuel Tank (Capacity: 16)\n\n4: 3E Cargo Rack (Capacity: 8)\n4: 3E Cargo Rack (Capacity: 8)\n4: 4E Shield Generator\n2: 2C Auto Field-Maintenance Unit\n2: 1E Standard Docking Computer\n2: 1E Basic Discovery Scanner\n---\nShield: 112.29 MJ\nPower : 10.45 MW retracted (67%)\n 12.16 MW deployed (78%)\n 15.60 MW available\nCargo : 16 T\nFuel : 16 T\nMass : 235.5 T empty\n 267.5 T full\nRange : 10.69 LY unladen\n 10.05 LY laden\nPrice : 2,929,040 CR\nRe-Buy: 146,452 CR @ 95% insurance\n"
},
{
"shipId": "type_9_heavy",
"buildName": "Imported Type-9 Heavy",
"buildCode": "3pftsFklkdisif57e2k2f2h110001020306054j03022f01242i.Iw18eQ==.Aw18eQ==.",
"buildText": "[Type-9 Heavy]\nM: 2D/G Fragment Cannon\nM: 2I/F Mine Launcher\nM: 2B/FD Missile Rack\nS: 1I/FS Torpedo Pylon\nS: 1F/F Burst Laser\nU: 0I Chaff Launcher\nU: 0F Electronic Countermeasure\nU: 0I Heat Sink Launcher\nU: 0I Point Defence\n\nBH: 1I Mirrored Surface Composite\nRB: 5A Power Plant\nTM: 7D Thrusters\nFH: 6A Frame Shift Drive\nEC: 5A Life Support\nPC: 4D Power Distributor\nSS: 4D Sensors\nFS: 5C Fuel Tank (Capacity: 32)\n\n8: 7E Cargo Rack (Capacity: 128)\n7: 6E Cargo Rack (Capacity: 64)\n6: 6E Shield Generator\n5: 4E Cargo Rack (Capacity: 16)\n4: 3E Cargo Rack (Capacity: 8)\n4: 1C Advanced Discovery Scanner\n3: 2E Cargo Rack (Capacity: 4)\n3: 1E Standard Docking Computer\n2: 1C Detailed Surface Scanner\n"
},
{
"shipId": "vulture",
"buildName": "Imported Vulture",
"buildCode": "4patfFalddksif31e1e0e0j04044a0n532jf1.Iw19kA==.Aw19kA==.",
"buildText": "[Vulture]\nL: 3E/G Pulse Laser\nL: 3E/G Pulse Laser\nU: 0A Frame Shift Wake Scanner\nU: 0A Kill Warrant Scanner\nU: 0A Shield Booster\nU: 0A Shield Booster\n\nBH: 1I Reactive Surface Composite\nRB: 4A Power Plant\nTM: 5A Thrusters\nFH: 4A Frame Shift Drive\nEC: 3D Life Support\nPC: 5A Power Distributor\nSS: 4D Sensors\nFS: 3C Fuel Tank (Capacity: 8)\n\n5: 5A Shield Generator\n4: 4A Auto Field-Maintenance Unit\n2: 2A Shield Cell Bank\n1: 1A Fuel Scoop\n1: 1C Fuel Tank (Capacity: 2)"
}
]

View File

@@ -0,0 +1,50 @@
{
"type_6_transporter": {
"Cargo": "A0p0tdFal8d8s8f4-----04040303430101-.Iw18UA==.Aw18UA==.",
"Miner": "A0p5tdFal8d8s8f42l2l---040403451q0101-.Iw18UA==.Aw18UA==.",
"Hopper": "A0p0tdFal8d0s8f41717---030302024300--.Iw18UA==.Aw18UA==."
},
"type_7_transport": {
"Cargo": "A0p0tiFfliddsdf5--------0505040403480101--.Iw18eQ==.Aw18eQ==.",
"Miner": "A0pdtiFflid8sdf5--2l2l----0505041v03450000--.Iw18eQ==.Aw18eQ==."
},
"federal_dropship": {
"Cargo": "A0pdtiFflnddsif4-1717------05040448--020201-.Iw18RQ==.Aw18RQ==."
},
"asp": {
"Miner": "A2pftfFflidfskf50s0s24242l2l---04054a1q02022o27-.Iw18eQ==.Aw18eQ==."
},
"imperial_clipper": {
"Cargo": "A0p5tiFflndisnf4--0s0s----0605450302020101-.Iw18WQ==.Aw18WQ==.",
"Dream": "A2pktkFflndpskf40v0v0s0s0404040n4k5n5d2b29292o--.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA.",
"Current": "A0patkFflndfskf4-----------------.AwRj4yWU1Yg=.CwBhCYy6YRigzPIA."
},
"type_9_heavy": {
"Current": "A0patsFklndnsif6---------0706054a0303020224--.AwRj4yo5iA==.EwBhEYy6d6g=."
},
"python": {
"Cargo": "A0patnFflidsssf5---------050505040448020201-.Iw18eAMQ.Aw18RQ==.",
"Miner": "A0pktkFflidpspf50v0v0v2m2m0404--050505Ce4a1v02022o-.Iw18eAMQ.IwBhBYy6dkCYRA==.",
"Dream": "A2pptkFfliduspf50v0v0v27270404040m5n5n4f2d2d032t0201-.Iw1+gDByUA==.EwBhEYy6e0VEA===.",
"Missile": "A0pttoFjljdystf52f2g2d2ePh----04044j03---00--.Iw18eAMQ.Aw18RQ==."
},
"anaconda": {
"Dream": "A4putpFklndzsuf52c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d04-0303326b-.AwRj4yo5dzhA.MwBhCYy6duvARhEA.",
"Cargo": "A0patnFklndnsxf5----------------06050505040404-45030301-.Iw18ZUAxA===.Aw18ZXEA.",
"Current": "A0patnFklndksxf5----------------06050505040404-03034524-.Iw18ZUAxA===.Aw18ZXEA.",
"Explorer": "A0patnFklndksxf5--------0202------f7050505040s37--2i4524-.AwRj4yVKJ9jCA===.AwhMIyumQRgkA===.",
"Test": "A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.Iw18ZUAxA===.Aw18ZXEA."
},
"diamondback_explorer": {
"Explorer": "A0p0tdFfldddsdf5---0202--320p432i----.AwRj4zTZaA==.AwiMIyqo."
},
"vulture": {
"Bounty Hunter": "A3patcFalddksff31e1e0404-0l4a-5d27662j--.AwRj4z2Gg===.MwBhBYy6oJmAjLMQ."
},
"fer_de_lance": {
"Attack": "A2pfthFalidpsff31r0s0s0s0s000404-04-4a-5d27--.Iw18aAMQ.CwBhrSu8EZxEA===."
},
"eagle": {
"Figther": "A4p0t5F5l3d5s5f20p0p24-4053-2j---.Iw18gDJQ.Aw19kA==."
}
}

View File

@@ -0,0 +1,50 @@
{
"builds": {
"type_6_transporter": {
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
},
"type_7_transport": {
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
},
"federal_dropship": {
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
},
"asp": {
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
},
"imperial_clipper": {
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
"Dream": "26A6A5A5D6A5A4C0v0v0s0s0404040n4k5n5d2b29292o-.AwRj4yWU1I==.CwBhCYy6YRigzLIA",
"Current": "04A6A5A5D4A5A4C----------------.AwRj4yWU1I==.CwBhCYy6YRigzLIA"
},
"type_9_heavy": {
"Current": "04A7D6A5D5D4D6C---------0706054a0303020224.AwRj4yoo.EwBhEYy6dsg="
},
"python": {
"Cargo": "04A6D5A4D6D6D5C---------050505040448020201.Iw18eQ==.Aw18eQ==",
"Miner": "06A6A5A4D6A6A5C0v0v0v2m2m0404--050505Ce4a1v02022o.Iw18eQ==.IwBhBYy6dkCYg===",
"Dream": "27A6A5A4D7A6A5C0v0v0v27270404040m5n5n4f2d2d032t0201.Iw1+gDBxA===.EwBhEYy6e0WEA==="
},
"anaconda": {
"Dream": "48A7A6A5D8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100004k5n5n112d2d040303326b.AwRj4yo5dig=.MwBhCYy6du3ARiA=",
"Cargo": "04A6D6A5D5D8D5C----------------0605050504040445030301.Iw18ZlA=.Aw18ZlA=",
"Current": "04A6D6A5D5A8D5C----------------0605050504040403034524.Iw18ZlA=.Aw18ZlA=",
"Explorer": "04A6D6A5D5A8D5C--------0202------f7050505040s372f2i4524.AwRj4yVKJthA.AwhMIyungRhEA==="
},
"diamondback_explorer": {
"Explorer": "02A4D5A3D3D3D5C---0202--320p432i2f.AwRj4zTI.AwiMIypI"
},
"vulture": {
"Bounty Hunter": "34A4C4A3D5A4A3C1e1e0404-0l4a5d27662j.AwRj4y2I.MwBhBYy6wJmAjLIA"
},
"fer_de_lance": {
"Attack": "25A5C4A4D6A4A3C1r0s0s0s0s000404-04-4a-5d27-.Iw18aQ==.CwBhrSu8EZyA"
},
"eagle": {
"Figther": "42A3A3A1D2A2A2C0p0p24-40532j.AwRj49iA.AwgsIkEZigmIA==="
}
}
}

View File

@@ -0,0 +1,366 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
},
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "diamondbackxl",
"ShipID": 11,
"ShipName": "star Hopper",
"ShipIdent": "PH-02",
"HullValue": 1615649,
"ModulesValue": 16981039,
"Rebuy": 929837,
"Modules": [
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true,
"Value": 3072
},
{
"Slot": "slot01_size4",
"Item": "int_fuelscoop_size4_class5",
"On": true,
"Priority": 3,
"Value": 2862364
},
{
"Slot": "slot02_size4",
"Item": "int_guardianfsdbooster_size4",
"On": true,
"Value": 2847499
},
{
"Slot": "slot03_size3",
"Item": "int_shieldgenerator_size3_class2",
"On": true,
"Value": 18812,
"Engineering": {
"BlueprintName": "shieldgenerator_thermic",
"Level": 3,
"Quality": 1,
"ExperimentalEffect": "special_shield_health"
}
},
{
"Slot": "slot04_size3",
"Item": "int_repairer_size3_class5",
"On": true,
"Value": 2302911
},
{
"Slot": "slot05_size2",
"Item": "int_buggybay_size2_class2",
"On": true,
"Priority": 3,
"Value": 21600
},
{
"Slot": "slot06_size2",
"Item": "int_cargorack_size2_class1",
"On": true,
"Priority": 1,
"Value": 2852
},
{
"Slot": "slot07_size1",
"Item": "int_supercruiseassist",
"On": true,
"Priority": 3,
"Value": 9121
},
{
"Slot": "slot08_size1",
"Item": "int_detailedsurfacescanner_tiny",
"On": true,
"Value": 250000,
"Engineering": {
"BlueprintName": "sensor_expanded",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size4_class5",
"On": true,
"Priority": 1,
"Value": 1441233,
"Engineering": {
"BlueprintName": "powerplant_boosted",
"Level": 1,
"Quality": 1
}
},
{
"Slot": "mainengines",
"Item": "int_engine_size4_class5",
"On": true,
"Value": 1610080,
"Engineering": {
"BlueprintName": "engine_dirty",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_engine_lightweight"
}
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Value": 5103953,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 5,
"Quality": 1,
"ExperimentalEffect": "special_fsd_lightweight"
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "misc_lightweight",
"Level": 3,
"Quality": 1
}
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size4_class5",
"On": true,
"Value": 389022,
"Engineering": {
"BlueprintName": "powerdistributor_highfrequency",
"Level": 4,
"Quality": 1
}
},
{
"Slot": "radar",
"Item": "int_sensors_size3_class2",
"On": true,
"Value": 10133,
"Engineering": {
"BlueprintName": "sensor_lightweight",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1,
"Value": 97754
},
{
"Slot": "armour",
"Item": "diamondbackxl_armour_grade1",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -0,0 +1,8 @@
{
"krait_mkii": {
"Imported pancake hammer": "A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ==.AwRgzKIkA===."
},
"diamondback_explorer": {
"Imported star Hopper": "A0pataFflddfsdf5---02---321P430iv6013w2i.Iw18SQ==.AwRm44GYpKg=."
}
}

View File

@@ -0,0 +1,188 @@
[
{
"header": {
"appName": "Inara",
"appVersion": "1.0",
"appURL": "https:\/\/inara.cz\/cmdr-fleet\/123\/123\/",
"appCustomProperties": {
"inaraCommanderID": 123,
"inaraShipID": 123
}
},
"data": {
"Ship": "krait_mkii",
"ShipID": 7,
"ShipName": "pancake hammer",
"ShipIdent": "PH-01",
"HullValue": 44160710,
"ModulesValue": 111274094,
"Rebuy": 7771743,
"Modules": [
{
"Slot": "largehardpoint1",
"Item": "hpt_mininglaser_fixed_small",
"On": true
},
{
"Slot": "largehardpoint2",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "largehardpoint3",
"Item": "hpt_cannon_gimbal_large",
"On": true,
"Engineering": {
"BlueprintName": "weapon_overcharged",
"Level": 2,
"Quality": 1,
"ExperimentalEffect": "special_auto_loader"
}
},
{
"Slot": "mediumhardpoint1",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true,
"Engineering": {
"BlueprintName": "weapon_highcapacity",
"Level": 5,
"Quality": 1
}
},
{
"Slot": "mediumhardpoint2",
"Item": "hpt_basicmissilerack_fixed_medium",
"On": true
},
{
"Slot": "tinyhardpoint1",
"Item": "hpt_heatsinklauncher_turret_tiny",
"On": true
},
{
"Slot": "tinyhardpoint2",
"Item": "hpt_cloudscanner_size0_class3",
"On": true
},
{
"Slot": "tinyhardpoint3",
"Item": "hpt_shieldbooster_size0_class5",
"On": true
},
{
"Slot": "tinyhardpoint4",
"Item": "hpt_shieldbooster_size0_class5",
"On": true,
"Priority": 1
},
{
"Slot": "slot01_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot02_size6",
"Item": "int_cargorack_size6_class1",
"On": true,
"Priority": 1
},
{
"Slot": "slot03_size5",
"Item": "int_guardianfsdbooster_size5",
"On": true
},
{
"Slot": "slot04_size5",
"Item": "int_fighterbay_size5_class1",
"On": true
},
{
"Slot": "slot05_size4",
"Item": "int_shieldgenerator_size4_class5",
"On": true
},
{
"Slot": "slot06_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot07_size3",
"Item": "int_dronecontrol_collection_size3_class4",
"On": true
},
{
"Slot": "slot08_size2",
"Item": "int_refinery_size2_class2",
"On": true
},
{
"Slot": "slot09_size1",
"Item": "int_dronecontrol_prospector_size1_class4",
"On": true
},
{
"Slot": "powerplant",
"Item": "int_powerplant_size7_class5",
"On": true,
"Priority": 1
},
{
"Slot": "mainengines",
"Item": "int_engine_size6_class5",
"On": true
},
{
"Slot": "frameshiftdrive",
"Item": "int_hyperdrive_size5_class5",
"On": true,
"Engineering": {
"BlueprintName": "fsd_longrange",
"Level": 2,
"Quality": 0.861
}
},
{
"Slot": "lifesupport",
"Item": "int_lifesupport_size4_class2",
"On": true,
"Priority": 3
},
{
"Slot": "powerdistributor",
"Item": "int_powerdistributor_size7_class5",
"On": true
},
{
"Slot": "radar",
"Item": "int_sensors_size6_class2",
"On": true
},
{
"Slot": "fueltank",
"Item": "int_fueltank_size5_class3",
"On": true,
"Priority": 1
},
{
"Slot": "armour",
"Item": "krait_mkii_armour_grade3",
"On": true,
"Priority": 1,
"Engineering": {
"BlueprintName": "armour_heavyduty",
"Level": 5,
"Quality": 1
}
}
]
}
}
]

View File

@@ -0,0 +1,67 @@
{
"builds": {
"type_6_transporter": {
"Cargo": "02A4D4A2D2D2D4C-----04040303430101",
"Miner": "03A4D4A2D2D2D4C2l2l---040403451q0101",
"Hopper": "02A4D4A2D1A2D4C1717---030302024300-"
},
"type_7_transport": {
"Cargo": "02A5D5A4D3D3D5C--------0505040403480101",
"Miner": "04D5D5A4D2D3D5C--2l2l----0505041v03450000"
},
"federal_dropship": {
"Cargo": "04D5D5A5D3D4D4C-1717------05040448020201"
},
"asp": {
"Miner": "25A5A5A4D4A5A5C0s0s24242l2l---04054a1q02022o27"
},
"cobra_mk_iii": {
"Example": "24A4A4A3D3A3A4C0s0s2d2d0m0445032b2o2753.AwRj4yKA.CwBhEYyrKhmMQ==="
},
"imperial_clipper": {
"Cargo": "03A5D5A5D4D5D4C--0s0s----0605450302020101",
"Multi-purpose": "26A4A5A5D6A5A4C0v0v272704090j0h064f2c0302020101",
"Current": "05A6D5A5D6A5A4C0v0v27270404050n4m05035d29292o01.AwRj4yrI.AwhMIyuBGNiA",
"Dream": "26A6A5A5D6A5A4C0v0v0s0s04040c0n064f5d2b02022o0d.AwRj49UlmI==.AwiMIyuo"
},
"type_9_heavy": {
"Cargo": "04A6D6A5D4D4D5C---------07064f040303010201.AwRj4yoo.EwBhEYy6dsg="
},
"python": {
"Cargo": "04A6D5A4D6D6D5C---------050505044a03020201",
"Miner": "04A6D5A4D6D6D5C---2m2m----050505044d1v02022o"
},
"anaconda": {
"Dream": "48A6A6A5A8A8A5C2c0o0o0o1m1m0q0q0404040l0b0100034k5n05050404040303326b.AwRj4yo5dig=.MwBhEYy6duwEziA=",
"Cargo": "03A7D6A5D4D8D5C----------------060505054d040403030301.AwRj4yuqg===.Aw18ZlA=",
"Modified": "0pyttFolodDsyf5------1717--------05044j-03----2h00.Iw18ZlA=.Aw18ZlA=.H4sIAAAAAAAAA2MUe8HMwPD-PwDDhxeuCAAAAA=="
},
"diamondback_explorer": {
"Explorer": "02A4D5A3D3D3D5C-------320p432i2f.AwRj4zTI.AwiMIypI"
}
},
"comparisons": {
"Test": {
"facets": [ 9, 6, 4, 1, 3, 2 ],
"builds": [
{
"shipId": "anaconda",
"buildName": "Dream"
},
{
"shipId": "asp",
"buildName": "Miner"
},
{
"shipId": "diamondback_explorer",
"buildName": "Explorer"
}
]
}
},
"insurance": "Beta",
"discounts": [
1,
1
]
}

File diff suppressed because it is too large Load Diff

90
__tests__/test-agility.js Normal file
View File

@@ -0,0 +1,90 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
describe("Agility", function() {
it("correctly calculates speed", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.topSpeed)).toBe(thrusterData.speed);
}
}
});
it("correctly calculates boost", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
// Turn off internals to ensure we have enough power to boost
for (let internal in ship.internal) {
ship.internal[internal].enabled = 0;
}
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.topBoost)).toBe(thrusterData.boost);
}
}
});
it("correctly calculates pitch", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.pitches[4] * 100) / 100).toBeCloseTo(thrusterData.pitch, 1);
}
}
});
it("correctly calculates roll", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.rolls[4] * 100) / 100).toBeCloseTo(thrusterData.roll, 1);
}
}
});
it("correctly calculates yaw", function() {
let agilityData = require('./fixtures/agility-data');
for (let shipId in agilityData) {
for (let thrusterId in agilityData[shipId]) {
const thrusterData = agilityData[shipId][thrusterId];
let shipData = Ships[shipId];
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildWith(shipData.defaults);
ship.use(ship.standard[1], ModuleUtils.findModule('t', thrusterId));
expect(Math.round(ship.yaws[4] * 100) / 100).toBeCloseTo(thrusterData.yaw, 1);
}
}
});
});

368
__tests__/test-import.js Normal file
View File

@@ -0,0 +1,368 @@
jest.unmock('../src/app/stores/Persist');
jest.unmock('../src/app/components/TranslatedComponent');
jest.unmock('../src/app/components/ModalImport');
jest.unmock('prop-types');
import React from 'react';
import PropTypes from 'prop-types';
import ReactDOM from 'react-dom';
import TU from 'react-testutils-additions';
import Utils from './testUtils';
import { getLanguage } from '../src/app/i18n/Language';
describe('Import Modal', function() {
let MockRouter = require('../src/app/Router').default;
const Persist = require('../src/app/stores/Persist').default;
const ModalImport = require('../src/app/components/ModalImport').default;
const mockContext = {
language: getLanguage('en'),
sizeRatio: 1,
openMenu: jest.fn(),
closeMenu: jest.fn(),
showModal: jest.fn(),
hideModal: jest.fn(),
tooltip: jest.fn(),
termtip: jest.fn(),
onWindowResize: jest.fn()
};
let modal, render, ContextProvider = Utils.createContextProvider(mockContext);
/**
* Clear saved builds, and reset React DOM
*/
function reset() {
MockRouter.go.mockClear();
Persist.deleteAll();
render = TU.renderIntoDocument(<ContextProvider><ModalImport /></ContextProvider>);
modal = TU.findRenderedComponentWithType(render, ModalImport);
}
/**
* Simulate user import text entry / paste
* @param {string} text Import text / raw data
*/
function pasteText(text) {
let textarea = TU.findRenderedDOMComponentWithTag(render, 'textarea');
TU.Simulate.change(textarea, { target: { value: text } });
}
/**
* Simulate click on Proceed button
*/
function clickProceed() {
let proceedButton = TU.findRenderedDOMComponentWithId(render, 'proceed');
TU.Simulate.click(proceedButton);
}
/**
* Simulate click on Import button
*/
function clickImport() {
let importButton = TU.findRenderedDOMComponentWithId(render, 'import');
TU.Simulate.click(importButton);
}
describe('Import Backup', function() {
beforeEach(reset);
it('imports a valid backup', function() {
let importData = require('./fixtures/valid-backup');
let importString = JSON.stringify(importData);
expect(modal.state.importValid).toEqual(false);
expect(modal.state.errorMsg).toEqual(null);
pasteText(importString);
expect(modal.state.importValid).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.builds).toEqual(importData.builds);
expect(modal.state.comparisons).toEqual(importData.comparisons);
expect(modal.state.shipDiscount).toEqual(importData.discounts[0]);
expect(modal.state.moduleDiscount).toEqual(importData.discounts[1]);
expect(modal.state.insurance).toBe(importData.insurance.toLowerCase());
clickProceed();
expect(modal.state.processed).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickImport();
expect(Persist.getBuilds()).toEqual(importData.builds);
expect(Persist.getComparisons()).toEqual(importData.comparisons);
expect(Persist.getInsurance()).toEqual(importData.insurance.toLowerCase());
expect(Persist.getShipDiscount()).toEqual(importData.discounts[0]);
expect(Persist.getModuleDiscount()).toEqual(importData.discounts[1]);
});
it('imports an old valid backup', function() {
const importData = require('./fixtures/old-valid-export');
const importStr = JSON.stringify(importData);
pasteText(importStr);
expect(modal.state.builds).toEqual(importData.builds);
expect(modal.state.importValid).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
expect(Persist.getBuilds()).toEqual(importData.builds);
});
it('catches an invalid backup', function() {
const importData = require('./fixtures/valid-backup');
let invalidImportData = Object.assign({}, importData);
// Remove Asp Miner build used in comparison
delete(invalidImportData.builds.asp);
pasteText('"this is not valid"');
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('Must be an object or array!');
pasteText('{ "builds": "Should not be a string" }');
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('builds must be an object!');
pasteText(JSON.stringify(importData).replace(/anaconda/g, 'invalid_ship'));
expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds)).not.toContain('anaconda');
pasteText(JSON.stringify(importData).replace('Dream', ''));
expect(modal.state.importValid).toBeFalsy();
expect(Object.keys(modal.state.builds.imperial_clipper).length).toEqual(3);
pasteText(JSON.stringify(invalidImportData));
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('asp build "Miner" data is missing!');
});
});
describe('Import Detailed V3 Build', function() {
beforeEach(reset);
it('imports a valid v3 build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.&bn=Test%20My%20Ship');
});
it('catches an invalid build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v3');
pasteText(JSON.stringify(importData).replace('references', 'refs'));
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual('Anaconda Build "Test My Ship": Invalid data');
});
});
describe('Import Detailed V4 Build', function() {
beforeEach(reset);
it('imports a valid v4 build', function() {
const importData = require('./fixtures/anaconda-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/anaconda?code=A4putkFklkdzsuf52c0o0o0o1m1m0q0q0404-0l0b0100034k5n052d04---0303326b-.AwRj4zNLeI%3D%3D.CwBhCYzBGW9qCTSqq5JA.H4sIAAAAAAAAE2MUe8HMwPD%2FPwMAAGvB0AkAAAA%3D&bn=Test%20My%20Ship');
});
});
describe('Import Detailed Engineered V4 Build', function() {
beforeEach(reset);
it('imports a valid v4 build', function() {
const importData = require('./fixtures/asp-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/asp?code=A0pftiFflfddsnf5------020202033c044002v6-2i-.AwRj4yvYg%3D%3D%3D.CwRgDBldHn5A.H4sIAAAAAAAAE2P858DAwPCXEUhwHPvx%2F78YG5AltB7I%2F8%2F0TwImJboDSPJ%2F%2B%2Ff%2Fv%2FKlX%2F%2F%2Fi3AwMTBIfARK%2FGf%2BJwVSxArStVAYqOjvz%2F%2F%2FJVo5GRhE2IBc4SKQSSz%2FDGEmCa398P8%2F%2F2%2BgTf%2F%2FA7kMAExxqlSAAAAA&bn=Multi-purpose%20Asp%20Explorer');
});
it('imports a valid v4 build with modifications', function() {
const importData = require('./fixtures/courier-test-detailed-export-v4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/imperial_courier?code=A0patzF5l0das8f31a1a270202000e402t0101----.AwRj4zOYg%3D%3D%3D.CwRgDBldLuZA.H4sIAAAAAAAAE12OPUvDYBSFT1OTfkRJjUkbbC3Yj8mlODgUISAtdOlety5ODv0Vgji7O7kJ%2FgzBQX%2BEY7Gg0NKhfY%2FnHQLFDBdynufe9%2BRMCmCb06g29oCgacjiRx6gY6oWKUT8UgLaszqQfHmSnpVFN1uSeXNsJVcj%2FA2EHlZkspIUpUc6UjTXGT85qwHuSEuVc%2F16r99kDQeSSjvSbSjpyUpNK10uJJ3aYqk6smwm1lQ9bOxw71TMm8VanEqq9JW1r3Qo%2BREOLnQHvbWmb7rZIu5VLIyGQGOukPv%2F0WQk5LeEAjPOUDwtAP6bShy2HKAz0HPO%2B5KsP25I79O2I7LvD%2Bz4Il1XAQAA&bn=Multi-purpose%20Imperial%20Courier');
});
});
describe('Import Detailed Builds Array', function() {
beforeEach(reset);
it('imports all builds', function() {
const importData = require('./fixtures/valid-detailed-export');
const expectedBuilds = require('./fixtures/expected-builds');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
let builds = Persist.getBuilds();
for (let s in builds) {
for (let b in builds[s]) {
expect(builds[s][b]).toEqual(expectedBuilds[s][b]);
}
}
});
});
describe('Import Companion API Build', function() {
beforeEach(reset);
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-1');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/federal_corvette?code=A2putsFklndzsxf50x0x7l28281919040404040402020l06p05sf63c5ifr--v66g--.AwRj4zNapI%3D%3D.CwRgDBldUExuBiIlWIA%3D.&bn=Imported%20Federal%20Corvette');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-2');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/beluga?code=A0pktsFplCdpsnf70t0t2727270004040404043c4fmimlmm04mc0iv62i--.AwRj4yusg%3D%3D%3D.CwRgDBldHi8IWIA%3D.&bn=Imported%20Beluga%20Liner');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-3');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/type_7_transport?code=A0patfFflidasdf5----0404040005050504044d2402--.AwRj4yoo.CwRgDBlVK7HjEA%3D%3D.&bn=Imported%20Type-7%20Transporter');
});
it('imports a valid companion API build', function() {
const importData = require('./fixtures/companion-api-import-4');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/cobra_mk_iii?code=A0p0tdFaldd3sdf4------34----2i--.AwRj4yqA.CwRgDMYExrezBig%3D.&bn=Imported%20Cobra%20Mk%20III');
});
});
describe('Import E:D Shipyard Builds', function() {
// it('imports a valid build', function() {
// const imports = require('./fixtures/ed-shipyard-import-valid');
//
// for (let i = 0; i < imports.length; i++ ) {
// reset();
// let fixture = imports[i];
// pasteText(fixture.buildText);
// expect(modal.state.importValid).toBeTruthy();
// expect(modal.state.errorMsg).toEqual(null);
// clickProceed();
// expect(MockRouter.go.mock.calls.length).toBe(1);
// expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/' + fixture.shipId + '?code=' + encodeURIComponent(fixture.buildCode) + '&bn=' + encodeURIComponent(fixture.buildName));
// }
// });
it('catches invalid builds', function() {
const imports = require('./fixtures/ed-shipyard-import-invalid');
for (let i = 0; i < imports.length; i++ ) {
reset();
pasteText(imports[i].buildText);
expect(modal.state.importValid).toBeFalsy();
expect(modal.state.errorMsg).toEqual(imports[i].errorMsg);
}
});
});
describe('Imports from a Comparison', function() {
it('imports a valid comparison', function() {
const importBuilds = require('./fixtures/valid-backup').builds;
Persist.deleteAll();
render = TU.renderIntoDocument(<ContextProvider><ModalImport builds={importBuilds} /></ContextProvider>);
modal = TU.findRenderedComponentWithType(render, ModalImport);
expect(modal.state.processed).toBe(true);
expect(modal.state.errorMsg).toEqual(null);
clickImport();
expect(Persist.getBuilds()).toEqual(importBuilds);
});
});
describe('Imports SLEF data', () => {
beforeEach(reset);
it('imports a single valid SLEF build', () => {
const importData = require('./fixtures/slef-single-build.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(true);
clickProceed();
expect(MockRouter.go.mock.calls.length).toBe(1);
expect(MockRouter.go.mock.calls[0][0]).toBe('/outfit/krait_mkii?code=A2pptkFflidussf52l1o1o2g2g020g040405051Ofr45C9C91oP3.Iw18eQ%3D%3D.AwRgzKIkA%3D%3D%3D.&bn=Imported%20pancake%20hammer');
});
it('imports multiple SLEF builds', () => {
const importData = require('./fixtures/slef-multiple-builds.json');
const expectedBuilds = require('./fixtures/slef-multiple-expected-builds.json');
pasteText(JSON.stringify(importData));
expect(modal.state.importValid).toBeTruthy();
expect(modal.state.errorMsg).toEqual(null);
expect(modal.state.singleBuild).toBe(false);
clickProceed();
expect(modal.state.processed).toBeTruthy();
clickImport();
const builds = Persist.getBuilds();
for (const shipModel in builds) {
for (const buildName in builds[shipModel]) {
expect(builds[shipModel][buildName])
.toEqual(expectedBuilds[shipModel][buildName]);
}
}
});
});
});

143
__tests__/test-persist.js Normal file
View File

@@ -0,0 +1,143 @@
jest.unmock('../src/app/stores/Persist');
import React from 'react';
import ReactDOM from 'react-dom';
import TU from 'react-testutils-additions';
let origAddEventListener = window.addEventListener;
let storageListener;
let ls = {};
// Implment mock localStorage
let localStorage = {
getItem: function(key) {
return ls[key];
},
setItem: function(key, value) {
ls[key] = value;
},
removeItem: function(key) {
delete ls[key];
},
clear: function() {
ls = {};
}
}
window.addEventListener = function(eventName, listener) {
if(eventName == 'storage') {
storageListener = listener; // Keep track of latest storage listener
} else {
origAddEventListener.apply(arguments);
}
}
describe('Persist', function() {
const Persist = require('../src/app/stores/Persist').Persist;
describe('Multi tab/window', function() {
it("syncs builds", function() {
window.localStorage = localStorage;
ls = {};
let p = new Persist();
let newBuilds = {
anaconda: { test: '1234' }
};
storageListener({ key: 'builds', newValue: JSON.stringify(newBuilds) });
expect(p.getBuild('anaconda', 'test')).toBe('1234');
});
});
describe('General and Settings', function() {
it("has defaults", function() {
window.localStorage = localStorage;
ls = {};
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getSizeRatio()).toBe(1);
});
it("loads from localStorage correctly", function() {
window.localStorage = localStorage;
let savedData = require('./fixtures/valid-backup');
ls = {};
ls.builds = JSON.stringify(savedData.builds);
ls.NG_TRANSLATE_LANG_KEY = 'de';
ls.insurance = 'Standard';
ls.shipDiscount = 0.25;
ls.moduleDiscount = 0.15;
let p = new Persist();
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0.25);
expect(p.getModuleDiscount()).toBe(0.15);
expect(p.getLangCode()).toEqual('de');
expect(p.getBuilds('anaconda')).toEqual(savedData.builds.anaconda);
expect(p.getBuilds('python')).toEqual(savedData.builds.python);
expect(p.getBuildsNamesFor('imperial_clipper')).toEqual(['Cargo', 'Current', 'Dream', 'Multi-purpose']);
expect(p.getBuild('type_7_transport', 'Cargo')).toEqual('02A5D5A4D3D3D5C--------0505040403480101');
});
it("uses defaults from a corrupted localStorage", function() {
window.localStorage = localStorage;
ls = {};
ls.builds = "not valid json";
ls.comparisons = "1, 3, 4";
ls.insurance = 'this insurance does not exist';
ls.shipDiscount = 'this is not a number';
ls.moduleDiscount = 10; // Way to big
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getBuilds()).toEqual({});
expect(p.getComparisons()).toEqual({});
});
it("works without localStorage", function() {
window.localStorage = null;
let p = new Persist();
expect(p.getLangCode()).toBe('en');
expect(p.showTooltips()).toBe(true);
expect(p.getInsurance()).toBe('standard');
expect(p.getShipDiscount()).toBe(0);
expect(p.getModuleDiscount()).toBe(0);
expect(p.getSizeRatio()).toBe(1);
p.saveBuild('anaconda', 'test', '12345');
expect(p.getBuild('anaconda', 'test')).toBe('12345');
p.deleteBuild('anaconda', 'test');
expect(p.hasBuilds()).toBe(false);
});
it("generates the backup", function() {
window.localStorage = localStorage;
let savedData = require('./fixtures/valid-backup');
ls = {};
ls.builds = JSON.stringify(savedData.builds);
ls.insurance = 'Beta';
ls.shipDiscount = 0.25;
ls.moduleDiscount = 0.15;
let p = new Persist();
let backup = p.getAll();
expect(backup.insurance).toBe('beta');
expect(backup.shipDiscount).toBe(0.25);
expect(backup.moduleDiscount).toBe(0.15);
expect(backup.builds).toEqual(savedData.builds);
expect(backup.comparisons).toEqual({});
});
});
})

View File

@@ -0,0 +1,63 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as Serializer from '../src/app/shipyard/Serializer';
import jsen from 'jsen';
describe("Serializer", function() {
const anacondaTestExport = require.requireActual('./fixtures/anaconda-test-detailed-export-v4');
const code = anacondaTestExport.references[0].code;
const anaconda = Ships.anaconda;
const validate = jsen(require('../src/schemas/ship-loadout/4'));
describe("To Detailed Build", function() {
let testBuild = new Ship('anaconda', anaconda.properties, anaconda.slots).buildFrom(code);
let exportData = Serializer.toDetailedBuild('Test My Ship', testBuild);
it("conforms to the v4 ship-loadout schema", function() {
expect(validate(exportData)).toBe(true);
});
it("contains the correct components and stats", function() {
expect(exportData.components).toEqual(anacondaTestExport.components);
expect(exportData.stats).toEqual(anacondaTestExport.stats);
expect(exportData.ship).toEqual(anacondaTestExport.ship);
expect(exportData.name).toEqual(anacondaTestExport.name);
});
});
describe("Export Detailed Builds", function() {
const expectedExport = require('./fixtures/valid-detailed-export');
const builds = require('./fixtures/expected-builds');
const exportData = Serializer.toDetailedExport(builds);
it("conforms to the v4 ship-loadout schema", function() {
expect(exportData instanceof Array).toBe(true);
for (let detailedBuild of exportData) {
expect(validate(detailedBuild)).toBe(true);
}
});
});
describe("From Detailed Build", function() {
it("builds the ship correctly", function() {
let testBuildA = new Ship('anaconda', anaconda.properties, anaconda.slots);
testBuildA.buildFrom(code);
let testBuildB = Serializer.fromDetailedBuild(anacondaTestExport);
for(var p in testBuildB) {
if (p == 'availCS') {
continue;
}
expect(testBuildB[p]).toEqual(testBuildA[p], p + ' does not match');
}
});
});
});

156
__tests__/test-ship.js Normal file
View File

@@ -0,0 +1,156 @@
import Ship from '../src/app/shipyard/Ship';
import { Ships } from 'coriolis-data/dist';
import * as ModuleUtils from '../src/app/shipyard/ModuleUtils';
describe("Ship", function() {
it("can build all ships", function() {
for (let s in Ships) {
let shipData = Ships[s];
let ship = new Ship(s, shipData.properties, shipData.slots);
for (let p in shipData.properties) {
expect(ship[p]).toEqual(shipData.properties[p], s + ' property [' + p + '] does not match when built');
}
ship.buildWith(shipData.defaults);
expect(ship.totalCost).toEqual(shipData.retailCost, s + ' retail cost does not match default build cost');
expect(ship.cargoCapacity).toBeDefined();
expect(ship.priorityBands[0].retracted).toBeGreaterThan(0, s + ' priorityBands');
expect(ship.powerAvailable).toBeGreaterThan(0, s + ' powerAvailable');
expect(ship.unladenRange).toBeGreaterThan(0, s + ' unladenRange');
expect(ship.ladenRange).toBeGreaterThan(0, s + ' ladenRange');
expect(ship.fuelCapacity).toBeGreaterThan(0, s + ' fuelCapacity');
expect(ship.unladenFastestRange).toBeGreaterThan(0, s + ' unladenFastestRange');
expect(ship.ladenFastestRange).toBeGreaterThan(0, s + ' ladenFastestRange');
expect(ship.shield).toBeGreaterThan(0, s + ' shield');
expect(ship.armour).toBeGreaterThan(0, s + ' armour');
expect(ship.topSpeed).toBeGreaterThan(0, s + ' topSpeed');
}
});
it("resets and rebuilds properly", function() {
var id = 'cobra_mk_iii';
var cobra = Ships[id];
var shipA = new Ship(id, cobra.properties, cobra.slots);
var shipB = new Ship(id, cobra.properties, cobra.slots);
var testShip = new Ship(id, cobra.properties, cobra.slots);
var buildA = cobra.defaults;
var buildB = {
standard:['4A', '4A', '4A', '3D', '3A', '3A', '4C'],
hardpoints: ['0s', '0s', '2d', '2d', 0, '04'],
internal: ['45', '03', '2b', '2o', '27', '53']
};
shipA.buildWith(buildA); // Build A
shipB.buildWith(buildB);// Build B
testShip.buildWith(buildA);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
}
testShip.buildWith(buildB);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipB[p], p + ' does not match');
}
testShip.buildWith(buildA);
for(var p in testShip) {
if (p == 'availCS') {
continue;
}
expect(testShip[p]).toEqual(shipA[p], p + ' does not match');
}
});
it("discounts hull and components properly", function() {
var id = 'cobra_mk_iii';
var cobra = Ships[id];
var testShip = new Ship(id, cobra.properties, cobra.slots);
testShip.buildWith(cobra.defaults);
var originalHullCost = testShip.hullCost;
var originalTotalCost = testShip.totalCost;
var discount = 0.1;
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
testShip.applyDiscounts(discount, discount);
// Floating point errors cause miniscule decimal places which are handled in the app by rounding/formatting
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.floor(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
expect(Math.floor(testShip.totalCost)).toEqual(Math.floor(originalTotalCost * (1 - discount)), 'Discounted Total cost does not match');
testShip.applyDiscounts(0, 0); // No discount, 100% of cost
expect(testShip.m.discountedCost).toEqual(originalHullCost, 'Hull cost does not match');
expect(testShip.totalCost).toEqual(originalTotalCost, 'Total cost does not match');
testShip.applyDiscounts(discount, 0); // Only discount hull
expect(Math.floor(testShip.m.discountedCost)).toEqual(Math.round(originalHullCost * (1 - discount)), 'Discounted Hull cost does not match');
expect(testShip.totalCost).toEqual(originalTotalCost - originalHullCost + testShip.m.discountedCost, 'Total cost does not match');
});
it("enforces a single shield generator", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
expect(anaconda.internal[2].m.grp).toEqual('sg', 'Anaconda default shield generator slot');
anaconda.use(anaconda.internal[1], ModuleUtils.internal('4j')); // 6E Shield Generator
expect(anaconda.internal[2].m).toEqual(null, 'Anaconda default shield generator slot is empty');
expect(anaconda.internal[1].m.id).toEqual('4j', 'Slot 1 should have SG 4j in it');
expect(anaconda.internal[1].m.grp).toEqual('sg','Slot 1 should have SG 4j in it');
});
it("enforces a single shield fuel scoop", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
anaconda.use(anaconda.internal[4], ModuleUtils.internal('32')); // 4A Fuel Scoop
expect(anaconda.internal[4].m.grp).toEqual('fs', 'Anaconda fuel scoop slot');
anaconda.use(anaconda.internal[3], ModuleUtils.internal('32'));
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original fuel scoop slot is empty');
expect(anaconda.internal[3].m.id).toEqual('32', 'Slot 1 should have FS 32 in it');
expect(anaconda.internal[3].m.grp).toEqual('fs','Slot 1 should have FS 32 in it');
});
it("enforces a single refinery", function() {
var id = 'anaconda';
var anacondaData = Ships[id];
var anaconda = new Ship(id, anacondaData.properties, anacondaData.slots);
anaconda.buildWith(anacondaData.defaults);
anaconda.use(anaconda.internal[4], ModuleUtils.internal('23')); // 4E Refinery
expect(anaconda.internal[4].m.grp).toEqual('rf', 'Anaconda refinery slot');
anaconda.use(anaconda.internal[3], ModuleUtils.internal('23'));
expect(anaconda.internal[4].m).toEqual(null, 'Anaconda original refinery slot is empty');
expect(anaconda.internal[3].m.id).toEqual('23', 'Slot 1 should have RF 23 in it');
expect(anaconda.internal[3].m.grp).toEqual('rf','Slot 1 should have RF 23 in it');
});
});

25
__tests__/testUtils.js Normal file
View File

@@ -0,0 +1,25 @@
import React from 'react';
import PropTypes from 'prop-types';
const TestUtils = {
createContextProvider: function(context) {
var _contextTypes = {};
Object.keys(context).forEach(function(key) {
_contextTypes[key] = PropTypes.any;
});
return React.createClass({
displayName: 'ContextProvider',
childContextTypes: _contextTypes,
getChildContext() { return context; },
render() {
return React.Children.only(this.props.children);
}
});
}
};
export default TestUtils;

View File

@@ -3,24 +3,13 @@ var WebpackDevServer = require("webpack-dev-server");
var config = require('./webpack.config.dev'); var config = require('./webpack.config.dev');
new WebpackDevServer(webpack(config), { new WebpackDevServer(webpack(config), {
publicPath: config.output.publicPath,
hot: true, hot: true,
disableHostCheck: true,
headers: { "Access-Control-Allow-Origin": "*" }, headers: { "Access-Control-Allow-Origin": "*" },
historyApiFallback: { historyApiFallback: {
rewrites: [ rewrites: [
// For some reason connect-history-api-fallback does not allow '.' in the URL for history fallback... // For some reason connect-history-api-fallback does not allow '.' in the URL for history fallback...
{ from: /\/outfit\//, to: '/index.html' } { from: /\/outfit\//, to: '/index.html' }
] ]
},
stats: {
assets: true,
colors: true,
version: false,
hash: false,
timings: true,
chunks: false,
chunkModules: false
} }
}).listen(3300, "0.0.0.0", function (err, result) { }).listen(3300, "0.0.0.0", function (err, result) {
if (err) { if (err) {

29120
package-lock.json generated

File diff suppressed because it is too large Load Diff

View File

@@ -1,28 +1,67 @@
{ {
"name": "coriolis_shipyard", "name": "coriolis_shipyard",
"version": "3.0.0", "version": "3.0.1",
"repository": { "repository": {
"type": "git", "type": "git",
"url": "https://github.com/EDCD/coriolis" "url": "https://github.com/EDCD/coriolis"
}, },
"homepage": "https://coriolis.io", "homepage": "https://coriolis.io",
"bugs": "https://github.com/EDCD/coriolis/issues", "bugs": "https://github.com/EDCD/coriolis/issues",
"contributors": [
{ "name": "cmdrmcdonald" },
{ "name": "willb321" },
{ "name": "felixlinker" }
],
"private": true, "private": true,
"engine": "node >= 4.8.1", "engine": "node >= 10.13.0",
"license": "MIT", "license": "MIT",
"scripts": { "scripts": {
"extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f", "extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f",
"clean": "rimraf build", "clean": "rimraf build",
"start": "node devServer.js", "start": "node devServer.js",
"lint": "eslint --ext .js,.jsx src", "lint": "eslint --ext .js,.jsx src",
"test": "jest",
"prod-serve": "nginx -p $(pwd) -c nginx.conf", "prod-serve": "nginx -p $(pwd) -c nginx.conf",
"prod-stop": "kill -QUIT $(cat nginx.pid)", "prod-stop": "kill -QUIT $(cat nginx.pid)",
"build": "npm run clean && cross-env NODE_ENV=production webpack -p --config webpack.config.prod.js", "buildfresh": "rimraf node_modules && rm package-lock.json && npm install && npm run build > >(tee -a stdout.log) 2> >(tee -a stderr.log >&2)",
"build": "npm run clean && cross-env NODE_ENV=production webpack --config webpack.config.prod.js",
"rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws", "rsync": "rsync -ae \"ssh -i $CORIOLIS_PEM\" --delete build/ $CORIOLIS_USER@$CORIOLIS_HOST:~/wwws",
"deploy": "npm run lint && npm test && npm run build && npm run rsync" "deploy": "npm run lint && npm test && npm run build && npm run rsync"
}, },
"jest": {
"transform": {
".*": "<rootDir>/node_modules/babel-jest"
},
"testRegex": "(/__tests__/test-.*|\\.(test|spec))\\.js$",
"moduleFileExtensions": [
"js",
"json",
"jsx"
],
"automock": true,
"bail": false,
"unmockedModulePathPatterns": [
"<rootDir>/node_modules/lodash",
"<rootDir>/node_modules/react",
"<rootDir>/node_modules/react-dom",
"<rootDir>/node_modules/react-transition-group",
"<rootDir>/node_modules/react-testutils-additions",
"<rootDir>/node_modules/fbjs",
"<rootDir>/node_modules/fbemitter",
"<rootDir>/node_modules/classnames",
"<rootDir>/node_modules/d3",
"<rootDir>/node_modules/lz-string",
"<rootDir>/node_modules/jsen",
"coriolis-data",
"<rootDir>/src/app/shipyard",
"<rootDir>/src/app/i18n",
"<rootDir>/src/app/utils",
"<rootDir>/src/schemas",
"<rootDir>/__tests__"
]
},
"devDependencies": { "devDependencies": {
"@babel/core": "^7.0.0", "@babel/core": "^7.20.12",
"@babel/plugin-proposal-class-properties": "^7.0.0", "@babel/plugin-proposal-class-properties": "^7.0.0",
"@babel/plugin-proposal-decorators": "^7.0.0", "@babel/plugin-proposal-decorators": "^7.0.0",
"@babel/plugin-proposal-do-expressions": "^7.0.0", "@babel/plugin-proposal-do-expressions": "^7.0.0",
@@ -41,14 +80,12 @@
"@babel/plugin-syntax-import-meta": "^7.0.0", "@babel/plugin-syntax-import-meta": "^7.0.0",
"@babel/preset-env": "^7.0.0", "@babel/preset-env": "^7.0.0",
"@babel/preset-react": "^7.0.0", "@babel/preset-react": "^7.0.0",
"appcache-webpack-plugin": "^1.4.0", "@rollup/plugin-node-resolve": "^15.0.1",
"babel-core": "^7.0.0-bridge.0",
"babel-eslint": "^10.0.1",
"babel-loader": "^8.0.0", "babel-loader": "^8.0.0",
"copy-webpack-plugin": "^4.5.2", "copy-webpack-plugin": "^10.2.4",
"create-react-class": "^15.6.3", "create-react-class": "^15.6.3",
"cross-env": "^5.2.0", "cross-env": "^5.2.0",
"css-loader": "^1.0.0", "css-loader": "^6.7.3",
"d3-selection": "^1.3.2", "d3-selection": "^1.3.2",
"esdoc": "^1.1.0", "esdoc": "^1.1.0",
"esdoc-custom-theme": "^1.4.2", "esdoc-custom-theme": "^1.4.2",
@@ -59,54 +96,66 @@
"esdoc-standard-plugin": "^1.0.0", "esdoc-standard-plugin": "^1.0.0",
"eslint": "^5.6.0", "eslint": "^5.6.0",
"eslint-plugin-react": "^7.11.1", "eslint-plugin-react": "^7.11.1",
"expose-loader": "^0.7.5", "expose-loader": "^3.1.0",
"express": "^4.16.3", "express": "^4.18.2",
"extract-text-webpack-plugin": "^4.0.0-beta.0", "html-webpack-plugin": "^5.5.0",
"file-loader": "^2.0.0", "jsen": "^0.6.6",
"html-webpack-plugin": "^3.0.7",
"jsen": "^0.6.4",
"json-loader": "^0.5.4", "json-loader": "^0.5.4",
"less": "^3.8.1", "less": "^3.8.1",
"less-loader": "^4.1.0", "less-loader": "^11.1.0",
"react-addons-perf": "^15.4.2", "mini-css-extract-plugin": "^2.7.2",
"react-container-dimensions": "^1.4.1", "react-container-dimensions": "^1.4.1",
"react-testutils-additions": "^16.0.0", "react-testutils-additions": "^15.0.0",
"react-transition-group": "^2.5.0", "react-transition-group": "^2.5.0",
"rimraf": "^2.6.1", "rimraf": "^4.1.2",
"rollup": "^0.66.2", "rollup": "^3.17.2",
"rollup-plugin-node-resolve": "^3.4.0", "style-loader": "^3.3.1",
"style-loader": "^0.23.0", "uglify-js": "^3.17.4",
"uglify-js": "^3.4.9", "webpack": "^5.75.0",
"url-loader": "^1.1.1", "webpack-cli": "^5.0.1",
"webpack": "^4.20.2", "webpack-dev-server": "^4.11.1",
"webpack-bugsnag-plugins": "^1.2.2", "webpack-merge": "^5.8.0",
"webpack-cli": "^3.1.1", "webpack-notifier": "^1.15.0",
"webpack-dev-server": "^3.1.9", "workbox-cacheable-response": "^6.5.4",
"webpack-notifier": "^1.6.0", "workbox-expiration": "^6.5.4",
"workbox-webpack-plugin": "^3.6.1" "workbox-precaching": "^6.5.4",
"workbox-routing": "^6.5.4",
"workbox-strategies": "^6.5.4",
"workbox-webpack-plugin": "^6.5.4"
}, },
"sideEffects": false, "sideEffects": false,
"dependencies": { "dependencies": {
"@babel/polyfill": "^7.0.0", "assert": "^1.5.0",
"auto-bind": "^2.1.1", "auto-bind": "^5.0.1",
"base64url": "^3.0.1",
"browserify-zlib-next": "^1.0.1", "browserify-zlib-next": "^1.0.1",
"buffer": "^5.7.0",
"classnames": "^2.2.6", "classnames": "^2.2.6",
"constants-browserify": "^1.0.0",
"core-js": "^3.28.0",
"coriolis-data": "../coriolis-data",
"crypto-browserify": "^3.12.0",
"d3": "^5.7.0", "d3": "^5.7.0",
"detect-browser": "^3.0.1", "detect-browser": "^3.0.1",
"ed-forge": "../ed-forge",
"fbemitter": "^2.1.1", "fbemitter": "^2.1.1",
"https-browserify": "^1.0.0",
"lodash": "^4.17.11", "lodash": "^4.17.11",
"lz-string": "^1.4.4", "lz-string": "^1.4.4",
"pako": "^1.0.6", "os-browserify": "^0.3.0",
"pako": "^2.1.0",
"path-browserify": "^1.0.1",
"prop-types": "^15.6.2", "prop-types": "^15.6.2",
"react": "^15.5.4", "react": "^15.6.2",
"react-dom": "^15.5.4", "react-dom": "^15.6.2",
"react-extras": "^0.7.1",
"react-fuzzy": "^0.5.2", "react-fuzzy": "^0.5.2",
"react-ga": "^2.5.3", "react-ga": "^2.5.3",
"react-number-editor": "^4.0.3", "react-number-editor": "^4.0.3",
"recharts": "^1.2.0", "recharts": "^1.2.0",
"register-service-worker": "^1.5.2", "register-service-worker": "^1.7.2",
"superagent": "^3.8.3" "stream-browserify": "^3.0.0",
"stream-http": "^3.2.0",
"superagent": "^3.8.3",
"url": "^0.11.0",
"vm-browserify": "^1.1.2"
} }
} }

View File

@@ -1,4 +1,4 @@
import nodeResolve from "rollup-plugin-node-resolve"; import nodeResolve from "@rollup/plugin-node-resolve";
export default { export default {
entry: "d3-funcs.js", entry: "d3-funcs.js",

View File

@@ -214,7 +214,7 @@ Options -MultiViews
# </Files> # </Files>
AddType application/x-web-app-manifest+json webapp AddType application/x-web-app-manifest+json webapp
AddType text/cache-manifest appcache manifest # AddType text/cache-manifest appcache manifest
# Media files # Media files
AddType audio/mp4 f4a f4b m4a AddType audio/mp4 f4a f4b m4a

View File

@@ -5,20 +5,27 @@ import { register } from 'register-service-worker';
import { EventEmitter } from 'fbemitter'; import { EventEmitter } from 'fbemitter';
import { getLanguage } from './i18n/Language'; import { getLanguage } from './i18n/Language';
import Persist from './stores/Persist'; import Persist from './stores/Persist';
import { Ship } from 'ed-forge';
import Announcement from './components/Announcement'; import Announcement from './components/Announcement';
import Header from './components/Header'; import Header from './components/Header';
import Tooltip from './components/Tooltip'; import Tooltip from './components/Tooltip';
import ModalExport from './components/ModalExport';
import ModalHelp from './components/ModalHelp'; import ModalHelp from './components/ModalHelp';
import ModalImport from './components/ModalImport'; import ModalImport from './components/ModalImport';
import ModalPermalink from './components/ModalPermalink'; import ModalPermalink from './components/ModalPermalink';
import * as CompanionApiUtils from './utils/CompanionApiUtils';
import * as JournalUtils from './utils/JournalUtils';
import AboutPage from './pages/AboutPage'; import AboutPage from './pages/AboutPage';
import NotFoundPage from './pages/NotFoundPage'; import NotFoundPage from './pages/NotFoundPage';
import OutfittingPage from './pages/OutfittingPage'; import OutfittingPage from './pages/OutfittingPage';
import ComparisonPage from './pages/ComparisonPage';
import ShipyardPage from './pages/ShipyardPage'; import ShipyardPage from './pages/ShipyardPage';
import ErrorDetails from './pages/ErrorDetails'; import ErrorDetails from './pages/ErrorDetails';
const zlib = require('pako');
const request = require('superagent');
/** /**
* Coriolis App * Coriolis App
*/ */
@@ -55,6 +62,7 @@ export default class Coriolis extends React.Component {
this._onLanguageChange = this._onLanguageChange.bind(this); this._onLanguageChange = this._onLanguageChange.bind(this);
this._onSizeRatioChange = this._onSizeRatioChange.bind(this); this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
this._keyDown = this._keyDown.bind(this); this._keyDown = this._keyDown.bind(this);
this._importBuild = this._importBuild.bind(this);
this.emitter = new EventEmitter(); this.emitter = new EventEmitter();
this.state = { this.state = {
@@ -65,14 +73,15 @@ export default class Coriolis extends React.Component {
route: {}, route: {},
sizeRatio: Persist.getSizeRatio() sizeRatio: Persist.getSizeRatio()
}; };
// TODO: New mechanism for announcements
// this._getAnnouncements();
Router('', (r) => this._setPage(ShipyardPage, r)); Router('', (r) => this._setPage(ShipyardPage, r));
Router('/import?', (r) => this._importBuild(r)); Router('/import?', (r) => this._importBuild(r));
Router('/import/:data', (r) => this._importBuild(r)); Router('/import/:data', (r) => this._importBuild(r));
Router('/outfit/?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/?', (r) => this._setPage(OutfittingPage, r));
Router('/outfit/:ship/?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/:ship/?', (r) => this._setPage(OutfittingPage, r));
Router('/outfit/:ship/:code?', (r) => this._setPage(OutfittingPage, r)); Router('/outfit/:ship/:code?', (r) => this._setPage(OutfittingPage, r));
Router('/compare/:name?', (r) => this._setPage(ComparisonPage, r));
Router('/comparison?', (r) => this._setPage(ComparisonPage, r));
Router('/comparison/:code', (r) => this._setPage(ComparisonPage, r));
Router('/about', (r) => this._setPage(AboutPage, r)); Router('/about', (r) => this._setPage(AboutPage, r));
Router('*', (r) => this._setPage(null, r)); Router('*', (r) => this._setPage(null, r));
} }
@@ -84,25 +93,39 @@ export default class Coriolis extends React.Component {
_importBuild(r) { _importBuild(r) {
try { try {
// Need to decode and gunzip the data, then build the ship // Need to decode and gunzip the data, then build the ship
let ship = new Ship(r.params.data); const data = zlib.inflate(new Buffer.from(r.params.data, 'base64'), { to: 'string' });
r.params.ship = ship.getShipType(); const json = JSON.parse(data);
r.params.code = ship.compress(); console.info('Ship import data: ');
this._setPage(OutfittingPage, r); console.info(json);
let ship, importString;
if (json) {
if (json.length && json[0].data) { // SLEF
if (json.length > 1) { // Multiple builds, open modal
importString = data;
} else { // Single build, import directly
ship = JournalUtils.shipFromLoadoutJSON(json[0].data);
}
} else { // not SLEF
if (json.modules) {
ship = CompanionApiUtils.shipFromJson(json);
} else if (json.Modules) {
ship = JournalUtils.shipFromLoadoutJSON(json);
}
}
}
if (ship) {
r.params.ship = ship.id;
r.params.code = ship.toString();
this._setPage(OutfittingPage, r);
} else if (importString) {
this._setPage(ShipyardPage, r);
this._showModal(<ModalImport importString={data}/>);
}
} catch (err) { } catch (err) {
this._onError('Failed to import ship', r.path, 0, 0, err); this._onError('Failed to import ship', r.path, 0, 0, err);
} }
} }
// async _getAnnouncements() {
// try {
// const announces = await request.get('https://orbis.zone/api/announcement')
// .query({ showInCoriolis: true });
// this.setState({ announcements: announces.body });
// } catch (err) {
// console.error(err)
// }
// }
/** /**
* Updates / Sets the page and route context * Updates / Sets the page and route context
* @param {[type]} page The page to be shown * @param {[type]} page The page to be shown
@@ -126,13 +149,6 @@ export default class Coriolis extends React.Component {
*/ */
_onError(msg, scriptUrl, line, col, errObj) { _onError(msg, scriptUrl, line, col, errObj) {
console && console.error && console.error(arguments); // eslint-disable-line no-console console && console.error && console.error(arguments); // eslint-disable-line no-console
if (errObj) {
if (errObj instanceof Error) {
bugsnagClient.notify(errObj); // eslint-disable-line
} else if (errObj instanceof String) {
bugsnagClient.notify(msg, errObj); // eslint-disable-line
}
}
this.setState({ this.setState({
error: <ErrorDetails error={{ message: msg, details: { scriptUrl, line, col, error: JSON.stringify(errObj) } }}/>, error: <ErrorDetails error={{ message: msg, details: { scriptUrl, line, col, error: JSON.stringify(errObj) } }}/>,
page: null, page: null,
@@ -377,12 +393,11 @@ export default class Coriolis extends React.Component {
render() { render() {
let currentMenu = this.state.currentMenu; let currentMenu = this.state.currentMenu;
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu} return <div style={{ minHeight: '100%' }} onClick={this._closeMenu}
className={this.state.noTouch ? 'no-touch' : null} className={this.state.noTouch ? 'no-touch' : null}>
>
<Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate} <Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate}
currentMenu={currentMenu}/> currentMenu={currentMenu}/>
{/* <div className="announcement-container">{this.state.announcements.map(a => <Announcement <div className="announcement-container">{this.state.announcements.map(a => <Announcement
text={a.message}/>)}</div> */} text={a.text}/>)}</div>
{this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) : {this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) :
<NotFoundPage/>} <NotFoundPage/>}
{this.state.modal} {this.state.modal}
@@ -391,7 +406,7 @@ export default class Coriolis extends React.Component {
<div className="right cap"> <div className="right cap">
<a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer" <a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer"
title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a> title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a>
<br/> <br/>
<a <a
href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'} href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'}

View File

@@ -1,11 +1,12 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import { autoBind } from 'react-extras'; import autoBind from 'auto-bind';
/** /**
* Announcement component * Announcement component
*/ */
export default class Announcement extends React.Component { export default class Announcement extends React.Component {
static propTypes = { static propTypes = {
text: PropTypes.string text: PropTypes.string
}; };
@@ -26,4 +27,5 @@ export default class Announcement extends React.Component {
render() { render() {
return <div className="announcement" >{this.props.text}</div>; return <div className="announcement" >{this.props.text}</div>;
} }
} }

View File

@@ -1,22 +1,129 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { CoriolisLogo, MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import FuzzySearch from 'react-fuzzy'; import FuzzySearch from 'react-fuzzy';
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
import { get, groupBy, mapValues, sortBy, zip, zipWith } from 'lodash';
import autoBind from 'auto-bind';
import MODULE_STATS from 'ed-forge/lib/src/module-stats';
import { SHOW } from '../shipyard/StatsMapping';
const PRESS_THRESHOLD = 500; // mouse/touch down threshold const PRESS_THRESHOLD = 500; // mouse/touch down threshold
const MOUNT_MAP = { /*
fixed: <MountFixed className={'lg'} />, * Categorisation of module groups
gimbal: <MountGimballed className={'lg'} />, */
turret: <MountTurret className={'lg'} />, const GRPCAT = {
'sg': 'shields',
'bsg': 'shields',
'psg': 'shields',
'scb': 'shields',
'cc': 'limpet controllers',
'fx': 'limpet controllers',
'hb': 'limpet controllers',
'mlc': 'limpet controllers',
'pc': 'limpet controllers',
'rpl': 'limpet controllers',
'pce': 'passenger cabins',
'pci': 'passenger cabins',
'pcm': 'passenger cabins',
'pcq': 'passenger cabins',
'fh': 'hangars',
'pv': 'hangars',
'fs': 'fuel',
'ft': 'fuel',
'hr': 'structural reinforcement',
'mrp': 'structural reinforcement',
'bl': 'lasers',
'pl': 'lasers',
'ul': 'lasers',
'ml': 'lasers',
'c': 'projectiles',
'mc': 'projectiles',
'advmc': 'projectiles',
'axmc': 'experimental',
'axmce': 'experimental',
'ntp': 'experimental',
'fc': 'projectiles',
'rfl': 'experimental',
'pa': 'projectiles',
'rg': 'projectiles',
'mr': 'ordnance',
'amr': 'ordnance',
'axmr': 'experimental',
'axmre': 'experimental',
'rcpl': 'experimental',
'dtl': 'experimental',
'tbsc': 'experimental',
'tbem': 'experimental',
'tbrfl': 'experimental',
'mahr': 'experimental',
'rsl': 'experimental',
'tp': 'ordnance',
'nl': 'ordnance',
'sc': 'scanners',
'ss': 'scanners',
// Utilities
'cs': 'scanners',
'kw': 'scanners',
'ws': 'scanners',
'xs': 'scanners',
'ch': 'defence',
'po': 'defence',
'ec': 'defence',
'sfn': 'defence',
// Guardian
'gpp': 'guardian',
'gpc': 'guardian',
'gsrp': 'guardian',
'ggc': 'guardian',
'gfsb': 'guardian',
'gmrp': 'guardian',
'gsc': 'guardian',
'ghrp': 'guardian',
// Mining
'scl': 'mining',
'pwa': 'mining',
'sdm': 'mining',
// Assists
'dc': 'flight assists',
'sua': 'flight assists',
// Stabilizers
'ews': 'weapon stabilizers',
};
// Order here is the order in which items will be shown in the modules menu
const CATEGORIES = {
// Internals
'am': ['am'],
'cr': ['cr'],
'fi': ['fi'],
'fuel': ['ft', 'fs'],
'hangars': ['fh', 'pv'],
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl', 'mlc'],
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
'rf': ['rf'],
'shields': ['sg', 'bsg', 'psg', 'scb'],
'structural reinforcement': ['hr', 'mrp'],
'flight assists': ['dc', 'sua'],
// Hardpoints
'lasers': ['pl', 'ul', 'bl'],
'projectiles': ['mc', 'advmc', 'c', 'fc', 'pa', 'rg'],
'ordnance': ['mr', 'amr', 'tp', 'nl'],
// Utilities
'sb': ['sb'],
'hs': ['hs'],
'csl': ['csl'],
'defence': ['ch', 'po', 'ec'],
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
// Experimental
'experimental': ['axmc', 'axmce', 'axmr', 'axmre', 'ntp','rfl', 'tbrfl', 'tbsc', 'tbem', 'xs', 'sfn', 'rcpl', 'dtl', 'rsl', 'mahr',],
'weapon stabilizers': ['ews'],
// Guardian
'guardian': ['gpp', 'gpd', 'gpc', 'ggc', 'gsrp', 'gfsb', 'ghrp', 'gmrp', 'gsc'],
'mining': ['ml', 'scl', 'pwa', 'sdm', 'abl'],
}; };
/** /**
@@ -24,10 +131,15 @@ const MOUNT_MAP = {
*/ */
export default class AvailableModulesMenu extends TranslatedComponent { export default class AvailableModulesMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
hideSearch: PropTypes.bool, diffDetails: PropTypes.func,
m: PropTypes.object, m: PropTypes.object,
ship: PropTypes.object.isRequired,
warning: PropTypes.func, warning: PropTypes.func,
firstSlotId: PropTypes.string,
lastSlotId: PropTypes.string,
activeSlotId: PropTypes.string,
slotDiv: PropTypes.object slotDiv: PropTypes.object
}; };
@@ -38,8 +150,10 @@ export default class AvailableModulesMenu extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); this._hideDiff = this._hideDiff.bind(this);
this._showSearch = this._showSearch.bind(this);
this.state = this._initState(props, context); this.state = this._initState(props, context);
this.slotItems = [];// Array to hold <li> refs.
} }
/** /**
@@ -49,206 +163,278 @@ export default class AvailableModulesMenu extends TranslatedComponent {
* @return {Object} list: Array of React Components, currentGroup Component if any * @return {Object} list: Array of React Components, currentGroup Component if any
*/ */
_initState(props, context) { _initState(props, context) {
const { translate } = context.language; let translate = context.language.translate;
const { m } = props; let { m, warning, onSelect, modules, ship } = props;
const list = [], fuzzy = []; let list, currentGroup;
let currentGroup;
const modules = m.getApplicableItems().map(getModuleInfo); let buildGroup = this._buildGroup.bind(
const groups = mapValues( this,
groupBy(modules, (info) => info.meta.group), ship,
(infos) => groupBy(infos, (info) => info.meta.type), translate,
m,
warning,
(m, event) => {
this._hideDiff(event);
onSelect(m);
}
); );
// Build categories sorted by translated category name let fuzzy = [];
const groupKeys = sortBy(Object.keys(groups), translate); if (modules instanceof Array) {
for (const group of groupKeys) { list = buildGroup(modules[0].grp, modules);
const groupName = translate(group); } else {
if (groupKeys.length > 1) { list = [];
list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>); // At present time slots with grouped options (Hardpoints and Internal) can be empty
if (m) {
let emptyId = 'empty';
if (this.firstSlotId == null) this.firstSlotId = emptyId;
let keyDown = this._keyDown.bind(this, onSelect);
list.push(<div className='empty-c upp' key={emptyId} data-id={emptyId} onClick={onSelect.bind(null, null)}
onKeyDown={keyDown} tabIndex="0"
ref={slotItem => this.slotItems[emptyId] = slotItem}>{translate('empty')}</div>);
} }
const categories = groups[group]; // Need to regroup the modules by our own categorisation
const categoryKeys = sortBy(Object.keys(categories), translate); let catmodules = {};
for (const category of categoryKeys) { // Pre-create to preserve ordering
const categoryName = translate(category); for (let cat in CATEGORIES) {
const infos = categories[category]; catmodules[cat] = [];
if (categoryKeys.length > 1) { }
list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>); for (let g in modules) {
const moduleCategory = GRPCAT[g] || g;
const existing = catmodules[moduleCategory] || [];
catmodules[moduleCategory] = existing.concat(modules[g]);
}
for (let category in catmodules) {
let categoryHeader = false;
// Order through CATEGORIES if present
const categories = CATEGORIES[category] || [category];
if (categories && categories.length) {
for (let n in categories) {
const grp = categories[n];
// We now have the group and the category. We might not have any modules, though...
if (modules[grp]) {
// Decide if we need a category header as well as a group header
if (categories.length === 1) {
// Show category header instead of group header
if (m && grp == m.grp) {
// If this is a missing module/weapon, skip it
if (m.grp == "mh" || m.grp == "mm"){
continue;
} else {
list.push(<div ref={(elem) => this.groupElem = elem} key={category}
className={'select-category upp'}>{translate(category)}</div>);
}
} else {
if (category == "mh" || category == "mm"){
continue;
} else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
}
}
} else {
// Show category header as well as group header
if (!categoryHeader) {
if (category == "mh" || category == "mm"){
continue;
}
else {
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
categoryHeader = true;
}
}
if (m && grp == m.grp) {
list.push(<div ref={(elem) => this.groupElem = elem} key={grp}
className={'select-group cap'}>{translate(grp)}</div>);
} else {
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
}
}
list.push(buildGroup(grp, modules[grp]));
for (const i of modules[grp]) {
let mount = '';
if (i.mount === 'F') {
mount = 'Fixed';
} else if (i.mount === 'G') {
mount = 'Gimballed';
} else if (i.mount === 'T') {
mount = 'Turreted';
}
let special = '';
if (typeof(i.special) !== 'undefined') {
special = `(${translate(i.special)})`;
}
const fuzz = { grp, m: i, name: `${i.class}${i.rating}${mount ? ' ' + mount : ''} ${translate(grp)} ${translate(special)}` };
fuzzy.push(fuzz);
}
}
}
} }
list.push(
this._buildGroup(
m,
category,
infos,
),
);
fuzzy.push(
...infos.map((info) => {
const { meta } = info;
const mount = meta.mount ? ' ' + translate(meta.mount) : '';
return {
grp: groupName,
cat: categoryName,
m: info.proto.Item,
name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
};
}),
);
} }
} }
return { list, currentGroup, fuzzy, trackingFocus: false }; let trackingFocus = false;
return { list, currentGroup, fuzzy, trackingFocus };
}
/**
* Return Is expiremental capacity reached
* @return {boolean} Is experimental capacity reached
*/
_experimentalCapacityReached() {
const ship = this.props.ship;
const ews = ship.internal.filter(o => o.m && o.m.grp === 'ews');
let expCap;
if(ews.length < 1){
expCap = 4;
} else{
expCap = ews[0].m.class == 3 ? 5 : 6;
}
return expCap <= this.props.ship.hardpoints.filter(o => o.m && o.m.experimental).length;
} }
/** /**
* Generate React Components for Module Group * Generate React Components for Module Group
* @param {Ship} ship Ship the selection is for
* @param {Function} translate Translate function
* @param {Object} mountedModule Mounted Module * @param {Object} mountedModule Mounted Module
* @param {String} category Category key * @param {Function} warningFunc Warning function
* @param {function} onSelect Select/Mount callback
* @param {string} grp Group name
* @param {Array} modules Available modules * @param {Array} modules Available modules
* @return {React.Component} Available Module Group contents * @return {React.Component} Available Module Group contents
*/ */
_buildGroup(mountedModule, category, modules) { _buildGroup(ship, translate, mountedModule, warningFunc, onSelect, grp, modules) {
const { warning } = this.props; let prevClass = null, prevRating = null, prevName;
const ship = mountedModule.getShip(); let elems = [];
const classMapping = groupBy(modules, (info) => info.meta.class);
const itemsPerClass = Math.max( const sortedModules = modules.sort(this._moduleOrder);
...Object.values(classMapping).map((l) => l.length),
);
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
// Nested array of <li> elements; will be flattened before being rendered.
// Each sub-array represents one row in the final view.
const elems = [[]];
// Reverse sort for descending order of module class // Calculate the number of items per class. Used so we don't have long lists with only a few items in each row
for (const clazz of Object.keys(classMapping).sort().reverse()) { const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => {
for (let info of sortBy( count[cls] = ++count[cls] || 1;
classMapping[clazz], return count;
(info) => info.meta.mount || info.meta.rating, }, {});
)) { const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key]));
const { meta } = info;
const { Item } = info.proto;
// Can only be true if shieldgenmaximalmass is defined, i.e. this let itemsOnThisRow = 0;
// module must be a shield generator for (let i = 0; i < sortedModules.length; i++) {
let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass'); let m = sortedModules[i];
if (meta.experimental && !mountedModule.readMeta('experimental')) { // If m.grp is mh or mm, or m.symbol contains 'Missing' skip it
disabled = if (m.grp == 'mh' || m.grp == 'mm' || (typeof(m.symbol) !== 'undefined' && m.symbol.includes("Missing"))) {
4 <= // If this is a missing module, skip it
ship.getHardpoints().filter((m) => m.readMeta('experimental')) continue;
.length;
}
// Default event handlers for objects that are disabled
let eventHandlers = {};
if (!disabled) {
const showDiff = this._showDiff.bind(this, mountedModule, info);
const select = (event) => {
this._hideDiff(event);
this.props.onSelect(Item);
};
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
};
}
const mountSymbol = MOUNT_MAP[meta.mount];
const li = (
<li key={Item} data-id={Item}
ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
className={cn(meta.type === 'armour' ? 'lc' : 'c', {
warning: !disabled && warning && warning(info),
active: mountedModule.getItem() === Item,
disabled,
hardpoint: mountSymbol,
})}
{...eventHandlers}
>{mountSymbol}{meta.type === 'armour' ? Item : `${meta.class}${meta.rating}`}</li>
);
const tail = elems.pop();
let newTail = [tail];
if (tail.length < itemsPerRow) {
// If the row has not grown too long, the new <li> element can be
// added to the row itself
tail.push(li);
} else {
// Otherwise, the last row gets a line break element added and this
// item is put into a new row
tail.push(<br key={elems.length}/>);
newTail.push([li]);
}
elems.push(...newTail);
} }
} let mount = null;
let disabled = false;
prevName = m.name;
if (ModuleUtils.isShieldGenerator(m.grp)) {
// Shield generators care about maximum hull mass
disabled = ship.hullMass > m.maxmass;
// If the mounted module is experimental as well, we can replace it so
// the maximum does not apply
} else if (m.experimental && (!mountedModule || !mountedModule.experimental)) {
disabled = this._experimentalCapacityReached();
} else if (m.grp === 'mlc' && (!mountedModule || mountedModule.grp !== 'mlc')) {
disabled = 1 <= ship.internal.filter(o => o.m && o.m.grp === 'mlc').length;
}
let active = mountedModule && mountedModule.id === m.id;
let classes = cn(m.name ? 'lc' : 'c', {
warning: !disabled && warningFunc && warningFunc(m),
active,
disabled
});
let eventHandlers;
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>; if (disabled) {
eventHandlers = {
onKeyDown: this._keyDown.bind(this, null),
onKeyUp: this._keyUp.bind(this, null)
};
} else {
/**
* Get the ids of the first and last <li> elements in the <ul> that are focusable (i.e. are not active or disabled)
* Will be used to keep focus inside the <ul> on Tab and Shift-Tab while it is visible
*/
if (this.firstSlotId == null) this.firstSlotId = sortedModules[i].id;
if (active) this.activeSlotId = sortedModules[i].id;
this.lastSlotId = sortedModules[i].id;
let showDiff = this._showDiff.bind(this, mountedModule, m);
let select = onSelect.bind(null, m);
eventHandlers = {
onMouseEnter: this._over.bind(this, showDiff),
onTouchStart: this._touchStart.bind(this, showDiff),
onTouchEnd: this._touchEnd.bind(this, select),
onMouseLeave: this._hideDiff,
onClick: select,
onKeyDown: this._keyDown.bind(this, select),
onKeyUp: this._keyUp.bind(this, select)
};
}
switch (m.mount) {
case 'F':
mount = <MountFixed className={'lg'}/>;
break;
case 'G':
mount = <MountGimballed className={'lg'}/>;
break;
case 'T':
mount = <MountTurret className={'lg'}/>;
break;
}
if (m.name && m.name === prevName) {
// elems.push(<br key={'b' + m.grp + i} />);
itemsOnThisRow = 0;
}
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
elems.push(<br key={'b' + m.grp + i}/>);
itemsOnThisRow = 0;
}
let tbIdx = (classes.indexOf('disabled') < 0) ? 0 : undefined;
elems.push(
<li key={m.id} data-id={m.id} className={classes} {...eventHandlers} tabIndex={tbIdx}
ref={slotItem => this.slotItems[m.id] = slotItem}>
{mount}
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
</li>
);
itemsOnThisRow++;
prevClass = m.class;
prevRating = m.rating;
prevName = m.name;
}
return <ul key={'modules' + grp}>{elems}</ul>;
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @param {Object} mountedModule The module mounted currently * @param {Object} mm The module mounet currently
* @param {Object} hoveringModule The hovered module * @param {Object} m The hovered module
* @param {DOMRect} rect DOMRect for target element * @param {DOMRect} rect DOMRect for target element
*/ */
_showDiff(mountedModule, hoveringModule, rect) { _showDiff(mm, m, rect) {
const { tooltip, language } = this.context; if (this.props.diffDetails) {
const { formats, translate, units } = language; this.touchTimeout = null;
this.touchTimeout = null; this.context.tooltip(this.props.diffDetails(m, mm), rect);
const mountedIsEmpty = mountedModule.isEmpty(); }
const props = (
mountedIsEmpty ? ['mass'] : Object.keys(hoveringModule.props)
).map((prop) => SHOW[prop] ? SHOW[prop].as : prop);
const oldProps = mountedIsEmpty ?
[{ value: 0 }] :
props.map((prop) => mountedModule.getFormatted(prop, false));
const newProps = mountedModule.try(() => {
mountedModule.setItem(hoveringModule.proto.Item);
return props.map((prop) => mountedModule.getFormatted(prop, false));
});
const diffs = zipWith(oldProps, newProps, (oldVal, newVal) => {
const { unit, value } = newVal;
if (!oldVal.value) {
return undefined;
}
return { value, diff: value - oldVal.value, unit };
});
const namedDiffs = zip(props, diffs).filter(([_, stat]) => stat !== undefined);
namedDiffs.push(['cost', {
value: hoveringModule.meta.cost,
diff: hoveringModule.meta.cost - (mountedIsEmpty ? 0 : mountedModule.readMeta('cost')),
unit: units.CR,
}]);
const tt = <div className='cap' style={{ whiteSpace: 'nowrap' }}>
{sortBy(namedDiffs, ([prop, _]) => prop).map(([prop, stats]) => {
const { unit, value, diff } = stats;
const beneficial = get(MODULE_STATS, [prop, 'higherbetter'], false) === diff > 0;
return <div key={prop}>
{translate(prop)}: <span className={diff === 0 ? 'disabled' : beneficial ? 'secondary' : 'warning'}>
{formats.round(value)} {diff !== 0 && ` (${diff > 0 ? '+' : ''}${formats.round(diff)})`}{unit}
</span>
</div>;
})}
</div>;
tooltip(tt, rect);
} }
/** /**
* Generate tooltip content for the difference between the * Generate tooltip content for the difference between the
* mounted module and the hovered modules * mounted module and the hovered modules
* @returns {React.Component} Search component if available
*/ */
_showSearch() { _showSearch() {
if (this.props.hideSearch) { if (this.props.modules instanceof Array) {
return; return;
} }
const mountedModule = this.props.m;
return ( return (
<FuzzySearch <FuzzySearch
list={this.state.fuzzy} list={this.state.fuzzy}
@@ -260,11 +446,20 @@ export default class AvailableModulesMenu extends TranslatedComponent {
onSelect={e => this.props.onSelect.bind(null, e.m)()} onSelect={e => this.props.onSelect.bind(null, e.m)()}
resultsTemplate={(props, state, styles, clickHandler) => { resultsTemplate={(props, state, styles, clickHandler) => {
return state.results.map((val, i) => { return state.results.map((val, i) => {
let disabled;
if(val.m.experimental && (!mountedModule || !mountedModule.experimental)) {
disabled = this._experimentalCapacityReached();
} else{
disabled = false;
}
const handler = disabled ? null : () => clickHandler(i);
return ( return (
<div <div
key={i} key={i}
className={'lc'} className={cn('lc', {disabled})}
onClick={() => clickHandler(i)} onClick={handler}
> >
{val.name} {val.name}
</div> </div>
@@ -309,6 +504,41 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this._hideDiff(); this._hideDiff();
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {Function} select Select module callback
* @param {SyntheticEvent} event Event
*/
_keyDown(select, event) {
let className = event.currentTarget.attributes['class'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
select();
return;
}
let elemId = event.currentTarget.attributes['data-id'].value;
if (className.indexOf('disabled') < 0 && event.key == 'Tab') {
if (event.shiftKey && elemId == this.firstSlotId) {
event.preventDefault();
this.slotItems[this.lastSlotId].focus();
return;
}
if (!event.shiftKey && elemId == this.lastSlotId) {
event.preventDefault();
this.slotItems[this.firstSlotId].focus();
return;
}
}
}
/**
* Key Up
* @param {Function} select Select module callback
* @param {SytheticEvent} event Event
*/
_keyUp(select, event) {
// nothing here yet
}
/** /**
* Hide diff tooltip * Hide diff tooltip
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
@@ -319,12 +549,69 @@ export default class AvailableModulesMenu extends TranslatedComponent {
this.context.tooltip(); this.context.tooltip();
} }
/**
* Order two modules suitably for display in module selection
* @param {Object} a the first module
* @param {Object} b the second module
* @return {int} -1 if the first module should go first, 1 if the second module should go first
*/
_moduleOrder(a, b) {
// Named modules go last
if (!a.name && b.name) {
return -1;
}
if (a.name && !b.name) {
return 1;
}
// Class ordered from highest (8) to lowest (1)
if (a.class < b.class) {
return 1;
}
if (a.class > b.class) {
return -1;
}
// Mount type, if applicable
if (a.mount && b.mount && a.mount !== b.mount) {
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
return -1;
} else {
return 1;
}
}
// Sort multi limpet controllers by name
if (a.grp === 'mlc') {
if (a.name[0] <= b.name[0]) {
return -1;
}
if (a.name[0] > b.name[0]) {
return 1;
}
}
// Rating ordered from highest (A) to lowest (E)
if (a.rating < b.rating) {
return -1;
}
if (a.rating > b.rating) {
return 1;
}
// Do not attempt to order by name at this point, as that mucks up the order of armour
return 0;
}
/** /**
* Scroll to mounted (if it exists) module group on mount * Scroll to mounted (if it exists) module group on mount
*/ */
componentDidMount() { componentDidMount() {
if (this.activeSlotRef) { if (this.groupElem) { // Scroll to currently selected group
this.activeSlotRef.focus(); this.node.scrollTop = this.groupElem.offsetTop;
}
/**
* Set focus on active or first slot element, if applicable.
*/
if (this.slotItems[this.activeSlotId]) {
this.slotItems[this.activeSlotId].focus();
} else if (this.slotItems[this.firstSlotId]) {
this.slotItems[this.firstSlotId].focus();
} }
} }
@@ -354,10 +641,10 @@ export default class AvailableModulesMenu extends TranslatedComponent {
render() { render() {
return ( return (
<div ref={node => this.node = node} <div ref={node => this.node = node}
className={cn('select', this.props.className)} className={cn('select', this.props.className)}
onScroll={this._hideDiff} onScroll={this._hideDiff}
onClick={(e) => e.stopPropagation()} onClick={(e) => e.stopPropagation()}
onContextMenu={stopCtxPropagation} onContextMenu={stopCtxPropagation}
> >
{this._showSearch()} {this._showSearch()}
{this.state.list} {this.state.list}

View File

@@ -1,7 +1,6 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
/** /**
* Boost displays a boost button that toggles bosot * Boost displays a boost button that toggles bosot
@@ -9,6 +8,8 @@ import autoBind from 'auto-bind';
*/ */
export default class Boost extends TranslatedComponent { export default class Boost extends TranslatedComponent {
static propTypes = { static propTypes = {
marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
onChange: PropTypes.func.isRequired onChange: PropTypes.func.isRequired
}; };
@@ -18,9 +19,12 @@ export default class Boost extends TranslatedComponent {
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props); super(props);
autoBind(this); const { ship, boost } = props;
this._keyDown = this._keyDown.bind(this);
this._toggleBoost = this._toggleBoost.bind(this);
} }
/** /**
@@ -66,12 +70,13 @@ export default class Boost extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { translate } = this.context.language; const { formats, translate, units } = this.context.language;
const { ship, boost } = this.props;
// TODO disable if ship cannot boost
return ( return (
<span id='boost'> <span id='boost'>
<button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}> <button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button>
{translate('boost')}
</button>
</span> </span>
); );
} }

View File

@@ -2,7 +2,6 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Cargo slider * Cargo slider
@@ -22,7 +21,8 @@ export default class Cargo extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._cargoChange = this._cargoChange.bind(this);
} }
/** /**

View File

@@ -1,14 +1,13 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import { Factory, Ship } from 'ed-forge'; import Ship from '../shipyard/Ship';
import { Insurance } from '../shipyard/Constants'; import { Insurance } from '../shipyard/Constants';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShoppingIcon } from './SvgIcons'; import { ShoppingIcon } from '../components/SvgIcons';
import autoBind from 'auto-bind';
import { assign, differenceBy, sortBy, reverse } from 'lodash';
import { FUEL_CAPACITY } from 'ed-forge/lib/src/ship-stats';
/** /**
* Cost Section * Cost Section
@@ -17,7 +16,7 @@ export default class CostSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
buildName: PropTypes.string, buildName: PropTypes.string
}; };
/** /**
@@ -26,34 +25,71 @@ export default class CostSection extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this); this._costsTab = this._costsTab.bind(this);
this._sortCost = this._sortCost.bind(this);
this._sortAmmo = this._sortAmmo.bind(this);
this._sortRetrofit = this._sortRetrofit.bind(this);
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
this._eddbShoppingList = this._inaraShoppingList.bind(this);
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
const { ship, buildName } = props;
this.shipType = ship.getShipType();
this.state = { this.state = {
retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null, retrofitShip,
shipDiscount: Persist.getShipDiscount(), retrofitName,
moduleDiscount: Persist.getModuleDiscount(), shipDiscount,
moduleDiscount,
insurance: Insurance[Persist.getInsurance()], insurance: Insurance[Persist.getInsurance()],
tab: Persist.getCostTab(), tab: Persist.getCostTab(),
buildOptions: Persist.getBuildsNamesFor(ship.getShipType()), buildOptions: Persist.getBuildsNamesFor(props.ship.id),
predicate: 'cr', ammoPredicate: 'cr',
desc: true, ammoDesc: true,
excluded: {}, costPredicate: 'cr',
costDesc: true,
retroPredicate: 'cr',
retroDesc: true
}; };
} }
/** /**
* Create a ship instance to base/reference retrofit changes from * Create a ship instance to base/reference retrofit changes from
* @param {string} shipId Ship Id
* @param {string} name Build name
* @param {Ship} retrofitShip Existing retrofit ship
* @return {Ship} Retrofit ship * @return {Ship} Retrofit ship
*/ */
_buildRetrofitShip() { _buildRetrofitShip(shipId, name, retrofitShip) {
const { retrofitName } = this.state; let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults
if (Persist.hasBuild(this.shipType, retrofitName)) {
return new Ship(Persist.getBuild(this.shipType, retrofitName)); if (!retrofitShip) { // Don't create a new instance unless needed
} else { retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
return Factory.newShip(this.shipType);
} }
if (Persist.hasBuild(shipId, name)) {
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
} else {
retrofitShip.buildWith(data.defaults); // Populate with default components
}
return retrofitShip;
}
/**
* Get the default retrofit build name if it exists
* @param {string} shipId Ship Id
* @param {string} name Build name
* @return {string} Build name or null
*/
_defaultRetrofitName(shipId, name) {
return Persist.hasBuild(shipId, name) ? name : null;
} }
/** /**
@@ -71,6 +107,9 @@ export default class CostSection extends TranslatedComponent {
_onDiscountChanged() { _onDiscountChanged() {
let shipDiscount = Persist.getShipDiscount(); let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount(); let moduleDiscount = Persist.getModuleDiscount();
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this.setState({ shipDiscount, moduleDiscount }); this.setState({ shipDiscount, moduleDiscount });
} }
@@ -87,33 +126,156 @@ export default class CostSection extends TranslatedComponent {
* @param {SyntheticEvent} event Build name to base the retrofit ship on * @param {SyntheticEvent} event Build name to base the retrofit ship on
*/ */
_onBaseRetrofitChange(event) { _onBaseRetrofitChange(event) {
this.setState({ retrofitName: event.target.value }); let retrofitName = event.target.value;
let ship = this.props.ship;
if (retrofitName) {
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
} else {
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
}
this._updateRetrofit(ship, this.state.retrofitShip);
this.setState({ retrofitName });
} }
/** /**
* Toggle item cost inclusion * On builds changed check to see if the retrofit ship needs
* @param {String} key Key of the row to toggle * to be updated
*/ */
_toggleExcluded(key) { _onBuildsChanged() {
let { excluded } = this.state; let update = false;
excluded = assign({}, excluded); let ship = this.props.ship;
const slotExcluded = excluded[key]; let { retrofitName, retrofitShip } = this.state;
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
this.setState({ excluded });
}
/** if(!Persist.hasBuild(ship.id, retrofitName)) {
* Set list sort predicate retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
* @param {string} newPredicate sort predicate this.setState({ retrofitName: null });
*/ update = true;
_sortBy(newPredicate) { } else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
let { predicate, desc } = this.state; retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
update = true;
if (newPredicate == predicate) {
desc = !desc;
} }
this.setState({ predicate: newPredicate, desc }); if (update) { // Update retrofit comparison
this._updateRetrofit(ship, retrofitShip);
}
// Update list of retrofit base build options
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
}
/**
* Toggle item cost inclusion in overall total
* @param {Object} item Cost item
*/
_toggleCost(item) {
this.props.ship.setCostIncluded(item, !item.incCost);
this.forceUpdate();
}
/**
* Toggle item cost inclusion in retrofit total
* @param {Object} item Cost item
*/
_toggleRetrofitCost(item) {
let retrofitTotal = this.state.retrofitTotal;
item.retroItem.incCost = !item.retroItem.incCost;
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
this.setState({ retrofitTotal });
}
/**
* Set cost list sort predicate
* @param {string} predicate sort predicate
*/
_sortCostBy(predicate) {
let { costPredicate, costDesc } = this.state;
if (costPredicate == predicate) {
costDesc = !costDesc;
}
this.setState({ costPredicate: predicate, costDesc });
}
/**
* Sort cost list
* @param {Ship} ship Ship instance
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortCost(ship, predicate, desc) {
let costList = ship.costList;
let translate = this.context.language.translate;
if (predicate == 'm') {
costList.sort(slotComparator(translate, null, desc));
} else {
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
}
}
/**
* Set ammo list sort predicate
* @param {string} predicate sort predicate
*/
_sortAmmoBy(predicate) {
let { ammoPredicate, ammoDesc } = this.state;
if (ammoPredicate == predicate) {
ammoDesc = !ammoDesc;
}
this.setState({ ammoPredicate: predicate, ammoDesc });
}
/**
* Sort ammo cost list
* @param {Array} ammoCosts Ammo cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortAmmo(ammoCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'm') {
ammoCosts.sort(slotComparator(translate, null, desc));
} else {
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
}
}
/**
* Set retrofit list sort predicate
* @param {string} predicate sort predicate
*/
_sortRetrofitBy(predicate) {
let { retroPredicate, retroDesc } = this.state;
if (retroPredicate == predicate) {
retroDesc = !retroDesc;
}
this.setState({ retroPredicate: predicate, retroDesc });
}
/**
* Sort retrofit cost list
* @param {Array} retrofitCosts Retrofit cost list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort descending
*/
_sortRetrofit(retrofitCosts, predicate, desc) {
let translate = this.context.language.translate;
if (predicate == 'cr') {
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
} else {
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
}
if (!desc) {
retrofitCosts.reverse();
}
} }
/** /**
@@ -122,34 +284,18 @@ export default class CostSection extends TranslatedComponent {
*/ */
_costsTab() { _costsTab() {
let { ship } = this.props; let { ship } = this.props;
let { let { shipDiscount, moduleDiscount, insurance } = this.state;
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
} = this.state;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let rows = []; let rows = [];
let modules = sortBy( for (let i = 0, l = ship.costList.length; i < l; i++) {
ship.getModules(), let item = ship.costList[i];
(predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost')) if (item.m && item.m.cost) {
); let toggle = this._toggleCost.bind(this, item);
if (desc) { rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}>
reverse(modules); <td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td>
} <td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td>
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
let totalCost = 0;
for (let module of modules) {
const cost = module.readMeta('cost');
const slot = module.getSlot();
if (cost) {
let toggle = this._toggleExcluded.bind(this, slot);
const disabled = excluded[slot];
if (!disabled) {
totalCost += cost;
}
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
</tr>); </tr>);
} }
} }
@@ -158,23 +304,23 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%', borderCollapse: 'collapse' }}> <table style={{ width: '100%', borderCollapse: 'collapse' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}> <th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}>
{translate('module')} {translate('module')}
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null} {shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} ${formats.pct(-1 * shipDiscount)}]`}</u> : null}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} ${formats.pct(-1 * moduleDiscount)}]`}</u> : null}
</th> </th>
<th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th> <th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl' >{translate('total')}</td> <td colSpan='2' className='lbl' >{translate('total')}</td>
<td className='val'>{formats.int(totalCost)}{units.CR}</td> <td className='val'>{formats.int(ship.totalCost)}{units.CR}</td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl'>{translate('insurance')}</td> <td colSpan='2' className='lbl'>{translate('insurance')}</td>
<td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td> <td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -182,66 +328,17 @@ export default class CostSection extends TranslatedComponent {
} }
/** /**
* Open up a window for EDDB with a shopping list of our retrofit components * Open up a window for inara with a shopping list of our retrofit components
*/ */
_eddbShoppingList() { _inaraShoppingList() {
const {} = this.state; const { retrofitCosts } = this.state;
const { ship } = this.props; const { ship } = this.props;
// Provide unique list of non-PP module EDDB IDs to buy // Provide unique list of non-PP module EDDB IDs to buy
// const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i); const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
// Open up the relevant URL // Open up the relevant URL
// TODO: window.open('https://inara.cz/inapi/corisearch.php?m=' + modIds.join(','));
// window.open('https://eddb.io/station?m=' + modIds.join(','));
}
/**
*
*/
_retrofitInfo() {
const { ship } = this.props;
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
const retrofitShip = this._buildRetrofitShip();
const currentModules = ship.getModules();
const oldModules = retrofitShip.getModules();
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
let modules = [];
let totalCost = 0;
const addModule = (m, costFactor) => {
const key = `${m.getItem()}@${m.getSlot()}`;
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
modules.push({
key, cost,
rating: m.getClassRating(),
item: m.readMeta('type'),
});
if (!excluded[key]) {
totalCost += cost;
}
};
for (let m of buyModules) {
addModule(m, 1);
}
for (let m of sellModules) {
addModule(m, -1);
}
let _sortF = undefined;
switch (predicate) {
case 'cr': _sortF = (o) => o.cost; break;
case 'm':
default: _sortF = (o) => o.item; break;
};
modules = sortBy(modules, _sortF);
if (desc) {
reverse(modules);
}
return [totalCost, modules];
} }
/** /**
@@ -249,52 +346,59 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_retrofitTab() { _retrofitTab() {
let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state; let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state;
const { termtip, tooltip } = this.context; const { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
let int = formats.int; let int = formats.int;
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
for (let opt of this.state.buildOptions) {
options.push(<option key={opt} value={opt}>{opt}</option>);
}
if (retrofitCosts.length) {
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
let item = retrofitCosts[i];
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
</tr>);
}
} else {
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
}
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
return <div> return <div>
<div className='scroll-x'> <div className='scroll-x'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th>
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}> <th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th>
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
{translate('net cost')} {translate('net cost')}
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null} {moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
</th> </th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{retrofitInfo.length ? {rows}
retrofitInfo.map((info) => (
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
onClick={() => this._toggleExcluded(info.key)}>
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
<td className='le ptr shorten cap'>{translate(info.item)}</td>
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
{int(info.cost)}{units.CR}
</td>
</tr>
)) : (
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
)}
<tr className='ri'> <tr className='ri'>
<td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td> <td className='lbl' ><button onClick={this._inaraShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
<td className='lbl' >{translate('cost')}</td> <td colSpan='3' className='lbl' >{translate('cost')}</td>
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}> <td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
{int(retrofitTotal)}{units.CR} {int(retrofitTotal)}{units.CR}
</td> </td>
</tr> </tr>
<tr className='ri'> <tr className='ri'>
<td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td> <td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td>
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td> <td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>&#9662;</u></td>
<td className='val' style={{ borderLeft:'none', padding: 0 }}> <td className='val' style={{ borderLeft:'none', padding: 0 }}>
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}> <select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
<option key='stock' value=''>{translate('Stock')}</option> {options}
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
</select> </select>
</td> </td>
</tr> </tr>
@@ -304,50 +408,63 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/**
*
* @param {*} modules
*/
_ammoInfo() {
const { ship } = this.props;
const { desc, predicate } = this.state;
let info = [{ /**
key: 'fuel', * Update retrofit costs
item: 'Fuel', * @param {Ship} ship Ship instance
qty: ship.get(FUEL_CAPACITY), * @param {Ship} retrofitShip Retrofit Ship instance
unitCost: 50, */
cost: 50 * ship.get(FUEL_CAPACITY), _updateRetrofit(ship, retrofitShip) {
}]; let retrofitCosts = [];
for (let m of ship.getModules()) { let retrofitTotal = 0, i, l, item;
const rebuilds = m.get('bays') * m.get('rebuildsperbay');
const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds; if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) {
if (ammo) { item = {
const unitCost = m.readMeta('ammocost'); buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating,
info.push({ buyId: ship.bulkheads.m.eddbID,
key: `restock_${m.getSlot()}`, buyPp: ship.bulkheads.m.pp,
rating: m.getClassRating(), buyName: ship.bulkheads.m.name,
item: m.readMeta('type'), sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating,
qty: ammo, sellName: retrofitShip.bulkheads.m.name,
unitCost, cost: unitCost * ammo, netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost,
}); retroItem: retrofitShip.bulkheads
};
retrofitCosts.push(item);
if (retrofitShip.bulkheads.incCost) {
retrofitTotal += item.netCost;
} }
} }
let _sortF = undefined; for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
switch (predicate) { let retroSlotGroup = retrofitShip[g];
case 'cr': _sortF = (o) => o.cost; break; let slotGroup = ship[g];
case 'qty': _sortF = (o) => o.qty; break; for (i = 0, l = slotGroup.length; i < l; i++) {
case 'cost': _sortF = (o) => o.unitCost; break; const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null;
case 'm': const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null;
default: _sortF = (o) => o.item; if (modId != retroModId) {
} item = { netCost: 0, retroItem: retroSlotGroup[i] };
info = sortBy(info, _sortF); if (slotGroup[i].m) {
if (desc) { item.buyId = slotGroup[i].m.eddbID,
reverse(info); item.buyPp = slotGroup[i].m.pp,
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
item.netCost = slotGroup[i].discountedCost;
}
if (retroSlotGroup[i].m) {
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
item.netCost -= retroSlotGroup[i].discountedCost;
}
retrofitCosts.push(item);
if (retroSlotGroup[i].incCost) {
retrofitTotal += item.netCost;
}
}
}
} }
return info; this.setState({ retrofitCosts, retrofitTotal });
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
} }
/** /**
@@ -355,24 +472,20 @@ export default class CostSection extends TranslatedComponent {
* @return {React.Component} Tab contents * @return {React.Component} Tab contents
*/ */
_ammoTab() { _ammoTab() {
const { excluded } = this.state; let { ammoTotal, ammoCosts } = this.state;
const { translate, formats, units } = this.context.language; let { translate, formats, units } = this.context.language;
const int = formats.int; let int = formats.int;
const rows = []; let rows = [];
const ammoInfo = this._ammoInfo(); for (let i = 0, l = ammoCosts.length; i < l; i++) {
let total = 0; let item = ammoCosts[i];
for (let i of ammoInfo) { rows.push(<tr key={i} className='highlight'>
const disabled = excluded[i.key]; <td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td>
rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)} <td className='le shorten cap'>{slotName(translate, item)}</td>
className={cn('highlight', { disabled })}> <td className='ri'>{int(item.max)}</td>
<td style={{ width: '1em' }}>{i.rating}</td> <td className='ri'>{int(item.cost)}{units.CR}</td>
<td className='le shorten cap'>{translate(i.item)}</td> <td className='ri'>{int(item.total)}{units.CR}</td>
<td className='ri'>{int(i.qty)}</td>
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
<td className='ri'>{int(i.cost)}{units.CR}</td>
</tr>); </tr>);
total += disabled ? 0 : i.cost;
} }
return <div> return <div>
@@ -380,17 +493,17 @@ export default class CostSection extends TranslatedComponent {
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th>
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th> <th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th>
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th> <th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th>
<th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th> <th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows} {rows}
<tr className='ri'> <tr className='ri'>
<td colSpan='4' className='lbl' >{translate('total')}</td> <td colSpan='4' className='lbl' >{translate('total')}</td>
<td className='val'>{int(total)}{units.CR}</td> <td className='val'>{int(ammoTotal)}{units.CR}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -398,6 +511,103 @@ export default class CostSection extends TranslatedComponent {
</div>; </div>;
} }
/**
* Recalculate all ammo costs
* @param {Ship} ship Ship instance
*/
_updateAmmoCosts(ship) {
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
let slotGroup = ship[g];
for (let i = 0, l = slotGroup.length; i < l; i++) {
if (slotGroup[i].m) {
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
q = 0;
switch (slotGroup[i].m.grp) {
case 'fs': // Skip fuel calculation if scoop present
scoop = true;
break;
case 'scb':
q = slotGroup[i].m.getAmmo() + 1;
break;
case 'am':
q = slotGroup[i].m.getAmmo();
break;
case 'pv':
srvs += slotGroup[i].m.getBays();
break;
case 'fx': case 'hb': case 'cc': case 'pc':
limpets = ship.cargoCapacity;
break;
default:
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
}
// Calculate ammo costs only if a cost is specified
if (slotGroup[i].m.ammocost > 0) {
item = {
m: slotGroup[i].m,
max: q,
cost: slotGroup[i].m.ammocost,
total: q * slotGroup[i].m.ammocost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Add fighters
if (slotGroup[i].m.grp === 'fh') {
item = {
m: slotGroup[i].m,
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
cost: slotGroup[i].m.fightercost,
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
};
ammoCosts.push(item);
ammoTotal += item.total;
}
}
}
}
// Limpets if controllers exist and cargo space available
if (limpets > 0) {
item = {
m: { name: 'limpets', class: '', rating: '' },
max: ship.cargoCapacity,
cost: 101,
total: ship.cargoCapacity * 101
};
ammoCosts.push(item);
ammoTotal += item.total;
}
if (srvs > 0) {
item = {
m: { name: 'SRVs', class: '', rating: '' },
max: srvs,
cost: 1030,
total: srvs * 1030
};
ammoCosts.push(item);
ammoTotal += item.total;
}
// Calculate refuel costs if no scoop present
if (!scoop) {
item = {
m: { name: 'fuel', class: '', rating: '' },
max: ship.fuelCapacity,
cost: 50,
total: ship.fuelCapacity * 50
};
ammoCosts.push(item);
ammoTotal += item.total;
}
this.setState({ ammoTotal, ammoCosts });
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
}
/** /**
* Add listeners on mount and update costs * Add listeners on mount and update costs
*/ */
@@ -405,7 +615,64 @@ export default class CostSection extends TranslatedComponent {
this.listeners = [ this.listeners = [
Persist.addListener('discounts', this._onDiscountChanged.bind(this)), Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)), Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
]; ];
this._updateAmmoCosts(this.props.ship);
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
this._sortCost(this.props.ship);
}
/**
* Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context
*/
componentWillReceiveProps(nextProps, nextContext) {
let retrofitShip = this.state.retrofitShip;
if (nextProps.ship != this.props.ship) { // Ship has changed
let nextId = nextProps.ship.id;
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
this.setState({
retrofitShip,
retrofitName,
buildOptions: Persist.getBuildsNamesFor(nextId)
});
}
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
this._updateAmmoCosts(nextProps.ship);
this._updateRetrofit(nextProps.ship, retrofitShip);
this._sortCost(nextProps.ship);
}
}
/**
* Sort lists before render
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
let state = this.state;
switch (nextState.tab) {
case 'ammo':
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
}
break;
case 'retrofit':
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
}
break;
default:
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
}
}
} }
/** /**

View File

@@ -1,10 +1,9 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import VerticalBarChart from './VerticalBarChart'; import VerticalBarChart from './VerticalBarChart';
import autoBind from 'auto-bind';
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/src/ship-stats';
/** /**
* Defence information * Defence information
@@ -16,10 +15,12 @@ import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-fo
*/ */
export default class Defence extends TranslatedComponent { export default class Defence extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired, marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.object.isRequired, opponent: PropTypes.object.isRequired,
engagementRange: PropTypes.number.isRequired, engagementrange: PropTypes.number.isRequired,
sys: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired
}; };
/** /**
@@ -28,7 +29,22 @@ export default class Defence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
this.state = { shield, armour, shielddamage, armourdamage };
}
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
this.setState({ shield, armour, shielddamage, armourdamage });
}
return true;
} }
/** /**
@@ -36,104 +52,187 @@ export default class Defence extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship } = this.props; const { opponent, sys, opponentWep } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { shield, armour, shielddamage, armourdamage } = this.state;
const shields = ship.get(SHIELD_METRICS); const pd = opponent.standard[4].m;
// Data for pie chart (absolute MJ) const shieldSourcesData = [];
const shieldSourcesData = [ const effectiveShieldData = [];
'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs', const shieldDamageTakenData = [];
].map((key) => { return { label: key, value: Math.round(shields[key]) }; }); const shieldSourcesTt = [];
const shieldDamageTakenAbsoluteTt = [];
const shieldDamageTakenExplosiveTt = [];
const shieldDamageTakenKineticTt = [];
const shieldDamageTakenThermalTt = [];
const effectiveShieldAbsoluteTt = [];
const effectiveShieldExplosiveTt = [];
const effectiveShieldKineticTt = [];
const effectiveShieldThermalTt = [];
let maxEffectiveShield = 0;
if (shield.total) {
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
shieldSourcesData.push({ value: Math.round(shield.addition), label: translate('shield addition') });
// Data for tooltip if (shield.generator > 0) {
const shieldSourcesTt = shieldSourcesData.map((o) => { shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
let { label, value } = o; effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
return <div key={label}> effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
{translate(label)} {formats.int(value)}{units.MJ} effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
</div>; effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
}); if (shield.boosters > 0) {
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
}
// Shield resistances if (shield.cells > 0) {
const shieldDamageTakenData = [ shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
'absolute', 'explosive', 'kinetic', 'thermal', effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
].map((label) => { effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
const dmgMult = shields[label]; effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map( effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
(label) => <div key={label}> }
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
});
// Effective MJ // Add effective shield from resistances
const effectiveShieldData = [ const rawMj = shield.generator + shield.boosters + shield.cells;
'absolute', 'explosive', 'kinetic', 'thermal' const explosiveMj = rawMj / (shield.explosive.base) - rawMj;
].map((label) => { if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>);
const dmgMult = shields[label]; const kineticMj = rawMj / (shield.kinetic.base) - rawMj;
const raw = shields.withSCBs; if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>);
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map( const thermalMj = rawMj / (shield.thermal.base) - rawMj;
(label) => <div key={label}> if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>);
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
</div>
);
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
});
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
const armour = ship.get(ARMOUR_METRICS); // Add effective shield from power distributor SYS pips
const moduleProtection = ship.get(MODULE_PROTECTION_METRICS); if (shield.absolute.sys != 1) {
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.total - rawMj)}{units.MJ}</div>);
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.total - rawMj / shield.explosive.base)}{units.MJ}</div>);
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.total - rawMj / shield.kinetic.base)}{units.MJ}</div>);
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.total - rawMj / shield.thermal.base)}{units.MJ}</div>);
}
}
// Data for pie chart (absolute HP) shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>);
const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map( shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>);
(key) => { return { label: key, value: Math.round(armour[key]) }; } shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>);
);
// Data for tooltip shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>);
const armourSourcesTt = armourSourcesData.map((o) => { shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>);
let { label, value } = o; shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>);
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
});
// Armour resistances shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>);
const armourDamageTakenData = [ shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>);
'absolute', 'explosive', 'kinetic', 'thermal', 'caustic', shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>);
].map((label) => {
const dmgMult = armour[label];
const tooltip = ['byAlloys', 'byHRPs'].map(
(label) => <div key={label}>
{translate(label)} {formats.pct1(dmgMult[label])}
</div>
);
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
});
// Effective HP shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>);
const effectiveArmourData = [ shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>);
'absolute', 'explosive', 'kinetic', 'thermal' shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>);
].map((label) => {
const dmgMult = armour[label]; const effectiveAbsoluteShield = shield.total / shield.absolute.total;
const raw = armour.armour; effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt });
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map( const effectiveExplosiveShield = shield.total / shield.explosive.total;
(label) => <div key={label}> effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt });
{translate(label)} {formats.int(raw * dmgMult[label])} const effectiveKineticShield = shield.total / shield.kinetic.total;
</div> effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt });
); const effectiveThermalShield = shield.total / shield.thermal.total;
return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip }; effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt });
});
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
}
const armourSourcesData = [];
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
const armourSourcesTt = [];
const effectiveArmourAbsoluteTt = [];
const effectiveArmourExplosiveTt = [];
const effectiveArmourKineticTt = [];
const effectiveArmourThermalTt = [];
const effectiveArmourCausticTt = [];
if (armour.bulkheads > 0) {
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
effectiveArmourCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
if (armour.reinforcement > 0) {
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
effectiveArmourCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
}
}
const rawArmour = armour.bulkheads + armour.reinforcement;
const armourDamageTakenTt = [];
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
const armourDamageTakenExplosiveTt = [];
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
if (armour.explosive.total != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.explosive.total - rawArmour)}</div>);
const armourDamageTakenKineticTt = [];
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
if (armour.kinetic.total != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.kinetic.total - rawArmour)}</div>);
const armourDamageTakenThermalTt = [];
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.thermal.total - rawArmour)}</div>);
const armourDamageTakenCausticTt = [];
armourDamageTakenCausticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.caustic.bulkheads)}</div>);
armourDamageTakenCausticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.caustic.reinforcement)}</div>);
if (armour.thermal.total != 1) effectiveArmourCausticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / armour.caustic.total - rawArmour)}</div>);
const effectiveArmourData = [];
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
const effectiveKineticArmour = armour.total / armour.kinetic.total;
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
const effectiveThermalArmour = armour.total / armour.thermal.total;
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
const effectiveCausticArmour = armour.total / armour.caustic.total;
effectiveArmourData.push({ value: Math.round(effectiveCausticArmour), label: translate('caustic'), tooltip: effectiveArmourCausticTt });
const armourDamageTakenData = [];
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
armourDamageTakenData.push({ value: Math.round(armour.caustic.total * 100), label: translate('caustic'), tooltip: armourDamageTakenCausticTt });
return ( return (
<span id='defence'> <span id='defence'>
{shields.withSCBs ? <span> {shield.total ? <span>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('shield metrics')}</h2> <h2>{translate('shield metrics')}</h2>
<br/> <br/>
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2> <h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2> <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
@@ -151,11 +250,11 @@ export default class Defence extends TranslatedComponent {
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('armour metrics')}</h2> <h2>{translate('armour metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2> <h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2>
<br/> <br/>
</div> </div>
<div className='group quarter'> <div className='group quarter'>

View File

@@ -1,134 +0,0 @@
import React from 'react';
import autoBind from 'auto-bind';
import Persist from '../stores/Persist';
import PropTypes from 'prop-types';
import { getBlueprintUuid, getExperimentalUuid } from 'ed-forge/lib/src/data/blueprints';
import { Loader, MatIcon } from '../components/SvgIcons';
import request from 'superagent';
import { chain, entries } from 'lodash';
import TranslatedComponent from './TranslatedComponent';
const STATE = {
READY: 0,
LOADING: 1,
ERROR: 2,
DONE: 3,
};
/**
*
*/
export default class EDEngineerButton extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
autoBind(this);
const { ship } = props;
const uuids = chain(ship.getModules())
.filter((m) => m.getBlueprint())
.map((m) => {
const uuids = [getBlueprintUuid(m.getBlueprint(), m.getBlueprintGrade())];
const exp = m.getExperimental();
if (exp) {
uuids.push(getExperimentalUuid(exp));
}
return uuids;
})
.flatMap()
.groupBy()
.mapValues((v) => v.length)
.value();
this.state = {
status: STATE.READY,
uuids,
};
}
/**
* Generates the shopping list
*/
_sendToEDEngineer() {
const { uuids } = this.state;
this.setState({ status: STATE.LOADING });
request.get('http://localhost:44405/commanders')
.then((data) => {
const [cmdr] = JSON.parse(data.text);
return Promise.all(
entries(uuids).map(
(entry) => {
const [uuid, n] = entry;
return new Promise((resolve, reject) => {
request.patch(`http://localhost:44405/${cmdr}/shopping-list`)
.field('uuid', uuid)
.field('size', n)
.end((err, res) => {
console.log('request goes out!');
if (err) {
reject(err);
} else {
resolve(res);
}
});
});
},
),
);
})
.then(() => this.setState({ status: STATE.DONE }))
.catch((err) => {
console.error(err);
this.setState({ status: STATE.ERROR });
});
}
/**
* Checks for browser compatibility of sending to ED Engineer.
* @returns {boolean} True if browser is compatible
*/
_browserIsCompatible() {
// !== Firefox 1.0+
// TODO: Double check if this really doesn't work in firefox
return typeof InstallTrigger === 'undefined';
}
/**
*
* @returns
*/
render() {
const { termtip, tooltip } = this.context;
const hide = tooltip.bind(null, null);
const { status } = this.state;
let msg = 'PHRASE_FIREFOX_EDENGINEER';
if (this._browserIsCompatible()) {
switch (status) {
case STATE.READY: msg = 'Send to EDEngineer'; break;
case STATE.LOADING: msg = 'Sending...'; break;
case STATE.ERROR: msg = 'Error sending to EDEngineer'; break;
case STATE.DONE: msg = 'Success! Clicking sends again.'; break;
}
}
return (<button
disabled={!this._browserIsCompatible()}
onClick={status !== STATE.LOADING && this._sendToEDEngineer}
onMouseOver={termtip.bind(null, msg)}
onMouseOut={hide}
>
{status === STATE.LOADING ?
<Loader className="lg" /> :
<MatIcon className="lg" />
}
</button>);
}
}

View File

@@ -2,7 +2,6 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import { moduleReduce } from 'ed-forge/lib/src/helper';
/** /**
* Engagement range slider * Engagement range slider
@@ -22,18 +21,35 @@ export default class EngagementRange extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
const { ship } = props;
const maxRange = Math.round(this._calcMaxRange(ship));
this.state = { this.state = {
maxRange: moduleReduce( maxRange
this.props.ship.getHardpoints(),
'maximumrange',
true,
// Don't use plain `Math.max` because callback will be passed four args
(a, v) => Math.max(a, v),
1000,
),
}; };
} }
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/** /**
* Update range * Update range
* @param {number} rangeLevel percentage level from 0 to 1 * @param {number} rangeLevel percentage level from 0 to 1
@@ -45,9 +61,7 @@ export default class EngagementRange extends TranslatedComponent {
const range = Math.round(rangeLevel * maxRange); const range = Math.round(rangeLevel * maxRange);
if (range !== this.props.engagementRange) { if (range !== this.props.engagementRange) {
const { onChange, ship } = this.props; this.props.onChange(range);
ship.setEngagementRange(range);
onChange(range);
} }
} }
@@ -56,8 +70,8 @@ export default class EngagementRange extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language, onWindowResize, sizeRatio } = this.context; const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { formats, translate } = language; const { formats, translate, units } = language;
const { engagementRange } = this.props; const { engagementRange } = this.props;
const { maxRange } = this.state; const { maxRange } = this.state;

View File

@@ -2,58 +2,98 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/src/stats/SpeedProfile'; import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* Engine profile for a given ship * Engine profile for a given ship
*/ */
export default class EngineProfile extends TranslatedComponent { export default class EngineProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
pips: PropTypes.number.isRequired, eng: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
}
return true;
}
/**
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
* @param {Object} ship The ship
* @param {Object} eng The number of pips to ENG
* @param {Object} boost If boost is enabled
* @param {Object} mass The mass at which to calculate the top speed
* @return {number} The maximum speed
*/
calcMaxSpeed(ship, eng, boost, mass) {
// Obtain the top speed
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
}
/** /**
* Render engine profile * Render engine profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language } = this.context; const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { translate } = language; const { formats, translate, units } = language;
const { code, ship, pips, boost } = this.props; const { ship, cargo, eng, fuel, boost } = this.props;
// Calculate bounds for our line chart // Calculate bounds for our line chart
const minMass = ship.readProp('hullmass'); const thrusters = ship.standard[1].m;
const maxMass = ship.getThrusters().get('enginemaximalmass'); const minMass = ship.calcLowestPossibleMass({ th: thrusters });
const baseSpeed = ship.readProp('speed'); const maxMass = thrusters.getMaxMass();
const baseBoost = getBoostMultiplier(ship); const mass = ship.unladenMass + fuel + cargo;
const cb = (eng, boost, mass) => { const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false);
const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5]; const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true);
return baseSpeed * (boost ? baseBoost : 1) * mult; // Add a mark at our current mass
}; const mark = Math.min(mass, maxMass);
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother // This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={cb(0, false, maxMass)} yMin={minSpeed}
yMax={cb(4, true, minMass)} yMax={maxSpeed}
// Add a mark at our current mass xMark={mark}
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum speed')} yLabel={translate('maximum speed')}
yUnit={translate('m/s')} yUnit={translate('m/s')}
func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)} func={this.state.calcMaxSpeedFunc}
points={1000} points={1000}
// Encode boost in code to re-render on state change code={code}
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
aspect={0.7} aspect={0.7}
/> />
); );

View File

@@ -2,47 +2,94 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import { calculateJumpRange } from 'ed-forge/lib/src/stats/JumpRangeProfile'; import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
const { LADEN_MASS } = ShipProps;
/** /**
* FSD profile for a given ship * FSD profile for a given ship
*/ */
export default class FSDProfile extends TranslatedComponent { export default class FSDProfile extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
cargo: PropTypes.number.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired, fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
}
return true;
}
/**
* Calculate the maximum range for this ship across its applicable mass
* @param {Object} ship The ship
* @param {Object} fuel The fuel on the ship
* @param {Object} mass The mass at which to calculate the maximum range
* @return {number} The maximum range
*/
_calcMaxRange(ship, fuel, mass) {
// Obtain the maximum range
return Calc.jumpRange(mass, ship.standard[2].m, Math.min(fuel, ship.standard[2].m.getMaxFuelPerJump()), ship);
}
/** /**
* Render FSD profile * Render FSD profile
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language } = this.context; const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { translate } = language; const { formats, translate, units } = language;
const { code, ship } = this.props; const { ship, cargo, fuel } = this.props;
// Calculate bounds for our line chart - use thruster info for X
const thrusters = ship.standard[1].m;
const fsd = ship.standard[2].m;
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
const maxMass = thrusters.getMaxMass();
const mass = ship.unladenMass + fuel + cargo;
const minRange = 0;
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump(), ship);
// Add a mark at our current mass
const mark = Math.min(mass, maxMass);
const code = ship.name + ship.toString() + '.' + fuel;
const minMass = ship.readProp('hullmass');
const maxMass = ship.getThrusters().get('enginemaximalmass');
const mass = ship.get(LADEN_MASS);
const cb = (mass) => calculateJumpRange(ship.getFSD(), 0, mass, Infinity, true);
return ( return (
<LineChart <LineChart
xMin={minMass} xMin={minMass}
xMax={maxMass} xMax={maxMass}
yMin={0} yMin={minRange}
yMax={cb(minMass)} yMax={maxRange}
// Add a mark at our current mass xMark={mark}
xMark={Math.min(mass, maxMass)}
xLabel={translate('mass')} xLabel={translate('mass')}
xUnit={translate('T')} xUnit={translate('T')}
yLabel={translate('maximum range')} yLabel={translate('maximum range')}
yUnit={translate('LY')} yUnit={translate('LY')}
func={cb} func={this.state.calcMaxRangeFunc}
points={200} points={200}
code={code} code={code}
aspect={0.7} aspect={0.7}

View File

@@ -2,7 +2,6 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Slider from '../components/Slider'; import Slider from '../components/Slider';
import autoBind from 'auto-bind';
/** /**
* Fuel slider * Fuel slider
@@ -22,7 +21,8 @@ export default class Fuel extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._fuelChange = this._fuelChange.bind(this);
} }
/** /**

View File

@@ -0,0 +1,152 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import {
DamageAbsolute,
DamageKinetic,
DamageThermal,
DamageExplosive,
MountFixed,
MountGimballed,
MountTurret,
ListModifications,
Modified
} from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Hardpoint / Utility Slot
*/
export default class HardpointSlot extends Slot {
/**
* Get the CSS class name for the slot.
* @return {string} CSS Class name
*/
_getClassNames() {
return this.props.maxClass > 0 ? 'hardpoint' : null;
}
/**
* Get the label for the slot
* @param {Function} translate Translate function
* @return {string} Label
*/
_getMaxClassLabel(translate) {
return translate(['U', 'S', 'M', 'L', 'H'][this.props.maxClass]);
}
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
let { drag, drop } = this.props;
let { termtip, tooltip } = this.context;
let validMods = Modifications.modules[m.grp].modifications || [];
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')}
onMouseOut={tooltip.bind(null, null)}><MountFixed/></span> : ''}
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')}
onMouseOut={tooltip.bind(null, null)}><MountGimballed/></span> : ''}
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')}
onMouseOut={tooltip.bind(null, null)}><MountTurret/></span> : ''}
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')}
onMouseOut={tooltip.bind(null, null)}><DamageKinetic/></span> : ''}
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')}
onMouseOut={tooltip.bind(null, null)}><DamageThermal/></span> : ''}
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')}
onMouseOut={tooltip.bind(null, null)}><DamageExplosive/></span> : ''}
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')}
onMouseOut={tooltip.bind(null, null)}><DamageAbsolute/></span> : ''}
{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r'
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}><Modified/></span> : null}
</div>
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
</div>
<div className={'cb'}>
{m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} {m.getClip() ?
<span>({formats.round1(m.getSDps())})</span> : null}</div> : null}
{m.getDamage() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getDamage() ? 'shotdmg' : 'shotdmg')}
onMouseOut={tooltip.bind(null, null)}>{translate('shotdmg')}: {formats.round1(m.getDamage())}</div> : null}
{m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')}
onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} {m.getClip() ?
<span>({formats.round1(m.getEps() * m.getSustainedFactor())}{u.MW})</span> : null}</div> : null}
{m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')}
onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} {m.getClip() ?
<span>({formats.round1(m.getHps() * m.getSustainedFactor())})</span> : null}</div> : null}
{m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')}
onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null}
{m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')}
onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null}
{m.getRange() ? <div
className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null}
{m.getScanTime() ? <div
className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null}
{m.getFalloff() ? <div
className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null}
{m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null}
{m.getAmmo() ? <div
className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null}
{m.getReload() ? <div className={'l'}>{translate('wep_reload')}: {formats.round(m.getReload())}{u.s}</div> : null}
{m.getShotSpeed() ? <div
className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null}
{m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null}
{m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null}
{m.getScanAngle() ? <div className={'l'}>{translate('scan angle')}: {formats.f2(m.getScanAngle())}°</div> : null}
{m.getScanRange() ? <div className={'l'}>{translate('scan range')}: {formats.int(m.getScanRange())}{u.m}</div> : null}
{m.getMaxAngle() ? <div className={'l'}>{translate('max angle')}: {formats.f2(m.getMaxAngle())}°</div> : null}
{showModuleResistances && m.getExplosiveResistance() ? <div
className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null}
{showModuleResistances && m.getKineticResistance() ? <div
className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null}
{showModuleResistances && m.getThermalResistance() ? <div
className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null}
{m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null}
{m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null}
{m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={modButton => this.modButton = modButton}>
<button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}>
<ListModifications/></button>
</div> : null}
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,82 +1,96 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import Slot from './Slot'; import HardpointSlot from './HardpointSlot';
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
const SIZE_ORDER = ['huge', 'large', 'medium', 'small'];
/** /**
* Hardpoint slot section * Hardpoint slot section
*/ */
export default class HardpointSlotSection extends SlotSection { export default class HardpointSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props, 'hardpoints'); super(props, context, 'hardpoints', 'hardpoints');
autoBind(this); this._empty = this._empty.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'nl-F';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.props.ship.getHardpoints(undefined, true).forEach((slot) => slot.reset()); this.selectedRefId = 'emptyall';
this.props.ship.emptyWeapons();
this.props.onChange();
this._close(); this._close();
} }
/** /**
* Fill slots with specified module * Fill slots with specified module
* @param {string} type Type of item * @param {string} group Group name
* @param {string} rating Mount Type - (fixed, gimbal, turret) * @param {string} mount Mount Type - F, G, T
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fill(type, rating, event) { _fill(group, mount, event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = group + '-' + mount;
this.props.ship.getHardpoints(undefined, true).forEach((slot) => { this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
if (slot.isEmpty() || fillAll) { this.props.onChange();
const slotSize = slot.getSize();
const fittingSizes = SIZE_ORDER.slice(SIZE_ORDER.findIndex((e) => e === slotSize));
for (const size of fittingSizes) {
try {
slot.setItem(type, size, rating);
} catch (err) {
// Try next item if this doesn't fit/exist
continue;
}
// If still here, we were able to apply the module
break;
}
}
});
this._close(); this._close();
} }
/**
* Empty all on section header right click
*/
_contextMenu() {
this._empty();
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let { ship, currentMenu, propsToShow, onPropToggle } = this.props; let { ship, currentMenu } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let slots = []; let slots = [];
let hardpoints = ship.hardpoints;
let availableModules = ship.getAvailableModules();
for (let h of ship.getHardpoints(undefined, true)) { for (let i = 0, l = hardpoints.length; i < l; i++) {
slots.push(<Slot let h = hardpoints[i];
key={h.object.Slot} if (h.maxClass) {
currentMenu={currentMenu} slots.push(<HardpointSlot
drag={this._drag.bind(this, h)} key={i}
dragOver={this._dragOverSlot.bind(this, h)} maxClass={h.maxClass}
drop={this._drop} availableModules={() => availableModules.getHps(h.maxClass)}
dropClass={this._dropClass(h, originSlot, targetSlot)} onOpen={this._openMenu.bind(this, h)}
m={h} onSelect={this._selectModule.bind(this, h)}
enabled={h.enabled ? true : false} onChange={this.props.onChange}
propsToShow={propsToShow} selected={currentMenu == h}
onPropToggle={onPropToggle} drag={this._drag.bind(this, h)}
/>); dragOver={this._dragOverSlot.bind(this, h)}
drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -87,68 +101,68 @@ export default class HardpointSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu() { _getSectionMenu(translate) {
const { translate } = this.context.language;
let _fill = this._fill; let _fill = this._fill;
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._empty}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('pulselaser')}</div> <div className='select-group cap'>{translate('pl')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'pulselaser', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'pl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pl-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('burstlaser')}</div> <div className='select-group cap'>{translate('ul')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'burstlaser', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'ul', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ul-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('beamlaser')}</div> <div className='select-group cap'>{translate('bl')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'beamlaser', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'bl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['bl-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('multicannon')}</div> <div className='select-group cap'>{translate('mc')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'multicannon', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'mc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mc-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('cannon')}</div> <div className='select-group cap'>{translate('c')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'cannon', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'c', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['c-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('fragcannon')}</div> <div className='select-group cap'>{translate('fc')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'gimbal')}><MountGimballed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'G')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-G'] = smRef}><MountGimballed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'fragcannon', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'fc', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['fc-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
<div className='select-group cap'>{translate('plasmaacc')}</div> <div className='select-group cap'>{translate('pa')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'plasmaacc', 'fixed')}>{translate('pa')}</li> <li className='lc' tabIndex='0' onClick={_fill.bind(this, 'pa', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pa-F'] = smRef}>{translate('pa')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('railgun')}</div> <div className='select-group cap'>{translate('rg')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'railgun', 'fixed')}>{translate('rg')}</li> <li className='lc' tabIndex='0' onClick={_fill.bind(this, 'rg', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rg-F'] = smRef}>{translate('rg')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('minelauncher')}</div> <div className='select-group cap'>{translate('nl')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'minelauncher', 'fixed')}>{translate('nl')}</li> <li className='lc' tabIndex='0' onClick={_fill.bind(this, 'nl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['nl-F'] = smRef}>{translate('nl')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('flaklauncher')}</div> <div className='select-group cap'>{translate('rfl')}</div>
<ul> <ul>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'fixed')}><MountFixed className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'F')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-F'] = smRef}><MountFixed className='lg'/></li>
<li className="c hardpoint" tabIndex="0" onClick={_fill.bind(this, 'flaklauncher', 'turret')}><MountTurret className='lg'/></li> <li className='c' tabIndex='0' onClick={_fill.bind(this, 'rfl', 'T')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['rfl-T'] = smRef}><MountTurret className='lg'/></li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -6,7 +6,10 @@ import Link from './Link';
import ActiveLink from './ActiveLink'; import ActiveLink from './ActiveLink';
import cn from 'classnames'; import cn from 'classnames';
import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons'; import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons';
import { Ships } from 'coriolis-data/dist';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import { toDetailedExport } from '../shipyard/Serializer';
import Ship from '../shipyard/Ship';
import ModalDeleteAll from './ModalDeleteAll'; import ModalDeleteAll from './ModalDeleteAll';
import ModalExport from './ModalExport'; import ModalExport from './ModalExport';
import ModalHelp from './ModalHelp'; import ModalHelp from './ModalHelp';
@@ -14,9 +17,6 @@ import ModalImport from './ModalImport';
import Slider from './Slider'; import Slider from './Slider';
import Announcement from './Announcement'; import Announcement from './Announcement';
import { outfitURL } from '../utils/UrlGenerators'; import { outfitURL } from '../utils/UrlGenerators';
import autoBind from 'auto-bind';
import { Factory, Ship } from 'ed-forge';
import { chain, entries } from 'lodash';
const SIZE_MIN = 0.65; const SIZE_MIN = 0.65;
const SIZE_RANGE = 0.55; const SIZE_RANGE = 0.55;
@@ -55,21 +55,32 @@ function selectAll(e) {
* Coriolis App Header section / menus * Coriolis App Header section / menus
*/ */
export default class Header extends TranslatedComponent { export default class Header extends TranslatedComponent {
/**
* Constructor /**
* @param {Object} props React Component properties * Constructor
* @param {Object} context React Component context * @param {Object} props React Component properties
*/ * @param {Object} context React Component context
*/
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); this.shipOrder = Object.keys(Ships).sort();
this.ships = Factory.getAllShipTypes().sort();
this._setLanguage = this._setLanguage.bind(this);
this._setInsurance = this._setInsurance.bind(this);
this._setShipDiscount = this._setShipDiscount.bind(this);
this._changeShipDiscount = this._changeShipDiscount.bind(this);
this._kpShipDiscount = this._kpShipDiscount.bind(this);
this._setModuleDiscount = this._setModuleDiscount.bind(this);
this._changeModuleDiscount = this._changeModuleDiscount.bind(this);
this._kpModuleDiscount = this._kpModuleDiscount.bind(this);
this._openShips = this._openMenu.bind(this, 's'); this._openShips = this._openMenu.bind(this, 's');
this._openBuilds = this._openMenu.bind(this, 'b'); this._openBuilds = this._openMenu.bind(this, 'b');
this._openComp = this._openMenu.bind(this, 'comp'); this._openComp = this._openMenu.bind(this, 'comp');
this._openAnnounce = this._openMenu.bind(this, 'announce'); this._openAnnounce = this._openMenu.bind(this, 'announce');
this._getAnnouncementsMenu = this._getAnnouncementsMenu.bind(this);
this._openSettings = this._openMenu.bind(this, 'settings'); this._openSettings = this._openMenu.bind(this, 'settings');
this._showHelp = this._showHelp.bind(this);
this.update = this.update.bind(this);
this.languageOptions = []; this.languageOptions = [];
this.insuranceOptions = []; this.insuranceOptions = [];
this.state = { this.state = {
@@ -199,6 +210,13 @@ export default class Header extends TranslatedComponent {
Persist.showTooltips(!Persist.showTooltips()); Persist.showTooltips(!Persist.showTooltips());
} }
/**
* Toggle module resistances setting
*/
_toggleModuleResistances() {
Persist.showModuleResistances(!Persist.showModuleResistances());
}
/** /**
* Show delete all modal * Show delete all modal
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} e Event
@@ -208,6 +226,20 @@ export default class Header extends TranslatedComponent {
this.context.showModal(<ModalDeleteAll />); this.context.showModal(<ModalDeleteAll />);
}; };
/**
* Show export modal with backup data
* @param {SyntheticEvent} e Event
*/
_showBackup(e) {
let translate = this.context.language.translate;
e.preventDefault();
this.context.showModal(<ModalExport
title={translate('backup')}
description={translate('PHRASE_BACKUP_DESC')}
data={Persist.getAll()}
/>);
};
/** /**
* Show export modal with detailed export * Show export modal with detailed export
* @param {SyntheticEvent} e Event * @param {SyntheticEvent} e Event
@@ -216,22 +248,10 @@ export default class Header extends TranslatedComponent {
let translate = this.context.language.translate; let translate = this.context.language.translate;
e.preventDefault(); e.preventDefault();
const builds = chain(Persist.getBuilds())
.values()
.map((builds) => Object.values(builds))
.flatMap()
.map((code) => new Ship(code))
.value();
this.context.showModal(<ModalExport this.context.showModal(<ModalExport
title={translate('detailed export')} title={translate('detailed export')}
description={translate('PHRASE_EXPORT_DESC')} description={translate('PHRASE_EXPORT_DESC')}
data={JSON.stringify(builds.map((build) => { data={toDetailedExport(Persist.getBuilds())}
return {
header: { appName: 'Inara', 'appVersion': '1.0' },
data: build.toJSON(),
};
}))}
/>); />);
} }
@@ -289,10 +309,15 @@ export default class Header extends TranslatedComponent {
* @return {React.Component} Menu * @return {React.Component} Menu
*/ */
_getShipsMenu() { _getShipsMenu() {
const { translate } = this.context.language; let shipList = [];
for (let s of this.shipOrder) {
shipList.push(<ActiveLink key={s} href={outfitURL(s)} className='block'>{Ships[s].properties.name}</ActiveLink>);
}
return ( return (
<div className='menu-list dbl no-wrap' onClick={ (e) => e.stopPropagation() }> <div className='menu-list dbl no-wrap' onClick={ (e) => e.stopPropagation() }>
{this.ships.map((s) => <ActiveLink key={s} href={outfitURL(s)} className='block'>{translate(s)}</ActiveLink>)} {shipList}
</div> </div>
); );
} }
@@ -302,10 +327,9 @@ export default class Header extends TranslatedComponent {
* @return {React.Component} Menu * @return {React.Component} Menu
*/ */
_getBuildsMenu() { _getBuildsMenu() {
const { translate } = this.context.language;
let builds = Persist.getBuilds(); let builds = Persist.getBuilds();
let buildList = []; let buildList = [];
for (let shipId of this.ships) { for (let shipId of this.shipOrder) {
if (builds[shipId]) { if (builds[shipId]) {
let shipBuilds = []; let shipBuilds = [];
let buildNameOrder = Object.keys(builds[shipId]).sort(); let buildNameOrder = Object.keys(builds[shipId]).sort();
@@ -313,7 +337,7 @@ export default class Header extends TranslatedComponent {
let href = outfitURL(shipId, builds[shipId][buildName], buildName); let href = outfitURL(shipId, builds[shipId][buildName], buildName);
shipBuilds.push(<li key={shipId + '-' + buildName} ><ActiveLink href={href} className='block'>{buildName}</ActiveLink></li>); shipBuilds.push(<li key={shipId + '-' + buildName} ><ActiveLink href={href} className='block'>{buildName}</ActiveLink></li>);
} }
buildList.push(<ul key={shipId}>{translate(shipId)}{shipBuilds}</ul>); buildList.push(<ul key={shipId}>{Ships[shipId].properties.name}{shipBuilds}</ul>);
} }
} }
@@ -386,6 +410,7 @@ export default class Header extends TranslatedComponent {
_getSettingsMenu() { _getSettingsMenu() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let tips = Persist.showTooltips(); let tips = Persist.showTooltips();
let moduleResistances = Persist.showModuleResistances();
return ( return (
<div className='menu-list no-wrap cap' onClick={ (e) => e.stopPropagation() }> <div className='menu-list no-wrap cap' onClick={ (e) => e.stopPropagation() }>
@@ -403,6 +428,10 @@ export default class Header extends TranslatedComponent {
<td>{translate('tooltips')}</td> <td>{translate('tooltips')}</td>
<td className={cn('ri', { disabled: !tips, 'primary-disabled': tips })}>{(tips ? '✓' : '✗')}</td> <td className={cn('ri', { disabled: !tips, 'primary-disabled': tips })}>{(tips ? '✓' : '✗')}</td>
</tr> </tr>
<tr className='cap ptr' onClick={this._toggleModuleResistances} >
<td>{translate('module resistances')}</td>
<td className={cn('ri', { disabled: !moduleResistances, 'primary-disabled': moduleResistances })}>{(moduleResistances ? '✓' : '✗')}</td>
</tr>
<tr> <tr>
<td>{translate('insurance')}</td> <td>{translate('insurance')}</td>
<td className='ri'> <td className='ri'>
@@ -430,9 +459,10 @@ export default class Header extends TranslatedComponent {
<hr /> <hr />
<ul style={{ width: '100%' }}> <ul style={{ width: '100%' }}>
{translate('builds')} & {translate('comparisons')} {translate('builds')} & {translate('comparisons')}
<li><Link href="#" className='block' onClick={this._showDetailedExport}>{translate('detailed export')}</Link></li> <li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li>
<li><Link href="#" className='block' onClick={this._showImport}>{translate('import')}</Link></li> <li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDeleteAll}>{translate('delete all')}</Link></li> <li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li>
<li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li>
</ul> </ul>
<hr /> <hr />
<table style={{ width: 300, backgroundColor: 'transparent' }}> <table style={{ width: 300, backgroundColor: 'transparent' }}>
@@ -443,7 +473,7 @@ export default class Header extends TranslatedComponent {
<td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td> <td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td>
</tr> </tr>
<tr> <tr>
<td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td> <td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -464,6 +494,7 @@ export default class Header extends TranslatedComponent {
Persist.addListener('deletedAll', update); Persist.addListener('deletedAll', update);
Persist.addListener('builds', update); Persist.addListener('builds', update);
Persist.addListener('tooltips', update); Persist.addListener('tooltips', update);
Persist.addListener('moduleresistances', update);
} }
/** /**
@@ -533,13 +564,19 @@ export default class Header extends TranslatedComponent {
{openedMenu == 'b' ? this._getBuildsMenu() : null} {openedMenu == 'b' ? this._getBuildsMenu() : null}
</div> </div>
{/* TODO: Enable */} <div className='l menu'>
{/* <div className='l menu'> <div className={cn('menu-header', { selected: openedMenu == 'comp', disabled: !hasBuilds })} onClick={hasBuilds && this._openComp}>
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0 })} onClick={this.props.announcements.length !== 0 && this._openAnnounce}> <StatsBars className={cn('warning', { 'warning-disabled': !hasBuilds })} /><span className='menu-item-label'>{translate('compare')}</span>
</div>
{openedMenu == 'comp' ? this._getComparisonsMenu() : null}
</div>
<div className='l menu'>
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0})} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
<span className='menu-item-label'>{translate('announcements')}</span> <span className='menu-item-label'>{translate('announcements')}</span>
</div> </div>
{openedMenu == 'announce' ? this._getAnnouncementsMenu() : null} {openedMenu == 'announce' ? this._getAnnouncementsMenu() : null}
</div> */} </div>
{window.location.origin.search('.edcd.io') >= 0 ? {window.location.origin.search('.edcd.io') >= 0 ?
<div className='l menu'> <div className='l menu'>
@@ -566,4 +603,5 @@ export default class Header extends TranslatedComponent {
</header> </header>
); );
} }
} }

View File

@@ -0,0 +1,99 @@
import React from 'react';
import cn from 'classnames';
import Slot from './Slot';
import Persist from '../stores/Persist';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Internal Slot
*/
export default class InternalSlot extends Slot {
/**
* Generate the slot contents
* @param {Object} m Mounted Module
* @param {Boolean} enabled Slot enabled
* @param {Function} translate Translate function
* @param {Object} formats Localized Formats map
* @param {Object} u Localized Units Map
* @return {React.Component} Slot contents
*/
_getSlotDetails(m, enabled, translate, formats, u) {
if (m) {
let classRating = m.class + m.rating;
let { drag, drop, ship } = this.props;
let { termtip, tooltip } = this.context;
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
let showModuleResistances = Persist.showModuleResistances();
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
let mass = m.getMass() || m.cargo || m.fuel || 0;
const className = cn('details', enabled ? '' : 'disabled');
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
<div className={'cb'}>
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
<div className={'r'}>{formats.round(mass)}{u.T}</div>
</div>
<div className={'cb'}>
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs}&nbsp;&nbsp;&nbsp;{translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
{ m.grp === 'gsrp' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.grp === 'gfsb' ? <div className={'l'}>{translate('jump addition')}: {formats.f1(m.getJumpBoost())}{u.LY}</div> : null }
{ m.grp === 'gs' ? <div className={'l'}>{translate('shield addition')}: {formats.f1(m.getShieldAddition())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
{ m.rangeLS === null ? <div className={'l'}>{u.Ls}</div> : null }
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ showModuleResistances && m.getCausticResistance() ? <div className='l'>{translate('causres')}: {formats.pct(m.getCausticResistance())}</div> : null }
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
{ m && validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>;
} else {
return <div className={'empty'}>{translate('empty')}</div>;
}
}
}

View File

@@ -1,46 +1,52 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import Slot from './Slot'; import InternalSlot from './InternalSlot';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind'; import { canMount } from '../utils/SlotFunctions';
import { TYPES } from 'ed-forge/lib/src/data/slots';
/**
* Sets all empty slots of a ship to a item of the given size.
* @param {Ship} ship Ship to set items for
* @param {boolean} fillAll True to also fill occupied
* @param {string} type Item type
* @param {string} rating Item rating
*/
function setAllEmpty(ship, fillAll, type, rating = '') {
ship.getModules(TYPES.ANY_INTERNAL, undefined, true).forEach((slot) => {
if (slot.isEmpty() || fillAll) {
try {
// Maybe the item does not exist. Simply catch this error.
slot.setItem(type, slot.getSize(), rating);
} catch (e) {}
}
});
}
/** /**
* Internal slot section * Internal slot section
*/ */
export default class InternalSlotSection extends SlotSection { export default class InternalSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props, 'optional internal'); super(props, context, 'internal', 'optional internal');
autoBind(this); this._empty = this._empty.bind(this);
this._fillWithCargo = this._fillWithCargo.bind(this);
this._fillWithCells = this._fillWithCells.bind(this);
this._fillWithArmor = this._fillWithArmor.bind(this);
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = this.sectionRefArr['pcq'] ? 'pcq' : 'pcm';
}
/**
* Handle focus when component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all slots * Empty all slots
*/ */
_empty() { _empty() {
this.props.ship.getModules(TYPES.ANY_INTERNAL).forEach((slot) => slot.reset()); this.selectedRefId = 'emptyall';
this.props.ship.emptyInternal();
this.props.onChange();
this._close(); this._close();
} }
@@ -49,8 +55,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCargo(event) { _fillWithCargo(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'cargo';
setAllEmpty(this.props.ship, fillAll, 'cargorack'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'cr')) {
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -59,8 +72,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFuelTanks(event) { _fillWithFuelTanks(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'ft';
setAllEmpty(this.props.ship, fillAll, 'fueltank', '3'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'ft')) {
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -69,8 +89,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithLuxuryCabins(event) { _fillWithLuxuryCabins(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'pcq';
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '4'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pcq')) {
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -79,8 +106,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithFirstClassCabins(event) { _fillWithFirstClassCabins(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'pcm';
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '3'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pcm')) {
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -89,8 +123,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithBusinessClassCabins(event) { _fillWithBusinessClassCabins(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'pci';
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '2'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pci')) {
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -99,8 +140,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithEconomyClassCabins(event) { _fillWithEconomyClassCabins(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'pce';
setAllEmpty(this.props.ship, fillAll, 'passengercabins', '1'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'pce')) {
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -109,8 +157,18 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithCells(event) { _fillWithCells(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'scb';
setAllEmpty(this.props.ship, fillAll, 'scb', '5'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
let chargeCap = 0; // Capacity of single activation
ship.internal.forEach(function(slot) {
if ((clobber && !(slot.m && ModuleUtils.isShieldGenerator(slot.m.grp)) || !slot.m) && canMount(ship, slot, 'scb')) {
ship.use(slot, ModuleUtils.findInternal('scb', slot.maxClass, 'A'));
ship.setSlotEnabled(slot, chargeCap <= ship.shieldStrength); // Don't waste cell capacity on overcharge
chargeCap += slot.m.recharge;
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -119,8 +177,15 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithArmor(event) { _fillWithArmor(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'hr';
setAllEmpty(this.props.ship, fillAll, 'hrp', '2'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'hr')) {
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
}
});
this.props.onChange();
this._close(); this._close();
} }
@@ -129,31 +194,56 @@ export default class InternalSlotSection extends SlotSection {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
*/ */
_fillWithModuleReinforcementPackages(event) { _fillWithModuleReinforcementPackages(event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = 'mrp';
setAllEmpty(this.props.ship, fillAll, 'mrp', '2'); let clobber = event.getModifierState('Alt');
let ship = this.props.ship;
ship.internal.forEach((slot) => {
if ((clobber || !slot.m) && canMount(ship, slot, 'mrp')) {
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
}
});
this.props.onChange();
this._close(); this._close();
} }
/**
* Empty all on section header right click
*/
_contextMenu() {
this._empty();
}
/** /**
* Generate the slot React Components * Generate the slot React Components
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { currentMenu, ship, propsToShow, onPropToggle } = this.props; let { currentMenu, ship } = this.props;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let { internal, fuelCapacity } = ship;
let availableModules = ship.getAvailableModules();
for (const m of ship.getInternals(undefined, true)) { for (let i = 0, l = internal.length; i < l; i++) {
slots.push(<Slot let s = internal[i];
key={m.object.Slot}
currentMenu={currentMenu} slots.push(<InternalSlot
m={m} key={i}
drag={this._drag.bind(this, m)} maxClass={s.maxClass}
dragOver={this._dragOverSlot.bind(this, m)} availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)}
onOpen={this._openMenu.bind(this,s)}
onChange={this.props.onChange}
onSelect={this._selectModule.bind(this, s)}
selected={currentMenu == s}
eligible={s.eligible}
m={s.m}
drag={this._drag.bind(this, s)}
dragOver={this._dragOverSlot.bind(this, s)}
drop={this._drop} drop={this._drop}
dropClass={this._dropClass(m, originSlot, targetSlot)} dropClass={this._dropClass(s, originSlot, targetSlot)}
propsToShow={propsToShow} fuel={fuelCapacity}
onPropToggle={onPropToggle} ship={ship}
enabled={s.enabled ? true : false}
/>); />);
} }
@@ -166,23 +256,22 @@ export default class InternalSlotSection extends SlotSection {
* @param {Function} ship The ship * @param {Function} ship The ship
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu() { _getSectionMenu(translate, ship) {
const { ship } = this.props;
const { translate } = this.context.language;
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCargo} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['cargo'] = smRef}>{translate('cargo')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithCells} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['scb'] = smRef}>{translate('scb')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithArmor} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hr'] = smRef}>{translate('hr')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['mrp'] = smRef}>{translate('mrp')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ft'] = smRef}>{translate('ft')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pce'] = smRef}>{translate('pce')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pci'] = smRef}>{translate('pci')}</li>
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li> <li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown} ref={smRef => this.sectionRefArr['pcm'] = smRef}>{translate('pcm')}</li>
{ ship.readMeta('luxuryCabins') ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''} { ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['pcq'] = smRef}>{translate('pcq')}</li> : ''}
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -0,0 +1,120 @@
import React from 'react';
import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart';
import Slider from '../components/Slider';
import * as Calc from '../shipyard/Calculations';
/**
* Jump range for a given ship
*/
export default class JumpRange extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired
};
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
const ship = this.props.ship;
this.state = {
fuelLevel: 1,
calcJumpRangeFunc: this._calcJumpRange.bind(this, ship)
};
}
/**
* Update the state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.code != this.props.code) {
this.setState({ fuelLevel: 1,
calcJumpRangeFunc: this._calcJumpRange.bind(this, nextProps.ship) });
}
return true;
}
/**
* Calculate the jump range this ship at a given cargo
* @param {Object} ship The ship
* @param {Object} cargo The cargo
* @return {number} The jump range
*/
_calcJumpRange(ship, cargo) {
// Obtain the FSD for this ship
const fsd = ship.standard[2].m;
const fuel = this.state.fuelLevel * ship.fuelCapacity;
// Obtain the jump range
return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel, ship);
}
/**
* Update fuel level
* @param {number} fuelLevel Fuel level 0 - 1
*/
_fuelChange(fuelLevel) {
this.setState({
fuelLevel,
});
}
/**
* Render engine profile
* @return {React.Component} contents
*/
render() {
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { formats, translate, units } = language;
const { ship } = this.props;
const { fuelLevel } = this.state;
const code = ship.toString() + '.' + ship.getModificationsString() + '.' + fuelLevel;
return (
<span>
<h1>{translate('jump range')}</h1>
<LineChart
xMax={ship.cargoCapacity}
yMax={ship.unladenRange}
xLabel={translate('cargo')}
xUnit={translate('T')}
yLabel={translate('jump range')}
yUnit={translate('LY')}
func={this.state.calcJumpRangeFunc}
points={200}
code={code}
/>
<h3>{translate('fuel carried')}: {formats.f2(fuelLevel * ship.fuelCapacity)}{units.T}</h3>
<table style={{ width: '100%', lineHeight: '1em', backgroundColor: 'transparent' }}>
<tbody >
<tr>
<td>
<Slider
axis={true}
onChange={this._fuelChange.bind(this)}
axisUnit={translate('T')}
percent={fuelLevel}
max={ship.fuelCapacity}
scale={sizeRatio}
onResize={onWindowResize}
/>
</td>
</tr>
</tbody>
</table>
</span>
);
}
}

View File

@@ -1,275 +1,281 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import autoBind from 'auto-bind';
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
/**
/** * Line Chart
* Line Chart */
*/ export default class LineChart extends TranslatedComponent {
export default class LineChart extends TranslatedComponent {
static defaultProps = { static defaultProps = {
code: '', code: '',
xMin: 0, xMin: 0,
yMin: 0, yMin: 0,
points: 20, points: 20,
colors: ['#ff8c0d'], colors: ['#ff8c0d'],
aspect: 0.5 aspect: 0.5
}; };
static propTypes = { static propTypes = {
func: PropTypes.func.isRequired, func: PropTypes.func.isRequired,
xLabel: PropTypes.string.isRequired, xLabel: PropTypes.string.isRequired,
xMin: PropTypes.number, xMin: PropTypes.number,
xMax: PropTypes.number.isRequired, xMax: PropTypes.number.isRequired,
xUnit: PropTypes.string.isRequired, xUnit: PropTypes.string.isRequired,
xMark: PropTypes.number, xMark: PropTypes.number,
yLabel: PropTypes.string.isRequired, yLabel: PropTypes.string.isRequired,
yMin: PropTypes.number, yMin: PropTypes.number,
yMax: PropTypes.number.isRequired, yMax: PropTypes.number.isRequired,
yUnit: PropTypes.string, yUnit: PropTypes.string,
series: PropTypes.array, series: PropTypes.array,
colors: PropTypes.array, colors: PropTypes.array,
points: PropTypes.number, points: PropTypes.number,
aspect: PropTypes.number, aspect: PropTypes.number,
code: PropTypes.string, code: PropTypes.string,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this._updateDimensions = this._updateDimensions.bind(this);
const series = props.series; this._updateSeries = this._updateSeries.bind(this);
this._tooltip = this._tooltip.bind(this);
let xScale = d3.scaleLinear(); this._showTip = this._showTip.bind(this);
let yScale = d3.scaleLinear(); this._hideTip = this._hideTip.bind(this);
let xAxisScale = d3.scaleLinear(); this._moveTip = this._moveTip.bind(this);
this.xAxis = d3.axisBottom(xAxisScale).tickSizeOuter(0); const series = props.series;
this.yAxis = d3.axisLeft(yScale).ticks(6).tickSizeOuter(0);
let xScale = d3.scaleLinear();
this.state = { let yScale = d3.scaleLinear();
xScale, let xAxisScale = d3.scaleLinear();
xAxisScale,
yScale, this.xAxis = d3.axisBottom(xAxisScale).tickSizeOuter(0);
tipHeight: 2 + (1.2 * (series ? series.length : 0.8)), this.yAxis = d3.axisLeft(yScale).ticks(6).tickSizeOuter(0);
};
} this.state = {
xScale,
/** xAxisScale,
* Update tooltip content yScale,
* @param {number} xPos x coordinate tipHeight: 2 + (1.2 * (series ? series.length : 0.8)),
* @param {number} width current container width };
*/ }
_tooltip(xPos, width) {
let { xLabel, yLabel, xUnit, yUnit, func, series } = this.props; /**
let { xScale, yScale } = this.state; * Update tooltip content
let { formats, translate } = this.context.language; * @param {number} xPos x coordinate
let x0 = xScale.invert(xPos), * @param {number} width current container width
y0 = func(x0), */
tips = this.tipContainer, _tooltip(xPos, width) {
yTotal = 0, let { xLabel, yLabel, xUnit, yUnit, func, series } = this.props;
flip = (xPos / width > 0.50), let { xScale, yScale } = this.state;
tipWidth = 0, let { formats, translate } = this.context.language;
tipHeightPx = tips.selectAll('rect').node().getBoundingClientRect().height; let x0 = xScale.invert(xPos),
y0 = func(x0),
tips = this.tipContainer,
xPos = xScale(x0); // Clamp xPos yTotal = 0,
flip = (xPos / width > 0.50),
tips.selectAll('text.text-tip.y').text(function(d, i) { tipWidth = 0,
let yVal = series ? y0[series[i]] : y0; tipHeightPx = tips.selectAll('rect').node().getBoundingClientRect().height;
yTotal += yVal;
return (series ? translate(series[i]) : '') + ' ' + formats.f2(yVal);
}).append('tspan').attr('class', 'metric').text(yUnit ? ' ' + yUnit : ''); xPos = xScale(x0); // Clamp xPos
tips.selectAll('text').each(function() { tips.selectAll('text.text-tip.y').text(function(d, i) {
if (this.getBBox().width > tipWidth) { let yVal = series ? y0[series[i]] : y0;
tipWidth = Math.ceil(this.getBBox().width); yTotal += yVal;
} return (series ? translate(series[i]) : '') + ' ' + formats.f2(yVal);
}); }).append('tspan').attr('class', 'metric').text(yUnit ? ' ' + yUnit : '');
let tipY = Math.floor(yScale(yTotal / (series ? series.length : 1)) - (tipHeightPx / 2)); tips.selectAll('text').each(function() {
if (this.getBBox().width > tipWidth) {
tipWidth += 8; tipWidth = Math.ceil(this.getBBox().width);
tips.attr('transform', 'translate(' + xPos + ',' + tipY + ')'); }
tips.selectAll('text.text-tip').attr('x', flip ? -12 : 12).style('text-anchor', flip ? 'end' : 'start'); });
tips.selectAll('text.text-tip.x').text(formats.f2(x0)).append('tspan').attr('class', 'metric').text(' ' + xUnit);
tips.selectAll('rect').attr('width', tipWidth + 4).attr('x', flip ? -tipWidth - 12 : 8).attr('y', 0).style('text-anchor', flip ? 'end' : 'start'); let tipY = Math.floor(yScale(yTotal / (series ? series.length : 1)) - (tipHeightPx / 2));
this.markersContainer.selectAll('circle').attr('cx', xPos).attr('cy', (d, i) => yScale(series ? y0[series[i]] : y0));
} tipWidth += 8;
tips.attr('transform', 'translate(' + xPos + ',' + tipY + ')');
/** tips.selectAll('text.text-tip').attr('x', flip ? -12 : 12).style('text-anchor', flip ? 'end' : 'start');
* Update dimensions based on properties and scale tips.selectAll('text.text-tip.x').text(formats.f2(x0)).append('tspan').attr('class', 'metric').text(' ' + xUnit);
* @param {Object} props React Component properties tips.selectAll('rect').attr('width', tipWidth + 4).attr('x', flip ? -tipWidth - 12 : 8).attr('y', 0).style('text-anchor', flip ? 'end' : 'start');
* @param {number} scale size ratio / scale this.markersContainer.selectAll('circle').attr('cx', xPos).attr('cy', (d, i) => yScale(series ? y0[series[i]] : y0));
* @param {number} width current width of the container }
* @returns {Object} calculated dimensions
*/ /**
_updateDimensions(props, scale, width) { * Update dimensions based on properties and scale
const { xMax, xMin, yMin, yMax } = props; * @param {Object} props React Component properties
const innerWidth = width - MARGIN.left - MARGIN.right; * @param {number} scale size ratio / scale
const outerHeight = Math.round(width * props.aspect); * @param {number} width current width of the container
const innerHeight = outerHeight - MARGIN.top - MARGIN.bottom; * @returns {Object} calculated dimensions
*/
this.state.xScale.range([0, innerWidth]).domain([xMin, xMax || 1]).clamp(true); _updateDimensions(props, scale, width) {
this.state.xAxisScale.range([0, innerWidth]).domain([xMin, xMax]).clamp(true); const { xMax, xMin, yMin, yMax } = props;
this.state.yScale.range([innerHeight, 0]).domain([yMin, yMax + (yMax - yMin) * 0.1]); // 10% higher than maximum value for tooltip visibility const innerWidth = width - MARGIN.left - MARGIN.right;
return { innerWidth, outerHeight, innerHeight }; const outerHeight = Math.round(width * props.aspect);
} const innerHeight = outerHeight - MARGIN.top - MARGIN.bottom;
/** this.state.xScale.range([0, innerWidth]).domain([xMin, xMax || 1]).clamp(true);
* Show tooltip this.state.xAxisScale.range([0, innerWidth]).domain([xMin, xMax]).clamp(true);
* @param {SyntheticEvent} e Event this.state.yScale.range([innerHeight, 0]).domain([yMin, yMax + (yMax - yMin) * 0.1]); // 10% higher than maximum value for tooltip visibility
*/ return { innerWidth, outerHeight, innerHeight };
_showTip(e) { }
e.preventDefault();
this.tipContainer.style('display', null); /**
this.markersContainer.style('display', null); * Show tooltip
this._moveTip(e); * @param {SyntheticEvent} e Event
} */
_showTip(e) {
/** e.preventDefault();
* Move and update tooltip this.tipContainer.style('display', null);
* @param {SyntheticEvent} e Event this.markersContainer.style('display', null);
* @param {number} width current container width this._moveTip(e);
*/ }
_moveTip(e, width) {
let clientX = e.touches ? e.touches[0].clientX : e.clientX; /**
this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left), width); * Move and update tooltip
} * @param {SyntheticEvent} e Event
* @param {number} width current container width
/** */
* Hide tooltip _moveTip(e, width) {
* @param {SyntheticEvent} e Event let clientX = e.touches ? e.touches[0].clientX : e.clientX;
*/ this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left), width);
_hideTip(e) { }
e.preventDefault();
this.tipContainer.style('display', 'none'); /**
this.markersContainer.style('display', 'none'); * Hide tooltip
} * @param {SyntheticEvent} e Event
*/
/** _hideTip(e) {
* Update series generated from props e.preventDefault();
* @param {Object} props React Component properties this.tipContainer.style('display', 'none');
* @param {Object} state React Component state this.markersContainer.style('display', 'none');
*/ }
_updateSeries(props, state) {
let { func, xMin, xMax, series, points } = props; /**
let delta = (xMax - xMin) / points; * Update series generated from props
let seriesData = new Array(points); * @param {Object} props React Component properties
* @param {Object} state React Component state
if (delta) { */
seriesData = new Array(points); _updateSeries(props, state) {
for (let i = 0, x = xMin; i < points; i++) { let { func, xMin, xMax, series, points } = props;
seriesData[i] = [x, func(x)]; let delta = (xMax - xMin) / points;
x += delta; let seriesData = new Array(points);
}
seriesData[points - 1] = [xMax, func(xMax)]; if (delta) {
} else { seriesData = new Array(points);
let yVal = func(xMin); for (let i = 0, x = xMin; i < points; i++) {
seriesData = [[0, yVal], [1, yVal]]; seriesData[i] = [x, func(x)];
} x += delta;
}
const markerElems = []; seriesData[points - 1] = [xMax, func(xMax)];
const detailElems = [<text key='lbl' className='text-tip x' y='1.25em'/>]; } else {
const seriesLines = []; let yVal = func(xMin);
for (let i = 0, l = series ? series.length : 1; i < l; i++) { seriesData = [[0, yVal], [1, yVal]];
const yAccessor = series ? function(d) { return state.yScale(d[1][this]); }.bind(series[i]) : (d) => state.yScale(d[1]); }
seriesLines.push(d3.line().x((d, i) => this.state.xScale(d[0])).y(yAccessor));
detailElems.push(<text key={i} className='text-tip y' strokeWidth={0} fill={props.colors[i]} y={1.25 * (i + 2) + 'em'}/>); const markerElems = [];
markerElems.push(<circle key={i} className='marker' r='4' />); const detailElems = [<text key='lbl' className='text-tip x' y='1.25em'/>];
} const seriesLines = [];
for (let i = 0, l = series ? series.length : 1; i < l; i++) {
const tipHeight = 2 + (1.2 * (seriesLines ? seriesLines.length : 0.8)); const yAccessor = series ? function(d) { return state.yScale(d[1][this]); }.bind(series[i]) : (d) => state.yScale(d[1]);
seriesLines.push(d3.line().x((d, i) => this.state.xScale(d[0])).y(yAccessor));
this.setState({ markerElems, detailElems, seriesLines, seriesData, tipHeight }); detailElems.push(<text key={i} className='text-tip y' strokeWidth={0} fill={props.colors[i]} y={1.25 * (i + 2) + 'em'}/>);
} markerElems.push(<circle key={i} className='marker' r='4' />);
}
/**
* Update dimensions and series data based on props and context. const tipHeight = 2 + (1.2 * (seriesLines ? seriesLines.length : 0.8));
*/
componentWillMount() { this.setState({ markerElems, detailElems, seriesLines, seriesData, tipHeight });
this._updateSeries(this.props, this.state); }
}
/**
/** * Update dimensions and series data based on props and context.
* Update state based on property and context changes */
* @param {Object} nextProps Incoming/Next properties componentWillMount() {
* @param {Object} nextContext Incoming/Next conext this._updateSeries(this.props, this.state);
*/ }
componentWillReceiveProps(nextProps, nextContext) {
const props = this.props; /**
* Update state based on property and context changes
if (props.code != nextProps.code) { * @param {Object} nextProps Incoming/Next properties
this._updateSeries(nextProps, this.state); * @param {Object} nextContext Incoming/Next conext
} */
} componentWillReceiveProps(nextProps, nextContext) {
const props = this.props;
/**
* Render the chart if (props.code != nextProps.code) {
* @return {React.Component} Chart SVG this._updateSeries(nextProps, this.state);
*/ }
render() { }
return (
<ContainerDimensions> /**
{ ({ width, height }) => { * Render the chart
const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio, width, height); * @return {React.Component} Chart SVG
const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props; */
const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state; render() {
const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse(); return (
<ContainerDimensions>
const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0; { ({ width, height }) => {
const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : ''; const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio, width, height);
return ( const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props;
<div width={width} height={height}> const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state;
<svg style={{ width: '100%', height: outerHeight }}> const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse();
<g transform={`translate(${MARGIN.left},${MARGIN.top})`}>
<g>{xmark}</g> const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0;
<g>{lines}</g> const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : '';
<g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}> return (
<text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}> <div width={width} height={height}>
<tspan>{xLabel}</tspan> <svg style={{ width: '100%', height: outerHeight }}>
<tspan className='metric'> ({xUnit})</tspan> <g transform={`translate(${MARGIN.left},${MARGIN.top})`}>
</text> <g>{xmark}</g>
</g> <g>{lines}</g>
<g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}> <g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}>
<text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}> <text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}>
<tspan>{yLabel}</tspan> <tspan>{xLabel}</tspan>
{ yUnit && <tspan className='metric'> ({yUnit})</tspan> } <tspan className='metric'> ({xUnit})</tspan>
</text> </text>
</g> </g>
<g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}> <g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}>
<rect className='tooltip' height={tipHeight + 'em'}></rect> <text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}>
{detailElems} <tspan>{yLabel}</tspan>
</g> { yUnit && <tspan className='metric'> ({yUnit})</tspan> }
<g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}> </text>
{markerElems} </g>
</g> <g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}>
<rect <rect className='tooltip' height={tipHeight + 'em'}></rect>
fillOpacity='0' {detailElems}
height={innerHeight} </g>
width={innerWidth + 1} <g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}>
onMouseEnter={this._showTip} {markerElems}
onTouchStart={this._showTip} </g>
onMouseLeave={this._hideTip} <rect
onTouchEnd={this._hideTip} fillOpacity='0'
onMouseMove={e => this._moveTip(e, width)} height={innerHeight}
onTouchMove={e => this._moveTip(e, width)} width={innerWidth + 1}
/> onMouseEnter={this._showTip}
</g> onTouchStart={this._showTip}
</svg> onMouseLeave={this._hideTip}
</div> onTouchEnd={this._hideTip}
); onMouseMove={e => this._moveTip(e, width)}
}} onTouchMove={e => this._moveTip(e, width)}
</ContainerDimensions> />
); </g>
} </svg>
} </div>
);
}}
</ContainerDimensions>
);
}
}

View File

@@ -7,6 +7,7 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Link wrapper component * Link wrapper component
*/ */
export default class Link extends React.Component { export default class Link extends React.Component {
static propTypes = { static propTypes = {
children: PropTypes.any, children: PropTypes.any,
href: PropTypes.string.isRequired, href: PropTypes.string.isRequired,
@@ -55,4 +56,5 @@ export default class Link extends React.Component {
render() { render() {
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>; return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
} }
} }

View File

@@ -21,6 +21,7 @@ function buildComparator(a, b) {
* Compare builds modal * Compare builds modal
*/ */
export default class ModalCompare extends TranslatedComponent { export default class ModalCompare extends TranslatedComponent {
static propTypes = { static propTypes = {
onSelect: PropTypes.func.isRequired, onSelect: PropTypes.func.isRequired,
builds: PropTypes.array builds: PropTypes.array
@@ -104,8 +105,8 @@ export default class ModalCompare extends TranslatedComponent {
let selectedBuilds = usedBuilds.map((build, i) => let selectedBuilds = usedBuilds.map((build, i) =>
<tr key={i} onClick={this._removeBuild.bind(this, i)}> <tr key={i} onClick={this._removeBuild.bind(this, i)}>
<td className='tl'>{build.name}</td> <td className='tl'>{build.name}</td><
<td className='tl'>{build.buildName}</td> td className='tl'>{build.buildName}</td>
</tr> </tr>
); );

View File

@@ -6,6 +6,7 @@ import TranslatedComponent from './TranslatedComponent';
* Export Modal * Export Modal
*/ */
export default class ModalExport extends TranslatedComponent { export default class ModalExport extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string, title: PropTypes.string,
generator: PropTypes.func, generator: PropTypes.func,

View File

@@ -7,10 +7,19 @@ import TranslatedComponent from './TranslatedComponent';
* Help Modal * Help Modal
*/ */
export default class ModalHelp extends TranslatedComponent { export default class ModalHelp extends TranslatedComponent {
static propTypes = { static propTypes = {
title: PropTypes.string title: PropTypes.string
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render the modal * Render the modal
* @return {React.Component} Modal Content * @return {React.Component} Modal Content

View File

@@ -2,21 +2,92 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import Router from '../Router';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import autoBind from 'auto-bind'; import { Ships } from 'coriolis-data/dist';
import { isArray } from 'lodash'; import Ship from '../shipyard/Ship';
import { Ship } from 'ed-forge'; import { ModuleNameToGroup, Insurance } from '../shipyard/Constants';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { fromDetailedBuild } from '../shipyard/Serializer';
import { Download } from './SvgIcons';
import { outfitURL } from '../utils/UrlGenerators';
import { shipFromJson, shipModelFromJson } from '../utils/CompanionApiUtils';
import { shipFromLoadoutJSON } from '../utils/JournalUtils';
const STATE = { const zlib = require('pako');
READY: 0,
PARSED: 1, const textBuildRegex = new RegExp('^\\[([\\w \\-]+)\\]\n');
ERROR: 2, const lineRegex = new RegExp('^([\\dA-Z]{1,2}): (\\d)([A-I])[/]?([FGT])?([SD])? ([\\w\\- ]+)');
}; const mountMap = { 'H': 4, 'L': 3, 'M': 2, 'S': 1, 'U': 0 };
const standardMap = { 'RB': 0, 'TM': 1, 'FH': 2, 'EC': 3, 'PC': 4, 'SS': 5, 'FS': 6 };
const bhMap = { 'lightweight alloy': 0, 'reinforced alloy': 1, 'military grade composite': 2, 'mirrored surface composite': 3, 'reactive surface composite': 4 };
/**
* Check is slot is empty
* @param {Object} slot Slot model
* @return {Boolean} True if empty
*/
function isEmptySlot(slot) {
return slot.maxClass == this && slot.m === null;
}
/**
* Determine if a build is valid
* @param {string} shipId Ship ID
* @param {string} code Serialzied ship build 'code'
* @param {string} name Build name
* @throws {string} If build is not valid
*/
function validateBuild(shipId, code, name) {
let shipData = Ships[shipId];
if (!shipData) {
throw '"' + shipId + '" is not a valid Ship Id!';
}
if (typeof name != 'string' || name.length == 0) {
throw shipData.properties.name + ' build "' + name + '" must be a string at least 1 character long!';
}
if (typeof code != 'string' || code.length < 10) {
throw shipData.properties.name + ' build "' + name + '" is not valid!';
}
try {
let ship = new Ship(shipId, shipData.properties, shipData.slots);
ship.buildFrom(code);
} catch (e) {
throw shipData.properties.name + ' build "' + name + '" is not valid!';
}
}
/**
* Convert a ship-loadout JSON object to a Coriolis build
* @param {Object} detailedBuild ship-loadout
* @return {Object} Coriolis build
*/
function detailedJsonToBuild(detailedBuild) {
let ship;
if (!detailedBuild.name) {
throw 'Build Name missing!';
}
if (!detailedBuild.name.trim()) {
throw 'Build Name must be a string at least 1 character long!';
}
try {
ship = fromDetailedBuild(detailedBuild);
} catch (e) {
throw detailedBuild.ship + ' Build "' + detailedBuild.name + '": Invalid data';
}
return { shipId: ship.id, name: detailedBuild.name, code: ship.toString() };
}
/** /**
* Import Modal * Import Modal
*/ */
export default class ModalImport extends TranslatedComponent { export default class ModalImport extends TranslatedComponent {
static propTypes = { static propTypes = {
importString: PropTypes.string, // Optional: Default data for import modal importString: PropTypes.string, // Optional: Default data for import modal
builds: PropTypes.object, // Optional: Import object builds: PropTypes.object, // Optional: Import object
@@ -28,12 +99,228 @@ export default class ModalImport extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this.state = { this.state = {
status: STATE.READY, builds: props.builds,
builds: props.builds || [], canEdit: !props.builds,
loadoutEvent: null,
comparisons: null,
shipDiscount: null,
moduleDiscount: null,
errorMsg: null,
importString: props.importString || null,
importValid: false,
insurance: null
}; };
this._process = this._process.bind(this);
this._import = this._import.bind(this);
this._importBackup = this._importBackup.bind(this);
this._importLoadout = this._importLoadout.bind(this);
this._importDetailedArray = this._importDetailedArray.bind(this);
this._importTextBuild = this._importTextBuild.bind(this);
this._importCompanionApiBuild = this._importCompanionApiBuild.bind(this);
this._validateImport = this._validateImport.bind(this);
}
/**
* Import a Loadout event from Elite: Dangerous journal files
* @param {Object} data Loadout event
* @throws {string} If import fails
*/
_importLoadout(data) {
if (data && data.Ship && data.Modules) {
const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' });
let compressed = btoa(deflated);
this.setState({loadoutEvent: compressed});
} else {
throw 'Loadout event must contain Ship and Modules';
}
}
/**
* Import a Coriolis backup
* @param {Object} importData Backup Data
* @throws {string} If import fails
*/
_importBackup(importData) {
if (importData.builds && typeof importData.builds == 'object') {
for (let shipId in importData.builds) {
for (let buildName in importData.builds[shipId]) {
try {
validateBuild(shipId, importData.builds[shipId][buildName], buildName);
} catch (err) {
delete importData.builds[shipId][buildName];
}
}
}
this.setState({ builds: importData.builds });
} else {
throw 'builds must be an object!';
}
if (importData.comparisons) {
for (let compName in importData.comparisons) {
let comparison = importData.comparisons[compName];
for (let i = 0, l = comparison.builds.length; i < l; i++) {
let build = comparison.builds[i];
if (!importData.builds[build.shipId] || !importData.builds[build.shipId][build.buildName]) {
throw build.shipId + ' build "' + build.buildName + '" data is missing!';
}
}
}
this.setState({ comparisons: importData.comparisons });
}
// Check for old/deprecated discounts
if (importData.discounts instanceof Array && importData.discounts.length == 2) {
this.setState({ shipDiscount: importData.discounts[0], moduleDiscount: importData.discounts[1] });
}
// Check for ship discount
if (!isNaN(importData.shipDiscount)) {
this.setState({ shipDiscount: importData.shipDiscount * 1 });
}
// Check for module discount
if (!isNaN(importData.moduleDiscount)) {
this.setState({ moduleDiscount: importData.moduleDiscount * 1 });
}
if (typeof importData.insurance == 'string') {
let insurance = importData.insurance.toLowerCase();
if (Insurance[insurance] !== undefined) {
this.setState({ insurance });
} else {
throw 'Invalid insurance type: ' + insurance;
}
}
}
/**
* Import an array of ship-loadout objects / builds
* @param {Array} importArr Array of ship-loadout JSON Schema builds
*/
_importDetailedArray(importArr) {
let builds = {};
for (let i = 0, l = importArr.length; i < l; i++) {
let build = detailedJsonToBuild(importArr[i]);
if (!builds[build.shipId]) {
builds[build.shipId] = {};
}
builds[build.shipId][build.name] = build.code;
}
this.setState({ builds });
}
/**
* Import a build direct from the companion API
* @param {string} build JSON from the companion API information
* @throws {string} if parse/import fails
*/
_importCompanionApiBuild(build) {
const shipModel = shipModelFromJson(build);
const ship = shipFromJson(build);
let builds = {};
builds[shipModel] = {};
builds[shipModel]['Imported ' + Ships[shipModel].properties.name] = ship.toString();
this.setState({ builds, singleBuild: true });
}
/**
* Import a text build from ED Shipyard
* @param {string} buildStr Build string
* @throws {string} If parse / import fails
*/
_importTextBuild(buildStr) {
let buildName = textBuildRegex.exec(buildStr)[1].trim();
let shipName = buildName.toLowerCase();
let shipId = null;
for (let sId in Ships) {
if (Ships[sId].properties.name.toLowerCase() == shipName) {
shipId = sId;
break;
}
}
if (!shipId) {
throw 'No such ship found: "' + buildName + '"';
}
let lines = buildStr.split('\n');
let ship = new Ship(shipId, Ships[shipId].properties, Ships[shipId].slots);
ship.buildWith(null);
for (let i = 1; i < lines.length; i++) {
let line = lines[i].trim();
if (!line) { continue; }
if (line.substring(0, 3) == '---') { break; }
let parts = lineRegex.exec(line);
if (!parts) { throw 'Error parsing: "' + line + '"'; }
let typeSize = parts[1];
let cl = parts[2];
let rating = parts[3];
let mount = parts[4];
let missile = parts[5];
let name = parts[6].trim();
let slot, group;
if (isNaN(typeSize)) { // Standard or Hardpoint
if (typeSize.length == 1) { // Hardpoint
let slotClass = mountMap[typeSize];
if (cl > slotClass) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
slot = ship.hardpoints.find(isEmptySlot, slotClass);
if (!slot) { throw 'No hardpoint slot available for: "' + line + '"'; }
group = ModuleNameToGroup[name.toLowerCase()];
let hp = ModuleUtils.findHardpoint(group, cl, rating, group ? null : name, mount, missile);
if (!hp) { throw 'Unknown component: "' + line + '"'; }
ship.use(slot, hp, true);
} else if (typeSize == 'BH') {
let bhId = bhMap[name.toLowerCase()];
if (bhId === undefined) { throw 'Unknown bulkhead: "' + line + '"'; }
ship.useBulkhead(bhId, true);
} else if (standardMap[typeSize] != undefined) {
let standardIndex = standardMap[typeSize];
if (ship.standard[standardIndex].maxClass < cl) { throw name + ' exceeds max class for the ' + ship.name; }
ship.use(ship.standard[standardIndex], ModuleUtils.standard(standardIndex, cl + rating), true);
} else {
throw 'Unknown component: "' + line + '"';
}
} else {
if (cl > typeSize) { throw cl + rating + ' ' + name + ' exceeds slot size: "' + line + '"'; }
slot = ship.internal.find(isEmptySlot, typeSize);
if (!slot) { throw 'No internal slot available for: "' + line + '"'; }
group = ModuleNameToGroup[name.toLowerCase()];
let intComp = ModuleUtils.findInternal(group, cl, rating, group ? null : name);
if (!intComp) { throw 'Unknown component: "' + line + '"'; }
ship.use(slot, intComp);
}
}
let builds = {};
builds[shipId] = {};
builds[shipId]['Imported ' + buildName] = ship.toString();
this.setState({ builds, singleBuild: true });
} }
/** /**
@@ -65,50 +352,166 @@ export default class ModalImport extends TranslatedComponent {
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} event Event
* @throws {string} If validation fails * @throws {string} If validation fails
*/ */
_parse(event) { _validateImport(event) {
const importString = event.target.value.trim(); let importData = null;
try { let importString = event.target.value.trim();
let data = JSON.parse(importString); this.setState({
if (!isArray(data)) { builds: null,
data = [data]; comparisons: null,
} shipDiscount: null,
moduleDiscount: null,
errorMsg: null,
importValid: false,
insurance: null,
singleBuild: false,
importString,
});
const ships = data.map((item) => { if (!importString) {
try { return;
return new Ship(item.data ? item.data : item);
} catch (err) {
return err;
}
});
this.setState({ ships, status: STATE.PARSED });
} catch (err) {
this.setState({ err, status: STATE.ERROR });
} }
}
try {
if (textBuildRegex.test(importString)) { // E:D Shipyard build text
this._importTextBuild(importString);
} else { // JSON Build data
importData = JSON.parse(importString);
if (!importData || typeof importData != 'object') {
throw 'Must be an object or array!';
}
if (importData?.[0]?.header?.appName) { // has SLEF envelope?
this._importSlefBuilds(importData);
} else if (importData.modules != null && importData.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData); // Single ship definition
} else if (importData.ship != null && importData.ship.modules != null && importData.ship.modules.Armour != null) { // Only the companion API has this information
this._importCompanionApiBuild(importData.ship); // Complete API dump
} else if (importData instanceof Array) { // Must be detailed export json
this._importDetailedArray(importData);
} else if (importData.ship && typeof importData.name !== undefined) { // Using JSON from a single ship build export
this._importDetailedArray([importData]); // Convert to array with singleobject
this.setState({ singleBuild: true });
} else if (importData.Modules != null && importData.Modules[0] != null) {
this._importLoadout(importData);
} else { // Using Backup JSON
this._importBackup(importData);
}
}
} catch (e) {
console.log(e);
this.setState({ errorMsg: (typeof e == 'string') ? e : 'Cannot Parse the data!' });
return;
}
this.setState({ importValid: true });
};
/** /**
* Process imported data * Process imported data
*/ */
_process() { _process() {
for (const build of this.state.builds) { let builds = null, comparisons = null;
if (!build instanceof Error) {
Persist.saveBuild(build.Ship, build.CoriolisBuildName || build.ShipName, build.compress()); if (this.state.loadoutEvent) {
return Router.go(`/import?data=${this.state.loadoutEvent}`);
}
// If only importing a single build go straight to the outfitting page
if (this.state.singleBuild) {
builds = this.state.builds;
let shipId = Object.keys(builds)[0];
let name = Object.keys(builds[shipId])[0];
Router.go(outfitURL(shipId, builds[shipId][name], name));
return;
}
if (this.state.builds) {
builds = {}; // Create new builds object such that orginal name retained, but can be renamed
for (let shipId in this.state.builds) {
let shipbuilds = this.state.builds[shipId];
builds[shipId] = {};
for (let buildName in shipbuilds) {
builds[shipId][buildName] = {
code: shipbuilds[buildName],
useName: buildName
};
}
} }
} }
this.setState({ builds: [], status: STATE.READY });
} if (this.state.comparisons) {
comparisons = {};
for (let name in this.state.comparisons) {
comparisons[name] = Object.assign({ useName: name }, this.state.comparisons[name]);
}
}
this.setState({ processed: true, builds, comparisons });
};
/**
* Import parsed, processed data and save
*/
_import() {
let state = this.state;
if (state.builds) {
let builds = state.builds;
for (let shipId in builds) {
for (let buildName in builds[shipId]) {
let build = builds[shipId][buildName];
let name = build.useName.trim();
if (name) {
Persist.saveBuild(shipId, name, build.code);
}
}
}
}
if (state.comparisons) {
let comparisons = state.comparisons;
for (let comp in comparisons) {
let comparison = comparisons[comp];
let useName = comparison.useName.trim();
if (useName) {
Persist.saveComparison(useName, comparison.builds, comparison.facets);
}
}
}
if (state.shipDiscount !== undefined) {
Persist.setShipDiscount(state.shipDiscount);
}
if (state.moduleDiscount !== undefined) {
Persist.setModuleDiscount(state.moduleDiscount);
}
if (state.insurance) {
Persist.setInsurance(state.insurance);
}
this.context.hideModal();
};
/** /**
* Capture build name changes * Capture build name changes
* @param {Object} index Build/Comparison import object * @param {Object} item Build/Comparison import object
* @param {SyntheticEvent} event Event * @param {SyntheticEvent} e Event
*/ */
_changeName(index, event) { _changeName(item, e) {
const { builds } = this.state; item.useName = e.target.value;
builds[index].CoriolisBuildName = event.target.value.trim(); this.forceUpdate();
this.setState({ builds });
} }
/**
* If imported data is already provided process immediately on mount
*/
componentWillMount() {
if (this.props.builds) {
this._process();
}
}
/** /**
* If textarea is shown focus on mount * If textarea is shown focus on mount
*/ */
@@ -123,54 +526,100 @@ export default class ModalImport extends TranslatedComponent {
* @return {React.Component} Modal contents * @return {React.Component} Modal contents
*/ */
render() { render() {
const { translate } = this.context.language; let translate = this.context.language.translate;
const { status, builds, err } = this.state; let state = this.state;
let importStage;
const buildRows = builds.map((build, i) => { if (!state.processed) {
if (build instanceof Error) { importStage = (
return <tr key={i} className='cb'> <div>
<td colSpan={3} className='warning'>Error: {build.name}</td> <textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._validateImport} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
</tr>; <button id='proceed' className='l cap' onClick={this._process} disabled={!state.importValid} >{translate('proceed')}</button>
<div className='l warning' style={{ marginLeft:'3em' }}>{state.errorMsg}</div>
</div>
);
} else {
let comparisonTable, edit, buildRows = [];
if (state.comparisons) {
let comparisonRows = [];
for (let name in state.comparisons) {
let comparison = state.comparisons[name];
let hasComparison = Persist.hasComparison(comparison.useName);
comparisonRows.push(
<tr key={name} className='cb'>
<td>
<input type='text' onChange={this._changeName.bind(this, comparison)} value={comparison.useName}/>
</td>
<td style={{ textAlign:'center' }} className={ cn('cap', { warning: hasComparison, disabled: comparison.useName == '' }) }>
{translate(comparison.useName == '' ? 'skip' : (hasComparison ? 'overwrite' : 'create'))}
</td>
</tr>
);
}
comparisonTable = (
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }} >
<thead>
<tr>
<th style={{ textAlign:'left' }}>{translate('comparison')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{comparisonRows}
</tbody>
</table>
);
} }
const exists = Persist.hasBuild(build.Ship, build.CoriolisBuildName); if(this.state.canEdit) {
const saveName = build.CoriolisBuildName || build.ShipName; edit = <button className='l cap' style={{ marginLeft: '2em' }} onClick={() => this.setState({ processed: false })}>{translate('edit data')}</button>;
return <tr key={i} className='cb'> }
<td>{translate(build.Ship)}</td>
<td><input type='text' onChange={this._changeName.bind(this, i)} value={saveName}/></td> let builds = this.state.builds;
<td style={{ textAlign: 'center' }} className={cn('cap', { warning: exists, disabled: saveName === '' })}> for (let shipId in builds) {
{translate(saveName === '' ? 'skip' : (exists ? 'overwrite' : 'create'))} let shipBuilds = builds[shipId];
</td> for (let buildName in shipBuilds) {
</tr>; let b = shipBuilds[buildName];
}); let hasBuild = Persist.hasBuild(shipId, b.useName);
buildRows.push(
<tr key={shipId + buildName} className='cb'>
<td>{Ships[shipId].properties.name}</td>
<td><input type='text' onChange={this._changeName.bind(this, b)} value={b.useName}/></td>
<td style={{ textAlign: 'center' }} className={cn('cap', { warning: hasBuild, disabled: b.useName == '' })}>
{translate(b.useName == '' ? 'skip' : (hasBuild ? 'overwrite' : 'create'))}
</td>
</tr>
);
}
}
importStage = (
<div>
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }}>
<thead>
<tr>
<th style={{ textAlign: 'left' }} >{translate('ship')}</th>
<th style={{ textAlign: 'left' }} >{translate('build name')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{buildRows}
</tbody>
</table>
{comparisonTable}
<button id='import' className='cl l' onClick={this._import}><Download/> {translate('import')}</button>
{edit}
</div>
);
}
return <div className='modal' onClick={ (e) => e.stopPropagation() }> return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h2 >{translate('import')}</h2> <h2 >{translate('import')}</h2>
<div> {importStage}
<textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._parse} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} /> <button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
{status === STATE.ERROR && <div className='l warning' style={{ marginLeft:'3em' }}>{err.toString()}</div>}
</div>
{builds.length && <div>
<table className='l' style={{ overflow:'hidden', margin: '1em 0', width: '100%' }}>
<thead>
<tr>
<th style={{ textAlign: 'left' }} >{translate('ship')}</th>
<th style={{ textAlign: 'left' }} >{translate('build name')}</th>
<th>{translate('action')}</th>
</tr>
</thead>
<tbody>
{buildRows}
</tbody>
</table>
</div>}
<button id='proceed' className='l cap' onClick={this._process}
disabled={status !== STATE.PARSED} >
{translate('proceed')}
</button>
<button className={'r dismiss cap'} onClick={this.context.hideModal}>
{translate('close')}
</button>
</div>; </div>;
} }
} }

View File

@@ -7,6 +7,7 @@ import ShortenUrl from '../utils/ShortenUrl';
* Permalink modal * Permalink modal
*/ */
export default class ModalPermalink extends TranslatedComponent { export default class ModalPermalink extends TranslatedComponent {
static propTypes = { static propTypes = {
url: PropTypes.string.isRequired url: PropTypes.string.isRequired
}; };

View File

@@ -0,0 +1,402 @@
import React from 'react';
import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent';
import request from 'superagent';
import Persist from '../stores/Persist';
const zlib = require('zlib');
const base64url = require('base64url');
/**
* Permalink modal
*/
export default class ModalShoppingList extends TranslatedComponent {
static propTypes = {
ship: PropTypes.object.isRequired,
buildName: PropTypes.string
};
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this.state = {
matsList: '',
mats: {},
failed: false,
cmdrName: Persist.getCmdr().selected,
cmdrs: Persist.getCmdr().cmdrs,
matsPerGrade: Persist.getRolls(),
blueprints: []
};
}
/**
* React component did mount
*/
componentDidMount() {
this.renderMats();
if (this.checkBrowserIsCompatible()) {
this.getCommanders();
this.registerBPs();
}
}
/**
* Find all blueprints needed to make a build.
*/
registerBPs() {
const ship = this.props.ship;
let blueprints = [];
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
if (module.m.blueprint.special) {
blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 });
}
for (const g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
if (g > module.m.blueprint.grade) {
continue;
}
blueprints.push({ uuid: module.m.blueprint.grades[g].uuid, number: this.state.matsPerGrade[g] });
}
}
}
this.setState({ blueprints });
}
/**
* Check browser isn't firefox.
* @return {boolean} true if compatible, false if not.
*/
checkBrowserIsCompatible() {
// Firefox 1.0+
return typeof InstallTrigger === 'undefined';
}
/**
* Get a list of commanders from EDEngineer.
*/
getCommanders() {
request
.get('http://localhost:44405/commanders')
.end((err, res) => {
this.display = 'block';
if (err) {
console.log(err);
this.display = 'none';
return this.setState({ failed: true });
}
const cmdrs = JSON.parse(res.text);
if (!this.state.cmdrName) {
this.setState({ cmdrName: cmdrs[0] });
}
this.setState({ cmdrs }, () => {
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs });
});
});
}
/**
* Send all blueprints to ED Engineer
* @param {Event} event React event
*/
sendToEDEng(event) {
event.preventDefault();
let translate = this.context.language.translate;
const target = event.target;
target.disabled = this.state.blueprints.length > 0;
if (this.state.blueprints.length === 0) {
target.innerText = translate('No modded components.');
target.disabled = true;
setTimeout(() => {
target.innerText = translate('Send to EDEngineer');
target.disabled = false;
}, 3000);
} else {
target.innerText = translate('Sending...');
}
let countSent = 0;
let countTotal = this.state.blueprints.length;
for (const i of this.state.blueprints) {
request
.patch(`http://localhost:44405/${this.state.cmdrName}/shopping-list`)
.field('uuid', i.uuid)
.field('size', i.number)
.end(err => {
if (err) {
console.log(err);
if (err.message !== 'Bad Request') {
this.setState({ failed: true });
}
}
countSent++;
if (countSent === countTotal) {
target.disabled = false;
target.innerText = translate('Send to EDEngineer');
}
});
}
}
/**
* Fix issues with the item name for bulkheads when sending to EDOMH
* @param {*} ship Ship object
* @param {*} item Item name
* @returns updated item name
*/
fixArmourItemNameForEDOMH(ship, item) {
// The module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
switch (ship.bulkheads.m.name){
case "Lightweight Alloy":
item = ship.id + "_Armour_Grade1";
break;
case "Reinforced Alloy":
item = ship.id + "_Armour_Grade2";
break;
case "Military Grade Composite":
item = ship.id + "_Armour_Grade3";
break;
case "Mirrored Surface Composite":
item = ship.id + "_Armour_Mirrored";
break;
case "Reactive Surface Composite":
item = ship.id + "_Armour_Reactive";
break;
}
return item;
}
/**
* Send all blueprints to EDOMH. This is a modified copy of registerBPs because this.state.blueprints was empty when I tried to modify sendToEDEng and I couldn't figure out why
* @param {Event} event React event
*/
sendToEDOMH(event) {
event.preventDefault();
const ship = this.props.ship;
const buildName = this.props.buildName;
let blueprints = [];
//create the json
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
if (module.m.blueprint.special) {
let item = "";
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
if (module.m.blueprint.fdname.includes("Armour_")) {
item = this.fixArmourItemNameForEDOMH(ship, item)
}
else {
item = module.m.symbol;
}
blueprints.push({
"item": item,
"blueprint": module.m.blueprint.special.edname
});
}
for (let g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
// We only want the grade that the module is currently at, not every grade up to that point
if (Number(g) !== module.m.blueprint.grade) {
continue;
}
let item = "";
// If the module blueprint fdname contains "Armour_" it's a bulkhead and we need to pre-populate the item field with the correct name from the ship object
if (module.m.blueprint.fdname.includes("Armour_")) {
item = this.fixArmourItemNameForEDOMH(ship, item)
}
else {
item = module.m.symbol;
}
blueprints.push({
"item": item,
"blueprint": module.m.blueprint.fdname,
"grade": module.m.blueprint.grade,
"highestGradePercentage":1.0
});
}
}
}
let shipName = buildName + " - " + ship.name;
//create JSON to encode
let baseJson = {
"version":1,
"name": shipName, // TO-DO: Import build name and put that here correctly
"items": blueprints
}
let JSONString = JSON.stringify(baseJson)
let deflated = zlib.deflateSync(JSONString)
//actually encode
let link = base64url.encode(deflated)
link = "edomh://coriolis/?" + link;
window.open(link, "_self")
}
/**
* Convert mats object to string
*/
renderMats() {
const ship = this.props.ship;
let mats = {};
for (const module of ship.costList) {
if (module.type === 'SHIP') {
continue;
}
if (module.m && module.m.blueprint) {
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
continue;
}
for (let g in module.m.blueprint.grades) {
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
continue;
}
// Ignore grades higher than the grade selected
if (Number(g) > module.m.blueprint.grade) {
continue;
}
for (let i in module.m.blueprint.grades[g].components) {
if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) {
continue;
}
if (mats[i]) {
mats[i] += module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
} else {
mats[i] = module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
}
}
}
if (module.m.blueprint.special) {
for (const j in module.m.blueprint.special.components) {
if (!module.m.blueprint.special.components.hasOwnProperty(j)) {
continue;
}
if (mats[j]) {
mats[j] += module.m.blueprint.special.components[j];
} else {
mats[j] = module.m.blueprint.special.components[j];
}
}
}
}
}
let matsString = '';
for (const i in mats) {
if (!mats.hasOwnProperty(i)) {
continue;
}
if (mats[i] === 0) {
delete mats[i];
continue;
}
matsString += `${i}: ${mats[i]}\n`;
}
this.setState({ matsList: matsString, mats });
}
/**
* Handler for changing roll amounts
* @param {SyntheticEvent} e React Event
*/
changeHandler(e) {
let grade = e.target.id;
let newState = this.state.matsPerGrade;
newState[grade] = parseInt(e.target.value);
this.setState({ matsPerGrade: newState });
Persist.setRolls(newState);
this.renderMats();
this.registerBPs();
}
/**
* Handler for changing cmdr name
* @param {SyntheticEvent} e React Event
*/
cmdrChangeHandler(e) {
let cmdrName = e.target.value;
this.setState({ cmdrName }, () => {
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs: this.state.cmdrs });
});
}
/**
* Render the modal
* @return {React.Component} Modal Content
*/
render() {
let translate = this.context.language.translate;
this.changeHandler = this.changeHandler.bind(this);
const compatible = this.checkBrowserIsCompatible();
this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this);
this.sendToEDEng = this.sendToEDEng.bind(this);
this.sendToEDOMH = this.sendToEDOMH.bind(this);
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
<h3>{translate('PHRASE_SHOPPING_MATS')}</h3>
<div>
<p>{translate('PHRASE_DIFFERENT_ROLLS')}</p>
<label>{translate('G1')}</label>
<input id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G2')}</label>
<input id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G3')}</label>
<input id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G4')}</label>
<input id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
&nbsp;|&nbsp;<label>{translate('G5')}</label>
<input id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
</div>
<div>
<p>{translate('PHRASE_ALL_MODULES_ALL_ROLLS')}</p>
<textarea className='cb json' readOnly value={this.state.matsList} />
<p>{translate('PHRASE_FOR_FINER_CONTROL')}</p>
</div>
<div id='edengineer' display={this.display} hidden={!!this.state.failed && !compatible}>
<hr />
<h3>ED Engineer</h3>
<h4 hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</h4>
<h4 hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAILED_TO_FIND_EDENGINEER')}</h4>
<label for='cmdr-select' hidden={!!this.state.failed || !compatible} className={'l cap'}>{translate('CMDR Name:')}</label>
<select id='cmdr-select' hidden={!!this.state.failed || !compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}>
{this.state.cmdrs.map(e => <option key={e}>{e}</option>)}
</select>
<br/>
<button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
</div>
<div id='edomh'>
<hr />
<h3>ED Odyssey Materials Helper</h3>
<p>{translate('PHRASE_ENSURE_EDOMH')}</p>
<button className={'l cb dismiss cap'} onClick={this.sendToEDOMH}>{translate('Send to EDOMH')}</button>
</div>
<hr />
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
</div>;
}
}

View File

@@ -3,52 +3,73 @@ import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import NumberEditor from 'react-number-editor'; import NumberEditor from 'react-number-editor';
import { Module } from 'ed-forge'; import { isChangeValueBeneficial } from '../utils/BlueprintFunctions';
import { Modifications } from 'coriolis-data/dist';
/** /**
* Modification * Modification
*/ */
export default class Modification extends TranslatedComponent { export default class Modification extends TranslatedComponent {
static propTypes = { static propTypes = {
highlight: PropTypes.bool, ship: PropTypes.object.isRequired,
m: PropTypes.instanceOf(Module).isRequired, m: PropTypes.object.isRequired,
property: PropTypes.string.isRequired, name: PropTypes.string.isRequired,
onSet: PropTypes.func.isRequired, value: PropTypes.number.isRequired,
showProp: PropTypes.object, onChange: PropTypes.func.isRequired,
onPropToggle: PropTypes.func.isRequired, onKeyDown: PropTypes.func.isRequired,
modItems: PropTypes.array.isRequired,
handleModChange: PropTypes.func.isRequired
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props); super(props);
const { m, property, showProp } = props; this.state = {};
const { beneficial, unit, value } = m.getFormatted(property, true); this.state.value = props.value;
this.state = { beneficial, unit, value, showProp };
} }
/** /**
* Notify listeners that a new value has been entered and commited. * Update modification given a value.
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
* in a value by hand
*/ */
_updateFinished() { _updateValue(value) {
const { onSet, m, property } = this.props; this.setState({ value });
const { inputValue } = this.state; let reCast = String(Number(value));
const numValue = Number(inputValue); if (reCast.endsWith(value) || reCast.startsWith(value)) {
if (!isNaN(numValue) && this.state.value !== numValue) { let { m, name, ship } = this.props;
onSet(property, numValue); value = Math.max(Math.min(value, 50000), -50000);
const { beneficial, unit, value } = m.getFormatted(property, true); ship.setModification(m, name, value, true);
this.setState({ beneficial, unit, value });
} }
} }
_toggleProperty() { /**
const { onPropToggle, property } = this.props; * Triggered when a key is pressed down with focus on the number editor.
const showProp = !this.state.showProp; * @param {SyntheticEvent} event Key down event
// TODO: defer until menu closed */
onPropToggle(property, showProp); _keyDown(event) {
this.setState({ showProp }); if (event.key == 'Enter') {
this._updateFinished();
}
this.props.onKeyDown(event);
}
/**
* Triggered when an update to slider value is finished i.e. when losing focus
*
* pnellesen (24/05/2018): added value check below - this should prevent experimental effects from being recalculated
* with each onBlur event, even when no change has actually been made to the field.
*/
_updateFinished() {
if (this.props.value != this.state.value) {
this.props.handleModChange(true);
this.props.onChange();
}
} }
/** /**
@@ -56,53 +77,57 @@ export default class Modification extends TranslatedComponent {
* @return {React.Component} modification * @return {React.Component} modification
*/ */
render() { render() {
const { formats } = this.context.language; let { translate, formats, units } = this.context.language;
const { highlight, m, property } = this.props; let { m, name } = this.props;
const { beneficial, unit, value, inputValue, showProp } = this.state; let modValue = m.getChange(name);
let isOverwrite = Modifications.modifications[name].method === 'overwrite';
// Some features only apply to specific modules; these features will be if (name === 'damagedist') {
// undefined on items that do not belong to the same class. Filter these // We don't show damage distribution
// features here
if (value === undefined) {
return null; return null;
} }
const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property); let inputClassNames = {
'cb': true,
'greyed-out': !this.props.highlight
};
return ( return (
<tr> <div onBlur={this._updateFinished.bind(this)} key={name}
<td> className={cn('cb', 'modification-container')}
<span> ref={ modItem => this.props.modItems[name] = modItem }>
<input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/> <span className={'cb'}>{translate(name, m.grp)}</span>
</span> <span className={'header-adjuster'}></span>
</td> <table style={{ width: '100%' }}>
<td className="input-container"> <tbody>
<span> <tr>
<NumberEditor value={inputValue || value} stepModifier={1} <td className={'input-container'}>
decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }} <span>
className={cn('cb', { 'greyed-out': !highlight })} {this.props.editable ?
onKeyDown={(event) => { <NumberEditor className={cn(inputClassNames)} value={this.state.value}
if (event.key == 'Enter') { decimals={2} style={{ textAlign: 'right' }} step={0.01}
this._updateFinished(); stepModifier={1} onKeyDown={this._keyDown.bind(this)}
event.stopPropagation(); onValueChange={this._updateValue.bind(this)} /> :
} <input type="text" value={formats.f2(this.state.value)}
}} disabled className={cn('number-editor', 'greyed-out')}
onValueChange={(inputValue) => { style={{ textAlign: 'right', cursor: 'inherit' }}/>
if (inputValue.length <= 15) { }
this.setState({ inputValue }); <span className={'unit-container'}>
} {units[m.getStoredUnitFor(name)]}
}} /> </span>
</span> </span>
</td> </td>
<td style={{ textAlign: 'left' }}> <td style={{ textAlign: 'center' }} className={
<span className="unit-container">{unit}</span> modValue ?
</td> isChangeValueBeneficial(name, modValue) ? 'secondary' : 'warning' :
<td style={{ textAlign: 'center' }} ''
className={cn({ }>
secondary: beneficial, {formats.f2(modValue / 100) || 0}{isOverwrite ? '' : '%'}
warning: beneficial === false, </td>
})} </tr>
>{formats.f2(modifierValue)}{modifierUnit || ''}</td> </tbody>
</tr> </table>
</div>
); );
} }
} }

View File

@@ -1,27 +1,34 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import { chain, flatMap, keys } from 'lodash'; import * as _ from 'lodash';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import cn from 'classnames'; import cn from 'classnames';
import { Modifications } from 'coriolis-data/dist';
import Modification from './Modification'; import Modification from './Modification';
import { import {
getBlueprint,
blueprintTooltip, blueprintTooltip,
setPercent,
getPercent,
setRandom,
specialToolTip specialToolTip
} from '../utils/BlueprintFunctions'; } from '../utils/BlueprintFunctions';
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/src/data/blueprints';
import { getModuleInfo } from 'ed-forge/lib/src/data/items'; const MODIFICATIONS_COMPARATOR = (mod1, mod2) => {
import { SHOW } from '../shipyard/StatsMapping'; return mod1.props.name.localeCompare(mod2.props.name);
};
/** /**
* Modifications menu * Modifications menu
*/ */
export default class ModificationsMenu extends TranslatedComponent { export default class ModificationsMenu extends TranslatedComponent {
static propTypes = { static propTypes = {
className: PropTypes.string, ship: PropTypes.object.isRequired,
m: PropTypes.object.isRequired, m: PropTypes.object.isRequired,
propsToShow: PropTypes.object.isRequired, marker: PropTypes.string.isRequired,
onPropToggle: PropTypes.func.isRequired, onChange: PropTypes.func.isRequired,
modButton:PropTypes.object
}; };
/** /**
@@ -34,177 +41,327 @@ export default class ModificationsMenu extends TranslatedComponent {
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this); this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this); this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
this.selectedModRef = null; this._rollFifty = this._rollFifty.bind(this);
this.selectedSpecialRef = null; this._rollRandom = this._rollRandom.bind(this);
this._rollBest = this._rollBest.bind(this);
this._rollWorst = this._rollWorst.bind(this);
this._reset = this._reset.bind(this);
this._keyDown = this._keyDown.bind(this);
this.modItems = [];// Array to hold various element refs (<li>, <div>, <ul>, etc.)
this.firstModId = null;
this.firstBPLabel = null;// First item in mod menu
this.lastModId = null;
this.selectedModId = null;
this.selectedSpecialId = null;
this.lastNeId = null;// Last number editor id. Used to set focus to last number editor when shift-tab pressed on first element in mod menu.
this.modValDidChange = false; // used to determine if component update was caused by change in modification value.
this._handleModChange = this._handleModChange.bind(this);
const { m } = props;
this.state = { this.state = {
blueprintProgress: m.getBlueprintProgress(), blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name),
blueprintMenuOpened: !m.getBlueprint(),
specialMenuOpened: false specialMenuOpened: false
}; };
} }
/** /**
* Render the blueprints * Render the blueprints
* @param {Object} props React component properties
* @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderBlueprints() { _renderBlueprints(props, context) {
const { m } = this.props; const { m } = props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = context;
const { translate } = language; const translate = language.translate;
const blueprints = [];
const blueprints = m.getApplicableBlueprints().map(blueprint => { for (const blueprintName in Modifications.modules[m.grp].blueprints) {
const info = getBlueprintInfo(blueprint); const blueprint = getBlueprint(blueprintName, m);
let blueprintGrades = keys(info.features).map(grade => { let blueprintGrades = [];
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
// Grade is a string in the JSON so make it a number // Grade is a string in the JSON so make it a number
grade = Number(grade); grade = Number(grade);
const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade; const classes = cn('c', {
const key = blueprint + ':' + grade; active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade
return <li key={key} data-id={key} className={cn('c', { active })} });
style={{ width: '2em' }} const close = this._blueprintSelected.bind(this, blueprintName, grade);
onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))} const key = blueprintName + ':' + grade;
onMouseOut={tooltip.bind(null, null)} const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp);
onClick={() => { if (classes.indexOf('active') >= 0) this.selectedModId = key;
m.setBlueprint(blueprint, grade, 1); blueprintGrades.unshift(<li key={key} tabIndex="0" data-id={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close} onKeyDown={this._keyDown} ref={modItem => this.modItems[key] = modItem}>{grade}</li>);
this.setState({ }
blueprintMenuOpened: false, if (blueprintGrades) {
specialMenuOpened: true, const thisLen = blueprintGrades.length;
}); if (this.firstModId == null) this.firstModId = blueprintGrades[0].key;
}} this.lastModId = blueprintGrades[thisLen - 1].key;
ref={active ? (ref) => { this.selectedModRef = ref; } : undefined} blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>);
>{grade}</li>; blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>);
}); }
}
return [ return blueprints;
<div key={'div' + blueprint} className={'select-group cap'}>
{translate(blueprint)}
</div>,
<ul key={'ul' + blueprint}>{blueprintGrades}</ul>
];
});
return flatMap(blueprints);
} }
/**
* Key down - select module on Enter key, move to next/previous module on Tab/Shift-Tab, close on Esc
* @param {SyntheticEvent} event Event
*
*/
_keyDown(event) {
let className = null;
let elemId = null;
if (event.currentTarget.attributes['class']) className = event.currentTarget.attributes['class'].value;
if (event.currentTarget.attributes['data-id']) elemId = event.currentTarget.attributes['data-id'].value;
if (event.key == 'Enter' && className.indexOf('disabled') < 0 && className.indexOf('active') < 0) {
event.stopPropagation();
if (elemId != null) {
this.modItems[elemId].click();
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
// Shift-Tab
if(event.shiftKey) {
if (elemId == this.firstModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.lastModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null && this.lastNeId != null && this.modItems[this.lastNeId] != null) {
// shift-tab on first element in modifications menu. set focus to last number editor field if open
event.preventDefault();
this.modItems[this.lastNeId].lastChild.focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.previousElementSibling == null) {
// shift-tab on button-inline-menu with no number editor
event.preventDefault();
event.currentTarget.parentElement.lastElementChild.focus();
}
} else {
if (elemId == this.lastModId && elemId != null) {
// Initial modification menu
event.preventDefault();
this.modItems[this.firstModId].focus();
return;
} else if (event.currentTarget.className.indexOf('button-inline-menu') >= 0 && event.currentTarget.nextSibling == null && event.currentTarget.nodeName != 'TD') {
// Experimental menu
event.preventDefault();
event.currentTarget.parentElement.firstElementChild.focus();
return;
} else if (event.currentTarget.className == 'cb' && event.currentTarget.parentElement.nextSibling == null) {
event.preventDefault();
this.modItems[this.firstBPLabel].focus();
}
}
}
}
/** /**
* Render the specials * Render the specials
* @param {Object} props React component properties * @param {Object} props React component properties
* @param {Object} context React component context * @param {Object} context React component context
* @return {Object} list: Array of React Components * @return {Object} list: Array of React Components
*/ */
_renderSpecials() { _renderSpecials(props, context) {
const { m } = this.props; const { m } = props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = context;
const translate = language.translate; const translate = language.translate;
const specials = [];
const applied = m.getExperimental(); const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials';
const experimentals = []; if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) {
for (const experimental of m.getApplicableExperimentals()) { const close = this._specialSelected.bind(this, null);
const active = experimental === applied; specials.push(<div tabIndex="0" style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } data-id={ 'none' } onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems['none'] = modItem}>{translate('PHRASE_NO_SPECIAL')}</div>);
let specialTt = specialToolTip(language, m, experimental); for (const specialName of Modifications.modules[m.grp][specialsId]) {
experimentals.push( if (Modifications.specials[specialName].name.search('Legacy') >= 0) {
<div key={experimental} data-id={experimental} continue;
style={{ cursor: 'pointer' }} }
className={cn('button-inline-menu', { active })} const classes = cn('button-inline-menu', {
onClick={this._specialSelected(experimental)} active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName
ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined} });
onMouseOver={termtip.bind(null, specialTt)} if (classes.indexOf('active') >= 0) this.selectedSpecialId = specialName;
onMouseOut={tooltip.bind(null, null)} const close = this._specialSelected.bind(this, specialName);
>{translate(experimental)}</div> if (m.blueprint && m.blueprint.name) {
); let tmp = {};
if (m.blueprint.special) {
tmp = m.blueprint.special;
} else {
tmp = undefined;
}
m.blueprint.special = Modifications.specials[specialName];
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName);
m.blueprint.special = tmp;
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
} else {
specials.push(<div tabIndex="0" style={{ cursor: 'pointer' }} className={classes} key={ specialName } data-id={ specialName }onClick={ close } onKeyDown={this._keyDown} ref={modItem => this.modItems[specialName] = modItem}>{translate(Modifications.specials[specialName].name)}</div>);
}
}
} }
return specials;
if (experimentals.length) {
experimentals.unshift(
<div style={{ cursor: 'pointer', fontWeight: 'bold' }}
className="button-inline-menu warning" key="none" data-id="none"
// Setting the special effect to undefined clears it
onClick={this._specialSelected(undefined)}
ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
>{translate('PHRASE_NO_SPECIAL')}</div>
);
}
return experimentals;
}
/**
* Create a modification component
*/
_mkModification(property, highlight) {
const { translate } = this.context.language;
const { m, propsToShow, onPropToggle } = this.props;
let onSet = m.set.bind(m);
// Show resistance instead of effectiveness
const mapped = SHOW[property];
if (mapped) {
property = mapped.as;
onSet = mapped.setter.bind(undefined, m);
}
return [
<tr key={`th-${property}`}>
<th colSpan="4">
<span className="cb">{translate(property)}</span>
</th>
</tr>,
<Modification key={property} m={m} property={property}
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
onPropToggle={onPropToggle} />
];
} }
/** /**
* Render the modifications * Render the modifications
* @return {Array} Array of React Components * @param {Object} props React Component properties
* @return {Object} list: Array of React Components
*/ */
_renderModifications() { _renderModifications(props) {
const { m } = this.props; const { m, onChange, ship } = props;
const modifiableModifications = [];
const modifications = [];
for (const modName of Modifications.modules[m.grp].modifications) {
if (!Modifications.modifications[modName].hidden) {
const key = modName + (m.getModValue(modName) / 100 || 0);
const editable = modName !== 'fallofffromrange';
const highlight = m.blueprint.grades[m.blueprint.grade].features[modName];
this.lastNeId = modName;
(editable && highlight ? modifiableModifications : modifications).push(
<Modification key={ key } ship={ ship } m={ m } highlight={highlight}
value={m.getPretty(modName) || 0} modItems={this.modItems}
onChange={onChange} onKeyDown={this._keyDown} name={modName}
editable={editable} handleModChange = {this._handleModChange} />
);
}
}
const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[ modifiableModifications.sort(MODIFICATIONS_COMPARATOR);
m.getBlueprintGrade() modifications.sort(MODIFICATIONS_COMPARATOR);
]; return modifiableModifications.concat(modifications);
const blueprintModifications = chain(keys(blueprintFeatures))
.map((feature) => this._mkModification(feature, true))
.filter(([_, mod]) => Boolean(mod))
.flatMap()
.value();
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
.filter((prop) => !blueprintFeatures[prop])
.map((prop) => this._mkModification(prop, false))
.flatMap()
.value();
return blueprintModifications.concat(moduleModifications);
} }
/** /**
* Toggle the blueprints menu * Toggle the blueprints menu
*/ */
_toggleBlueprintsMenu() { _toggleBlueprintsMenu() {
this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened }); const blueprintMenuOpened = !this.state.blueprintMenuOpened;
this.setState({ blueprintMenuOpened });
}
/**
* Activated when a blueprint is selected
* @param {int} fdname The Frontier name of the blueprint
* @param {int} grade The grade of the selected blueprint
*/
_blueprintSelected(fdname, grade) {
this.context.tooltip(null);
const { m, ship } = this.props;
const blueprint = getBlueprint(fdname, m);
blueprint.grade = grade;
ship.setModuleBlueprint(m, blueprint);
setPercent(ship, m, 100);
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
this.props.onChange();
} }
/** /**
* Toggle the specials menu * Toggle the specials menu
*/ */
_toggleSpecialsMenu() { _toggleSpecialsMenu() {
this.setState({ specialMenuOpened: !this.state.specialMenuOpened }); const specialMenuOpened = !this.state.specialMenuOpened;
this.setState({ specialMenuOpened });
} }
/** /**
* Creates a callback for when a special effect is being selected * Activated when a special is selected
* @param {string} special The name of the selected special * @param {int} special The name of the selected special
* @returns {function} Callback
*/ */
_specialSelected(special) { _specialSelected(special) {
return () => { this.context.tooltip(null);
const { m } = this.props; const { m, ship } = this.props;
m.setExperimental(special);
this.setState({ specialMenuOpened: false }); if (special === null) {
}; ship.clearModuleSpecial(m);
} else {
ship.setModuleSpecial(m, Modifications.specials[special]);
}
this.setState({ specialMenuOpened: false });
this.props.onChange();
}
/**
* Provide a '50%' roll within the information we have
*/
_rollFifty() {
const { m, ship } = this.props;
setPercent(ship, m, 50);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a random roll within the information we have
*/
_rollRandom() {
const { m, ship } = this.props;
setRandom(ship, m);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'best' roll within the information we have
*/
_rollBest() {
const { m, ship } = this.props;
setPercent(ship, m, 100);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Provide a 'worst' roll within the information we have
*/
_rollWorst() {
const { m, ship } = this.props;
setPercent(ship, m, 0);
// this will change the values in the modifications. Set modDidChange to true to prevent focus change when component updates
this._handleModChange(true);
this.props.onChange();
}
/**
* Reset modification information
*/
_reset() {
const { m, ship } = this.props;
ship.clearModifications(m);
ship.clearModuleBlueprint(m);
this.selectedModId = null;
this.selectedSpecialId = null;
this.props.onChange();
}
/**
* set mod did change boolean
* @param {boolean} b Boolean to determine if a change has been made to a module
*/
_handleModChange(b) {
this.modValDidChange = b;
}
/**
* Set focus on first element in modifications menu
* after it first mounts
*/
componentDidMount() {
let firstEleCn = this.modItems['modMainDiv'].children.length > 0 ? this.modItems['modMainDiv'].children[0].className : null;
if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
} else {
this.modItems['modMainDiv'].firstElementChild.focus();
}
} }
/** /**
@@ -213,12 +370,32 @@ export default class ModificationsMenu extends TranslatedComponent {
* in a modification * in a modification
*/ */
componentDidUpdate() { componentDidUpdate() {
if (this.selectedModRef) { if (!this.modValDidChange) {
this.selectedModRef.focus(); if (this.modItems['modMainDiv'].children.length > 0) {
return; if (this.modItems[this.selectedModId]) {
} else if (this.selectedSpecialRef) { this.modItems[this.selectedModId].focus();
this.selectedSpecialRef.focus(); return;
return; } else if (this.modItems[this.selectedSpecialId]) {
this.modItems[this.selectedSpecialId].focus();
return;
}
let firstEleCn = this.modItems['modMainDiv'].children[0].className;
if (firstEleCn.indexOf('button-inline-menu') >= 0) {
this.modItems['modMainDiv'].firstElementChild.focus();
} else if (firstEleCn.indexOf('select-group cap') >= 0) {
this.modItems['modMainDiv'].children[1].firstElementChild.focus();
}
}
} else {
this._handleModChange(false);// Need to reset if component update due to value change
}
}
/**
* set focus to the modification menu icon after mod menu is unmounted.
*/
componentWillUnmount() {
if (this.props.modButton) {
this.props.modButton.focus();
} }
} }
@@ -230,155 +407,90 @@ export default class ModificationsMenu extends TranslatedComponent {
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const translate = language.translate; const translate = language.translate;
const { m } = this.props; const { m } = this.props;
const { const { blueprintMenuOpened, specialMenuOpened } = this.state;
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
} = this.state;
const appliedBlueprint = m.getBlueprint(); const _toggleBlueprintsMenu = this._toggleBlueprintsMenu;
const appliedGrade = m.getBlueprintGrade(); const _toggleSpecialsMenu = this._toggleSpecialsMenu;
const appliedExperimental = m.getExperimental(); const _rollFull = this._rollBest;
const _rollWorst = this._rollWorst;
const _rollFifty = this._rollFifty;
const _rollRandom = this._rollRandom;
const _reset = this._reset;
let renderComponents = []; let blueprintLabel;
switch (true) { let haveBlueprint = false;
case !appliedBlueprint || blueprintMenuOpened: let blueprintTt;
renderComponents = this._renderBlueprints(); let blueprintCv;
break; // TODO: Fix this to actually find the correct blueprint.
case specialMenuOpened: if (!m.blueprint || !m.blueprint.name || !m.blueprint.fdname || !Modifications.modules[m.grp].blueprints || !Modifications.modules[m.grp].blueprints[m.blueprint.fdname]) {
renderComponents = this._renderSpecials(); this.props.ship.clearModuleBlueprint(m);
break; this.props.ship.clearModuleSpecial(m);
default: }
// Since the first case didn't apply, there is a blueprint applied so if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade]) {
// we render the modifications blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade); haveBlueprint = true;
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade].engineers, m.grp);
renderComponents.push( blueprintCv = getPercent(m);
<div style={{ cursor: 'pointer' }} key="blueprintsMenu"
className="section-menu button-inline-menu"
onMouseOver={termtip.bind(null, blueprintTt)}
onMouseOut={tooltip.bind(null, null)}
onClick={this._toggleBlueprintsMenu}
>
{translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
</div>
);
if (m.getApplicableExperimentals().length) {
let specialLabel = translate('PHRASE_SELECT_SPECIAL');
let specialTt;
if (appliedExperimental) {
specialLabel = appliedExperimental;
specialTt = specialToolTip(language, m, appliedExperimental);
}
renderComponents.push(
<div className="section-menu button-inline-menu"
style={{ cursor: 'pointer' }}
onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
onMouseOut={specialTt ? tooltip.bind(null, null) : null}
onClick={this._toggleSpecialsMenu}
>{specialLabel}</div>
);
}
renderComponents.push(
<div
className="section-menu button-inline-menu warning"
style={{ cursor: 'pointer' }}
onClick={() => {
m.resetEngineering();
this.selectedModRef = null;
this.selectedSpecialRef = null;
tooltip(null);
this.setState({
blueprintMenuOpened: true,
blueprintProgress: undefined,
});
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
onMouseOut={tooltip.bind(null, null)}
>{translate('reset')}</div>,
<table style={{ width: '100%', backgroundColor: 'transparent' }}>
<tbody>
<tr>
<td
className={cn(
'section-menu button-inline-menu',
{ active: false },
)}
>{translate('mroll')}:</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0);
this.setState({ blueprintProgress: 0 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('0%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 0.5 },
)} style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(0.5);
this.setState({ blueprintProgress: 0.5 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
onMouseOut={tooltip.bind(null, null)}
>{translate('50%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress === 1 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
m.setBlueprintProgress(1);
this.setState({ blueprintProgress: 1 });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
onMouseOut={tooltip.bind(null, null)}
>{translate('100%')}</td>
<td
className={cn(
'section-menu button-inline-menu',
{ active: blueprintProgress % 0.5 !== 0 },
)}
style={{ cursor: 'pointer' }}
onClick={() => {
const blueprintProgress = Math.random();
m.setBlueprintProgress(blueprintProgress);
this.setState({ blueprintProgress });
}}
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
onMouseOut={tooltip.bind(null, null)}
>{translate('random')}</td>
</tr>
</tbody>
</table>,
<hr />,
<span
onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
onMouseOut={tooltip.bind(null, null)}
>
<table style={{ width: '100%' }}>
<tbody>
{this._renderModifications()}
</tbody>
</table>
</span>
);
} }
let specialLabel;
let specialTt;
if (m.blueprint && m.blueprint.special) {
specialLabel = translate(m.blueprint.special.name);
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname);
} else {
specialLabel = translate('PHRASE_SELECT_SPECIAL');
}
const specials = this._renderSpecials(this.props, this.context);
/**
* pnellesen - 05/28/2018 - added additional checks for specials.length below to ensure menus
* display correctly in cases where there are no specials (ex: AFMUs.)
*/
const showBlueprintsMenu = blueprintMenuOpened;
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened;
const showSpecialsMenu = specialMenuOpened && specials.length;
const showRolls = haveBlueprint && !blueprintMenuOpened && (!specialMenuOpened || !specials.length);
const showReset = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
const showMods = !blueprintMenuOpened && (!specialMenuOpened || !specials.length) && haveBlueprint;
if (haveBlueprint) {
this.firstBPLabel = blueprintLabel;
} else {
this.firstBPLabel = 'selectBP';
}
return ( return (
<div className={cn('select', this.props.className)} <div
onClick={(e) => e.stopPropagation()} className={cn('select', this.props.className)}
onClick={(e) => e.stopPropagation() }
onContextMenu={stopCtxPropagation} onContextMenu={stopCtxPropagation}
ref={modItem => this.modItems['modMainDiv'] = modItem}
> >
{renderComponents} { showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ?
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{blueprintLabel}</div> :
<div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu} onKeyDown={ this._keyDown } ref={modItems => this.modItems[this.firstBPLabel] = modItems}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> }
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
{ showSpecial & !showSpecialsMenu ? <div tabIndex="0" className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu} onKeyDown={ this._keyDown }>{specialLabel}</div> : null }
{ showSpecialsMenu ? specials : null }
{ showReset ? <div tabIndex="0" className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
{ showRolls ?
<table style={{ width: '100%', backgroundColor: 'transparent' }}>
<tbody>
{ showRolls ?
<tr>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: false }) }> { translate('mroll') }: </td>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 }) } style={{ cursor: 'pointer' }} onClick={_rollWorst} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td>
<td tabIndex="0" className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onKeyDown={ this._keyDown } onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td>
</tr> : null }
</tbody>
</table> : null }
{ showMods ? <hr /> : null }
{ showMods ?
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} >
{ this._renderModifications(this.props) }
</span> : null }
</div> </div>
); );
} }

View File

@@ -1,28 +1,36 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { ShipProps } from 'ed-forge';
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
/** /**
* Movement * Movement
*/ */
export default class Movement extends TranslatedComponent { export default class Movement extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired, marker: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
boost: PropTypes.bool.isRequired, boost: PropTypes.bool.isRequired,
pips: PropTypes.object.isRequired, eng: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
}
/** /**
* Render movement * Render movement
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship, boost } = this.props; const { ship, boost, eng, cargo, fuel } = this.props;
const { language } = this.context; const { language } = this.context;
const { formats } = language; const { formats, translate, units } = language;
return ( return (
<span id='movement'> <span id='movement'>
@@ -49,10 +57,14 @@ export default class Movement extends TranslatedComponent {
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/> <path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/> <path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
<text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text> {/* Speed */}
<text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text> <text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text>
<text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text> {/* Pitch */}
<text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text> <text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
{/* Roll */}
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
{/* Yaw */}
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
</svg> </svg>
</span>); </span>);
} }

View File

@@ -1,37 +1,103 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import * as Calc from '../shipyard/Calculations';
import PieChart from './PieChart'; import PieChart from './PieChart';
import { nameComparator } from '../utils/SlotFunctions';
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons'; import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { DAMAGE_METRICS } from 'ed-forge/lib/src/ship-stats';
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
/** /**
* Turns an object into a tooltip. * Generates an internationalization friendly weapon comparator that will
* @param {function} translate Translate function * sort by specified property (if provided) then by name/group, class, rating
* @param {object} o Map to make the tooltip from * @param {function} translate Translation function
* @returns {React.Component} Tooltip * @param {function} propComparator Optional property comparator
* @param {boolean} desc Use descending order
* @return {function} Comparator function for names
*/ */
function objToTooltip(translate, o) { export function weaponComparator(translate, propComparator, desc) {
return toPairs(o) return (a, b) => {
.filter(([k, v]) => Boolean(v)) if (!desc) { // Flip A and B if ascending order
.map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>); let t = a;
a = b;
b = t;
}
// If a property comparator is provided use it first
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
if (diff) {
return diff;
}
// Property matches so sort by name / group, then class, rating
if (a.name === b.name && a.grp === b.grp) {
if(a.class == b.class) {
return a.rating > b.rating ? 1 : -1;
}
return a.class - b.class;
}
return nameComparator(translate, a, b);
};
}
/**
* Creates a tooltip that shows damage by type.
* @param {function} translate Translation function
* @param {Object} formats Object that holds format functions
* @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
* @returns {Array} Tooltip
*/
function getSDpsTooltip(translate, formats, sdpsObject) {
return Object.keys(sdpsObject).filter(key => sdpsObject[key])
.map(key => {
return (
<div key={key}>
{translate(key) + ' ' + formats.f1(sdpsObject[key])}
</div>
);
});
} }
/** /**
* Returns a data object used by {@link PieChart} that shows damage by type. * Returns a data object used by {@link PieChart} that shows damage by type.
* @param {function} translate Translation function * @param {function} translate Translation function
* @param {Calc.SDps} o Object that holds sdps split up by type * @param {Calc.SDps} sdpsObject Object that holds sdps split up by type
* @returns {Object} Data object * @returns {Object} Data object
*/ */
function objToPie(translate, o) { function getSDpsData(translate, sdpsObject) {
return toPairs(o).map(([k, value]) => { return Object.keys(sdpsObject).map(key => {
return { label: translate(k), value }; return {
value: Math.round(sdpsObject[key]),
label: translate(key)
};
}); });
} }
/**
* Adds all damage of `add` onto `addOn`.
* @param {Calc.SDps} addOn Object that holds sdps split up by type (will be mutated)
* @param {Calc.SDps} add Object that holds sdps split up by type
*/
function addSDps(addOn, add) {
Object.keys(addOn).map(k => addOn[k] += (add[k] ? add[k] : 0));
}
/**
* Calculates the overall sdps of an sdps object.
* @param {Calc.SDps} sdpsObject Object that holds sdps spluit up by type
*/
function sumSDps(sdpsObject) {
if (sdpsObject.total) {
return sdpsObject.total;
}
return Object.keys(sdpsObject).reduce(
(acc, k) => acc + (sdpsObject[k] ? sdpsObject[k] : 0),
0
);
}
/** /**
* Offence information * Offence information
* Offence information consists of four panels: * Offence information consists of four panels:
@@ -42,10 +108,12 @@ function objToPie(translate, o) {
*/ */
export default class Offence extends TranslatedComponent { export default class Offence extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired, marker: PropTypes.string.isRequired,
ship: PropTypes.instanceOf(Ship).isRequired, ship: PropTypes.object.isRequired,
opponent: PropTypes.instanceOf(Ship).isRequired, opponent: PropTypes.object.isRequired,
engagementRange: PropTypes.number.isRequired, engagementrange: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired
}; };
/** /**
@@ -54,234 +122,151 @@ export default class Offence extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this._sort = this._sort.bind(this);
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
this.state = { this.state = {
predicate: 'classRating', predicate: 'n',
desc: true, desc: true,
damage
}; };
} }
/**
* Update the state if our properties change
* @param {Object} nextProps Incoming/Next properties
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps) {
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
this.setState({ damage });
}
return true;
}
/** /**
* Set the sort order and sort * Set the sort order and sort
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
let desc = predicate == this.state.predicate ? !this.state.desc : true; let desc = this.state.desc;
if (predicate == this.state.predicate) {
desc = !desc;
} else {
desc = true;
}
this._sort(predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/**
* Sorts the weapon list
* @param {string} predicate Sort predicate
* @param {Boolean} desc Sort order descending
*/
_sort(predicate, desc) {
let comp = weaponComparator.bind(null, this.context.language.translate);
switch (predicate) {
case 'n': comp = comp(null, desc); break;
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
}
this.state.damage.sort(comp);
}
/** /**
* Render offence * Render offence
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship } = this.props; const { ship, opponent, wep, engagementrange } = this.props;
const { language, tooltip, termtip } = this.context; const { language, tooltip, termtip } = this.context;
const { formats, translate, units } = language; const { formats, translate, units } = language;
const { damage } = this.state;
const sortOrder = this._sortOrder; const sortOrder = this._sortOrder;
const { const pd = ship.standard[4].m;
drained, sustained, rangeMultiplier, hardnessMultiplier, timeToDrain
} = ship.getMetrics(DAMAGE_METRICS);
const portions = {
Absolute: sustained.types.abs,
Explosive: sustained.types.expl,
Kinetic: sustained.types.kin,
Thermic: sustained.types.therm,
};
const oppShield = ship.getOpponent().getShield(); const opponentShields = Calc.shieldMetrics(opponent, 4);
const shieldMults = { const opponentArmour = Calc.armourMetrics(opponent);
Absolute: 1,
Explosive: oppShield.explosive.damageMultiplier,
Kinetic: oppShield.kinetic.damageMultiplier,
Thermic: oppShield.thermal.damageMultiplier,
};
const oppArmour = ship.getOpponent().getArmour(); const timeToDrain = Calc.timeToDrainWep(ship, wep);
const armourMults = {
Absolute: 1,
Explosive: oppArmour.explosive.damageMultiplier,
Kinetic: oppArmour.kinetic.damageMultiplier,
Thermic: oppArmour.thermal.damageMultiplier,
};
const weapons = sortBy(ship.getHardpoints(), (m) => m.get('distributordraw'));
let rows = weapons.map((weapon) => {
const sdps = weapon.get('sustaineddamagepersecond');
const byRange = weapon.getRangeEffectiveness();
const weaponPortions = {
Absolute: weapon.get('absolutedamageportion'),
Explosive: weapon.get('explosivedamageportion'),
Kinetic: weapon.get('kineticdamageportion'),
Thermic: weapon.get('thermicdamageportion'),
};
const baseSdpsTooltip = objToTooltip(
translate,
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
);
const bySys = oppShield.absolute.bySys; let totalSEps = 0;
const shieldResEfts = mergeWith( let totalSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
clone(weaponPortions), let shieldsSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
shieldMults, let armourSDpsObject = { 'absolute': 0, 'explosive': 0, 'kinetic': 0, 'thermal': 0 };
(objV, srcV) => objV * srcV
);
const byShieldRes = sum(values(shieldResEfts));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(
shieldResEfts,
(mult) => formats.f1(byRange * mult * bySys * sdps),
),
);
const shieldsEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byShieldRes),
'power distributor': formats.pct1(bySys),
},
);
const shieldEft = byRange * byShieldRes * bySys;
const byHardness = weapon.getArmourEffectiveness(); const rows = [];
const armourResEfts = mergeWith( for (let i = 0; i < damage.length; i++) {
clone(weaponPortions), const weapon = damage[i];
armourMults,
(objV, srcV) => objV * srcV,
);
const byArmourRes = sum(values(armourResEfts));
const armourSdpsTooltip = objToTooltip(
translate,
mapValues(
armourResEfts,
(mult) => formats.f1(byRange * mult * byHardness * sdps)
),
);
const armourEftTooltip = objToTooltip(
translate,
{
range: formats.pct1(byRange),
resistance: formats.pct1(byArmourRes),
hardness: formats.pct1(byHardness),
},
);
const armourEft = byRange * byArmourRes * byHardness;
const bp = weapon.getBlueprint(); totalSEps += weapon.seps;
const grade = weapon.getBlueprintGrade(); addSDps(totalSDpsObject, weapon.sdps.base);
const exp = weapon.getExperimental(); addSDps(shieldsSDpsObject, weapon.sdps.shields);
let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`; addSDps(armourSDpsObject, weapon.sdps.armour);
if (exp) {
bpTitle += `, ${translate(exp)}`;
}
return {
slot: weapon.getSlot(),
mount: weapon.mount,
classRating: weapon.getClassRating(),
type: weapon.readMeta('type'),
bpTitle: bp ? ` (${bpTitle})` : null,
sdps,
baseSdpsTooltip,
shieldSdps: sdps * shieldEft,
shieldEft,
shieldsSdpsTooltip,
shieldsEftTooltip,
armourSdps: sdps * armourEft,
armourEft,
armourSdpsTooltip,
armourEftTooltip,
};
});
const { predicate, desc } = this.state; const baseSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.base);
rows = sortBy(rows, (row) => row[predicate]);
if (desc) { const effectivenessShieldsTooltipDetails = [];
reverse(rows); effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>);
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>);
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>);
const effectiveShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
const effectivenessArmourTooltipDetails = [];
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>);
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>);
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>);
const effectiveArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, weapon.sdps.armour);
rows.push(
<tr key={weapon.id}>
<td className='ri'>
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{weapon.classRating} {translate(weapon.name)}
{weapon.engineering ? ' (' + weapon.engineering + ')' : null }
</td>
<td className='ri'><span onMouseOver={termtip.bind(null, baseSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.base.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.shields.dpe)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
<td className='ri'><span>{formats.f1(weapon.effectiveness.armour.dpe)}</span></td>
</tr>);
} }
const sdpsTooltip = objToTooltip( const totalSDps = sumSDps(totalSDpsObject);
translate, const totalSDpsTooltipDetails = getSDpsTooltip(translate, formats, totalSDpsObject);
mapValues(portions, (p) => formats.f1(sustained.dps * p)), const totalSDpsData = getSDpsData(translate, totalSDpsObject);
);
const sdpsPie = objToPie(
translate,
mapValues(portions, (p) => Math.round(sustained.dps * p)),
);
const shieldSdpsSrcs = mergeWith( const totalShieldsSDps = sumSDps(shieldsSDpsObject);
clone(portions), const totalShieldsSDpsTooltipDetails = getSDpsTooltip(translate, formats, shieldsSDpsObject);
shieldMults, const shieldsSDpsData = getSDpsData(translate, shieldsSDpsObject);
(objV, srcV) => sustained.dps * oppShield.absolute.bySys *
rangeMultiplier * objV * srcV,
);
const shieldsSdps = sum(values(shieldSdpsSrcs));
const shieldsSdpsTooltip = objToTooltip(
translate,
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
);
const shieldsSdpsPie = objToPie(
translate,
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
);
const armourSdpsSrcs = mergeWith( const totalArmourSDps = sumSDps(armourSDpsObject);
clone(portions), const totalArmourSDpsTooltipDetails = getSDpsTooltip(translate, formats, armourSDpsObject);
armourMults, const armourSDpsData = getSDpsData(translate, armourSDpsObject);
(objV, srcV) => sustained.dps * hardnessMultiplier * rangeMultiplier *
objV * srcV,
);
const armourSdps = sum(values(armourSdpsSrcs));
const totalArmourSDpsTooltipDetails = objToTooltip(
translate,
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
);
const armourSDpsData = objToPie(
translate,
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
);
const drainedPortions = { const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
Absolute: drained.types.abs, const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
Explosive: drained.types.expl,
Kinetic: drained.types.kin,
Thermic: drained.types.therm,
};
// How much damage do we deal, before the capacitor is empty?
const armourLeft = oppArmour.armour - (timeToDrain * armourSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteArmour;
if (armourLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
armourMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier *
hardnessMultiplier;
timeToDepleteArmour = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (armourLeft / effectiveDrainedDps);
} else {
timeToDepleteArmour = oppArmour.armour / armourSdps;
}
// How much damage do we deal, before the capacitor is empty?
const shieldsLeft = oppShield.withSCBs - (timeToDrain * shieldsSdps);
// If we can't kill the enemy on one capacitor, factor in drained damage
let timeToDepleteShields;
if (shieldsLeft > 0) {
const effectiveDrainedDps = sum(values(mergeWith(
clone(drainedPortions),
shieldMults,
(objV, srcV) => objV * srcV,
))) * drained.dps * rangeMultiplier;
timeToDepleteShields = effectiveDrainedDps === 0 ? Infinity :
timeToDrain + (shieldsLeft / effectiveDrainedDps);
} else {
timeToDepleteShields = oppShield.withSCBs / shieldsSdps;
}
return ( return (
<span id='offence'> <span id='offence'>
@@ -289,75 +274,34 @@ export default class Offence extends TranslatedComponent {
<table> <table>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th> <th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th>
<th colSpan='1'>{translate('overall')}</th> <th colSpan='1'>{translate('overall')}</th>
<th colSpan='3'>{translate('opponent\'s shields')}</th> <th colSpan='3'>{translate('opponent\'s shields')}</th>
<th colSpan='3'>{translate('opponent\'s armour')}</th> <th colSpan='3'>{translate('opponent\'s armour')}</th>
</tr> </tr>
<tr> <tr>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th>
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th> <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} <th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th>
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} <th className='sortable'>{'dpe'}</th>
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} <th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th>
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th> <th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th>
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th> <th className='sortable'>{'dpe'}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
{rows.map((row) => ( {rows}
<tr key={row.slot}>
<td className='ri'>
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
{row.classRating} {translate(row.type)}
{row.bpTitle}
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.sdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.shieldSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.shieldEft)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.f1(row.armourSdps)}</span></td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
onMouseOut={tooltip.bind(null, null)}
>{formats.pct1(row.armourEft)}</span></td>
</tr>
))}
{rows.length > 0 && {rows.length > 0 &&
<tr> <tr>
<td></td> <td></td>
<td className='ri'> <td className='ri'><span onMouseOver={termtip.bind(null, totalSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalSDps)}</span></td>
<span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}> <td className='ri'><span onMouseOver={termtip.bind(null, totalShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalShieldsSDps)}</span></td>
={formats.f1(sustained.dps)}
</span>
</td>
<td className='ri'>
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
={formats.f1(shieldsSdps)}
</span>
</td>
<td></td> <td></td>
<td className='ri'> <td></td>
<span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}> <td className='ri'><span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>={formats.f1(totalArmourSDps)}</span></td>
={formats.f1(armourSdps)}
</span>
</td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
@@ -367,51 +311,22 @@ export default class Offence extends TranslatedComponent {
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2>{translate('offence metrics')}</h2> <h2>{translate('offence metrics')}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2>
onMouseOut={tooltip.bind(null, null)}> <h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2>
{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2>
{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)} <h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2>
</h2> <h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
{formats.f1(shieldsSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
{formats.f1(armourSdps)}
</h2>
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
onMouseOut={tooltip.bind(null, null)}>
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}
</h2>
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} <h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('overall damage')}</h2>
onMouseOut={tooltip.bind(null, null)}> <PieChart data={totalSDpsData} />
{translate('overall damage')}
</h2>
<PieChart data={sdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} <h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2>
onMouseOut={tooltip.bind(null, null)}> <PieChart data={shieldsSDpsData} />
{translate('shield damage sources')}
</h2>
<PieChart data={shieldsSdpsPie} />
</div> </div>
<div className='group quarter'> <div className='group quarter'>
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} <h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2>
onMouseOut={tooltip.bind(null, null)}>
{translate('armour damage sources')}
</h2>
<PieChart data={armourSDpsData} /> <PieChart data={armourSDpsData} />
</div> </div>
</span>); </span>);

View File

@@ -11,24 +11,29 @@ import Movement from './Movement';
import Offence from './Offence'; import Offence from './Offence';
import Defence from './Defence'; import Defence from './Defence';
import WeaponDamageChart from './WeaponDamageChart'; import WeaponDamageChart from './WeaponDamageChart';
import Pips from '../components/Pips';
import Boost from '../components/Boost';
import Fuel from '../components/Fuel';
import Cargo from '../components/Cargo';
import ShipPicker from '../components/ShipPicker';
import EngagementRange from '../components/EngagementRange';
import autoBind from 'auto-bind';
import { ShipProps } from 'ed-forge';
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
/** /**
* Outfitting subpages * Outfitting subpages
*/ */
export default class OutfittingSubpages extends TranslatedComponent { export default class OutfittingSubpages extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired,
buildName: PropTypes.string, buildName: PropTypes.string,
sys: PropTypes.number.isRequired,
eng: PropTypes.number.isRequired,
wep: PropTypes.number.isRequired,
cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
boost: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired,
opponent: PropTypes.object.isRequired,
opponentBuild: PropTypes.string,
opponentSys: PropTypes.number.isRequired,
opponentEng: PropTypes.number.isRequired,
opponentWep: PropTypes.number.isRequired,
}; };
/** /**
@@ -37,17 +42,13 @@ export default class OutfittingSubpages extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this); this._powerTab = this._powerTab.bind(this);
this._profilesTab = this._profilesTab.bind(this);
this._offenceTab = this._offenceTab.bind(this);
this._defenceTab = this._defenceTab.bind(this);
this.props.ship.setOpponent(this.props.ship);
this.state = { this.state = {
boost: false,
cargo: props.ship.get(CARGO_CAPACITY),
fuel: props.ship.get(FUEL_CAPACITY),
pips: props.ship.getDistributorSettingsObject(),
tab: Persist.getOutfittingTab() || 'power', tab: Persist.getOutfittingTab() || 'power',
engagementRange: 1000,
opponent: this.props.ship,
}; };
} }
@@ -56,113 +57,128 @@ export default class OutfittingSubpages extends TranslatedComponent {
* @param {string} tab Tab name * @param {string} tab Tab name
*/ */
_showTab(tab) { _showTab(tab) {
Persist.setOutfittingTab(tab);
this.setState({ tab }); this.setState({ tab });
} }
/**
* Render the power tab
* @return {React.Component} Tab contents
*/
_powerTab() {
let { ship, buildName, code, onChange } = this.props;
Persist.setOutfittingTab('power');
const powerMarker = `${ship.toString()}`;
const costMarker = `${ship.toString().split('.')[0]}`;
return <div>
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
<CostSection ship={ship} buildName={buildName} code={costMarker} />
</div>;
}
/**
* Render the profiles tab
* @return {React.Component} Tab contents
*/
_profilesTab() {
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
const { translate } = this.context.language;
let realBoost = boost && ship.canBoost(cargo, fuel);
Persist.setOutfittingTab('profiles');
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
return <div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
</div>
</div>;
}
/**
* Render the offence tab
* @return {React.Component} Tab contents
*/
_offenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
Persist.setOutfittingTab('offence');
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
return <div>
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
</div>;
}
/**
* Render the defence tab
* @return {React.Component} Tab contents
*/
_defenceTab() {
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
Persist.setOutfittingTab('defence');
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
return <div>
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
</div>;
}
/** /**
* Render the section * Render the section
* @return {React.Component} Contents * @return {React.Component} Contents
*/ */
render() { render() {
const { buildName, code, ship } = this.props; const tab = this.state.tab;
const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state; const translate = this.context.language.translate;
const { translate } = this.context.language; let tabSection;
switch (tab) {
case 'power': tabSection = this._powerTab(); break;
case 'profiles': tabSection = this._profilesTab(); break;
case 'offence': tabSection = this._offenceTab(); break;
case 'defence': tabSection = this._defenceTab(); break;
}
const cargoCapacity = ship.get(CARGO_CAPACITY);
const showCargoSlider = cargoCapacity > 0;
return ( return (
<div> <div className='group full' style={{ minHeight: '1000px' }}>
{/* Control of ship and opponent */} <table className='tabs'>
<div className="group quarter"> <thead>
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}> <tr>
{translate('ship control')} <th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th>
</h2> <th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th>
<Boost boost={boost} onChange={(boost) => this.setState({ boost })} /> <th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th>
</div> <th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('tab_defence')}</th>
<div className="group quarter"> </tr>
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}> </thead>
{translate('opponent')} </table>
</h2> {tabSection}
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
</div>
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
onChange={(fuel) => this.setState({ fuel })} />
</div>
{showCargoSlider ?
<div className="group quarter">
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
onChange={(cargo) => this.setState({ cargo })} />
</div> : null}
<div className="group half">
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
</div>
<div className="group half">
<EngagementRange ship={ship} engagementRange={engagementRange}
onChange={(engagementRange) => this.setState({ engagementRange })} />
</div>
<div className='group full' style={{ minHeight: '1000px' }}>
<table className='tabs'>
{/* Select tab section */}
<thead>
<tr>
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
onClick={this._showTab.bind(this, 'power')}>
{translate('power and costs')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
onClick={this._showTab.bind(this, 'profiles')}>
{translate('profiles')}</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
onClick={this._showTab.bind(this, 'offence')}>
{translate('offence')}
</th>
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
onClick={this._showTab.bind(this, 'defence')}>
{translate('tab_defence')}
</th>
</tr>
</thead>
</table>
{/* Show selected tab */}
{tab == 'power' ?
<div>
<PowerManagement ship={ship} code={code} />
<CostSection ship={ship} buildName={buildName} code={code} />
</div> : null}
{tab == 'profiles' ?
<div>
<div className='group third'>
<h1>{translate('engine profile')}</h1>
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
</div>
<div className='group third'>
<h1>{translate('fsd profile')}</h1>
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
</div>
<div className='group third'>
<h1>{translate('movement profile')}</h1>
<Movement code={code} ship={ship} boost={boost} pips={pips} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s shields')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
</div>
<div className='group half'>
<h1>{translate('damage to opponent\'s hull')}</h1>
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
</div>
</div> : null}
{tab == 'offence' ?
<div>
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
{tab == 'defence' ?
<div>
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
</div> : null}
</div>
</div> </div>
); );
} }

View File

@@ -1,91 +1,92 @@
import React, { Component } from 'react'; import React, { Component } from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import * as d3 from 'd3'; import * as d3 from 'd3';
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D']; const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
const LABEL_COLOUR = '#000000'; const LABEL_COLOUR = '#000000';
/** /**
* A pie chart * A pie chart
*/ */
export default class PieChart extends Component { export default class PieChart extends Component {
static propTypes = {
data : PropTypes.array.isRequired static propTypes = {
}; data : PropTypes.array.isRequired
};
/**
* Constructor /**
* @param {Object} props React Component properties * Constructor
* @param {Object} context React Component context * @param {Object} props React Component properties
*/ * @param {Object} context React Component context
constructor(props, context) { */
super(props); constructor(props, context) {
super(props);
this.pie = d3.pie().value((d) => d.value);
this.colors = CORIOLIS_COLOURS; this.pie = d3.pie().value((d) => d.value);
this.arc = d3.arc(); this.colors = CORIOLIS_COLOURS;
this.arc.innerRadius(0); this.arc = d3.arc();
} this.arc.innerRadius(0);
}
/**
* Generate a slice of the pie chart /**
* @param {Object} d the data for this slice * Generate a slice of the pie chart
* @param {number} i the index of this slice * @param {Object} d the data for this slice
* @param {number} width the current width of the parent container * @param {number} i the index of this slice
* @returns {Object} the SVG for the slice * @param {number} width the current width of the parent container
*/ * @returns {Object} the SVG for the slice
sliceGenerator(d, i, width) { */
if (!d || d.value == 0) { sliceGenerator(d, i, width) {
// Ignore 0 values if (!d || d.value == 0) {
return null; // Ignore 0 values
} return null;
}
const { data } = this.props;
const { data } = this.props;
// Push the labels further out from the centre of the slice
let [labelX, labelY] = this.arc.centroid(d); // Push the labels further out from the centre of the slice
const labelTranslate = `translate(${labelX * 1.5}, ${labelY * 1.5})`; let [labelX, labelY] = this.arc.centroid(d);
const labelTranslate = `translate(${labelX * 1.5}, ${labelY * 1.5})`;
// Put the keys in a line with equal spacing
const nonZeroItems = data.filter(d => d.value != 0).length; // Put the keys in a line with equal spacing
const thisItemIndex = data.slice(0, i + 1).filter(d => d.value != 0).length - 1; const nonZeroItems = data.filter(d => d.value != 0).length;
const keyX = -width / 2 + (width / nonZeroItems) * (thisItemIndex + 0.5); const thisItemIndex = data.slice(0, i + 1).filter(d => d.value != 0).length - 1;
const keyTranslate = `translate(${keyX}, ${width * 0.45})`; const keyX = -width / 2 + (width / nonZeroItems) * (thisItemIndex + 0.5);
const keyTranslate = `translate(${keyX}, ${width * 0.45})`;
return (
<g key={`group-${i}`}> return (
<path key={`arc-${i}`} d={this.arc(d)} style={{ fill: this.colors[i] }} /> <g key={`group-${i}`}>
<text key={`label-${i}`} transform={labelTranslate} style={{ strokeWidth: '0px', fill: LABEL_COLOUR }} textAnchor='middle'>{d.value}</text> <path key={`arc-${i}`} d={this.arc(d)} style={{ fill: this.colors[i] }} />
<text key={`key-${i}`} transform={keyTranslate} style={{ strokeWidth:'0px', fill: this.colors[i] }} textAnchor='middle'>{d.data.label}</text> <text key={`label-${i}`} transform={labelTranslate} style={{ strokeWidth: '0px', fill: LABEL_COLOUR }} textAnchor='middle'>{d.value}</text>
</g> <text key={`key-${i}`} transform={keyTranslate} style={{ strokeWidth:'0px', fill: this.colors[i] }} textAnchor='middle'>{d.data.label}</text>
); </g>
} );
}
/**
* Render the component /**
* @returns {object} Markup * Render the component
*/ * @returns {object} Markup
render() { */
return ( render() {
<ContainerDimensions> return (
{ ({ width }) => { <ContainerDimensions>
const pie = this.pie(this.props.data), { ({ width }) => {
translate = `translate(${width / 2}, ${width * 0.4})`; const pie = this.pie(this.props.data),
translate = `translate(${width / 2}, ${width * 0.4})`;
this.arc.outerRadius(width * 0.4);
return ( this.arc.outerRadius(width * 0.4);
<div width={width} height={width}> return (
<svg style={{ stroke: 'None' }} width={width} height={width * 0.9}> <div width={width} height={width}>
<g transform={translate}> <svg style={{ stroke: 'None' }} width={width} height={width * 0.9}>
{pie.map((d, i) => this.sliceGenerator(d, i, width))} <g transform={translate}>
</g> {pie.map((d, i) => this.sliceGenerator(d, i, width))}
</svg> </g>
</div> </svg>
); </div>
}} );
</ContainerDimensions> }}
); </ContainerDimensions>
} );
} }
}

View File

@@ -2,8 +2,7 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Pip } from './SvgIcons'; import { Pip } from './SvgIcons';
import { autoBind } from 'react-extras'; import autoBind from 'auto-bind';
import { Ship } from 'ed-forge';
/** /**
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area. * Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
@@ -11,9 +10,13 @@ import { Ship } from 'ed-forge';
*/ */
export default class Pips extends TranslatedComponent { export default class Pips extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.instanceOf(Ship).isRequired, sys: PropTypes.number.isRequired,
pips: PropTypes.object.isRequired, eng: PropTypes.number.isRequired,
onChange: PropTypes.func.isRequired, wep: PropTypes.number.isRequired,
mcSys: PropTypes.number.isRequired,
mcEng: PropTypes.number.isRequired,
mcWep: PropTypes.number.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -24,12 +27,6 @@ export default class Pips extends TranslatedComponent {
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this); autoBind(this);
const { ship } = props;
this._incSys = this._change(ship.incSys);
this._incEng = this._change(ship.incEng);
this._incWep = this._change(ship.incWep);
this._reset = this._change(ship.pipsReset);
} }
/** /**
@@ -74,42 +71,153 @@ export default class Pips extends TranslatedComponent {
} }
/** /**
* Creates a function that handles pip assignment and call `onChance`. * Reset the capacitor
* @param {String} cb Callback that handles the actual pip assignment
* @param {Boolean} isMc True when increase is by multi crew
* @returns {Function} Function that handles pip assigment
*/ */
_change(cb, isMc) { _reset(isMc) {
return () => { let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
cb(isMc); if (isMc) {
this.props.onChange(this.props.ship.getDistributorSettingsObject()); if (mcSys || mcEng || mcWep) {
sys -= mcSys;
eng -= mcEng;
wep -= mcWep;
this.props.onChange(sys, eng, wep, 0, 0, 0);
}
} else if (sys != 2 || eng != 2 || wep != 2) {
sys = eng = wep = 2;
this.props.onChange(sys + mcSys, eng + mcEng, wep + mcWep, mcSys, mcEng, mcWep);
}
}
/**
* Increment the SYS capacitor
*/
_incSys() {
this._inc('sys', false);
}
/**
* Increment the ENG capacitor
*/
_incEng() {
this._inc('eng', false);
}
/**
* Increment the WEP capacitor
*/
_incWep() {
this._inc('wep', false);
}
_wrapMcClick(key) {
return (event) => {
event.stopPropagation();
event.preventDefault();
if (key == 'rst') {
this._reset(true);
} else {
this._inc(key, true);
}
}; };
} }
/**
* Increases a given capacitor
* @param {String} key Pip name to increase (one of 'sys', 'eng', 'wep')
* @param {Boolean} isMc True when increase is by multi crew
*/
_inc(key, isMc) {
if (!['sys', 'eng', 'wep'].includes(key)) {
return;
}
let { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
let mc = key == 'sys' ? mcSys : (key == 'eng' ? mcEng : mcWep);
let pips = this.props[key] - mc;
let other1 = key == 'sys' ? eng - mcEng : sys - mcSys;
let other2 = key == 'wep' ? eng - mcEng : wep - mcWep;
const required = Math.min(1, 4 - mc - pips);
if (isMc) {
// We can only set full pips in multi-crew also we can only set two pips
if (required > 0.5 && mcSys + mcEng + mcWep < 2) {
if (key == 'sys') {
mcSys += 1;
} else if (key == 'eng') {
mcEng += 1;
} else {
mcWep += 1;
}
}
} else if (required > 0) {
if (required == 0.5) {
// Take from whichever is larger
if (other1 > other2) {
other1 -= 0.5;
} else {
other2 -= 0.5;
}
pips += 0.5;
} else {
// Required is 1 - take from both if possible
if (other1 == 0) {
other2 -= 1;
} else if (other2 == 0) {
other1 -= 1;
} else {
other1 -= 0.5;
other2 -= 0.5;
}
pips += 1;
}
}
sys = mcSys + (key == 'sys' ? pips : other1);
eng = mcEng + (key == 'eng' ? pips : (key == 'sys' ? other1 : other2));
wep = mcWep + (key == 'wep' ? pips : other2);
this.props.onChange(sys, eng, wep, mcSys, mcEng, mcWep);
}
/** /**
* Set up the rendering for pips * Set up the rendering for pips
* @param {Number} sys the SYS pips
* @param {Number} eng the ENG pips
* @param {Number} wep the WEP pips
* @param {Number} mcSys SYS pips from multi-crew
* @param {Number} mcEng ENG pips from multi-crew
* @param {Number} mcWep WEP pips from multi-crew
* @returns {Object} Object containing the rendering for the pips * @returns {Object} Object containing the rendering for the pips
*/ */
_renderPips() { _renderPips(sys, eng, wep, mcSys, mcEng, mcWep) {
const pipsSvg = { const pipsSvg = {
Sys: [], SYS: [],
Eng: [], ENG: [],
Wep: [], WEP: [],
}; };
for (let k in this.props.pips) { // Multi-crew pipsSettings actually are included in the overall pip count therefore
let { base, mc } = this.props.pips[k]; // we can consider [0, sys - mcSys] as normal pipsSettings whilst [sys - mcSys, sys]
for (let i = 0; i < Math.floor(base); i++) { // are the multi-crew pipsSettings in what follows.
pipsSvg[k].push(<Pip key={i} className='full' />);
let pipsSettings = {
SYS: [sys, mcSys],
ENG: [eng, mcEng],
WEP: [wep, mcWep],
};
for (let pipName in pipsSettings) {
let [pips, mcPips] = pipsSettings[pipName];
for (let i = 0; i < Math.floor(pips - mcPips); i++) {
pipsSvg[pipName].push(<Pip key={i} className='full' />);
} }
if (base > Math.floor(base)) { if (pips > Math.floor(pips)) {
pipsSvg[k].push(<Pip className='half' key={'half'} />); pipsSvg[pipName].push(<Pip className='half' key={'half'} />);
} }
for (let i = 0; i < mc; i++) { for (let i = pips - mcPips; i < Math.floor(pips); i++) {
pipsSvg[k].push(<Pip key={base + i} className='mc' />); pipsSvg[pipName].push(<Pip key={i} className='mc' />);
} }
for (let i = Math.ceil(base + mc); i < 4; i++) { for (let i = Math.floor(pips + 0.5); i < 4; i++) {
pipsSvg[k].push(<Pip className='empty' key={i} />); pipsSvg[pipName].push(<Pip className='empty' key={i} />);
} }
} }
@@ -121,10 +229,11 @@ export default class Pips extends TranslatedComponent {
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { ship } = this.props; const { tooltip, termtip } = this.context;
const { translate } = this.context.language; const { formats, translate, units } = this.context.language;
const { sys, eng, wep, mcSys, mcEng, mcWep } = this.props;
const pipsSvg = this._renderPips(); const pipsSvg = this._renderPips(sys, eng, wep, mcSys, mcEng, mcWep);
return ( return (
<span id='pips'> <span id='pips'>
<table> <table>
@@ -132,40 +241,38 @@ export default class Pips extends TranslatedComponent {
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td> <td className='clickable' onClick={() => this._inc('eng')}
onContextMenu={this._wrapMcClick('eng')}>{pipsSvg['ENG']}</td>
<td>&nbsp;</td> <td>&nbsp;</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td> <td className='clickable' onClick={this._incSys}
<td className='clickable' onClick={this._incEng}> onContextMenu={this._wrapMcClick('sys')}>{pipsSvg['SYS']}</td>
{translate('ENG')} <td className='clickable' onClick={this._incEng}
</td> onContextMenu={this._wrapMcClick('eng')}>{translate('ENG')}</td>
<td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td> <td className='clickable' onClick={this._incWep}
onContextMenu={this._wrapMcClick('wep')}>{pipsSvg['WEP']}</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._incSys}> <td className='clickable' onClick={this._incSys}
{translate('SYS')} onContextMenu={this._wrapMcClick('sys')}>{translate('SYS')}</td>
</td> <td className='clickable' onClick={this._reset.bind(this, false)}>
<td className='clickable' onClick={this._reset}>
{translate('RST')} {translate('RST')}
</td> </td>
<td className='clickable' onClick={this._incWep}> <td className='clickable' onClick={this._incWep}
{translate('WEP')} onContextMenu={this._wrapMcClick('wep')}>{translate('WEP')}</td>
</td>
</tr> </tr>
<tr> <tr>
<td>&nbsp;</td> <td>&nbsp;</td>
<td className='clickable' onClick={this._change(ship.incSys, true)}> <td>&nbsp;</td>
<Pip className='mc' /> <td className='clickable secondary' onClick={this._wrapMcClick('rst')}
</td> onMouseEnter={termtip.bind(null, 'PHRASE_MULTI_CREW_CAPACITOR_POINTS')}
<td className='clickable' onClick={this._change(ship.incEng, true)}> onMouseLeave={tooltip.bind(null, null)}>
<Pip className='mc' /> {translate('RST')}
</td>
<td className='clickable' onClick={this._change(ship.incWep, true)}>
<Pip className='mc' />
</td> </td>
<td>&nbsp;</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -4,25 +4,27 @@ import * as d3 from 'd3';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { Ship } from 'ed-forge';
import { POWER_METRICS } from 'ed-forge/lib/src/ship-stats';
import autoBind from 'auto-bind';
/** /**
* Get the band-class. * Round to avoid floating point precision errors
* @param {Boolean} selected Band selected * @param {Boolean} selected Band selected
* @param {Number} relDraw Relative amount of power drawn by this band and * @param {number} sum Band power sum
* all prior * @param {number} avail Total available power
* @return {string} CSS Class name * @return {string} CSS Class name
*/ */
function getClass(selected, relDraw) { function getClass(selected, sum, avail) {
if (selected) { return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary';
return 'secondary'; }
} else if (relDraw >= 1) {
return 'warning'; /**
} else { * Get the # label for a Priority band
return 'primary'; * @param {number} val Priority Band Watt value
} * @param {number} index Priority Band index
* @param {Function} wattScale Watt Scale function
* @return {number} label / text
*/
function bandText(val, index, wattScale) {
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
} }
/** /**
@@ -31,9 +33,10 @@ function getClass(selected, relDraw) {
*/ */
export default class PowerBands extends TranslatedComponent { export default class PowerBands extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.instanceOf(Ship).isRequired, bands: PropTypes.array.isRequired,
code: PropTypes.string.isRequired, available: PropTypes.number.isRequired,
width: PropTypes.number.isRequired, width: PropTypes.number.isRequired,
code: PropTypes.string,
}; };
/** /**
@@ -43,16 +46,20 @@ export default class PowerBands extends TranslatedComponent {
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
autoBind(this);
this.wattScale = d3.scaleLinear(); this.wattScale = d3.scaleLinear();
this.pctScale = d3.scaleLinear().domain([0, 1]); this.pctScale = d3.scaleLinear().domain([0, 1]);
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2); this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct); this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
this._updateDimensions = this._updateDimensions.bind(this);
this._updateScales = this._updateScales.bind(this);
this._selectNone = this._selectNone.bind(this);
this._hidetip = () => this.context.tooltip(); this._hidetip = () => this.context.tooltip();
this.profile = props.ship.getMetrics(POWER_METRICS); let maxBand = props.bands[props.bands.length - 1];
this.state = { this.state = {
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
ret: {}, ret: {},
dep: {} dep: {}
}; };
@@ -76,6 +83,8 @@ export default class PowerBands extends TranslatedComponent {
let mRight = Math.round(140 * scale); let mRight = Math.round(140 * scale);
let innerWidth = props.width - mLeft - mRight; let innerWidth = props.width - mLeft - mRight;
this._updateScales(innerWidth, this.state.maxPwr, props.available);
this.setState({ this.setState({
barHeight, barHeight,
innerHeight, innerHeight,
@@ -131,67 +140,41 @@ export default class PowerBands extends TranslatedComponent {
this.setState({ dep: Object.assign({}, dep) }); this.setState({ dep: Object.assign({}, dep) });
} }
/**
* Update scale
* @param {number} innerWidth SVG innerwidth
* @param {number} maxPwr Maximum power level MJ (deployed or available)
* @param {number} available Available power MJ
*/
_updateScales(innerWidth, maxPwr, available) {
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
}
/** /**
* Update state based on property and context changes * Update state based on property and context changes
* @param {Object} nextProps Incoming/Next properties * @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next context * @param {Object} nextContext Incoming/Next context
*/ */
componentWillReceiveProps(nextProps, nextContext) { componentWillReceiveProps(nextProps, nextContext) {
let { innerWidth, maxPwr } = this.state;
let { language, sizeRatio } = this.context; let { language, sizeRatio } = this.context;
let maxBand = nextProps.bands[nextProps.bands.length - 1];
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
if (language !== nextContext.language) { if (language !== nextContext.language) {
this.wattAxis.tickFormat(nextContext.language.formats.r2); this.wattAxis.tickFormat(nextContext.language.formats.r2);
this.pctAxis.tickFormat(nextContext.language.formats.rPct); this.pctAxis.tickFormat(nextContext.language.formats.rPct);
} }
if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) { if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
this.setState({ maxPwr: nextMaxPwr });
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
this._updateDimensions(nextProps, nextContext.sizeRatio); this._updateDimensions(nextProps, nextContext.sizeRatio);
} }
} }
/**
* Assemble bands for relative consumption array.
* @param {Number[]} consumed Array of relative-consumption numbers
* @param {object} selected Object mapping selected bands to 1
* @param {Number} yOffset Offset in y-direction of the bar
* @param {Function} onClick onClick callback
* @returns {React.Component} Bands
*/
_consumedToBands(consumed, selected, yOffset, onClick) {
const { state, wattScale } = this;
const bands = [];
let consumesPrev = 0;
for (let i = 0; i < consumed.length; i++) {
consumesPrev = consumed[i - 1] || consumesPrev;
const consumes = consumed[i];
if (!consumes) {
continue;
}
bands.push(<rect
key={'b' + i}
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
height={state.barHeight}
x={wattScale(consumesPrev)}
y={yOffset + 1}
onClick={onClick.bind(this, i)}
className={getClass(selected[i], consumes)}
/>);
bands.push(<text
key={'t' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
y={yOffset + (state.barHeight / 2)}
onClick={onClick.bind(this, i)}
className='primary-bg'>{i + 1}</text>
);
}
return bands;
}
/** /**
* Render the power bands * Render the power bands
* @return {React.Component} Power bands * @return {React.Component} Power bands
@@ -201,27 +184,78 @@ export default class PowerBands extends TranslatedComponent {
return null; return null;
} }
let { pctScale, context, props, state } = this; let { wattScale, pctScale, context, props, state } = this;
let { translate, formats } = context.language; let { translate, formats } = context.language;
let { f2, pct1 } = formats; // wattFmt, pctFmt let { f2, pct1 } = formats; // wattFmt, pctFmt
let { ship } = props; let { available, bands } = props;
let { innerWidth, ret, dep, barHeight } = state; let { innerWidth, ret, dep } = state;
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
let { let deployed = [];
consumed, generated, relativeConsumed, relativeConsumedRetracted let retracted = [];
} = ship.getMetrics(POWER_METRICS);
let maxPwr = Math.max(consumed, generated);
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
let depSum = relativeConsumed[relativeConsumed.length - 1];
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
let retSelected = Object.keys(ret).length > 0; let retSelected = Object.keys(ret).length > 0;
let depSelected = Object.keys(dep).length > 0; let depSelected = Object.keys(dep).length > 0;
let retSum = 0;
let depSum = 0;
for (let i = 0; i < bands.length; i++) {
let b = bands[i];
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
if (b.retracted > 0) {
let retLbl = bandText(b.retracted, i, wattScale);
retracted.push(<rect
key={'rB' + i}
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
y={1}
onClick={this._selectRet.bind(this, i)}
className={getClass(ret[i], b.retractedSum, available)}
/>);
if (retLbl) {
retracted.push(<text
key={'rT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
y={state.retY}
onClick={this._selectRet.bind(this, i)}
className='primary-bg'>{retLbl}</text>
);
}
}
if (b.retracted > 0 || b.deployed > 0) {
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
deployed.push(<rect
key={'dB' + i}
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
height={state.barHeight}
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
y={state.barHeight + 1}
onClick={this._selectDep.bind(this, i)}
className={getClass(dep[i], b.deployedSum, available)}
/>);
if (depLbl) {
deployed.push(<text
key={'dT' + i}
dy='0.5em'
textAnchor='middle'
height={state.barHeight}
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
y={state.depY}
onClick={this._selectDep.bind(this, i)}
className='primary-bg'>{depLbl}</text>
);
}
}
}
return ( return (
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}> <svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
@@ -237,8 +271,8 @@ export default class PowerBands extends TranslatedComponent {
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} /> <line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text> <text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text> <text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text>
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text> <text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text>
</g> </g>
</svg> </svg>
); );

View File

@@ -3,49 +3,24 @@ import PropTypes from 'prop-types';
import cn from 'classnames'; import cn from 'classnames';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import PowerBands from './PowerBands'; import PowerBands from './PowerBands';
import { slotName, slotComparator } from '../utils/SlotFunctions';
import { Power, NoPower } from './SvgIcons'; import { Power, NoPower } from './SvgIcons';
import autoBind from 'auto-bind';
import { Ship, Module } from 'ed-forge';
/** const POWER = [
* Makes a comparison based on the order `false < undefined < true` (fut) and null,
* maps it to `[-1, 0, 1]`. null,
* @param {boolean} a Bool or undefined <NoPower className='icon warning' />,
* @param {boolean} b Bool or undefined <Power className='secondary-disabled' />
* @returns {number} Comparison ];
*/
function futComp(a, b) {
switch (a) {
case false: return (b === false ? 0 : 1);
// The next else-expression maps false to -1 and true to 1
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
case true: return (b === true ? 0 : -1);
}
}
/**
* Get the enabled-icon.
* @param {boolean} enabled Is the module enabled?
* @returns {React.Component} Enabled icon.
*/
function getPowerIcon(enabled) {
if (enabled === undefined) {
return null;
}
if (enabled) {
return <Power className='secondary-disabled' />;
} else {
return <NoPower className='icon warning' />;
}
}
/** /**
* Power Management Section * Power Management Section
*/ */
export default class PowerManagement extends TranslatedComponent { export default class PowerManagement extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.instanceOf(Ship).isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
onChange: PropTypes.func.isRequired
}; };
/** /**
@@ -54,17 +29,19 @@ export default class PowerManagement extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this); this._renderPowerRows = this._renderPowerRows.bind(this);
this._updateWidth = this._updateWidth.bind(this);
this._sort = this._sort.bind(this);
this.state = { this.state = {
predicate: 'pwr', predicate: 'pwr',
desc: true, desc: false,
width: 0 width: 0
}; };
} }
/** /**
* Set the sort order * Set the sort order and sort
* @param {string} predicate Sort predicate * @param {string} predicate Sort predicate
*/ */
_sortOrder(predicate) { _sortOrder(predicate) {
@@ -76,51 +53,50 @@ export default class PowerManagement extends TranslatedComponent {
desc = true; desc = true;
} }
this._sort(this.props.ship, predicate, desc);
this.setState({ predicate, desc }); this.setState({ predicate, desc });
} }
/** /**
* Sorts the power list * Sorts the power list
* @param {Module[]} modules Modules to sort * @param {Ship} ship Ship instance
* @returns {Module[]} Sorted modules * @param {string} predicate Sort predicate
* @param {Boolean} desc Sort order descending
*/ */
_sortAndFilter(modules) { _sort(ship, predicate, desc) {
modules = modules.filter((m) => m.get('powerdraw') >= 0); let powerList = ship.powerList;
let { translate } = this.context.language; let comp = slotComparator.bind(null, this.context.language.translate);
const { predicate, desc } = this.state;
let comp;
switch (predicate) { switch (predicate) {
case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare( case 'n': comp = comp(null, desc); break;
translate(b.readMeta('type')) case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
); break; case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break;
// case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break; case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break;
case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break; case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break;
case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break; case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break;
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
} }
modules.sort(comp);
if (desc) { powerList.sort(comp);
modules.reverse();
}
return modules;
} }
/** /**
* Creates a callback that changes the power priority for the given module * Update slot priority
* based on the given delta. * @param {Object} slot Slot model
* @param {Module} m Module to set the priority for * @param {number} inc increment / decrement
* @param {Number} delta Delta to set
* @returns {Function} Callback
*/ */
_prioCb(m, delta) { _priority(slot, inc) {
return () => { if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) {
const prio = m.getPowerPriority(); this.props.onChange();
const newPrio = Math.max(0, prio + delta); }
if (0 <= newPrio) { }
m.setPowerPriority(newPrio);
} /**
}; * Toggle slot active/inactive
* @param {Object} slot Slot model
*/
_toggleEnabled(slot) {
this.props.ship.setSlotEnabled(slot, !slot.enabled);
this.props.onChange();
} }
/** /**
@@ -134,35 +110,36 @@ export default class PowerManagement extends TranslatedComponent {
_renderPowerRows(ship, translate, pwr, pct) { _renderPowerRows(ship, translate, pwr, pct) {
let powerRows = []; let powerRows = [];
let modules = this._sortAndFilter(ship.getModules()); for (let i = 0, l = ship.powerList.length; i < l; i++) {
for (let m of modules) { let slot = ship.powerList[i];
let retractedElem = null, deployedElem = null;
const flipEnabled = () => m.setEnabled();
if (m.isEnabled()) {
let powered = m.isPowered();
retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
} else {
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
}
const slot = m.getSlot(); if (slot.m && slot.m.getPowerUsage() > 0) {
powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}> let m = slot.m;
<td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td> let toggleEnabled = this._toggleEnabled.bind(this, slot);
<td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td> let retractedElem = null, deployedElem = null;
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
<td> if (slot.enabled) {
<span className='flip ptr btn' onClick={this._prioCb(m, -1)}>&#9658;</span> retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>;
{' ' + (m.getPowerPriority() + 1) + ' '} deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>;
<span className='ptr btn' onClick={this._prioCb(m, 1)}>&#9658;</span> } else {
</td> retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>;
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td> }
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u> powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}>
</td> <td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td>
{retractedElem} <td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td>
{deployedElem} <td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td>
</tr>); <td>
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>&#9658;</span>
{' ' + (slot.priority + 1) + ' '}
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>&#9658;</span>
</td>
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
{retractedElem}
{deployedElem}
</tr>);
}
} }
return powerRows; return powerRows;
} }
@@ -178,6 +155,7 @@ export default class PowerManagement extends TranslatedComponent {
* Add listeners when about to mount and sort power list * Add listeners when about to mount and sort power list
*/ */
componentWillMount() { componentWillMount() {
this._sort(this.props.ship, this.state.predicate, this.state.desc);
this.resizeListener = this.context.onWindowResize(this._updateWidth); this.resizeListener = this.context.onWindowResize(this._updateWidth);
} }
@@ -188,6 +166,17 @@ export default class PowerManagement extends TranslatedComponent {
this._updateWidth(); this._updateWidth();
} }
/**
* Sort power list if the ship instance has changed
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextState Incoming/Next state
*/
componentWillUpdate(nextProps, nextState) {
if (this.props.ship != nextProps.ship) {
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
}
}
/** /**
* Remove listeners on unmount * Remove listeners on unmount
*/ */
@@ -202,38 +191,39 @@ export default class PowerManagement extends TranslatedComponent {
render() { render() {
let { ship, code } = this.props; let { ship, code } = this.props;
let { translate, formats } = this.context.language; let { translate, formats } = this.context.language;
let pp = ship.getPowerPlant(); let pwr = formats.f2;
let pp = ship.standard[0].m;
let sortOrder = this._sortOrder;
return ( return (
<div ref={node => this.node = node} className='group half' id='componentPriority'> <div ref={node => this.node = node} className='group half' id='componentPriority'>
<table style={{ width: '100%' }}> <table style={{ width: '100%' }}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th> <th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th>
{/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */} <th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th>
<th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th> <th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th>
<th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th> <th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th> <th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th>
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th> <th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th>
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{String(pp.getClass()) + pp.getRating()}</td> <td>{pp.class + pp.rating}</td>
<td className='le shorten cap' >{translate('pp')}</td> <td className='le shorten cap' >{translate('pp')}</td>
<td><u >{translate('SYS')}</u></td>
<td>1</td> <td>1</td>
<td className='ri'>{formats.f2(pp.get('powercapacity'))}</td> <td className='ri'>{pwr(pp.getPowerGeneration())}</td>
<td className='ri'><u>100%</u></td> <td className='ri'><u>100%</u></td>
<td></td> <td></td>
<td></td> <td></td>
</tr> </tr>
<tr><td style={{ lineHeight:0 }} colSpan='8'> <tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr>
<hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /> {this._renderPowerRows(ship, translate, pwr, formats.pct1)}
</td></tr>
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
</tbody> </tbody>
</table> </table>
<PowerBands width={this.state.width} ship={ship} code={code} /> <PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} />
</div> </div>
); );
} }

View File

@@ -1,12 +1,10 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { Ships } from 'coriolis-data/dist';
import { Rocket } from './SvgIcons'; import { Rocket } from './SvgIcons';
import Persist from '../stores/Persist'; import Persist from '../stores/Persist';
import cn from 'classnames'; import cn from 'classnames';
import { Factory, Ship } from 'ed-forge';
import autoBind from 'auto-bind';
import { isEqual } from 'lodash';
/** /**
* Ship picker * Ship picker
@@ -15,49 +13,40 @@ import { isEqual } from 'lodash';
export default class ShipPicker extends TranslatedComponent { export default class ShipPicker extends TranslatedComponent {
static propTypes = { static propTypes = {
onChange: PropTypes.func.isRequired, onChange: PropTypes.func.isRequired,
ship: PropTypes.instanceOf(Ship).isRequired, ship: PropTypes.string.isRequired,
build: PropTypes.string
}; };
static defaultProps = {
ship: 'eagle'
}
/** /**
* constructor * constructor
* @param {object} props Properties react * @param {object} props Properties react
* @param {object} context react context * @param {object} context react context
*/ */
constructor(props, context) { constructor(props, context) { // eslint-disable-line
super(props); super(props);
autoBind(this);
this.state = { this.shipOrder = Object.keys(Ships).sort();
menuOpen: false, this._toggleMenu = this._toggleMenu.bind(this);
opponent: { this._closeMenu = this._closeMenu.bind(this);
self: true,
type: props.ship.getShipType(), this.state = { menuOpen: false };
stock: false,
id: undefined,
},
};
} }
/** /**
* Update ship * Update ship
* @param {boolean} self True to compare with ship itself * @param {object} ship the ship
* @param {object} type The ship type * @param {string} build the build, if present
* @param {boolean} stock True to compare with a stock version of given type
* @param {string} id The build's stored ID
*/ */
_shipChange(self, type, stock = false, id = null) { _shipChange(ship, build) {
const opponent = { self, type, stock, id }; this._closeMenu();
if (isEqual(opponent, this.state.opponent)) {
this.setState({ menuOpen: false }); // Ensure that the ship has changed
} else { if (ship !== this.props.ship || build !== this.props.build) {
const { onChange } = this.props; this.props.onChange(ship, build);
if (self) {
onChange(this.props.ship);
} else if (stock) {
onChange(Factory.newShip(type));
} else {
onChange(new Ship(Persist.getBuild(type, id)));
}
this.setState({ menuOpen: false, opponent });
} }
} }
@@ -66,41 +55,26 @@ export default class ShipPicker extends TranslatedComponent {
* @returns {object} the picker menu * @returns {object} the picker menu
*/ */
_renderPickerMenu() { _renderPickerMenu() {
const { menuOpen } = this.state; const { ship, build } = this.props;
if (!menuOpen) { const _shipChange = this._shipChange;
return null; const builds = Persist.getBuilds();
const buildList = [];
for (let shipId of this.shipOrder) {
const shipBuilds = [];
// Add stock build
const stockSelected = (ship == shipId && !build);
shipBuilds.push(<li key={shipId} className={ cn({ 'selected': stockSelected })} onClick={_shipChange.bind(this, shipId, null)}>Stock</li>);
if (builds[shipId]) {
let buildNameOrder = Object.keys(builds[shipId]).sort();
for (let buildName of buildNameOrder) {
const buildSelected = ship === shipId && build === buildName;
shipBuilds.push(<li key={shipId + '-' + buildName} className={ cn({ 'selected': buildSelected })} onClick={_shipChange.bind(this, shipId, buildName)}>{buildName}</li>);
}
}
buildList.push(<ul key={shipId} className='block'>{Ships[shipId].properties.name}{shipBuilds}</ul>);
} }
const { translate } = this.context.language; return buildList;
const { self, type, stock, id } = this.state.opponent;
return <div className='menu-list' onClick={(e) => e.stopPropagation()}>
<div className='quad'>
{Factory.getAllShipTypes().sort().map((shipType) =>
<ul key={shipType} className='block'>
{translate(shipType)}
{/* Add stock build */}
<li key={shipType}
onClick={this._shipChange.bind(this, false, shipType, true)}
className={cn({ selected: stock && type === shipType })}>
{translate('stock')}
</li>
{Persist.getBuildsNamesFor(shipType).sort().map((storedId) =>
<li key={`${shipType}-${storedId}`}
onClick={this._shipChange.bind(this, false, shipType, false, storedId)}
className={ cn({ selected: type === shipType && id === storedId })}>
{storedId}
</li>)}
{/* Add ship itself */}
{(this.props.ship.getShipType() === shipType ?
<li key='self'
onClick={this._shipChange.bind(this, true, shipType)}
className={cn({ selected: self })}>
{translate('THIS_SHIP')}
</li> :
null)}
</ul>)}
</div>
</div>;
} }
/** /**
@@ -111,35 +85,40 @@ export default class ShipPicker extends TranslatedComponent {
this.setState({ menuOpen: !menuOpen }); this.setState({ menuOpen: !menuOpen });
} }
/**
* Close the menu
*/
_closeMenu() {
const { menuOpen } = this.state;
if (menuOpen) {
this._toggleMenu();
}
}
/** /**
* Render picker * Render picker
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { translate } = this.context.language; const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { ship } = this.props; const { formats, translate, units } = language;
const { ship, build } = this.props;
const { menuOpen } = this.state; const { menuOpen } = this.state;
const { self, type, stock, id } = this.state.opponent;
let label;
if (self) {
label = translate('THIS_SHIP');
} else if (stock) {
label = translate('stock');
} else {
label = id;
}
const shipString = ship + ': ' + (build ? build : translate('stock'));
return ( return (
<div className='shippicker' onClick={ (e) => e.stopPropagation() }> <div className='shippicker' onClick={ (e) => e.stopPropagation() }>
<div className='menu'> <div className='menu'>
<div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}> <div className={cn('menu-header', { selected: menuOpen })} onClick={this._toggleMenu}>
<span><Rocket className='warning' /></span> <span><Rocket className='warning' /></span>
<span className='menu-item-label'> <span className='menu-item-label'>{shipString}</span>
{`${translate(type)}: ${label}`}
</span>
</div> </div>
{this._renderPickerMenu()} { menuOpen ?
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
<div className='quad'>
{this._renderPickerMenu()}
</div>
</div> : null }
</div> </div>
</div> </div>
); );

View File

@@ -1,25 +1,21 @@
import autoBind from 'auto-bind';
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { Warning } from './SvgIcons'; import { Warning } from './SvgIcons';
import * as Calc from '../shipyard/Calculations';
import { ShipProps } from 'ed-forge';
import { BOOST_INTERVAL, MINIMUM_MASS } from 'ed-forge/lib/src/ship-stats';
const {
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, LADEN_MASS,
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
} = ShipProps;
/** /**
* Ship Summary Table / Stats * Ship Summary Table / Stats
*/ */
export default class ShipSummaryTable extends TranslatedComponent { export default class ShipSummaryTable extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
code: PropTypes.string.isRequired, cargo: PropTypes.number.isRequired,
fuel: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired,
pips: PropTypes.object.isRequired
}; };
/** /**
@@ -28,7 +24,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this); this.didContextChange = this.didContextChange.bind(this);
this.state = { this.state = {
shieldColour: 'blue' shieldColour: 'blue'
}; };
@@ -39,53 +35,44 @@ export default class ShipSummaryTable extends TranslatedComponent {
* @return {React.Component} Summary table * @return {React.Component} Summary table
*/ */
render() { render() {
const { ship } = this.props; const { ship, cargo, fuel, pips } = this.props;
let { language, tooltip, termtip } = this.context; let { language, tooltip, termtip } = this.context;
let translate = language.translate; let translate = language.translate;
let u = language.units; let u = language.units;
let formats = language.formats; let formats = language.formats;
let { time, int, f1, f2 } = formats; let { time, int, round, f1, f2 } = formats;
let hide = tooltip.bind(null, null); let hide = tooltip.bind(null, null);
const shieldGenerator = ship.findInternalByGroup('sg') || ship.findInternalByGroup('psg');
const speed = ship.get(SPEED); const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator });
const shipBoost = ship.get(BOOST_SPEED);
const boostInterval = ship.get(BOOST_INTERVAL);
const canThrust = 0 < speed;
const canBoost = canThrust && !isNaN(shipBoost);
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const sgMetrics = ship.get(SHIELD_METRICS);
const armourMetrics = ship.get(ARMOUR_METRICS);
const damageMetrics = ship.get(DAMAGE_METRICS);
const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
const timeToDrain = damageMetrics.timeToDrain;
const shieldGenerator = ship.getShieldGenerator();
const sgClassNames = cn({
warning: shieldGenerator && !shieldGenerator.isEnabled(),
muted: !shieldGenerator,
});
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL'; const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined; const timeToDrain = Calc.timeToDrainWep(ship, 4);
const canThrust = ship.canThrust(cargo, ship.fuelCapacity);
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
const canJump = ship.getSlotStatus(ship.standard[2]) == 3;
const sgMetrics = Calc.shieldMetrics(ship, pips.sys);
const shipBoost = canBoost ? Calc.calcBoost(ship) : 'No Boost';
const restingHeat = Math.sqrt(((ship.standard[0].m.pgen * ship.standard[0].m.eff) / ship.heatCapacity) / 0.2);
const armourMetrics = Calc.armourMetrics(ship);
let shieldColour = 'blue'; let shieldColour = 'blue';
switch (sgType) { if (shieldGenerator && shieldGenerator.m.grp === 'psg') {
case 'biweaveshieldgen': shieldColour = 'purple'; break; shieldColour = 'green';
case 'prismaticshieldgen': shieldColour = 'green'; break; } else if (shieldGenerator && shieldGenerator.m.grp === 'bsg') {
shieldColour = 'purple';
} }
this.state = { shieldColour }; this.state = {
shieldColour
const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS); };
return <div id='summary'> return <div id='summary'>
<div style={{ display: 'table', width: '100%' }}> <div style={{display: "table", width: "100%"}}>
<div style={{ display: 'table-row' }}> <div style={{display: "table-row"}}>
<table className={'summaryTable'}> <table className={'summaryTable'}>
<thead> <thead>
<tr className='main'> <tr className='main'>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th>
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th> <th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
<th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRangeCurrent == 0 }) }>{translate('jump range')}</th> <th colSpan={5} className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('jump range')}</th>
<th rowSpan={2}>{translate('shield')}</th> <th rowSpan={2}>{translate('shield')}</th>
<th rowSpan={2}>{translate('integrity')}</th> <th rowSpan={2}>{translate('integrity')}</th>
<th rowSpan={2}>{translate('DPS')}</th> <th rowSpan={2}>{translate('DPS')}</th>
@@ -100,15 +87,14 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2}>{translate('crew')}</th> <th rowSpan={2}>{translate('crew')}</th>
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th> <th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th> <th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th>
{/* TODO: Resting heat */} <th rowSpan={2}>{translate('resting heat (Beta)')}</th>
{/* <th rowSpan={2}>{translate('resting heat (Beta)')}</th> */}
</tr> </tr>
<tr> <tr>
<th className="lft">{translate('max')}</th> <th className={ cn({ 'lft': true, 'bg-warning-disabled': !canJump }) }>{translate('max')}</th>
<th>{translate('unladen')}</th> <th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('unladen')}</th>
<th>{translate('laden')}</th> <th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('laden')}</th>
<th>{translate('total unladen')}</th> <th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total unladen')}</th>
<th>{translate('total laden')}</th> <th className={ cn({ 'bg-warning-disabled': !canJump }) }>{translate('total laden')}</th>
<th className='lft'>{translate('hull')}</th> <th className='lft'>{translate('hull')}</th>
<th>{translate('unladen')}</th> <th>{translate('unladen')}</th>
<th>{translate('laden')}</th> <th>{translate('laden')}</th>
@@ -116,68 +102,30 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} <td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
onMouseLeave={hide} <td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
>{canThrust ? <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{ f2(Calc.jumpRange(ship.unladenMass + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump(), ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
<span>{int(speed)}{u['m/s']}</span> : <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
<span className='warning'>0<Warning/></span> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{ canJump ? <span>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity, ship))}{u.LY}</span> : <span className='warning'>0 <Warning/></span> }</td>
onMouseLeave={hide} <td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td>
>{canBoost ? <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td>
<span>{int(shipBoost)}{u['m/s']}</span> : <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td>
<span className='warning'>0<Warning/></span> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td>
}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeMax)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeUnladen)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.jumpRangeLaden)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.totalRangeUnladen)}{u.LY}</span>}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
onMouseLeave={hide}
>{<span>{f2(jumpRangeMetrics.totalRangeLaden)}{u.LY}</span>}</td>
<td className={sgClassNames}
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
onMouseLeave={hide}
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
onMouseLeave={hide}
>{int(armourMetrics.armour)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.dps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
onMouseLeave={hide}
>{f1(damageMetrics.eps)}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
onMouseLeave={hide}
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
{/* <td>{f1(ship.totalHps)}</td> */} {/* <td>{f1(ship.totalHps)}</td> */}
<td>{ship.get(CARGO_CAPACITY)}{u.T}</td> <td>{round(ship.cargoCapacity)}{u.T}</td>
<td>{ship.get(PASSENGER_CAPACITY)}</td> <td>{ship.passengerCapacity}</td>
<td>{ship.get(FUEL_CAPACITY)}{u.T}</td> <td>{round(ship.fuelCapacity)}{u.T}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td>
onMouseLeave={hide} <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td>
>{ship.readProp('hullmass')}{u.T}</td> <td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} <td>{int(ship.hardness)}</td>
onMouseLeave={hide} <td>{ship.crew}</td>
>{int(ship.get(MINIMUM_MASS))}{u.T}</td> <td>{ship.masslock}</td>
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} <td>{shipBoost !== 'No Boost' ? formats.time(shipBoost) : 'No Boost'}</td>
onMouseLeave={hide} <td>{formats.pct(restingHeat)}</td>
>{int(ship.get(LADEN_MASS))}{u.T}</td>
<td>{int(ship.readProp('hardness'))}</td>
<td>{ship.readMeta('crew')}</td>
<td>{ship.readProp('masslock')}</td>
<td>{time(boostInterval)}</td>
{/* TODO: resting heat */}
{/* <td>{NaN}</td> */}
</tr> </tr>
</tbody> </tbody>
</table> </table>
@@ -205,21 +153,21 @@ export default class ShipSummaryTable extends TranslatedComponent {
</tr> </tr>
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(sgType || 'No Shield')}</td> <td>{translate(shieldGenerator && shieldGenerator.m.grp || 'No Shield')}</td>
<td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td> <td>{formats.pct1(ship.shieldExplRes)}</td>
<td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td> <td>{formats.pct1(ship.shieldKinRes)}</td>
<td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td> <td>{formats.pct1(ship.shieldThermRes)}</td>
<td></td> <td></td>
<td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td> <td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary : 0)}{u.MJ}</td>
<td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td> <td>{int(ship && sgMetrics.summary > 0 ? sgMetrics.summary / sgMetrics.explosive.base : 0)}{u.MJ}</td>
<td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td> <td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.kinetic.base : 0)}{u.MJ}</td>
<td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td> <td>{int(ship && sgMetrics.summary ? sgMetrics.summary / sgMetrics.thermal.base : 0)}{u.MJ}</td>
<td></td> <td></td>
<td>{isNaN(sgMetrics.recover) ? translate('Never') : formats.time(sgMetrics.recover)}</td> <td>{sgMetrics && sgMetrics.recover === Math.Inf ? translate('Never') : formats.time(sgMetrics.recover)}</td>
<td>{isNaN(sgMetrics.recharge) ? translate('Never') : formats.time(sgMetrics.recharge)}</td> <td>{sgMetrics && sgMetrics.recharge === Math.Inf ? translate('Never') : formats.time(sgMetrics.recharge)}</td>
</tr> </tr>
</tbody> </tbody>
<thead> <thead>
<tr> <tr>
@@ -231,7 +179,7 @@ export default class ShipSummaryTable extends TranslatedComponent {
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th> <th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th>
</tr> </tr>
<tr> <tr>
<th>{`${translate('explosive')}`}</th> <th>{`${translate('explosive')}`}</th>
<th>{`${translate('kinetic')}`}</th> <th>{`${translate('kinetic')}`}</th>
<th>{`${translate('thermal')}`}</th> <th>{`${translate('thermal')}`}</th>
<th>{`${translate('caustic')}`}</th> <th>{`${translate('caustic')}`}</th>
@@ -245,18 +193,19 @@ export default class ShipSummaryTable extends TranslatedComponent {
</thead> </thead>
<tbody> <tbody>
<tr> <tr>
<td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td> <td>{translate(ship && ship.bulkheads && ship.bulkheads.m && ship.bulkheads.m.name || 'No Armour')}</td>
<td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td> <td>{formats.pct1(ship.hullExplRes)}</td>
<td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td> <td>{formats.pct1(ship.hullKinRes)}</td>
<td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td> <td>{formats.pct1(ship.hullThermRes)}</td>
<td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td> <td>{formats.pct1(ship.hullCausRes)}</td>
<td>{int(armourMetrics.armour)}</td> <td>{int(armourMetrics.total)}</td>
<td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td> <td>{int(armourMetrics.total / armourMetrics.explosive.total)}</td>
<td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td> <td>{int(armourMetrics.total/ armourMetrics.kinetic.total)}</td>
<td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td> <td>{int(armourMetrics.total / armourMetrics.thermal.total)}</td>
<td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td> <td>{int(armourMetrics.total/ armourMetrics.caustic.total)}</td>
<td>{int(moduleProtectionMetrics.moduleArmour)}</td> <td>{int(armourMetrics.modulearmour)}</td>
<td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td> <td>{int(armourMetrics.moduleprotection * 100) + '%'}</td>
</tr> </tr>
</tbody> </tbody>
</table> </table>

View File

@@ -1,160 +1,386 @@
import React from 'react'; import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import autoBind from 'auto-bind';
const MARGIN_LR = 8; // Left/ Right margin
const MARGIN_LR = 8; // Left/ Right margin
/**
/** * Horizontal Slider
* Horizontal Slider */
*/ export default class Slider extends React.Component {
export default class Slider extends React.Component {
static defaultProps = { static defaultProps = {
axis: false, axis: false,
min: 0, min: 0,
max: 1, max: 1,
scale: 1 // SVG render scale scale: 1 // SVG render scale
}; };
static propTypes = { static propTypes = {
axis: PropTypes.bool, axis: PropTypes.bool,
axisUnit: PropTypes.string,// units (T, M, etc.) axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number, max: PropTypes.number,
min: PropTypes.number, min: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value onChange: PropTypes.func.isRequired,// function which determins percent value
onResize: PropTypes.func, onResize: PropTypes.func,
percent: PropTypes.number.isRequired,// value of slider percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number scale: PropTypes.number
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this); this._down = this._down.bind(this);
this._move = this._move.bind(this);
this.state = { width: 0 }; this._up = this._up.bind(this);
} this._keyup = this._keyup.bind(this);
this._keydown = this._keydown.bind(this);
/** this._touchstart = this._touchstart.bind(this);
* On Mouse/Touch down handler this._touchend = this._touchend.bind(this);
* @param {SyntheticEvent} event Event
*/ this._updatePercent = this._updatePercent.bind(this);
_down(event) { this._updateDimensions = this._updateDimensions.bind(this);
let rect = event.currentTarget.getBoundingClientRect();
this.left = rect.left; this.state = { width: 0 };
this.width = rect.width; }
this._move(event);
} /**
* On Mouse/Touch down handler
/** * @param {SyntheticEvent} event Event
* Update the slider percentage on move */
* @param {SyntheticEvent} event Event _down(event) {
*/ let rect = event.currentTarget.getBoundingClientRect();
_move(event) { this.left = rect.left;
if(this.width !== null && this.left != null) { this.width = rect.width;
let clientX = event.touches ? event.touches[0].clientX : event.clientX; this._move(event);
event.preventDefault(); this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
this._updatePercent(clientX - this.left, this.width); }
}
} /**
* Update the slider percentage on move
/** * @param {SyntheticEvent} event Event
* On Mouse/Touch up handler */
* @param {Event} event DOM Event _move(event) {
*/ if(this.width !== null && this.left != null) {
_up(event) { let clientX = event.touches ? event.touches[0].clientX : event.clientX;
event.preventDefault(); event.preventDefault();
this.left = null; this._updatePercent(clientX - this.left, this.width);
this.width = null; }
} }
/** /**
* Determine if the user is still dragging * On Mouse/Touch up handler
* @param {SyntheticEvent} event Event * @param {Event} event DOM Event
*/ */
_enter(event) { _up(event) {
if(event.buttons !== 1) { this.sliderInputBox.sliderVal.focus();
this.left = null; clearTimeout(this.touchStartTimer);
this.width = null; event.preventDefault();
} this.left = null;
} this.width = null;
}
/**
* Update the slider percentage
* @param {number} pos Slider drag position /**
* @param {number} width Slider width * Key up handler for keyboard.
* @param {Event} event DOM Event * display the number field then set focus to it
*/ * when "Enter" key is pressed
_updatePercent(pos, width) { * @param {Event} event Keyboard event
this.props.onChange(Math.min(Math.max(pos / width, 0), 1)); */
} _keyup(event) {
switch (event.key) {
/** case 'Enter':
* Update dimenions from rendered DOM event.preventDefault();
*/ this.sliderInputBox._setDisplay('block');
_updateDimensions() { return;
this.setState({ default:
outerWidth: this.node.getBoundingClientRect().width return;
}); }
} }
/**
/** * Key down handler
* Add listeners when about to mount * increment slider position by +/- 1 when right/left arrow key is pressed or held
*/ * @param {Event} event Keyboard even
componentWillMount() { */
if (this.props.onResize) { _keydown(event) {
this.resizeListener = this.props.onResize(this._updateDimensions); let newVal = this.props.percent * this.props.max;
} switch (event.key) {
} case 'ArrowRight':
newVal += 1;
/** if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
* Trigger DOM updates on mount return;
*/ case 'ArrowLeft':
componentDidMount() { newVal -= 1;
this._updateDimensions(); if (newVal >= 0) this.props.onChange(newVal / this.props.max);
} return;
default:
/** return;
* Remove listeners on unmount }
*/ }
componentWillUnmount() {
if (this.resizeListener) { /**
this.resizeListener.remove(); * Touch start handler
} * @param {Event} event DOM Event
} *
*/
/** _touchstart(event) {
* Render the slider this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
* @return {React.Component} The slider }
*/
render() { /**
let outerWidth = this.state.outerWidth; * Touch end handler
let { axis, axisUnit, min, max, scale } = this.props; * @param {Event} event DOM Event
let style = { *
width: '100%', */
height: axis ? '2.5em' : '1.5em', _touchend(event) {
boxSizing: 'border-box' this.sliderInputBox.sliderVal.focus();
}; clearTimeout(this.touchStartTimer);
if (!outerWidth) { }
return <svg style={style} ref={node => this.node = node} />;
} /**
let margin = MARGIN_LR * scale; * Determine if the user is still dragging
let width = outerWidth - (margin * 2); * @param {SyntheticEvent} event Event
let pctPos = width * this.props.percent; */
return <div><svg _enter(event) {
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} style={style} ref={node => this.node = node} tabIndex="0"> if(event.buttons !== 1) {
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' /> this.left = null;
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' /> this.width = null;
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} /> }
<rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} onTouchEnd={this._touchend} /> }
{axis && <g style={{ fontSize: '.7em' }}>
<text className='primary-disabled' y='3em' x={margin} style={{ textAnchor: 'middle' }}>{min + axisUnit}</text> /**
<text className='primary-disabled' y='3em' x='50%' style={{ textAnchor: 'middle' }}>{(min + max / 2) + axisUnit}</text> * Update the slider percentage
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text> * @param {number} pos Slider drag position
</g>} * @param {number} width Slider width
</svg> * @param {Event} event DOM Event
</div>; */
} _updatePercent(pos, width) {
} this.props.onChange(Math.min(Math.max(pos / width, 0), 1));
}
/**
* Update dimenions from rendered DOM
*/
_updateDimensions() {
this.setState({
outerWidth: this.node.getBoundingClientRect().width
});
}
/**
* Add listeners when about to mount
*/
componentWillMount() {
if (this.props.onResize) {
this.resizeListener = this.props.onResize(this._updateDimensions);
}
}
/**
* Trigger DOM updates on mount
*/
componentDidMount() {
this._updateDimensions();
}
/**
* Remove listeners on unmount
*/
componentWillUnmount() {
if (this.resizeListener) {
this.resizeListener.remove();
}
}
/**
* Render the slider
* @return {React.Component} The slider
*/
render() {
let outerWidth = this.state.outerWidth;
let { axis, axisUnit, min, max, scale } = this.props;
let style = {
width: '100%',
height: axis ? '2.5em' : '1.5em',
boxSizing: 'border-box'
};
if (!outerWidth) {
return <svg style={style} ref={node => this.node = node} />;
}
let margin = MARGIN_LR * scale;
let width = outerWidth - (margin * 2);
let pctPos = width * this.props.percent;
return <div><svg
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0">
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
<rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} onTouchEnd={this._touchend} />
{axis && <g style={{ fontSize: '.7em' }}>
<text className='primary-disabled' y='3em' x={margin} style={{ textAnchor: 'middle' }}>{min + axisUnit}</text>
<text className='primary-disabled' y='3em' x='50%' style={{ textAnchor: 'middle' }}>{(min + max / 2) + axisUnit}</text>
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
</g>}
</svg>
<TextInputBox ref={(tb) => this.sliderInputBox = tb}
onChange={this.props.onChange}
percent={this.props.percent}
axisUnit={this.props.axisUnit}
scale={this.props.scale}
max={this.props.max}
/>
</div>;
}
}
/**
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
**/
class TextInputBox extends React.Component {
static propTypes = {
axisUnit: PropTypes.string,// units (T, M, etc.)
max: PropTypes.number,
onChange: PropTypes.func.isRequired,// function which determins percent value
percent: PropTypes.number.isRequired,// value of slider
scale: PropTypes.number
};
/**
* Determine if the user is still dragging
* @param {Object} props React Component properties
*/
constructor(props) {
super(props);
this._handleFocus = this._handleFocus.bind(this);
this._handleBlur = this._handleBlur.bind(this);
this._handleChange = this._handleChange.bind(this);
this._keyup = this._keyup.bind(this);
this.state = this._getInitialState();
}
/**
* Update input value if slider changes will change props/state
* @param {Object} nextProps React Component properites
* @param {Object} nextState React Component state values
*/
componentWillReceiveProps(nextProps, nextState) {
let nextValue = nextProps.percent * nextProps.max;
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
this.setState({ inputValue: nextValue });
}
}
/**
* Update slider textbox visibility/values if changes are made to slider
* @param {Object} prevProps React Component properites
* @param {Object} prevState React Component state values
*/
componentDidUpdate(prevProps, prevState) {
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
}
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
// they chose a different module
this.setState({ inputValue: this.props.max });
}
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
this.props.onChange(this.state.inputValue / this.props.max);
}
}
/**
* Set initial state for the textbox.
* We may want to rethink this to
* try and make it a stateless component
* @returns {object} React state object with initial values set
*/
_getInitialState() {
return {
divStyle: { display:'none' },
inputStyle: { width:'4em' },
labelStyle: { marginLeft: '.1em' },
maxLength:5,
size:5,
min:0,
tabIndex:-1,
type:'number',
readOnly: true,
inputValue: this.props.percent * this.props.max
};
}
/**
*
* @param {string} val block or none
*/
_setDisplay(val) {
this.setState({
divStyle: { display:val }
});
}
/**
* Update the input value
* when textbox gets focus
*/
_handleFocus() {
this.setState({
inputValue:this._getValue()
});
}
/**
* Update inputValue when textbox loses focus
*/
_handleBlur() {
this._setDisplay('none');
if (this.state.inputValue !== '') {
this.props.onChange(this.state.inputValue / this.props.max);
} else {
this.setState({
inputValue: this.props.percent * this.props.max
});
}
}
/**
* Get the value in the text box
* @returns {number} inputValue Value of the input box
*/
_getValue() {
return this.state.inputValue;
}
/**
* Update and set limits on input box
* values depending on what user
* has selected
*
* @param {SyntheticEvent} event ReactJs onChange event
*/
_handleChange(event) {
if (event.target.value < 0) {
this.setState({ inputValue: 0 });
} else if (event.target.value <= this.props.max) {
this.setState({ inputValue: event.target.value });
} else {
this.setState({ inputValue: this.props.max });
}
}
/**
* Key up handler for input field.
* If user hits Enter key, blur/close the input field
* @param {Event} event Keyboard event
*/
_keyup(event) {
switch (event.key) {
case 'Enter':
this.sliderVal.blur();
return;
default:
return;
}
}
/**
* Get the value in the text box
* @return {React.Component} Text Input component for Slider
*/
render() {
let { axisUnit, onChange, percent, scale } = this.props;
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
}
}

View File

@@ -2,37 +2,30 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import cn from 'classnames'; import cn from 'classnames';
import { ListModifications, Modified } from './SvgIcons';
import AvailableModulesMenu from './AvailableModulesMenu'; import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu'; import ModificationsMenu from './ModificationsMenu';
import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions'; import { diffDetails } from '../utils/SlotFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { Module } from 'ed-forge';
import { TYPES } from 'ed-forge/lib/src/data/slots';
import autoBind from 'auto-bind';
import { toPairs } from 'lodash';
const HARDPOINT_SLOT_LABELS = {
1: 'S',
2: 'M',
3: 'L',
4: 'H',
};
/** /**
* Abstract Slot * Abstract Slot
*/ */
export default class Slot extends TranslatedComponent { export default class Slot extends TranslatedComponent {
static propTypes = { static propTypes = {
currentMenu: PropTypes.any, availableModules: PropTypes.func.isRequired,
hideSearch: PropTypes.bool, onSelect: PropTypes.func.isRequired,
m: PropTypes.instanceOf(Module), onOpen: PropTypes.func.isRequired,
maxClass: PropTypes.number.isRequired,
selected: PropTypes.bool,
m: PropTypes.object,
enabled: PropTypes.bool.isRequired,
ship: PropTypes.object.isRequired,
eligible: PropTypes.object,
warning: PropTypes.func, warning: PropTypes.func,
drag: PropTypes.func, drag: PropTypes.func,
drop: PropTypes.func, drop: PropTypes.func,
dropClass: PropTypes.string, dropClass: PropTypes.string
propsToShow: PropTypes.object.isRequired,
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
@@ -41,122 +34,25 @@ export default class Slot extends TranslatedComponent {
*/ */
constructor(props) { constructor(props) {
super(props); super(props);
autoBind(this);
this.state = { menuIndex: 0 }; this._modificationsSelected = false;
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
this._keyDown = this._keyDown.bind(this);
this.slotDiv = null;
} }
/** // Must be implemented by subclasses:
* Opens a menu while setting state. // _getSlotDetails()
* @param {Object} newMenuIndex New menu index
* @param {Event} event Event object
*/
_openMenu(newMenuIndex, event) {
const slotName = this.props.m.getSlot();
if (
this.props.currentMenu === slotName &&
newMenuIndex === this.state.menuIndex
) {
this.context.closeMenu();
} {
this.setState({ menuIndex: newMenuIndex });
this.context.openMenu(slotName);
}
// If we don't stop event propagation, the underlying divs also might
// get clicked which would open up other menus
event.stopPropagation();
}
/** /**
* Generate the slot contents * Get the CSS class name for the slot. Can/should be overriden
* @return {React.Component} Slot contents * as necessary.
* @return {string} CSS Class name
*/ */
_getSlotDetails() { _getClassNames() {
const { m, propsToShow } = this.props; return null;
let { termtip, tooltip, language } = this.context;
const { translate, units, formats } = language;
if (m.isEmpty()) {
return <div className="empty">
{translate(
m.isOnSlot(TYPES.MILITARY) ? 'emptyrestricted' : 'empty'
)}
</div>;
} else {
let classRating = m.getClassRating();
let { drag, drop } = this.props;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
const blueprint = m.getBlueprint();
const experimental = m.getExperimental();
const grade = m.getBlueprintGrade();
if (blueprint) {
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
if (experimental) {
modTT += `, ${translate(experimental)}`;
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(language, m)}
</div>
);
}
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
return (
<div
className={cn('details', { disabled: !m.isEnabled() })}
draggable="true"
onDragStart={drag}
onDragEnd={drop}
>
<div className={'cb'}>
<div className={'l'}>
{classRating} {translate(m.readMeta('type'))}
{blueprint && (
<span
onMouseOver={termtip.bind(null, modTT)}
onMouseOut={tooltip.bind(null, null)}
>
<Modified />
</span>
)}
</div>
{propsToShow.mass ?
<div className={'r'}>
{formats.round(mass)}
{units.T}
</div> : null}
</div>
<div className={'cb'}>
{toPairs(propsToShow).sort().map(([prop, show]) => {
const { unit, value } = m.getFormatted(prop, true);
// Don't show mass again; it's already shown on the top right
// corner of a slot
if (!show || isNaN(value) || prop == 'mass') {
return null;
} else {
return (<div className='l'>
{translate(prop)}: {formats.round(value)}{unit}
</div>);
}
})}
{(m.getApplicableBlueprints() || []).length > 0 ? (
<div className="r">
<button onClick={this._openMenu.bind(this, 1)}
onContextMenu={stopCtxPropagation}
onMouseOver={termtip.bind(null, translate('modifications'))}
onMouseOut={tooltip.bind(null, null)}
>
<ListModifications />
</button>
</div>
) : null}
</div>
</div>
);
}
} }
/** /**
@@ -165,19 +61,7 @@ export default class Slot extends TranslatedComponent {
* @return {string} label * @return {string} label
*/ */
_getMaxClassLabel() { _getMaxClassLabel() {
const { m } = this.props; return this.props.maxClass;
let size = m.getSizeNum();
switch (true) {
case m.getSlot() === 'armour':
return '';
case size === 0:
// This can also happen for armour but that case was handled above
return 'U';
case m.isOnSlot(TYPES.HARDPOINT):
return HARDPOINT_SLOT_LABELS[size];
default:
return size;
}
} }
/** /**
@@ -187,15 +71,25 @@ export default class Slot extends TranslatedComponent {
_contextMenu(event) { _contextMenu(event) {
event.stopPropagation(); event.stopPropagation();
event.preventDefault(); event.preventDefault();
const { m } = this.props; this.props.onSelect(null,null);
m.reset();
if (this.props.currentMenu === m.getSlot()) {
this.context.closeMenu();
} else {
this.forceUpdate();
}
} }
/** Key Down handler
* @param {SyntheticEvent} event Event
* ToDo: see if this can be moved up
* we do more or less the same thing
* in every section when Enter key is pressed
* on a focusable item
*
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/** /**
* Render the slot * Render the slot
* @return {React.Component} The slot * @return {React.Component} The slot
@@ -203,41 +97,73 @@ export default class Slot extends TranslatedComponent {
render() { render() {
let language = this.context.language; let language = this.context.language;
let translate = language.translate; let translate = language.translate;
let { let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props;
currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow, let slotDetails, modificationsMarker, menu;
onPropToggle, let missing = false;
} = this.props;
const { menuIndex } = this.state; if (!selected) {
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
if (m) {
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
modificationsMarker = JSON.stringify(m);
if(typeof m.grp !== 'undefined' || m.grp !== null) {
if(m.grp == "mh" || m.grp == "mm") {
missing = true;
}
}
} else {
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
modificationsMarker = '';
}
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className={this._getClassNames()}
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className={this._getClassNames()}
modules={availableModules()}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
// TODO: implement touch dragging // TODO: implement touch dragging
const selected = currentMenu === m.getSlot();
return ( return (
<div <div className={cn('slot', dropClass, { selected })} onClick={onOpen} onKeyDown={this._keyDown} onContextMenu={this._contextMenu} onDragOver={dragOver} tabIndex="0" ref={slotDiv => this.slotDiv = slotDiv}>
className={cn('slot', dropClass, { selected })} {
onContextMenu={this._contextMenu} // If missing module/hardpoint, set the div container to warning status.
onDragOver={dragOver} tabIndex="0" }
onClick={this._openMenu.bind(this, 0)} <div className={ missing === true ? 'details-container warning' : 'details-container'}>
> <div className='sz'>{this._getMaxClassLabel(translate)}</div>
<div className={cn( {slotDetails}
'details-container', </div>
{ warning: warning && warning(m) }, {menu}
)}>
<div className="sz">{this._getMaxClassLabel(translate)}</div>
{this._getSlotDetails()}
</div>
{selected && menuIndex === 0 &&
<AvailableModulesMenu
m={m} hideSearch={hideSearch}
onSelect={(item) => {
m.setItem(item);
this.context.closeMenu();
}}
warning={warning}
/>}
{selected && menuIndex === 1 &&
<ModificationsMenu m={m} propsToShow={propsToShow}
onPropToggle={onPropToggle} />}
</div> </div>
); );
} }
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
} }

View File

@@ -2,35 +2,50 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import { wrapCtxMenu } from '../utils/UtilityFunctions'; import { wrapCtxMenu } from '../utils/UtilityFunctions';
import { canMount } from '../utils/SlotFunctions';
import { Equalizer } from '../components/SvgIcons'; import { Equalizer } from '../components/SvgIcons';
import cn from 'classnames'; import cn from 'classnames';
import { Ship } from 'ed-forge';
import autoBind from 'auto-bind';
const browser = require('detect-browser'); const browser = require('detect-browser');
/** /**
* Abstract Slot Section * Abstract Slot Section
*/ */
export default class SlotSection extends TranslatedComponent { export default class SlotSection extends TranslatedComponent {
static propTypes = { static propTypes = {
ship: PropTypes.instanceOf(Ship), ship: PropTypes.object.isRequired,
onChange: PropTypes.func.isRequired,
onCargoChange: PropTypes.func.isRequired,
onFuelChange: PropTypes.func.isRequired,
code: PropTypes.string.isRequired, code: PropTypes.string.isRequired,
togglePwr: PropTypes.func, togglePwr: PropTypes.func,
propsToShow: PropTypes.object.isRequired, sectionMenuRefs: PropTypes.object
onPropToggle: PropTypes.func.isRequired,
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
* @param {string} sectionId Section DOM Id
* @param {string} sectionName Section name * @param {string} sectionName Section name
*/ */
constructor(props, sectionName) { constructor(props, context, sectionId, sectionName) {
super(props); super(props);
autoBind(this); this.sectionId = sectionId;
this.sectionName = sectionName; this.sectionName = sectionName;
this.ssHeadRef = null;
this.sectionRefArr = this.props.sectionMenuRefs[this.sectionId] = [];
this.sectionRefArr['selectedRef'] = null;
this._getSlots = this._getSlots.bind(this);
this._selectModule = this._selectModule.bind(this);
this._getSectionMenu = this._getSectionMenu.bind(this);
this._contextMenu = this._contextMenu.bind(this);
this._drop = this._drop.bind(this);
this._dragOverNone = this._dragOverNone.bind(this);
this._close = this._close.bind(this);
this._keyDown = this._keyDown.bind(this);
this._handleSectionFocus = this._handleSectionFocus.bind(this);
this.state = {}; this.state = {};
} }
@@ -40,6 +55,82 @@ export default class SlotSection extends TranslatedComponent {
// _contextMenu() // _contextMenu()
// componentDidUpdate(prevProps) // componentDidUpdate(prevProps)
/**
* TODO: May either need to send the function to be triggered when Enter key is pressed, or else
* may need a separate keyDown handler for each subclass (StandardSlotSection, HardpointSlotSection, etc.)
* ex: _keyDown(_keyDownfn, event)
*
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
event.stopPropagation();
if (event.currentTarget.nodeName === 'H1') {
this._openMenu(this.sectionName, event);
} else {
event.currentTarget.click();
}
return;
}
if (event.key == 'Tab') {
if (event.shiftKey) {
if ((event.currentTarget === this.sectionRefArr[this.firstRefId]) && this.sectionRefArr[this.lastRefId]) {
event.preventDefault();
this.sectionRefArr[this.lastRefId].focus();
}
} else {
if ((event.currentTarget === this.sectionRefArr[this.lastRefId]) && this.sectionRefArr[this.firstRefId]) {
event.preventDefault();
this.sectionRefArr[this.firstRefId].focus();
}
}
}
}
/**
* Set focus on appropriate Slot Section Menu element
* @param {Object} focusPrevProps prevProps for componentDidUpdate() from ...SlotSection.jsx
* @param {String} firstRef id of the first ref in ...SlotSection.jsx
* @param {String} lastRef id of the last ref in ...SlotSection.jsx
*
*/
_handleSectionFocus(focusPrevProps, firstRef, lastRef) {
if (this.selectedRefId !== null && this.sectionRefArr[this.selectedRefId]) {
// set focus on the previously selected option for the currently open section menu
this.sectionRefArr[this.selectedRefId].focus();
} else if (this.sectionRefArr[firstRef] && this.sectionRefArr[firstRef] != null) {
// set focus on the first option in the currently open section menu if none have been selected previously
this.sectionRefArr[firstRef].focus();
} else if (this.props.currentMenu == null && focusPrevProps.currentMenu == this.sectionName && this.sectionRefArr['ssHeadRef']) {
// set focus on the section menu header when section menu is closed
this.sectionRefArr['ssHeadRef'].focus();
}
}
/**
* Open a menu
* @param {string} menu Menu name
* @param {SyntheticEvent} event Event
*/
_openMenu(menu, event) {
event.preventDefault();
event.stopPropagation();
if (this.props.currentMenu === menu) {
menu = null;
}
this.context.openMenu(menu);
}
/**
* Mount/Use the specified module in the slot
* @param {Object} slot Slot
* @param {Object} m Selected module
*/
_selectModule(slot, m) {
this.props.ship.use(slot, m, false);
this.props.onChange();
this._close();
}
/** /**
* Slot Drag Handler * Slot Drag Handler
* @param {object} originSlot Origin slot model * @param {object} originSlot Origin slot model
@@ -116,6 +207,7 @@ export default class SlotSection extends TranslatedComponent {
// Copy power info // Copy power info
targetSlot.enabled = originSlot.enabled; targetSlot.enabled = originSlot.enabled;
targetSlot.priority = originSlot.priority; targetSlot.priority = originSlot.priority;
this.props.onChange();
} }
} else { } else {
// Store power info // Store power info
@@ -144,6 +236,7 @@ export default class SlotSection extends TranslatedComponent {
targetSlot.enabled = targetEnabled; targetSlot.enabled = targetEnabled;
targetSlot.priority = targetPriority; targetSlot.priority = targetPriority;
} }
this.props.onChange();
this.props.ship this.props.ship
.updatePowerGenerated() .updatePowerGenerated()
.updatePowerUsed() .updatePowerUsed()
@@ -189,17 +282,6 @@ export default class SlotSection extends TranslatedComponent {
return 'ineligible'; // Cannot be dropped / invalid drop slot return 'ineligible'; // Cannot be dropped / invalid drop slot
} }
_open(newMenu, event) {
event.preventDefault();
event.stopPropagation();
const { currentMenu } = this.props;
if (currentMenu === newMenu) {
this.context.closeMenu();
} else {
this.context.openMenu(newMenu);
}
}
/** /**
* Close current menu * Close current menu
*/ */
@@ -216,13 +298,14 @@ export default class SlotSection extends TranslatedComponent {
render() { render() {
let translate = this.context.language.translate; let translate = this.context.language.translate;
let sectionMenuOpened = this.props.currentMenu === this.sectionName; let sectionMenuOpened = this.props.currentMenu === this.sectionName;
let open = this._openMenu.bind(this, this.sectionName);
let ctx = wrapCtxMenu(this._contextMenu);
return ( return (
<div className="group" onDragLeave={this._dragOverNone}> <div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}>
<div className={cn('section-menu', { selected: sectionMenuOpened })} <div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}>
onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}> <h1 tabIndex="0" onKeyDown={this._keyDown} ref={ssHead => this.sectionRefArr['ssHeadRef'] = ssHead}>{translate(this.sectionName)} <Equalizer/></h1>
<h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1> {sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null }
{sectionMenuOpened && this._getSectionMenu()}
</div> </div>
{this._getSlots()} {this._getSlots()}
</div> </div>

View File

@@ -0,0 +1,168 @@
import React from 'react';
import PropTypes from 'prop-types';
import cn from 'classnames';
import Persist from '../stores/Persist';
import TranslatedComponent from './TranslatedComponent';
import { diffDetails } from '../utils/SlotFunctions';
import AvailableModulesMenu from './AvailableModulesMenu';
import ModificationsMenu from './ModificationsMenu';
import * as ModuleUtils from '../shipyard/ModuleUtils';
import { ListModifications, Modified } from './SvgIcons';
import { Modifications } from 'coriolis-data/dist';
import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { blueprintTooltip } from '../utils/BlueprintFunctions';
/**
* Standard Slot
*/
export default class StandardSlot extends TranslatedComponent {
static propTypes = {
slot: PropTypes.object,
modules: PropTypes.array.isRequired,
onSelect: PropTypes.func.isRequired,
onOpen: PropTypes.func.isRequired,
onChange: PropTypes.func.isRequired,
ship: PropTypes.object.isRequired,
selected: PropTypes.bool,
warning: PropTypes.func,
};
/**
* Construct the slot
* @param {object} props Object properties
*/
constructor(props) {
super(props);
this._modificationsSelected = false;
this._keyDown = this._keyDown.bind(this);
this.modButton = null;
this.slotDiv = null;
}
/**
* Handle Enter key
* @param {SyntheticEvent} event KeyDown event
*/
_keyDown(event) {
if (event.key == 'Enter') {
if(event.target.className == 'r') {
this._toggleModifications();
}
this.props.onOpen(event);
}
}
/**
* Render the slot
* @return {React.Component} Slot component
*/
render() {
let { termtip, tooltip } = this.context;
let { translate, formats, units } = this.context.language;
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
let m = slot.m;
let classRating = m.class + m.rating;
let menu;
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
if (m && m.name && m.name === 'Guardian Hybrid Power Plant') {
validMods = [];
}
if (m && m.name && m.name === 'Guardian Power Distributor') {
validMods = [];
}
let showModuleResistances = Persist.showModuleResistances();
let mass = m.getMass() || m.cargo || m.fuel || 0;
// Modifications tooltip shows blueprint and grade, if available
let modTT = translate('modified');
if (m && m.blueprint && m.blueprint.name) {
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id >= 0) {
modTT += ', ' + translate(m.blueprint.special.name);
}
modTT = (
<div>
<div>{modTT}</div>
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
</div>
);
}
if (!selected) {
// If not selected then sure that modifications flag is unset
this._modificationsSelected = false;
}
// If this is a missing module, therefore has the 'info' field, set the warning value on the module to be true when loaded.
if (m.info) {
warning = () => true;
}
const modificationsMarker = JSON.stringify(m);
if (selected) {
if (this._modificationsSelected) {
menu = <ModificationsMenu
className='standard'
onChange={onChange}
ship={ship}
m={m}
marker={modificationsMarker}
modButton = {this.modButton}
/>;
} else {
menu = <AvailableModulesMenu
className='standard'
modules={modules}
m={m}
ship={ship}
onSelect={onSelect}
warning={warning}
diffDetails={diffDetails.bind(ship, this.context.language)}
slotDiv = {this.slotDiv}
/>;
}
}
return (
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onKeyDown={this._keyDown} onContextMenu={stopCtxPropagation} tabIndex="0" ref={ slotDiv => this.slotDiv = slotDiv }>
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
<div>
<div className={'l'}>{classRating} {m.getInfo() ? translate(m.ukName) : translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
<div className={'r'}>{formats.round(mass)}{units.T}</div>
<div/>
<div className={'cb'}>
{ m.getMinMass() ? <div className='l'>{translate('minimum mass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
{ m.getOptMass() ? <div className='l'>{translate('optimal mass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
{ m.getMaxMass() ? <div className='l'>{translate('max mass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
{ m.getOptMul() ? <div className='l'>{translate('optimal multiplier')}: {formats.rPct(m.getOptMul())}</div> : null }
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
{ m.getInfo() ? <div className='l'>{translate(m.getInfo())}</div> : null }
{ m.getInfo() ? <div className='r'></div> : validMods.length > 0 ? <div className='r' tabIndex="0" ref={ modButton => this.modButton = modButton }><button tabIndex="-1" onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
</div>
</div>
</div>
{menu}
</div>
);
}
/**
* Toggle the modifications flag when selecting the modifications icon
*/
_toggleModifications() {
this._modificationsSelected = !this._modificationsSelected;
}
}

View File

@@ -1,67 +1,132 @@
import React from 'react'; import React from 'react';
import cn from 'classnames';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import Slot from './Slot'; import StandardSlot from './StandardSlot';
import autoBind from 'auto-bind'; import Module from '../shipyard/Module';
import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions'; import * as ShipRoles from '../shipyard/ShipRoles';
import { ShipProps, Module } from 'ed-forge'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import { getModuleInfo } from 'ed-forge/lib/src/data/items';
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
/** /**
* Standard Slot section * Standard Slot section
*/ */
export default class StandardSlotSection extends SlotSection { export default class StandardSlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props, 'core internal'); super(props, context, 'standard', 'core internal');
autoBind(this); this._optimizeStandard = this._optimizeStandard.bind(this);
this._selectBulkhead = this._selectBulkhead.bind(this);
this.selectedRefId = null;
this.firstRefId = 'maxjump';
this.lastRefId = 'racer';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Resets all modules of the ship * Use the lightest/optimal available standard modules
*/ */
_emptyAll() { _optimizeStandard() {
this.props.ship.getModules().forEach((slot) => slot.reset()); this.selectedRefId = 'maxjump';
this.props.ship.useLightestStandard();
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close(); this._close();
} }
/** /**
* Sets all modules to a specific rating * Fill all standard slots with the specificed rating (using max class)
* @param {string} rating Module rating to set * @param {Boolean} shielded True if shield generator should be included
* @param {string} fsdPPException Custom rating for FSD * @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
*/ */
_nRated(rating, fsdPPException) { _multiPurpose(shielded, bulkheadIndex) {
const { ship } = this.props; this.selectedRefId = 'multipurpose';
const pp = ship.getPowerPlant(); if (bulkheadIndex === 2) this.selectedRefId = 'combat';
pp.setItem('powerplant', pp.getSize(), fsdPPException || rating); ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex);
const eng = ship.getThrusters(); this.props.onChange();
eng.setItem('thrusters', eng.getSize(), rating); this.props.onCargoChange(this.props.ship.cargoCapacity);
const fsd = ship.getFSD(); this.props.onFuelChange(this.props.ship.fuelCapacity);
fsd.setItem('fsd', fsd.getSize(), fsdPPException || rating);
const ls = ship.getLifeSupport();
ls.setItem('lifesupport', ls.getSize(), rating);
const pd = ship.getPowerDistributor();
pd.setItem('powerdistributor', pd.getSize(), rating);
const sen = ship.getSensors();
sen.setItem('sensors', sen.getSize(), rating);
this._close(); this._close();
} }
/** /**
* Creates a new slot for a given module. * Trader Build
* @param {Module} m Module to create the slot for * @param {Boolean} shielded True if shield generator should be included
* @param {function} warning Warning callback
* @return {React.Component} Slot component
*/ */
_mkSlot(m, warning) { _optimizeCargo(shielded) {
const { currentMenu, propsToShow, onPropToggle } = this.props; this.selectedRefId = 'trader';
return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true} ShipRoles.trader(this.props.ship, shielded);
currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle} this.props.onChange();
/>; this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Miner Build
* @param {Boolean} shielded True if shield generator should be included
*/
_optimizeMiner(shielded) {
this.selectedRefId = 'miner';
ShipRoles.miner(this.props.ship, shielded);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Explorer role
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
*/
_optimizeExplorer(planetary) {
this.selectedRefId = 'explorer';
if (planetary) this.selectedRefId = 'planetary';
ShipRoles.explorer(this.props.ship, planetary);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Racer role
*/
_optimizeRacer() {
this.selectedRefId = 'racer';
ShipRoles.racer(this.props.ship);
this.props.onChange();
this.props.onCargoChange(this.props.ship.cargoCapacity);
this.props.onFuelChange(this.props.ship.fuelCapacity);
this._close();
}
/**
* Use the specified bulkhead
* @param {Object} bulkhead Bulkhead module details
*/
_selectBulkhead(bulkhead) {
this.props.ship.useBulkhead(bulkhead.index);
this.context.tooltip();
this.props.onChange();
this._close();
}
/**
* On right click optimize the standard modules
*/
_contextMenu() {
this._optimizeStandard();
} }
/** /**
@@ -69,30 +134,108 @@ export default class StandardSlotSection extends SlotSection {
* @return {Array} Array of Slots * @return {Array} Array of Slots
*/ */
_getSlots() { _getSlots() {
const { ship } = this.props; let { ship, currentMenu, cargo, fuel } = this.props;
const fsd = ship.getFSD(); let slots = new Array(8);
return [ let open = this._openMenu;
this._mkSlot(ship.getAlloys()), let select = this._selectModule;
this._mkSlot( let st = ship.standard;
ship.getPowerPlant(), let avail = ship.getAvailableModules().standard;
(m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR), let bh = ship.bulkheads;
),
this._mkSlot( slots[0] = <StandardSlot
ship.getThrusters(), key='bh'
(m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS), slot={bh}
), modules={ship.getAvailableModules().bulkheads}
this._mkSlot(fsd), onOpen={open.bind(this, bh)}
this._mkSlot( onSelect={this._selectBulkhead}
ship.getPowerDistributor(), selected={currentMenu == bh}
(m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'), onChange={this.props.onChange}
), ship={ship}
this._mkSlot(ship.getLifeSupport()), />;
this._mkSlot(ship.getSensors()),
this._mkSlot( slots[1] = <StandardSlot
ship.getCoreFuelTank(), key='pp'
(m) => moduleGet(m, 'fuel') < fsd.get('maxfuel') slot={st[0]}
), modules={avail[0]}
]; onOpen={open.bind(this, st[0])}
onSelect={select.bind(this, st[0])}
selected={currentMenu == st[0]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
/>;
slots[2] = <StandardSlot
key='th'
slot={st[1]}
modules={avail[1]}
onOpen={open.bind(this, st[1])}
onSelect={select.bind(this, st[1])}
selected={currentMenu == st[1]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
/>;
slots[3] = <StandardSlot
key='fsd'
slot={st[2]}
modules={avail[2]}
onOpen={open.bind(this, st[2])}
onSelect={select.bind(this, st[2])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[2]}
/>;
slots[4] = <StandardSlot
key='ls'
slot={st[3]}
modules={avail[3]}
onOpen={open.bind(this, st[3])}
onSelect={select.bind(this, st[3])}
onChange={this.props.onChange}
ship={ship}
selected={currentMenu == st[3]}
/>;
slots[5] = <StandardSlot
key='pd'
slot={st[4]}
modules={avail[4]}
onOpen={open.bind(this, st[4])}
onSelect={select.bind(this, st[4])}
selected={currentMenu == st[4]}
onChange={this.props.onChange}
ship={ship}
warning={m => m instanceof Module ? m.getEnginesCapacity() <= ship.boostEnergy : m.engcap <= ship.boostEnergy}
/>;
slots[6] = <StandardSlot
key='ss'
slot={st[5]}
modules={avail[5]}
onOpen={open.bind(this, st[5])}
onSelect={select.bind(this, st[5])}
selected={currentMenu == st[5]}
onChange={this.props.onChange}
ship={ship}
/>;
slots[7] = <StandardSlot
key='ft'
slot={st[6]}
modules={avail[6]}
onOpen={open.bind(this, st[6])}
onSelect={select.bind(this, st[6])}
selected={currentMenu == st[6]}
onChange={this.props.onChange}
ship={ship}
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
/>;
return slots;
} }
/** /**
@@ -100,18 +243,23 @@ export default class StandardSlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu() { _getSectionMenu(translate) {
const { translate } = this.context.language; let planetaryDisabled = this.props.ship.internal.length < 4;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._emptyAll}>{translate('empty all slots')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeStandard} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['maxjump'] = smRef}>{translate('Maximize Jump Range')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('core')}</div> <div className='select-group cap'>{translate('roles')}</div>
<ul> <ul>
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '5', undefined)}>{translate('A-rated')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['multipurpose'] = smRef}>{translate('Multi-purpose')}</li>
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', undefined)}>{translate('D-rated')}</li> <li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['combat'] = smRef}>{translate('Combat')}</li>
<li className='lc' tabIndex="0" onClick={this._nRated.bind(this, '2', '5')}>{translate('D-rated + A-rated FSD/PP')}</li> <li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['trader'] = smRef}>{translate('Trader')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['explorer'] = smRef}>{translate('Explorer')}</li>
<li className={cn('lc', { disabled: planetaryDisabled })} tabIndex={planetaryDisabled ? '' : '0'} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['planetary'] = smRef}>{translate('Planetary Explorer')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['miner'] = smRef}>{translate('Miner')}</li>
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['racer'] = smRef}>{translate('Racer')}</li>
</ul> </ul>
</div>; </div>;
} }
} }

View File

@@ -247,7 +247,8 @@ export class OrbisIcon extends SvgIcon {
<path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/> <path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/>
<path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" /> <path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" />
<rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" /> <rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" />
</g>); </g>
);
} }
} }
@@ -262,7 +263,7 @@ export class MatIcon extends SvgIcon {
*/ */
svg() { svg() {
return<g xmlns="http://www.w3.org/2000/svg"> return<g xmlns="http://www.w3.org/2000/svg">
<path d="M 24.86,4.18 <path fill="#FF7100" d="M 24.86,4.18
C 24.86,4.18 17.17,7.82 17.17,7.82 C 24.86,4.18 17.17,7.82 17.17,7.82
17.17,7.82 15.35,14.55 15.35,14.55 17.17,7.82 15.35,14.55 15.35,14.55
15.35,14.55 24.70,9.75 24.70,9.75 15.35,14.55 24.70,9.75 24.70,9.75
@@ -741,9 +742,9 @@ export class Modified extends SvgIcon {
*/ */
svg() { svg() {
return <g> return <g>
<path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/> <path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/>
<path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/> <path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/>
</g>; </g>;
} }
} }

View File

@@ -6,6 +6,7 @@ import TranslatedComponent from './TranslatedComponent';
* Document Root Tooltip * Document Root Tooltip
*/ */
export default class Tooltip extends TranslatedComponent { export default class Tooltip extends TranslatedComponent {
static propTypes = { static propTypes = {
rect: PropTypes.object.isRequired, rect: PropTypes.object.isRequired,
options: PropTypes.object options: PropTypes.object
@@ -126,4 +127,5 @@ export default class Tooltip extends TranslatedComponent {
</div> </div>
</div>; </div>;
} }
} }

View File

@@ -6,6 +6,7 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract Translated Component * Abstract Translated Component
*/ */
export default class TranslatedComponent extends React.Component { export default class TranslatedComponent extends React.Component {
static contextTypes = { static contextTypes = {
language: PropTypes.object.isRequired, language: PropTypes.object.isRequired,
sizeRatio: PropTypes.number.isRequired, sizeRatio: PropTypes.number.isRequired,

View File

@@ -1,8 +1,7 @@
import React from 'react'; import React from 'react';
import SlotSection from './SlotSection'; import SlotSection from './SlotSection';
import Slot from './Slot'; import HardpointSlot from './HardpointSlot';
import { stopCtxPropagation } from '../utils/UtilityFunctions'; import { stopCtxPropagation } from '../utils/UtilityFunctions';
import autoBind from 'auto-bind';
/** /**
* Utility Slot Section * Utility Slot Section
@@ -11,58 +10,87 @@ export default class UtilitySlotSection extends SlotSection {
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context
*/ */
constructor(props) { constructor(props, context) {
super(props, 'utility mounts'); super(props, context, 'utility', 'utility mounts');
autoBind(this); this._empty = this._empty.bind(this);
this.selectedRefId = null;
this.firstRefId = 'emptyall';
this.lastRefId = 'po';
}
/**
* Handle focus if the component updates
* @param {Object} prevProps React Component properties
*/
componentDidUpdate(prevProps) {
this._handleSectionFocus(prevProps,this.firstRefId, this.lastRefId);
} }
/** /**
* Empty all utility slots and close the menu * Empty all utility slots and close the menu
*/ */
_empty() { _empty() {
this.props.ship.getUtilities().forEach((slot) => slot.reset()); this.selectedRefId = this.firstRefId;
this.props.ship.emptyUtility();
this.props.onChange();
this._close(); this._close();
} }
/** /**
* Mount module in utility slot, replace all if Alt is held * Mount module in utility slot, replace all if Alt is held
* @param {string} type Module type * @param {string} group Module Group name
* @param {string} rating Module Rating * @param {string} rating Module Rating
* @param {string} name Module name
* @param {Synthetic} event Event * @param {Synthetic} event Event
*/ */
_use(type, rating, event) { _use(group, rating, name, event) {
const fillAll = event.getModifierState('Alt'); this.selectedRefId = group;
for (const slot of this.props.ship.getUtilities(undefined, true)) { if (rating !== null) this.selectedRefId += '-' + rating;
if (slot.isEmpty() || fillAll) {
slot.setItem(type, '', rating); this.props.ship.useUtility(group, rating, name, event.getModifierState('Alt'));
} this.props.onChange();
}
this._close(); this._close();
} }
/**
* Empty all utility slots on right-click
*/
_contextMenu() {
this._empty();
}
/** /**
* Create all HardpointSlots (React component) for the slots * Create all HardpointSlots (React component) for the slots
* @return {Array} Array of HardpointSlots * @return {Array} Array of HardpointSlots
*/ */
_getSlots() { _getSlots() {
let slots = []; let slots = [];
let { ship, currentMenu, propsToShow, onPropToggle } = this.props; let { ship, currentMenu } = this.props;
let hardpoints = ship.hardpoints;
let { originSlot, targetSlot } = this.state; let { originSlot, targetSlot } = this.state;
let availableModules = ship.getAvailableModules();
for (let h of ship.getUtilities(undefined, true)) { for (let i = 0, l = hardpoints.length; i < l; i++) {
slots.push(<Slot let h = hardpoints[i];
key={h.object.Slot} if (h.maxClass === 0) {
currentMenu={currentMenu} slots.push(<HardpointSlot
drag={this._drag.bind(this, h)} key={i}
dragOver={this._dragOverSlot.bind(this, h)} maxClass={h.maxClass}
drop={this._drop} availableModules={() => availableModules.getHps(h.maxClass)}
dropClass={this._dropClass(h, originSlot, targetSlot)} onOpen={this._openMenu.bind(this,h)}
m={h} onSelect={this._selectModule.bind(this, h)}
enabled={h.enabled ? true : false} onChange={this.props.onChange}
propsToShow={propsToShow} selected={currentMenu == h}
onPropToggle={onPropToggle} drag={this._drag.bind(this, h)}
/>); dragOver={this._dragOverSlot.bind(this, h)}
drop={this._drop}
dropClass={this._dropClass(h, originSlot, targetSlot)}
ship={ship}
m={h.m}
enabled={h.enabled ? true : false}
/>);
}
} }
return slots; return slots;
@@ -73,34 +101,33 @@ export default class UtilitySlotSection extends SlotSection {
* @param {Function} translate Translate function * @param {Function} translate Translate function
* @return {React.Component} Section menu * @return {React.Component} Section menu
*/ */
_getSectionMenu() { _getSectionMenu(translate) {
const { translate } = this.context.language;
let _use = this._use; let _use = this._use;
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}> return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li> <li className='lc' tabIndex='0' onClick={this._empty} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li> <li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('sb')}</div> <div className='select-group cap'>{translate('sb')}</div>
<ul> <ul>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '5')}>A</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-A'] = smRef}>A</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '4')}>B</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-B'] = smRef}>B</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '3')}>C</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-C'] = smRef}>C</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '2')}>D</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-D'] = smRef}>D</li>
<li className='c' tabIndex='0' onClick={_use.bind(this, 'shieldbooster', '1')}>E</li> <li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['sb-E'] = smRef}>E</li>
</ul> </ul>
<div className='select-group cap'>{translate('hs')}</div> <div className='select-group cap'>{translate('hs')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'heatsinklauncher', '')}>{translate('Heat Sink Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['hs'] = smRef}>{translate('Heat Sink Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('ch')}</div> <div className='select-group cap'>{translate('ch')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'chafflauncher', '')}>{translate('Chaff Launcher')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['ch'] = smRef}>{translate('Chaff Launcher')}</li>
</ul> </ul>
<div className='select-group cap'>{translate('po')}</div> <div className='select-group cap'>{translate('po')}</div>
<ul> <ul>
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'pointdefence', '')}>{translate('Point Defence')}</li> <li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')} onKeyDown={this._keyDown} ref={smRef => this.sectionRefArr['po'] = smRef}>{translate('Point Defence')}</li>
</ul> </ul>
</div>; </div>;
} }

View File

@@ -1,80 +1,80 @@
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import React, { PropTypes } from 'react'; import React, { PropTypes } from 'react';
import ContainerDimensions from 'react-container-dimensions'; import ContainerDimensions from 'react-container-dimensions';
import { BarChart, Bar, XAxis, YAxis, LabelList } from 'recharts'; import { BarChart, Bar, XAxis, YAxis, LabelList } from 'recharts';
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D']; const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
const LABEL_COLOUR = '#000000'; const LABEL_COLOUR = '#000000';
const AXIS_COLOUR = '#C06400'; const AXIS_COLOUR = '#C06400';
const ASPECT = 1; const ASPECT = 1;
const merge = function(one, two) { const merge = function(one, two) {
return Object.assign({}, one, two); return Object.assign({}, one, two);
}; };
/** /**
* A vertical bar chart * A vertical bar chart
*/ */
export default class VerticalBarChart extends TranslatedComponent { export default class VerticalBarChart extends TranslatedComponent {
static propTypes = { static propTypes = {
data : PropTypes.array.isRequired, data : PropTypes.array.isRequired,
yMax : PropTypes.number yMax : PropTypes.number
}; };
/** /**
* Constructor * Constructor
* @param {Object} props React Component properties * @param {Object} props React Component properties
* @param {Object} context React Component context * @param {Object} context React Component context
*/ */
constructor(props, context) { constructor(props, context) {
super(props); super(props);
this._termtip = this._termtip.bind(this); this._termtip = this._termtip.bind(this);
} }
/** /**
* Render the bar chart * Render the bar chart
* @returns {Object} the markup * @returns {Object} the markup
*/ */
render() { render() {
const { tooltip, termtip } = this.context; const { tooltip, termtip } = this.context;
// Calculate maximum for Y // Calculate maximum for Y
let dataMax = Math.max(...this.props.data.map(d => d.value)); let dataMax = Math.max(...this.props.data.map(d => d.value));
if (dataMax == -Infinity) dataMax = 0; if (dataMax == -Infinity) dataMax = 0;
let yMax = this.props.yMax ? Math.round(this.props.yMax) : 0; let yMax = this.props.yMax ? Math.round(this.props.yMax) : 0;
const localMax = Math.max(dataMax, yMax); const localMax = Math.max(dataMax, yMax);
return ( return (
<ContainerDimensions> <ContainerDimensions>
{ ({ width }) => ( { ({ width }) => (
<div width='100%'> <div width='100%'>
<BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}> <BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}>
<XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' /> <XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' />
<YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/> <YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/>
<Bar dataKey='value' fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}> <Bar dataKey='value' fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}>
<LabelList dataKey='value' position='insideTop'/> <LabelList dataKey='value' position='insideTop'/>
</Bar> </Bar>
</BarChart> </BarChart>
</div> </div>
)} )}
</ContainerDimensions> </ContainerDimensions>
); );
} }
/** /**
* Generate a term tip * Generate a term tip
* @param {Object} d the data * @param {Object} d the data
* @param {number} i the index * @param {number} i the index
* @param {Object} e the event * @param {Object} e the event
* @returns {Object} termtip markup * @returns {Object} termtip markup
*/ */
_termtip(d, i, e) { _termtip(d, i, e) {
if (this.props.data[i].tooltip) { if (this.props.data[i].tooltip) {
return this.context.termtip(this.props.data[i].tooltip, e); return this.context.termtip(this.props.data[i].tooltip, e);
} else { } else {
return null; return null;
} }
} }
} }

View File

@@ -2,99 +2,194 @@ import React from 'react';
import PropTypes from 'prop-types'; import PropTypes from 'prop-types';
import TranslatedComponent from './TranslatedComponent'; import TranslatedComponent from './TranslatedComponent';
import LineChart from '../components/LineChart'; import LineChart from '../components/LineChart';
import { moduleReduce } from 'ed-forge/lib/src/helper'; import * as Calc from '../shipyard/Calculations';
import { chain, keys, mapValues, values } from 'lodash';
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777']; const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
const PORTION_MAPPINGS = {
'absolute': 'absolutedamageportion',
'explosive': 'explosivedamageportion',
'kinetic': 'kineticdamageportion',
'thermal': 'thermicdamageportion',
};
const MULTS = keys(PORTION_MAPPINGS);
// TODO: help with this in ed-forge
/**
* .
* @param {Object} opponentDefence .
* @returns {Object} .
*/
function defenceToMults(opponentDefence) {
return chain(opponentDefence)
.pick(MULTS)
.mapKeys((v, k) => PORTION_MAPPINGS[k])
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
.value();
}
/** /**
* Weapon damage chart * Weapon damage chart
*/ */
export default class WeaponDamageChart extends TranslatedComponent { export default class WeaponDamageChart extends TranslatedComponent {
static propTypes = { static propTypes = {
code: PropTypes.string.isRequired,
ship: PropTypes.object.isRequired, ship: PropTypes.object.isRequired,
opponentDefence: PropTypes.object.isRequired, opponent: PropTypes.object.isRequired,
hull: PropTypes.bool.isRequired,
engagementRange: PropTypes.number.isRequired, engagementRange: PropTypes.number.isRequired,
opponentSys: PropTypes.number.isRequired,
marker: PropTypes.string.isRequired
}; };
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props);
}
/**
* Set the initial weapons state
*/
componentWillMount() {
const weaponNames = this._weaponNames(this.props.ship, this.context);
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
const opponentArmour = Calc.armourMetrics(this.props.opponent);
const maxRange = this._calcMaxRange(this.props.ship);
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
}
/**
* Set the updated weapons state if our ship changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
* @return {boolean} Returns true if the component should be rerendered
*/
componentWillReceiveProps(nextProps, nextContext) {
if (nextProps.marker != this.props.marker) {
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
const maxRange = this._calcMaxRange(nextProps.ship);
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
this.setState({ weaponNames,
opponentShields,
opponentArmour,
maxRange,
maxDps,
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
});
}
return true;
}
/**
* Calculate the maximum range of a ship's weapons
* @param {Object} ship The ship
* @returns {int} The maximum range, in metres
*/
_calcMaxRange(ship) {
let maxRange = 1000; // Minimum
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const thisRange = ship.hardpoints[i].m.getRange();
if (thisRange > maxRange) {
maxRange = thisRange;
}
}
}
return maxRange;
}
/**
* Calculate the maximum sustained single-weapon DPS for this ship
* @param {Object} ship The ship
* @param {Object} opponent The opponent ship
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @return {number} The maximum sustained single-weapon DPS
*/
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
// Additional information to allow effectiveness calculations
let maxSDps = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
if (thisSDps > maxSDps) {
maxSDps = thisSDps;
}
}
}
return maxSDps;
}
/**
* Obtain the weapon names for this ship
* @param {Object} ship The ship
* @param {Object} context The context
* @return {array} The weapon names
*/
_weaponNames(ship, context) {
const translate = context.language.translate;
let names = [];
let num = 1;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
let engineering;
if (m.blueprint && m.blueprint.name) {
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
if (m.blueprint.special && m.blueprint.special.id) {
engineering += ', ' + translate(m.blueprint.special.name);
}
}
if (engineering) {
name = name + ' (' + engineering + ')';
}
names.push(name);
}
}
return names;
}
/**
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
* @param {Object} ship The ship
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
* @param {Object} opponent The target
* @param {Object} opponentShields The opponent's shields
* @param {Object} opponentArmour The opponent's armour
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
* @param {Object} engagementRange The engagement range
* @return {array} The array of weapon DPS
*/
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
let results = {};
let weaponNum = 0;
for (let i = 0; i < ship.hardpoints.length; i++) {
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
const m = ship.hardpoints[i].m;
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
}
}
return results;
}
/** /**
* Render damage dealt * Render damage dealt
* @return {React.Component} contents * @return {React.Component} contents
*/ */
render() { render() {
const { language } = this.context; const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
const { translate } = language; const { formats, translate, units } = language;
const { code, ship, opponentDefence, engagementRange } = this.props; const { maxRange } = this.state;
const { ship, opponent, engagementRange } = this.props;
const hardpoints = ship.getHardpoints(); const sortOrder = this._sortOrder;
const hardpointsMap = chain(hardpoints) const onCollapseExpand = this._onCollapseExpand;
.map((m) => [m.getSlot(), m])
.fromPairs() const code = `${ship.toString()}:${opponent.toString()}`;
.value();
const mults = defenceToMults(opponentDefence);
const cb = (range) => {
return mapValues(
hardpointsMap,
(m) => {
const sdps = m.get('sustaineddamagepersecond', true);
const resistanceMul = chain(mults)
.toPairs()
.map((pair) => {
const [k, mul] = pair;
return m.get(k, true) * mul;
})
.sum()
.value();
const falloff = m.get('damagefalloffrange', true);
const rangeMul = Math.min(1, Math.max(0,
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
));
return sdps * resistanceMul * rangeMul;
}
);
};
return ( return (
<div> <div>
<LineChart <LineChart
xMin={0} xMax={maxRange}
xMax={moduleReduce( yMax={this.state.maxDps}
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
)}
yMin={0}
// Factor in highest damage multiplier to get a safe upper bound
yMax={Math.max(1, ...values(mults)) * moduleReduce(
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
)}
xLabel={translate('range')} xLabel={translate('range')}
xUnit={translate('m')} xUnit={translate('m')}
yLabel={translate('sustaineddamagepersecond')} yLabel={translate('sdps')}
series={hardpoints.map((m) => m.getSlot())} series={this.state.weaponNames}
xMark={engagementRange} xMark={this.props.engagementRange}
colors={DAMAGE_DEALT_COLORS} colors={DAMAGE_DEALT_COLORS}
func={cb} func={this.state.calcSDpsFunc}
points={200} points={200}
code={code} code={code}
/> />

View File

@@ -8,6 +8,7 @@ import * as RU from './ru';
import * as PL from './pl'; import * as PL from './pl';
import * as PT from './pt'; import * as PT from './pt';
import * as CN from './cn'; import * as CN from './cn';
import * as KO from './ko';
import * as d3 from 'd3'; import * as d3 from 'd3';
let fallbackTerms = EN.terms; let fallbackTerms = EN.terms;
@@ -29,6 +30,7 @@ export function getLanguage(langCode) {
case 'pl': lang = PL; break; case 'pl': lang = PL; break;
case 'pt': lang = PT; break; case 'pt': lang = PT; break;
case 'cn': lang = CN; break; case 'cn': lang = CN; break;
case 'ko': lang = KO; break;
default: default:
lang = EN; lang = EN;
} }
@@ -97,5 +99,6 @@ export const Languages = {
ru: 'ру́сский', ru: 'ру́сский',
pl: 'polski', pl: 'polski',
pt: 'português', pt: 'português',
cn: '中文' cn: '中文',
ko: '한국어'
}; };

View File

@@ -398,6 +398,7 @@
"No modded components.": "没有改装的部件", "No modded components.": "没有改装的部件",
"Sending...": "发送中...", "Sending...": "发送中...",
"Send to EDEngineer": "发送至EDEngineer", "Send to EDEngineer": "发送至EDEngineer",
"Send to EDOMH": "发送至EDOMH",
"PHASE_UPLOAD_ORBIS": "上传到orbis.zone测试阶段", "PHASE_UPLOAD_ORBIS": "上传到orbis.zone测试阶段",
"orbis username": "orbis.zone的Email或用户名", "orbis username": "orbis.zone的Email或用户名",
"orbis password": "orbis.zone的密码", "orbis password": "orbis.zone的密码",

View File

@@ -1,16 +1,16 @@
export const formats = { export const formats = {
decimal: ',', decimal: ',',
thousands: '.', thousands: '.',
grouping: [3], grouping: [3],
currency: ['', ' €'], currency: ['', ' €'],
dateTime: '%A, der %e. %B %Y, %X', dateTime: '%A, der %e. %B %Y, %X',
date: '%d.%m.%Y', date: '%d.%m.%Y',
time: '%H:%M:%S', time: '%H:%M:%S',
periods: ['AM', 'PM'], // unused periods: ['AM', 'PM'], // unused
days: ['Sonntag', 'Montag', 'Dienstag', 'Mittwoch', 'Donnerstag', 'Freitag', 'Samstag'], days: ['Sonntag', 'Montag', 'Dienstag', 'Mittwoch', 'Donnerstag', 'Freitag', 'Samstag'],
shortDays: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'], shortDays: ['So', 'Mo', 'Di', 'Mi', 'Do', 'Fr', 'Sa'],
months: ['Januar', 'Februar', 'März', 'April', 'Mai', 'Juni', 'Juli', 'August', 'September', 'Oktober', 'November', 'Dezember'], months: ['Januar', 'Februar', 'März', 'April', 'Mai', 'Juni', 'Juli', 'August', 'September', 'Oktober', 'November', 'Dezember'],
shortMonths: ['Jan', 'Feb', 'Mrz', 'Apr', 'Mai', 'Jun', 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Dez'] shortMonths: ['Jan', 'Feb', 'Mrz', 'Apr', 'Mai', 'Jun', 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Dez']
}; };
export { default as terms } from './de.json'; export { default as terms } from './de.json';

View File

@@ -26,6 +26,9 @@
"PHRASE_NO_SPECIAL": "No experimental effect", "PHRASE_NO_SPECIAL": "No experimental effect",
"PHRASE_SHOPPING_LIST": "Stations that sell this build", "PHRASE_SHOPPING_LIST": "Stations that sell this build",
"PHRASE_SHOPPING_MATS": "Materials needed for this build", "PHRASE_SHOPPING_MATS": "Materials needed for this build",
"PHRASE_DIFFERENT_ROLLS": "Material requirements will differ, based on the number of rolls per grade, per module.",
"PHRASE_FOR_FINER_CONTROL": "For finer control over rolls per grade/module, a more accurate list of required mats and help in finding those mats, please consider using the export options below to ED Odyssey Materials Helper, or ED Engineer, or use the Crafting Lists feature on inara.cz.",
"PHRASE_ALL_MODULES_ALL_ROLLS": "The list below, assumes standard to G5 Engineered (approx 80% - 90%) with the rolls above, for ALL engineered modules in the build. You can adjust the number of rolls above for each grade, however it will still apply to all engineered modules in the build.",
"PHRASE_REFIT_SHOPPING_LIST": "Stations that sell required modules", "PHRASE_REFIT_SHOPPING_LIST": "Stations that sell required modules",
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Total amount of damage that can be taken from each damage type, if using all shield cells", "PHRASE_TOTAL_EFFECTIVE_SHIELD": "Total amount of damage that can be taken from each damage type, if using all shield cells",
"PHRASE_TIME_TO_LOSE_SHIELDS": "Shields will hold for", "PHRASE_TIME_TO_LOSE_SHIELDS": "Shields will hold for",
@@ -81,8 +84,10 @@
"TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Farthest possible range with no cargo, a full fuel tank, and jumping as far as possible each time", "TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Farthest possible range with no cargo, a full fuel tank, and jumping as far as possible each time",
"TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time", "TT_SUMMARY_LADEN_TOTAL_JUMP": "Farthest possible range with full cargo, a full fuel tank, and jumping as far as possible each time",
"HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes", "HELP_MODIFICATIONS_MENU": "Click on a number to enter a new value, or drag along the bar for small changes",
"PHRASE_FAIL_EDENGINEER": "Failed to send to EDEngineer (Launch EDEngineer and make sure the API is started then refresh the page.)", "PHRASE_ENSURE_EDOMH": "Ensure ED Odyssey Material Helper is installed and registered to handle edomh:// urls, else this button will do nothing!",
"PHRASE_FIREFOX_EDENGINEER": "Send to EDEngineer is incompatible with Firefox.", "PHRASE_FIREFOX_EDENGINEER": "Sending to EDEngineer is not compatible with Firefox's security settings. Please try again with Chrome.",
"PHRASE_FAILED_TO_FIND_EDENGINEER": "Failed to find ED Engineer API. Please ensure it is running and try again.",
"MISSING_MODULES": "Missing Modules",
"am": "Auto Field-Maintenance Unit", "am": "Auto Field-Maintenance Unit",
"bh": "Bulkheads", "bh": "Bulkheads",
"bl": "Beam Laser", "bl": "Beam Laser",
@@ -93,6 +98,7 @@
"ch": "Chaff Launcher", "ch": "Chaff Launcher",
"cr": "Cargo Rack", "cr": "Cargo Rack",
"cs": "Manifest Scanner", "cs": "Manifest Scanner",
"csl": "Caustic Sink Launcher",
"dc": "Docking Computer", "dc": "Docking Computer",
"ec": "Electronic Countermeasure", "ec": "Electronic Countermeasure",
"fc": "Fragment Cannon", "fc": "Fragment Cannon",
@@ -108,10 +114,18 @@
"kw": "Kill Warrant Scanner", "kw": "Kill Warrant Scanner",
"ls": "Life Support", "ls": "Life Support",
"mc": "Multi-cannon", "mc": "Multi-cannon",
"mh": "Missing Weapon/Utility",
"mm": "Missing Module",
"advmc": "Multi-cannon (Advanced)",
"axmc": "AX Multi-cannon", "axmc": "AX Multi-cannon",
"axmce": "AX Multi-cannon (Enhanced)",
"ml": "Mining Laser", "ml": "Mining Laser",
"mlc": "Multi Limpet Controller",
"mr": "Missile Rack", "mr": "Missile Rack",
"amr": "Missile Rack (Advanced)",
"axmr": "AX Missile Rack", "axmr": "AX Missile Rack",
"axmre": "AX Missile Rack (Enhanced)",
"ews": "Experimental Weapon Stabilizer",
"mrp": "Module Reinforcement Package", "mrp": "Module Reinforcement Package",
"nl": "Mine Launcher", "nl": "Mine Launcher",
"pa": "Plasma Accelerator", "pa": "Plasma Accelerator",
@@ -156,8 +170,10 @@
"sua": "Supercruise Assist", "sua": "Supercruise Assist",
"t": "thrusters", "t": "thrusters",
"tp": "Torpedo Pylon", "tp": "Torpedo Pylon",
"ntp": "Nanite Torpedo Pylon",
"ul": "Burst Laser", "ul": "Burst Laser",
"Send To EDEngineer": "Send To EDEngineer", "Send To EDEngineer": "Send To EDEngineer",
"Send To EDOMH": "Send To EDOMH",
"ws": "Frame Shift Wake Scanner", "ws": "Frame Shift Wake Scanner",
"rpl": "Repair Limpet Controller", "rpl": "Repair Limpet Controller",
"rcpl": "Recon Limpet Controller", "rcpl": "Recon Limpet Controller",
@@ -208,6 +224,7 @@
"boost interval": "Boost interval", "boost interval": "Boost interval",
"total": "Total", "total": "Total",
"ammo": "Ammunition maximum", "ammo": "Ammunition maximum",
"info": "Info",
"boot": "Boot time", "boot": "Boot time",
"hacktime": "Hack time", "hacktime": "Hack time",
"brokenregen": "Broken regeneration rate", "brokenregen": "Broken regeneration rate",

16
src/app/i18n/ko.js Normal file
View File

@@ -0,0 +1,16 @@
export const formats = {
decimal: '.',
thousands: ',',
grouping: [3],
currency: ['₩', ''],
dateTime: '%a %b %e %X %Y',
date: '%Y/%m/%d',
time: '%H:%M:%S',
periods: ['오전', '오후'],
days: ['일요일', '월요일', '화요일', '수요일', '목요일', '금요일', '토요일'],
shortDays: ['일', '월', '화', '수', '목', '금', '토'],
months: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월'],
shortMonths: ['1월', '2월', '3월', '4월', '5월', '6월', '7월', '8월', '9월', '10월', '11월', '12월']
};
export { default as terms } from './ko.json';

369
src/app/i18n/ko.json Normal file

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@@ -13,7 +13,7 @@
"PHRASE_SG_RECOVER": "Восстановление с 0% до 50% объема щита, учитывая полный аккумулятор СИС в начале", "PHRASE_SG_RECOVER": "Восстановление с 0% до 50% объема щита, учитывая полный аккумулятор СИС в начале",
"PHRASE_UNLADEN": "Масса корабля без учета топлива и грузов", "PHRASE_UNLADEN": "Масса корабля без учета топлива и грузов",
"PHRASE_UPDATE_RDY": "Доступна новая версия. Нажмите для обновления.", "PHRASE_UPDATE_RDY": "Доступна новая версия. Нажмите для обновления.",
"PHRASE_ENGAGEMENT_RANGE": "Дистанция между кораблем и целью", "PHRASE_ENGAGEMENT_RANGE": "Дистанция между кораблём и целью",
"PHRASE_SELECT_BLUEPRINT": "Нажмите чтобы выбрать чертеж", "PHRASE_SELECT_BLUEPRINT": "Нажмите чтобы выбрать чертеж",
"PHRASE_BLUEPRINT_WORST": "Худшие основные значения для чертежа", "PHRASE_BLUEPRINT_WORST": "Худшие основные значения для чертежа",
"PHRASE_BLUEPRINT_FIFTY": "50% значения для чертежа", "PHRASE_BLUEPRINT_FIFTY": "50% значения для чертежа",
@@ -24,9 +24,9 @@
"PHRASE_BLUEPRINT_RESET": "Сбросить все модификаторы и чертеж", "PHRASE_BLUEPRINT_RESET": "Сбросить все модификаторы и чертеж",
"PHRASE_SELECT_SPECIAL": "Нажмите, чтобы выбрать экспериментальный эффект", "PHRASE_SELECT_SPECIAL": "Нажмите, чтобы выбрать экспериментальный эффект",
"PHRASE_NO_SPECIAL": "Без экспериментального эффекта", "PHRASE_NO_SPECIAL": "Без экспериментального эффекта",
"PHRASE_SHOPPING_LIST": "Станции, что продают эту сборку", "PHRASE_SHOPPING_LIST": "Станции, на которых продают эту сборку",
"PHRASE_SHOPPING_MATS": "Материалы которые нужны для сборки", "PHRASE_SHOPPING_MATS": "Материалы которые нужны для сборки",
"PHRASE_REFIT_SHOPPING_LIST": "Станции, что продают необходимые модули", "PHRASE_REFIT_SHOPPING_LIST": "Станции, на которых продают необходимые модули",
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Общий урон, что может быть нанесен в каждым типе, если используются все щитонакопители", "PHRASE_TOTAL_EFFECTIVE_SHIELD": "Общий урон, что может быть нанесен в каждым типе, если используются все щитонакопители",
"PHRASE_TIME_TO_LOSE_SHIELDS": "Щиты продержатся", "PHRASE_TIME_TO_LOSE_SHIELDS": "Щиты продержатся",
"PHRASE_TIME_TO_RECOVER_SHIELDS": "Щиты восстановятся за", "PHRASE_TIME_TO_RECOVER_SHIELDS": "Щиты восстановятся за",
@@ -37,36 +37,36 @@
"PHRASE_EFFECTIVE_ARMOUR": "Эффективная сила брони против разных типов урона", "PHRASE_EFFECTIVE_ARMOUR": "Эффективная сила брони против разных типов урона",
"PHRASE_DAMAGE_TAKEN": "% общих повреждений полученных в разных типах урона", "PHRASE_DAMAGE_TAKEN": "% общих повреждений полученных в разных типах урона",
"PHRASE_TIME_TO_LOSE_ARMOUR": "Броня продержится", "PHRASE_TIME_TO_LOSE_ARMOUR": "Броня продержится",
"PHRASE_MODULE_PROTECTION_EXTERNAL": "Защита гнезд", "PHRASE_MODULE_PROTECTION_EXTERNAL": "Защита гнёзд",
"PHRASE_MODULE_PROTECTION_INTERNAL": "Защита всех остальных модулей", "PHRASE_MODULE_PROTECTION_INTERNAL": "Защита всех остальных модулей",
"PHRASE_OVERALL_DAMAGE": "Разбивка источников устойчивого ДПС", "PHRASE_OVERALL_DAMAGE": "Разбивка источников устойчивого УвС",
"PHRASE_SHIELD_DAMAGE": "Подробности источников поддерживаемого ДПС против щитов", "PHRASE_SHIELD_DAMAGE": "Подробности источников поддерживаемого УвС против щитов",
"PHRASE_ARMOUR_DAMAGE": "Подробности источников поддерживаемого ДПС против брони", "PHRASE_ARMOUR_DAMAGE": "Подробности источников поддерживаемого УвС против брони",
"PHRASE_TIME_TO_REMOVE_SHIELDS": "Снимет щиты за", "PHRASE_TIME_TO_REMOVE_SHIELDS": "Снимет щиты за",
"PHRASE_MULTI_CREW_CAPACITOR_POINTS": "Щелкните правой кновкой мыши чтобы объединить в группу.", "PHRASE_MULTI_CREW_CAPACITOR_POINTS": "Щелкните правой кновкой мыши чтобы объединить в группу.",
"TT_TIME_TO_REMOVE_SHIELDS": "Непрерывным огнем из всех орудий", "TT_TIME_TO_REMOVE_SHIELDS": "Непрерывным огнём из всех орудий",
"PHRASE_TIME_TO_REMOVE_ARMOUR": "Снимет броню за", "PHRASE_TIME_TO_REMOVE_ARMOUR": "Снимет броню за",
"TT_TIME_TO_REMOVE_ARMOUR": "Непрерывным огнем из всех орудий", "TT_TIME_TO_REMOVE_ARMOUR": "Непрерывным огнём из всех орудий",
"PHRASE_TIME_TO_DRAIN_WEP": "Опустошит ОРУ за", "PHRASE_TIME_TO_DRAIN_WEP": "Опустошит ОРУ за",
"TT_TIME_TO_DRAIN_WEP": "Время, за которое опустошится аккумулятор ОРУ при стрельбе из всех орудий", "TT_TIME_TO_DRAIN_WEP": "Время, за которое опустошится аккумулятор ОРУ при стрельбе из всех орудий",
"TT_TIME_TO_LOSE_SHIELDS": "Против поддерживаемой стрельбы из всех орудий противника", "TT_TIME_TO_LOSE_SHIELDS": "Против поддерживаемой стрельбы из всех орудий противника",
"TT_TIME_TO_LOSE_ARMOUR": "Против поддерживаемой стрельбы из всех орудий противника", "TT_TIME_TO_LOSE_ARMOUR": "Против поддерживаемой стрельбы из всех орудий противника",
"TT_MODULE_ARMOUR": "Броня, защищающая модули от урона", "TT_MODULE_ARMOUR": "Броня, защищающая модули от урона",
"TT_MODULE_PROTECTION_EXTERNAL": "Процент урона, перенаправленного от гнезд на наборы для усиления модулей", "TT_MODULE_PROTECTION_EXTERNAL": "Процент урона, перенаправленного от гнезд на наборы для усиления модулей",
"TT_MODULE_PROTECTION_INTERNAL": "Процент урона, перенаправленного от модулей вне гнезд на наборы для усиления модулей", "TT_MODULE_PROTECTION_INTERNAL": "Процент урона, перенаправленного от модулей вне гнёзд на наборы для усиления модулей",
"TT_EFFECTIVE_SDPS_SHIELDS": "Реальный поддерживаемый ДПС пока аккумулятор ОРУ не пуст", "TT_EFFECTIVE_SDPS_SHIELDS": "Реальный поддерживаемый УвС пока ёмкость ОРУ не пуста",
"TT_EFFECTIVENESS_SHIELDS": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью без пунктов в СИС на 0 метрах", "TT_EFFECTIVENESS_SHIELDS": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью без пунктов в СИС на 0 метрах",
"TT_EFFECTIVE_SDPS_ARMOUR": "Реальный поддерживаемый ДПС пока аккумулятор ОРУ не пуст", "TT_EFFECTIVE_SDPS_ARMOUR": "Реальный поддерживаемый УвС пока аккумулятор ОРУ не пуст",
"TT_EFFECTIVENESS_ARMOUR": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью на 0 метрах", "TT_EFFECTIVENESS_ARMOUR": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью на 0 метрах",
"PHRASE_EFFECTIVE_SDPS_SHIELDS": ДПС против щитов", "PHRASE_EFFECTIVE_SDPS_SHIELDS": УвС против щитов",
"PHRASE_EFFECTIVE_SDPS_ARMOUR": ДПС против брони", "PHRASE_EFFECTIVE_SDPS_ARMOUR": УвС против брони",
"TT_SUMMARY_SPEED": "С полным топливным баком и 4 пунктами в ДВГ", "TT_SUMMARY_SPEED": "С полным топливным баком и 4 пунктами в ДВГ",
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "Маневровые двигатели выключены или превышена максимальная масса с топливом и грузом", "TT_SUMMARY_SPEED_NONFUNCTIONAL": "Маневровые двигатели выключены или превышена максимальная масса с топливом и грузом",
"TT_SUMMARY_BOOST": "С полным топливным баком и 4 пунктами в ДВГ", "TT_SUMMARY_BOOST": "С полным топливным баком и 4 пунктами в ДВГ",
"TT_SUMMARY_BOOST_INTERVAL": "Время заполнения с 4 пунктами в СИС", "TT_SUMMARY_BOOST_INTERVAL": "Время заполнения с 4 пунктами в СИС",
"TT_SUMMARY_BOOST_NONFUNCTIONAL": "Распределитель питания не может обеспечить достаточно энергии для форсажа", "TT_SUMMARY_BOOST_NONFUNCTIONAL": "Распределитель питания не может обеспечить достаточно энергии для форсажа",
"TT_SUMMARY_SHIELDS": "Чистая сила щита, включая усилители", "TT_SUMMARY_SHIELDS": "Чистая сила щита, включая усилители",
"TT_SUMMARY_SHIELDS_SCB": "Прочность щита, включая бустеры и SCB", "TT_SUMMARY_SHIELDS_SCB": "Прочность щита, включая бустеры и щитонакопители",
"TT_SUMMARY_SHIELDS_NONFUNCTIONAL": "Шитогенератор отсутствует или выключен", "TT_SUMMARY_SHIELDS_NONFUNCTIONAL": "Шитогенератор отсутствует или выключен",
"TT_SUMMARY_INTEGRITY": "Целостность корабля, включая переборки и наборы для усиления корпуса", "TT_SUMMARY_INTEGRITY": "Целостность корабля, включая переборки и наборы для усиления корпуса",
"TT_SUMMARY_HULL_MASS": "Масса корпуса без каких-либо модулей", "TT_SUMMARY_HULL_MASS": "Масса корпуса без каких-либо модулей",
@@ -88,22 +88,23 @@
"bl": "Пучковый лазер", "bl": "Пучковый лазер",
"bsg": "Двухпоточный щитогенератор", "bsg": "Двухпоточный щитогенератор",
"c": "Пушка", "c": "Пушка",
"causres": "Каустическое сопротивление", "causres": "Сопротивление едк.урону",
"Caustic resistance": "Каустическое сопротивление", "Caustic resistance": "Сопротивление едк.урону",
"cc": "Контроллер магнитного снаряда для сбора", "cc": "Контроллер дронов-сборщиков",
"ch": "Разбрасыватель дипольных отражателей", "ch": "Разбрасыватель дипольных отражателей",
"cr": "Грузовой стеллаж", "cr": "Грузовой стеллаж",
"cs": "Сканер содержимого", "cs": "Сканер содержимого",
"csl": "Антикор катапульта",
"dc": "Стыковочный компьютер", "dc": "Стыковочный компьютер",
"ec": "Электр. противодействие", "ec": "Радиоэлектронное подавление",
"fc": "Залповое орудие", "fc": "Залповое орудие",
"fh": "Ангар для истребителя", "fh": "Ангар для истребителя",
"fi": "FSD-перехватчик", "fi": "FSD-перехватчик",
"fs": "Топливозаборник", "fs": "Топливозаборник",
"fsd": "Рамочно-сместительный двигатель", "fsd": "Рамочно-сместительный двигатель",
"ft": "Топливный бак", "ft": "Топливный бак",
"fx": "Контроллер магнитного снаряда для топлива", "fx": "Контроллер дронов-заправщиков",
"hb": "Контроллер магнитного снаряда для взлома трюма", "hb": "Контроллер дронов-взломщиков трюмов",
"hr": "Набор для усиления корпуса", "hr": "Набор для усиления корпуса",
"hs": "Теплоотводная катапульта", "hs": "Теплоотводная катапульта",
"kw": "Сканер преступников", "kw": "Сканер преступников",
@@ -111,13 +112,14 @@
"mc": "Многоствольное орудие", "mc": "Многоствольное орудие",
"axmc": "Многоствольное орудие АИ", "axmc": "Многоствольное орудие АИ",
"ml": "Проходочный лазер", "ml": "Проходочный лазер",
"mr": "Ракетный лоток", "mr": "Блок ракет",
"axmr": "Блок ракет АИ", "axmr": "Блок ракет АИ",
"ews": "Стабилизатор экспериментального вооружения",
"mrp": "Набор для усиления модуля", "mrp": "Набор для усиления модуля",
"nl": "Мины", "nl": "Мины",
"pa": "Ускоритель плазмы", "pa": "Ускоритель плазмы",
"pas": "Комплект для сближения с планетой", "pas": "Комплект для сближения с планетой",
"pc": "Контроллер магнитного снаряда для геологоразведки", "pc": "Контроллер дронов-геологоразведчиков",
"pce": "Каюта пассажира эконом-класса", "pce": "Каюта пассажира эконом-класса",
"passenger capacity": "Количество пассажиров", "passenger capacity": "Количество пассажиров",
"pci": "Каюта пассажира бизнес-класса", "pci": "Каюта пассажира бизнес-класса",
@@ -143,36 +145,38 @@
"gsc": "Осколочное орудие Стражей", "gsc": "Осколочное орудие Стражей",
"psg": "Призматический щитогенератор", "psg": "Призматический щитогенератор",
"pv": "Гараж для планетарного транспорта", "pv": "Гараж для планетарного транспорта",
"rf": "Устройство переработки", "rf": "Очиститель",
"rfl": "Зенитная установка (снаряды с дистанционным подрывом)", "rfl": "Зенитная установка (снаряды с дистанционным подрывом)",
"rg": "Электромагнитная пушка", "rg": "Рельсотрон",
"rsl": "Дроны-исследователи", "rsl": "Контроллер дронов-исследователей",
"s": "Сенсоры", "s": "Сенсоры",
"sb": "Усилитель щита", "sb": "Усилитель щита",
"sc": "Сканер обнаружения", "sc": "Сканер обнаружения",
"scb": "Щитонакопитель", "scb": "Щитонакопитель",
"sfn": "Нейтрализатор глушащего поля", "sfn": "Нейтрализатор отключающего поля",
"sg": "Щитогенератор", "sg": "Щитогенератор",
"ss": "Сканер поверхностей", "ss": "Сканер поверхностей",
"sua": "Помощь в гиперкрейсерском режиме", "sua": "Помощь в гиперкрейсерском режиме",
"t": "Маневровые двигатели", "t": "Маневровые двигатели",
"tp": "Торпедная стойка", "tp": "Торпедная установка",
"ul": "Пульсирующие лазеры", "ul": "Пульсирующий лазер",
"Send To EDEngineer": "Отправить в EDEngineer", "Send To EDEngineer": "Отправить в EDEngineer",
"Send To EDOMH": "Отправить в EDOMH",
"ws": "Сканер следа FSD", "ws": "Сканер следа FSD",
"rpl": "Дроны-ремонтники", "rpl": "Контроллер дронов-ремонтников",
"rcpl": "Дроны-разведчики", "rcpl": "Контроллер дронов-разведчиков",
"xs": "Сканер «инопланетянин»", "xs": "Ксено-сканер",
"tbem": "Блок энзимных ракет", "tbem": "Блок энзимных ракет",
"tbrfl": "Установка для стрельбы стреловидными снарядами с дистанционным подрывом", "tbrfl": "Установка для стрельбы стреловидными снарядами с дистанционным подрывом",
"dtl": "Дроны-очистители", "dtl": "Контроллер дронов-очистителей",
"mahr": "Набор для усиления корпуса из Метасплава", "mlc": "Мультиконтроллер",
"mahr": "Метасплавное усиление корпуса",
"emptyrestricted": "пусто (ограниченно)", "emptyrestricted": "пусто (ограниченно)",
"damage dealt to": "Урон нанесен", "damage dealt to": "Урон нанесён",
"damage received from": "Урон получен от", "damage received from": "Урон получен от",
"against shields": "Против щитов", "against shields": "Против щитов",
"against hull": "Против корпуса", "against hull": "Против корпуса",
"total effective shield": "Общие эффективные щиты", "total effective shield": "Общая эффективность щита",
"ammunition": "Припасы", "ammunition": "Припасы",
"secs": "с", "secs": "с",
"bays": "Ячейки", "bays": "Ячейки",
@@ -201,7 +205,7 @@
"shield cells": "Щитонакопители", "shield cells": "Щитонакопители",
"recovery": "включение", "recovery": "включение",
"recharge": "перезарядка", "recharge": "перезарядка",
"engine pips": "Пункты в двигателе", "engine pips": "Ячейки питания на ДВГ",
"4b": "4 пункта и Форсаж", "4b": "4 пункта и Форсаж",
"speed": "скорость", "speed": "скорость",
"pitch": "Тангаж", "pitch": "Тангаж",
@@ -287,12 +291,12 @@
"explosive": "Взрывч.", "explosive": "Взрывч.",
"kinetic": "Механич.", "kinetic": "Механич.",
"thermal": "Тепл.", "thermal": "Тепл.",
"caustic": "Каустич.", "caustic": "Едкий",
"generator": "Генератор", "generator": "Генератор",
"boosters": "Усилители", "boosters": "Усилители",
"cells": "Ячейки", "cells": "Ячейки",
"shield addition": Обавления к щиту", "shield addition": обавления к щиту",
"jump addition": Обавления к прыжку", "jump addition": обавления к прыжку",
"bulkheads": "Переборки", "bulkheads": "Переборки",
"reinforcement": "Усилители", "reinforcement": "Усилители",
"power and costs": "Энергия и стоимость", "power and costs": "Энергия и стоимость",
@@ -374,9 +378,9 @@
"/s": "/с", "/s": "/с",
"/min": "/мин", "/min": "/мин",
"m/s": "м/с", "m/s": "м/с",
"Ls": "Св.сек", "Ls": "Св.с",
"LY": "Св.лет", "LY": "Св.лет",
"CR": "кр.", "CR": "КР.",
"S": "М", "S": "М",
"M": "С", "M": "С",
"L": "Б", "L": "Б",
@@ -435,7 +439,7 @@
"deployed": "Открыты", "deployed": "Открыты",
"disabled": "Отключено", "disabled": "Отключено",
"discount": "Скидка", "discount": "Скидка",
"DPS": "УВС", "DPS": "УвС",
"efficiency": "Эффективность", "efficiency": "Эффективность",
"empty": "пусто", "empty": "пусто",
"ENG": "ДВГ", "ENG": "ДВГ",
@@ -449,7 +453,7 @@
"jumps": "Прыжков", "jumps": "Прыжков",
"laden": "Груж", "laden": "Груж",
"language": "Язык", "language": "Язык",
"maneuverability": "Маневренность", "maneuverability": "Манёвренность",
"max": "Макс", "max": "Макс",
"no": "Нет", "no": "Нет",
"pen": "ПБ", "pen": "ПБ",
@@ -462,7 +466,7 @@
"repair": "Починка", "repair": "Починка",
"ret": "Убр", "ret": "Убр",
"retracted": "Убрано", "retracted": "Убрано",
"ROF": "В\/сек", "ROF": "В\/с",
"save": "Сохранить", "save": "Сохранить",
"sell": "Продать", "sell": "Продать",
"settings": "Настройки", "settings": "Настройки",
@@ -492,7 +496,7 @@
"module": "модуль", "module": "модуль",
"announcements": "объявления", "announcements": "объявления",
"resistance": "сопротивление", "resistance": "сопротивление",
"Lightweight Alloy": егкие сплавы", "Lightweight Alloy": ёгкие сплавы",
"base": "базовые", "base": "базовые",
"core module classes": "основные модули", "core module classes": "основные модули",
"Group highlighted ships": "Сгруппировать выделенные корабли", "Group highlighted ships": "Сгруппировать выделенные корабли",
@@ -511,7 +515,7 @@
"maximum speed": "максимальная скорость", "maximum speed": "максимальная скорость",
"maximum range": "максимальная дальность", "maximum range": "максимальная дальность",
"shortlink": "короткая ссылка", "shortlink": "короткая ссылка",
"guardian": "стражи", "guardian": "Стражи",
"engineers": "инженеры", "engineers": "инженеры",
"component": "компонент", "component": "компонент",
"amount": "кол-во", "amount": "кол-во",
@@ -520,35 +524,35 @@
"Heat Sink Launcher": "Теплоотводная катапульта", "Heat Sink Launcher": "Теплоотводная катапульта",
"scanners": "сканеры", "scanners": "сканеры",
"experimental": "экспериментальное", "experimental": "экспериментальное",
"mining": "шахтерство", "mining": "добыча ресурсов",
"lasers": "лазеры", "lasers": "лазеры",
"ordnance": "артиллерия", "ordnance": "артиллерия",
"projectiles": "с боеприпасами", "projectiles": "с боеприпасами",
"hangars": "ангары", "hangars": "ангары",
"limpet controllers": "контроллеры снарядов", "limpet controllers": "контроллеры дронов",
"passenger cabins": "каюты пассажиров", "passenger cabins": "каюты пассажиров",
"structural reinforcement": "структурные усиления", "structural reinforcement": "усиление конструктива",
"flight assists": "помощники в полете", "flight assists": "помощь в полёте",
"modifications": "модификации", "modifications": "модификации",
"wep_reload": "перезарядка", "wep_reload": "перезарядка",
"optimal multiplier": "оптимальный усилитель", "optimal multiplier": "оптимальный усилитель",
"Cargo Hatch": "Грузовой люк", "Cargo Hatch": "Грузовой люк",
"Chaff Launcher": "Разбрасыватель дипольных отражателей", "Chaff Launcher": "Разбрасыватель дипольных отражателей",
"Point Defence": "Точечная оборона", "Point Defence": "Точечная оборона",
"Electronic Countermeasure": "Электронное противодействие", "Electronic Countermeasure": "Радиоэлектронное подавление",
"Xeno Scanner": "Сканер «инопланетянин»", "Xeno Scanner": "Ксено-сканер",
"Shutdown Field Neutraliser": "Нейтрализатор глушащего поля", "Shutdown Field Neutraliser": "Нейтрализатор отключающего поля",
"Disruptor": "Диверсант", "Disruptor": "«Диверсант»",
"Pacifier": "Миротворец", "Pacifier": "«Миротворец»",
"Advanced Plasma Accelerator": "Улучшенный ускоритель плазмы", "Advanced Plasma Accelerator": "Улучшенный ускоритель плазмы",
"Cytoscrambler": "Дезинтегратор", "Cytoscrambler": "«Дезинтегратор»",
"Retributor": "Каратель", "Retributor": "«Каратель»",
"Enforcer": "Убийца", "Enforcer": "«Убийца»",
"Imperial Hammer": "Имперский молот", "Imperial Hammer": "«Имперский молот»",
"Rocket Propelled FSD Disruptor": "Ракетный FSD-разрушитель", "Rocket Propelled FSD Disruptor": "Ракетный FSD-разрушитель",
"Pack-Hound": "Гончие", "Pack-Hound": "«Гончие»",
"Shock Mine Launcher": "Установщик шоковых мин", "Shock Mine Launcher": "Установщик шоковых мин",
"Mining Lance": "Копье шахтера", "Mining Lance": "«Копьё шахтера»",
"Corrosion Resistant": "Коррозийно-устойчивый стеллаж", "Corrosion Resistant": "Коррозийно-устойчивый стеллаж",
"Standard Docking Computer": "Стандартный стыковочный компьютер", "Standard Docking Computer": "Стандартный стыковочный компьютер",
"Advanced Docking Computer": "Улучшенный стыковочный компьютер", "Advanced Docking Computer": "Улучшенный стыковочный компьютер",
@@ -557,20 +561,20 @@
"Guardian Power Distributor": "Рапределитель питания Стражей", "Guardian Power Distributor": "Рапределитель питания Стражей",
"Enhanced Performance": "Усиленные маневровые двигатели", "Enhanced Performance": "Усиленные маневровые двигатели",
"Guardian Hybrid Power Plant": "Гибридная силовая установка Стражей", "Guardian Hybrid Power Plant": "Гибридная силовая установка Стражей",
"Reinforced Alloy": "Укрепленные сплавы", "Reinforced Alloy": "Укреплённые сплавы",
"Military Grade Composite": "Композит военного класса", "Military Grade Composite": "Композит военного класса",
"Mirrored Surface Composite": "Композит с зеркальной поверхностью", "Mirrored Surface Composite": "Композит с зеркальной поверхностью",
"Reactive Surface Composite": "Композит с реактивной поверхностью", "Reactive Surface Composite": "Композит с реактивной поверхностью",
"Proto Light Alloys": "Опытные легкие сплавы", "Proto Light Alloys": "Опытные лёгкие сплавы",
"Ammo capacity": "Вместимость магазина", "Ammo capacity": "Вместимость магазина",
"Lightweight": "Облегченный", "Lightweight": "Облегчённый",
"Reinforced": "Усиленный", "Reinforced": "Усиленный",
"Shielded": "Защищенный", "Shielded": "Защищённый",
"Fast scan": "Быстрое сканирование", "Fast scan": "Быстрое сканирование",
"Long range": "Дальнего действия", "Long range": "Дальнего действия",
"Wide angle": "Широкоугольный", "Wide angle": "Широкоугольный",
"Blast resistant": "Взрывостойкий", "Blast resistant": "Взрывостойкий",
"Heavy duty": "Надежный", "Heavy duty": "Надёжный",
"Kinetic resistant": "Противокинетический", "Kinetic resistant": "Противокинетический",
"Resistance augmented": "С универсальной защитой", "Resistance augmented": "С универсальной защитой",
"Thermal resistant": "Термостойкий", "Thermal resistant": "Термостойкий",
@@ -622,7 +626,7 @@
"Penetrator Munitions": "Бронебойные боеголовки", "Penetrator Munitions": "Бронебойные боеголовки",
"Mass lock munition": "Боеприпасы с гравитационным захватом", "Mass lock munition": "Боеприпасы с гравитационным захватом",
"Mass Lock Munition": "Боеприпасы с гравитационным захватом", "Mass Lock Munition": "Боеприпасы с гравитационным захватом",
"Reverberating cascade": "Отраженный залп", "Reverberating cascade": "Отражённый залп",
"Shift-lock canister": "Рамоблокирующая кассета", "Shift-lock canister": "Рамоблокирующая кассета",
"Ion disruptor": "Ионный дестабилизатор", "Ion disruptor": "Ионный дестабилизатор",
"Radiant Canister": "Светящаяся кассета", "Radiant Canister": "Светящаяся кассета",
@@ -639,7 +643,7 @@
"Reflective Plating": "Отражающая броня", "Reflective Plating": "Отражающая броня",
"Angled Plating": "Угловая броня", "Angled Plating": "Угловая броня",
"Layered Plating": "Многослойная броня", "Layered Plating": "Многослойная броня",
"Deep Plating": "Утолщенная броня", "Deep Plating": "Утолщённая броня",
"Expanded Probe Scanning Radius": "Увеличение радиуса сканирования зондов", "Expanded Probe Scanning Radius": "Увеличение радиуса сканирования зондов",
"High charge capacity": "Высокоёмкий", "High charge capacity": "Высокоёмкий",
"Charge enhanced": "Быстрозаряжающийся", "Charge enhanced": "Быстрозаряжающийся",
@@ -666,8 +670,8 @@
"Combat": "Боец", "Combat": "Боец",
"Trader": "Торговец", "Trader": "Торговец",
"Explorer": "Исследователь", "Explorer": "Исследователь",
"Planetary Explorer": "Планетарный исследователь", "Planetary Explorer": "Исследователь планет",
"Miner": "Шахтер", "Miner": "Старатель",
"Racer": "Гонщик", "Racer": "Гонщик",
"Aberrant Shield Pattern Analysis": "Анализ аномального поведения щита", "Aberrant Shield Pattern Analysis": "Анализ аномального поведения щита",
@@ -691,7 +695,7 @@
"Chemical Manipulators": "Манипуляторы для работы с химикатами", "Chemical Manipulators": "Манипуляторы для работы с химикатами",
"Chemical Processors": "Оборудование для химобработки", "Chemical Processors": "Оборудование для химобработки",
"Chromium": "Хром", "Chromium": "Хром",
"Classified Scan Databanks": "Засекреченные базы данных сканированоя", "Classified Scan Databanks": "Засекреченные базы данных сканирования",
"Classified Scan Fragment": "Засекреченные фрагменты данных сканирования", "Classified Scan Fragment": "Засекреченные фрагменты данных сканирования",
"Compound Shielding": "Многоступенчатая защита", "Compound Shielding": "Многоступенчатая защита",
"Conductive Ceramics": "Проводящая керамика", "Conductive Ceramics": "Проводящая керамика",
@@ -702,7 +706,7 @@
"Cracked Industrial Firmware": "Взломанные промышленные микропрограммы", "Cracked Industrial Firmware": "Взломанные промышленные микропрограммы",
"Datamined Wake Exceptions": "Исключения из глубинного анализа данных следа", "Datamined Wake Exceptions": "Исключения из глубинного анализа данных следа",
"Decoded Emission Data": "Расшифрованные данные об излучении", "Decoded Emission Data": "Расшифрованные данные об излучении",
"Distorted Shield Cycle Recordings": "Поврежденные цикличные записи щита", "Distorted Shield Cycle Recordings": "Повреждённые цикличные записи щита",
"Divergent Scan Data": "Неформатные данные сканирования", "Divergent Scan Data": "Неформатные данные сканирования",
"Eccentric Hyperspace Trajectories": "Аномальные траектории в гиперпространстве", "Eccentric Hyperspace Trajectories": "Аномальные траектории в гиперпространстве",
"Electrochemical Arrays": "Электрохимические массивы", "Electrochemical Arrays": "Электрохимические массивы",
@@ -717,7 +721,7 @@
"Heat Dispersion Plate": "Теплорассеивающая пластина", "Heat Dispersion Plate": "Теплорассеивающая пластина",
"Heat Exchangers": "Теплообменные агрегаты", "Heat Exchangers": "Теплообменные агрегаты",
"Heat Vanes": "Тепловые заслонки", "Heat Vanes": "Тепловые заслонки",
"High Density Composites": "Высокоплотные композиты", "High Density Composites": "Высокоплотностные композиты",
"Hybrid Capacitors": "Гибридные конденсаторы", "Hybrid Capacitors": "Гибридные конденсаторы",
"Imperial Shielding": "Имперская защита", "Imperial Shielding": "Имперская защита",
"Improvised Components": "Кустарные компоненты", "Improvised Components": "Кустарные компоненты",
@@ -731,8 +735,8 @@
"Mercury": "Ртуть", "Mercury": "Ртуть",
"Military Grade Alloys": "Сплавы военного назначения", "Military Grade Alloys": "Сплавы военного назначения",
"Military Supercapacitors": "Военные суперконденсаторы", "Military Supercapacitors": "Военные суперконденсаторы",
"Modified Consumer Firmware": "Измененные пользовательские микропрограммы", "Modified Consumer Firmware": "Изменённые пользовательские микропрограммы",
"Modified Embedded Firmware": "Измененные встроенные микропрограммы", "Modified Embedded Firmware": "Изменённые встроенные микропрограммы",
"Molybdenum": "Молибден", "Molybdenum": "Молибден",
"Nickel": "Никель", "Nickel": "Никель",
"Niobium": "Ниобий", "Niobium": "Ниобий",
@@ -741,7 +745,7 @@
"Phase Alloys": "Фазовые сплавы", "Phase Alloys": "Фазовые сплавы",
"Phosphorus": "Фосфор", "Phosphorus": "Фосфор",
"Polymer Capacitors": "Полимерные конденсаторы", "Polymer Capacitors": "Полимерные конденсаторы",
"Precipitated Alloys": "Осажденные сплавы", "Precipitated Alloys": "Осаждённые сплавы",
"Proprietary Composites": "Патентованные композиты", "Proprietary Composites": "Патентованные композиты",
"Proto Heat Radiators": "Прототипы теплоизлучателей", "Proto Heat Radiators": "Прототипы теплоизлучателей",
"Proto Radiolic Alloys": "Сплавы для изготовления зондов", "Proto Radiolic Alloys": "Сплавы для изготовления зондов",
@@ -749,15 +753,15 @@
"Ruthenium": "Рутений", "Ruthenium": "Рутений",
"Salvaged Alloys": "Захваченные сплавы", "Salvaged Alloys": "Захваченные сплавы",
"Security Firmware Patch": "Обновление для защитной микропрограммы", "Security Firmware Patch": "Обновление для защитной микропрограммы",
"Selenium": "Селениум", "Selenium": "Селен",
"Shield Emitters": "Щитоизлучатели", "Shield Emitters": "Щитоизлучатели",
"Shielding Sensors": "Сенсоры системы экранирования", "Shielding Sensors": "Сенсоры системы экранирования",
"Specialised Legacy Firmware": "Специальные микропрограммы предыдущего поколения", "Specialised Legacy Firmware": "Специальные микропрограммы предыдущего поколения",
"Strange Wake Solutions": "Странные расчеты следа", "Strange Wake Solutions": "Странные расчёты следа",
"Sulphur": "Сера", "Sulphur": "Сера",
"Tagged Encryption Codes": "Меченные шифровальные коды", "Tagged Encryption Codes": "Меченные шифровальные коды",
"Technetium": "Технеций", "Technetium": "Технеций",
"Tellurium": "Теллурий", "Tellurium": "Теллур",
"Thermic Alloys": "Термические сплавы", "Thermic Alloys": "Термические сплавы",
"Tin": "Олово", "Tin": "Олово",
"Tungsten": "Вольфрам", "Tungsten": "Вольфрам",

View File

@@ -1,12 +1,6 @@
import '@babel/polyfill';
import React from 'react'; import React from 'react';
import { render } from 'react-dom'; import { render } from 'react-dom';
import '../less/app.less'; import '../less/app.less';
import Coriolis from './Coriolis'; import Coriolis from './Coriolis';
// import TapEventPlugin from 'react/lib/TapEventPlugin';
// import EventPluginHub from 'react/lib/EventPluginHub';
// onTouchTap not ready for primetime yet, too many issues with preventing default
// EventPluginHub.injection.injectEventPluginsByName({ TapEventPlugin });
render(<Coriolis />, document.getElementById('coriolis')); render(<Coriolis />, document.getElementById('coriolis'));

View File

@@ -0,0 +1,627 @@
import React from 'react';
import Page from './Page';
import Router from '../Router';
import cn from 'classnames';
import { Ships } from 'coriolis-data/dist';
import Ship from '../shipyard/Ship';
import { fromComparison, toComparison } from '../shipyard/Serializer';
import Persist from '../stores/Persist';
import { SizeMap, ShipFacets } from '../shipyard/Constants';
import ComparisonTable from '../components/ComparisonTable';
import BarChart from '../components/BarChart';
import ModalCompare from '../components/ModalCompare';
import ModalExport from '../components/ModalExport';
import ModalPermalink from '../components/ModalPermalink';
import ModalImport from '../components/ModalImport';
import {
FloppyDisk,
Bin,
Download,
Embed,
Rocket,
LinkIcon
} from '../components/SvgIcons';
import ShortenUrl from '../utils/ShortenUrl';
import { comparisonBBCode } from '../utils/BBCode';
const browser = require('detect-browser');
/**
* Creates a comparator based on the specified predicate
* @param {string} predicate Predicate / propterty name
* @return {Function} Comparator
*/
function sortBy(predicate) {
return (a, b) => {
if (a[predicate] === b[predicate]) {
if (a.name == b.name) {
a.buildName.toLowerCase() > b.buildName.toLowerCase() ? 1 : -1;
}
return a.name.toLowerCase() > b.name.toLowerCase() ? 1 : -1;
}
if (typeof a[predicate] == 'string') {
return a[predicate].toLowerCase() > b[predicate].toLowerCase() ? 1 : -1;
}
return a[predicate] > b[predicate] ? 1 : -1;
};
}
/**
* Comparison Page
*/
export default class ComparisonPage extends Page {
/**
* Constructor
* @param {Object} props React Component properties
* @param {Object} context React Component context
*/
constructor(props, context) {
super(props, context);
this._sortShips = this._sortShips.bind(this);
this._buildsSelected = this._buildsSelected.bind(this);
this._updateDiscounts = this._updateDiscounts.bind(this);
this.state = this._initState(context);
}
/**
* [Re]Create initial state from context
* @param {context} context React component context
* @return {Object} New state object
*/
_initState(context) {
let defaultFacets = [13, 12, 11, 9, 6, 4, 1, 3, 2]; // Reverse order of Armour, Shields, Speed, Jump Range, Cargo Capacity, Cost, DPS, EPS, HPS
let params = context.route.params;
let code = params.code;
let name = params.name ? decodeURIComponent(params.name) : null;
let newName = '';
let compareMode = !code;
let builds = [];
let saved = false;
let predicate = 'name';
let desc = false;
let importObj = {};
if (compareMode) {
if (name == 'all') {
let allBuilds = Persist.getBuilds();
newName = name;
for (let shipId in allBuilds) {
for (let buildName in allBuilds[shipId]) {
if (buildName && allBuilds[shipId][buildName]) {
builds.push(
this._createBuild(
shipId,
buildName,
allBuilds[shipId][buildName]
)
);
}
}
}
} else {
let comparisonData = Persist.getComparison(name);
if (comparisonData) {
defaultFacets = comparisonData.facets;
comparisonData.builds.forEach(b =>
builds.push(this._createBuild(b.shipId, b.buildName))
);
saved = true;
newName = name;
}
}
} else {
try {
let comparisonData = toComparison(code);
defaultFacets = comparisonData.f;
newName = name = comparisonData.n;
predicate = comparisonData.p;
desc = comparisonData.d;
comparisonData.b.forEach(build => {
builds.push(this._createBuild(build.s, build.n, build.c));
if (!importObj[build.s]) {
importObj[build.s] = {};
}
importObj[build.s][build.n] = build.c;
});
} catch (e) {
throw { type: 'bad-comparison', message: e.message, details: e };
}
}
let facets = [];
let selectedLength = defaultFacets.length;
let selectedFacets = new Array(selectedLength);
for (let i = 0; i < ShipFacets.length; i++) {
let facet = Object.assign({}, ShipFacets[i]);
let defaultIndex = defaultFacets.indexOf(facet.i);
if (defaultIndex == -1) {
facets.push(facet);
} else {
facet.active = true;
selectedFacets[selectedLength - defaultIndex - 1] = facet;
}
}
facets = selectedFacets.concat(facets);
builds.sort(sortBy(predicate));
return {
title: 'Coriolis EDCD Edition - Compare',
predicate,
desc,
facets,
builds,
compareMode,
code,
name,
newName,
saved,
importObj
};
}
/**
* Create a Ship instance / build
* @param {string} id Ship Id
* @param {name} name Build name
* @param {string} code Optional - Serialized ship code
* @return {Object} Ship instance with build name
*/
_createBuild(id, name, code) {
code = code ? code : Persist.getBuild(id, name); // Retrieve build code if not passed
if (!code) {
// No build found
return;
}
let data = Ships[id]; // Get ship properties
let b = new Ship(id, data.properties, data.slots); // Create a new Ship instance
b.buildFrom(code); // Populate components from code
b.buildName = name;
b.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
return b;
}
/**
* Update state with the specified sort predicates
* @param {String} predicate Sort predicate - property name
*/
_sortShips(predicate) {
let { builds, desc } = this.state;
if (this.state.predicate == predicate) {
desc = !desc;
}
builds.sort(sortBy(predicate));
if (desc) {
builds.reverse();
}
this.setState({ predicate, desc });
}
/**
* Show selected builds modal
*/
_selectBuilds() {
this.context.showModal(
<ModalCompare
onSelect={this._buildsSelected}
builds={this.state.builds}
/>
);
}
/**
* Update selected builds with new list
* @param {Array} newBuilds List of new builds
*/
_buildsSelected(newBuilds) {
this.context.hideModal();
let builds = [];
for (let b of newBuilds) {
builds.push(this._createBuild(b.id, b.buildName));
}
this.setState({ builds, saved: false });
}
/**
* Toggle facet display
* @param {string} facet Facet / Ship Property
*/
_toggleFacet(facet) {
facet.active = !facet.active;
this.setState({ facets: [].concat(this.state.facets), saved: false });
}
/**
* Handle facet drag
* @param {Event} e Drag Event
*/
_facetDrag(e) {
this.nodeAfter = false;
this.dragged = e.currentTarget;
let placeholder = (this.placeholder = document.createElement('li'));
placeholder.style.width = Math.round(this.dragged.offsetWidth) + 'px';
placeholder.className = 'facet-placeholder';
if (!browser || (browser.name !== 'edge' && browser.name !== 'ie')) {
e.dataTransfer.effectAllowed = 'move';
e.dataTransfer.setData('text/html', e.currentTarget);
}
}
/**
* Handle facet drop
* @param {Event} e Drop Event
*/
_facetDrop(e) {
this.dragged.parentNode.removeChild(this.placeholder);
let facets = this.state.facets;
let frm = Number(this.dragged.dataset.i);
let to = Number(this.over.dataset.i);
if (frm < to) {
to--;
}
if (this.nodeAfter) {
to++;
}
facets.splice(to, 0, facets.splice(frm, 1)[0]);
this.dragged.style.display = null;
this.setState({ facets: [].concat(facets), saved: false });
}
/**
* Handle facet drag over
* @param {Event} e Drag over Event
*/
_facetDragOver(e) {
e.preventDefault();
if (e.target.className == 'facet-placeholder') {
return;
} else if (e.target != e.currentTarget) {
this.over = e.target;
this.dragged.style.display = 'none';
let relX = e.clientX - this.over.getBoundingClientRect().left;
let width = this.over.offsetWidth / 2;
let parent = e.target.parentNode;
if (parent == e.currentTarget) {
if (relX > width && this.dragged != e.target) {
this.nodeAfter = true;
parent.insertBefore(this.placeholder, e.target.nextElementSibling);
} else {
this.nodeAfter = false;
parent.insertBefore(this.placeholder, e.target);
}
}
}
}
/**
* Handle name change and update state
* @param {SyntheticEvent} e Event
*/
_onNameChange(e) {
this.setState({ newName: e.target.value, saved: false });
}
/**
* Delete the current comparison
*/
_delete() {
Persist.deleteComparison(this.state.name);
Router.go('/compare');
}
/**
* Import the comparison builds
*/
_import() {
let builds = {};
for (let ship of this.state.builds) {
if (!builds[ship.id]) {
builds[ship.id] = {};
}
builds[ship.id][ship.buildName] = ship.toString();
}
this.context.showModal(<ModalImport builds={builds} />);
}
/**
* Save the current comparison
*/
_save() {
let { newName, builds, facets } = this.state;
let selectedFacets = [];
facets.forEach(f => {
if (f.active) {
selectedFacets.unshift(f.i);
}
});
Persist.saveComparison(newName, builds, selectedFacets);
Router.replace(`/compare/${encodeURIComponent(this.state.newName)}`);
this.setState({ name: newName, saved: true });
}
/**
* Serialize and generate a long URL for the current comparison
* @return {string} URL for serialized comparison
*/
_buildUrl() {
let { facets, builds, name, predicate, desc } = this.state;
let selectedFacets = [];
for (let f of facets) {
if (f.active) {
selectedFacets.unshift(f.i);
}
}
let code = fromComparison(name, builds, selectedFacets, predicate, desc);
let loc = window.location;
return (
loc.protocol +
'//' +
loc.host +
'/comparison?code=' +
encodeURIComponent(code)
);
}
/**
* Generates the long permalink URL
*/
_genPermalink() {
this.context.showModal(<ModalPermalink url={this._buildUrl()} />);
}
/**
* Generate E:D Forum BBCode and show in the export modal
*/
_genBBcode() {
let { translate, formats } = this.context.language;
let { facets, builds } = this.state;
let generator = callback => {
let url = this._buildUrl();
ShortenUrl(
url,
shortenedUrl =>
callback(
comparisonBBCode(translate, formats, facets, builds, shortenedUrl)
),
error =>
callback(comparisonBBCode(translate, formats, facets, builds, url))
);
};
this.context.showModal(
<ModalExport
title={translate('forum') + ' BBCode'}
generator={generator}
/>
);
}
/**
* Update dimenions from rendered DOM
*/
_updateDimensions() {
this.setState({
chartWidth: this.chartRef.offsetWidth
});
}
/**
* Update all ship costs on disount change
*/
_updateDiscounts() {
let shipDiscount = Persist.getShipDiscount();
let moduleDiscount = Persist.getModuleDiscount();
let builds = [];
for (let b of this.state.builds) {
builds.push(b.applyDiscounts(shipDiscount, moduleDiscount));
}
this.setState({ builds });
}
/**
* Update state based on context changes
* @param {Object} nextProps Incoming/Next properties
* @param {Object} nextContext Incoming/Next conext
*/
componentWillReceiveProps(nextProps, nextContext) {
if (this.context.route !== nextContext.route) {
// Only reinit state if the route has changed
this.setState(this._initState(nextContext));
}
}
/**
* Add listeners when about to mount
*/
componentWillMount() {
this.resizeListener = this.context.onWindowResize(this._updateDimensions);
this.persistListener = Persist.addListener(
'discounts',
this._updateDiscounts
);
}
/**
* Trigger DOM updates on mount
*/
componentDidMount() {
this._updateDimensions();
}
/**
* Remove listeners on unmount
*/
componentWillUnmount() {
this.resizeListener.remove();
this.persistListener.remove();
}
/**
* Render the Page
* @return {React.Component} The page contents
*/
renderPage() {
let translate = this.context.language.translate;
let compareHeader;
let {
newName,
name,
saved,
builds,
facets,
predicate,
desc,
chartWidth
} = this.state;
if (this.state.compareMode) {
compareHeader = (
<tr>
<td className="head">{translate('comparison')}</td>
<td>
<input
value={newName}
onChange={this._onNameChange}
placeholder={translate('Enter Name')}
maxLength="50"
/>
<button
onClick={this._save}
disabled={!newName || newName == 'all' || saved}
>
<FloppyDisk className="lg" />
<span className="button-lbl">{translate('save')}</span>
</button>
<button onClick={this._delete} disabled={name == 'all' || !saved}>
<Bin className="lg warning" />
</button>
<button onClick={this._selectBuilds}>
<Rocket className="lg" />
<span className="button-lbl">{translate('builds')}</span>
</button>
<button
className="r"
onClick={this._genPermalink}
disabled={builds.length == 0}
>
<LinkIcon className="lg" />
<span className="button-lbl">{translate('permalink')}</span>
</button>
<button
className="r"
onClick={this._genBBcode}
disabled={builds.length == 0}
>
<Embed className="lg" />
<span className="button-lbl">{translate('forum')}</span>
</button>
</td>
</tr>
);
} else {
compareHeader = (
<tr>
<td className="head">{translate('comparison')}</td>
<td>
<h3>{name}</h3>
<button className="r" onClick={this._import}>
<Download className="lg" />
{translate('import')}
</button>
</td>
</tr>
);
}
return (
<div
className={'page'}
style={{ fontSize: this.context.sizeRatio + 'em' }}
>
<table id="comparison">
<tbody>
{compareHeader}
<tr key="facets">
<td className="head">{translate('compare')}</td>
<td>
<ul id="facet-container" onDragOver={this._facetDragOver}>
{facets.map((f, i) => (
<li
key={f.title}
data-i={i}
draggable="true"
onDragStart={this._facetDrag}
onDragEnd={this._facetDrop}
className={cn('facet', { active: f.active })}
onClick={this._toggleFacet.bind(this, f)}
>
{'↔ ' + translate(f.title)}
</li>
))}
</ul>
</td>
</tr>
</tbody>
</table>
<ComparisonTable
builds={builds}
facets={facets}
onSort={this._sortShips}
predicate={predicate}
desc={desc}
/>
{!builds.length ? (
<div className="chart" ref={node => (this.chartRef = node)}>
{translate('PHRASE_NO_BUILDS')}
</div>
) : (
facets.filter(f => f.active).map((f, i) => (
<div
key={f.title}
className="chart"
ref={i == 0 ? node => (this.chartRef = node) : null}
>
<h3
className="ptr"
onClick={this._sortShips.bind(this, f.props[0])}
>
{translate(f.title)}
</h3>
<BarChart
width={chartWidth}
data={builds}
properties={f.props}
labels={f.lbls}
unit={translate(f.unit)}
format={f.fmt}
title={translate(f.title)}
predicate={predicate}
desc={desc}
/>
</div>
))
)}
</div>
);
}
}

View File

@@ -5,6 +5,7 @@ import PropTypes from 'prop-types';
* Unexpected Error page / block * Unexpected Error page / block
*/ */
export default class ErrorDetails extends React.Component { export default class ErrorDetails extends React.Component {
static contextTypes = { static contextTypes = {
route: PropTypes.object.isRequired, route: PropTypes.object.isRequired,
language: PropTypes.object.isRequired language: PropTypes.object.isRequired
@@ -44,8 +45,11 @@ export default class ErrorDetails extends React.Component {
return <div className='error'> return <div className='error'>
<h1>Jameson, we have a problem..</h1> <h1>Jameson, we have a problem..</h1>
<h1><small>{error.message}</small></h1> <h1><small>{error.message}</small></h1>
Import Error handling has been improved, but still isn't perfect. <br/>MOST Import failures are a result of missing modules in Coriolis, <br />OR incorrect import strings generated by third party apps. If you're seeing this page, we may have failed to handle the errors in your import correctly. Please see the data output below, specifically the 'scriptUrl:' section if it's there and then if you feel confident enough, please check the github issues page linked below and see if there is a similar issue already logged. If not, please create a new issue with the data below. If you're not confident, please ask for help on the Coriolis Channel of the EDCD Discord server.
<br/>
<br/>
<br/> <br/>
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null } {importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
<br/> <br/>
<div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div> <div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div>
<br/> <br/>

File diff suppressed because it is too large Load Diff

View File

@@ -7,6 +7,7 @@ import { shallowEqual } from '../utils/UtilityFunctions';
* Abstract/Base Page * Abstract/Base Page
*/ */
export default class Page extends React.Component { export default class Page extends React.Component {
static contextTypes = { static contextTypes = {
closeMenu: PropTypes.func.isRequired, closeMenu: PropTypes.func.isRequired,
hideModal: PropTypes.func.isRequired, hideModal: PropTypes.func.isRequired,
@@ -91,4 +92,5 @@ export default class Page extends React.Component {
} }
return this.renderPage(); return this.renderPage();
} }
} }

View File

@@ -1,81 +1,102 @@
import React from 'react'; import React from 'react';
import Page from './Page'; import Page from './Page';
import { Ships } from 'coriolis-data/dist';
import cn from 'classnames'; import cn from 'classnames';
import { Factory } from 'ed-forge'; import Ship from '../shipyard/Ship';
import { JUMP_METRICS } from 'ed-forge/lib/src/ship-stats'; import * as ModuleUtils from '../shipyard/ModuleUtils';
import { SizeMap } from '../shipyard/Constants'; import { SizeMap } from '../shipyard/Constants';
import Link from '../components/Link'; import Link from '../components/Link';
/**
* Counts the hardpoints by class/size
* @param {Object} slot Hardpoint Slot model
*/
function countHp(slot) {
this.hp[slot.maxClass]++;
this.hpCount++;
}
/**
* Counts the internal slots and aggregated properties
* @param {Object} slot Internal Slots
*/
function countInt(slot) {
let crEligible = !slot.eligible || slot.eligible.cr;
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
this.intCount++;
this.maxCargo += crEligible ?
ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo :
0;
// if no eligiblity, then assume pce
let passSlotType = null;
let passSlotRating = null;
if (!slot.eligible || slot.eligible.pce) {
passSlotType = 'pce';
passSlotRating = 'E';
} else if (slot.eligible.pci) {
passSlotType = 'pci';
passSlotRating = 'D';
} else if (slot.eligible.pcm) {
passSlotType = 'pcm';
passSlotRating = 'C';
} else if (slot.eligible.pcq) {
passSlotType = 'pcq';
passSlotRating = 'B';
}
let passengerBay = passSlotType ?
ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) :
null;
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
}
/** /**
* Generate Ship summary and aggregated properties * Generate Ship summary and aggregated properties
* @param {String} shipId Ship Id * @param {String} shipId Ship Id
* @param {Object} shipData Ship Default Data
* @return {Object} Ship summary and aggregated properties * @return {Object} Ship summary and aggregated properties
*/ */
function shipSummary(shipId) { function shipSummary(shipId, shipData) {
// Build Ship
let ship = Factory.newShip(shipId);
let coreSizes = ship.readMeta('coreSizes');
let { jumpRangeLaden, totalRange } = ship.getMetrics(JUMP_METRICS);
let summary = { let summary = {
agility: ship.readProp('pitch') + ship.readProp('yaw') + ship.readProp('roll'),
baseArmour: ship.readProp('basearmour'),
baseShieldStrength: ship.readProp('baseshieldstrength'),
boost: ship.readProp('boost'),
class: ship.readMeta('class'),
crew: ship.readMeta('crew'),
id: shipId, id: shipId,
hardness: ship.readProp('hardness'),
hpCount: 0, hpCount: 0,
hullMass: ship.readProp('hullmass'),
intCount: 0, intCount: 0,
masslock: ship.readProp('masslock'), beta: shipData.beta,
maxCargo: 0,
maxPassengers: 0,
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8 int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
jumpRangeLaden, standard: shipData.slots.standard,
pitch: ship.readProp('pitch'), agility:
retailCost: ship.readMeta('retailCost'), shipData.properties.pitch +
roll: ship.readProp('roll'), shipData.properties.yaw +
speed: ship.readProp('speed'), shipData.properties.roll
standard: [
'powerplant',
'mainengines',
'frameshiftdrive',
'lifesupport',
'powerdistributor',
'radar',
'fueltank'
].map(k => coreSizes[k]),
totalRange,
yaw: ship.readProp('yaw'),
}; };
Object.assign(summary, shipData.properties);
let ship = new Ship(shipId, shipData.properties, shipData.slots);
// Count Hardpoints by class // Build Ship
ship.getHardpoints(undefined, true).forEach(hardpoint => { ship.buildWith(shipData.defaults); // Populate with stock/default components
summary.hp[hardpoint.getSizeNum()]++; ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class
summary.hpCount++; ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class
}); summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost
// Count Internal Compartments by class ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range
let maxCargo = 0, maxPassengers = 0; summary.maxJumpRange = ship.unladenRange; // Record Jump Range
ship.getInternals(undefined, true).forEach(internal => {
const size = String(internal.getSizeNum());
summary.int[size]++;
summary.intCount++;
// Try cargo racks // Best thrusters
try { let th;
internal.setItem('cargorack', size); if (ship.standard[1].maxClass === 3) {
maxCargo += internal.get('cargo'); th = 'tz';
} catch {} } else if (ship.standard[1].maxClass === 2) {
// Try economy cabins th = 'u0';
try { } else {
internal.setItem('passengercabins', size < '6' ? size : '6', '1'); th = ship.standard[1].maxClass + 'A';
maxPassengers += internal.get('cabincapacity'); }
} catch {}
});
summary.maxCargo = maxCargo; ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters
summary.maxPassengers = maxPassengers; summary.topSpeed = ship.topSpeed;
summary.topBoost = ship.topBoost;
summary.baseArmour = ship.armour;
return summary; return summary;
} }
@@ -96,14 +117,14 @@ export default class ShipyardPage extends Page {
if (!ShipyardPage.cachedShipSummaries) { if (!ShipyardPage.cachedShipSummaries) {
ShipyardPage.cachedShipSummaries = []; ShipyardPage.cachedShipSummaries = [];
for (let s of Factory.getAllShipTypes()) { for (let s in Ships) {
ShipyardPage.cachedShipSummaries.push(shipSummary(s)); ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s]));
} }
} }
this.state = { this.state = {
title: 'Coriolis EDCD Edition - Shipyard', title: 'Coriolis EDCD Edition - Shipyard',
shipPredicate: 'id', shipPredicate: 'name',
shipDesc: true, shipDesc: true,
shipSummaries: ShipyardPage.cachedShipSummaries, shipSummaries: ShipyardPage.cachedShipSummaries,
compare: {}, compare: {},
@@ -136,7 +157,7 @@ export default class ShipyardPage extends Page {
* @private * @private
*/ */
_toggleGroupCompared() { _toggleGroupCompared() {
this.setState({ groupCompared: !this.state.groupCompared }); this.setState({groupCompared: !this.state.groupCompared})
} }
/** /**
@@ -188,18 +209,16 @@ export default class ShipyardPage extends Page {
<td className="ri cap">{translate(SizeMap[s.class])}</td> <td className="ri cap">{translate(SizeMap[s.class])}</td>
<td className="ri">{fInt(s.crew)}</td> <td className="ri">{fInt(s.crew)}</td>
<td className="ri">{s.masslock}</td> <td className="ri">{s.masslock}</td>
<td className="ri">{fInt(s.hullMass)}</td>
<td className="ri">{fInt(s.agility)}</td> <td className="ri">{fInt(s.agility)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.hullMass)}</td>
<td className="ri">{fInt(s.speed)}</td> <td className="ri">{fInt(s.speed)}</td>
<td className="ri">{fInt(s.boost)}</td> <td className="ri">{fInt(s.boost)}</td>
<td className="ri">{fInt(s.pitch)}</td>
<td className="ri">{fInt(s.yaw)}</td>
<td className="ri">{fInt(s.roll)}</td>
<td className="ri">{fRound(s.jumpRangeLaden)}</td>
<td className="ri">{fRound(s.totalRange)}</td>
<td className="ri">{fInt(s.hardness)}</td>
<td className="ri">{fInt(s.baseArmour)}</td> <td className="ri">{fInt(s.baseArmour)}</td>
<td className="ri">{fInt(s.baseShieldStrength)}</td> <td className="ri">{fInt(s.baseShieldStrength)}</td>
<td className="ri">{fInt(s.topSpeed)}</td>
<td className="ri">{fInt(s.topBoost)}</td>
<td className="ri">{fRound(s.maxJumpRange)}</td>
<td className="ri">{fInt(s.maxCargo)}</td> <td className="ri">{fInt(s.maxCargo)}</td>
<td className="ri">{fInt(s.maxPassengers)}</td> <td className="ri">{fInt(s.maxPassengers)}</td>
<td className="cn">{s.standard[0]}</td> <td className="cn">{s.standard[0]}</td>
@@ -235,6 +254,7 @@ export default class ShipyardPage extends Page {
let { translate, formats, units } = language; let { translate, formats, units } = language;
let hide = this.context.tooltip.bind(null, null); let hide = this.context.tooltip.bind(null, null);
let fInt = formats.int; let fInt = formats.int;
let fRound = formats.round;
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state; let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
let sortShips = (predicate, index) => let sortShips = (predicate, index) =>
this._sortShips.bind(this, predicate, index); this._sortShips.bind(this, predicate, index);
@@ -278,7 +298,7 @@ export default class ShipyardPage extends Page {
} }
if (valA == valB) { if (valA == valB) {
if (a.id > b.id) { if (a.name > b.name) {
return 1; return 1;
} else { } else {
return -1; return -1;
@@ -314,7 +334,7 @@ export default class ShipyardPage extends Page {
onClick={() => this._toggleCompare(s.id)} onClick={() => this._toggleCompare(s.id)}
> >
<td className="le"> <td className="le">
<Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link> <Link href={'/outfit/' + s.id}>{s.name} {s.beta === true ? '(Beta)' : null}</Link>
</td> </td>
</tr> </tr>
); );
@@ -322,250 +342,282 @@ export default class ShipyardPage extends Page {
} }
return ( return (
<div className="page" style={{ fontSize: sizeRatio + 'em' }}> <div className="page" style={{fontSize: sizeRatio + 'em'}}>
<div className="content-wrapper"> <div className="content-wrapper">
<div className="shipyard-table-wrapper"> <div className="shipyard-table-wrapper">
<table style={{ width: '12em', position: 'absolute', zIndex: 1 }} className="shipyard-table"> <table style={{width: '12em', position: 'absolute', zIndex: 1}} className="shipyard-table">
<thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main">
<th className="sortable le rgt" onClick={sortShips('name')}>
{translate('ship')}
</th>
</tr>
<tr>
<th className="le rgt invisible">{units['m/s']}</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{shipRows}
</tbody>
</table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead> <thead>
<tr>
<th className="le rgt">&nbsp;</th>
</tr>
<tr className="main"> <tr className="main">
<th className="sortable le rgt" onClick={sortShips('id')}> <th>&nbsp;</th>
{translate('ship')} <th
rowSpan={3}
className="sortable"
onClick={sortShips('class')}
>
{translate('size')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('crew')}
>
{translate('crew')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide}
onClick={sortShips('masslock')}
>
{translate('MLF')}
</th>
<th
rowSpan={3}
className="sortable"
onClick={sortShips('agility')}
>
{translate('agility')}
</th>
<th
rowSpan={3}
className="sortable"
onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide}
onClick={sortShips('hardness')}
>
{translate('hrd')}
</th>
<th>&nbsp;</th>
<th colSpan={4}>{translate('base')}</th>
<th colSpan={5}>{translate('max')}</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')}
onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th
colSpan={5}
className="sortable lft"
onClick={sortShips('hpCount')}
>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th> </th>
</tr> </tr>
<tr> <tr>
<th className="le rgt invisible">{units['m/s']}</th> <th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
<th className="sortable lft" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('topSpeed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('topBoost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('maxJumpRange')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('maxCargo')}>
{units.T}
</th>
<th>&nbsp;</th>
<th
className="sortable lft"
onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide}
onClick={sortShips('standard', 0)}
>
{'pp'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide}
onClick={sortShips('standard', 1)}
>
{'th'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide}
onClick={sortShips('standard', 2)}
>
{'fsd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide}
onClick={sortShips('standard', 3)}
>
{'ls'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'power distributor')}
onMouseLeave={hide}
onClick={sortShips('standard', 4)}
>
{'pd'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide}
onClick={sortShips('standard', 5)}
>
{'s'}
</th>
<th
className="sortable"
onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide}
onClick={sortShips('standard', 6)}
>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr> </tr>
</thead> </thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}> <tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{shipRows} {detailRows}
</tbody> </tbody>
</table> </table>
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
<thead>
<tr className="main">
{/* First all headers that spread out over three rows */}
{/* cost placeholder */}
<th>&nbsp;</th>
<th rowSpan={3} className="sortable" onClick={sortShips('class')}>
{translate('size')}
</th>
<th rowSpan={3} className="sortable" onClick={sortShips('crew')}>
{translate('crew')}
</th>
<th rowSpan={3} className="sortable"
onMouseEnter={termtip.bind(null, 'mass lock factor')}
onMouseLeave={hide} onClick={sortShips('masslock')}>
{translate('MLF')}
</th>
{/* hull mass placeholder */}
<th>&nbsp;</th>
<th colSpan={6}>{translate('agility')}</th>
<th colSpan={2}>{translate('travel')}</th>
<th colSpan={3}>{translate('defence')}</th>
{/* cargo placeholder */}
<th>&nbsp;</th>
{/* pax placeholder */}
<th>&nbsp;</th>
<th className="lft" colSpan={7} />
<th className="lft" colSpan={5} />
<th className="lft" colSpan={8} />
</tr>
<tr>
{/* Now all headers in a second-row */}
<th className="sortable lft" onClick={sortShips('retailCost')}>
{translate('cost')}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{translate('hull')}
</th>
<th className="sortable lft" onClick={sortShips('agility')}>
{translate('rating')}
</th>
<th className="sortable" onClick={sortShips('speed')}>
{translate('speed')}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{translate('boost')}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{translate('pitch')}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{translate('yaw')}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{translate('roll')}
</th>
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
{translate('jump')}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{translate('range')}
</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'hardness')}
onMouseLeave={hide} onClick={sortShips('hardness')}>
{translate('hrd')}
</th>
<th className="sortable" onClick={sortShips('baseArmour')}>
{translate('armour')}
</th>
<th className="sortable" onClick={sortShips('baseShieldStrength')}>
{translate('shields')}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{translate('cargo')}
</th>
<th className="sortable lft" onClick={sortShips('maxPassengers')}
onMouseEnter={termtip.bind(null, 'passenger capacity')} onMouseLeave={hide}>
{translate('pax')}
</th>
<th className="lft" colSpan={7}>
{translate('core module classes')}
</th>
<th colSpan={5} className="sortable lft" onClick={sortShips('hpCount')}>
{translate('hardpoints')}
</th>
<th
colSpan={8}
className="sortable lft"
onClick={sortShips('intCount')}
>
{translate('internal compartments')}
</th>
</tr>
<tr>
{/* Third row headers, i.e., units */}
<th
className="sortable lft"
onClick={sortShips('retailCost')}
>
{units.CR}
</th>
<th className="sortable lft" onClick={sortShips('hullMass')}>
{units.T}
</th>
{/* agility rating placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable" onClick={sortShips('speed')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('boost')}>
{units['m/s']}
</th>
<th className="sortable" onClick={sortShips('pitch')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('yaw')}>
{units['°/s']}
</th>
<th className="sortable" onClick={sortShips('roll')}>
{units['°/s']}
</th>
<th className="sortable lft" onClick={sortShips('jumpRangeLaden')}>
{units.LY}
</th>
<th className="sortable" onClick={sortShips('totalRange')}>
{units.LY}
</th>
<th className="lft">&nbsp;</th>
{/* armour placeholder */}
<th>&nbsp;</th>
<th
className="sortable"
onClick={sortShips('baseShieldStrength')}
>
{units.MJ}
</th>
<th className="sortable lft" onClick={sortShips('maxCargo')}>
{units.T}
</th>
{/* pax placeholder */}
<th className="lft">&nbsp;</th>
<th className="sortable lft" onMouseEnter={termtip.bind(null, 'power plant')}
onMouseLeave={hide} onClick={sortShips('standard', 0)}>
{'pp'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'thrusters')}
onMouseLeave={hide} onClick={sortShips('standard', 1)}>
{'th'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'frame shift drive')}
onMouseLeave={hide} onClick={sortShips('standard', 2)}>
{'fsd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'life support')}
onMouseLeave={hide} onClick={sortShips('standard', 3)}>
{'ls'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'power distriubtor')}
onMouseLeave={hide} onClick={sortShips('standard', 4)}>
{'pd'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'sensors')}
onMouseLeave={hide} onClick={sortShips('standard', 5)}>
{'s'}
</th>
<th className="sortable" onMouseEnter={termtip.bind(null, 'fuel tank')}
onMouseLeave={hide} onClick={sortShips('standard', 6)}>
{'ft'}
</th>
<th className="sortable lft" onClick={sortShips('hp', 1)}>
{translate('S')}
</th>
<th className="sortable" onClick={sortShips('hp', 2)}>
{translate('M')}
</th>
<th className="sortable" onClick={sortShips('hp', 3)}>
{translate('L')}
</th>
<th className="sortable" onClick={sortShips('hp', 4)}>
{translate('H')}
</th>
<th className="sortable" onClick={sortShips('hp', 0)}>
{translate('U')}
</th>
<th className="sortable lft" onClick={sortShips('int', 0)}>
1
</th>
<th className="sortable" onClick={sortShips('int', 1)}>
2
</th>
<th className="sortable" onClick={sortShips('int', 2)}>
3
</th>
<th className="sortable" onClick={sortShips('int', 3)}>
4
</th>
<th className="sortable" onClick={sortShips('int', 4)}>
5
</th>
<th className="sortable" onClick={sortShips('int', 5)}>
6
</th>
<th className="sortable" onClick={sortShips('int', 6)}>
7
</th>
<th className="sortable" onClick={sortShips('int', 7)}>
8
</th>
</tr>
</thead>
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
{detailRows}
</tbody>
</table>
</div>
</div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
</div> </div>
</div> </div>
<div className="table-tools" >
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>{translate('Group highlighted ships')}</label>
</div>
</div>
</div> </div>
); );
} }

File diff suppressed because it is too large Load Diff

View File

@@ -25,7 +25,6 @@ export const ModuleGroupToName = {
pd: 'Power Distributor', pd: 'Power Distributor',
s: 'Sensors', s: 'Sensors',
ft: 'Fuel Tank', ft: 'Fuel Tank',
pas: 'Planetary Approach Suite',
// Internal // Internal
fs: 'Fuel Scoop', fs: 'Fuel Scoop',
@@ -58,6 +57,9 @@ export const ModuleGroupToName = {
gmrp: 'Guardian Module Reinforcement Package', gmrp: 'Guardian Module Reinforcement Package',
mahr: 'Meta Alloy Hull Reinforcement Package', mahr: 'Meta Alloy Hull Reinforcement Package',
sua: 'Supercruise Assist', sua: 'Supercruise Assist',
mlc: "Multi Limpet Controller",
rpl: "Repair Limpet Controller",
pas: 'Planetary Approach Suite',
// Hard Points // Hard Points
bl: 'Beam Laser', bl: 'Beam Laser',
@@ -75,11 +77,15 @@ export const ModuleGroupToName = {
nl: 'Mine Launcher', nl: 'Mine Launcher',
ml: 'Mining Laser', ml: 'Mining Laser',
mr: 'Missile Rack', mr: 'Missile Rack',
amr: 'Missile Rack (Advanced)',
axmr: 'AX Missile Rack', axmr: 'AX Missile Rack',
axmre: 'AX Missile Rack (Enhanced)',
pa: 'Plasma Accelerator', pa: 'Plasma Accelerator',
po: 'Point Defence', po: 'Point Defence',
mc: 'Multi-cannon', mc: 'Multi-cannon',
advmc: 'Multi-cannon (Advanced)',
axmc: 'AX Multi-cannon', axmc: 'AX Multi-cannon',
axmce: 'AX Multi-cannon (Enhanced)',
pl: 'Pulse Laser', pl: 'Pulse Laser',
rg: 'Rail Gun', rg: 'Rail Gun',
sb: 'Shield Booster', sb: 'Shield Booster',

Some files were not shown because too many files have changed in this diff Show More