mirror of
https://github.com/EDCD/coriolis.git
synced 2025-12-11 16:53:02 +00:00
Compare commits
535 Commits
2.9.12
...
c07cfc6e70
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
c07cfc6e70 | ||
|
|
c4c6d32a5d | ||
|
|
a65bb06754 | ||
|
|
23548e7c5c | ||
|
|
74e6f54e19 | ||
|
|
a46f8f97f6 | ||
|
|
44dbdb1703 | ||
|
|
187c5dae4a | ||
|
|
07d324a3fa | ||
|
|
5c63afd96c | ||
|
|
53c40ac9c4 | ||
|
|
a180cbfdd4 | ||
|
|
fc1524a943 | ||
|
|
c3747e4e5e | ||
|
|
ab153981c9 | ||
|
|
a970e052c1 | ||
|
|
df7e264a02 | ||
|
|
cdcda004f3 | ||
|
|
20e448fc0a | ||
|
|
436e626c42 | ||
|
|
3dd4675a0b | ||
|
|
d3766d9e17 | ||
|
|
d987c08ac8 | ||
|
|
f865ef6c6c | ||
|
|
f2b7daac82 | ||
|
|
832bc488b6 | ||
|
|
f513166d6c | ||
|
|
61fd0eb991 | ||
|
|
1e51e7d4a6 | ||
|
|
4943d36bb8 | ||
|
|
9271d1fa09 | ||
|
|
8a09d94dfa | ||
|
|
c44925dd62 | ||
|
|
d006bbcb0f | ||
|
|
14453f6b80 | ||
|
|
8c267150a9 | ||
|
|
ed60a78be0 | ||
|
|
82142b0cb1 | ||
|
|
d8949fedb2 | ||
|
|
cf72bd11a8 | ||
|
|
16ef7ea389 | ||
|
|
ff455e349e | ||
|
|
ba9e7f1a32 | ||
|
|
904498b20c | ||
|
|
409be7374c | ||
|
|
00c525e6ab | ||
|
|
a2f52c03a1 | ||
|
|
037df6b166 | ||
|
|
90ab5b4b0a | ||
|
|
7bbfa8c43f | ||
|
|
2fbcd158cc | ||
|
|
33c201800e | ||
|
|
9797a8d781 | ||
|
|
cee4c32551 | ||
|
|
081d8fb86a | ||
|
|
3dfd563d90 | ||
|
|
fd08cd219c | ||
|
|
6a15326d31 | ||
|
|
608ecc51b7 | ||
|
|
fcef26ebbb | ||
|
|
ba6d758ed5 | ||
|
|
43aa3e4e79 | ||
|
|
18f0e060a7 | ||
|
|
c7547e8baf | ||
|
|
ffff242abe | ||
|
|
b44c66b986 | ||
|
|
ae77ec6256 | ||
|
|
4f1e32b154 | ||
|
|
af37c2bfc5 | ||
|
|
5d4ab6f2ad | ||
|
|
0c9db53057 | ||
|
|
b689605ac2 | ||
|
|
baab91e371 | ||
|
|
70e69c7099 | ||
|
|
f4534fd3eb | ||
|
|
93594e1a65 | ||
|
|
b5e449ea54 | ||
|
|
0ff4b849aa | ||
|
|
b99e38043f | ||
|
|
28e3a59473 | ||
|
|
b20290fb60 | ||
|
|
2734beb6f8 | ||
|
|
345eec528c | ||
|
|
7a17e18a76 | ||
|
|
4697677457 | ||
|
|
7d8a5a1368 | ||
|
|
dd7402bd0e | ||
|
|
65592b0fc6 | ||
|
|
0ab66023a6 | ||
|
|
d6fad098ee | ||
|
|
1b5730d337 | ||
|
|
439b615b1b | ||
|
|
a8b30594dc | ||
|
|
9b6b1d328c | ||
|
|
ac2e2e4d69 | ||
|
|
3a5fb31860 | ||
|
|
c610eb8627 | ||
|
|
94980270c4 | ||
|
|
c685e002e3 | ||
|
|
1f665eed9e | ||
|
|
0c4fc1fd9a | ||
|
|
0fc033363e | ||
|
|
fb6e9538bc | ||
|
|
95b98fc4ed | ||
|
|
1840dafed0 | ||
|
|
1ad82b116c | ||
|
|
7bdd17504b | ||
|
|
2d820bb5d5 | ||
|
|
2e14512ed8 | ||
|
|
48ed583c6d | ||
|
|
dd444a17f3 | ||
|
|
2ea63c711e | ||
|
|
6d6d31db25 | ||
|
|
e9273dcb9b | ||
|
|
2bdc4562c6 | ||
|
|
9e8a5323e9 | ||
|
|
8e001063b3 | ||
|
|
dc88fab4c5 | ||
|
|
dfca917e50 | ||
|
|
ef7dfd6ca1 | ||
|
|
435c1b6d45 | ||
|
|
c5c9abe588 | ||
|
|
363735d36b | ||
|
|
2741e7701b | ||
|
|
3be442ea60 | ||
|
|
34cbeca201 | ||
|
|
b37e73ead6 | ||
|
|
ee775521d6 | ||
|
|
5f84aaef1b | ||
|
|
99ac58d999 | ||
|
|
f128a1e87d | ||
|
|
8c0768b451 | ||
|
|
319307136c | ||
|
|
a498452943 | ||
|
|
4b854b8305 | ||
|
|
b400db8216 | ||
|
|
fb811faf5e | ||
|
|
deeb525433 | ||
|
|
1cb88115f6 | ||
|
|
a181791500 | ||
|
|
94eec120da | ||
|
|
48092d4395 | ||
|
|
2457c30b94 | ||
|
|
593f069806 | ||
|
|
a073692632 | ||
|
|
7752d5c9db | ||
|
|
544e5acaef | ||
|
|
9ab35bbaf9 | ||
|
|
98782da200 | ||
|
|
2936364934 | ||
|
|
01e1609a9f | ||
|
|
f85a03a9ae | ||
|
|
2703c2aa23 | ||
|
|
954921c231 | ||
|
|
8bed35a8ba | ||
|
|
9f4ae60577 | ||
|
|
ee3c50e27d | ||
|
|
03020743b3 | ||
|
|
001fed67b7 | ||
|
|
3894915740 | ||
|
|
68fd13e8dc | ||
|
|
fdf16cd959 | ||
|
|
d916c67fe0 | ||
|
|
d8a8e224f4 | ||
|
|
e1c115747c | ||
|
|
e9b6d71606 | ||
|
|
e03e249d2f | ||
|
|
0cfb0b6878 | ||
|
|
600df162aa | ||
|
|
94141aa3c5 | ||
|
|
aca90d7077 | ||
|
|
a66fa8e83f | ||
|
|
194db07057 | ||
|
|
307886d4ae | ||
|
|
bbba048129 | ||
|
|
222173b388 | ||
|
|
ec0d05e081 | ||
|
|
b3be0bd639 | ||
|
|
529d80682c | ||
|
|
934de01803 | ||
|
|
3367580d78 | ||
|
|
fbf59219d0 | ||
|
|
77401a3b3f | ||
|
|
7c587c29aa | ||
|
|
2295dccd82 | ||
|
|
cc4ad6d132 | ||
|
|
8a2d27290a | ||
|
|
eda61a8e06 | ||
|
|
3987c4e681 | ||
|
|
71b90eb6f4 | ||
|
|
4e891f382c | ||
|
|
3d3f9e44b5 | ||
|
|
dd7a133caa | ||
|
|
ae247c4812 | ||
|
|
6c932f96a6 | ||
|
|
0ea25692d3 | ||
|
|
e129e1da39 | ||
|
|
8acd32b0fc | ||
|
|
8e5dd9fb8d | ||
|
|
97ce2828e0 | ||
|
|
f8f99a5aaa | ||
|
|
70cfa58896 | ||
|
|
6e79ced51e | ||
|
|
56571f9c1f | ||
|
|
0b10cac85c | ||
|
|
34c04a6354 | ||
|
|
4e337c4ca1 | ||
|
|
5048b7e094 | ||
|
|
27fbc1ad66 | ||
|
|
4ab376d9ed | ||
|
|
dfffc3a268 | ||
|
|
b59fa15e00 | ||
|
|
12bca4c44e | ||
|
|
2858ef3e93 | ||
|
|
7d99471f89 | ||
|
|
a2ab708ac9 | ||
|
|
a34a9c355f | ||
|
|
3215b3942d | ||
|
|
557c0afd9b | ||
|
|
d52365a204 | ||
|
|
14b2a14e58 | ||
|
|
7f24904f77 | ||
|
|
da07790594 | ||
|
|
5008c7cd74 | ||
|
|
a778b1b6e1 | ||
|
|
bd9771f9ba | ||
|
|
600c244f9b | ||
|
|
a599b1a076 | ||
|
|
3e0a5e22b1 | ||
|
|
3a6ac818c2 | ||
|
|
6f077d4c41 | ||
|
|
9c767c928c | ||
|
|
515f4ad3da | ||
|
|
4fcf074595 | ||
|
|
e5f8153a34 | ||
|
|
571854a11c | ||
|
|
1f22f249a1 | ||
|
|
718ac0a514 | ||
|
|
8f089cb1ee | ||
|
|
d19a7276dd | ||
|
|
10fffe67fc | ||
|
|
f0bf8e8ce2 | ||
|
|
598cf8d677 | ||
|
|
90f03de3fe | ||
|
|
e0766f4424 | ||
|
|
28a90768e4 | ||
|
|
f3d917ccbe | ||
|
|
7e5d52385d | ||
|
|
4368015dc0 | ||
|
|
1201da1811 | ||
|
|
d195b568b0 | ||
|
|
c9866c146b | ||
|
|
5d52809d0d | ||
|
|
8f0cca4fd9 | ||
|
|
e46bb425fe | ||
|
|
06dc110025 | ||
|
|
e9c34c636a | ||
|
|
59d38cbd33 | ||
|
|
51f5188efc | ||
|
|
be8934da80 | ||
|
|
18d78b3089 | ||
|
|
b1ff4e84f7 | ||
|
|
bed2ede701 | ||
|
|
124bd62d2c | ||
|
|
975846f4ab | ||
|
|
3f73f9be10 | ||
|
|
d218101708 | ||
|
|
608ce12156 | ||
|
|
80d653483a | ||
|
|
f9a1e5afd9 | ||
|
|
7f5181a9c7 | ||
|
|
93d8f15f26 | ||
|
|
06d8930777 | ||
|
|
23f4024e09 | ||
|
|
a5e9a71037 | ||
|
|
423d42bc8a | ||
|
|
4075bab3d0 | ||
|
|
469f7a0a48 | ||
|
|
25d9f8ec61 | ||
|
|
1151bd1614 | ||
|
|
2456ce330b | ||
|
|
f86ce62c27 | ||
|
|
c295a9f4e4 | ||
|
|
c4186faa4a | ||
|
|
00f4889c93 | ||
|
|
b6c83f4aba | ||
|
|
3fa040c210 | ||
|
|
8c4957c21e | ||
|
|
a178c59aa3 | ||
|
|
0d9fcd97d7 | ||
|
|
b02ca117be | ||
|
|
ca2e2a22dd | ||
|
|
035e217124 | ||
|
|
6424ab283a | ||
|
|
f30f10c904 | ||
|
|
8ce09a607f | ||
|
|
5b48e30798 | ||
|
|
0d7e6af2e6 | ||
|
|
be3ca23aee | ||
|
|
28f464ba5a | ||
|
|
8cedd1b8bc | ||
|
|
56cbc49d04 | ||
|
|
5d1ccd2a20 | ||
|
|
f898fbc55e | ||
|
|
63acad3aeb | ||
|
|
5b4b0b8dff | ||
|
|
8492dd74f9 | ||
|
|
77e652cd34 | ||
|
|
5069d7e464 | ||
|
|
8b3e9c0f63 | ||
|
|
99e76e480b | ||
|
|
c161ed2298 | ||
|
|
464770f096 | ||
|
|
9fba1be814 | ||
|
|
b419b8b104 | ||
|
|
0cae955ca2 | ||
|
|
ec70ad5d29 | ||
|
|
8a386c4ece | ||
|
|
013460ada4 | ||
|
|
d46ad89dc5 | ||
|
|
86c53c8e46 | ||
|
|
df14786e79 | ||
|
|
24f206ad82 | ||
|
|
242c3efe45 | ||
|
|
07a848b906 | ||
|
|
1b5402fd2d | ||
|
|
903d791549 | ||
|
|
f03c164f1c | ||
|
|
107bab0192 | ||
|
|
41f5ebb2f1 | ||
|
|
266090dc2a | ||
|
|
83f29f3d62 | ||
|
|
3e6137ca96 | ||
|
|
58510bbd22 | ||
|
|
2f7be75bcf | ||
|
|
0aecbbf892 | ||
|
|
9ef2f4179b | ||
|
|
afbfe3ea12 | ||
|
|
b145a2da85 | ||
|
|
a679f7dd98 | ||
|
|
f343366ea1 | ||
|
|
1bbea7dda0 | ||
|
|
da097e0955 | ||
|
|
1307474755 | ||
|
|
80f5a95297 | ||
|
|
e619966679 | ||
|
|
3f94382925 | ||
|
|
ea7a6f8872 | ||
|
|
4e87b3a0b8 | ||
|
|
8463dd46f7 | ||
|
|
3febe465f6 | ||
|
|
45b834c424 | ||
|
|
1ca041097b | ||
|
|
587f7acd5b | ||
|
|
9e64e4a26b | ||
|
|
96e09ab36c | ||
|
|
4268d3f07b | ||
|
|
1767a2aed5 | ||
|
|
9f061506bb | ||
|
|
0eb9a2048d | ||
|
|
faeafb2402 | ||
|
|
2a0acfa6cb | ||
|
|
0ac44ac267 | ||
|
|
b9ae3a4d5a | ||
|
|
b1aefb0003 | ||
|
|
f6a41ec55c | ||
|
|
39650cc584 | ||
|
|
d837287da7 | ||
|
|
6e718a39d1 | ||
|
|
2e7db02238 | ||
|
|
dbfd108819 | ||
|
|
82c0f6fc0f | ||
|
|
9e6bbaa67d | ||
|
|
012a203c4a | ||
|
|
c7ba129ed7 | ||
|
|
fbe57d00db | ||
|
|
dc4fdf215c | ||
|
|
2166ac1584 | ||
|
|
504756de09 | ||
|
|
90f04dba94 | ||
|
|
bfd7645fb7 | ||
|
|
c37c6983c3 | ||
|
|
736c700aa0 | ||
|
|
de1cb901fc | ||
|
|
3d9d6397f6 | ||
|
|
dbe836729f | ||
|
|
82fa93e676 | ||
|
|
90a3392b80 | ||
|
|
b7f715bd5e | ||
|
|
5f88f46770 | ||
|
|
2244c91a64 | ||
|
|
78134404c3 | ||
|
|
c9cd6b175d | ||
|
|
5f70d283e0 | ||
|
|
cd1e27fd11 | ||
|
|
0fd1c19514 | ||
|
|
a82dffd77d | ||
|
|
d3eed87077 | ||
|
|
d99f8ad7e7 | ||
|
|
e933305407 | ||
|
|
690bc5a64a | ||
|
|
d2380a5c9c | ||
|
|
c2d0a6e9e0 | ||
|
|
a8c44fddca | ||
|
|
0e6b306bdc | ||
|
|
9b2a47ba0c | ||
|
|
3038ebc1c7 | ||
|
|
5a48d5b400 | ||
|
|
f36edfe98d | ||
|
|
3e80d6e13b | ||
|
|
c8f0a1ccc6 | ||
|
|
79325a3129 | ||
|
|
1ca0fffe5e | ||
|
|
f5b9842b2e | ||
|
|
72ea3f125e | ||
|
|
f7a2408e44 | ||
|
|
c05de9a085 | ||
|
|
fc657f3b2d | ||
|
|
e388de0364 | ||
|
|
26e55afb29 | ||
|
|
9b8e1039f6 | ||
|
|
082d14ba50 | ||
|
|
87ead595c6 | ||
|
|
fb073acdc3 | ||
|
|
3dda4e24bf | ||
|
|
c966bd08ed | ||
|
|
692c73a6d0 | ||
|
|
849b484b4d | ||
|
|
9489baccda | ||
|
|
62cac15222 | ||
|
|
0ee9ce2958 | ||
|
|
a83007fc6c | ||
|
|
901f266dad | ||
|
|
6009426f04 | ||
|
|
6fb89df4cd | ||
|
|
48b99425a3 | ||
|
|
9569f9b09b | ||
|
|
7421896902 | ||
|
|
b837c8d66c | ||
|
|
e180f96eab | ||
|
|
de1f1f790e | ||
|
|
fefa74ce0f | ||
|
|
a2ceb70aa4 | ||
|
|
634103f144 | ||
|
|
f3379de81e | ||
|
|
064ee74c1a | ||
|
|
0e0c15fe3b | ||
|
|
3c855c608d | ||
|
|
414516289c | ||
|
|
d79fa71337 | ||
|
|
39c2ca94c8 | ||
|
|
acf1c5ce04 | ||
|
|
fd7923155f | ||
|
|
2aa6a6daa2 | ||
|
|
9662621980 | ||
|
|
37d007d9ab | ||
|
|
a4e48c359a | ||
|
|
8ef0101a6e | ||
|
|
e21f109026 | ||
|
|
737837eebd | ||
|
|
ba09b54409 | ||
|
|
417091c648 | ||
|
|
5a02368298 | ||
|
|
da7c739497 | ||
|
|
0842281466 | ||
|
|
b480f879b1 | ||
|
|
f8a215d790 | ||
|
|
da69f3b2c8 | ||
|
|
fc442c1a42 | ||
|
|
cf59a6b9fd | ||
|
|
34afcd511a | ||
|
|
e2444a2e4e | ||
|
|
692516de9b | ||
|
|
d51009c823 | ||
|
|
2f121bef5e | ||
|
|
61f7d376d2 | ||
|
|
9e253012e6 | ||
|
|
e4e5b1327b | ||
|
|
6ef3b227b8 | ||
|
|
bf657a0945 | ||
|
|
c3dd1886c9 | ||
|
|
32498bb8a7 | ||
|
|
69bb90a0e4 | ||
|
|
8e2988edf0 | ||
|
|
876a352cfd | ||
|
|
84e44cabfa | ||
|
|
36a838d565 | ||
|
|
9ee8693f40 | ||
|
|
6f02965149 | ||
|
|
27ce82de3b | ||
|
|
3d5a9ef220 | ||
|
|
9b81f6efd2 | ||
|
|
3e77e23d71 | ||
|
|
120c032c82 | ||
|
|
46e15b8ecd | ||
|
|
d71d87041b | ||
|
|
124bd58b9f | ||
|
|
257b9b0562 | ||
|
|
b8e15f691d | ||
|
|
2255e3bfc4 | ||
|
|
8797d84605 | ||
|
|
719179a923 | ||
|
|
1d544099f6 | ||
|
|
9b131a762a | ||
|
|
08c5d2256a | ||
|
|
ed6ee4341f | ||
|
|
157c1148fb | ||
|
|
507ea9e09e | ||
|
|
af68cba7be | ||
|
|
224fbe0e8f | ||
|
|
49a6c5f2c4 | ||
|
|
07c936897c | ||
|
|
3786fb907c | ||
|
|
752d9f0c68 | ||
|
|
baf59aafcb | ||
|
|
8787303d2a | ||
|
|
298eaa8b4b | ||
|
|
118c80af27 | ||
|
|
7b87038a8c | ||
|
|
d103939e45 | ||
|
|
fdc9171c69 | ||
|
|
2a6ade3cab | ||
|
|
c8c42689f9 | ||
|
|
da2f472f4d | ||
|
|
3ba878237b | ||
|
|
7577fb53a2 | ||
|
|
f2509f89ee | ||
|
|
9dd1f78330 | ||
|
|
ebb6c2c420 | ||
|
|
9d23dc1763 | ||
|
|
5fa3f8703e | ||
|
|
797885faea | ||
|
|
68e7e9f5b7 | ||
|
|
d1d165ad51 | ||
|
|
0ebb247666 |
33
.babelrc
33
.babelrc
@@ -1,3 +1,34 @@
|
||||
{
|
||||
"presets": ["env", "react", "stage-0"]
|
||||
"presets": [
|
||||
["@babel/preset-env", {"modules": "commonjs"}],
|
||||
"@babel/preset-react"
|
||||
],
|
||||
"plugins": [
|
||||
"@babel/plugin-syntax-dynamic-import",
|
||||
"@babel/plugin-syntax-import-meta",
|
||||
["@babel/plugin-proposal-class-properties", { "loose": true }],
|
||||
"@babel/plugin-proposal-json-strings",
|
||||
[
|
||||
"@babel/plugin-proposal-decorators",
|
||||
{
|
||||
"legacy": true
|
||||
}
|
||||
],
|
||||
"@babel/plugin-proposal-function-sent",
|
||||
"@babel/plugin-proposal-export-namespace-from",
|
||||
"@babel/plugin-proposal-numeric-separator",
|
||||
"@babel/plugin-proposal-throw-expressions",
|
||||
"@babel/plugin-proposal-export-default-from",
|
||||
"@babel/plugin-proposal-logical-assignment-operators",
|
||||
"@babel/plugin-proposal-optional-chaining",
|
||||
[
|
||||
"@babel/plugin-proposal-pipeline-operator",
|
||||
{
|
||||
"proposal": "minimal"
|
||||
}
|
||||
],
|
||||
"@babel/plugin-proposal-nullish-coalescing-operator",
|
||||
"@babel/plugin-proposal-do-expressions",
|
||||
"@babel/plugin-proposal-function-bind"
|
||||
]
|
||||
}
|
||||
|
||||
77
.dockerignore
Normal file
77
.dockerignore
Normal file
@@ -0,0 +1,77 @@
|
||||
node_modules
|
||||
npm-debug.log
|
||||
### Node template
|
||||
# Logs
|
||||
logs
|
||||
*.log
|
||||
npm-debug.log*
|
||||
yarn-debug.log*
|
||||
yarn-error.log*
|
||||
|
||||
# Runtime data
|
||||
pids
|
||||
*.pid
|
||||
*.seed
|
||||
*.pid.lock
|
||||
|
||||
# Directory for instrumented libs generated by jscoverage/JSCover
|
||||
lib-cov
|
||||
|
||||
# Coverage directory used by tools like istanbul
|
||||
coverage
|
||||
|
||||
# nyc test coverage
|
||||
.nyc_output
|
||||
|
||||
# Grunt intermediate storage (http://gruntjs.com/creating-plugins#storing-task-files)
|
||||
.grunt
|
||||
|
||||
# Bower dependency directory (https://bower.io/)
|
||||
bower_components
|
||||
|
||||
# node-waf configuration
|
||||
.lock-wscript
|
||||
|
||||
# Compiled binary addons (https://nodejs.org/api/addons.html)
|
||||
build/Release
|
||||
|
||||
# Dependency directories
|
||||
node_modules/
|
||||
jspm_packages/
|
||||
|
||||
# TypeScript v1 declaration files
|
||||
typings/
|
||||
|
||||
# Optional npm cache directory
|
||||
.npm
|
||||
|
||||
# Optional eslint cache
|
||||
.eslintcache
|
||||
|
||||
# Optional REPL history
|
||||
.node_repl_history
|
||||
|
||||
# Output of 'npm pack'
|
||||
*.tgz
|
||||
|
||||
# Yarn Integrity file
|
||||
.yarn-integrity
|
||||
|
||||
# dotenv environment variables file
|
||||
.env
|
||||
|
||||
# parcel-bundler cache (https://parceljs.org/)
|
||||
.cache
|
||||
|
||||
# next.js build output
|
||||
.next
|
||||
|
||||
# nuxt.js build output
|
||||
.nuxt
|
||||
|
||||
# vuepress build output
|
||||
.vuepress/dist
|
||||
|
||||
# Serverless directories
|
||||
.serverless
|
||||
|
||||
103
.esdoc.json
Normal file
103
.esdoc.json
Normal file
@@ -0,0 +1,103 @@
|
||||
{
|
||||
"source": "./src/app",
|
||||
"includes": ["\\.js$", "\\.jsx$"],
|
||||
"destination": "./docs",
|
||||
"index": "./README.md",
|
||||
"plugins": [
|
||||
{
|
||||
"name": "esdoc-standard-plugin",
|
||||
"option": {
|
||||
"lint": {
|
||||
"enable": false
|
||||
},
|
||||
"coverage": {
|
||||
"enable": false
|
||||
},
|
||||
"accessor": {
|
||||
"access": [
|
||||
"public",
|
||||
"protected",
|
||||
"private"
|
||||
],
|
||||
"autoPrivate": true
|
||||
},
|
||||
"undocumentIdentifier": {
|
||||
"enable": true
|
||||
},
|
||||
"unexportedIdentifier": {
|
||||
"enable": false
|
||||
},
|
||||
"typeInference": {
|
||||
"enable": true
|
||||
},
|
||||
"brand": {
|
||||
"logo": "./src/images/logo/192x192.png",
|
||||
"title": "Coriolis",
|
||||
"description": "Coriolis Shipyard for Elite Dangerous",
|
||||
"repository": "https://github.com/EDCD/coriolis",
|
||||
"site": "https://coriolis.io",
|
||||
"author": "https://github.com/edcd",
|
||||
"image": "./src/images/logo/192x192.png"
|
||||
}
|
||||
}
|
||||
},
|
||||
{
|
||||
"name": "esdoc-ecmascript-proposal-plugin",
|
||||
"option": {
|
||||
"all": true
|
||||
}
|
||||
},
|
||||
{
|
||||
"name": "esdoc-react-plugin"
|
||||
},
|
||||
{
|
||||
"name": "esdoc-standard-plugin",
|
||||
"option": {
|
||||
"lint": {
|
||||
"enable": false
|
||||
},
|
||||
"coverage": {
|
||||
"enable": false
|
||||
},
|
||||
"accessor": {
|
||||
"access": [
|
||||
"public",
|
||||
"protected",
|
||||
"private"
|
||||
],
|
||||
"autoPrivate": true
|
||||
},
|
||||
"undocumentIdentifier": {
|
||||
"enable": true
|
||||
},
|
||||
"unexportedIdentifier": {
|
||||
"enable": false
|
||||
},
|
||||
"typeInference": {
|
||||
"enable": true
|
||||
},
|
||||
"brand": {
|
||||
"logo": "./src/images/logo/192x192.png",
|
||||
"title": "Coriolis",
|
||||
"description": "Coriolis Shipyard for Elite Dangerous",
|
||||
"repository": "https://github.com/EDCD/coriolis",
|
||||
"site": "https://coriolis.io",
|
||||
"author": "https://github.com/edcd",
|
||||
"image": "./src/images/logo/192x192.png"
|
||||
}
|
||||
}
|
||||
},
|
||||
{
|
||||
"name": "esdoc-jsx-plugin",
|
||||
"option": {
|
||||
"enable": true
|
||||
}
|
||||
},
|
||||
{
|
||||
"name": "esdoc-publish-html-plugin",
|
||||
"option": {
|
||||
"template": "./node_modules/esdoc-custom-theme/template"
|
||||
}
|
||||
}
|
||||
]
|
||||
}
|
||||
@@ -5,11 +5,12 @@
|
||||
"jsx": true,
|
||||
"classes": true,
|
||||
"modules": true
|
||||
},
|
||||
}
|
||||
},
|
||||
"env": {
|
||||
"browser": true,
|
||||
"node": true
|
||||
"node": true,
|
||||
"es6": true
|
||||
},
|
||||
"plugins": [
|
||||
"react"
|
||||
@@ -33,7 +34,6 @@
|
||||
"ClassDeclaration": true
|
||||
}
|
||||
}],
|
||||
"no-console": 2,
|
||||
"brace-style": [2, "1tbs", { "allowSingleLine": true }],
|
||||
"comma-style": [2, "last"],
|
||||
"indent": [2, 2, { "SwitchCase": 1, "VariableDeclarator": 2 }],
|
||||
|
||||
3
.gitignore
vendored
3
.gitignore
vendored
@@ -7,3 +7,6 @@ nginx.pid
|
||||
/bin
|
||||
env
|
||||
*.swp
|
||||
.project
|
||||
.vscode/
|
||||
docs/
|
||||
|
||||
13
.gitlab-ci.yml
Normal file
13
.gitlab-ci.yml
Normal file
@@ -0,0 +1,13 @@
|
||||
image: docker:stable
|
||||
services:
|
||||
- docker:dind
|
||||
|
||||
stages:
|
||||
- Build image
|
||||
|
||||
docker build:
|
||||
stage: Build image
|
||||
script:
|
||||
- img build --build-arg branch=$CI_COMMIT_REF_NAME -t edcd/coriolis:$CI_COMMIT_REF_NAME .
|
||||
- echo "$REGISTRY_PASSWORD" | img login --username "$REGISTRY_USER" --password-stdin
|
||||
- img push edcd/coriolis:$CI_COMMIT_REF_NAME
|
||||
@@ -8,7 +8,8 @@ cache:
|
||||
directories:
|
||||
- node_modules
|
||||
|
||||
before_script:
|
||||
before_install:
|
||||
- git clone https://github.com/EDCD/coriolis-data.git ../coriolis-data
|
||||
|
||||
script:
|
||||
- npm run lint
|
||||
|
||||
35
Dockerfile
Normal file
35
Dockerfile
Normal file
@@ -0,0 +1,35 @@
|
||||
### STAGE 1: Build ###
|
||||
FROM node:9.11.1-alpine as builder
|
||||
ARG branch=develop
|
||||
ENV BRANCH=$branch
|
||||
WORKDIR /src/app
|
||||
RUN mkdir -p /src/app/coriolis
|
||||
RUN mkdir -p /src/app/coriolis-data
|
||||
|
||||
RUN apk add --update git
|
||||
|
||||
COPY . /src/app/coriolis
|
||||
|
||||
RUN npm i -g npm
|
||||
|
||||
# Set up coriolis-data
|
||||
WORKDIR /src/app/coriolis-data
|
||||
RUN git clone https://github.com/EDCD/coriolis-data.git .
|
||||
RUN git checkout ${BRANCH}
|
||||
RUN npm install --no-package-lock
|
||||
RUN npm start
|
||||
|
||||
# Set up coriolis
|
||||
WORKDIR /src/app/coriolis
|
||||
RUN git checkout ${BRANCH}
|
||||
RUN npm install --no-package-lock
|
||||
RUN npm run build
|
||||
|
||||
|
||||
### STAGE 2: Production Environment ###
|
||||
FROM fholzer/nginx-brotli as web
|
||||
COPY nginx.conf /etc/nginx/nginx.conf
|
||||
COPY --from=builder /src/app/coriolis/build /usr/share/nginx/html
|
||||
WORKDIR /usr/share/nginx/html
|
||||
EXPOSE 80
|
||||
CMD ["nginx", "-c", "/etc/nginx/nginx.conf", "-g", "daemon off;"]
|
||||
24
LICENSE.md
Normal file
24
LICENSE.md
Normal file
@@ -0,0 +1,24 @@
|
||||
All Data and [associated JSON](https://github.com/EDCD/coriolis-data) files are intellectual property and copyright of Frontier Developments plc ('Frontier', 'Frontier Developments') and are subject to their
|
||||
[terms and conditions](https://www.frontierstore.net/terms-and-conditions/).
|
||||
|
||||
The code (Javascript, CSS, HTML, and SVG files only) specificially for Coriolis.io is released under the MIT License.
|
||||
|
||||
Copyright (c) 2015 Coriolis.io, Colin McLeod
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software (Javascript, CSS, HTML, and SVG files only), and associated documentation files (the "Software"), to deal
|
||||
in the Software without restriction, including without limitation the rights
|
||||
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||
copies of the Software, and to permit persons to whom the Software is
|
||||
furnished to do so, subject to the following conditions:
|
||||
|
||||
The above copyright notice and this permission notice shall be included in
|
||||
all copies or substantial portions of the Software.
|
||||
|
||||
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
||||
THE SOFTWARE.
|
||||
@@ -23,11 +23,14 @@ Chat to us on [Discord](https://discord.gg/0uwCh6R62aPRjk9w)!
|
||||
|
||||
See the [Developer's Guide](https://github.com/EDCD/coriolis/wiki/Developing-for-Coriolis) in the wiki.
|
||||
|
||||
Also see [the documentation site.](https://coriolis.willb.info/)
|
||||
|
||||
### Ship and Module Database
|
||||
|
||||
See the [Data wiki](https://github.com/cmmcleod/coriolis-data/wiki) for details on structure, etc.
|
||||
|
||||
You can find hosted and compiled versions of these data-jsons under https://coriolis.io/data/ and https://beta.coriolis.io/data/.
|
||||
You might want to load these as depedency instead of reyling on the npm-dependency.
|
||||
|
||||
## License
|
||||
|
||||
|
||||
11
d3-funcs.js
vendored
11
d3-funcs.js
vendored
@@ -1,11 +0,0 @@
|
||||
export {
|
||||
axisBottom,
|
||||
axisLeft,
|
||||
axisTop,
|
||||
formatLocale,
|
||||
line,
|
||||
scaleBand,
|
||||
scaleLinear,
|
||||
scaleOrdinal,
|
||||
select
|
||||
} from 'd3';
|
||||
56
docker-compose.yml
Normal file
56
docker-compose.yml
Normal file
@@ -0,0 +1,56 @@
|
||||
version: '2.2'
|
||||
|
||||
services:
|
||||
coriolis_prod:
|
||||
image: edcd/coriolis:master
|
||||
build:
|
||||
dockerfile: Dockerfile
|
||||
args:
|
||||
branch: master
|
||||
restart: always
|
||||
volumes:
|
||||
- ./nginx.conf:/etc/nginx/nginx.conf
|
||||
networks:
|
||||
- web
|
||||
labels:
|
||||
- "traefik.docker.network=web"
|
||||
- "traefik.enable=true"
|
||||
- "traefik.basic.frontend.rule=Host:coriolis.io,coriolis.edcd.io"
|
||||
- "traefik.basic.port=80"
|
||||
- "traefik.basic.protocol=http"
|
||||
|
||||
coriolis_dev:
|
||||
image: edcd/coriolis:develop
|
||||
build:
|
||||
dockerfile: Dockerfile
|
||||
args:
|
||||
branch: develop
|
||||
restart: always
|
||||
volumes:
|
||||
- ./nginx.conf:/etc/nginx/nginx.conf
|
||||
networks:
|
||||
- web
|
||||
labels:
|
||||
- "traefik.docker.network=web"
|
||||
- "traefik.enable=true"
|
||||
- "traefik.basic.frontend.rule=Host:beta.coriolis.io,beta.coriolis.edcd.io"
|
||||
- "traefik.basic.port=80"
|
||||
- "traefik.basic.protocol=http"
|
||||
|
||||
coriolis_dw2:
|
||||
image: edcd/coriolis:dw2
|
||||
restart: always
|
||||
volumes:
|
||||
- ./nginx.conf:/etc/nginx/nginx.conf
|
||||
networks:
|
||||
- web
|
||||
labels:
|
||||
- "traefik.docker.network=web"
|
||||
- "traefik.enable=true"
|
||||
- "traefik.basic.frontend.rule=Host:dw2.coriolis.io"
|
||||
- "traefik.basic.port=80"
|
||||
- "traefik.basic.protocol=http"
|
||||
|
||||
networks:
|
||||
web:
|
||||
external: true
|
||||
127
nginx.conf
127
nginx.conf
@@ -1,59 +1,96 @@
|
||||
worker_processes 2;
|
||||
error_log ./nginx.error.log;
|
||||
worker_rlimit_nofile 8192;
|
||||
pid nginx.pid;
|
||||
worker_processes 1;
|
||||
user nobody nobody;
|
||||
error_log /tmp/error.log;
|
||||
pid /tmp/nginx.pid;
|
||||
|
||||
events {
|
||||
worker_connections 1024;
|
||||
multi_accept on;
|
||||
|
||||
worker_connections 1024;
|
||||
}
|
||||
|
||||
http {
|
||||
|
||||
access_log off;
|
||||
charset UTF-8;
|
||||
include /etc/nginx/mime.types;
|
||||
default_type application/octet-stream;
|
||||
sendfile on;
|
||||
client_body_temp_path /tmp/client_body;
|
||||
fastcgi_temp_path /tmp/fastcgi_temp;
|
||||
proxy_temp_path /tmp/proxy_temp;
|
||||
scgi_temp_path /tmp/scgi_temp;
|
||||
uwsgi_temp_path /tmp/uwsgi_temp;
|
||||
access_log /tmp/access.log;
|
||||
error_log /tmp/error.log;
|
||||
|
||||
types {
|
||||
text/html html htm shtml;
|
||||
text/css css;
|
||||
text/xml xml rss;
|
||||
image/gif gif;
|
||||
image/jpeg jpeg jpg;
|
||||
application/x-javascript js;
|
||||
text/plain txt;
|
||||
image/png png;
|
||||
image/svg+xml svg;
|
||||
image/x-icon ico;
|
||||
application/pdf pdf;
|
||||
text/cache-manifest appcache;
|
||||
}
|
||||
# https://nginx.org/en/docs/http/ngx_http_gzip_module.html
|
||||
# Enable gzip compression.
|
||||
# Default: off
|
||||
gzip off;
|
||||
|
||||
gzip on;
|
||||
gzip_vary on;
|
||||
gzip_proxied any;
|
||||
gzip_comp_level 6;
|
||||
gzip_buffers 16 8k;
|
||||
gzip_http_version 1.1;
|
||||
gzip_types text/plain text/css application/json application/x-javascript text/xml application/xml application/xml+rss text/javascript;
|
||||
# Compression level (1-9).
|
||||
# 5 is a perfect compromise between size and CPU usage, offering about
|
||||
# 75% reduction for most ASCII files (almost identical to level 9).
|
||||
# Default: 1
|
||||
gzip_comp_level 5;
|
||||
|
||||
server {
|
||||
listen 3301;
|
||||
server_name localhost;
|
||||
root ./build/;
|
||||
index index.html;
|
||||
# Don't compress anything that's already small and unlikely to shrink much
|
||||
# if at all (the default is 20 bytes, which is bad as that usually leads to
|
||||
# larger files after gzipping).
|
||||
# Default: 20
|
||||
gzip_min_length 256;
|
||||
|
||||
location ~* \.(?:manifest|appcache|html?|xml|json|css|js|map|jpg|jpeg|gif|png|ico|svg|eot|ttf|woff|woff2)$ {
|
||||
expires -1;
|
||||
add_header Access-Control-Allow-Origin *;
|
||||
# Compress data even for clients that are connecting to us via proxies,
|
||||
# identified by the "Via" header (required for CloudFront).
|
||||
# Default: off
|
||||
gzip_proxied any;
|
||||
|
||||
# Tell proxies to cache both the gzipped and regular version of a resource
|
||||
# whenever the client's Accept-Encoding capabilities header varies;
|
||||
# Avoids the issue where a non-gzip capable client (which is extremely rare
|
||||
# today) would display gibberish if their proxy gave them the gzipped version.
|
||||
# Default: off
|
||||
gzip_vary on;
|
||||
|
||||
# Compress all output labeled with one of the following MIME-types.
|
||||
# text/html is always compressed by gzip module.
|
||||
# Default: text/html
|
||||
gzip_types *;
|
||||
brotli on;
|
||||
# brotli_static on;
|
||||
brotli_types *;
|
||||
# This should be turned on if you are going to have pre-compressed copies (.gz) of
|
||||
# static files available. If not it should be left off as it will cause extra I/O
|
||||
# for the check. It is best if you enable this in a location{} block for
|
||||
# a specific directory, or on an individual server{} level.
|
||||
# gzip_static on;
|
||||
keepalive_timeout 3000;
|
||||
server {
|
||||
listen 80;
|
||||
listen [::]:80;
|
||||
index index.html;
|
||||
server_name localhost;
|
||||
root /usr/share/nginx/html;
|
||||
autoindex on;
|
||||
|
||||
location ~* \.(?:manifest|appcache|html?|xml|json|css|js|map|jpg|jpeg|gif|png|ico|svg|eot|ttf|woff|woff2)$ {
|
||||
add_header Access-Control-Allow-Origin *;
|
||||
add_header Access-Control-Allow-Credentials true;
|
||||
add_header Access-Control-Allow-Methods 'GET, POST, OPTIONS';
|
||||
add_header Access-Control-Allow-Headers 'DNT,X-CustomHeader,Keep-Alive,User-Agent,X-Requested-With,If-Modified-Since,Cache-Control,Content-Type';
|
||||
access_log off;
|
||||
}
|
||||
location /service-worker.js {
|
||||
expires -1;
|
||||
add_header Access-Control-Allow-Origin *;
|
||||
add_header Access-Control-Allow-Credentials true;
|
||||
add_header Access-Control-Allow-Methods 'GET, POST, OPTIONS';
|
||||
add_header Access-Control-Allow-Headers 'DNT,X-CustomHeader,Keep-Alive,User-Agent,X-Requested-With,If-Modified-Since,Cache-Control,Content-Type';
|
||||
access_log off;
|
||||
}
|
||||
|
||||
location / {
|
||||
try_files $uri $uri/ /index.html =404;
|
||||
}
|
||||
}
|
||||
access_log off;
|
||||
}
|
||||
location / {
|
||||
try_files $uri $uri/ /index.html =404;
|
||||
}
|
||||
location /iframe.html {
|
||||
try_files $uri $uri/ /iframe.html =404;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
29173
package-lock.json
generated
29173
package-lock.json
generated
File diff suppressed because it is too large
Load Diff
122
package.json
122
package.json
@@ -1,17 +1,16 @@
|
||||
{
|
||||
"name": "coriolis_shipyard",
|
||||
"version": "2.9.12",
|
||||
"version": "3.0.0",
|
||||
"repository": {
|
||||
"type": "git",
|
||||
"url": "https://github.com/EDCD/coriolis"
|
||||
},
|
||||
"homepage": "https://coriolis.edcd.io",
|
||||
"homepage": "https://coriolis.io",
|
||||
"bugs": "https://github.com/EDCD/coriolis/issues",
|
||||
"private": true,
|
||||
"engine": "node >= 4.8.1",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
"prepublish": "rollup -c && uglifyjs d3.js -c -m -o d3.min.js",
|
||||
"extract-translations": "grep -hroE \"(translate\\('[^']+'\\))|(tip.bind\\(null, '[^']+')\" src/* | grep -oE \"'[^']+'\" | grep -oE \"[^']+\" | sort -u -f",
|
||||
"clean": "rimraf build",
|
||||
"start": "node devServer.js",
|
||||
@@ -56,61 +55,94 @@
|
||||
]
|
||||
},
|
||||
"devDependencies": {
|
||||
"appcache-webpack-plugin": "^1.3.0",
|
||||
"babel-core": "*",
|
||||
"babel-eslint": "*",
|
||||
"babel-jest": "*",
|
||||
"babel-loader": "*",
|
||||
"babel-preset-env": "*",
|
||||
"babel-preset-react": "*",
|
||||
"babel-preset-stage-0": "*",
|
||||
"create-react-class": "^15.6.2",
|
||||
"css-loader": "^0.28.0",
|
||||
"cross-env": "^5.1.4",
|
||||
"d3-selection": "1",
|
||||
"eslint": "3.19.0",
|
||||
"eslint-plugin-react": "^6.10.3",
|
||||
"expose-loader": "^0.7.3",
|
||||
"express": "^4.15.2",
|
||||
"extract-text-webpack-plugin": "2.1.0",
|
||||
"file-loader": "^0.11.1",
|
||||
"html-webpack-plugin": "^2.28.0",
|
||||
"jest-cli": "^21.2.1",
|
||||
"@babel/core": "^7.0.0",
|
||||
"@babel/plugin-proposal-class-properties": "^7.0.0",
|
||||
"@babel/plugin-proposal-decorators": "^7.0.0",
|
||||
"@babel/plugin-proposal-do-expressions": "^7.0.0",
|
||||
"@babel/plugin-proposal-export-default-from": "^7.0.0",
|
||||
"@babel/plugin-proposal-export-namespace-from": "^7.0.0",
|
||||
"@babel/plugin-proposal-function-bind": "^7.0.0",
|
||||
"@babel/plugin-proposal-function-sent": "^7.0.0",
|
||||
"@babel/plugin-proposal-json-strings": "^7.0.0",
|
||||
"@babel/plugin-proposal-logical-assignment-operators": "^7.0.0",
|
||||
"@babel/plugin-proposal-nullish-coalescing-operator": "^7.0.0",
|
||||
"@babel/plugin-proposal-numeric-separator": "^7.0.0",
|
||||
"@babel/plugin-proposal-optional-chaining": "^7.0.0",
|
||||
"@babel/plugin-proposal-pipeline-operator": "^7.0.0",
|
||||
"@babel/plugin-proposal-throw-expressions": "^7.0.0",
|
||||
"@babel/plugin-syntax-dynamic-import": "^7.0.0",
|
||||
"@babel/plugin-syntax-import-meta": "^7.0.0",
|
||||
"@babel/preset-env": "^7.0.0",
|
||||
"@babel/preset-react": "^7.0.0",
|
||||
"appcache-webpack-plugin": "^1.4.0",
|
||||
"babel-core": "^7.0.0-bridge.0",
|
||||
"babel-eslint": "^10.0.1",
|
||||
"babel-jest": "^23.6.0",
|
||||
"babel-loader": "^8.0.0",
|
||||
"copy-webpack-plugin": "^4.5.2",
|
||||
"create-react-class": "^15.6.3",
|
||||
"cross-env": "^5.2.0",
|
||||
"css-loader": "^1.0.0",
|
||||
"d3-selection": "^1.3.2",
|
||||
"esdoc": "^1.1.0",
|
||||
"esdoc-custom-theme": "^1.4.2",
|
||||
"esdoc-ecmascript-proposal-plugin": "^1.0.0",
|
||||
"esdoc-jsx-plugin": "^1.0.0",
|
||||
"esdoc-publish-html-plugin": "^1.1.2",
|
||||
"esdoc-react-plugin": "^1.0.1",
|
||||
"esdoc-standard-plugin": "^1.0.0",
|
||||
"eslint": "^5.6.0",
|
||||
"eslint-plugin-react": "^7.11.1",
|
||||
"expose-loader": "^0.7.5",
|
||||
"express": "^4.16.3",
|
||||
"extract-text-webpack-plugin": "^4.0.0-beta.0",
|
||||
"file-loader": "^2.0.0",
|
||||
"html-webpack-plugin": "^3.0.7",
|
||||
"jest-cli": "^23.6.0",
|
||||
"jsen": "^0.6.4",
|
||||
"json-loader": "^0.5.4",
|
||||
"less": "^2.7.2",
|
||||
"less-loader": "^4.0.3",
|
||||
"less": "^3.8.1",
|
||||
"less-loader": "^4.1.0",
|
||||
"react-addons-perf": "^15.4.2",
|
||||
"react-measure": "^1.4.7",
|
||||
"react-testutils-additions": "^15.2.0",
|
||||
"react-transition-group": "^1.1.2",
|
||||
"react-container-dimensions": "^1.4.1",
|
||||
"react-testutils-additions": "^16.0.0",
|
||||
"react-transition-group": "^2.5.0",
|
||||
"rimraf": "^2.6.1",
|
||||
"rollup": "0.41",
|
||||
"rollup-plugin-node-resolve": "3",
|
||||
"style-loader": "^0.16.1",
|
||||
"uglify-js": "^2.4.11",
|
||||
"url-loader": "^0.5.8",
|
||||
"webpack": "^2.4.1",
|
||||
"webpack-dev-server": "^2.4.4",
|
||||
"rollup": "^0.66.2",
|
||||
"rollup-plugin-node-resolve": "^3.4.0",
|
||||
"style-loader": "^0.23.0",
|
||||
"uglify-js": "^3.4.9",
|
||||
"url-loader": "^1.1.1",
|
||||
"webpack": "^4.20.2",
|
||||
"webpack-bugsnag-plugins": "^1.2.2",
|
||||
"webpack-cli": "^3.1.1",
|
||||
"webpack-dev-server": "^3.1.9",
|
||||
"webpack-notifier": "^1.6.0",
|
||||
"webpack-bugsnag-plugins": "^1.1.1"
|
||||
"workbox-webpack-plugin": "^3.6.1"
|
||||
},
|
||||
"sideEffects": false,
|
||||
"dependencies": {
|
||||
"babel-polyfill": "*",
|
||||
"@babel/polyfill": "^7.0.0",
|
||||
"auto-bind": "^2.1.1",
|
||||
"browserify-zlib-next": "^1.0.1",
|
||||
"classnames": "^2.2.5",
|
||||
"classnames": "^2.2.6",
|
||||
"coriolis-data": "../coriolis-data",
|
||||
"d3": "4.8.0",
|
||||
"detect-browser": "^1.7.0",
|
||||
"d3": "^5.7.0",
|
||||
"detect-browser": "^3.0.1",
|
||||
"ed-forge": "github:EDCD/ed-forge",
|
||||
"fbemitter": "^2.1.1",
|
||||
"lodash": "^4.17.4",
|
||||
"lodash": "^4.17.11",
|
||||
"lz-string": "^1.4.4",
|
||||
"pako": "^1.0.6",
|
||||
"prop-types": "^15.5.8",
|
||||
"prop-types": "^15.6.2",
|
||||
"react": "^15.5.4",
|
||||
"react-dom": "^15.5.4",
|
||||
"react-number-editor": "Athanasius/react-number-editor.git#miggy",
|
||||
"recharts": "^0.22.3",
|
||||
"superagent": "^3.5.2"
|
||||
"react-extras": "^0.7.1",
|
||||
"react-fuzzy": "^0.5.2",
|
||||
"react-ga": "^2.5.3",
|
||||
"react-number-editor": "^4.0.3",
|
||||
"recharts": "^1.2.0",
|
||||
"register-service-worker": "^1.5.2",
|
||||
"superagent": "^3.8.3"
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,19 +1,18 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import Router from './Router';
|
||||
import { register } from 'register-service-worker';
|
||||
import { EventEmitter } from 'fbemitter';
|
||||
import { getLanguage } from './i18n/Language';
|
||||
import Persist from './stores/Persist';
|
||||
import { Ship } from 'ed-forge';
|
||||
|
||||
import Announcement from './components/Announcement';
|
||||
import Header from './components/Header';
|
||||
import Tooltip from './components/Tooltip';
|
||||
import ModalExport from './components/ModalExport';
|
||||
import ModalHelp from './components/ModalHelp';
|
||||
import ModalImport from './components/ModalImport';
|
||||
import ModalPermalink from './components/ModalPermalink';
|
||||
import * as CompanionApiUtils from './utils/CompanionApiUtils';
|
||||
import * as JournalUtils from './utils/JournalUtils';
|
||||
|
||||
import AboutPage from './pages/AboutPage';
|
||||
import NotFoundPage from './pages/NotFoundPage';
|
||||
import OutfittingPage from './pages/OutfittingPage';
|
||||
@@ -21,13 +20,12 @@ import ComparisonPage from './pages/ComparisonPage';
|
||||
import ShipyardPage from './pages/ShipyardPage';
|
||||
import ErrorDetails from './pages/ErrorDetails';
|
||||
|
||||
const zlib = require('pako');
|
||||
const request = require('superagent');
|
||||
|
||||
/**
|
||||
* Coriolis App
|
||||
*/
|
||||
export default class Coriolis extends React.Component {
|
||||
|
||||
static childContextTypes = {
|
||||
closeMenu: PropTypes.func.isRequired,
|
||||
hideModal: PropTypes.func.isRequired,
|
||||
@@ -60,17 +58,17 @@ export default class Coriolis extends React.Component {
|
||||
this._onLanguageChange = this._onLanguageChange.bind(this);
|
||||
this._onSizeRatioChange = this._onSizeRatioChange.bind(this);
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this._importBuild = this._importBuild.bind(this);
|
||||
|
||||
this.emitter = new EventEmitter();
|
||||
this.state = {
|
||||
noTouch: !('ontouchstart' in window || navigator.msMaxTouchPoints || navigator.maxTouchPoints),
|
||||
page: null,
|
||||
announcements: [],
|
||||
language: getLanguage(Persist.getLangCode()),
|
||||
route: {},
|
||||
sizeRatio: Persist.getSizeRatio()
|
||||
};
|
||||
|
||||
this._getAnnouncements();
|
||||
Router('', (r) => this._setPage(ShipyardPage, r));
|
||||
Router('/import?', (r) => this._importBuild(r));
|
||||
Router('/import/:data', (r) => this._importBuild(r));
|
||||
@@ -91,24 +89,25 @@ export default class Coriolis extends React.Component {
|
||||
_importBuild(r) {
|
||||
try {
|
||||
// Need to decode and gunzip the data, then build the ship
|
||||
const data = zlib.inflate(new Buffer(r.params.data, 'base64'), { to: 'string' });
|
||||
const json = JSON.parse(data);
|
||||
console.log('Ship import data: ');
|
||||
console.log(json);
|
||||
let ship;
|
||||
if (json && json.modules) {
|
||||
ship = CompanionApiUtils.shipFromJson(json);
|
||||
} else if (json && json.Modules) {
|
||||
ship = JournalUtils.shipFromLoadoutJSON(json);
|
||||
}
|
||||
r.params.ship = ship.id;
|
||||
r.params.code = ship.toString();
|
||||
let ship = new Ship(r.params.data);
|
||||
r.params.ship = ship.getShipType();
|
||||
r.params.code = ship.compress();
|
||||
this._setPage(OutfittingPage, r);
|
||||
} catch (err) {
|
||||
this._onError('Failed to import ship', r.path, 0, 0, err);
|
||||
}
|
||||
}
|
||||
|
||||
async _getAnnouncements() {
|
||||
try {
|
||||
const announces = await request.get('https://orbis.zone/api/announcement')
|
||||
.query({ showInCoriolis: true });
|
||||
this.setState({ announcements: announces.body });
|
||||
} catch (err) {
|
||||
console.error(err)
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates / Sets the page and route context
|
||||
* @param {[type]} page The page to be shown
|
||||
@@ -134,9 +133,9 @@ export default class Coriolis extends React.Component {
|
||||
console && console.error && console.error(arguments); // eslint-disable-line no-console
|
||||
if (errObj) {
|
||||
if (errObj instanceof Error) {
|
||||
bugsnagClient.notify(errObj) // eslint-disable-line
|
||||
bugsnagClient.notify(errObj); // eslint-disable-line
|
||||
} else if (errObj instanceof String) {
|
||||
bugsnagClient.notify(msg, errObj) // eslint-disable-line
|
||||
bugsnagClient.notify(msg, errObj); // eslint-disable-line
|
||||
}
|
||||
}
|
||||
this.setState({
|
||||
@@ -180,13 +179,13 @@ export default class Coriolis extends React.Component {
|
||||
case 72: // 'h'
|
||||
if (e.ctrlKey || e.metaKey) { // CTRL/CMD + h
|
||||
e.preventDefault();
|
||||
this._showModal(<ModalHelp />);
|
||||
this._showModal(<ModalHelp/>);
|
||||
}
|
||||
break;
|
||||
case 73: // 'i'
|
||||
if (e.ctrlKey || e.metaKey) { // CTRL/CMD + i
|
||||
e.preventDefault();
|
||||
this._showModal(<ModalImport />);
|
||||
this._showModal(<ModalImport/>);
|
||||
}
|
||||
break;
|
||||
case 79: // 'o'
|
||||
@@ -208,7 +207,7 @@ export default class Coriolis extends React.Component {
|
||||
* @param {React.Component} content Modal Content
|
||||
*/
|
||||
_showModal(content) {
|
||||
let modal = <div className='modal-bg' onClick={(e) => this._hideModal() }>{content}</div>;
|
||||
let modal = <div className='modal-bg' onClick={(e) => this._hideModal()}>{content}</div>;
|
||||
this.setState({ modal });
|
||||
}
|
||||
|
||||
@@ -286,7 +285,7 @@ export default class Coriolis extends React.Component {
|
||||
return this.emitter.addListener('windowResize', listener);
|
||||
}
|
||||
|
||||
/**
|
||||
/**
|
||||
* Add a listener to global commands such as save,
|
||||
* @param {Function} listener Listener callback
|
||||
* @return {Object} Subscription token
|
||||
@@ -322,14 +321,50 @@ export default class Coriolis extends React.Component {
|
||||
*/
|
||||
componentWillMount() {
|
||||
// Listen for appcache updated event, present refresh to update view
|
||||
if (window.applicationCache) {
|
||||
window.applicationCache.addEventListener('updateready', () => {
|
||||
if (window.applicationCache.status == window.applicationCache.UPDATEREADY) {
|
||||
this.setState({ appCacheUpdate: true }); // Browser downloaded a new app cache.
|
||||
}
|
||||
// Check that service workers are registered
|
||||
if (navigator.storage && navigator.storage.persist) {
|
||||
window.addEventListener('load', () => {
|
||||
navigator.storage.persist().then(granted => {
|
||||
if (granted)
|
||||
console.log('Storage will not be cleared except by explicit user action');
|
||||
else
|
||||
console.log('Storage may be cleared by the UA under storage pressure.');
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
if ('serviceWorker' in navigator) {
|
||||
// Your service-worker.js *must* be located at the top-level directory relative to your site.
|
||||
// It won't be able to control pages unless it's located at the same level or higher than them.
|
||||
// *Don't* register service worker file in, e.g., a scripts/ sub-directory!
|
||||
// See https://github.com/slightlyoff/ServiceWorker/issues/468
|
||||
const self = this;
|
||||
if (process.env.NODE_ENV === 'production') {
|
||||
register('/service-worker.js', {
|
||||
ready(registration) {
|
||||
console.log('Service worker is active.');
|
||||
},
|
||||
registered(registration) {
|
||||
console.log('Service worker has been registered.');
|
||||
},
|
||||
cached(registration) {
|
||||
console.log('Content has been cached for offline use.');
|
||||
},
|
||||
updatefound(registration) {
|
||||
console.log('New content is downloading.');
|
||||
},
|
||||
updated(registration) {
|
||||
self.setState({ appCacheUpdate: true });
|
||||
console.log('New content is available; please refresh.');
|
||||
},
|
||||
offline() {
|
||||
console.log('No internet connection found. App is running in offline mode.');
|
||||
},
|
||||
error(error) {
|
||||
console.error('Error during service worker registration:', error);
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
window.onerror = this._onError.bind(this);
|
||||
window.addEventListener('resize', () => this.emitter.emit('windowResize'));
|
||||
document.getElementById('coriolis').addEventListener('scroll', () => this._tooltip());
|
||||
@@ -347,14 +382,26 @@ export default class Coriolis extends React.Component {
|
||||
render() {
|
||||
let currentMenu = this.state.currentMenu;
|
||||
|
||||
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu} className={ this.state.noTouch ? 'no-touch' : null }>
|
||||
<Header appCacheUpdate={this.state.appCacheUpdate} currentMenu={currentMenu} />
|
||||
{ this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) : <NotFoundPage/> }
|
||||
{ this.state.modal }
|
||||
{ this.state.tooltip }
|
||||
return <div style={{ minHeight: '100%' }} onClick={this._closeMenu}
|
||||
className={this.state.noTouch ? 'no-touch' : null}>
|
||||
<Header announcements={this.state.announcements} appCacheUpdate={this.state.appCacheUpdate}
|
||||
currentMenu={currentMenu}/>
|
||||
<div className="announcement-container">{this.state.announcements.map(a => <Announcement
|
||||
text={a.message}/>)}</div>
|
||||
{this.state.error ? this.state.error : this.state.page ? React.createElement(this.state.page, { currentMenu }) :
|
||||
<NotFoundPage/>}
|
||||
{this.state.modal}
|
||||
{this.state.tooltip}
|
||||
<footer>
|
||||
<div className="right cap">
|
||||
<a href="https://github.com/EDCD/coriolis" target="_blank" title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a>
|
||||
<a href="https://github.com/EDCD/coriolis" target="_blank" rel="noopener noreferrer"
|
||||
title="Coriolis Github Project">{window.CORIOLIS_VERSION} - {window.CORIOLIS_DATE}</a>
|
||||
<br/>
|
||||
<a
|
||||
href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'}
|
||||
target="_blank" rel="noopener noreferrer" title={'Coriolis Commits since' + window.CORIOLIS_DATE}>Commits
|
||||
since last release
|
||||
({window.CORIOLIS_DATE})</a>
|
||||
</div>
|
||||
</footer>
|
||||
</div>;
|
||||
|
||||
@@ -257,9 +257,8 @@ Route.prototype.match = function(path, params) {
|
||||
* @param {string} path Path to track
|
||||
*/
|
||||
function gaTrack(path) {
|
||||
if (window.ga) {
|
||||
window.ga('send', 'pageview', path);
|
||||
}
|
||||
const _paq = window._paq || [];
|
||||
_paq.push(['trackPageView']);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -16,7 +16,6 @@ function isActive(href) {
|
||||
* Active Link - Highlighted when URL matches window location
|
||||
*/
|
||||
export default class ActiveLink extends Link {
|
||||
|
||||
/**
|
||||
* Renders the component
|
||||
* @return {React.Component} The active link
|
||||
@@ -29,5 +28,4 @@ export default class ActiveLink extends Link {
|
||||
|
||||
return <a {...this.props} className={className} onClick={this.handler}>{this.props.children}</a>;
|
||||
}
|
||||
|
||||
}
|
||||
29
src/app/components/Announcement.jsx
Normal file
29
src/app/components/Announcement.jsx
Normal file
@@ -0,0 +1,29 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import { autoBind } from 'react-extras';
|
||||
|
||||
/**
|
||||
* Announcement component
|
||||
*/
|
||||
export default class Announcement extends React.Component {
|
||||
static propTypes = {
|
||||
text: PropTypes.string
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Renders the announcement
|
||||
* @return {React.Component} A href element
|
||||
*/
|
||||
render() {
|
||||
return <div className="announcement" >{this.props.text}</div>;
|
||||
}
|
||||
}
|
||||
@@ -1,114 +1,33 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import cn from 'classnames';
|
||||
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import FuzzySearch from 'react-fuzzy';
|
||||
import { getModuleInfo } from 'ed-forge/lib/data/items';
|
||||
import { groupBy, mapValues, sortBy } from 'lodash';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
const PRESS_THRESHOLD = 500; // mouse/touch down threshold
|
||||
|
||||
/*
|
||||
* Categorisation of module groups
|
||||
*/
|
||||
const GRPCAT = {
|
||||
'sg': 'shields',
|
||||
'bsg': 'shields',
|
||||
'psg': 'shields',
|
||||
'scb': 'shields',
|
||||
'cc': 'limpet controllers',
|
||||
'fx': 'limpet controllers',
|
||||
'hb': 'limpet controllers',
|
||||
'pc': 'limpet controllers',
|
||||
'rpl': 'limpet controllers',
|
||||
'pce': 'passenger cabins',
|
||||
'pci': 'passenger cabins',
|
||||
'pcm': 'passenger cabins',
|
||||
'pcq': 'passenger cabins',
|
||||
'fh': 'hangars',
|
||||
'pv': 'hangars',
|
||||
'fs': 'fuel',
|
||||
'ft': 'fuel',
|
||||
'hr': 'structural reinforcement',
|
||||
'mrp': 'structural reinforcement',
|
||||
'bl': 'lasers',
|
||||
'pl': 'lasers',
|
||||
'ul': 'lasers',
|
||||
'ml': 'lasers',
|
||||
'c': 'projectiles',
|
||||
'mc': 'projectiles',
|
||||
'axmc': 'experimental',
|
||||
'fc': 'projectiles',
|
||||
'rfl': 'experimental',
|
||||
'pa': 'projectiles',
|
||||
'rg': 'projectiles',
|
||||
'mr': 'ordnance',
|
||||
'axmr': 'experimental',
|
||||
'rcpl': 'experimental',
|
||||
'tp': 'ordnance',
|
||||
'nl': 'ordnance',
|
||||
'sc': 'scanners',
|
||||
'ss': 'scanners',
|
||||
// Utilities
|
||||
'cs': 'scanners',
|
||||
'kw': 'scanners',
|
||||
'ws': 'scanners',
|
||||
'xs': 'scanners',
|
||||
'ch': 'defence',
|
||||
'po': 'defence',
|
||||
'ec': 'defence',
|
||||
'sfn': 'defence',
|
||||
// Standard
|
||||
'gpp': 'guardian',
|
||||
'gpc': 'guardian',
|
||||
'ggc': 'guardian'
|
||||
};
|
||||
// Order here is the order in which items will be shown in the modules menu
|
||||
const CATEGORIES = {
|
||||
// Internals
|
||||
'am': ['am'],
|
||||
'cr': ['cr'],
|
||||
'fi': ['fi'],
|
||||
'fuel': ['ft', 'fs'],
|
||||
'hangars': ['fh', 'pv'],
|
||||
'limpet controllers': ['cc', 'fx', 'hb', 'pc', 'rpl'],
|
||||
'passenger cabins': ['pce', 'pci', 'pcm', 'pcq'],
|
||||
'rf': ['rf'],
|
||||
'shields': ['sg', 'bsg', 'psg', 'scb'],
|
||||
'structural reinforcement': ['hr', 'mrp'],
|
||||
'dc': ['dc'],
|
||||
// Hardpoints
|
||||
'lasers': ['pl', 'ul', 'bl', 'ml'],
|
||||
'projectiles': ['mc', 'c', 'fc', 'pa', 'rg'],
|
||||
'ordnance': ['mr', 'tp', 'nl'],
|
||||
// Utilities
|
||||
'sb': ['sb'],
|
||||
'hs': ['hs'],
|
||||
'defence': ['ch', 'po', 'ec'],
|
||||
'scanners': ['sc', 'ss', 'cs', 'kw', 'ws'], // Overloaded with internal scanners
|
||||
// Experimental
|
||||
'experimental': ['axmc', 'axmr', 'rfl', 'xs', 'sfn', 'rcpl'],
|
||||
|
||||
// Guardian
|
||||
'guardian': ['gpp', 'gpc', 'ggc']
|
||||
const MOUNT_MAP = {
|
||||
fixed: <MountFixed className={'lg'} />,
|
||||
gimbal: <MountGimballed className={'lg'} />,
|
||||
turret: <MountTurret className={'lg'} />,
|
||||
};
|
||||
|
||||
/**
|
||||
* Available modules menu
|
||||
*/
|
||||
export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
modules: PropTypes.oneOfType([PropTypes.object, PropTypes.array]).isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
diffDetails: PropTypes.func,
|
||||
hideSearch: PropTypes.bool,
|
||||
m: PropTypes.object,
|
||||
shipMass: PropTypes.number,
|
||||
warning: PropTypes.func
|
||||
};
|
||||
|
||||
static defaultProps = {
|
||||
shipMass: 0
|
||||
warning: PropTypes.func,
|
||||
slotDiv: PropTypes.object
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -118,7 +37,7 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
this._hideDiff = this._hideDiff.bind(this);
|
||||
autoBind(this);
|
||||
this.state = this._initState(props, context);
|
||||
}
|
||||
|
||||
@@ -129,182 +48,199 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
* @return {Object} list: Array of React Components, currentGroup Component if any
|
||||
*/
|
||||
_initState(props, context) {
|
||||
let translate = context.language.translate;
|
||||
let { m, warning, shipMass, onSelect, modules } = props;
|
||||
let list, currentGroup;
|
||||
let buildGroup = this._buildGroup.bind(
|
||||
this,
|
||||
translate,
|
||||
m,
|
||||
warning,
|
||||
shipMass - (m && m.mass ? m.mass : 0),
|
||||
(m, event) => {
|
||||
this._hideDiff(event);
|
||||
onSelect(m);
|
||||
}
|
||||
const { translate } = context.language;
|
||||
const { m } = props;
|
||||
const list = [], fuzzy = [];
|
||||
let currentGroup;
|
||||
|
||||
const modules = m.getApplicableItems().map(getModuleInfo);
|
||||
const groups = mapValues(
|
||||
groupBy(modules, (info) => info.meta.group),
|
||||
(infos) => groupBy(infos, (info) => info.meta.type),
|
||||
);
|
||||
|
||||
if (modules instanceof Array) {
|
||||
list = buildGroup(modules[0].grp, modules);
|
||||
} else {
|
||||
list = [];
|
||||
// At present time slots with grouped options (Hardpoints and Internal) can be empty
|
||||
if (m) {
|
||||
list.push(<div className='empty-c upp' key='empty' onClick={onSelect.bind(null, null)} >{translate('empty')}</div>);
|
||||
// Build categories sorted by translated category name
|
||||
const groupKeys = sortBy(Object.keys(groups), translate);
|
||||
for (const group of groupKeys) {
|
||||
const groupName = translate(group);
|
||||
if (groupKeys.length > 1) {
|
||||
list.push(<div key={`group-${group}`} className="select-category upp">{groupName}</div>);
|
||||
}
|
||||
|
||||
// Need to regroup the modules by our own categorisation
|
||||
let catmodules = {};
|
||||
// Pre-create to preserve ordering
|
||||
for (let cat in CATEGORIES) {
|
||||
catmodules[cat] = [];
|
||||
}
|
||||
for (let g in modules) {
|
||||
const moduleCategory = GRPCAT[g] || g;
|
||||
const existing = catmodules[moduleCategory] || [];
|
||||
catmodules[moduleCategory] = existing.concat(modules[g]);
|
||||
}
|
||||
|
||||
for (let category in catmodules) {
|
||||
let categoryHeader = false;
|
||||
// Order through CATEGORIES if present
|
||||
const categories = CATEGORIES[category] || [category];
|
||||
if (categories && categories.length) {
|
||||
for (let n in categories) {
|
||||
const grp = categories[n];
|
||||
// We now have the group and the category. We might not have any modules, though...
|
||||
if (modules[grp]) {
|
||||
// Decide if we need a category header as well as a group header
|
||||
if (categories.length === 1) {
|
||||
// Show category header instead of group header
|
||||
if (m && grp == m.grp) {
|
||||
list.push(<div ref={(elem) => this.groupElem = elem} key={category} className={'select-category upp'}>{translate(category)}</div>);
|
||||
} else {
|
||||
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
|
||||
}
|
||||
} else {
|
||||
// Show category header as well as group header
|
||||
if (!categoryHeader) {
|
||||
list.push(<div key={category} className={'select-category upp'}>{translate(category)}</div>);
|
||||
categoryHeader = true;
|
||||
}
|
||||
if (m && grp == m.grp) {
|
||||
list.push(<div ref={(elem) => this.groupElem = elem} key={grp} className={'select-group cap'}>{translate(grp)}</div>);
|
||||
} else {
|
||||
list.push(<div key={grp} className={'select-group cap'}>{translate(grp)}</div>);
|
||||
}
|
||||
}
|
||||
list.push(buildGroup(grp, modules[grp]));
|
||||
}
|
||||
}
|
||||
const categories = groups[group];
|
||||
const categoryKeys = sortBy(Object.keys(categories), translate);
|
||||
for (const category of categoryKeys) {
|
||||
const categoryName = translate(category);
|
||||
const infos = categories[category];
|
||||
if (categoryKeys.length > 1) {
|
||||
list.push(<div key={`category-${category}`} className="select-group cap">{categoryName}</div>);
|
||||
}
|
||||
list.push(
|
||||
this._buildGroup(
|
||||
m,
|
||||
category,
|
||||
infos,
|
||||
),
|
||||
);
|
||||
fuzzy.push(
|
||||
...infos.map((info) => {
|
||||
const { meta } = info;
|
||||
const mount = meta.mount ? ' ' + translate(meta.mount) : '';
|
||||
return {
|
||||
grp: groupName,
|
||||
cat: categoryName,
|
||||
m: info.proto.Item,
|
||||
name: `${meta.class}${meta.rating}${mount} ${categoryName}`,
|
||||
};
|
||||
}),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
return { list, currentGroup };
|
||||
return { list, currentGroup, fuzzy, trackingFocus: false };
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate React Components for Module Group
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} mountedModule Mounted Module
|
||||
* @param {Function} warningFunc Warning function
|
||||
* @param {number} mass Mass
|
||||
* @param {function} onSelect Select/Mount callback
|
||||
* @param {string} grp Group name
|
||||
* @param {String} category Category key
|
||||
* @param {Array} modules Available modules
|
||||
* @return {React.Component} Available Module Group contents
|
||||
*/
|
||||
_buildGroup(translate, mountedModule, warningFunc, mass, onSelect, grp, modules) {
|
||||
let prevClass = null, prevRating = null, prevName;
|
||||
let elems = [];
|
||||
_buildGroup(mountedModule, category, modules) {
|
||||
const { warning } = this.props;
|
||||
const ship = mountedModule.getShip();
|
||||
const classMapping = groupBy(modules, (info) => info.meta.class);
|
||||
|
||||
const sortedModules = modules.sort(this._moduleOrder);
|
||||
const itemsPerClass = Math.max(
|
||||
...Object.values(classMapping).map((l) => l.length),
|
||||
);
|
||||
const itemsPerRow = itemsPerClass <= 2 ? 6 : itemsPerClass;
|
||||
// Nested array of <li> elements; will be flattened before being rendered.
|
||||
// Each sub-array represents one row in the final view.
|
||||
const elems = [[]];
|
||||
|
||||
// Calculate the number of items per class. Used so we don't have long lists with only a few items in each row
|
||||
const tmp = sortedModules.map((v, i) => v['class']).reduce((count, cls) => { count[cls] = ++count[cls] || 1; return count; }, {});
|
||||
const itemsPerClass = Math.max.apply(null, Object.keys(tmp).map(key => tmp[key]));
|
||||
// Reverse sort for descending order of module class
|
||||
for (const clazz of Object.keys(classMapping).sort().reverse()) {
|
||||
for (let info of sortBy(
|
||||
classMapping[clazz],
|
||||
(info) => info.meta.mount || info.meta.rating,
|
||||
)) {
|
||||
const { meta } = info;
|
||||
const { Item } = info.proto;
|
||||
|
||||
let itemsOnThisRow = 0;
|
||||
// Can only be true if shieldgenmaximalmass is defined, i.e. this
|
||||
// module must be a shield generator
|
||||
let disabled = info.props.shieldgenmaximalmass < ship.readProp('hullmass');
|
||||
if (meta.experimental && !mountedModule.readMeta('experimental')) {
|
||||
disabled =
|
||||
4 <=
|
||||
ship.getHardpoints().filter((m) => m.readMeta('experimental'))
|
||||
.length;
|
||||
}
|
||||
|
||||
for (let i = 0; i < sortedModules.length; i++) {
|
||||
let m = sortedModules[i];
|
||||
let mount = null;
|
||||
let disabled = false;
|
||||
prevName = m.name
|
||||
if (ModuleUtils.isShieldGenerator(m.grp)) {
|
||||
// Shield generators care about maximum hull mass
|
||||
disabled = mass > m.maxmass;
|
||||
} else if (m.maxmass) {
|
||||
// Thrusters care about total mass
|
||||
disabled = mass + m.mass > m.maxmass;
|
||||
// Default event handlers for objects that are disabled
|
||||
let eventHandlers = {};
|
||||
if (!disabled) {
|
||||
const showDiff = this._showDiff.bind(this, mountedModule, info);
|
||||
const select = (event) => {
|
||||
this._hideDiff(event);
|
||||
this.props.onSelect(Item);
|
||||
};
|
||||
|
||||
eventHandlers = {
|
||||
onMouseEnter: this._over.bind(this, showDiff),
|
||||
onTouchStart: this._touchStart.bind(this, showDiff),
|
||||
onTouchEnd: this._touchEnd.bind(this, select),
|
||||
onMouseLeave: this._hideDiff,
|
||||
onClick: select,
|
||||
};
|
||||
}
|
||||
|
||||
const mountSymbol = MOUNT_MAP[meta.mount];
|
||||
const li = (
|
||||
<li key={Item} data-id={Item}
|
||||
ref={Item === mountedModule.getItem() ? (ref) => { this.activeSlotRef = ref; } : undefined}
|
||||
className={cn('c', {
|
||||
warning: !disabled && warning && warning(info),
|
||||
active: mountedModule.getItem() === Item,
|
||||
disabled,
|
||||
hardpoint: mountSymbol,
|
||||
})}
|
||||
{...eventHandlers}
|
||||
>{mountSymbol}{meta.class}{meta.rating}</li>
|
||||
);
|
||||
|
||||
const tail = elems.pop();
|
||||
let newTail = [tail];
|
||||
if (tail.length < itemsPerRow) {
|
||||
// If the row has not grown too long, the new <li> element can be
|
||||
// added to the row itself
|
||||
tail.push(li);
|
||||
} else {
|
||||
// Otherwise, the last row gets a line break element added and this
|
||||
// item is put into a new row
|
||||
tail.push(<br key={elems.length}/>);
|
||||
newTail.push([li]);
|
||||
}
|
||||
elems.push(...newTail);
|
||||
}
|
||||
let active = mountedModule && mountedModule.id === m.id;
|
||||
let classes = cn(m.name ? 'lc' : 'c', {
|
||||
warning: !disabled && warningFunc && warningFunc(m),
|
||||
active,
|
||||
disabled
|
||||
});
|
||||
let eventHandlers;
|
||||
|
||||
if (disabled || active) {
|
||||
eventHandlers = {};
|
||||
} else {
|
||||
let showDiff = this._showDiff.bind(this, mountedModule, m);
|
||||
let select = onSelect.bind(null, m);
|
||||
|
||||
eventHandlers = {
|
||||
onMouseEnter: this._over.bind(this, showDiff),
|
||||
onTouchStart: this._touchStart.bind(this, showDiff),
|
||||
onTouchEnd: this._touchEnd.bind(this, select),
|
||||
onMouseLeave: this._hideDiff,
|
||||
onClick: select
|
||||
};
|
||||
}
|
||||
|
||||
switch(m.mount) {
|
||||
case 'F': mount = <MountFixed className={'lg'} />; break;
|
||||
case 'G': mount = <MountGimballed className={'lg'}/>; break;
|
||||
case 'T': mount = <MountTurret className={'lg'}/>; break;
|
||||
}
|
||||
if (m.name && m.name === prevName) {
|
||||
// elems.push(<br key={'b' + m.grp + i} />);
|
||||
itemsOnThisRow = 0;
|
||||
}
|
||||
if (itemsOnThisRow == 6 || i > 0 && sortedModules.length > 3 && itemsPerClass > 2 && m.class != prevClass && (m.rating != prevRating || m.mount)) {
|
||||
elems.push(<br key={'b' + m.grp + i} />);
|
||||
itemsOnThisRow = 0;
|
||||
}
|
||||
|
||||
elems.push(
|
||||
<li key={m.id} className={classes} {...eventHandlers}>
|
||||
{mount}
|
||||
{(mount ? ' ' : '') + m.class + m.rating + (m.missile ? '/' + m.missile : '') + (m.name ? ' ' + translate(m.name) : '')}
|
||||
</li>
|
||||
);
|
||||
itemsOnThisRow++;
|
||||
prevClass = m.class;
|
||||
prevRating = m.rating;
|
||||
prevName = m.name;
|
||||
}
|
||||
|
||||
return <ul key={'modules' + grp} >{elems}</ul>;
|
||||
return <ul key={'ul' + category}>{[].concat(...elems)}</ul>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate tooltip content for the difference between the
|
||||
* mounted module and the hovered modules
|
||||
* @param {Object} mm The module mounet currently
|
||||
* @param {Object} m The hovered module
|
||||
* @param {Object} mountedModule The module mounted currently
|
||||
* @param {Object} hoveringModule The hovered module
|
||||
* @param {DOMRect} rect DOMRect for target element
|
||||
*/
|
||||
_showDiff(mm, m, rect) {
|
||||
_showDiff(mountedModule, hoveringModule, rect) {
|
||||
if (this.props.diffDetails) {
|
||||
this.touchTimeout = null;
|
||||
this.context.tooltip(this.props.diffDetails(m, mm), rect);
|
||||
// TODO:
|
||||
// this.context.tooltip(
|
||||
// this.props.diffDetails(hoveringModule, mountedModule),
|
||||
// rect,
|
||||
// );
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate tooltip content for the difference between the
|
||||
* mounted module and the hovered modules
|
||||
* @returns {React.Component} Search component if available
|
||||
*/
|
||||
_showSearch() {
|
||||
if (this.props.hideSearch) {
|
||||
return;
|
||||
}
|
||||
return (
|
||||
<FuzzySearch
|
||||
list={this.state.fuzzy}
|
||||
keys={['grp', 'name']}
|
||||
tokenize={true}
|
||||
className={'input'}
|
||||
width={'100%'}
|
||||
style={{ padding: 0 }}
|
||||
onSelect={e => this.props.onSelect.bind(null, e.m)()}
|
||||
resultsTemplate={(props, state, styles, clickHandler) => {
|
||||
return state.results.map((val, i) => {
|
||||
return (
|
||||
<div
|
||||
key={i}
|
||||
className={'lc'}
|
||||
onClick={() => clickHandler(i)}
|
||||
>
|
||||
{val.name}
|
||||
</div>
|
||||
);
|
||||
});
|
||||
}}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Mouse over diff handler
|
||||
* @param {Function} showDiff diff tooltip callback
|
||||
@@ -349,52 +285,22 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
this.context.tooltip();
|
||||
}
|
||||
|
||||
/**
|
||||
* Order two modules suitably for display in module selection
|
||||
* @param {Object} a the first module
|
||||
* @param {Object} b the second module
|
||||
* @return {int} -1 if the first module should go first, 1 if the second module should go first
|
||||
*/
|
||||
_moduleOrder(a, b) {
|
||||
// Named modules go last
|
||||
if (!a.name && b.name) {
|
||||
return -1;
|
||||
}
|
||||
if (a.name && !b.name) {
|
||||
return 1;
|
||||
}
|
||||
// Class ordered from highest (8) to lowest (1)
|
||||
if (a.class < b.class) {
|
||||
return 1;
|
||||
}
|
||||
if (a.class > b.class) {
|
||||
return -1;
|
||||
}
|
||||
// Mount type, if applicable
|
||||
if (a.mount && b.mount && a.mount !== b.mount) {
|
||||
if (a.mount === 'F' || (a.mount === 'G' && b.mount === 'T')) {
|
||||
return -1;
|
||||
} else {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
// Rating ordered from highest (A) to lowest (E)
|
||||
if (a.rating < b.rating) {
|
||||
return -1;
|
||||
}
|
||||
if (a.rating > b.rating) {
|
||||
return 1;
|
||||
}
|
||||
// Do not attempt to order by name at this point, as that mucks up the order of armour
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Scroll to mounted (if it exists) module group on mount
|
||||
*/
|
||||
componentDidMount() {
|
||||
if (this.groupElem) { // Scroll to currently selected group
|
||||
this.node.scrollTop = this.groupElem.offsetTop;
|
||||
if (this.activeSlotRef) {
|
||||
this.activeSlotRef.focus();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle focus if the component updates
|
||||
*
|
||||
*/
|
||||
componentWillUnmount() {
|
||||
if (this.props.slotDiv) {
|
||||
this.props.slotDiv.focus();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -414,14 +320,14 @@ export default class AvailableModulesMenu extends TranslatedComponent {
|
||||
render() {
|
||||
return (
|
||||
<div ref={node => this.node = node}
|
||||
className={cn('select', this.props.className)}
|
||||
onScroll={this._hideDiff}
|
||||
onClick={(e) => e.stopPropagation() }
|
||||
onContextMenu={stopCtxPropagation}
|
||||
className={cn('select', this.props.className)}
|
||||
onScroll={this._hideDiff}
|
||||
onClick={(e) => e.stopPropagation()}
|
||||
onContextMenu={stopCtxPropagation}
|
||||
>
|
||||
{this._showSearch()}
|
||||
{this.state.list}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -38,7 +38,6 @@ function insertLinebreaks(d) {
|
||||
* Bar Chart
|
||||
*/
|
||||
export default class BarChart extends TranslatedComponent {
|
||||
|
||||
static defaultProps = {
|
||||
colors: ['#7b6888', '#6b486b', '#3182bd', '#a05d56', '#d0743c'],
|
||||
labels: null,
|
||||
|
||||
@@ -1,13 +1,7 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import { Pip } from './SvgIcons';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Module from '../shipyard/Module';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Boost displays a boost button that toggles bosot
|
||||
@@ -15,8 +9,6 @@ import Module from '../shipyard/Module';
|
||||
*/
|
||||
export default class Boost extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
};
|
||||
@@ -26,12 +18,9 @@ export default class Boost extends TranslatedComponent {
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
constructor(props) {
|
||||
super(props);
|
||||
const { ship, boost } = props;
|
||||
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
this._toggleBoost = this._toggleBoost.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -77,13 +66,12 @@ export default class Boost extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { formats, translate, units } = this.context.language;
|
||||
const { ship, boost } = this.props;
|
||||
|
||||
// TODO disable if ship cannot boost
|
||||
const { translate } = this.context.language;
|
||||
return (
|
||||
<span id='boost'>
|
||||
<button id='boost' className={boost ? 'selected' : null} onClick={this._toggleBoost}>{translate('boost')}</button>
|
||||
<button id='boost' className={this.props.boost ? 'selected' : null} onClick={this._toggleBoost}>
|
||||
{translate('boost')}
|
||||
</button>
|
||||
</span>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Slider from '../components/Slider';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Cargo slider
|
||||
@@ -22,8 +22,7 @@ export default class Cargo extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._cargoChange = this._cargoChange.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -10,7 +10,6 @@ import { outfitURL } from '../utils/UrlGenerators';
|
||||
* Comparison Table
|
||||
*/
|
||||
export default class ComparisonTable extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
facets: PropTypes.array.isRequired,
|
||||
builds: PropTypes.array.isRequired,
|
||||
|
||||
@@ -1,23 +1,23 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Persist from '../stores/Persist';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import { Factory, Ship } from 'ed-forge';
|
||||
import { Insurance } from '../shipyard/Constants';
|
||||
import { slotName, slotComparator } from '../utils/SlotFunctions';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { ShoppingIcon } from '../components/SvgIcons';
|
||||
import { ShoppingIcon } from './SvgIcons';
|
||||
import autoBind from 'auto-bind';
|
||||
import { assign, differenceBy, sortBy, reverse } from 'lodash';
|
||||
import { FUEL_CAPACITY } from 'ed-forge/lib/ship-stats';
|
||||
|
||||
/**
|
||||
* Cost Section
|
||||
*/
|
||||
export default class CostSection extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
buildName: PropTypes.string
|
||||
buildName: PropTypes.string,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -26,71 +26,34 @@ export default class CostSection extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._costsTab = this._costsTab.bind(this);
|
||||
this._sortCost = this._sortCost.bind(this);
|
||||
this._sortAmmo = this._sortAmmo.bind(this);
|
||||
this._sortRetrofit = this._sortRetrofit.bind(this);
|
||||
this._buildRetrofitShip = this._buildRetrofitShip.bind(this);
|
||||
this._onBaseRetrofitChange = this._onBaseRetrofitChange.bind(this);
|
||||
this._defaultRetrofitName = this._defaultRetrofitName.bind(this);
|
||||
this._eddbShoppingList = this._eddbShoppingList.bind(this);
|
||||
|
||||
let data = Ships[props.ship.id]; // Retrieve the basic ship properties, slots and defaults
|
||||
let retrofitName = this._defaultRetrofitName(props.ship.id, props.buildName);
|
||||
let retrofitShip = this._buildRetrofitShip(props.ship.id, retrofitName);
|
||||
let shipDiscount = Persist.getShipDiscount();
|
||||
let moduleDiscount = Persist.getModuleDiscount();
|
||||
|
||||
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
autoBind(this);
|
||||
|
||||
const { ship, buildName } = props;
|
||||
this.shipType = ship.getShipType();
|
||||
this.state = {
|
||||
retrofitShip,
|
||||
retrofitName,
|
||||
shipDiscount,
|
||||
moduleDiscount,
|
||||
retrofitName: Persist.hasBuild(ship.getShipType(), buildName) ? buildName : null,
|
||||
shipDiscount: Persist.getShipDiscount(),
|
||||
moduleDiscount: Persist.getModuleDiscount(),
|
||||
insurance: Insurance[Persist.getInsurance()],
|
||||
tab: Persist.getCostTab(),
|
||||
buildOptions: Persist.getBuildsNamesFor(props.ship.id),
|
||||
ammoPredicate: 'cr',
|
||||
ammoDesc: true,
|
||||
costPredicate: 'cr',
|
||||
costDesc: true,
|
||||
retroPredicate: 'cr',
|
||||
retroDesc: true
|
||||
buildOptions: Persist.getBuildsNamesFor(ship.getShipType()),
|
||||
predicate: 'cr',
|
||||
desc: true,
|
||||
excluded: {},
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a ship instance to base/reference retrofit changes from
|
||||
* @param {string} shipId Ship Id
|
||||
* @param {string} name Build name
|
||||
* @param {Ship} retrofitShip Existing retrofit ship
|
||||
* @return {Ship} Retrofit ship
|
||||
*/
|
||||
_buildRetrofitShip(shipId, name, retrofitShip) {
|
||||
let data = Ships[shipId]; // Retrieve the basic ship properties, slots and defaults
|
||||
|
||||
if (!retrofitShip) { // Don't create a new instance unless needed
|
||||
retrofitShip = new Ship(shipId, data.properties, data.slots); // Create a new Ship for retrofit comparison
|
||||
}
|
||||
|
||||
if (Persist.hasBuild(shipId, name)) {
|
||||
retrofitShip.buildFrom(Persist.getBuild(shipId, name)); // Populate modules from existing build
|
||||
_buildRetrofitShip() {
|
||||
const { retrofitName } = this.state;
|
||||
if (Persist.hasBuild(this.shipType, retrofitName)) {
|
||||
return new Ship(Persist.getBuild(this.shipType, retrofitName));
|
||||
} else {
|
||||
retrofitShip.buildWith(data.defaults); // Populate with default components
|
||||
return Factory.newShip(this.shipType);
|
||||
}
|
||||
return retrofitShip;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the default retrofit build name if it exists
|
||||
* @param {string} shipId Ship Id
|
||||
* @param {string} name Build name
|
||||
* @return {string} Build name or null
|
||||
*/
|
||||
_defaultRetrofitName(shipId, name) {
|
||||
return Persist.hasBuild(shipId, name) ? name : null;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -108,9 +71,6 @@ export default class CostSection extends TranslatedComponent {
|
||||
_onDiscountChanged() {
|
||||
let shipDiscount = Persist.getShipDiscount();
|
||||
let moduleDiscount = Persist.getModuleDiscount();
|
||||
this.props.ship.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
this.state.retrofitShip.applyDiscounts(shipDiscount, moduleDiscount);
|
||||
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
|
||||
this.setState({ shipDiscount, moduleDiscount });
|
||||
}
|
||||
|
||||
@@ -127,156 +87,33 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @param {SyntheticEvent} event Build name to base the retrofit ship on
|
||||
*/
|
||||
_onBaseRetrofitChange(event) {
|
||||
let retrofitName = event.target.value;
|
||||
let ship = this.props.ship;
|
||||
|
||||
if (retrofitName) {
|
||||
this.state.retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName));
|
||||
} else {
|
||||
this.state.retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
|
||||
}
|
||||
this._updateRetrofit(ship, this.state.retrofitShip);
|
||||
this.setState({ retrofitName });
|
||||
this.setState({ retrofitName: event.target.value });
|
||||
}
|
||||
|
||||
/**
|
||||
* On builds changed check to see if the retrofit ship needs
|
||||
* to be updated
|
||||
* Toggle item cost inclusion
|
||||
* @param {String} key Key of the row to toggle
|
||||
*/
|
||||
_onBuildsChanged() {
|
||||
let update = false;
|
||||
let ship = this.props.ship;
|
||||
let { retrofitName, retrofitShip } = this.state;
|
||||
|
||||
if(!Persist.hasBuild(ship.id, retrofitName)) {
|
||||
retrofitShip.buildWith(Ships[ship.id].defaults); // Retrofit ship becomes stock build
|
||||
this.setState({ retrofitName: null });
|
||||
update = true;
|
||||
} else if (Persist.getBuild(ship.id, retrofitName) != retrofitShip.toString()) {
|
||||
retrofitShip.buildFrom(Persist.getBuild(ship.id, retrofitName)); // Repopulate modules from saved build
|
||||
update = true;
|
||||
}
|
||||
|
||||
if (update) { // Update retrofit comparison
|
||||
this._updateRetrofit(ship, retrofitShip);
|
||||
}
|
||||
// Update list of retrofit base build options
|
||||
this.setState({ buildOptions: Persist.getBuildsNamesFor(ship.id) });
|
||||
_toggleExcluded(key) {
|
||||
let { excluded } = this.state;
|
||||
excluded = assign({}, excluded);
|
||||
const slotExcluded = excluded[key];
|
||||
excluded[key] = (slotExcluded === undefined ? true : !slotExcluded);
|
||||
this.setState({ excluded });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle item cost inclusion in overall total
|
||||
* @param {Object} item Cost item
|
||||
* Set list sort predicate
|
||||
* @param {string} newPredicate sort predicate
|
||||
*/
|
||||
_toggleCost(item) {
|
||||
this.props.ship.setCostIncluded(item, !item.incCost);
|
||||
this.forceUpdate();
|
||||
}
|
||||
_sortBy(newPredicate) {
|
||||
let { predicate, desc } = this.state;
|
||||
|
||||
/**
|
||||
* Toggle item cost inclusion in retrofit total
|
||||
* @param {Object} item Cost item
|
||||
*/
|
||||
_toggleRetrofitCost(item) {
|
||||
let retrofitTotal = this.state.retrofitTotal;
|
||||
item.retroItem.incCost = !item.retroItem.incCost;
|
||||
retrofitTotal += item.netCost * (item.retroItem.incCost ? 1 : -1);
|
||||
this.setState({ retrofitTotal });
|
||||
}
|
||||
|
||||
/**
|
||||
* Set cost list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortCostBy(predicate) {
|
||||
let { costPredicate, costDesc } = this.state;
|
||||
|
||||
if (costPredicate == predicate) {
|
||||
costDesc = !costDesc;
|
||||
if (newPredicate == predicate) {
|
||||
desc = !desc;
|
||||
}
|
||||
|
||||
this.setState({ costPredicate: predicate, costDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort cost list
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortCost(ship, predicate, desc) {
|
||||
let costList = ship.costList;
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'm') {
|
||||
costList.sort(slotComparator(translate, null, desc));
|
||||
} else {
|
||||
costList.sort(slotComparator(translate, (a, b) => (a.m.cost || 0) - (b.m.cost || 0), desc));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Set ammo list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortAmmoBy(predicate) {
|
||||
let { ammoPredicate, ammoDesc } = this.state;
|
||||
|
||||
if (ammoPredicate == predicate) {
|
||||
ammoDesc = !ammoDesc;
|
||||
}
|
||||
|
||||
this.setState({ ammoPredicate: predicate, ammoDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort ammo cost list
|
||||
* @param {Array} ammoCosts Ammo cost list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortAmmo(ammoCosts, predicate, desc) {
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'm') {
|
||||
ammoCosts.sort(slotComparator(translate, null, desc));
|
||||
} else {
|
||||
ammoCosts.sort(slotComparator(translate, (a, b) => a[predicate] - b[predicate], desc));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Set retrofit list sort predicate
|
||||
* @param {string} predicate sort predicate
|
||||
*/
|
||||
_sortRetrofitBy(predicate) {
|
||||
let { retroPredicate, retroDesc } = this.state;
|
||||
|
||||
if (retroPredicate == predicate) {
|
||||
retroDesc = !retroDesc;
|
||||
}
|
||||
|
||||
this.setState({ retroPredicate: predicate, retroDesc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort retrofit cost list
|
||||
* @param {Array} retrofitCosts Retrofit cost list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort descending
|
||||
*/
|
||||
_sortRetrofit(retrofitCosts, predicate, desc) {
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (predicate == 'cr') {
|
||||
retrofitCosts.sort((a, b) => a.netCost - b.netCost);
|
||||
} else {
|
||||
retrofitCosts.sort((a , b) => (a[predicate] ? translate(a[predicate]).toLowerCase() : '').localeCompare(b[predicate] ? translate(b[predicate]).toLowerCase() : ''));
|
||||
}
|
||||
|
||||
if (!desc) {
|
||||
retrofitCosts.reverse();
|
||||
}
|
||||
this.setState({ predicate: newPredicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -285,18 +122,34 @@ export default class CostSection extends TranslatedComponent {
|
||||
*/
|
||||
_costsTab() {
|
||||
let { ship } = this.props;
|
||||
let { shipDiscount, moduleDiscount, insurance } = this.state;
|
||||
let {
|
||||
excluded, shipDiscount, moduleDiscount, insurance, desc, predicate
|
||||
} = this.state;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let rows = [];
|
||||
|
||||
for (let i = 0, l = ship.costList.length; i < l; i++) {
|
||||
let item = ship.costList[i];
|
||||
if (item.m && item.m.cost) {
|
||||
let toggle = this._toggleCost.bind(this, item);
|
||||
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.incCost })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{item.m.class + item.m.rating}</td>
|
||||
<td className='le ptr shorten cap' onClick={toggle}>{slotName(translate, item)}</td>
|
||||
<td className='ri ptr' onClick={toggle}>{formats.int(item.discountedCost)}{units.CR}</td>
|
||||
let modules = sortBy(
|
||||
ship.getModules(),
|
||||
(predicate === 'm' ? (m) => m.getItem() : (m) => m.readMeta('cost'))
|
||||
);
|
||||
if (desc) {
|
||||
reverse(modules);
|
||||
}
|
||||
|
||||
let totalCost = 0;
|
||||
for (let module of modules) {
|
||||
const cost = module.readMeta('cost');
|
||||
const slot = module.getSlot();
|
||||
if (cost) {
|
||||
let toggle = this._toggleExcluded.bind(this, slot);
|
||||
const disabled = excluded[slot];
|
||||
if (!disabled) {
|
||||
totalCost += cost;
|
||||
}
|
||||
rows.push(<tr key={slot} className={cn('highlight', { disabled })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggle}>{module.getClassRating()}</td>
|
||||
<td className='le ptr shorten cap' onClick={toggle}>{translate(module.readMeta('type'))}</td>
|
||||
<td className='ri ptr' onClick={toggle}>{formats.int(cost * (1 - moduleDiscount))}{units.CR}</td>
|
||||
</tr>);
|
||||
}
|
||||
}
|
||||
@@ -305,23 +158,23 @@ export default class CostSection extends TranslatedComponent {
|
||||
<table style={{ width: '100%', borderCollapse: 'collapse' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortCostBy.bind(this,'m')}>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>
|
||||
{translate('module')}
|
||||
{shipDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('ship')} -${formats.pct(shipDiscount)}]`}</u> : null}
|
||||
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
|
||||
</th>
|
||||
<th className='sortable le' onClick={this._sortCostBy.bind(this, 'cr')} >{translate('credits')}</th>
|
||||
<th className='sortable le' onClick={() => this._sortBy('cr')} >{translate('credits')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
<tr className='ri'>
|
||||
<td colSpan='2' className='lbl' >{translate('total')}</td>
|
||||
<td className='val'>{formats.int(ship.totalCost)}{units.CR}</td>
|
||||
<td className='val'>{formats.int(totalCost)}{units.CR}</td>
|
||||
</tr>
|
||||
<tr className='ri'>
|
||||
<td colSpan='2' className='lbl'>{translate('insurance')}</td>
|
||||
<td className='val'>{formats.int(ship.totalCost * insurance)}{units.CR}</td>
|
||||
<td className='val'>{formats.int(totalCost * insurance)}{units.CR}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -332,14 +185,63 @@ export default class CostSection extends TranslatedComponent {
|
||||
* Open up a window for EDDB with a shopping list of our retrofit components
|
||||
*/
|
||||
_eddbShoppingList() {
|
||||
const { retrofitCosts } = this.state;
|
||||
const {} = this.state;
|
||||
const { ship } = this.props;
|
||||
|
||||
// Provide unique list of non-PP module EDDB IDs to buy
|
||||
const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
|
||||
// const modIds = retrofitCosts.filter(item => item.retroItem.incCost && item.buyId && !item.buyPp).map(item => item.buyId).filter((v, i, a) => a.indexOf(v) === i);
|
||||
|
||||
// Open up the relevant URL
|
||||
window.open('https://eddb.io/station?m=' + modIds.join(','));
|
||||
// TODO:
|
||||
// window.open('https://eddb.io/station?m=' + modIds.join(','));
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
_retrofitInfo() {
|
||||
const { ship } = this.props;
|
||||
const { desc, moduleDiscount, predicate, retrofitName, excluded } = this.state;
|
||||
const retrofitShip = this._buildRetrofitShip();
|
||||
|
||||
const currentModules = ship.getModules();
|
||||
const oldModules = retrofitShip.getModules();
|
||||
const buyModules = differenceBy(currentModules, oldModules, (m) => m.getItem());
|
||||
const sellModules = differenceBy(oldModules, currentModules, (m) => m.getItem());
|
||||
|
||||
let modules = [];
|
||||
let totalCost = 0;
|
||||
const addModule = (m, costFactor) => {
|
||||
const key = `${m.getItem()}@${m.getSlot()}`;
|
||||
const cost = costFactor * m.readMeta('cost') * (1 - moduleDiscount);
|
||||
modules.push({
|
||||
key, cost,
|
||||
rating: m.getClassRating(),
|
||||
item: m.readMeta('type'),
|
||||
});
|
||||
if (!excluded[key]) {
|
||||
totalCost += cost;
|
||||
}
|
||||
};
|
||||
for (let m of buyModules) {
|
||||
addModule(m, 1);
|
||||
}
|
||||
for (let m of sellModules) {
|
||||
addModule(m, -1);
|
||||
}
|
||||
|
||||
let _sortF = undefined;
|
||||
switch (predicate) {
|
||||
case 'cr': _sortF = (o) => o.cost; break;
|
||||
case 'm':
|
||||
default: _sortF = (o) => o.item; break;
|
||||
};
|
||||
|
||||
modules = sortBy(modules, _sortF);
|
||||
if (desc) {
|
||||
reverse(modules);
|
||||
}
|
||||
return [totalCost, modules];
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -347,59 +249,52 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_retrofitTab() {
|
||||
let { retrofitTotal, retrofitCosts, moduleDiscount, retrofitName } = this.state;
|
||||
let { buildOptions, excluded, moduleDiscount, retrofitName } = this.state;
|
||||
const { termtip, tooltip } = this.context;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let int = formats.int;
|
||||
let rows = [], options = [<option key='stock' value=''>{translate('Stock')}</option>];
|
||||
|
||||
for (let opt of this.state.buildOptions) {
|
||||
options.push(<option key={opt} value={opt}>{opt}</option>);
|
||||
}
|
||||
|
||||
if (retrofitCosts.length) {
|
||||
for (let i = 0, l = retrofitCosts.length; i < l; i++) {
|
||||
let item = retrofitCosts[i];
|
||||
rows.push(<tr key={i} className={cn('highlight', { disabled: !item.retroItem.incCost })} onClick={this._toggleRetrofitCost.bind(this, item)}>
|
||||
<td className='ptr' style={{ width: '1em' }}>{item.sellClassRating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(item.sellName)}</td>
|
||||
<td className='ptr' style={{ width: '1em' }}>{item.buyClassRating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(item.buyName)}</td>
|
||||
<td colSpan='2' className={cn('ri ptr', item.retroItem.incCost ? item.netCost > 0 ? 'warning' : 'secondary-disabled' : 'disabled')}>{int(item.netCost)}{units.CR}</td>
|
||||
</tr>);
|
||||
}
|
||||
} else {
|
||||
rows = <tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>;
|
||||
}
|
||||
|
||||
const [retrofitTotal, retrofitInfo] = this._retrofitInfo();
|
||||
return <div>
|
||||
<div className='scroll-x'>
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'sellName')}>{translate('sell')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'buyName')}>{translate('buy')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortRetrofitBy.bind(this, 'cr')}>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('cr')}>
|
||||
{translate('net cost')}
|
||||
{moduleDiscount ? <u className='cap optional-hide' style={{ marginLeft: '0.5em' }}>{`[${translate('modules')} -${formats.pct(moduleDiscount)}]`}</u> : null}
|
||||
</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
{retrofitInfo.length ?
|
||||
retrofitInfo.map((info) => (
|
||||
<tr key={info.key} className={cn('highlight', { disabled: excluded[info.key] })}
|
||||
onClick={() => this._toggleExcluded(info.key)}>
|
||||
<td className='ptr' style={{ width: '1em' }}>{info.rating}</td>
|
||||
<td className='le ptr shorten cap'>{translate(info.item)}</td>
|
||||
<td colSpan="2" className={cn('ri ptr', excluded[info.key] ? 'disabled' : (info.cost < 0 ? 'secondary-disabled' : 'warning'))}>
|
||||
{int(info.cost)}{units.CR}
|
||||
</td>
|
||||
</tr>
|
||||
)) : (
|
||||
<tr><td colSpan='7' style={{ padding: '3em 0' }}>{translate('PHRASE_NO_RETROCH')}</td></tr>
|
||||
)}
|
||||
<tr className='ri'>
|
||||
<td className='lbl' ><button onClick={this._eddbShoppingList} onMouseOver={termtip.bind(null, 'PHRASE_REFIT_SHOPPING_LIST')} onMouseOut={tooltip.bind(null, null)}><ShoppingIcon className='lg' style={{ fill: 'black' }}/></button></td>
|
||||
<td colSpan='3' className='lbl' >{translate('cost')}</td>
|
||||
<td className='lbl' >{translate('cost')}</td>
|
||||
<td colSpan='2' className={cn('val', retrofitTotal > 0 ? 'warning' : 'secondary-disabled')} style={{ borderBottom:'none' }}>
|
||||
{int(retrofitTotal)}{units.CR}
|
||||
</td>
|
||||
</tr>
|
||||
<tr className='ri'>
|
||||
<td colSpan='4' className='lbl cap' >{translate('retrofit from')}</td>
|
||||
<td colSpan='2' className='lbl cap' >{translate('retrofit from')}</td>
|
||||
<td className='val cen' style={{ borderRight: 'none', width: '1em' }}><u className='primary-disabled'>▾</u></td>
|
||||
<td className='val' style={{ borderLeft:'none', padding: 0 }}>
|
||||
<select style={{ width: '100%', padding: 0 }} value={retrofitName || translate('Stock')} onChange={this._onBaseRetrofitChange}>
|
||||
{options}
|
||||
<option key='stock' value=''>{translate('Stock')}</option>
|
||||
{buildOptions.map((opt) => <option key={opt} value={opt}>{opt}</option>)}
|
||||
</select>
|
||||
</td>
|
||||
</tr>
|
||||
@@ -409,63 +304,50 @@ export default class CostSection extends TranslatedComponent {
|
||||
</div>;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Update retrofit costs
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {Ship} retrofitShip Retrofit Ship instance
|
||||
*
|
||||
* @param {*} modules
|
||||
*/
|
||||
_updateRetrofit(ship, retrofitShip) {
|
||||
let retrofitCosts = [];
|
||||
let retrofitTotal = 0, i, l, item;
|
||||
_ammoInfo() {
|
||||
const { ship } = this.props;
|
||||
const { desc, predicate } = this.state;
|
||||
|
||||
if (ship.bulkheads.m.index != retrofitShip.bulkheads.m.index) {
|
||||
item = {
|
||||
buyClassRating: ship.bulkheads.m.class + ship.bulkheads.m.rating,
|
||||
buyId: ship.bulkheads.m.eddbID,
|
||||
buyPp: ship.bulkheads.m.pp,
|
||||
buyName: ship.bulkheads.m.name,
|
||||
sellClassRating: retrofitShip.bulkheads.m.class + retrofitShip.bulkheads.m.rating,
|
||||
sellName: retrofitShip.bulkheads.m.name,
|
||||
netCost: ship.bulkheads.discountedCost - retrofitShip.bulkheads.discountedCost,
|
||||
retroItem: retrofitShip.bulkheads
|
||||
};
|
||||
retrofitCosts.push(item);
|
||||
if (retrofitShip.bulkheads.incCost) {
|
||||
retrofitTotal += item.netCost;
|
||||
let info = [{
|
||||
key: 'fuel',
|
||||
item: 'Fuel',
|
||||
qty: ship.get(FUEL_CAPACITY),
|
||||
unitCost: 50,
|
||||
cost: 50 * ship.get(FUEL_CAPACITY),
|
||||
}];
|
||||
for (let m of ship.getModules()) {
|
||||
const rebuilds = m.get('bays') * m.get('rebuildsperbay');
|
||||
const ammo = (m.get('ammomaximum') + m.get('ammoclipsize')) || rebuilds;
|
||||
if (ammo) {
|
||||
const unitCost = m.readMeta('ammocost');
|
||||
info.push({
|
||||
key: `restock_${m.getSlot()}`,
|
||||
rating: m.getClassRating(),
|
||||
item: m.readMeta('type'),
|
||||
qty: ammo,
|
||||
unitCost, cost: unitCost * ammo,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
|
||||
let retroSlotGroup = retrofitShip[g];
|
||||
let slotGroup = ship[g];
|
||||
for (i = 0, l = slotGroup.length; i < l; i++) {
|
||||
const modId = slotGroup[i].m ? slotGroup[i].m.eddbID : null;
|
||||
const retroModId = retroSlotGroup[i].m ? retroSlotGroup[i].m.eddbID : null;
|
||||
if (modId != retroModId) {
|
||||
item = { netCost: 0, retroItem: retroSlotGroup[i] };
|
||||
if (slotGroup[i].m) {
|
||||
item.buyId = slotGroup[i].m.eddbID,
|
||||
item.buyPp = slotGroup[i].m.pp,
|
||||
item.buyName = slotGroup[i].m.name || slotGroup[i].m.grp;
|
||||
item.buyClassRating = slotGroup[i].m.class + slotGroup[i].m.rating;
|
||||
item.netCost = slotGroup[i].discountedCost;
|
||||
}
|
||||
if (retroSlotGroup[i].m) {
|
||||
item.sellName = retroSlotGroup[i].m.name || retroSlotGroup[i].m.grp;
|
||||
item.sellClassRating = retroSlotGroup[i].m.class + retroSlotGroup[i].m.rating;
|
||||
item.netCost -= retroSlotGroup[i].discountedCost;
|
||||
}
|
||||
retrofitCosts.push(item);
|
||||
if (retroSlotGroup[i].incCost) {
|
||||
retrofitTotal += item.netCost;
|
||||
}
|
||||
}
|
||||
}
|
||||
let _sortF = undefined;
|
||||
switch (predicate) {
|
||||
case 'cr': _sortF = (o) => o.cost; break;
|
||||
case 'qty': _sortF = (o) => o.qty; break;
|
||||
case 'cost': _sortF = (o) => o.unitCost; break;
|
||||
case 'm':
|
||||
default: _sortF = (o) => o.item;
|
||||
}
|
||||
info = sortBy(info, _sortF);
|
||||
if (desc) {
|
||||
reverse(info);
|
||||
}
|
||||
|
||||
this.setState({ retrofitCosts, retrofitTotal });
|
||||
this._sortRetrofit(retrofitCosts, this.state.retroPredicate, this.state.retroDesc);
|
||||
return info;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -473,20 +355,24 @@ export default class CostSection extends TranslatedComponent {
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_ammoTab() {
|
||||
let { ammoTotal, ammoCosts } = this.state;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let int = formats.int;
|
||||
let rows = [];
|
||||
const { excluded } = this.state;
|
||||
const { translate, formats, units } = this.context.language;
|
||||
const int = formats.int;
|
||||
const rows = [];
|
||||
|
||||
for (let i = 0, l = ammoCosts.length; i < l; i++) {
|
||||
let item = ammoCosts[i];
|
||||
rows.push(<tr key={i} className='highlight'>
|
||||
<td style={{ width: '1em' }}>{item.m.class + item.m.rating}</td>
|
||||
<td className='le shorten cap'>{slotName(translate, item)}</td>
|
||||
<td className='ri'>{int(item.max)}</td>
|
||||
<td className='ri'>{int(item.cost)}{units.CR}</td>
|
||||
<td className='ri'>{int(item.total)}{units.CR}</td>
|
||||
const ammoInfo = this._ammoInfo();
|
||||
let total = 0;
|
||||
for (let i of ammoInfo) {
|
||||
const disabled = excluded[i.key];
|
||||
rows.push(<tr key={i.key} onClick={() => this._toggleExcluded(i.key)}
|
||||
className={cn('highlight', { disabled })}>
|
||||
<td style={{ width: '1em' }}>{i.rating}</td>
|
||||
<td className='le shorten cap'>{translate(i.item)}</td>
|
||||
<td className='ri'>{int(i.qty)}</td>
|
||||
<td className='ri'>{int(i.unitCost)}{units.CR}</td>
|
||||
<td className='ri'>{int(i.cost)}{units.CR}</td>
|
||||
</tr>);
|
||||
total += disabled ? 0 : i.cost;
|
||||
}
|
||||
|
||||
return <div>
|
||||
@@ -494,17 +380,17 @@ export default class CostSection extends TranslatedComponent {
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'm')} >{translate('module')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'max')} >{translate('qty')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={this._sortAmmoBy.bind(this, 'cost')} >{translate('unit cost')}</th>
|
||||
<th className='sortable le' onClick={this._sortAmmoBy.bind(this, 'total')}>{translate('subtotal')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortBy('m')}>{translate('module')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('qty')}>{translate('qty')}</th>
|
||||
<th colSpan='1' className='sortable le' onClick={() => this._sortBy('cost')}>{translate('unit cost')}</th>
|
||||
<th className='sortable le' onClick={() => this._sortBy('cr')}>{translate('subtotal')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
<tr className='ri'>
|
||||
<td colSpan='4' className='lbl' >{translate('total')}</td>
|
||||
<td className='val'>{int(ammoTotal)}{units.CR}</td>
|
||||
<td className='val'>{int(total)}{units.CR}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -512,103 +398,6 @@ export default class CostSection extends TranslatedComponent {
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Recalculate all ammo costs
|
||||
* @param {Ship} ship Ship instance
|
||||
*/
|
||||
_updateAmmoCosts(ship) {
|
||||
let ammoCosts = [], ammoTotal = 0, item, q, limpets = 0, srvs = 0, scoop = false;
|
||||
|
||||
for (let g in { standard: 1, internal: 1, hardpoints: 1 }) {
|
||||
let slotGroup = ship[g];
|
||||
for (let i = 0, l = slotGroup.length; i < l; i++) {
|
||||
if (slotGroup[i].m) {
|
||||
// Special cases needed for SCB, AFMU, and limpet controllers since they don't use standard ammo/clip
|
||||
q = 0;
|
||||
switch (slotGroup[i].m.grp) {
|
||||
case 'fs': // Skip fuel calculation if scoop present
|
||||
scoop = true;
|
||||
break;
|
||||
case 'scb':
|
||||
q = slotGroup[i].m.getAmmo() + 1;
|
||||
break;
|
||||
case 'am':
|
||||
q = slotGroup[i].m.getAmmo();
|
||||
break;
|
||||
case 'pv':
|
||||
srvs += slotGroup[i].m.getBays();
|
||||
break;
|
||||
case 'fx': case 'hb': case 'cc': case 'pc':
|
||||
limpets = ship.cargoCapacity;
|
||||
break;
|
||||
default:
|
||||
q = slotGroup[i].m.getClip() + slotGroup[i].m.getAmmo();
|
||||
}
|
||||
// Calculate ammo costs only if a cost is specified
|
||||
if (slotGroup[i].m.ammocost > 0) {
|
||||
item = {
|
||||
m: slotGroup[i].m,
|
||||
max: q,
|
||||
cost: slotGroup[i].m.ammocost,
|
||||
total: q * slotGroup[i].m.ammocost
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
// Add fighters
|
||||
if (slotGroup[i].m.grp === 'fh') {
|
||||
item = {
|
||||
m: slotGroup[i].m,
|
||||
max: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays(),
|
||||
cost: slotGroup[i].m.fightercost,
|
||||
total: slotGroup[i].m.getRebuildsPerBay() * slotGroup[i].m.getBays() * slotGroup[i].m.fightercost
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Limpets if controllers exist and cargo space available
|
||||
if (limpets > 0) {
|
||||
item = {
|
||||
m: { name: 'limpets', class: '', rating: '' },
|
||||
max: ship.cargoCapacity,
|
||||
cost: 101,
|
||||
total: ship.cargoCapacity * 101
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
if (srvs > 0) {
|
||||
item = {
|
||||
m: { name: 'SRVs', class: '', rating: '' },
|
||||
max: srvs,
|
||||
cost: 1030,
|
||||
total: srvs * 1030
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
// Calculate refuel costs if no scoop present
|
||||
if (!scoop) {
|
||||
item = {
|
||||
m: { name: 'fuel', class: '', rating: '' },
|
||||
max: ship.fuelCapacity,
|
||||
cost: 50,
|
||||
total: ship.fuelCapacity * 50
|
||||
};
|
||||
ammoCosts.push(item);
|
||||
ammoTotal += item.total;
|
||||
}
|
||||
|
||||
this.setState({ ammoTotal, ammoCosts });
|
||||
this._sortAmmo(ammoCosts, this.state.ammoPredicate, this.state.ammoDesc);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add listeners on mount and update costs
|
||||
*/
|
||||
@@ -616,64 +405,7 @@ export default class CostSection extends TranslatedComponent {
|
||||
this.listeners = [
|
||||
Persist.addListener('discounts', this._onDiscountChanged.bind(this)),
|
||||
Persist.addListener('insurance', this._onInsuranceChanged.bind(this)),
|
||||
Persist.addListener('builds', this._onBuildsChanged.bind(this)),
|
||||
];
|
||||
this._updateAmmoCosts(this.props.ship);
|
||||
this._updateRetrofit(this.props.ship, this.state.retrofitShip);
|
||||
this._sortCost(this.props.ship);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state based on property and context changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next context
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
let retrofitShip = this.state.retrofitShip;
|
||||
|
||||
if (nextProps.ship != this.props.ship) { // Ship has changed
|
||||
let nextId = nextProps.ship.id;
|
||||
let retrofitName = this._defaultRetrofitName(nextId, nextProps.buildName);
|
||||
retrofitShip = this._buildRetrofitShip(nextId, retrofitName, nextId == this.props.ship.id ? retrofitShip : null);
|
||||
this.setState({
|
||||
retrofitShip,
|
||||
retrofitName,
|
||||
buildOptions: Persist.getBuildsNamesFor(nextId)
|
||||
});
|
||||
}
|
||||
|
||||
if (nextProps.ship != this.props.ship || nextProps.code != this.props.code) {
|
||||
nextProps.ship.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
|
||||
this._updateAmmoCosts(nextProps.ship);
|
||||
this._updateRetrofit(nextProps.ship, retrofitShip);
|
||||
this._sortCost(nextProps.ship);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort lists before render
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextState Incoming/Next state
|
||||
*/
|
||||
componentWillUpdate(nextProps, nextState) {
|
||||
let state = this.state;
|
||||
|
||||
switch (nextState.tab) {
|
||||
case 'ammo':
|
||||
if (state.ammoPredicate != nextState.ammoPredicate || state.ammoDesc != nextState.ammoDesc) {
|
||||
this._sortAmmo(nextState.ammoCosts, nextState.ammoPredicate, nextState.ammoDesc);
|
||||
}
|
||||
break;
|
||||
case 'retrofit':
|
||||
if (state.retroPredicate != nextState.retroPredicate || state.retroDesc != nextState.retroDesc) {
|
||||
this._sortRetrofit(nextState.retrofitCosts, nextState.retroPredicate, nextState.retroDesc);
|
||||
}
|
||||
break;
|
||||
default:
|
||||
if (state.costPredicate != nextState.costPredicate || state.costDesc != nextState.costDesc) {
|
||||
this._sortCost(nextProps.ship, nextState.costPredicate, nextState.costDesc);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -4,6 +4,8 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import PieChart from './PieChart';
|
||||
import VerticalBarChart from './VerticalBarChart';
|
||||
import autoBind from 'auto-bind';
|
||||
import { ARMOUR_METRICS, MODULE_PROTECTION_METRICS, SHIELD_METRICS } from 'ed-forge/lib/ship-stats';
|
||||
|
||||
/**
|
||||
* Defence information
|
||||
@@ -15,12 +17,10 @@ import VerticalBarChart from './VerticalBarChart';
|
||||
*/
|
||||
export default class Defence extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
engagementrange: PropTypes.number.isRequired,
|
||||
sys: PropTypes.number.isRequired,
|
||||
opponentWep: PropTypes.number.isRequired
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -29,22 +29,7 @@ export default class Defence extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(props.ship, props.opponent, props.sys, props.opponentWep, props.engagementrange);
|
||||
this.state = { shield, armour, shielddamage, armourdamage };
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our properties change
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps) {
|
||||
if (this.props.marker != nextProps.marker || this.props.sys != nextProps.sys) {
|
||||
const { shield, armour, shielddamage, armourdamage } = Calc.defenceMetrics(nextProps.ship, nextProps.opponent, nextProps.sys, nextProps.opponentWep, nextProps.engagementrange);
|
||||
this.setState({ shield, armour, shielddamage, armourdamage });
|
||||
}
|
||||
return true;
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -52,197 +37,126 @@ export default class Defence extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { ship, sys, opponentWep } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { shield, armour, shielddamage, armourdamage } = this.state;
|
||||
|
||||
const pd = ship.standard[4].m;
|
||||
const shields = ship.get(SHIELD_METRICS);
|
||||
|
||||
const shieldSourcesData = [];
|
||||
const effectiveShieldData = [];
|
||||
const shieldDamageTakenData = [];
|
||||
const shieldSourcesTt = [];
|
||||
const shieldDamageTakenAbsoluteTt = [];
|
||||
const shieldDamageTakenExplosiveTt = [];
|
||||
const shieldDamageTakenKineticTt = [];
|
||||
const shieldDamageTakenThermalTt = [];
|
||||
const effectiveShieldAbsoluteTt = [];
|
||||
const effectiveShieldExplosiveTt = [];
|
||||
const effectiveShieldKineticTt = [];
|
||||
const effectiveShieldThermalTt = [];
|
||||
let maxEffectiveShield = 0;
|
||||
if (shield.total) {
|
||||
shieldSourcesData.push({ value: Math.round(shield.generator), label: translate('generator') });
|
||||
shieldSourcesData.push({ value: Math.round(shield.boosters), label: translate('boosters') });
|
||||
shieldSourcesData.push({ value: Math.round(shield.cells), label: translate('cells') });
|
||||
// Data for pie chart (absolute MJ)
|
||||
const shieldSourcesData = [
|
||||
'byBoosters', 'byGenerator', 'byReinforcements', 'bySCBs',
|
||||
].map((key) => { return { label: key, value: Math.round(shields[key]) }; });
|
||||
|
||||
if (shield.generator > 0) {
|
||||
shieldSourcesTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.int(shield.generator)}{units.MJ}</div>);
|
||||
if (shield.boosters > 0) {
|
||||
shieldSourcesTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.int(shield.boosters)}{units.MJ}</div>);
|
||||
}
|
||||
// Data for tooltip
|
||||
const shieldSourcesTt = shieldSourcesData.map((o) => {
|
||||
let { label, value } = o;
|
||||
return <div key={label}>
|
||||
{translate(label)} {formats.int(value)}{units.MJ}
|
||||
</div>;
|
||||
});
|
||||
|
||||
if (shield.cells > 0) {
|
||||
shieldSourcesTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldAbsoluteTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='cells'>{translate('cells') + ' ' + formats.int(shield.cells)}{units.MJ}</div>);
|
||||
}
|
||||
// Shield resistances
|
||||
const shieldDamageTakenData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal',
|
||||
].map((label) => {
|
||||
const dmgMult = shields[label];
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.pct1(dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(100 * dmgMult.withSys), tooltip };
|
||||
});
|
||||
|
||||
// Add effective shield from resistances
|
||||
const rawMj = shield.generator + shield.boosters + shield.cells;
|
||||
const explosiveMj = rawMj / (shield.explosive.generator * shield.explosive.boosters) - rawMj;
|
||||
if (explosiveMj != 0) effectiveShieldExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(explosiveMj)}{units.MJ}</div>);
|
||||
const kineticMj = rawMj / (shield.kinetic.generator * shield.kinetic.boosters) - rawMj;
|
||||
if (kineticMj != 0) effectiveShieldKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(kineticMj)}{units.MJ}</div>);
|
||||
const thermalMj = rawMj / (shield.thermal.generator * shield.thermal.boosters) - rawMj;
|
||||
if (thermalMj != 0) effectiveShieldThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(thermalMj)}{units.MJ}</div>);
|
||||
// Effective MJ
|
||||
const effectiveShieldData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal'
|
||||
].map((label) => {
|
||||
const dmgMult = shields[label];
|
||||
const raw = shields.withSCBs;
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.int(raw * dmgMult[label])}{units.MJ}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(dmgMult.withSys * raw), tooltip };
|
||||
});
|
||||
const maxEffectiveShield = Math.max(...effectiveShieldData.map((o) => o.value));
|
||||
|
||||
// Add effective shield from power distributor SYS pips
|
||||
if (shield.absolute.sys != 1) {
|
||||
effectiveShieldAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.absolute.sys - rawMj)}{units.MJ}</div>);
|
||||
effectiveShieldExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.explosive.sys - rawMj)}{units.MJ}</div>);
|
||||
effectiveShieldKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.kinetic.sys - rawMj)}{units.MJ}</div>);
|
||||
effectiveShieldThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.int(rawMj / shield.thermal.sys - rawMj)}{units.MJ}</div>);
|
||||
}
|
||||
}
|
||||
const armour = ship.get(ARMOUR_METRICS);
|
||||
const moduleProtection = ship.get(MODULE_PROTECTION_METRICS);
|
||||
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.absolute.generator)}</div>);
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.absolute.boosters)}</div>);
|
||||
shieldDamageTakenAbsoluteTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.absolute.sys)}</div>);
|
||||
// Data for pie chart (absolute HP)
|
||||
const armourSourcesData = ['base', 'byAlloys', 'byHRPs',].map(
|
||||
(key) => { return { label: key, value: Math.round(armour[key]) }; }
|
||||
);
|
||||
|
||||
shieldDamageTakenExplosiveTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.explosive.generator)}</div>);
|
||||
shieldDamageTakenExplosiveTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.explosive.boosters)}</div>);
|
||||
shieldDamageTakenExplosiveTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.explosive.sys)}</div>);
|
||||
// Data for tooltip
|
||||
const armourSourcesTt = armourSourcesData.map((o) => {
|
||||
let { label, value } = o;
|
||||
return <div key={label}>{translate(label)} {formats.int(value)}</div>;
|
||||
});
|
||||
|
||||
shieldDamageTakenKineticTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.kinetic.generator)}</div>);
|
||||
shieldDamageTakenKineticTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.kinetic.boosters)}</div>);
|
||||
shieldDamageTakenKineticTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.kinetic.sys)}</div>);
|
||||
// Armour resistances
|
||||
const armourDamageTakenData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal', 'caustic',
|
||||
].map((label) => {
|
||||
const dmgMult = armour[label];
|
||||
const tooltip = ['byAlloys', 'byHRPs'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.pct1(dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(100 * dmgMult.damageMultiplier), tooltip };
|
||||
});
|
||||
|
||||
shieldDamageTakenThermalTt.push(<div key='generator'>{translate('generator') + ' ' + formats.pct1(shield.thermal.generator)}</div>);
|
||||
shieldDamageTakenThermalTt.push(<div key='boosters'>{translate('boosters') + ' ' + formats.pct1(shield.thermal.boosters)}</div>);
|
||||
shieldDamageTakenThermalTt.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(shield.thermal.sys)}</div>);
|
||||
|
||||
const effectiveAbsoluteShield = shield.total / shield.absolute.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveAbsoluteShield), label: translate('absolute'), tooltip: effectiveShieldAbsoluteTt });
|
||||
const effectiveExplosiveShield = shield.total / shield.explosive.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveExplosiveShield), label: translate('explosive'), tooltip: effectiveShieldExplosiveTt });
|
||||
const effectiveKineticShield = shield.total / shield.kinetic.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveKineticShield), label: translate('kinetic'), tooltip: effectiveShieldKineticTt });
|
||||
const effectiveThermalShield = shield.total / shield.thermal.total;
|
||||
effectiveShieldData.push({ value: Math.round(effectiveThermalShield), label: translate('thermal'), tooltip: effectiveShieldThermalTt });
|
||||
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.absolute.total * 100), label: translate('absolute'), tooltip: shieldDamageTakenAbsoluteTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.explosive.total * 100), label: translate('explosive'), tooltip: shieldDamageTakenExplosiveTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.kinetic.total * 100), label: translate('kinetic'), tooltip: shieldDamageTakenKineticTt });
|
||||
shieldDamageTakenData.push({ value: Math.round(shield.thermal.total * 100), label: translate('thermal'), tooltip: shieldDamageTakenThermalTt });
|
||||
|
||||
maxEffectiveShield = Math.max(shield.total / shield.absolute.max, shield.total / shield.explosive.max, shield.total / shield.kinetic.max, shield.total / shield.thermal.max);
|
||||
}
|
||||
|
||||
const armourSourcesData = [];
|
||||
armourSourcesData.push({ value: Math.round(armour.bulkheads), label: translate('bulkheads') });
|
||||
armourSourcesData.push({ value: Math.round(armour.reinforcement), label: translate('reinforcement') });
|
||||
|
||||
const armourSourcesTt = [];
|
||||
const effectiveArmourAbsoluteTt = [];
|
||||
const effectiveArmourExplosiveTt = [];
|
||||
const effectiveArmourKineticTt = [];
|
||||
const effectiveArmourThermalTt = [];
|
||||
if (armour.bulkheads > 0) {
|
||||
armourSourcesTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourAbsoluteTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
effectiveArmourThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.int(armour.bulkheads)}</div>);
|
||||
if (armour.reinforcement > 0) {
|
||||
armourSourcesTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourAbsoluteTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
effectiveArmourThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.int(armour.reinforcement)}</div>);
|
||||
}
|
||||
}
|
||||
|
||||
const rawArmour = armour.bulkheads + armour.reinforcement;
|
||||
|
||||
const armourDamageTakenTt = [];
|
||||
armourDamageTakenTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.absolute.bulkheads)}</div>);
|
||||
armourDamageTakenTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.absolute.reinforcement)}</div>);
|
||||
|
||||
const armourDamageTakenExplosiveTt = [];
|
||||
armourDamageTakenExplosiveTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.explosive.bulkheads)}</div>);
|
||||
armourDamageTakenExplosiveTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.explosive.reinforcement)}</div>);
|
||||
if (armour.explosive.bulkheads * armour.explosive.reinforcement != 1) effectiveArmourExplosiveTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / (armour.explosive.bulkheads * armour.explosive.reinforcement) - rawArmour)}</div>);
|
||||
|
||||
const armourDamageTakenKineticTt = [];
|
||||
armourDamageTakenKineticTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.kinetic.bulkheads)}</div>);
|
||||
armourDamageTakenKineticTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.kinetic.reinforcement)}</div>);
|
||||
if (armour.kinetic.bulkheads * armour.kinetic.reinforcement != 1) effectiveArmourKineticTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / (armour.kinetic.bulkheads * armour.kinetic.reinforcement) - rawArmour)}</div>);
|
||||
|
||||
const armourDamageTakenThermalTt = [];
|
||||
armourDamageTakenThermalTt.push(<div key='bulkheads'>{translate('bulkheads') + ' ' + formats.pct1(armour.thermal.bulkheads)}</div>);
|
||||
armourDamageTakenThermalTt.push(<div key='reinforcement'>{translate('reinforcement') + ' ' + formats.pct1(armour.thermal.reinforcement)}</div>);
|
||||
if (armour.thermal.bulkheads * armour.thermal.reinforcement != 1) effectiveArmourThermalTt.push(<div key='resistance'>{translate('resistance') + ' ' + formats.int(rawArmour / (armour.thermal.bulkheads * armour.thermal.reinforcement) - rawArmour)}</div>);
|
||||
|
||||
const effectiveArmourData = [];
|
||||
const effectiveAbsoluteArmour = armour.total / armour.absolute.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveAbsoluteArmour), label: translate('absolute'), tooltip: effectiveArmourAbsoluteTt });
|
||||
const effectiveExplosiveArmour = armour.total / armour.explosive.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveExplosiveArmour), label: translate('explosive'), tooltip: effectiveArmourExplosiveTt });
|
||||
const effectiveKineticArmour = armour.total / armour.kinetic.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveKineticArmour), label: translate('kinetic'), tooltip: effectiveArmourKineticTt });
|
||||
const effectiveThermalArmour = armour.total / armour.thermal.total;
|
||||
effectiveArmourData.push({ value: Math.round(effectiveThermalArmour), label: translate('thermal'), tooltip: effectiveArmourThermalTt });
|
||||
|
||||
const armourDamageTakenData = [];
|
||||
armourDamageTakenData.push({ value: Math.round(armour.absolute.total * 100), label: translate('absolute'), tooltip: armourDamageTakenTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.explosive.total * 100), label: translate('explosive'), tooltip: armourDamageTakenExplosiveTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.kinetic.total * 100), label: translate('kinetic'), tooltip: armourDamageTakenKineticTt });
|
||||
armourDamageTakenData.push({ value: Math.round(armour.thermal.total * 100), label: translate('thermal'), tooltip: armourDamageTakenThermalTt });
|
||||
// Effective HP
|
||||
const effectiveArmourData = [
|
||||
'absolute', 'explosive', 'kinetic', 'thermal'
|
||||
].map((label) => {
|
||||
const dmgMult = armour[label];
|
||||
const raw = armour.armour;
|
||||
const tooltip = ['byBoosters', 'byGenerator', 'bySys'].map(
|
||||
(label) => <div key={label}>
|
||||
{translate(label)} {formats.int(raw * dmgMult[label])}
|
||||
</div>
|
||||
);
|
||||
return { label, value: Math.round(dmgMult.damageMultiplier * raw), tooltip };
|
||||
});
|
||||
|
||||
return (
|
||||
<span id='defence'>
|
||||
{shield.total ? <span>
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('shield metrics')}</h2>
|
||||
<br/>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shield.total)}{units.MJ}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>{shielddamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(shield.total, shielddamage.totalsdps, shielddamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shield.recover === Math.Inf ? translate('never') : formats.time(shield.recover)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shield.recharge === Math.Inf ? translate('never') : formats.time(shield.recharge)}</h2>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
|
||||
<PieChart data={shieldSourcesData} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_DAMAGE_TAKEN'))} onMouseOut={tooltip.bind(null, null)}>{translate('damage taken')}(%)</h2>
|
||||
<VerticalBarChart data={shieldDamageTakenData} yMax={140} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_EFFECTIVE_SHIELD'))} onMouseOut={tooltip.bind(null, null)}>{translate('effective shield')}(MJ)</h2>
|
||||
<VerticalBarChart data={effectiveShieldData} yMax={maxEffectiveShield}/>
|
||||
</div>
|
||||
{shields.withSCBs ? <span>
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('shield metrics')}</h2>
|
||||
<br/>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{shieldSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw shield strength')}<br/>{formats.int(shields.withSCBs)}{units.MJ}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_SHIELDS')}<br/>TODO</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECOVER'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECOVER_SHIELDS')}<br/>{shields.recover ? formats.time(shields.recover) : translate('never')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SG_RECHARGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_RECHARGE_SHIELDS')}<br/>{shields.recharge ? formats.time(shields.recharge) : translate('never')}</h2>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_SOURCES'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield sources')}</h2>
|
||||
<PieChart data={shieldSourcesData} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_DAMAGE_TAKEN'))} onMouseOut={tooltip.bind(null, null)}>{translate('damage taken')}(%)</h2>
|
||||
<VerticalBarChart data={shieldDamageTakenData} yMax={140} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_EFFECTIVE_SHIELD'))} onMouseOut={tooltip.bind(null, null)}>{translate('effective shield')}(MJ)</h2>
|
||||
<VerticalBarChart data={effectiveShieldData} yMax={maxEffectiveShield}/>
|
||||
</div>
|
||||
</span> : null }
|
||||
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('armour metrics')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.total)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>{armourdamage.totalsdps == 0 ? translate('ever') : formats.time(Calc.timeToDeplete(armour.total, armourdamage.totalsdps, armourdamage.totalseps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * opponentWep / 4))}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(armour.modulearmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1(armour.moduleprotection / 2)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(armour.moduleprotection)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, <div>{armourSourcesTt}</div>)} onMouseOut={tooltip.bind(null, null)} className='summary'>{translate('raw armour strength')}<br/>{formats.int(armour.armour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_LOSE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_LOSE_ARMOUR')}<br/>TODO</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('raw module armour')}<br/>{formats.int(moduleProtection.moduleArmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_EXTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_EXTERNAL')}<br/>{formats.pct1((1 - moduleProtection.moduleProtection) / 2)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_MODULE_PROTECTION_INTERNAL'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_MODULE_PROTECTION_INTERNAL')}<br/>{formats.pct1(1 - moduleProtection.moduleProtection)}</h2>
|
||||
<br/>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
|
||||
@@ -1,7 +1,6 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Slider from '../components/Slider';
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,104 +1,59 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Module from '../shipyard/Module';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import { getBoostMultiplier, getSpeedMultipliers } from 'ed-forge/lib/stats/SpeedProfile';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* Engine profile for a given ship
|
||||
*/
|
||||
export default class EngineProfile extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
pips: PropTypes.number.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const ship = this.props.ship;
|
||||
|
||||
this.state = {
|
||||
calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, ship, this.props.eng, this.props.boost)
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
this.setState({ calcMaxSpeedFunc: this.calcMaxSpeed.bind(this, nextProps.ship, nextProps.eng, nextProps.boost) });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the top speed for this ship given thrusters, mass and pips to ENG
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} eng The number of pips to ENG
|
||||
* @param {Object} boost If boost is enabled
|
||||
* @param {Object} mass The mass at which to calculate the top speed
|
||||
* @return {number} The maximum speed
|
||||
*/
|
||||
calcMaxSpeed(ship, eng, boost, mass) {
|
||||
// Obtain the top speed
|
||||
return Calc.calcSpeed(mass, ship.speed, ship.standard[1].m, ship.pipSpeed, eng, ship.boost / ship.speed, boost);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render engine profile
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship, cargo, eng, fuel, boost } = this.props;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship, pips, boost } = this.props;
|
||||
|
||||
// Calculate bounds for our line chart
|
||||
const thrusters = ship.standard[1].m;
|
||||
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
|
||||
const maxMass = thrusters.getMaxMass();
|
||||
const mass = ship.unladenMass + fuel + cargo;
|
||||
const minSpeed = Calc.calcSpeed(maxMass, ship.speed, thrusters, ship.pipSpeed, 0, ship.boost / ship.speed, false);
|
||||
const maxSpeed = Calc.calcSpeed(minMass, ship.speed, thrusters, ship.pipSpeed, 4, ship.boost / ship.speed, true);
|
||||
// Add a mark at our current mass
|
||||
const mark = Math.min(mass, maxMass);
|
||||
|
||||
const code = `${ship.toString()}:${cargo}:${fuel}:${eng}:${boost}`;
|
||||
|
||||
const minMass = ship.readProp('hullmass');
|
||||
const maxMass = ship.getThrusters().get('enginemaximalmass');
|
||||
const baseSpeed = ship.readProp('speed');
|
||||
const baseBoost = getBoostMultiplier(ship);
|
||||
const cb = (eng, boost, mass) => {
|
||||
const mult = getSpeedMultipliers(ship, mass)[(boost ? 4 : eng) / 0.5];
|
||||
return baseSpeed * (boost ? baseBoost : 1) * mult;
|
||||
};
|
||||
// This graph can have a precipitous fall-off so we use lots of points to make it look a little smoother
|
||||
return (
|
||||
<LineChart
|
||||
xMin={minMass}
|
||||
xMax={maxMass}
|
||||
yMin={minSpeed}
|
||||
yMax={maxSpeed}
|
||||
xMark={mark}
|
||||
yMin={cb(0, false, maxMass)}
|
||||
yMax={cb(4, true, minMass)}
|
||||
// Add a mark at our current mass
|
||||
xMark={Math.min(ship.get(LADEN_MASS), maxMass)}
|
||||
xLabel={translate('mass')}
|
||||
xUnit={translate('T')}
|
||||
yLabel={translate('maximum speed')}
|
||||
yUnit={translate('m/s')}
|
||||
func={this.state.calcMaxSpeedFunc}
|
||||
func={cb.bind(this, pips.Eng.base + pips.Eng.mc, boost)}
|
||||
points={1000}
|
||||
code={code}
|
||||
// Encode boost in code to re-render on state change
|
||||
code={`${pips.Eng.base + pips.Eng.mc}:${Number(boost)}:${code}`}
|
||||
aspect={0.7}
|
||||
/>
|
||||
);
|
||||
|
||||
@@ -1,53 +1,23 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Module from '../shipyard/Module';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import { calculateJumpRange } from 'ed-forge/lib/stats/JumpRangeProfile';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* FSD profile for a given ship
|
||||
*/
|
||||
export default class FSDProfile extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
const ship = this.props.ship;
|
||||
|
||||
this.state = {
|
||||
calcMaxRangeFunc: this._calcMaxRange.bind(this, ship, this.props.fuel)
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
this.setState({ calcMaxRangeFunc: this._calcMaxRange.bind(this, nextProps.ship, nextProps.fuel) });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum range for this ship across its applicable mass
|
||||
* @param {Object} ship The ship
|
||||
@@ -57,7 +27,7 @@ export default class FSDProfile extends TranslatedComponent {
|
||||
*/
|
||||
_calcMaxRange(ship, fuel, mass) {
|
||||
// Obtain the maximum range
|
||||
return Calc.jumpRange(mass, ship.standard[2].m, Math.min(fuel, ship.standard[2].m.getMaxFuelPerJump()));
|
||||
return Calc.jumpRange(mass, ship.standard[2].m, Math.min(fuel, ship.standard[2].m.getMaxFuelPerJump()), ship);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -65,36 +35,27 @@ export default class FSDProfile extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { ship, cargo, fuel } = this.props;
|
||||
|
||||
|
||||
// Calculate bounds for our line chart - use thruster info for X
|
||||
const thrusters = ship.standard[1].m;
|
||||
const fsd = ship.standard[2].m;
|
||||
const minMass = ship.calcLowestPossibleMass({ th: thrusters });
|
||||
const maxMass = thrusters.getMaxMass();
|
||||
const mass = ship.unladenMass + fuel + cargo;
|
||||
const minRange = 0;
|
||||
const maxRange = Calc.jumpRange(minMass + fsd.getMaxFuelPerJump(), fsd, fsd.getMaxFuelPerJump());
|
||||
// Add a mark at our current mass
|
||||
const mark = Math.min(mass, maxMass);
|
||||
|
||||
const code = ship.name + ship.toString() + '.' + fuel;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship } = this.props;
|
||||
|
||||
const minMass = ship.readProp('hullmass');
|
||||
const maxMass = ship.getThrusters().get('enginemaximalmass');
|
||||
const mass = ship.get(LADEN_MASS);
|
||||
const cb = (mass) => calculateJumpRange(ship, mass, Infinity, true);
|
||||
return (
|
||||
<LineChart
|
||||
xMin={minMass}
|
||||
xMax={maxMass}
|
||||
yMin={minRange}
|
||||
yMax={maxRange}
|
||||
xMark={mark}
|
||||
yMin={0}
|
||||
yMax={cb(minMass)}
|
||||
// Add a mark at our current mass
|
||||
xMark={Math.min(mass, maxMass)}
|
||||
xLabel={translate('mass')}
|
||||
xUnit={translate('T')}
|
||||
yLabel={translate('maximum range')}
|
||||
yUnit={translate('LY')}
|
||||
func={this.state.calcMaxRangeFunc}
|
||||
func={cb}
|
||||
points={200}
|
||||
code={code}
|
||||
aspect={0.7}
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Slider from '../components/Slider';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Fuel slider
|
||||
@@ -22,8 +22,7 @@ export default class Fuel extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._fuelChange = this._fuelChange.bind(this);
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,107 +0,0 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import Slot from './Slot';
|
||||
import Persist from '../stores/Persist';
|
||||
import { DamageAbsolute, DamageKinetic, DamageThermal, DamageExplosive, MountFixed, MountGimballed, MountTurret, ListModifications, Modified } from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
|
||||
/**
|
||||
* Hardpoint / Utility Slot
|
||||
*/
|
||||
export default class HardpointSlot extends Slot {
|
||||
|
||||
/**
|
||||
* Get the CSS class name for the slot.
|
||||
* @return {string} CSS Class name
|
||||
*/
|
||||
_getClassNames() {
|
||||
return this.props.maxClass > 0 ? 'hardpoint' : null;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the label for the slot
|
||||
* @param {Function} translate Translate function
|
||||
* @return {string} Label
|
||||
*/
|
||||
_getMaxClassLabel(translate) {
|
||||
return translate(['U','S','M','L','H'][this.props.maxClass]);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the slot contents
|
||||
* @param {Object} m Mounted Module
|
||||
* @param {Boolean} enabled Slot enabled
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} formats Localized Formats map
|
||||
* @param {Object} u Localized Units Map
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getSlotDetails(m, enabled, translate, formats, u) {
|
||||
if (m) {
|
||||
let classRating = `${m.class}${m.rating}${m.missile ? '/' + m.missile : ''}`;
|
||||
let { drag, drop } = this.props;
|
||||
let { termtip, tooltip } = this.context;
|
||||
let validMods = Modifications.modules[m.grp].modifications || [];
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
const className = cn('details', enabled ? '' : 'disabled');
|
||||
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>
|
||||
{m.mount && m.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed /></span> : ''}
|
||||
{m.mount && m.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : ''}
|
||||
{m.mount && m.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().K ? <span onMouseOver={termtip.bind(null, 'kinetic')} onMouseOut={tooltip.bind(null, null)}><DamageKinetic /></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().T ? <span onMouseOver={termtip.bind(null, 'thermal')} onMouseOut={tooltip.bind(null, null)}><DamageThermal /></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().E ? <span onMouseOver={termtip.bind(null, 'explosive')} onMouseOut={tooltip.bind(null, null)}><DamageExplosive /></span> : ''}
|
||||
{m.getDamageDist() && m.getDamageDist().A ? <span onMouseOver={termtip.bind(null, 'absolute')} onMouseOut={tooltip.bind(null, null)}><DamageAbsolute /></span> : ''}
|
||||
{classRating} {translate(m.name || m.grp)}{ m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }
|
||||
</div>
|
||||
|
||||
<div className={'r'}>{formats.round(m.getMass())}{u.T}</div>
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{ m.getDps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'dpssdps' : 'dps')} onMouseOut={tooltip.bind(null, null)}>{translate('DPS')}: {formats.round1(m.getDps())} { m.getClip() ? <span>({formats.round1((m.getClip() * m.getDps() / m.getRoF()) / ((m.getClip() / m.getRoF()) + m.getReload())) })</span> : null }</div> : null }
|
||||
{ m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'epsseps' : 'eps')} onMouseOut={tooltip.bind(null, null)}>{translate('EPS')}: {formats.round1(m.getEps())}{u.MW} { m.getClip() ? <span>({formats.round1((m.getClip() * m.getEps() / m.getRoF()) / ((m.getClip() / m.getRoF()) + m.getReload())) }{u.MW})</span> : null }</div> : null }
|
||||
{ m.getHps() ? <div className={'l'} onMouseOver={termtip.bind(null, m.getClip() ? 'hpsshps' : 'hps')} onMouseOut={tooltip.bind(null, null)}>{translate('HPS')}: {formats.round1(m.getHps())} { m.getClip() ? <span>({formats.round1((m.getClip() * m.getHps() / m.getRoF()) / ((m.getClip() / m.getRoF()) + m.getReload())) })</span> : null }</div> : null }
|
||||
{ m.getDps() && m.getEps() ? <div className={'l'} onMouseOver={termtip.bind(null, 'dpe')} onMouseOut={tooltip.bind(null, null)}>{translate('DPE')}: {formats.f1(m.getDps() / m.getEps())}</div> : null }
|
||||
{ m.getRoF() ? <div className={'l'} onMouseOver={termtip.bind(null, 'rof')} onMouseOut={tooltip.bind(null, null)}>{translate('ROF')}: {formats.f1(m.getRoF())}{u.ps}</div> : null }
|
||||
{ m.getRange() ? <div className={'l'}>{translate('range', m.grp)} {formats.f1(m.getRange() / 1000)}{u.km}</div> : null }
|
||||
{ m.getScanTime() ? <div className={'l'}>{translate('scantime')} {formats.f1(m.getScanTime())}{u.s}</div> : null }
|
||||
{ m.getFalloff() ? <div className={'l'}>{translate('falloff')} {formats.round(m.getFalloff() / 1000)}{u.km}</div> : null }
|
||||
{ m.getShieldBoost() ? <div className={'l'}>+{formats.pct1(m.getShieldBoost())}</div> : null }
|
||||
{ m.getAmmo() ? <div className={'l'}>{translate('ammunition')}: {formats.int(m.getClip())}/{formats.int(m.getAmmo())}</div> : null }
|
||||
{ m.getReload() ? <div className={'l'}>{translate('reload')}: {formats.round(m.getReload())}{u.s}</div> : null }
|
||||
{ m.getShotSpeed() ? <div className={'l'}>{translate('shotspeed')}: {formats.int(m.getShotSpeed())}{u.mps}</div> : null }
|
||||
{ m.getPiercing() ? <div className={'l'}>{translate('piercing')}: {formats.int(m.getPiercing())}</div> : null }
|
||||
{ m.getJitter() ? <div className={'l'}>{translate('jitter')}: {formats.f2(m.getJitter())}°</div> : null }
|
||||
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
|
||||
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
|
||||
{ m && validMods.length > 0 ? <div className='r' ><button onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
|
||||
</div>
|
||||
</div>;
|
||||
} else {
|
||||
return <div className={'empty'}>{translate('empty')}</div>;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,32 +1,29 @@
|
||||
import React from 'react';
|
||||
import SlotSection from './SlotSection';
|
||||
import HardpointSlot from './HardpointSlot';
|
||||
import cn from 'classnames';
|
||||
import Slot from './Slot';
|
||||
import { MountFixed, MountGimballed, MountTurret } from '../components/SvgIcons';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Hardpoint slot section
|
||||
*/
|
||||
export default class HardpointSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'hardpoints', 'hardpoints');
|
||||
|
||||
this._empty = this._empty.bind(this);
|
||||
constructor(props) {
|
||||
super(props, 'hardpoints');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all slots
|
||||
*/
|
||||
_empty() {
|
||||
this.props.ship.emptyWeapons();
|
||||
this.props.onChange();
|
||||
// TODO:
|
||||
// this.props.ship.emptyWeapons();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -37,8 +34,8 @@ export default class HardpointSlotSection extends SlotSection {
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_fill(group, mount, event) {
|
||||
this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
|
||||
this.props.onChange();
|
||||
// TODO:
|
||||
// this.props.ship.useWeapon(group, mount, null, event.getModifierState('Alt'));
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -54,32 +51,24 @@ export default class HardpointSlotSection extends SlotSection {
|
||||
* @return {Array} Array of Slots
|
||||
*/
|
||||
_getSlots() {
|
||||
let { ship, currentMenu } = this.props;
|
||||
let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let slots = [];
|
||||
let hardpoints = ship.hardpoints;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = hardpoints.length; i < l; i++) {
|
||||
let h = hardpoints[i];
|
||||
if (h.maxClass) {
|
||||
slots.push(<HardpointSlot
|
||||
key={i}
|
||||
maxClass={h.maxClass}
|
||||
availableModules={() => availableModules.getHps(h.maxClass)}
|
||||
onOpen={this._openMenu.bind(this, h)}
|
||||
onSelect={this._selectModule.bind(this, h)}
|
||||
onChange={this.props.onChange}
|
||||
selected={currentMenu == h}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
ship={ship}
|
||||
m={h.m}
|
||||
enabled={h.enabled ? true : false}
|
||||
/>);
|
||||
}
|
||||
for (let h of ship.getHardpoints(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={h.object.Slot}
|
||||
maxClass={h.getSize()}
|
||||
currentMenu={currentMenu}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
m={h}
|
||||
enabled={h.enabled ? true : false}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
|
||||
return slots;
|
||||
@@ -90,59 +79,68 @@ export default class HardpointSlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
let _fill = this._fill;
|
||||
|
||||
return <div className='select hardpoint' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._empty} ref={smRef => this.sectionRefArr['emptyall'] = smRef}>{translate('empty all')}</li>
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('pl')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'pl', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'pl', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'pl', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'pl', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('ul')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'ul', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'ul', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'ul', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'ul', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('bl')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'bl', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'bl', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'bl', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'bl', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('mc')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'mc', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'mc', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'mc', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'mc', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('c')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'c', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'c', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'c', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'c', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('fc')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_fill.bind(this, 'fc', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'fc', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className='c' onClick={_fill.bind(this, 'fc', 'T')}><MountTurret className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'G')}><MountGimballed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'fc', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('pa')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={_fill.bind(this, 'pa', 'F')}>{translate('pa')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'pa', 'F')}>{translate('pa')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('rg')}</div>
|
||||
<ul>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'rg', 'F')}>{translate('rg')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('nl')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={_fill.bind(this, 'nl', 'F')}>{translate('nl')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={_fill.bind(this, 'nl', 'F')}>{translate('nl')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('rfl')}</div>
|
||||
<ul>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'F')}><MountFixed className='lg'/></li>
|
||||
<li className="c" tabIndex="0" onClick={_fill.bind(this, 'rfl', 'T')}><MountTurret className='lg'/></li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -9,11 +9,14 @@ import { Cogs, CoriolisLogo, Hammer, Help, Rocket, StatsBars } from './SvgIcons'
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Persist from '../stores/Persist';
|
||||
import { toDetailedExport } from '../shipyard/Serializer';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import ModalBatchOrbis from './ModalBatchOrbis';
|
||||
import ModalDeleteAll from './ModalDeleteAll';
|
||||
import ModalExport from './ModalExport';
|
||||
import ModalHelp from './ModalHelp';
|
||||
import ModalImport from './ModalImport';
|
||||
import Slider from './Slider';
|
||||
import Announcement from './Announcement';
|
||||
import { outfitURL } from '../utils/UrlGenerators';
|
||||
|
||||
const SIZE_MIN = 0.65;
|
||||
@@ -53,12 +56,11 @@ function selectAll(e) {
|
||||
* Coriolis App Header section / menus
|
||||
*/
|
||||
export default class Header extends TranslatedComponent {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
this.shipOrder = Object.keys(Ships).sort();
|
||||
@@ -74,8 +76,11 @@ export default class Header extends TranslatedComponent {
|
||||
this._openShips = this._openMenu.bind(this, 's');
|
||||
this._openBuilds = this._openMenu.bind(this, 'b');
|
||||
this._openComp = this._openMenu.bind(this, 'comp');
|
||||
this._openAnnounce = this._openMenu.bind(this, 'announce');
|
||||
this._getAnnouncementsMenu = this._getAnnouncementsMenu.bind(this);
|
||||
this._openSettings = this._openMenu.bind(this, 'settings');
|
||||
this._showHelp = this._showHelp.bind(this);
|
||||
this.update = this.update.bind(this);
|
||||
this.languageOptions = [];
|
||||
this.insuranceOptions = [];
|
||||
this.state = {
|
||||
@@ -235,6 +240,43 @@ export default class Header extends TranslatedComponent {
|
||||
/>);
|
||||
};
|
||||
|
||||
/**
|
||||
* Uploads all ship-builds to orbis
|
||||
* @param {e} e Event
|
||||
*/
|
||||
_uploadAllBuildsToOrbis(e) {
|
||||
e.preventDefault();
|
||||
const data = Persist.getBuilds();
|
||||
let postObject = [];
|
||||
for (const ship in data) {
|
||||
for (const code in data[ship]) {
|
||||
const shipModel = ship;
|
||||
if (!shipModel) {
|
||||
throw 'No such ship found: "' + ship + '"';
|
||||
}
|
||||
const shipTemplate = Ships[shipModel];
|
||||
const shipPostObject = {};
|
||||
let shipInstance = new Ship(shipModel, shipTemplate.properties, shipTemplate.slots);
|
||||
shipInstance.buildWith(null);
|
||||
shipInstance.buildFrom(data[ship][code]);
|
||||
shipPostObject.coriolisId = shipInstance.id;
|
||||
shipPostObject.coriolisShip = shipInstance;
|
||||
|
||||
shipPostObject.coriolisShip.url = window.location.origin + outfitURL(shipModel, data[ship][code], code);
|
||||
shipPostObject.title = code || shipInstance.id;
|
||||
shipPostObject.description = code || shipInstance.id;
|
||||
shipPostObject.ShipName = shipInstance.id;
|
||||
shipPostObject.Ship = shipInstance.id;
|
||||
postObject.push(shipPostObject);
|
||||
}
|
||||
}
|
||||
console.log(postObject);
|
||||
|
||||
this.context.showModal(<ModalBatchOrbis
|
||||
ships={postObject}
|
||||
/>);
|
||||
}
|
||||
|
||||
/**
|
||||
* Show export modal with detailed export
|
||||
* @param {SyntheticEvent} e Event
|
||||
@@ -306,7 +348,7 @@ export default class Header extends TranslatedComponent {
|
||||
_getShipsMenu() {
|
||||
let shipList = [];
|
||||
|
||||
for (let s in Ships) {
|
||||
for (let s of this.shipOrder) {
|
||||
shipList.push(<ActiveLink key={s} href={outfitURL(s)} className='block'>{Ships[s].properties.name}</ActiveLink>);
|
||||
}
|
||||
|
||||
@@ -372,6 +414,29 @@ export default class Header extends TranslatedComponent {
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the announcement menu
|
||||
* @return {React.Component} Menu
|
||||
*/
|
||||
_getAnnouncementsMenu() {
|
||||
let announcements;
|
||||
let translate = this.context.language.translate;
|
||||
|
||||
if (this.props.announcements) {
|
||||
announcements = [];
|
||||
for (let announce of this.props.announcements) {
|
||||
announcements.push(<Announcement text={announce.message} />);
|
||||
announcements.push(<hr/>);
|
||||
}
|
||||
}
|
||||
return (
|
||||
<div className='menu-list' onClick={ (e) => e.stopPropagation() } style={{ whiteSpace: 'nowrap' }}>
|
||||
{announcements}
|
||||
<hr />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the settings menu
|
||||
* @return {React.Component} Menu
|
||||
@@ -430,6 +495,7 @@ export default class Header extends TranslatedComponent {
|
||||
{translate('builds')} & {translate('comparisons')}
|
||||
<li><Link href="#" className='block' onClick={this._showBackup.bind(this)}>{translate('backup')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDetailedExport.bind(this)}>{translate('detailed export')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._uploadAllBuildsToOrbis.bind(this)}>{translate('upload all builds to orbis')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showImport.bind(this)}>{translate('import')}</Link></li>
|
||||
<li><Link href="#" className='block' onClick={this._showDeleteAll.bind(this)}>{translate('delete all')}</Link></li>
|
||||
</ul>
|
||||
@@ -442,7 +508,7 @@ export default class Header extends TranslatedComponent {
|
||||
<td style={{ width: 20 }}><span style={{ fontSize: 30 }}>A</span></td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td>
|
||||
<td colSpan='3' style={{ textAlign: 'center', cursor: 'pointer' }} className='primary-disabled cap' onClick={this._resetTextSize.bind(this)}>{translate('reset')}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
@@ -494,6 +560,15 @@ export default class Header extends TranslatedComponent {
|
||||
}
|
||||
}
|
||||
|
||||
async update() {
|
||||
const reg = await navigator.serviceWorker.getRegistration();
|
||||
if (!reg || !reg.waiting) {
|
||||
return window.location.reload();
|
||||
}
|
||||
reg.waiting.postMessage('skipWaiting');
|
||||
window.location.reload();
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the header
|
||||
* @return {React.Component} Header
|
||||
@@ -504,7 +579,10 @@ export default class Header extends TranslatedComponent {
|
||||
let hasBuilds = Persist.hasBuilds();
|
||||
return (
|
||||
<header>
|
||||
{this.props.appCacheUpdate && <div id="app-update" onClick={() => window.location.reload() }>{translate('PHRASE_UPDATE_RDY')}</div>}
|
||||
{this.props.appCacheUpdate && <div id="app-update" onClick={this.update}>{translate('PHRASE_UPDATE_RDY')}</div>}
|
||||
{this.props.appCacheUpdate ? <a className={'view-changes'} href={'https://github.com/EDCD/coriolis/compare/edcd:develop@{' + window.CORIOLIS_DATE + '}...edcd:develop'} target="_blank">
|
||||
{'View Release Changes'}
|
||||
</a> : null}
|
||||
<Link className='l' href='/' style={{ marginRight: '1em' }} title='Home'><CoriolisLogo className='icon xl' /></Link>
|
||||
|
||||
<div className='l menu'>
|
||||
@@ -528,6 +606,23 @@ export default class Header extends TranslatedComponent {
|
||||
{openedMenu == 'comp' ? this._getComparisonsMenu() : null}
|
||||
</div>
|
||||
|
||||
<div className='l menu'>
|
||||
<div className={cn('menu-header', { selected: openedMenu == 'announce', disabled: this.props.announcements.length === 0 })} onClick={this.props.announcements.length !== 0 && this._openAnnounce}>
|
||||
<span className='menu-item-label'>{translate('announcements')}</span>
|
||||
</div>
|
||||
{openedMenu == 'announce' ? this._getAnnouncementsMenu() : null}
|
||||
</div>
|
||||
|
||||
{window.location.origin.search('.edcd.io') >= 0 ?
|
||||
<div className='l menu'>
|
||||
<a href="https://youtu.be/4SvnLcefhtI" target="_blank">
|
||||
<div className={cn('menu-header')}>
|
||||
<Rocket className='warning'/><span className='menu-item-label'>{translate('please migrate to coriolis.io')}</span>
|
||||
</div>
|
||||
</a>
|
||||
</div> : null
|
||||
}
|
||||
|
||||
<div className='r menu'>
|
||||
<div className={cn('menu-header', { selected: openedMenu == 'settings' })} onClick={this._openSettings}>
|
||||
<Cogs className='xl warning'/><span className='menu-item-label'>{translate('settings')}</span>
|
||||
@@ -543,5 +638,4 @@ export default class Header extends TranslatedComponent {
|
||||
</header>
|
||||
);
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,95 +0,0 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import Slot from './Slot';
|
||||
import Persist from '../stores/Persist';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
/**
|
||||
* Internal Slot
|
||||
*/
|
||||
export default class InternalSlot extends Slot {
|
||||
|
||||
/**
|
||||
* Generate the slot contents
|
||||
* @param {Object} m Mounted Module
|
||||
* @param {Boolean} enabled Slot enabled
|
||||
* @param {Function} translate Translate function
|
||||
* @param {Object} formats Localized Formats map
|
||||
* @param {Object} u Localized Units Map
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getSlotDetails(m, enabled, translate, formats, u) {
|
||||
if (m) {
|
||||
let classRating = m.class + m.rating;
|
||||
let { drag, drop, ship } = this.props;
|
||||
let { termtip, tooltip } = this.context;
|
||||
let validMods = (Modifications.modules[m.grp] ? Modifications.modules[m.grp].modifications : []);
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
let mass = m.getMass() || m.cargo || m.fuel || 0;
|
||||
|
||||
const className = cn('details', enabled ? '' : 'disabled');
|
||||
return <div className={className} draggable='true' onDragStart={drag} onDragEnd={drop}>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : ''}</div>
|
||||
<div className={'r'}>{formats.round(mass)}{u.T}</div>
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{ m.getOptMass() ? <div className={'l'}>{translate('optmass', 'sg')}: {formats.int(m.getOptMass())}{u.T}</div> : null }
|
||||
{ m.getMaxMass() ? <div className={'l'}>{translate('maxmass', 'sg')}: {formats.int(m.getMaxMass())}{u.T}</div> : null }
|
||||
{ m.bins ? <div className={'l'}>{m.bins} <u>{translate('bins')}</u></div> : null }
|
||||
{ m.bays ? <div className={'l'}>{translate('bays')}: {m.bays}</div> : null }
|
||||
{ m.rebuildsperbay ? <div className={'l'}>{translate('rebuildsperbay')}: {m.rebuildsperbay}</div> : null }
|
||||
{ m.rate ? <div className={'l'}>{translate('rate')}: {m.rate}{u.kgs} {translate('refuel time')}: {formats.time(this.props.fuel * 1000 / m.rate)}</div> : null }
|
||||
{ m.getAmmo() && m.grp !== 'scb' ? <div className={'l'}>{translate('ammunition')}: {formats.gen(m.getAmmo())}</div> : null }
|
||||
{ m.getSpinup() ? <div className={'l'}>{translate('spinup')}: {formats.f1(m.getSpinup())}{u.s}</div> : null }
|
||||
{ m.getDuration() ? <div className={'l'}>{translate('duration')}: {formats.f1(m.getDuration())}{u.s}</div> : null }
|
||||
{ m.grp === 'scb' ? <div className={'l'}>{translate('cells')}: {formats.int(m.getAmmo() + 1)}</div> : null }
|
||||
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('shieldreinforcement')}: {formats.f1(m.getDuration() * m.getShieldReinforcement())}{u.MJ}</div> : null }
|
||||
{ m.getShieldReinforcement() ? <div className={'l'}>{translate('total')}: {formats.int((m.getAmmo() + 1) * (m.getDuration() * m.getShieldReinforcement()))}{u.MJ}</div> : null }
|
||||
{ m.repair ? <div className={'l'}>{translate('repair')}: {m.repair}</div> : null }
|
||||
{ m.getFacingLimit() ? <div className={'l'}>{translate('facinglimit')} {formats.f1(m.getFacingLimit())}°</div> : null }
|
||||
{ m.getRange() ? <div className={'l'}>{translate('range')} {formats.f2(m.getRange())}{u.km}</div> : null }
|
||||
{ m.getRangeT() ? <div className={'l'}>{translate('ranget')} {formats.f1(m.getRangeT())}{u.s}</div> : null }
|
||||
{ m.getTime() ? <div className={'l'}>{translate('time')}: {formats.time(m.getTime())}</div> : null }
|
||||
{ m.getHackTime() ? <div className={'l'}>{translate('hacktime')}: {formats.time(m.getHackTime())}</div> : null }
|
||||
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
|
||||
{ m.rangeLS ? <div className={'l'}>{translate('range')}: {m.rangeLS}{u.Ls}</div> : null }
|
||||
{ m.rangeLS === null ? <div className={'l'}>∞{u.Ls}</div> : null }
|
||||
{ m.rangeRating ? <div className={'l'}>{translate('range')}: {m.rangeRating}</div> : null }
|
||||
{ m.maximum ? <div className={'l'}>{translate('max')}: {(m.maximum)}</div> : null }
|
||||
{ m.passengers ? <div className={'l'}>{translate('passengers')}: {m.passengers}</div> : null }
|
||||
{ m.getRegenerationRate() ? <div className='l'>{translate('regen')}: {formats.round1(m.getRegenerationRate())}{u.ps}</div> : null }
|
||||
{ m.getBrokenRegenerationRate() ? <div className='l'>{translate('brokenregen')}: {formats.round1(m.getBrokenRegenerationRate())}{u.ps}</div> : null }
|
||||
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
|
||||
{ m.getHullReinforcement() ? <div className='l'>{translate('armour')}: {formats.int(m.getHullReinforcement() + ship.baseArmour * m.getModValue('hullboost') / 10000)}</div> : null }
|
||||
{ m.getProtection() ? <div className='l'>{translate('protection')}: {formats.rPct(m.getProtection())}</div> : null }
|
||||
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
|
||||
{ m && validMods.length > 0 ? <div className='r' ><button onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
|
||||
</div>
|
||||
</div>;
|
||||
} else {
|
||||
return <div className={'empty'}>{translate('empty')}</div>;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,42 +1,30 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import SlotSection from './SlotSection';
|
||||
import InternalSlot from './InternalSlot';
|
||||
import Slot from './Slot';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { canMount } from '../utils/SlotFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Internal slot section
|
||||
*/
|
||||
export default class InternalSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'internal', 'optional internal');
|
||||
|
||||
this._empty = this._empty.bind(this);
|
||||
this._fillWithCargo = this._fillWithCargo.bind(this);
|
||||
this._fillWithCells = this._fillWithCells.bind(this);
|
||||
this._fillWithArmor = this._fillWithArmor.bind(this);
|
||||
this._fillWithModuleReinforcementPackages = this._fillWithModuleReinforcementPackages.bind(this);
|
||||
this._fillWithFuelTanks = this._fillWithFuelTanks.bind(this);
|
||||
this._fillWithLuxuryCabins = this._fillWithLuxuryCabins.bind(this);
|
||||
this._fillWithFirstClassCabins = this._fillWithFirstClassCabins.bind(this);
|
||||
this._fillWithBusinessClassCabins = this._fillWithBusinessClassCabins.bind(this);
|
||||
this._fillWithEconomyClassCabins = this._fillWithEconomyClassCabins.bind(this);
|
||||
constructor(props) {
|
||||
super(props, 'optional internal');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Empty all slots
|
||||
*/
|
||||
_empty() {
|
||||
this.props.ship.emptyInternal();
|
||||
this.props.onChange();
|
||||
// TODO:
|
||||
// this.props.ship.emptyInternal();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -52,7 +40,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -68,7 +55,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('ft', slot.maxClass, 'C'));
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -84,7 +70,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('pcq', Math.min(slot.maxClass, 6), 'B')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -100,7 +85,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('pcm', Math.min(slot.maxClass, 6), 'C')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -116,7 +100,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('pci', Math.min(slot.maxClass, 6), 'D')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -132,7 +115,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('pce', Math.min(slot.maxClass, 6), 'E')); // Passenger cabins top out at 6
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -151,7 +133,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
chargeCap += slot.m.recharge;
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -167,7 +148,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('hr', Math.min(slot.maxClass, 5), 'D')); // Hull reinforcements top out at 5D
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -183,7 +163,6 @@ export default class InternalSlotSection extends SlotSection {
|
||||
ship.use(slot, ModuleUtils.findInternal('mrp', Math.min(slot.maxClass, 5), 'D')); // Module reinforcements top out at 5D
|
||||
}
|
||||
});
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -200,31 +179,20 @@ export default class InternalSlotSection extends SlotSection {
|
||||
*/
|
||||
_getSlots() {
|
||||
let slots = [];
|
||||
let { currentMenu, ship } = this.props;
|
||||
let { currentMenu, ship, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let { internal, fuelCapacity } = ship;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = internal.length; i < l; i++) {
|
||||
let s = internal[i];
|
||||
|
||||
slots.push(<InternalSlot
|
||||
key={i}
|
||||
maxClass={s.maxClass}
|
||||
availableModules={() => availableModules.getInts(ship, s.maxClass, s.eligible)}
|
||||
onOpen={this._openMenu.bind(this,s)}
|
||||
onChange={this.props.onChange}
|
||||
onSelect={this._selectModule.bind(this, s)}
|
||||
selected={currentMenu == s}
|
||||
eligible={s.eligible}
|
||||
m={s.m}
|
||||
drag={this._drag.bind(this, s)}
|
||||
dragOver={this._dragOverSlot.bind(this, s)}
|
||||
for (const m of ship.getInternals(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={m.object.Slot}
|
||||
currentMenu={currentMenu}
|
||||
m={m}
|
||||
drag={this._drag.bind(this, m)}
|
||||
dragOver={this._dragOverSlot.bind(this, m)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(s, originSlot, targetSlot)}
|
||||
fuel={fuelCapacity}
|
||||
ship={ship}
|
||||
enabled={s.enabled ? true : false}
|
||||
dropClass={this._dropClass(m, originSlot, targetSlot)}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
|
||||
@@ -237,22 +205,23 @@ export default class InternalSlotSection extends SlotSection {
|
||||
* @param {Function} ship The ship
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate, ship) {
|
||||
_getSectionMenu() {
|
||||
const { ship } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
return <div className='select' onClick={e => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='lc' onClick={this._fillWithCargo}>{translate('cargo')}</li>
|
||||
<li className='lc' onClick={this._fillWithCells}>{translate('scb')}</li>
|
||||
<li className='lc' onClick={this._fillWithArmor}>{translate('hr')}</li>
|
||||
<li className='lc' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
|
||||
<li className='lc' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
|
||||
<li className='lc' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
|
||||
<li className='lc' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
|
||||
<li className='lc' onClick={this._fillWithFirstClassCabins}>{translate('pcm')}</li>
|
||||
{ ship.luxuryCabins ? <li className='lc' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
|
||||
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCargo}>{translate('cargo')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithCells}>{translate('scb')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithArmor}>{translate('hr')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithModuleReinforcementPackages}>{translate('mrp')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFuelTanks}>{translate('ft')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithEconomyClassCabins}>{translate('pce')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithBusinessClassCabins}>{translate('pci')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._fillWithFirstClassCabins} onKeyDown={ship.luxuryCabins ? '' : this._keyDown}>{translate('pcm')}</li>
|
||||
{ ship.luxuryCabins ? <li className='lc' tabIndex='0' onClick={this._fillWithLuxuryCabins}>{translate('pcq')}</li> : ''}
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,12 +1,8 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Module from '../shipyard/Module';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
|
||||
/**
|
||||
@@ -61,7 +57,7 @@ export default class JumpRange extends TranslatedComponent {
|
||||
const fuel = this.state.fuelLevel * ship.fuelCapacity;
|
||||
|
||||
// Obtain the jump range
|
||||
return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel);
|
||||
return Calc.jumpRange(ship.unladenMass + fuel + cargo, fsd, fuel, ship);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,8 +1,9 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import Measure from 'react-measure';
|
||||
import ContainerDimensions from 'react-container-dimensions';
|
||||
import * as d3 from 'd3';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
|
||||
|
||||
@@ -10,7 +11,6 @@ const MARGIN = { top: 15, right: 20, bottom: 35, left: 60 };
|
||||
* Line Chart
|
||||
*/
|
||||
export default class LineChart extends TranslatedComponent {
|
||||
|
||||
static defaultProps = {
|
||||
code: '',
|
||||
xMin: 0,
|
||||
@@ -45,13 +45,7 @@ export default class LineChart extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
this._updateSeries = this._updateSeries.bind(this);
|
||||
this._tooltip = this._tooltip.bind(this);
|
||||
this._showTip = this._showTip.bind(this);
|
||||
this._hideTip = this._hideTip.bind(this);
|
||||
this._moveTip = this._moveTip.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
const series = props.series;
|
||||
|
||||
@@ -67,21 +61,17 @@ export default class LineChart extends TranslatedComponent {
|
||||
xAxisScale,
|
||||
yScale,
|
||||
tipHeight: 2 + (1.2 * (series ? series.length : 0.8)),
|
||||
dimensions: {
|
||||
width: 100,
|
||||
height: 100
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update tooltip content
|
||||
* @param {number} xPos x coordinate
|
||||
* @param {number} width current container width
|
||||
*/
|
||||
_tooltip(xPos) {
|
||||
_tooltip(xPos, width) {
|
||||
let { xLabel, yLabel, xUnit, yUnit, func, series } = this.props;
|
||||
let { xScale, yScale } = this.state;
|
||||
let { width } = this.state.dimensions;
|
||||
let { formats, translate } = this.context.language;
|
||||
let x0 = xScale.invert(xPos),
|
||||
y0 = func(x0),
|
||||
@@ -120,11 +110,11 @@ export default class LineChart extends TranslatedComponent {
|
||||
* Update dimensions based on properties and scale
|
||||
* @param {Object} props React Component properties
|
||||
* @param {number} scale size ratio / scale
|
||||
* @param {number} width current width of the container
|
||||
* @returns {Object} calculated dimensions
|
||||
*/
|
||||
_updateDimensions(props, scale) {
|
||||
_updateDimensions(props, scale, width) {
|
||||
const { xMax, xMin, yMin, yMax } = props;
|
||||
const { width, height } = this.state.dimensions;
|
||||
const innerWidth = width - MARGIN.left - MARGIN.right;
|
||||
const outerHeight = Math.round(width * props.aspect);
|
||||
const innerHeight = outerHeight - MARGIN.top - MARGIN.bottom;
|
||||
@@ -149,10 +139,11 @@ export default class LineChart extends TranslatedComponent {
|
||||
/**
|
||||
* Move and update tooltip
|
||||
* @param {SyntheticEvent} e Event
|
||||
* @param {number} width current container width
|
||||
*/
|
||||
_moveTip(e) {
|
||||
_moveTip(e, width) {
|
||||
let clientX = e.touches ? e.touches[0].clientX : e.clientX;
|
||||
this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left));
|
||||
this._tooltip(Math.round(clientX - e.currentTarget.getBoundingClientRect().left), width);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -227,57 +218,58 @@ export default class LineChart extends TranslatedComponent {
|
||||
* @return {React.Component} Chart SVG
|
||||
*/
|
||||
render() {
|
||||
const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio);
|
||||
const { width, height } = this.state.dimensions;
|
||||
const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props;
|
||||
const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state;
|
||||
const line = this.line;
|
||||
const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse();
|
||||
|
||||
const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0;
|
||||
const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : '';
|
||||
|
||||
return (
|
||||
<Measure width='100%' whitelist={['width', 'top']} onMeasure={ (dimensions) => { this.setState({ dimensions }); }}>
|
||||
<div width={width} height={height}>
|
||||
<svg style={{ width: '100%', height: outerHeight }}>
|
||||
<g transform={`translate(${MARGIN.left},${MARGIN.top})`}>
|
||||
<g>{xmark}</g>
|
||||
<g>{lines}</g>
|
||||
<g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}>
|
||||
<text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}>
|
||||
<tspan>{xLabel}</tspan>
|
||||
<tspan className='metric'> ({xUnit})</tspan>
|
||||
</text>
|
||||
</g>
|
||||
<g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}>
|
||||
<text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}>
|
||||
<tspan>{yLabel}</tspan>
|
||||
{ yUnit && <tspan className='metric'> ({yUnit})</tspan> }
|
||||
</text>
|
||||
</g>
|
||||
<g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}>
|
||||
<rect className='tooltip' height={tipHeight + 'em'}></rect>
|
||||
{detailElems}
|
||||
</g>
|
||||
<g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}>
|
||||
{markerElems}
|
||||
</g>
|
||||
<rect
|
||||
fillOpacity='0'
|
||||
height={innerHeight}
|
||||
width={innerWidth + 1}
|
||||
onMouseEnter={this._showTip}
|
||||
onTouchStart={this._showTip}
|
||||
onMouseLeave={this._hideTip}
|
||||
onTouchEnd={this._hideTip}
|
||||
onMouseMove={this._moveTip}
|
||||
onTouchMove={this._moveTip}
|
||||
/>
|
||||
</g>
|
||||
</svg>
|
||||
</div>
|
||||
</Measure>
|
||||
<ContainerDimensions>
|
||||
{ ({ width, height }) => {
|
||||
const { innerWidth, outerHeight, innerHeight } = this._updateDimensions(this.props, this.context.sizeRatio, width, height);
|
||||
const { xMin, xMax, xLabel, yLabel, xUnit, yUnit, xMark, colors } = this.props;
|
||||
const { tipHeight, detailElems, markerElems, seriesData, seriesLines } = this.state;
|
||||
const lines = seriesLines.map((line, i) => <path key={i} className='line' fill='none' stroke={colors[i]} strokeWidth='1' d={line(seriesData)} />).reverse();
|
||||
|
||||
const markX = xMark ? innerWidth * (xMark - xMin) / (xMax - xMin) : 0;
|
||||
const xmark = xMark ? <path key={'mark'} className='line' fill='none' strokeDasharray='5,5' stroke={'#ff8c0d'} strokeWidth='1' d={'M ' + markX + ' ' + innerHeight + ' L ' + markX + ' 0'} /> : '';
|
||||
return (
|
||||
<div width={width} height={height}>
|
||||
<svg style={{ width: '100%', height: outerHeight }}>
|
||||
<g transform={`translate(${MARGIN.left},${MARGIN.top})`}>
|
||||
<g>{xmark}</g>
|
||||
<g>{lines}</g>
|
||||
<g className='x axis' ref={(elem) => d3.select(elem).call(this.xAxis)} transform={`translate(0,${innerHeight})`}>
|
||||
<text className='cap' y='30' dy='.1em' x={innerWidth / 2} style={{ textAnchor: 'middle' }}>
|
||||
<tspan>{xLabel}</tspan>
|
||||
<tspan className='metric'> ({xUnit})</tspan>
|
||||
</text>
|
||||
</g>
|
||||
<g className='y axis' ref={(elem) => d3.select(elem).call(this.yAxis)}>
|
||||
<text className='cap' transform='rotate(-90)' y='-50' dy='.1em' x={innerHeight / -2} style={{ textAnchor: 'middle' }}>
|
||||
<tspan>{yLabel}</tspan>
|
||||
{ yUnit && <tspan className='metric'> ({yUnit})</tspan> }
|
||||
</text>
|
||||
</g>
|
||||
<g ref={(g) => this.tipContainer = d3.select(g)} style={{ display: 'none' }}>
|
||||
<rect className='tooltip' height={tipHeight + 'em'}></rect>
|
||||
{detailElems}
|
||||
</g>
|
||||
<g ref={(g) => this.markersContainer = d3.select(g)} style={{ display: 'none' }}>
|
||||
{markerElems}
|
||||
</g>
|
||||
<rect
|
||||
fillOpacity='0'
|
||||
height={innerHeight}
|
||||
width={innerWidth + 1}
|
||||
onMouseEnter={this._showTip}
|
||||
onTouchStart={this._showTip}
|
||||
onMouseLeave={this._hideTip}
|
||||
onTouchEnd={this._hideTip}
|
||||
onMouseMove={e => this._moveTip(e, width)}
|
||||
onTouchMove={e => this._moveTip(e, width)}
|
||||
/>
|
||||
</g>
|
||||
</svg>
|
||||
</div>
|
||||
);
|
||||
}}
|
||||
</ContainerDimensions>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Link wrapper component
|
||||
*/
|
||||
export default class Link extends React.Component {
|
||||
|
||||
static propTypes = {
|
||||
children: PropTypes.any,
|
||||
href: PropTypes.string.isRequired,
|
||||
@@ -56,5 +55,4 @@ export default class Link extends React.Component {
|
||||
render() {
|
||||
return <a {...this.props} onClick={this.handler}>{this.props.children}</a>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
92
src/app/components/ModalBatchOrbis.jsx
Normal file
92
src/app/components/ModalBatchOrbis.jsx
Normal file
@@ -0,0 +1,92 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import request from 'superagent';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { orbisUpload } from '../utils/ShortenUrl';
|
||||
import Persist from '../stores/Persist';
|
||||
|
||||
/**
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalBatchOrbis extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ships: PropTypes.any.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
this.state = {
|
||||
orbisCreds: Persist.getOrbisCreds(),
|
||||
resp: ''
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Send ship to Orbis.zone
|
||||
* @param {SyntheticEvent} e React Event
|
||||
* @return {Promise} Promise sending post request to orbis
|
||||
*/
|
||||
sendToOrbis(e) {
|
||||
let agent;
|
||||
try {
|
||||
agent = request.agent(); // apparently this crashes somehow
|
||||
} catch (e) {
|
||||
console.error(e);
|
||||
}
|
||||
if (!agent) {
|
||||
agent = request;
|
||||
}
|
||||
const API_ORBIS = 'https://orbis.zone/api/builds/add/batch';
|
||||
return new Promise((resolve, reject) => {
|
||||
try {
|
||||
agent
|
||||
.post(API_ORBIS)
|
||||
.withCredentials()
|
||||
.redirects(0)
|
||||
.set('Content-Type', 'application/json')
|
||||
.send(this.props.ships)
|
||||
.end((err, response) => {
|
||||
console.log(response);
|
||||
if (err) {
|
||||
console.error(err);
|
||||
this.setState({ resp: response.text });
|
||||
reject('Bad Request');
|
||||
} else {
|
||||
this.setState({ resp: 'All builds uploaded. Check https://orbis.zone' });
|
||||
resolve('All builds uploaded. Check https://orbis.zone');
|
||||
}
|
||||
});
|
||||
} catch (e) {
|
||||
console.log(e);
|
||||
reject(e.message ? e.message : e);
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
this.sendToOrbis = this.sendToOrbis.bind(this);
|
||||
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h2>{translate('permalink')}</h2>
|
||||
<br/>
|
||||
<a className='button' href="https://orbis.zone/api/auth">Log in / signup to Orbis</a>
|
||||
<br/><br/>
|
||||
<h3 >{translate('success')}</h3>
|
||||
<input value={this.state.resp} readOnly size={25} onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<p>Orbis.zone is currently in a trial period, and may be wiped at any time as development progresses. Some elements are also still placeholders.</p>
|
||||
<button className={'l cb dismiss cap'} disabled={!!this.state.failed} onClick={this.sendToOrbis}>{translate('PHASE_UPLOAD_ORBIS')}</button>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
@@ -21,7 +21,6 @@ function buildComparator(a, b) {
|
||||
* Compare builds modal
|
||||
*/
|
||||
export default class ModalCompare extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
builds: PropTypes.array
|
||||
@@ -105,8 +104,8 @@ export default class ModalCompare extends TranslatedComponent {
|
||||
|
||||
let selectedBuilds = usedBuilds.map((build, i) =>
|
||||
<tr key={i} onClick={this._removeBuild.bind(this, i)}>
|
||||
<td className='tl'>{build.name}</td><
|
||||
td className='tl'>{build.buildName}</td>
|
||||
<td className='tl'>{build.name}</td>
|
||||
<td className='tl'>{build.buildName}</td>
|
||||
</tr>
|
||||
);
|
||||
|
||||
|
||||
@@ -6,7 +6,6 @@ import Persist from '../stores/Persist';
|
||||
* Delete All saved data modal
|
||||
*/
|
||||
export default class ModalDeleteAll extends TranslatedComponent {
|
||||
|
||||
/**
|
||||
* Delete everything and hide the modal
|
||||
*/
|
||||
|
||||
@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Export Modal
|
||||
*/
|
||||
export default class ModalExport extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
title: PropTypes.string,
|
||||
generator: PropTypes.func,
|
||||
|
||||
@@ -7,19 +7,10 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Help Modal
|
||||
*/
|
||||
export default class ModalHelp extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
title: PropTypes.string
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
|
||||
@@ -13,6 +13,8 @@ import { Download } from './SvgIcons';
|
||||
import { outfitURL } from '../utils/UrlGenerators';
|
||||
import * as CompanionApiUtils from '../utils/CompanionApiUtils';
|
||||
|
||||
const zlib = require('pako');
|
||||
|
||||
const textBuildRegex = new RegExp('^\\[([\\w \\-]+)\\]\n');
|
||||
const lineRegex = new RegExp('^([\\dA-Z]{1,2}): (\\d)([A-I])[/]?([FGT])?([SD])? ([\\w\\- ]+)');
|
||||
const mountMap = { 'H': 4, 'L': 3, 'M': 2, 'S': 1, 'U': 0 };
|
||||
@@ -83,8 +85,6 @@ function detailedJsonToBuild(detailedBuild) {
|
||||
* Import Modal
|
||||
*/
|
||||
export default class ModalImport extends TranslatedComponent {
|
||||
|
||||
|
||||
static propTypes = {
|
||||
builds: PropTypes.object, // Optional: Import object
|
||||
};
|
||||
@@ -99,6 +99,7 @@ export default class ModalImport extends TranslatedComponent {
|
||||
this.state = {
|
||||
builds: props.builds,
|
||||
canEdit: !props.builds,
|
||||
loadoutEvent: null,
|
||||
comparisons: null,
|
||||
shipDiscount: null,
|
||||
moduleDiscount: null,
|
||||
@@ -111,12 +112,28 @@ export default class ModalImport extends TranslatedComponent {
|
||||
this._process = this._process.bind(this);
|
||||
this._import = this._import.bind(this);
|
||||
this._importBackup = this._importBackup.bind(this);
|
||||
this._importLoadout = this._importLoadout.bind(this);
|
||||
this._importDetailedArray = this._importDetailedArray.bind(this);
|
||||
this._importTextBuild = this._importTextBuild.bind(this);
|
||||
this._importCompanionApiBuild = this._importCompanionApiBuild.bind(this);
|
||||
this._validateImport = this._validateImport.bind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a Loadout event from Elite: Dangerous journal files
|
||||
* @param {Object} data Loadout event
|
||||
* @throws {string} If import fails
|
||||
*/
|
||||
_importLoadout(data) {
|
||||
if (data && data.Ship && data.Modules) {
|
||||
const deflated = zlib.deflate(JSON.stringify(data), { to: 'string' });
|
||||
let compressed = btoa(deflated);
|
||||
this.setState({ loadoutEvent: compressed });
|
||||
} else {
|
||||
throw 'Loadout event must contain Ship and Modules';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Import a Coriolis backup
|
||||
* @param {Object} importData Backup Data
|
||||
@@ -126,7 +143,11 @@ export default class ModalImport extends TranslatedComponent {
|
||||
if (importData.builds && typeof importData.builds == 'object') {
|
||||
for (let shipId in importData.builds) {
|
||||
for (let buildName in importData.builds[shipId]) {
|
||||
validateBuild(shipId, importData.builds[shipId][buildName], buildName);
|
||||
try {
|
||||
validateBuild(shipId, importData.builds[shipId][buildName], buildName);
|
||||
} catch (err) {
|
||||
delete importData.builds[shipId][buildName];
|
||||
}
|
||||
}
|
||||
}
|
||||
this.setState({ builds: importData.builds });
|
||||
@@ -155,7 +176,7 @@ export default class ModalImport extends TranslatedComponent {
|
||||
}
|
||||
// Check for module discount
|
||||
if (!isNaN(importData.moduleDiscount)) {
|
||||
this.setState({ shipDiscount: importData.moduleDiscount * 1 });
|
||||
this.setState({ moduleDiscount: importData.moduleDiscount * 1 });
|
||||
}
|
||||
|
||||
if (typeof importData.insurance == 'string') {
|
||||
@@ -341,12 +362,14 @@ export default class ModalImport extends TranslatedComponent {
|
||||
} else if (importData.ship && typeof importData.name !== undefined) { // Using JSON from a single ship build export
|
||||
this._importDetailedArray([importData]); // Convert to array with singleobject
|
||||
this.setState({ singleBuild: true });
|
||||
} else if (importData.Modules != null && importData.Modules[0] != null) {
|
||||
this._importLoadout(importData);
|
||||
} else { // Using Backup JSON
|
||||
this._importBackup(importData);
|
||||
}
|
||||
}
|
||||
} catch (e) {
|
||||
// console.log(e.stack);
|
||||
console.log(e);
|
||||
this.setState({ errorMsg: (typeof e == 'string') ? e : 'Cannot Parse the data!' });
|
||||
return;
|
||||
}
|
||||
@@ -360,6 +383,10 @@ export default class ModalImport extends TranslatedComponent {
|
||||
_process() {
|
||||
let builds = null, comparisons = null;
|
||||
|
||||
if (this.state.loadoutEvent) {
|
||||
return Router.go(`/import?data=${this.state.loadoutEvent}`);
|
||||
}
|
||||
|
||||
// If only importing a single build go straight to the outfitting page
|
||||
if (this.state.singleBuild) {
|
||||
builds = this.state.builds;
|
||||
@@ -476,7 +503,7 @@ export default class ModalImport extends TranslatedComponent {
|
||||
if (!state.processed) {
|
||||
importStage = (
|
||||
<div>
|
||||
<textarea className='cb json' ref={node => this.importField = node} onChange={this._validateImport} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
|
||||
<textarea spellCheck={false} className='cb json' ref={node => this.importField = node} onChange={this._validateImport} defaultValue={this.state.importString} placeholder={translate('PHRASE_IMPORT')} />
|
||||
<button id='proceed' className='l cap' onClick={this._process} disabled={!state.importValid} >{translate('proceed')}</button>
|
||||
<div className='l warning' style={{ marginLeft:'3em' }}>{state.errorMsg}</div>
|
||||
</div>
|
||||
@@ -513,7 +540,7 @@ export default class ModalImport extends TranslatedComponent {
|
||||
{comparisonRows}
|
||||
</tbody>
|
||||
</table>
|
||||
);
|
||||
);
|
||||
}
|
||||
|
||||
if(this.state.canEdit) {
|
||||
|
||||
140
src/app/components/ModalOrbis.jsx
Normal file
140
src/app/components/ModalOrbis.jsx
Normal file
@@ -0,0 +1,140 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { orbisUpload } from '../utils/ShortenUrl';
|
||||
import Persist from '../stores/Persist';
|
||||
|
||||
/**
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalOrbis extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.any.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
this.state = {
|
||||
orbisCreds: Persist.getOrbisCreds(),
|
||||
orbisUrl: '...',
|
||||
ship: this.props.ship,
|
||||
authenticatedStatus: 'Checking...'
|
||||
};
|
||||
this.orbisCategory = this.orbisCategory.bind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Send ship to Orbis.zone
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
sendToOrbis(e) {
|
||||
const target = e.target;
|
||||
target.disabled = true;
|
||||
this.setState({ orbisUrl: 'Sending...' }, () => {
|
||||
orbisUpload(this.props.ship, this.state.orbisCreds)
|
||||
.then(orbisUrl => {
|
||||
target.disabled = false;
|
||||
this.setState({ orbisUrl });
|
||||
})
|
||||
.catch(err => {
|
||||
target.disabled = false;
|
||||
this.setState({ orbisUrl: 'Error - ' + err });
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Get Orbis.zone auth status
|
||||
* @returns {Object} auth status
|
||||
*/
|
||||
getOrbisAuthStatus() {
|
||||
return fetch('https://orbis.zone/api/checkauth', {
|
||||
credentials: 'include',
|
||||
mode: 'cors'
|
||||
})
|
||||
.then(data => data.json())
|
||||
.then(res => {
|
||||
this.setState({ authenticatedStatus: res.status || res.error });
|
||||
})
|
||||
.catch(err => {
|
||||
console.error(err);
|
||||
this.setState({ authenticatedStatus: err.message });
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing cmdr name
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
orbisPasswordHandler(e) {
|
||||
let password = e.target.value;
|
||||
this.setState({ orbisCreds: { email: this.state.orbisCreds.email, password } }, () => {
|
||||
Persist.setOrbisCreds(this.state.orbisCreds);
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing cmdr name
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
orbisUsername(e) {
|
||||
let orbisUsername = e.target.value;
|
||||
this.setState({ orbisCreds: { email: orbisUsername, password: this.state.orbisCreds.password } }, () => {
|
||||
Persist.setOrbisCreds(this.state.orbisCreds);
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing category
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
orbisCategory(e) {
|
||||
let ship = this.state.ship;
|
||||
let cat = e.target.value;
|
||||
ship.category = cat;
|
||||
this.setState({ ship });
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
this.orbisPasswordHandler = this.orbisPasswordHandler.bind(this);
|
||||
this.orbisUsername = this.orbisUsername.bind(this);
|
||||
this.sendToOrbis = this.sendToOrbis.bind(this);
|
||||
this.getOrbisAuthStatus();
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h2>{translate('upload to orbis')}</h2>
|
||||
<br/>
|
||||
<label>Orbis auth status: </label>
|
||||
<input value={this.state.authenticatedStatus} readOnly size={25} onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<a className='button' href="https://orbis.zone/api/auth">Log in / signup to Orbis</a>
|
||||
<br/><br/>
|
||||
<h3>Category</h3>
|
||||
<select onChange={this.orbisCategory}>
|
||||
<option value="">No Category</option>
|
||||
<option>Combat</option>
|
||||
<option>Mining</option>
|
||||
<option>Trading</option>
|
||||
<option>Exploration</option>
|
||||
<option>Passenger Liner</option>
|
||||
<option>PvP</option>
|
||||
</select>
|
||||
<br/><br/>
|
||||
<h3 >{translate('Orbis link')}</h3>
|
||||
<input value={this.state.orbisUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<p>Orbis.zone is currently in a trial period, and may be wiped at any time as development progresses. Some elements are also still placeholders.</p>
|
||||
<button className={'l cb dismiss cap'} disabled={!!this.state.failed} onClick={this.sendToOrbis}>{translate('PHASE_UPLOAD_ORBIS')}</button>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
@@ -7,7 +7,6 @@ import ShortenUrl from '../utils/ShortenUrl';
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalPermalink extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
url: PropTypes.string.isRequired
|
||||
};
|
||||
@@ -50,6 +49,7 @@ export default class ModalPermalink extends TranslatedComponent {
|
||||
<h3 >{translate('shortened')}</h3>
|
||||
<input value={this.state.shortenedUrl} readOnly size={25} onFocus={ (e) => e.target.select() }/>
|
||||
<br/><br/>
|
||||
<p>s.orbis.zone is the new URL shortener domain, old eddp.co urls are considered end of life and could go down at any moment. Sorry for any inconvenience.</p>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
|
||||
262
src/app/components/ModalShoppingList.jsx
Normal file
262
src/app/components/ModalShoppingList.jsx
Normal file
@@ -0,0 +1,262 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import request from 'superagent';
|
||||
import Persist from '../stores/Persist';
|
||||
|
||||
/**
|
||||
* Permalink modal
|
||||
*/
|
||||
export default class ModalShoppingList extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.state = {
|
||||
matsList: '',
|
||||
mats: {},
|
||||
failed: false,
|
||||
cmdrName: Persist.getCmdr().selected,
|
||||
cmdrs: Persist.getCmdr().cmdrs,
|
||||
matsPerGrade: Persist.getRolls(),
|
||||
blueprints: []
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* React component did mount
|
||||
*/
|
||||
componentDidMount() {
|
||||
this.renderMats();
|
||||
if (this.checkBrowserIsCompatible()) {
|
||||
this.getCommanders();
|
||||
this.registerBPs();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Find all blueprints needed to make a build.
|
||||
*/
|
||||
registerBPs() {
|
||||
const ship = this.props.ship;
|
||||
let blueprints = [];
|
||||
for (const module of ship.costList) {
|
||||
if (module.type === 'SHIP') {
|
||||
continue;
|
||||
}
|
||||
if (module.m && module.m.blueprint) {
|
||||
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
|
||||
continue;
|
||||
}
|
||||
if (module.m.blueprint.special) {
|
||||
console.log(module.m.blueprint.special);
|
||||
blueprints.push({ uuid: module.m.blueprint.special.uuid, number: 1 });
|
||||
}
|
||||
for (const g in module.m.blueprint.grades) {
|
||||
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
|
||||
continue;
|
||||
}
|
||||
if (g > module.m.blueprint.grade) {
|
||||
continue;
|
||||
}
|
||||
blueprints.push({ uuid: module.m.blueprint.grades[g].uuid, number: this.state.matsPerGrade[g] });
|
||||
}
|
||||
}
|
||||
}
|
||||
this.setState({ blueprints });
|
||||
}
|
||||
|
||||
/**
|
||||
* Check browser isn't firefox.
|
||||
* @return {boolean} true if compatible, false if not.
|
||||
*/
|
||||
checkBrowserIsCompatible() {
|
||||
// Firefox 1.0+
|
||||
return typeof InstallTrigger === 'undefined';
|
||||
}
|
||||
|
||||
/**
|
||||
* Get a list of commanders from EDEngineer.
|
||||
*/
|
||||
getCommanders() {
|
||||
request
|
||||
.get('http://localhost:44405/commanders')
|
||||
.end((err, res) => {
|
||||
if (err) {
|
||||
console.log(err);
|
||||
return this.setState({ failed: true });
|
||||
}
|
||||
const cmdrs = JSON.parse(res.text);
|
||||
if (!this.state.cmdrName) {
|
||||
this.setState({ cmdrName: cmdrs[0] });
|
||||
}
|
||||
this.setState({ cmdrs }, () => {
|
||||
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs });
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Send all blueprints to ED Engineer
|
||||
* @param {Event} event React event
|
||||
*/
|
||||
sendToEDEng(event) {
|
||||
event.preventDefault();
|
||||
let translate = this.context.language.translate;
|
||||
const target = event.target;
|
||||
target.disabled = this.state.blueprints.length > 0;
|
||||
if (this.state.blueprints.length === 0) {
|
||||
target.innerText = translate('No modded components.');
|
||||
target.disabled = true;
|
||||
setTimeout(() => {
|
||||
target.innerText = translate('Send to EDEngineer');
|
||||
target.disabled = false;
|
||||
}, 3000);
|
||||
} else {
|
||||
target.innerText = translate('Sending...');
|
||||
}
|
||||
let countSent = 0;
|
||||
let countTotal = this.state.blueprints.length;
|
||||
|
||||
for (const i of this.state.blueprints) {
|
||||
request
|
||||
.patch(`http://localhost:44405/${this.state.cmdrName}/shopping-list`)
|
||||
.field('uuid', i.uuid)
|
||||
.field('size', i.number)
|
||||
.end(err => {
|
||||
if (err) {
|
||||
console.log(err);
|
||||
if (err.message !== 'Bad Request') {
|
||||
this.setState({ failed: true });
|
||||
}
|
||||
}
|
||||
countSent++;
|
||||
if (countSent === countTotal) {
|
||||
target.disabled = false;
|
||||
target.innerText = translate('Send to EDEngineer');
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Convert mats object to string
|
||||
*/
|
||||
renderMats() {
|
||||
const ship = this.props.ship;
|
||||
let mats = {};
|
||||
for (const module of ship.costList) {
|
||||
if (module.type === 'SHIP') {
|
||||
continue;
|
||||
}
|
||||
if (module.m && module.m.blueprint) {
|
||||
if (!module.m.blueprint.grade || !module.m.blueprint.grades) {
|
||||
continue;
|
||||
}
|
||||
for (const g in module.m.blueprint.grades) {
|
||||
if (!module.m.blueprint.grades.hasOwnProperty(g)) {
|
||||
continue;
|
||||
}
|
||||
if (g > module.m.blueprint.grade) {
|
||||
continue;
|
||||
}
|
||||
for (const i in module.m.blueprint.grades[g].components) {
|
||||
if (!module.m.blueprint.grades[g].components.hasOwnProperty(i)) {
|
||||
continue;
|
||||
}
|
||||
if (mats[i]) {
|
||||
mats[i] += module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
|
||||
} else {
|
||||
mats[i] = module.m.blueprint.grades[g].components[i] * this.state.matsPerGrade[g];
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
let matsString = '';
|
||||
for (const i in mats) {
|
||||
if (!mats.hasOwnProperty(i)) {
|
||||
continue;
|
||||
}
|
||||
if (mats[i] === 0) {
|
||||
delete mats[i];
|
||||
continue;
|
||||
}
|
||||
matsString += `${i}: ${mats[i]}\n`;
|
||||
}
|
||||
this.setState({ matsList: matsString, mats });
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing roll amounts
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
changeHandler(e) {
|
||||
let grade = e.target.id;
|
||||
let newState = this.state.matsPerGrade;
|
||||
newState[grade] = parseInt(e.target.value);
|
||||
this.setState({ matsPerGrade: newState });
|
||||
Persist.setRolls(newState);
|
||||
this.renderMats();
|
||||
this.registerBPs();
|
||||
}
|
||||
|
||||
/**
|
||||
* Handler for changing cmdr name
|
||||
* @param {SyntheticEvent} e React Event
|
||||
*/
|
||||
cmdrChangeHandler(e) {
|
||||
let cmdrName = e.target.value;
|
||||
this.setState({ cmdrName }, () => {
|
||||
Persist.setCmdr({ selected: this.state.cmdrName, cmdrs: this.state.cmdrs });
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modal
|
||||
* @return {React.Component} Modal Content
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
this.changeHandler = this.changeHandler.bind(this);
|
||||
const compatible = this.checkBrowserIsCompatible();
|
||||
this.cmdrChangeHandler = this.cmdrChangeHandler.bind(this);
|
||||
this.sendToEDEng = this.sendToEDEng.bind(this);
|
||||
return <div className='modal' onClick={ (e) => e.stopPropagation() }>
|
||||
<h2>{translate('PHRASE_SHOPPING_MATS')}</h2>
|
||||
<label>{translate('Grade 1 rolls ')}</label>
|
||||
<input id={1} type={'number'} min={0} defaultValue={this.state.matsPerGrade[1]} onChange={this.changeHandler} />
|
||||
<br/>
|
||||
<label>{translate('Grade 2 rolls ')}</label>
|
||||
<input id={2} type={'number'} min={0} defaultValue={this.state.matsPerGrade[2]} onChange={this.changeHandler} />
|
||||
<br/>
|
||||
<label>{translate('Grade 3 rolls ')}</label>
|
||||
<input id={3} type={'number'} min={0} value={this.state.matsPerGrade[3]} onChange={this.changeHandler} />
|
||||
<br/>
|
||||
<label>{translate('Grade 4 rolls ')}</label>
|
||||
<input id={4} type={'number'} min={0} value={this.state.matsPerGrade[4]} onChange={this.changeHandler} />
|
||||
<br/>
|
||||
<label>{translate('Grade 5 rolls ')}</label>
|
||||
<input id={5} type={'number'} min={0} value={this.state.matsPerGrade[5]} onChange={this.changeHandler} />
|
||||
<div>
|
||||
<textarea className='cb json' readOnly value={this.state.matsList} />
|
||||
</div>
|
||||
<label hidden={!compatible} className={'l cap'}>{translate('CMDR Name')}</label>
|
||||
<br/>
|
||||
<select hidden={!compatible} className={'cmdr-select l cap'} onChange={this.cmdrChangeHandler} defaultValue={this.state.cmdrName}>
|
||||
{this.state.cmdrs.map(e => <option key={e}>{e}</option>)}
|
||||
</select>
|
||||
<br/>
|
||||
<p hidden={!this.state.failed} id={'failed'} className={'l'}>{translate('PHRASE_FAIL_EDENGINEER')}</p>
|
||||
<p hidden={compatible} id={'browserbad'} className={'l'}>{translate('PHRASE_FIREFOX_EDENGINEER')}</p>
|
||||
<button className={'l cb dismiss cap'} disabled={!!this.state.failed || !compatible} onClick={this.sendToEDEng}>{translate('Send to EDEngineer')}</button>
|
||||
<button className={'r dismiss cap'} onClick={this.context.hideModal}>{translate('close')}</button>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
@@ -3,63 +3,52 @@ import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import NumberEditor from 'react-number-editor';
|
||||
import { Module } from 'ed-forge';
|
||||
|
||||
/**
|
||||
* Modification
|
||||
*/
|
||||
export default class Modification extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
m: PropTypes.object.isRequired,
|
||||
name: PropTypes.string.isRequired,
|
||||
value: PropTypes.number.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
highlight: PropTypes.bool,
|
||||
m: PropTypes.instanceOf(Module).isRequired,
|
||||
property: PropTypes.string.isRequired,
|
||||
onSet: PropTypes.func.isRequired,
|
||||
showProp: PropTypes.object,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this.state = {};
|
||||
this.state.value = props.value;
|
||||
const { m, property, showProp } = props;
|
||||
const { beneficial, unit, value } = m.getFormatted(property, true);
|
||||
this.state = { beneficial, unit, value, showProp };
|
||||
}
|
||||
|
||||
/**
|
||||
* Update modification given a value.
|
||||
* @param {Number} value The value to set. This comes in as a string and must be stored in state as a string,
|
||||
* because it needs to allow illegal 'numbers' ('-', '1.', etc) when the user is typing
|
||||
* in a value by hand
|
||||
*/
|
||||
_updateValue(value) {
|
||||
const name = this.props.name;
|
||||
|
||||
let scaledValue = Math.round(Number(value) * 100);
|
||||
// Limit to +1000% / -99.99%
|
||||
if (scaledValue > 100000) {
|
||||
scaledValue = 100000;
|
||||
value = 1000;
|
||||
}
|
||||
if (scaledValue < -9999) {
|
||||
scaledValue = -9999;
|
||||
value = -99.99;
|
||||
}
|
||||
|
||||
let m = this.props.m;
|
||||
let ship = this.props.ship;
|
||||
ship.setModification(m, name, scaledValue, true);
|
||||
|
||||
this.setState({ value });
|
||||
}
|
||||
|
||||
/**
|
||||
* Triggered when an update to slider value is finished i.e. when losing focus
|
||||
* Notify listeners that a new value has been entered and commited.
|
||||
*/
|
||||
_updateFinished() {
|
||||
this.props.onChange();
|
||||
const { onSet, m, property } = this.props;
|
||||
const { inputValue } = this.state;
|
||||
const numValue = Number(inputValue);
|
||||
if (!isNaN(numValue) && this.state.value !== numValue) {
|
||||
onSet(property, numValue);
|
||||
const { beneficial, unit, value } = m.getFormatted(property, true);
|
||||
this.setState({ beneficial, unit, value });
|
||||
}
|
||||
}
|
||||
|
||||
_toggleProperty() {
|
||||
const { onPropToggle, property } = this.props;
|
||||
const showProp = !this.state.showProp;
|
||||
// TODO: defer until menu closed
|
||||
onPropToggle(property, showProp);
|
||||
this.setState({ showProp });
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -67,29 +56,53 @@ export default class Modification extends TranslatedComponent {
|
||||
* @return {React.Component} modification
|
||||
*/
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
let { m, name } = this.props;
|
||||
const { formats } = this.context.language;
|
||||
const { highlight, m, property } = this.props;
|
||||
const { beneficial, unit, value, inputValue, showProp } = this.state;
|
||||
|
||||
if (name === 'damagedist') {
|
||||
// We don't show damage distribution
|
||||
// Some features only apply to specific modules; these features will be
|
||||
// undefined on items that do not belong to the same class. Filter these
|
||||
// features here
|
||||
if (value === undefined) {
|
||||
return null;
|
||||
}
|
||||
|
||||
let symbol;
|
||||
if (name === 'jitter') {
|
||||
symbol = '°';
|
||||
} else if (name !== 'burst' && name != 'burstrof') {
|
||||
symbol = '%';
|
||||
}
|
||||
if (symbol) {
|
||||
symbol = ' (' + symbol + ')';
|
||||
}
|
||||
|
||||
const { value: modifierValue, unit: modifierUnit } = m.getModifierFormatted(property);
|
||||
return (
|
||||
<div onBlur={this._updateFinished.bind(this)} className={'cb'} key={name}>
|
||||
<div className={'cb'}>{translate(name, m.grp)}{symbol}</div>
|
||||
<NumberEditor className={'cb'} style={{ width: '90%', textAlign: 'center' }} step={0.01} stepModifier={1} decimals={2} value={this.state.value} onValueChange={this._updateValue.bind(this)} />
|
||||
</div>
|
||||
<tr>
|
||||
<td>
|
||||
<span>
|
||||
<input type="checkbox" checked={showProp} onClick={() => this._toggleProperty()}/>
|
||||
</span>
|
||||
</td>
|
||||
<td className="input-container">
|
||||
<span>
|
||||
<NumberEditor value={inputValue || value} stepModifier={1}
|
||||
decimals={2} step={0.01} style={{ textAlign: 'right', width: '100%' }}
|
||||
className={cn('cb', { 'greyed-out': !highlight })}
|
||||
onKeyDown={(event) => {
|
||||
if (event.key == 'Enter') {
|
||||
this._updateFinished();
|
||||
event.stopPropagation();
|
||||
}
|
||||
}}
|
||||
onValueChange={(inputValue) => {
|
||||
if (inputValue.length <= 15) {
|
||||
this.setState({ inputValue });
|
||||
}
|
||||
}} />
|
||||
</span>
|
||||
</td>
|
||||
<td style={{ textAlign: 'left' }}>
|
||||
<span className="unit-container">{unit}</span>
|
||||
</td>
|
||||
<td style={{ textAlign: 'center' }}
|
||||
className={cn({
|
||||
secondary: beneficial,
|
||||
warning: beneficial === false,
|
||||
})}
|
||||
>{formats.f2(modifierValue)}{modifierUnit || ''}</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,30 +1,27 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import * as _ from 'lodash';
|
||||
import { chain, flatMap, keys } from 'lodash';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { isEmpty, stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import cn from 'classnames';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import Modification from './Modification';
|
||||
import {
|
||||
getBlueprint,
|
||||
blueprintTooltip,
|
||||
setPercent,
|
||||
getPercent,
|
||||
setRandom,
|
||||
specialToolTip
|
||||
} from '../utils/BlueprintFunctions'
|
||||
} from '../utils/BlueprintFunctions';
|
||||
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
|
||||
import { getModuleInfo } from 'ed-forge/lib/data/items';
|
||||
import { SHOW } from '../shipyard/StatsMapping';
|
||||
|
||||
/**
|
||||
* Modifications menu
|
||||
*/
|
||||
export default class ModificationsMenu extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
className: PropTypes.string,
|
||||
m: PropTypes.object.isRequired,
|
||||
marker: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -37,50 +34,57 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
|
||||
this._toggleBlueprintsMenu = this._toggleBlueprintsMenu.bind(this);
|
||||
this._toggleSpecialsMenu = this._toggleSpecialsMenu.bind(this);
|
||||
this._rollFifty = this._rollFifty.bind(this);
|
||||
this._rollRandom = this._rollRandom.bind(this);
|
||||
this._rollBest = this._rollBest.bind(this);
|
||||
this._rollWorst = this._rollWorst.bind(this);
|
||||
this._reset = this._reset.bind(this);
|
||||
this.selectedModRef = null;
|
||||
this.selectedSpecialRef = null;
|
||||
|
||||
const { m } = props;
|
||||
this.state = {
|
||||
blueprintMenuOpened: !(props.m.blueprint && props.m.blueprint.name),
|
||||
blueprintProgress: m.getBlueprintProgress(),
|
||||
blueprintMenuOpened: !m.getBlueprint(),
|
||||
specialMenuOpened: false
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the blueprints
|
||||
* @param {Object} props React component properties
|
||||
* @param {Object} context React component context
|
||||
* @return {Object} list: Array of React Components
|
||||
*/
|
||||
_renderBlueprints(props, context) {
|
||||
const { m } = props;
|
||||
const { language, tooltip, termtip } = context;
|
||||
const translate = language.translate;
|
||||
_renderBlueprints() {
|
||||
const { m } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { translate } = language;
|
||||
|
||||
const blueprints = [];
|
||||
for (const blueprintName in Modifications.modules[m.grp].blueprints) {
|
||||
const blueprint = getBlueprint(blueprintName, m);
|
||||
let blueprintGrades = [];
|
||||
for (let grade in Modifications.modules[m.grp].blueprints[blueprintName].grades) {
|
||||
const blueprints = m.getApplicableBlueprints().map(blueprint => {
|
||||
const info = getBlueprintInfo(blueprint);
|
||||
let blueprintGrades = keys(info.features).map(grade => {
|
||||
// Grade is a string in the JSON so make it a number
|
||||
grade = Number(grade);
|
||||
const classes = cn('c', {
|
||||
active: m.blueprint && blueprint.id === m.blueprint.id && grade === m.blueprint.grade
|
||||
});
|
||||
const close = this._blueprintSelected.bind(this, blueprintName, grade);
|
||||
const key = blueprintName + ':' + grade;
|
||||
const tooltipContent = blueprintTooltip(translate, blueprint.grades[grade], Modifications.modules[m.grp].blueprints[blueprintName].grades[grade].engineers, m.grp);
|
||||
blueprintGrades.unshift(<li key={key} className={classes} style={{ width: '2em' }} onMouseOver={termtip.bind(null, tooltipContent)} onMouseOut={tooltip.bind(null, null)} onClick={close}>{grade}</li>);
|
||||
}
|
||||
if (blueprintGrades) {
|
||||
blueprints.push(<div key={blueprint.name} className={'select-group cap'}>{translate(blueprint.name)}</div>);
|
||||
blueprints.push(<ul key={blueprintName}>{blueprintGrades}</ul>);
|
||||
}
|
||||
}
|
||||
return blueprints;
|
||||
const active = m.getBlueprint() === blueprint && m.getBlueprintGrade() === grade;
|
||||
const key = blueprint + ':' + grade;
|
||||
return <li key={key} data-id={key} className={cn('c', { active })}
|
||||
style={{ width: '2em' }}
|
||||
onMouseOver={termtip.bind(null, blueprintTooltip(language, m, blueprint, grade))}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
onClick={() => {
|
||||
m.setBlueprint(blueprint, grade, 1);
|
||||
this.setState({
|
||||
blueprintMenuOpened: false,
|
||||
specialMenuOpened: true,
|
||||
});
|
||||
}}
|
||||
ref={active ? (ref) => { this.selectedModRef = ref; } : undefined}
|
||||
>{grade}</li>;
|
||||
});
|
||||
|
||||
return [
|
||||
<div key={'div' + blueprint} className={'select-group cap'}>
|
||||
{translate(blueprint)}
|
||||
</div>,
|
||||
<ul key={'ul' + blueprint}>{blueprintGrades}</ul>
|
||||
];
|
||||
});
|
||||
|
||||
return flatMap(blueprints);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -89,155 +93,133 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
* @param {Object} context React component context
|
||||
* @return {Object} list: Array of React Components
|
||||
*/
|
||||
_renderSpecials(props, context) {
|
||||
const { m } = props;
|
||||
const { language, tooltip, termtip } = context;
|
||||
_renderSpecials() {
|
||||
const { m } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const translate = language.translate;
|
||||
const specials = [];
|
||||
const specialsId = m.missile && Modifications.modules[m.grp]['specials_' + m.missile] ? 'specials_' + m.missile : 'specials';
|
||||
if (Modifications.modules[m.grp][specialsId] && Modifications.modules[m.grp][specialsId].length > 0) {
|
||||
const close = this._specialSelected.bind(this, null);
|
||||
specials.push(<div style={{ cursor: 'pointer', fontWeight: 'bold' }} className={ 'button-inline-menu warning' } key={ 'none' } onClick={ close }>{translate('PHRASE_NO_SPECIAL')}</div>);
|
||||
for (const specialName of Modifications.modules[m.grp][specialsId]) {
|
||||
if (Modifications.specials[specialName].name.search('Legacy') >= 0) {
|
||||
continue;
|
||||
}
|
||||
const classes = cn('button-inline-menu', {
|
||||
active: m.blueprint && m.blueprint.special && m.blueprint.special.edname == specialName
|
||||
});
|
||||
const close = this._specialSelected.bind(this, specialName);
|
||||
if (m.blueprint && m.blueprint.name) {
|
||||
let tmp = {};
|
||||
if (m.blueprint.special) {
|
||||
tmp = m.blueprint.special;
|
||||
} else {
|
||||
tmp = undefined;
|
||||
}
|
||||
m.blueprint.special = Modifications.specials[specialName];
|
||||
let specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, specialName);
|
||||
m.blueprint.special = tmp;
|
||||
specials.push(<div style={{ cursor: 'pointer' }} className={classes} key={ specialName } onMouseOver={termtip.bind(null, specialTt)} onMouseOut={tooltip.bind(null, null)} onClick={ close }>{translate(Modifications.specials[specialName].name)}</div>);
|
||||
} else {
|
||||
specials.push(<div style={{ cursor: 'pointer' }} className={classes} key={ specialName } onClick={ close }>{translate(Modifications.specials[specialName].name)}</div>);
|
||||
}
|
||||
}
|
||||
|
||||
const applied = m.getExperimental();
|
||||
const experimentals = [];
|
||||
for (const experimental of m.getApplicableExperimentals()) {
|
||||
const active = experimental === applied;
|
||||
let specialTt = specialToolTip(language, m, experimental);
|
||||
experimentals.push(
|
||||
<div key={experimental} data-id={experimental}
|
||||
style={{ cursor: 'pointer' }}
|
||||
className={cn('button-inline-menu', { active })}
|
||||
onClick={this._specialSelected(experimental)}
|
||||
ref={active ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
|
||||
onMouseOver={termtip.bind(null, specialTt)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate(experimental)}</div>
|
||||
);
|
||||
}
|
||||
return specials;
|
||||
|
||||
if (experimentals.length) {
|
||||
experimentals.unshift(
|
||||
<div style={{ cursor: 'pointer', fontWeight: 'bold' }}
|
||||
className="button-inline-menu warning" key="none" data-id="none"
|
||||
// Setting the special effect to undefined clears it
|
||||
onClick={this._specialSelected(undefined)}
|
||||
ref={!applied ? (ref) => { this.selectedSpecialRef = ref; } : undefined}
|
||||
>{translate('PHRASE_NO_SPECIAL')}</div>
|
||||
);
|
||||
}
|
||||
|
||||
return experimentals;
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a modification component
|
||||
*/
|
||||
_mkModification(property, highlight) {
|
||||
const { translate } = this.context.language;
|
||||
const { m, propsToShow, onPropToggle } = this.props;
|
||||
|
||||
let onSet = m.set.bind(m);
|
||||
// Show resistance instead of effectiveness
|
||||
const mapped = SHOW[property];
|
||||
if (mapped) {
|
||||
property = mapped.as;
|
||||
onSet = mapped.setter.bind(undefined, m);
|
||||
}
|
||||
|
||||
return [
|
||||
<tr key={`th-${property}`}>
|
||||
<th colSpan="4">
|
||||
<span className="cb">{translate(property)}</span>
|
||||
</th>
|
||||
</tr>,
|
||||
<Modification key={property} m={m} property={property}
|
||||
onSet={onSet} highlight={highlight} showProp={propsToShow[property]}
|
||||
onPropToggle={onPropToggle} />
|
||||
];
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the modifications
|
||||
* @param {Object} props React Component properties
|
||||
* @return {Object} list: Array of React Components
|
||||
* @return {Array} Array of React Components
|
||||
*/
|
||||
_renderModifications(props) {
|
||||
const { m, onChange, ship } = props;
|
||||
const modifications = [];
|
||||
for (const modName of Modifications.modules[m.grp].modifications) {
|
||||
if (!Modifications.modifications[modName].hidden) {
|
||||
const key = modName + (m.getModValue(modName) / 100 || 0);
|
||||
modifications.push(<Modification key={ key } ship={ ship } m={ m } name={ modName } value={ m.getModValue(modName) / 100 || 0 } onChange={ onChange }/>);
|
||||
}
|
||||
}
|
||||
return modifications;
|
||||
_renderModifications() {
|
||||
const { m } = this.props;
|
||||
|
||||
const blueprintFeatures = getBlueprintInfo(m.getBlueprint()).features[
|
||||
m.getBlueprintGrade()
|
||||
];
|
||||
const blueprintModifications = chain(keys(blueprintFeatures))
|
||||
.map((feature) => this._mkModification(feature, true))
|
||||
.filter(([_, mod]) => Boolean(mod))
|
||||
.flatMap()
|
||||
.value();
|
||||
const moduleModifications = chain(keys(getModuleInfo(m.getItem()).props))
|
||||
.filter((prop) => !blueprintFeatures[prop])
|
||||
.map((prop) => this._mkModification(prop, false))
|
||||
.flatMap()
|
||||
.value();
|
||||
|
||||
return blueprintModifications.concat(moduleModifications);
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the blueprints menu
|
||||
*/
|
||||
_toggleBlueprintsMenu() {
|
||||
const blueprintMenuOpened = !this.state.blueprintMenuOpened;
|
||||
this.setState({ blueprintMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Activated when a blueprint is selected
|
||||
* @param {int} fdname The Frontier name of the blueprint
|
||||
* @param {int} grade The grade of the selected blueprint
|
||||
*/
|
||||
_blueprintSelected(fdname, grade) {
|
||||
this.context.tooltip(null);
|
||||
const { m, ship } = this.props;
|
||||
const blueprint = getBlueprint(fdname, m);
|
||||
blueprint.grade = grade;
|
||||
ship.setModuleBlueprint(m, blueprint);
|
||||
setPercent(ship, m, 100);
|
||||
|
||||
this.setState({ blueprintMenuOpened: false, specialMenuOpened: true });
|
||||
this.props.onChange();
|
||||
this.setState({ blueprintMenuOpened: !this.state.blueprintMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the specials menu
|
||||
*/
|
||||
_toggleSpecialsMenu() {
|
||||
const specialMenuOpened = !this.state.specialMenuOpened;
|
||||
this.setState({ specialMenuOpened });
|
||||
this.setState({ specialMenuOpened: !this.state.specialMenuOpened });
|
||||
}
|
||||
|
||||
/**
|
||||
* Activated when a special is selected
|
||||
* @param {int} special The name of the selected special
|
||||
* Creates a callback for when a special effect is being selected
|
||||
* @param {string} special The name of the selected special
|
||||
* @returns {function} Callback
|
||||
*/
|
||||
_specialSelected(special) {
|
||||
this.context.tooltip(null);
|
||||
const { m, ship } = this.props;
|
||||
return () => {
|
||||
const { m } = this.props;
|
||||
m.setExperimental(special);
|
||||
this.setState({ specialMenuOpened: false });
|
||||
};
|
||||
}
|
||||
|
||||
if (special === null) {
|
||||
ship.clearModuleSpecial(m);
|
||||
} else {
|
||||
ship.setModuleSpecial(m, Modifications.specials[special]);
|
||||
/**
|
||||
* Set focus on first element in modifications menu
|
||||
* if component updates, unless update is due to value change
|
||||
* in a modification
|
||||
*/
|
||||
componentDidUpdate() {
|
||||
if (this.selectedModRef) {
|
||||
this.selectedModRef.focus();
|
||||
return;
|
||||
} else if (this.selectedSpecialRef) {
|
||||
this.selectedSpecialRef.focus();
|
||||
return;
|
||||
}
|
||||
|
||||
this.setState({ specialMenuOpened: false });
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a '50%' roll within the information we have
|
||||
*/
|
||||
_rollFifty() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 50);
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a random roll within the information we have
|
||||
*/
|
||||
_rollRandom() {
|
||||
const { m, ship } = this.props;
|
||||
setRandom(ship, m);
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a 'best' roll within the information we have
|
||||
*/
|
||||
_rollBest() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 100);
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide a 'worst' roll within the information we have
|
||||
*/
|
||||
_rollWorst() {
|
||||
const { m, ship } = this.props;
|
||||
setPercent(ship, m, 0);
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset modification information
|
||||
*/
|
||||
_reset() {
|
||||
const { m, ship } = this.props;
|
||||
ship.clearModifications(m);
|
||||
ship.clearModuleBlueprint(m);
|
||||
|
||||
this.props.onChange();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -248,77 +230,155 @@ export default class ModificationsMenu extends TranslatedComponent {
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const translate = language.translate;
|
||||
const { m } = this.props;
|
||||
const { blueprintMenuOpened, specialMenuOpened } = this.state;
|
||||
const {
|
||||
blueprintProgress, blueprintMenuOpened, specialMenuOpened,
|
||||
} = this.state;
|
||||
|
||||
const _toggleBlueprintsMenu = this._toggleBlueprintsMenu;
|
||||
const _toggleSpecialsMenu = this._toggleSpecialsMenu;
|
||||
const _rollFull = this._rollBest;
|
||||
const _rollWorst = this._rollWorst;
|
||||
const _rollFifty = this._rollFifty;
|
||||
const _rollRandom = this._rollRandom;
|
||||
const _reset = this._reset;
|
||||
const appliedBlueprint = m.getBlueprint();
|
||||
const appliedGrade = m.getBlueprintGrade();
|
||||
const appliedExperimental = m.getExperimental();
|
||||
|
||||
let blueprintLabel;
|
||||
let haveBlueprint = false;
|
||||
let blueprintTt;
|
||||
let blueprintCv;
|
||||
if (m.blueprint && m.blueprint.name && Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade]) {
|
||||
blueprintLabel = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
haveBlueprint = true;
|
||||
blueprintTt = blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], Modifications.modules[m.grp].blueprints[m.blueprint.fdname].grades[m.blueprint.grade].engineers, m.grp);
|
||||
blueprintCv = getPercent(m);
|
||||
let renderComponents = [];
|
||||
switch (true) {
|
||||
case !appliedBlueprint || blueprintMenuOpened:
|
||||
renderComponents = this._renderBlueprints();
|
||||
break;
|
||||
case specialMenuOpened:
|
||||
renderComponents = this._renderSpecials();
|
||||
break;
|
||||
default:
|
||||
// Since the first case didn't apply, there is a blueprint applied so
|
||||
// we render the modifications
|
||||
let blueprintTt = blueprintTooltip(language, m, appliedBlueprint, appliedGrade);
|
||||
|
||||
renderComponents.push(
|
||||
<div style={{ cursor: 'pointer' }} key="blueprintsMenu"
|
||||
className="section-menu button-inline-menu"
|
||||
onMouseOver={termtip.bind(null, blueprintTt)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
onClick={this._toggleBlueprintsMenu}
|
||||
>
|
||||
{translate(appliedBlueprint)} {translate('grade')} {appliedGrade}
|
||||
</div>
|
||||
);
|
||||
|
||||
if (m.getApplicableExperimentals().length) {
|
||||
let specialLabel = translate('PHRASE_SELECT_SPECIAL');
|
||||
let specialTt;
|
||||
if (appliedExperimental) {
|
||||
specialLabel = appliedExperimental;
|
||||
specialTt = specialToolTip(language, m, appliedExperimental);
|
||||
}
|
||||
renderComponents.push(
|
||||
<div className="section-menu button-inline-menu"
|
||||
style={{ cursor: 'pointer' }}
|
||||
onMouseOver={specialTt ? termtip.bind(null, specialTt) : null}
|
||||
onMouseOut={specialTt ? tooltip.bind(null, null) : null}
|
||||
onClick={this._toggleSpecialsMenu}
|
||||
>{specialLabel}</div>
|
||||
);
|
||||
}
|
||||
|
||||
renderComponents.push(
|
||||
<div
|
||||
className="section-menu button-inline-menu warning"
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.resetEngineering();
|
||||
this.selectedModRef = null;
|
||||
this.selectedSpecialRef = null;
|
||||
tooltip(null);
|
||||
this.setState({
|
||||
blueprintMenuOpened: true,
|
||||
blueprintProgress: undefined,
|
||||
});
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('reset')}</div>,
|
||||
<table style={{ width: '100%', backgroundColor: 'transparent' }}>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: false },
|
||||
)}
|
||||
>{translate('mroll')}:</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 0 },
|
||||
)} style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(0);
|
||||
this.setState({ blueprintProgress: 0 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('0%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 0.5 },
|
||||
)} style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(0.5);
|
||||
this.setState({ blueprintProgress: 0.5 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('50%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress === 1 },
|
||||
)}
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
m.setBlueprintProgress(1);
|
||||
this.setState({ blueprintProgress: 1 });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('100%')}</td>
|
||||
<td
|
||||
className={cn(
|
||||
'section-menu button-inline-menu',
|
||||
{ active: blueprintProgress % 0.5 !== 0 },
|
||||
)}
|
||||
style={{ cursor: 'pointer' }}
|
||||
onClick={() => {
|
||||
const blueprintProgress = Math.random();
|
||||
m.setBlueprintProgress(blueprintProgress);
|
||||
this.setState({ blueprintProgress });
|
||||
}}
|
||||
onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{translate('random')}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>,
|
||||
<hr />,
|
||||
<span
|
||||
onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<table style={{ width: '100%' }}>
|
||||
<tbody>
|
||||
{this._renderModifications()}
|
||||
</tbody>
|
||||
</table>
|
||||
</span>
|
||||
);
|
||||
}
|
||||
|
||||
let specialLabel;
|
||||
let specialTt;
|
||||
if (m.blueprint && m.blueprint.special) {
|
||||
specialLabel = m.blueprint.special.name;
|
||||
specialTt = specialToolTip(translate, m.blueprint.grades[m.blueprint.grade], m.grp, m, m.blueprint.special.edname);
|
||||
} else {
|
||||
specialLabel = translate('PHRASE_SELECT_SPECIAL');
|
||||
}
|
||||
|
||||
const specials = this._renderSpecials(this.props, this.context);
|
||||
|
||||
const showBlueprintsMenu = blueprintMenuOpened;
|
||||
const showSpecial = haveBlueprint && specials.length && !blueprintMenuOpened;
|
||||
const showSpecialsMenu = specialMenuOpened;
|
||||
const showRolls = haveBlueprint && !blueprintMenuOpened && !specialMenuOpened;
|
||||
const showReset = !blueprintMenuOpened && !specialMenuOpened && haveBlueprint;
|
||||
const showMods = !blueprintMenuOpened && !specialMenuOpened && haveBlueprint;
|
||||
|
||||
return (
|
||||
<div
|
||||
className={cn('select', this.props.className)}
|
||||
onClick={(e) => e.stopPropagation() }
|
||||
onContextMenu={stopCtxPropagation}
|
||||
<div className={cn('select', this.props.className)}
|
||||
onClick={(e) => e.stopPropagation()}
|
||||
onContextMenu={stopCtxPropagation}
|
||||
>
|
||||
{ showBlueprintsMenu | showSpecialsMenu ? '' : haveBlueprint ?
|
||||
<div className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={termtip.bind(null, blueprintTt)} onMouseOut={tooltip.bind(null, null)} onClick={_toggleBlueprintsMenu}>{blueprintLabel}</div> :
|
||||
<div className={ cn('section-menu button-inline-menu', { selected: blueprintMenuOpened })} style={{ cursor: 'pointer' }} onClick={_toggleBlueprintsMenu}>{translate('PHRASE_SELECT_BLUEPRINT')}</div> }
|
||||
{ showBlueprintsMenu ? this._renderBlueprints(this.props, this.context) : null }
|
||||
{ showSpecial & !showSpecialsMenu ? <div className={ cn('section-menu button-inline-menu', { selected: specialMenuOpened })} style={{ cursor: 'pointer' }} onMouseOver={specialTt ? termtip.bind(null, specialTt) : null} onMouseOut={specialTt ? tooltip.bind(null, null) : null} onClick={_toggleSpecialsMenu}>{specialLabel}</div> : null }
|
||||
{ showSpecialsMenu ? specials : null }
|
||||
{ showReset ? <div className={'section-menu button-inline-menu warning'} style={{ cursor: 'pointer' }} onClick={_reset} onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RESET')} onMouseOut={tooltip.bind(null, null)}> { translate('reset') } </div> : null }
|
||||
{ showRolls ?
|
||||
|
||||
<table style={{ width: '100%', backgroundColor: 'transparent' }}>
|
||||
<tbody>
|
||||
{ showRolls ?
|
||||
<tr>
|
||||
<td className={ cn('section-menu button-inline-menu', {active: false})}> { translate('roll') }: </td>
|
||||
<td className={ cn('section-menu button-inline-menu', { active: blueprintCv === 0 })} style={{ cursor: 'pointer' }} onClick={_rollWorst} onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_WORST')} onMouseOut={tooltip.bind(null, null)}> { translate('0%') } </td>
|
||||
<td className={ cn('section-menu button-inline-menu', { active: blueprintCv === 50 })} style={{ cursor: 'pointer' }} onClick={_rollFifty} onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_FIFTY')} onMouseOut={tooltip.bind(null, null)}> { translate('50%') } </td>
|
||||
<td className={ cn('section-menu button-inline-menu', { active: blueprintCv === 100 })} style={{ cursor: 'pointer' }} onClick={_rollFull} onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_BEST')} onMouseOut={tooltip.bind(null, null)}> { translate('100%') } </td>
|
||||
<td className={ cn('section-menu button-inline-menu', { active: blueprintCv === null || blueprintCv % 50 != 0 })} style={{ cursor: 'pointer' }} onClick={_rollRandom} onMouseOver={termtip.bind(null, 'PHRASE_BLUEPRINT_RANDOM')} onMouseOut={tooltip.bind(null, null)}> { translate('random') } </td>
|
||||
</tr> : null }
|
||||
</tbody>
|
||||
</table> : null }
|
||||
{ showMods ? <hr /> : null }
|
||||
{ showMods ?
|
||||
<span onMouseOver={termtip.bind(null, 'HELP_MODIFICATIONS_MENU')} onMouseOut={tooltip.bind(null, null)} >
|
||||
{ this._renderModifications(this.props) }
|
||||
</span> : null }
|
||||
{renderComponents}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,47 +1,39 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { SPEED, BOOST_SPEED, ROLL, BOOST_ROLL, YAW, BOOST_YAW, PITCH, BOOST_PITCH } = ShipProps;
|
||||
|
||||
/**
|
||||
* Movement
|
||||
*/
|
||||
export default class Movement extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
cargo: PropTypes.number.isRequired
|
||||
pips: PropTypes.object.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render movement
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { ship, boost, eng, cargo, fuel } = this.props;
|
||||
const { ship, boost } = this.props;
|
||||
const { language } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { formats } = language;
|
||||
|
||||
return (
|
||||
<span id='movement'>
|
||||
<svg viewBox='0 0 600 600' fillRule="evenodd" clipRule="evenodd">
|
||||
// Axes
|
||||
{/* Axes */}
|
||||
<path d="M150 250v300" strokeWidth='1'/>
|
||||
<path d="M150 250l236 236" strokeWidth='1'/>
|
||||
<path d="M150 250l350 -200" strokeWidth='1'/>
|
||||
// End Arrow
|
||||
{/* End Arrow */}
|
||||
<path d="M508 43.3L487 67l-10-17.3 31-6.4z"/>
|
||||
// Axes arcs and arrows
|
||||
{/* Axes arcs and arrows */}
|
||||
<path d="M71.7 251.7C64.2 259.2 60 269.4 60 280c0 22 18 40 40 40s40-18 40-40c0-10.6-4.2-20.8-11.7-28.3 7.5 7.5 11.7 17.7 11.7 28.3 0 22-18 40-40 40s-40-18-40-40c0-10.6 4.2-20.8 11.7-28.3z" strokeWidth='4' transform="matrix(.6 0 0 .3 87.5 376.3)"/>
|
||||
<path d="M142.8 453l-13.2 8.7-2.6-9.7 15.8 1z"/>
|
||||
<path d="M144.7 451.6l.5 1.6-16.2 10.6h-.4l-3.5-13 .7-.4 19.3 1.2zm-14.2 7.7l7.7-5-9.2-.7 1.5 5.7zm25.7-6.3l15.8-1-2.6 9.7-13.2-8.8z"/>
|
||||
@@ -57,14 +49,10 @@ export default class Movement extends TranslatedComponent {
|
||||
<path d="M359.5 422.4l-1.2 19.3-1.6.4-10.7-16 .2-.2 13-3.4.3.4zm-9 5l5.2 7.8.6-9.3-5.7 1.2zm-10.5 24l-13.2 8.6-2.6-9.7 15.8 1z"/>
|
||||
<path d="M342 450l.4 1.5-16.2 10.7-.4-.2-3.5-13 .3-.3L342 450zm-14.3 7.6l7.7-5-9.2-.6 1.5 5.6z"/>
|
||||
|
||||
// Speed
|
||||
<text x="470" y="30" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcSpeed(eng, fuel, cargo, boost)) + 'm/s' : '-'}</text>
|
||||
// Pitch
|
||||
<text x="355" y="410" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcPitch(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
// Roll
|
||||
<text x="450" y="110" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcRoll(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
// Yaw
|
||||
<text x="160" y="430" strokeWidth='0'>{ship.canThrust(cargo, fuel) ? formats.int(ship.calcYaw(eng, fuel, cargo, boost)) + '°/s' : '-'}</text>
|
||||
<text x="470" y="30" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_SPEED : SPEED)) + 'm/s'}</text>
|
||||
<text x="355" y="410" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_PITCH : PITCH)) + '°/s'}</text>
|
||||
<text x="450" y="110" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_ROLL : ROLL)) + '°/s'}</text>
|
||||
<text x="160" y="430" strokeWidth='0'>{formats.int(ship.get(boost ? BOOST_YAW : YAW)) + '°/s'}</text>
|
||||
</svg>
|
||||
</span>);
|
||||
}
|
||||
|
||||
@@ -3,43 +3,34 @@ import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import PieChart from './PieChart';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import { MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import VerticalBarChart from './VerticalBarChart';
|
||||
import { Ship } from 'ed-forge';
|
||||
import autoBind from 'auto-bind';
|
||||
import { DAMAGE_METRICS } from 'ed-forge/lib/ship-stats';
|
||||
import { clone, mapValues, mergeWith, reverse, sortBy, sum, toPairs, values } from 'lodash';
|
||||
|
||||
/**
|
||||
* Generates an internationalization friendly weapon comparator that will
|
||||
* sort by specified property (if provided) then by name/group, class, rating
|
||||
* @param {function} translate Translation function
|
||||
* @param {function} propComparator Optional property comparator
|
||||
* @param {boolean} desc Use descending order
|
||||
* @return {function} Comparator function for names
|
||||
* Turns an object into a tooltip.
|
||||
* @param {function} translate Translate function
|
||||
* @param {object} o Map to make the tooltip from
|
||||
* @returns {React.Component} Tooltip
|
||||
*/
|
||||
export function weaponComparator(translate, propComparator, desc) {
|
||||
return (a, b) => {
|
||||
if (!desc) { // Flip A and B if ascending order
|
||||
let t = a;
|
||||
a = b;
|
||||
b = t;
|
||||
}
|
||||
function objToTooltip(translate, o) {
|
||||
return toPairs(o)
|
||||
.filter(([k, v]) => Boolean(v))
|
||||
.map(([k, v]) => <div key={k}>{`${translate(k)}: ${v}`}</div>);
|
||||
}
|
||||
|
||||
// If a property comparator is provided use it first
|
||||
let diff = propComparator ? propComparator(a, b) : nameComparator(translate, a, b);
|
||||
|
||||
if (diff) {
|
||||
return diff;
|
||||
}
|
||||
|
||||
// Property matches so sort by name / group, then class, rating
|
||||
if (a.name === b.name && a.grp === b.grp) {
|
||||
if(a.class == b.class) {
|
||||
return a.rating > b.rating ? 1 : -1;
|
||||
}
|
||||
return a.class - b.class;
|
||||
}
|
||||
|
||||
return nameComparator(translate, a, b);
|
||||
};
|
||||
/**
|
||||
* Returns a data object used by {@link PieChart} that shows damage by type.
|
||||
* @param {function} translate Translation function
|
||||
* @param {Calc.SDps} o Object that holds sdps split up by type
|
||||
* @returns {Object} Data object
|
||||
*/
|
||||
function objToPie(translate, o) {
|
||||
return toPairs(o).map(([k, value]) => {
|
||||
return { label: translate(k), value };
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -52,12 +43,10 @@ export function weaponComparator(translate, propComparator, desc) {
|
||||
*/
|
||||
export default class Offence extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
marker: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
engagementrange: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
opponentSys: PropTypes.number.isRequired
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
opponent: PropTypes.instanceOf(Ship).isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -66,200 +55,327 @@ export default class Offence extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
|
||||
this._sort = this._sort.bind(this);
|
||||
|
||||
const damage = Calc.offenceMetrics(props.ship, props.opponent, props.wep, props.opponentSys, props.engagementrange);
|
||||
this.state = {
|
||||
predicate: 'n',
|
||||
predicate: 'classRating',
|
||||
desc: true,
|
||||
damage
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the state if our properties change
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps) {
|
||||
if (this.props.marker != nextProps.marker || this.props.eng != nextProps.eng) {
|
||||
const damage = Calc.offenceMetrics(nextProps.ship, nextProps.opponent, nextProps.wep, nextProps.opponentSys, nextProps.engagementrange);
|
||||
this.setState({ damage });
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the sort order and sort
|
||||
* @param {string} predicate Sort predicate
|
||||
*/
|
||||
_sortOrder(predicate) {
|
||||
let desc = this.state.desc;
|
||||
|
||||
if (predicate == this.state.predicate) {
|
||||
desc = !desc;
|
||||
} else {
|
||||
desc = true;
|
||||
}
|
||||
|
||||
this._sort(predicate, desc);
|
||||
let desc = predicate == this.state.predicate ? !this.state.desc : true;
|
||||
this.setState({ predicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sorts the weapon list
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort order descending
|
||||
*/
|
||||
_sort(predicate, desc) {
|
||||
let comp = weaponComparator.bind(null, this.context.language.translate);
|
||||
|
||||
switch (predicate) {
|
||||
case 'n': comp = comp(null, desc); break;
|
||||
case 'esdpss': comp = comp((a, b) => a.sdps.shields.total - b.sdps.shields.total, desc); break;
|
||||
case 'es': comp = comp((a, b) => a.effectiveness.shields.total - b.effectiveness.shields.total, desc); break;
|
||||
case 'esdpsh': comp = comp((a, b) => a.sdps.armour.total - b.sdps.armour.total, desc); break;
|
||||
case 'eh': comp = comp((a, b) => a.effectiveness.armour.total - b.effectiveness.armour.total, desc); break;
|
||||
}
|
||||
|
||||
this.state.damage.sort(comp);
|
||||
}
|
||||
|
||||
/**
|
||||
* Render offence
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { ship, opponent, wep, engagementrange } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { language, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { damage } = this.state;
|
||||
const sortOrder = this._sortOrder;
|
||||
|
||||
const pd = ship.standard[4].m;
|
||||
const damage = ship.getMetrics(DAMAGE_METRICS);
|
||||
const portions = {
|
||||
Absolute: damage.types.abs,
|
||||
Explosive: damage.types.expl,
|
||||
Kinetic: damage.types.kin,
|
||||
Thermic: damage.types.therm,
|
||||
};
|
||||
|
||||
const opponentShields = Calc.shieldMetrics(opponent, 4);
|
||||
const opponentArmour = Calc.armourMetrics(opponent);
|
||||
const oppShield = ship.getOpponent().getShield();
|
||||
const shieldMults = {
|
||||
Absolute: 1,
|
||||
Explosive: oppShield.explosive.damageMultiplier,
|
||||
Kinetic: oppShield.kinetic.damageMultiplier,
|
||||
Thermic: oppShield.thermal.damageMultiplier,
|
||||
};
|
||||
|
||||
const timeToDrain = Calc.timeToDrainWep(ship, wep);
|
||||
const oppArmour = ship.getOpponent().getArmour();
|
||||
const armourMults = {
|
||||
Absolute: 1,
|
||||
Explosive: oppArmour.explosive.damageMultiplier,
|
||||
Kinetic: oppArmour.kinetic.damageMultiplier,
|
||||
Thermic: oppArmour.thermal.damageMultiplier,
|
||||
};
|
||||
|
||||
let absoluteShieldsSDps = 0;
|
||||
let explosiveShieldsSDps = 0;
|
||||
let kineticShieldsSDps = 0;
|
||||
let thermalShieldsSDps = 0;
|
||||
let absoluteArmourSDps = 0;
|
||||
let explosiveArmourSDps = 0;
|
||||
let kineticArmourSDps = 0;
|
||||
let thermalArmourSDps = 0;
|
||||
let rows = [];
|
||||
for (let weapon of ship.getHardpoints()) {
|
||||
const sdps = weapon.get('sustaineddamagepersecond');
|
||||
const byRange = weapon.getRangeEffectiveness();
|
||||
const weaponPortions = {
|
||||
Absolute: weapon.get('absolutedamageportion'),
|
||||
Explosive: weapon.get('explosivedamageportion'),
|
||||
Kinetic: weapon.get('kineticdamageportion'),
|
||||
Thermic: weapon.get('thermicdamageportion'),
|
||||
};
|
||||
const baseSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(weaponPortions, (p) => formats.f1(sdps * p)),
|
||||
);
|
||||
|
||||
let totalSEps = 0;
|
||||
const bySys = oppShield.absolute.bySys;
|
||||
const shieldResEfts = mergeWith(
|
||||
clone(weaponPortions),
|
||||
shieldMults,
|
||||
(objV, srcV) => objV * srcV
|
||||
);
|
||||
const byShieldRes = sum(values(shieldResEfts));
|
||||
const shieldsSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(
|
||||
shieldResEfts,
|
||||
(mult) => formats.f1(byRange * mult * bySys * sdps),
|
||||
),
|
||||
);
|
||||
const shieldsEftTooltip = objToTooltip(
|
||||
translate,
|
||||
{
|
||||
range: formats.pct1(byRange),
|
||||
resistance: formats.pct1(byShieldRes),
|
||||
'power distributor': formats.pct1(bySys),
|
||||
},
|
||||
);
|
||||
const shieldEft = byRange * byShieldRes * bySys;
|
||||
|
||||
const rows = [];
|
||||
for (let i = 0; i < damage.length; i++) {
|
||||
const weapon = damage[i];
|
||||
const byHardness = weapon.getArmourEffectiveness();
|
||||
const armourResEfts = mergeWith(
|
||||
clone(weaponPortions),
|
||||
armourMults,
|
||||
(objV, srcV) => objV * srcV,
|
||||
);
|
||||
const byArmourRes = sum(values(armourResEfts));
|
||||
const armourSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(
|
||||
armourResEfts,
|
||||
(mult) => formats.f1(byRange * mult * byHardness * sdps)
|
||||
),
|
||||
);
|
||||
const armourEftTooltip = objToTooltip(
|
||||
translate,
|
||||
{
|
||||
range: formats.pct1(byRange),
|
||||
resistance: formats.pct1(byArmourRes),
|
||||
hardness: formats.pct1(byHardness),
|
||||
},
|
||||
);
|
||||
const armourEft = byRange * byArmourRes * byHardness;
|
||||
|
||||
totalSEps += weapon.seps;
|
||||
absoluteShieldsSDps += weapon.sdps.shields.absolute;
|
||||
explosiveShieldsSDps += weapon.sdps.shields.explosive;
|
||||
kineticShieldsSDps += weapon.sdps.shields.kinetic;
|
||||
thermalShieldsSDps += weapon.sdps.shields.thermal;
|
||||
absoluteArmourSDps += weapon.sdps.armour.absolute;
|
||||
explosiveArmourSDps += weapon.sdps.armour.explosive;
|
||||
kineticArmourSDps += weapon.sdps.armour.kinetic;
|
||||
thermalArmourSDps += weapon.sdps.armour.thermal;
|
||||
|
||||
const effectivenessShieldsTooltipDetails = [];
|
||||
effectivenessShieldsTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.shields.range)}</div>);
|
||||
effectivenessShieldsTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.shields.resistance)}</div>);
|
||||
effectivenessShieldsTooltipDetails.push(<div key='power distributor'>{translate('power distributor') + ' ' + formats.pct1(weapon.effectiveness.shields.sys)}</div>);
|
||||
|
||||
const effectiveShieldsSDpsTooltipDetails = [];
|
||||
if (weapon.sdps.shields.absolute) effectiveShieldsSDpsTooltipDetails.push(<div key='absolute'>{translate('absolute') + ' ' + formats.f1(weapon.sdps.shields.absolute)}</div>);
|
||||
if (weapon.sdps.shields.explosive) effectiveShieldsSDpsTooltipDetails.push(<div key='explosive'>{translate('explosive') + ' ' + formats.f1(weapon.sdps.shields.explosive)}</div>);
|
||||
if (weapon.sdps.shields.kinetic) effectiveShieldsSDpsTooltipDetails.push(<div key='kinetic'>{translate('kinetic') + ' ' + formats.f1(weapon.sdps.shields.kinetic)}</div>);
|
||||
if (weapon.sdps.shields.thermal) effectiveShieldsSDpsTooltipDetails.push(<div key='thermal'>{translate('thermal') + ' ' + formats.f1(weapon.sdps.shields.thermal)}</div>);
|
||||
|
||||
const effectivenessArmourTooltipDetails = [];
|
||||
effectivenessArmourTooltipDetails.push(<div key='range'>{translate('range') + ' ' + formats.pct1(weapon.effectiveness.armour.range)}</div>);
|
||||
effectivenessArmourTooltipDetails.push(<div key='resistance'>{translate('resistance') + ' ' + formats.pct1(weapon.effectiveness.armour.resistance)}</div>);
|
||||
effectivenessArmourTooltipDetails.push(<div key='hardness'>{translate('hardness') + ' ' + formats.pct1(weapon.effectiveness.armour.hardness)}</div>);
|
||||
const effectiveArmourSDpsTooltipDetails = [];
|
||||
if (weapon.sdps.armour.absolute) effectiveArmourSDpsTooltipDetails.push(<div key='absolute'>{translate('absolute') + ' ' + formats.f1(weapon.sdps.armour.absolute)}</div>);
|
||||
if (weapon.sdps.armour.explosive) effectiveArmourSDpsTooltipDetails.push(<div key='explosive'>{translate('explosive') + ' ' + formats.f1(weapon.sdps.armour.explosive)}</div>);
|
||||
if (weapon.sdps.armour.kinetic) effectiveArmourSDpsTooltipDetails.push(<div key='kinetic'>{translate('kinetic') + ' ' + formats.f1(weapon.sdps.armour.kinetic)}</div>);
|
||||
if (weapon.sdps.armour.thermal) effectiveArmourSDpsTooltipDetails.push(<div key='thermal'>{translate('thermal') + ' ' + formats.f1(weapon.sdps.armour.thermal)}</div>);
|
||||
|
||||
rows.push(
|
||||
<tr key={weapon.id}>
|
||||
<td className='ri'>
|
||||
{weapon.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
|
||||
{weapon.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
|
||||
{weapon.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
|
||||
{weapon.classRating} {translate(weapon.name)}
|
||||
{weapon.engineering ? ' (' + weapon.engineering + ')' : null }
|
||||
</td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveShieldsSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.shields.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessShieldsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.shields.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectiveArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.f1(weapon.sdps.armour.total)}</span></td>
|
||||
<td className='ri'><span onMouseOver={termtip.bind(null, effectivenessArmourTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>{formats.pct1(weapon.effectiveness.armour.total)}</span></td>
|
||||
</tr>);
|
||||
const bp = weapon.getBlueprint();
|
||||
const grade = weapon.getBlueprintGrade();
|
||||
const exp = weapon.getExperimental();
|
||||
let bpTitle = `${translate(bp)} ${translate('grade')} ${grade}`;
|
||||
if (exp) {
|
||||
bpTitle += `, ${translate(exp)}`;
|
||||
}
|
||||
rows.push({
|
||||
slot: weapon.getSlot(),
|
||||
mount: weapon.mount,
|
||||
classRating: weapon.getClassRating(),
|
||||
type: weapon.readMeta('type'),
|
||||
bpTitle: bp ? ` (${bpTitle})` : null,
|
||||
sdps,
|
||||
baseSdpsTooltip,
|
||||
shieldSdps: sdps * shieldEft,
|
||||
shieldEft,
|
||||
shieldsSdpsTooltip,
|
||||
shieldsEftTooltip,
|
||||
armourSdps: sdps * armourEft,
|
||||
armourEft,
|
||||
armourSdpsTooltip,
|
||||
armourEftTooltip,
|
||||
});
|
||||
}
|
||||
const { predicate, desc } = this.state;
|
||||
rows = sortBy(rows, (row) => row[predicate]);
|
||||
if (desc) {
|
||||
reverse(rows);
|
||||
}
|
||||
|
||||
const totalShieldsSDps = absoluteShieldsSDps + explosiveShieldsSDps + kineticShieldsSDps + thermalShieldsSDps;
|
||||
const totalArmourSDps = absoluteArmourSDps + explosiveArmourSDps + kineticArmourSDps + thermalArmourSDps;
|
||||
const sdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(portions, (p) => formats.f1(damage.sustained.dps * p)),
|
||||
);
|
||||
const sdpsPie = objToPie(
|
||||
translate,
|
||||
mapValues(portions, (p) => Math.round(damage.sustained.dps * p)),
|
||||
);
|
||||
|
||||
const shieldsSDpsData = [];
|
||||
shieldsSDpsData.push({ value: Math.round(absoluteShieldsSDps), label: translate('absolute') });
|
||||
shieldsSDpsData.push({ value: Math.round(explosiveShieldsSDps), label: translate('explosive') });
|
||||
shieldsSDpsData.push({ value: Math.round(kineticShieldsSDps), label: translate('kinetic') });
|
||||
shieldsSDpsData.push({ value: Math.round(thermalShieldsSDps), label: translate('thermal') });
|
||||
const shieldSdpsSrcs = mergeWith(
|
||||
clone(portions),
|
||||
shieldMults,
|
||||
(objV, srcV) => damage.sustained.dps * oppShield.absolute.bySys *
|
||||
damage.rangeMultiplier * objV * srcV,
|
||||
);
|
||||
const shieldsSdps = sum(values(shieldSdpsSrcs));
|
||||
const shieldsSdpsTooltip = objToTooltip(
|
||||
translate,
|
||||
mapValues(shieldSdpsSrcs, (v) => formats.f1(v)),
|
||||
);
|
||||
const shieldsSdpsPie = objToPie(
|
||||
translate,
|
||||
mapValues(shieldSdpsSrcs, (v) => Math.round(v)),
|
||||
);
|
||||
|
||||
const armourSDpsData = [];
|
||||
armourSDpsData.push({ value: Math.round(absoluteArmourSDps), label: translate('absolute') });
|
||||
armourSDpsData.push({ value: Math.round(explosiveArmourSDps), label: translate('explosive') });
|
||||
armourSDpsData.push({ value: Math.round(kineticArmourSDps), label: translate('kinetic') });
|
||||
armourSDpsData.push({ value: Math.round(thermalArmourSDps), label: translate('thermal') });
|
||||
const armourSdpsSrcs = mergeWith(
|
||||
clone(portions),
|
||||
armourMults,
|
||||
(objV, srcV) => damage.sustained.dps * damage.hardnessMultiplier *
|
||||
damage.rangeMultiplier * objV * srcV,
|
||||
);
|
||||
const armourSdps = sum(values(armourSdpsSrcs));
|
||||
const totalArmourSDpsTooltipDetails = objToTooltip(
|
||||
translate,
|
||||
mapValues(armourSdpsSrcs, (v) => formats.f1(v)),
|
||||
);
|
||||
const armourSDpsData = objToPie(
|
||||
translate,
|
||||
mapValues(armourSdpsSrcs, (v) => Math.round(v)),
|
||||
);
|
||||
|
||||
const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, totalShieldsSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, totalArmourSDps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
const pd = ship.getPowerDistributor();
|
||||
const timeToDrain = damage.sustained.timeToDrain[ship.getDistributorSettings().Wep];
|
||||
// const timeToDepleteShields = Calc.timeToDeplete(opponentShields.total, shieldsSdps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
// const timeToDepleteArmour = Calc.timeToDeplete(opponentArmour.total, armourSdps, totalSEps, pd.getWeaponsCapacity(), pd.getWeaponsRechargeRate() * (wep / 4));
|
||||
|
||||
return (
|
||||
<span id='offence'>
|
||||
<div className='group full'>
|
||||
<table>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'n')}>{translate('weapon')}</th>
|
||||
<th colSpan='2'>{translate('opponent\'s shields')}</th>
|
||||
<th colSpan='2'>{translate('opponent\'s armour')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')} onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'esdpss')}>{'sdps'}</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'es')}>{'eft'}</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'esdpsh')}>{'sdps'}</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')} onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'eh')}>{'eft'}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows}
|
||||
</tbody>
|
||||
</table>
|
||||
<table>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan='2' className='sortable' onClick={sortOrder.bind(this, 'classRating')}>{translate('weapon')}</th>
|
||||
<th colSpan='1'>{translate('overall')}</th>
|
||||
<th colSpan='2'>{translate('opponent\'s shields')}</th>
|
||||
<th colSpan='2'>{translate('opponent\'s armour')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'sdps')}>sdps</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'shieldSdps')}>sdps</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_SHIELDS')}
|
||||
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'shieldEft')}>eft</th>
|
||||
<th className='lft sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVE_SDPS_ARMOUR')}
|
||||
onMouseOut={tooltip.bind(null, null)}onClick={sortOrder.bind(this, 'armourSdps')}>sdps</th>
|
||||
<th className='sortable' onMouseOver={termtip.bind(null, 'TT_EFFECTIVENESS_ARMOUR')}
|
||||
onMouseOut={tooltip.bind(null, null)} onClick={sortOrder.bind(this, 'armourEft')}>eft</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{rows.map((row) => (
|
||||
<tr key={row.slot}>
|
||||
<td className='ri'>
|
||||
{row.mount == 'F' ? <span onMouseOver={termtip.bind(null, 'fixed')} onMouseOut={tooltip.bind(null, null)}><MountFixed className='icon'/></span> : null}
|
||||
{row.mount == 'G' ? <span onMouseOver={termtip.bind(null, 'gimballed')} onMouseOut={tooltip.bind(null, null)}><MountGimballed /></span> : null}
|
||||
{row.mount == 'T' ? <span onMouseOver={termtip.bind(null, 'turreted')} onMouseOut={tooltip.bind(null, null)}><MountTurret /></span> : null}
|
||||
{row.classRating} {translate(row.type)}
|
||||
{row.bpTitle}
|
||||
</td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.baseSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.sdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.shieldsSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.shieldSdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.shieldsEftTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.pct1(row.shieldEft)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.armourSdpsTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.f1(row.armourSdps)}</span></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, row.armourEftTooltip)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>{formats.pct1(row.armourEft)}</span></td>
|
||||
</tr>
|
||||
))}
|
||||
{rows.length > 0 &&
|
||||
<tr>
|
||||
<td></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, sdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(damage.sustained.dps)}
|
||||
</span>
|
||||
</td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, shieldsSdpsTooltip)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(shieldsSdps)}
|
||||
</span>
|
||||
</td>
|
||||
<td></td>
|
||||
<td className='ri'>
|
||||
<span onMouseOver={termtip.bind(null, totalArmourSDpsTooltipDetails)} onMouseOut={tooltip.bind(null, null)}>
|
||||
={formats.f1(armourSdps)}
|
||||
</span>
|
||||
</td>
|
||||
<td></td>
|
||||
</tr>
|
||||
}
|
||||
</tbody>
|
||||
</table>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2>{translate('offence metrics')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>{formats.f1(totalShieldsSDps)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>{timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>{formats.f1(totalArmourSDps)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))} onMouseOut={tooltip.bind(null, null)}>{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>{timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_DRAIN_WEP'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_DRAIN_WEP')}<br/>
|
||||
{timeToDrain === Infinity ? translate('never') : formats.time(timeToDrain)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_SHIELDS'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_EFFECTIVE_SDPS_SHIELDS')}<br/>
|
||||
{formats.f1(shieldsSdps)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_SHIELDS'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_REMOVE_SHIELDS')}<br/>
|
||||
ToDo
|
||||
{/* {timeToDepleteShields === Infinity ? translate('never') : formats.time(timeToDepleteShields)} */}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_EFFECTIVE_SDPS_ARMOUR'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_EFFECTIVE_SDPS_ARMOUR')}<br/>
|
||||
{formats.f1(armourSdps)}
|
||||
</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('TT_TIME_TO_REMOVE_ARMOUR'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('PHRASE_TIME_TO_REMOVE_ARMOUR')}<br/>
|
||||
ToDo
|
||||
{/* {timeToDepleteArmour === Infinity ? translate('never') : formats.time(timeToDepleteArmour)} */}
|
||||
</h2>
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('shield damage sources')}</h2>
|
||||
<PieChart data={shieldsSDpsData} />
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_OVERALL_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('overall damage')}
|
||||
</h2>
|
||||
<PieChart data={sdpsPie} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))} onMouseOut={tooltip.bind(null, null)}>{translate('armour damage sources')}</h2>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_SHIELD_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('shield damage sources')}
|
||||
</h2>
|
||||
<PieChart data={shieldsSdpsPie} />
|
||||
</div>
|
||||
<div className='group quarter'>
|
||||
<h2 onMouseOver={termtip.bind(null, translate('PHRASE_ARMOUR_DAMAGE'))}
|
||||
onMouseOut={tooltip.bind(null, null)}>
|
||||
{translate('armour damage sources')}
|
||||
</h2>
|
||||
<PieChart data={armourSDpsData} />
|
||||
</div>
|
||||
</span>);
|
||||
|
||||
@@ -1,8 +1,6 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import Persist from '../stores/Persist';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import PowerManagement from './PowerManagement';
|
||||
@@ -13,29 +11,24 @@ import Movement from './Movement';
|
||||
import Offence from './Offence';
|
||||
import Defence from './Defence';
|
||||
import WeaponDamageChart from './WeaponDamageChart';
|
||||
import Pips from '../components/Pips';
|
||||
import Boost from '../components/Boost';
|
||||
import Fuel from '../components/Fuel';
|
||||
import Cargo from '../components/Cargo';
|
||||
import ShipPicker from '../components/ShipPicker';
|
||||
import EngagementRange from '../components/EngagementRange';
|
||||
import autoBind from 'auto-bind';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { CARGO_CAPACITY, FUEL_CAPACITY } = ShipProps;
|
||||
|
||||
/**
|
||||
* Outfitting subpages
|
||||
*/
|
||||
export default class OutfittingSubpages extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
buildName: PropTypes.string,
|
||||
sys: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
boost: PropTypes.bool.isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
opponentBuild: PropTypes.string,
|
||||
opponentSys: PropTypes.number.isRequired,
|
||||
opponentEng: PropTypes.number.isRequired,
|
||||
opponentWep: PropTypes.number.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -44,13 +37,17 @@ export default class OutfittingSubpages extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._powerTab = this._powerTab.bind(this);
|
||||
this._profilesTab = this._profilesTab.bind(this);
|
||||
this._offenceTab = this._offenceTab.bind(this);
|
||||
this._defenceTab = this._defenceTab.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
this.props.ship.setOpponent(this.props.ship);
|
||||
this.state = {
|
||||
boost: false,
|
||||
cargo: props.ship.get(CARGO_CAPACITY),
|
||||
fuel: props.ship.get(FUEL_CAPACITY),
|
||||
pips: props.ship.getDistributorSettingsObject(),
|
||||
tab: Persist.getOutfittingTab() || 'power',
|
||||
engagementRange: 1000,
|
||||
opponent: this.props.ship,
|
||||
};
|
||||
}
|
||||
|
||||
@@ -59,128 +56,114 @@ export default class OutfittingSubpages extends TranslatedComponent {
|
||||
* @param {string} tab Tab name
|
||||
*/
|
||||
_showTab(tab) {
|
||||
Persist.setOutfittingTab(tab);
|
||||
this.setState({ tab });
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the power tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_powerTab() {
|
||||
let { ship, buildName, code, onChange } = this.props;
|
||||
Persist.setOutfittingTab('power');
|
||||
|
||||
const powerMarker = `${ship.toString()}`;
|
||||
const costMarker = `${ship.toString().split('.')[0]}`;
|
||||
|
||||
return <div>
|
||||
<PowerManagement ship={ship} code={powerMarker} onChange={onChange} />
|
||||
<CostSection ship={ship} buildName={buildName} code={costMarker} />
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the profiles tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_profilesTab() {
|
||||
const { ship, opponent, cargo, fuel, eng, boost, engagementRange, opponentSys } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
let realBoost = boost && ship.canBoost(cargo, fuel);
|
||||
Persist.setOutfittingTab('profiles');
|
||||
|
||||
const engineProfileMarker = `${ship.toString()}:${cargo}:${fuel}:${eng}:${realBoost}`;
|
||||
const fsdProfileMarker = `${ship.toString()}:${cargo}:${fuel}`;
|
||||
const movementMarker = `${ship.topSpeed}:${ship.pitch}:${ship.roll}:${ship.yaw}:${ship.canBoost(cargo, fuel)}`;
|
||||
const damageMarker = `${ship.toString()}:${opponent.toString()}:${engagementRange}:${opponentSys}`;
|
||||
|
||||
return <div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('engine profile')}</h1>
|
||||
<EngineProfile ship={ship} marker={engineProfileMarker} fuel={fuel} cargo={cargo} eng={eng} boost={realBoost} />
|
||||
</div>
|
||||
|
||||
<div className='group third'>
|
||||
<h1>{translate('fsd profile')}</h1>
|
||||
<FSDProfile ship={ship} marker={fsdProfileMarker} fuel={fuel} cargo={cargo} />
|
||||
</div>
|
||||
|
||||
<div className='group third'>
|
||||
<h1>{translate('movement profile')}</h1>
|
||||
<Movement marker={movementMarker} ship={ship} boost={boost} eng={eng} cargo={cargo} fuel={fuel} />
|
||||
</div>
|
||||
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s shields')}</h1>
|
||||
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={false} engagementRange={engagementRange} />
|
||||
</div>
|
||||
|
||||
<div className='group half'>
|
||||
<h1>{translate('damage to opponent\'s hull')}</h1>
|
||||
<WeaponDamageChart marker={damageMarker} ship={ship} opponent={opponent} opponentSys={opponentSys} hull={true} engagementRange={engagementRange} />
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the offence tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_offenceTab() {
|
||||
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentSys } = this.props;
|
||||
Persist.setOutfittingTab('offence');
|
||||
|
||||
const marker = `${ship.toString()}${opponent.toString()}${opponentBuild}${engagementRange}${opponentSys}`;
|
||||
|
||||
return <div>
|
||||
<Offence marker={marker} ship={ship} opponent={opponent} wep={wep} opponentSys={opponentSys} engagementrange={engagementRange}/>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the defence tab
|
||||
* @return {React.Component} Tab contents
|
||||
*/
|
||||
_defenceTab() {
|
||||
const { ship, sys, eng, wep, cargo, fuel, boost, engagementRange, opponent, opponentBuild, opponentWep } = this.props;
|
||||
Persist.setOutfittingTab('defence');
|
||||
|
||||
const marker = `${ship.toString()}${opponent.toString()}{opponentBuild}${engagementRange}${opponentWep}`;
|
||||
|
||||
return <div>
|
||||
<Defence marker={marker} ship={ship} opponent={opponent} sys={sys} opponentWep={opponentWep} engagementrange={engagementRange}/>
|
||||
</div>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the section
|
||||
* @return {React.Component} Contents
|
||||
*/
|
||||
render() {
|
||||
const tab = this.state.tab;
|
||||
const translate = this.context.language.translate;
|
||||
let tabSection;
|
||||
|
||||
switch (tab) {
|
||||
case 'power': tabSection = this._powerTab(); break;
|
||||
case 'profiles': tabSection = this._profilesTab(); break;
|
||||
case 'offence': tabSection = this._offenceTab(); break;
|
||||
case 'defence': tabSection = this._defenceTab(); break;
|
||||
}
|
||||
const { buildName, code, ship } = this.props;
|
||||
const { boost, cargo, fuel, pips, tab, engagementRange, opponent } = this.state;
|
||||
const { translate } = this.context.language;
|
||||
|
||||
const cargoCapacity = ship.get(CARGO_CAPACITY);
|
||||
const showCargoSlider = cargoCapacity > 0;
|
||||
return (
|
||||
<div className='group full' style={{ minHeight: '1000px' }}>
|
||||
<table className='tabs'>
|
||||
<thead>
|
||||
<tr>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })} onClick={this._showTab.bind(this, 'power')} >{translate('power and costs')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })} onClick={this._showTab.bind(this, 'profiles')} >{translate('profiles')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })} onClick={this._showTab.bind(this, 'offence')} >{translate('offence')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })} onClick={this._showTab.bind(this, 'defence')} >{translate('defence')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
</table>
|
||||
{tabSection}
|
||||
<div>
|
||||
{/* Control of ship and opponent */}
|
||||
<div className="group quarter">
|
||||
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
|
||||
{translate('ship control')}
|
||||
</h2>
|
||||
<Boost boost={boost} onChange={(boost) => this.setState({ boost })} />
|
||||
</div>
|
||||
<div className="group quarter">
|
||||
<h2 style={{ verticalAlign: 'middle', textAlign: 'center' }}>
|
||||
{translate('opponent')}
|
||||
</h2>
|
||||
<ShipPicker ship={ship} onChange={(opponent) => this.setState({ opponent })} />
|
||||
</div>
|
||||
<div className={cn('group', { quarter: showCargoSlider, half: !showCargoSlider })}>
|
||||
<Fuel fuelCapacity={ship.get(FUEL_CAPACITY)} fuel={fuel}
|
||||
onChange={(fuel) => this.setState({ fuel })} />
|
||||
</div>
|
||||
{showCargoSlider ?
|
||||
<div className="group quarter">
|
||||
<Cargo cargoCapacity={cargoCapacity} cargo={cargo}
|
||||
onChange={(cargo) => this.setState({ cargo })} />
|
||||
</div> : null}
|
||||
<div className="group half">
|
||||
<Pips ship={ship} pips={pips} onChange={(pips) => this.setState({ pips })} />
|
||||
</div>
|
||||
<div className="group half">
|
||||
<EngagementRange ship={ship} engagementRange={engagementRange}
|
||||
onChange={(engagementRange) => this.setState({ engagementRange })} />
|
||||
</div>
|
||||
<div className='group full' style={{ minHeight: '1000px' }}>
|
||||
<table className='tabs'>
|
||||
{/* Select tab section */}
|
||||
<thead>
|
||||
<tr>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'power' })}
|
||||
onClick={this._showTab.bind(this, 'power')}>
|
||||
{translate('power and costs')}
|
||||
</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'profiles' })}
|
||||
onClick={this._showTab.bind(this, 'profiles')}>
|
||||
{translate('profiles')}</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'offence' })}
|
||||
onClick={this._showTab.bind(this, 'offence')}>
|
||||
{translate('offence')}
|
||||
</th>
|
||||
<th style={{ width:'25%' }} className={cn({ active: tab == 'defence' })}
|
||||
onClick={this._showTab.bind(this, 'defence')}>
|
||||
{translate('tab_defence')}
|
||||
</th>
|
||||
</tr>
|
||||
</thead>
|
||||
</table>
|
||||
{/* Show selected tab */}
|
||||
{tab == 'power' ?
|
||||
<div>
|
||||
<PowerManagement ship={ship} code={code} />
|
||||
<CostSection ship={ship} buildName={buildName} code={code} />
|
||||
</div> : null}
|
||||
{tab == 'profiles' ?
|
||||
<div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('engine profile')}</h1>
|
||||
<EngineProfile code={code} ship={ship} fuel={fuel} cargo={cargo} pips={pips} boost={boost} />
|
||||
</div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('fsd profile')}</h1>
|
||||
<FSDProfile code={code} ship={ship} fuel={fuel} cargo={cargo} />
|
||||
</div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('movement profile')}</h1>
|
||||
<Movement code={code} ship={ship} boost={boost} pips={pips} />
|
||||
</div>
|
||||
<div className='group third'>
|
||||
<h1>{translate('damage to opponent\'s shields')}</h1>
|
||||
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getShield()} engagementRange={engagementRange} />
|
||||
</div>
|
||||
|
||||
<div className='group third'>
|
||||
<h1>{translate('damage to opponent\'s hull')}</h1>
|
||||
<WeaponDamageChart code={code} ship={ship} opponentDefence={opponent.getArmour()} engagementRange={engagementRange} />
|
||||
</div>
|
||||
</div> : null}
|
||||
{tab == 'offence' ?
|
||||
<div>
|
||||
<Offence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
|
||||
</div> : null}
|
||||
{tab == 'defence' ?
|
||||
<div>
|
||||
<Defence code={code} ship={ship} opponent={opponent} engagementRange={engagementRange} />
|
||||
</div> : null}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
import React, { Component } from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import Measure from 'react-measure';
|
||||
import ContainerDimensions from 'react-container-dimensions';
|
||||
import * as d3 from 'd3';
|
||||
|
||||
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
|
||||
@@ -10,7 +10,6 @@ const LABEL_COLOUR = '#000000';
|
||||
* A pie chart
|
||||
*/
|
||||
export default class PieChart extends Component {
|
||||
|
||||
static propTypes = {
|
||||
data : PropTypes.array.isRequired
|
||||
};
|
||||
@@ -27,13 +26,6 @@ export default class PieChart extends Component {
|
||||
this.colors = CORIOLIS_COLOURS;
|
||||
this.arc = d3.arc();
|
||||
this.arc.innerRadius(0);
|
||||
|
||||
this.state = {
|
||||
dimensions: {
|
||||
width: 100,
|
||||
height: 100
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
|
||||
@@ -41,15 +33,15 @@ export default class PieChart extends Component {
|
||||
* Generate a slice of the pie chart
|
||||
* @param {Object} d the data for this slice
|
||||
* @param {number} i the index of this slice
|
||||
* @param {number} width the current width of the parent container
|
||||
* @returns {Object} the SVG for the slice
|
||||
*/
|
||||
sliceGenerator(d, i) {
|
||||
sliceGenerator(d, i, width) {
|
||||
if (!d || d.value == 0) {
|
||||
// Ignore 0 values
|
||||
return null;
|
||||
}
|
||||
|
||||
const { width, height } = this.state.dimensions;
|
||||
const { data } = this.props;
|
||||
|
||||
// Push the labels further out from the centre of the slice
|
||||
@@ -76,22 +68,24 @@ export default class PieChart extends Component {
|
||||
* @returns {object} Markup
|
||||
*/
|
||||
render() {
|
||||
const { width, height } = this.state.dimensions;
|
||||
const pie = this.pie(this.props.data),
|
||||
translate = `translate(${width / 2}, ${width * 0.4})`;
|
||||
|
||||
this.arc.outerRadius(width * 0.4);
|
||||
|
||||
return (
|
||||
<Measure width='100%' whitelist={['width', 'top']} onMeasure={ (dimensions) => { this.setState({ dimensions }); }}>
|
||||
<div width={width} height={width}>
|
||||
<svg style={{ stroke: 'None' }} width={width} height={width * 0.9}>
|
||||
<g transform={translate}>
|
||||
{pie.map((d, i) => this.sliceGenerator(d, i))}
|
||||
</g>
|
||||
</svg>
|
||||
</div>
|
||||
</Measure>
|
||||
<ContainerDimensions>
|
||||
{ ({ width }) => {
|
||||
const pie = this.pie(this.props.data),
|
||||
translate = `translate(${width / 2}, ${width * 0.4})`;
|
||||
|
||||
this.arc.outerRadius(width * 0.4);
|
||||
return (
|
||||
<div width={width} height={width}>
|
||||
<svg style={{ stroke: 'None' }} width={width} height={width * 0.9}>
|
||||
<g transform={translate}>
|
||||
{pie.map((d, i) => this.sliceGenerator(d, i, width))}
|
||||
</g>
|
||||
</svg>
|
||||
</div>
|
||||
);
|
||||
}}
|
||||
</ContainerDimensions>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,13 +1,9 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import { Pip } from './SvgIcons';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import Module from '../shipyard/Module';
|
||||
import { autoBind } from 'react-extras';
|
||||
import { Ship } from 'ed-forge';
|
||||
|
||||
/**
|
||||
* Pips displays SYS/ENG/WEP pips and allows users to change them with key presses by clicking on the relevant area.
|
||||
@@ -15,10 +11,9 @@ import Module from '../shipyard/Module';
|
||||
*/
|
||||
export default class Pips extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
sys: PropTypes.number.isRequired,
|
||||
eng: PropTypes.number.isRequired,
|
||||
wep: PropTypes.number.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
pips: PropTypes.object.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -28,9 +23,13 @@ export default class Pips extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
const { sys, eng, wep } = props;
|
||||
autoBind(this);
|
||||
|
||||
this._keyDown = this._keyDown.bind(this);
|
||||
const { ship } = props;
|
||||
this._incSys = this._change(ship.incSys);
|
||||
this._incEng = this._change(ship.incEng);
|
||||
this._incWep = this._change(ship.incWep);
|
||||
this._reset = this._change(ship.pipsReset);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -75,181 +74,43 @@ export default class Pips extends TranslatedComponent {
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle a click
|
||||
* @param {string} which Which item was clicked
|
||||
* Creates a function that handles pip assignment and call `onChance`.
|
||||
* @param {String} cb Callback that handles the actual pip assignment
|
||||
* @param {Boolean} isMc True when increase is by multi crew
|
||||
* @returns {Function} Function that handles pip assigment
|
||||
*/
|
||||
onClick(which) {
|
||||
if (which == 'SYS') {
|
||||
this._incSys();
|
||||
} else if (which == 'ENG') {
|
||||
this._incEng();
|
||||
} else if (which == 'WEP') {
|
||||
this._incWep();
|
||||
} else if (which == 'RST') {
|
||||
this._reset();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset the capacitor
|
||||
*/
|
||||
_reset() {
|
||||
let { sys, eng, wep } = this.props;
|
||||
if (sys != 2 || eng != 2 || wep != 2) {
|
||||
sys = eng = wep = 2;
|
||||
this.props.onChange(sys, eng, wep);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the SYS capacitor
|
||||
*/
|
||||
_incSys() {
|
||||
let { sys, eng, wep } = this.props;
|
||||
|
||||
const required = Math.min(1, 4 - sys);
|
||||
if (required > 0) {
|
||||
if (required == 0.5) {
|
||||
// Take from whichever is larger
|
||||
if (eng > wep) {
|
||||
eng -= 0.5;
|
||||
sys += 0.5;
|
||||
} else {
|
||||
wep -= 0.5;
|
||||
sys += 0.5;
|
||||
}
|
||||
} else {
|
||||
// Required is 1 - take from both if possible
|
||||
if (eng == 0) {
|
||||
wep -= 1;
|
||||
sys += 1;
|
||||
} else if (wep == 0) {
|
||||
eng -= 1;
|
||||
sys += 1;
|
||||
} else {
|
||||
eng -= 0.5;
|
||||
wep -= 0.5;
|
||||
sys += 1;
|
||||
}
|
||||
}
|
||||
this.props.onChange(sys, eng, wep);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the ENG capacitor
|
||||
*/
|
||||
_incEng() {
|
||||
let { sys, eng, wep } = this.props;
|
||||
|
||||
const required = Math.min(1, 4 - eng);
|
||||
if (required > 0) {
|
||||
if (required == 0.5) {
|
||||
// Take from whichever is larger
|
||||
if (sys > wep) {
|
||||
sys -= 0.5;
|
||||
eng += 0.5;
|
||||
} else {
|
||||
wep -= 0.5;
|
||||
eng += 0.5;
|
||||
}
|
||||
} else {
|
||||
// Required is 1 - take from both if possible
|
||||
if (sys == 0) {
|
||||
wep -= 1;
|
||||
eng += 1;
|
||||
} else if (wep == 0) {
|
||||
sys -= 1;
|
||||
eng += 1;
|
||||
} else {
|
||||
sys -= 0.5;
|
||||
wep -= 0.5;
|
||||
eng += 1;
|
||||
}
|
||||
}
|
||||
this.props.onChange(sys, eng, wep);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Increment the WEP capacitor
|
||||
*/
|
||||
_incWep() {
|
||||
let { sys, eng, wep } = this.props;
|
||||
|
||||
const required = Math.min(1, 4 - wep);
|
||||
if (required > 0) {
|
||||
if (required == 0.5) {
|
||||
// Take from whichever is larger
|
||||
if (sys > eng) {
|
||||
sys -= 0.5;
|
||||
wep += 0.5;
|
||||
} else {
|
||||
eng -= 0.5;
|
||||
wep += 0.5;
|
||||
}
|
||||
} else {
|
||||
// Required is 1 - take from both if possible
|
||||
if (sys == 0) {
|
||||
eng -= 1;
|
||||
wep += 1;
|
||||
} else if (eng == 0) {
|
||||
sys -= 1;
|
||||
wep += 1;
|
||||
} else {
|
||||
sys -= 0.5;
|
||||
eng -= 0.5;
|
||||
wep += 1;
|
||||
}
|
||||
}
|
||||
this.props.onChange(sys, eng, wep);
|
||||
}
|
||||
_change(cb, isMc) {
|
||||
return () => {
|
||||
cb(isMc);
|
||||
this.props.onChange(this.props.ship.getDistributorSettingsObject());
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Set up the rendering for pips
|
||||
* @param {int} sys the SYS pips
|
||||
* @param {int} eng the ENG pips
|
||||
* @param {int} wep the WEP pips
|
||||
* @returns {Object} Object containing the rendering for the pips
|
||||
*/
|
||||
_renderPips(sys, eng, wep) {
|
||||
const pipsSvg = {};
|
||||
_renderPips() {
|
||||
const pipsSvg = {
|
||||
Sys: [],
|
||||
Eng: [],
|
||||
Wep: [],
|
||||
};
|
||||
|
||||
// SYS
|
||||
pipsSvg['SYS'] = [];
|
||||
for (let i = 0; i < Math.floor(sys); i++) {
|
||||
pipsSvg['SYS'].push(<Pip className='full' key={i} />);
|
||||
}
|
||||
if (sys > Math.floor(sys)) {
|
||||
pipsSvg['SYS'].push(<Pip className='half' key={'half'} />);
|
||||
}
|
||||
for (let i = Math.floor(sys + 0.5); i < 4; i++) {
|
||||
pipsSvg['SYS'].push(<Pip className='empty' key={i} />);
|
||||
}
|
||||
|
||||
// ENG
|
||||
pipsSvg['ENG'] = [];
|
||||
for (let i = 0; i < Math.floor(eng); i++) {
|
||||
pipsSvg['ENG'].push(<Pip className='full' key={i} />);
|
||||
}
|
||||
if (eng > Math.floor(eng)) {
|
||||
pipsSvg['ENG'].push(<Pip className='half' key={'half'} />);
|
||||
}
|
||||
for (let i = Math.floor(eng + 0.5); i < 4; i++) {
|
||||
pipsSvg['ENG'].push(<Pip className='empty' key={i} />);
|
||||
}
|
||||
|
||||
// WEP
|
||||
pipsSvg['WEP'] = [];
|
||||
for (let i = 0; i < Math.floor(wep); i++) {
|
||||
pipsSvg['WEP'].push(<Pip className='full' key={i} />);
|
||||
}
|
||||
if (wep > Math.floor(wep)) {
|
||||
pipsSvg['WEP'].push(<Pip className='half' key={'half'} />);
|
||||
}
|
||||
for (let i = Math.floor(wep + 0.5); i < 4; i++) {
|
||||
pipsSvg['WEP'].push(<Pip className='empty' key={i} />);
|
||||
for (let k in this.props.pips) {
|
||||
let { base, mc } = this.props.pips[k];
|
||||
for (let i = 0; i < Math.floor(base); i++) {
|
||||
pipsSvg[k].push(<Pip key={i} className='full' />);
|
||||
}
|
||||
if (base > Math.floor(base)) {
|
||||
pipsSvg[k].push(<Pip className='half' key={'half'} />);
|
||||
}
|
||||
for (let i = 0; i < mc; i++) {
|
||||
pipsSvg[k].push(<Pip key={base + i} className='mc' />);
|
||||
}
|
||||
for (let i = Math.ceil(base + mc); i < 4; i++) {
|
||||
pipsSvg[k].push(<Pip className='empty' key={i} />);
|
||||
}
|
||||
}
|
||||
|
||||
return pipsSvg;
|
||||
@@ -260,15 +121,10 @@ export default class Pips extends TranslatedComponent {
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { formats, translate, units } = this.context.language;
|
||||
const { sys, eng, wep } = this.props;
|
||||
const { ship } = this.props;
|
||||
const { translate } = this.context.language;
|
||||
|
||||
const onSysClicked = this.onClick.bind(this, 'SYS');
|
||||
const onEngClicked = this.onClick.bind(this, 'ENG');
|
||||
const onWepClicked = this.onClick.bind(this, 'WEP');
|
||||
const onRstClicked = this.onClick.bind(this, 'RST');
|
||||
|
||||
const pipsSvg = this._renderPips(sys, eng, wep);
|
||||
const pipsSvg = this._renderPips();
|
||||
return (
|
||||
<span id='pips'>
|
||||
<table>
|
||||
@@ -276,20 +132,40 @@ export default class Pips extends TranslatedComponent {
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={onEngClicked}>{pipsSvg['ENG']}</td>
|
||||
<td className='clickable' onClick={this._incEng}>{pipsSvg.Eng}</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={onSysClicked}>{pipsSvg['SYS']}</td>
|
||||
<td className='clickable' onClick={onEngClicked}>{translate('ENG')}</td>
|
||||
<td className='clickable' onClick={onWepClicked}>{pipsSvg['WEP']}</td>
|
||||
<td className='clickable' onClick={this._incSys}>{pipsSvg.Sys}</td>
|
||||
<td className='clickable' onClick={this._incEng}>
|
||||
{translate('ENG')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._incWep}>{pipsSvg.Wep}</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={onSysClicked}>{translate('SYS')}</td>
|
||||
<td className='clickable' onClick={onRstClicked}>{translate('RST')}</td>
|
||||
<td className='clickable' onClick={onWepClicked}>{translate('WEP')}</td>
|
||||
<td className='clickable' onClick={this._incSys}>
|
||||
{translate('SYS')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._reset}>
|
||||
{translate('RST')}
|
||||
</td>
|
||||
<td className='clickable' onClick={this._incWep}>
|
||||
{translate('WEP')}
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td> </td>
|
||||
<td className='clickable' onClick={this._change(ship.incSys, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
<td className='clickable' onClick={this._change(ship.incEng, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
<td className='clickable' onClick={this._change(ship.incWep, true)}>
|
||||
<Pip className='mc' />
|
||||
</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
@@ -4,27 +4,25 @@ import * as d3 from 'd3';
|
||||
import cn from 'classnames';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { Ship } from 'ed-forge';
|
||||
import { POWER_METRICS } from 'ed-forge/lib/ship-stats';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Round to avoid floating point precision errors
|
||||
* Get the band-class.
|
||||
* @param {Boolean} selected Band selected
|
||||
* @param {number} sum Band power sum
|
||||
* @param {number} avail Total available power
|
||||
* @return {string} CSS Class name
|
||||
* @param {Number} relDraw Relative amount of power drawn by this band and
|
||||
* all prior
|
||||
* @return {string} CSS Class name
|
||||
*/
|
||||
function getClass(selected, sum, avail) {
|
||||
return selected ? 'secondary' : ((Math.round(sum * 100) / 100) >= avail) ? 'warning' : 'primary';
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the # label for a Priority band
|
||||
* @param {number} val Priority Band Watt value
|
||||
* @param {number} index Priority Band index
|
||||
* @param {Function} wattScale Watt Scale function
|
||||
* @return {number} label / text
|
||||
*/
|
||||
function bandText(val, index, wattScale) {
|
||||
return (val > 0 && wattScale(val) > 13) ? index + 1 : null;
|
||||
function getClass(selected, relDraw) {
|
||||
if (selected) {
|
||||
return 'secondary';
|
||||
} else if (relDraw >= 1) {
|
||||
return 'warning';
|
||||
} else {
|
||||
return 'primary';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -32,12 +30,10 @@ function bandText(val, index, wattScale) {
|
||||
* Renders the SVG to simulate in-game power bands
|
||||
*/
|
||||
export default class PowerBands extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
bands: PropTypes.array.isRequired,
|
||||
available: PropTypes.number.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
width: PropTypes.number.isRequired,
|
||||
code: PropTypes.string,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -47,20 +43,16 @@ export default class PowerBands extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
this.wattScale = d3.scaleLinear();
|
||||
this.pctScale = d3.scaleLinear().domain([0, 1]);
|
||||
this.wattAxis = d3.axisTop(this.wattScale).tickSizeOuter(0).tickFormat(context.language.formats.r2);
|
||||
this.pctAxis = d3.axisBottom(this.pctScale).tickSizeOuter(0).tickFormat(context.language.formats.rPct);
|
||||
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
this._updateScales = this._updateScales.bind(this);
|
||||
this._selectNone = this._selectNone.bind(this);
|
||||
this._hidetip = () => this.context.tooltip();
|
||||
|
||||
let maxBand = props.bands[props.bands.length - 1];
|
||||
|
||||
this.profile = props.ship.getMetrics(POWER_METRICS);
|
||||
this.state = {
|
||||
maxPwr: Math.max(props.available, maxBand.retractedSum, maxBand.deployedSum),
|
||||
ret: {},
|
||||
dep: {}
|
||||
};
|
||||
@@ -84,8 +76,6 @@ export default class PowerBands extends TranslatedComponent {
|
||||
let mRight = Math.round(140 * scale);
|
||||
let innerWidth = props.width - mLeft - mRight;
|
||||
|
||||
this._updateScales(innerWidth, this.state.maxPwr, props.available);
|
||||
|
||||
this.setState({
|
||||
barHeight,
|
||||
innerHeight,
|
||||
@@ -141,41 +131,67 @@ export default class PowerBands extends TranslatedComponent {
|
||||
this.setState({ dep: Object.assign({}, dep) });
|
||||
}
|
||||
|
||||
/**
|
||||
* Update scale
|
||||
* @param {number} innerWidth SVG innerwidth
|
||||
* @param {number} maxPwr Maximum power level MJ (deployed or available)
|
||||
* @param {number} available Available power MJ
|
||||
*/
|
||||
_updateScales(innerWidth, maxPwr, available) {
|
||||
this.wattScale.range([0, innerWidth]).domain([0, maxPwr]).clamp(true);
|
||||
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / available]).clamp(true);
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state based on property and context changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next context
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
let { innerWidth, maxPwr } = this.state;
|
||||
let { language, sizeRatio } = this.context;
|
||||
let maxBand = nextProps.bands[nextProps.bands.length - 1];
|
||||
let nextMaxPwr = Math.max(nextProps.available, maxBand.retractedSum, maxBand.deployedSum);
|
||||
|
||||
if (language !== nextContext.language) {
|
||||
this.wattAxis.tickFormat(nextContext.language.formats.r2);
|
||||
this.pctAxis.tickFormat(nextContext.language.formats.rPct);
|
||||
}
|
||||
|
||||
if (maxPwr != nextMaxPwr) { // Update Axes if max power has changed
|
||||
this._updateScales(innerWidth, nextMaxPwr, nextProps.available);
|
||||
this.setState({ maxPwr: nextMaxPwr });
|
||||
} else if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
|
||||
if (nextProps.width != this.props.width || sizeRatio != nextContext.sizeRatio) {
|
||||
this._updateDimensions(nextProps, nextContext.sizeRatio);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Assemble bands for relative consumption array.
|
||||
* @param {Number[]} consumed Array of relative-consumption numbers
|
||||
* @param {object} selected Object mapping selected bands to 1
|
||||
* @param {Number} yOffset Offset in y-direction of the bar
|
||||
* @param {Function} onClick onClick callback
|
||||
* @returns {React.Component} Bands
|
||||
*/
|
||||
_consumedToBands(consumed, selected, yOffset, onClick) {
|
||||
const { state, wattScale } = this;
|
||||
const bands = [];
|
||||
let consumesPrev = 0;
|
||||
for (let i = 0; i < consumed.length; i++) {
|
||||
consumesPrev = consumed[i - 1] || consumesPrev;
|
||||
const consumes = consumed[i];
|
||||
|
||||
if (!consumes) {
|
||||
continue;
|
||||
}
|
||||
|
||||
bands.push(<rect
|
||||
key={'b' + i}
|
||||
width={Math.ceil(Math.max(wattScale(consumes - consumesPrev), 0))}
|
||||
height={state.barHeight}
|
||||
x={wattScale(consumesPrev)}
|
||||
y={yOffset + 1}
|
||||
onClick={onClick.bind(this, i)}
|
||||
className={getClass(selected[i], consumes)}
|
||||
/>);
|
||||
|
||||
bands.push(<text
|
||||
key={'t' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(consumesPrev) + (wattScale(consumes - consumesPrev) / 2)}
|
||||
y={yOffset + (state.barHeight / 2)}
|
||||
onClick={onClick.bind(this, i)}
|
||||
className='primary-bg'>{i + 1}</text>
|
||||
);
|
||||
}
|
||||
return bands;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the power bands
|
||||
* @return {React.Component} Power bands
|
||||
@@ -185,78 +201,27 @@ export default class PowerBands extends TranslatedComponent {
|
||||
return null;
|
||||
}
|
||||
|
||||
let { wattScale, pctScale, context, props, state } = this;
|
||||
let { pctScale, context, props, state } = this;
|
||||
let { translate, formats } = context.language;
|
||||
let { f2, pct1 } = formats; // wattFmt, pctFmt
|
||||
let { available, bands } = props;
|
||||
let { innerWidth, ret, dep } = state;
|
||||
let pwrWarningClass = cn('threshold', { exceeded: bands[0].retractedSum > available * 0.4 });
|
||||
let deployed = [];
|
||||
let retracted = [];
|
||||
let { ship } = props;
|
||||
let { innerWidth, ret, dep, barHeight } = state;
|
||||
|
||||
let {
|
||||
consumed, generated, relativeConsumed, relativeConsumedRetracted
|
||||
} = ship.getMetrics(POWER_METRICS);
|
||||
let maxPwr = Math.max(consumed, generated);
|
||||
let retSum = relativeConsumedRetracted[relativeConsumedRetracted.length - 1];
|
||||
let depSum = relativeConsumed[relativeConsumed.length - 1];
|
||||
|
||||
this.wattScale.range([0, innerWidth]).domain([0, 1]).clamp(true);
|
||||
this.pctScale.range([0, innerWidth]).domain([0, maxPwr / generated]).clamp(true);
|
||||
|
||||
let pwrWarningClass = cn('threshold', { exceeded: retSum > generated * 0.4 });
|
||||
let retracted = this._consumedToBands(relativeConsumedRetracted, ret, 0, this._selectRet);
|
||||
let deployed = this._consumedToBands(relativeConsumed, dep, barHeight, this._selectDep);
|
||||
let retSelected = Object.keys(ret).length > 0;
|
||||
let depSelected = Object.keys(dep).length > 0;
|
||||
let retSum = 0;
|
||||
let depSum = 0;
|
||||
|
||||
for (let i = 0; i < bands.length; i++) {
|
||||
let b = bands[i];
|
||||
retSum += (!retSelected || ret[i]) ? b.retracted : 0;
|
||||
depSum += (!depSelected || dep[i]) ? b.deployed + b.retracted : 0;
|
||||
|
||||
if (b.retracted > 0) {
|
||||
let retLbl = bandText(b.retracted, i, wattScale);
|
||||
|
||||
retracted.push(<rect
|
||||
key={'rB' + i}
|
||||
width={Math.ceil(Math.max(wattScale(b.retracted), 0))}
|
||||
height={state.barHeight}
|
||||
x={Math.floor(Math.max(wattScale(b.retractedSum) - wattScale(b.retracted), 0))}
|
||||
y={1}
|
||||
onClick={this._selectRet.bind(this, i)}
|
||||
className={getClass(ret[i], b.retractedSum, available)}
|
||||
/>);
|
||||
|
||||
if (retLbl) {
|
||||
retracted.push(<text
|
||||
key={'rT' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(b.retractedSum) - (wattScale(b.retracted) / 2)}
|
||||
y={state.retY}
|
||||
onClick={this._selectRet.bind(this, i)}
|
||||
className='primary-bg'>{retLbl}</text>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
if (b.retracted > 0 || b.deployed > 0) {
|
||||
let depLbl = bandText(b.deployed + b.retracted, i, wattScale);
|
||||
|
||||
deployed.push(<rect
|
||||
key={'dB' + i}
|
||||
width={Math.ceil(Math.max(wattScale(b.deployed + b.retracted), 0))}
|
||||
height={state.barHeight}
|
||||
x={Math.floor(Math.max(wattScale(b.deployedSum) - wattScale(b.retracted) - wattScale(b.deployed), 0))}
|
||||
y={state.barHeight + 1}
|
||||
onClick={this._selectDep.bind(this, i)}
|
||||
className={getClass(dep[i], b.deployedSum, available)}
|
||||
/>);
|
||||
|
||||
if (depLbl) {
|
||||
deployed.push(<text
|
||||
key={'dT' + i}
|
||||
dy='0.5em'
|
||||
textAnchor='middle'
|
||||
height={state.barHeight}
|
||||
x={wattScale(b.deployedSum) - ((wattScale(b.retracted) + wattScale(b.deployed)) / 2)}
|
||||
y={state.depY}
|
||||
onClick={this._selectDep.bind(this, i)}
|
||||
className='primary-bg'>{depLbl}</text>
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return (
|
||||
<svg style={{ marginTop: '1em', width: '100%', height: state.height }} onContextMenu={wrapCtxMenu(this._selectNone)}>
|
||||
@@ -272,8 +237,8 @@ export default class PowerBands extends TranslatedComponent {
|
||||
<line x1={pctScale(0.4)} x2={pctScale(0.4)} y1='0' y2={state.innerHeight} className={pwrWarningClass} />
|
||||
<text dy='0.5em' x='-3' y={state.retY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'retracted')} onMouseLeave={this._hidetip}>{translate('ret')}</text>
|
||||
<text dy='0.5em' x='-3' y={state.depY} className='primary upp' textAnchor='end' onMouseOver={this.context.termtip.bind(null, 'deployed', { orientation: 's', cap: 1 })} onMouseLeave={this._hidetip}>{translate('dep')}</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, available)}>{f2(Math.max(0, retSum))} ({pct1(Math.max(0, retSum / available))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, available)}>{f2(Math.max(0, depSum))} ({pct1(Math.max(0, depSum / available))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.retY} className={getClass(retSelected, retSum, generated)}>{f2(Math.max(0, retSum * generated))} ({pct1(Math.max(0, retSum))})</text>
|
||||
<text dy='0.5em' x={innerWidth + 5} y={state.depY} className={getClass(depSelected, depSum, generated)}>{f2(Math.max(0, depSum * generated))} ({pct1(Math.max(0, depSum))})</text>
|
||||
</g>
|
||||
</svg>
|
||||
);
|
||||
|
||||
@@ -3,24 +3,49 @@ import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import PowerBands from './PowerBands';
|
||||
import { slotName, slotComparator } from '../utils/SlotFunctions';
|
||||
import { Power, NoPower } from './SvgIcons';
|
||||
import autoBind from 'auto-bind';
|
||||
import { Ship, Module } from 'ed-forge';
|
||||
|
||||
const POWER = [
|
||||
null,
|
||||
null,
|
||||
<NoPower className='icon warning' />,
|
||||
<Power className='secondary-disabled' />
|
||||
];
|
||||
/**
|
||||
* Makes a comparison based on the order `false < undefined < true` (fut) and
|
||||
* maps it to `[-1, 0, 1]`.
|
||||
* @param {boolean} a Bool or undefined
|
||||
* @param {boolean} b Bool or undefined
|
||||
* @returns {number} Comparison
|
||||
*/
|
||||
function futComp(a, b) {
|
||||
switch (a) {
|
||||
case false: return (b === false ? 0 : 1);
|
||||
// The next else-expression maps false to -1 and true to 1
|
||||
case undefined: return (b === undefined ? 0 : 2 * Number(b) - 1);
|
||||
case true: return (b === true ? 0 : -1);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the enabled-icon.
|
||||
* @param {boolean} enabled Is the module enabled?
|
||||
* @returns {React.Component} Enabled icon.
|
||||
*/
|
||||
function getPowerIcon(enabled) {
|
||||
if (enabled === undefined) {
|
||||
return null;
|
||||
}
|
||||
if (enabled) {
|
||||
return <Power className='secondary-disabled' />;
|
||||
} else {
|
||||
return <NoPower className='icon warning' />;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Power Management Section
|
||||
*/
|
||||
export default class PowerManagement extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship).isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
onChange: PropTypes.func.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -29,19 +54,17 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._renderPowerRows = this._renderPowerRows.bind(this);
|
||||
this._updateWidth = this._updateWidth.bind(this);
|
||||
this._sort = this._sort.bind(this);
|
||||
autoBind(this);
|
||||
|
||||
this.state = {
|
||||
predicate: 'pwr',
|
||||
desc: false,
|
||||
desc: true,
|
||||
width: 0
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the sort order and sort
|
||||
* Set the sort order
|
||||
* @param {string} predicate Sort predicate
|
||||
*/
|
||||
_sortOrder(predicate) {
|
||||
@@ -53,50 +76,51 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
desc = true;
|
||||
}
|
||||
|
||||
this._sort(this.props.ship, predicate, desc);
|
||||
this.setState({ predicate, desc });
|
||||
}
|
||||
|
||||
/**
|
||||
* Sorts the power list
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {string} predicate Sort predicate
|
||||
* @param {Boolean} desc Sort order descending
|
||||
* @param {Module[]} modules Modules to sort
|
||||
* @returns {Module[]} Sorted modules
|
||||
*/
|
||||
_sort(ship, predicate, desc) {
|
||||
let powerList = ship.powerList;
|
||||
let comp = slotComparator.bind(null, this.context.language.translate);
|
||||
|
||||
_sortAndFilter(modules) {
|
||||
modules = modules.filter((m) => m.get('powerdraw') >= 0);
|
||||
let { translate } = this.context.language;
|
||||
const { predicate, desc } = this.state;
|
||||
let comp;
|
||||
switch (predicate) {
|
||||
case 'n': comp = comp(null, desc); break;
|
||||
case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
|
||||
case 'pri': comp = comp((a, b) => a.priority - b.priority, desc); break;
|
||||
case 'pwr': comp = comp((a, b) => a.m.getPowerUsage() - b.m.getPowerUsage(), desc); break;
|
||||
case 'r': comp = comp((a, b) => ship.getSlotStatus(a) - ship.getSlotStatus(b), desc); break;
|
||||
case 'd': comp = comp((a, b) => ship.getSlotStatus(a, true) - ship.getSlotStatus(b, true), desc); break;
|
||||
case 'n': comp = (a, b) => translate(a.readMeta('type')).localeCompare(
|
||||
translate(b.readMeta('type'))
|
||||
); break;
|
||||
// case 't': comp = comp((a, b) => a.type.localeCompare(b.type), desc); break;
|
||||
case 'pri': comp = (a, b) => a.getPowerPriority() - b.getPowerPriority(); break;
|
||||
case 'pwr': comp = (a, b) => a.get('powerdraw') - b.get('powerdraw'); break;
|
||||
case 'r': comp = (a, b) => futComp(a.isPowered().retracted, b.isPowered().retracted); break;
|
||||
case 'd': comp = (a, b) => futComp(a.isPowered().deployed, b.isPowered().deployed); break;
|
||||
}
|
||||
|
||||
powerList.sort(comp);
|
||||
modules.sort(comp);
|
||||
if (desc) {
|
||||
modules.reverse();
|
||||
}
|
||||
return modules;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update slot priority
|
||||
* @param {Object} slot Slot model
|
||||
* @param {number} inc increment / decrement
|
||||
* Creates a callback that changes the power priority for the given module
|
||||
* based on the given delta.
|
||||
* @param {Module} m Module to set the priority for
|
||||
* @param {Number} delta Delta to set
|
||||
* @returns {Function} Callback
|
||||
*/
|
||||
_priority(slot, inc) {
|
||||
if (this.props.ship.setSlotPriority(slot, slot.priority + inc)) {
|
||||
this.props.onChange();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle slot active/inactive
|
||||
* @param {Object} slot Slot model
|
||||
*/
|
||||
_toggleEnabled(slot) {
|
||||
this.props.ship.setSlotEnabled(slot, !slot.enabled);
|
||||
this.props.onChange();
|
||||
_prioCb(m, delta) {
|
||||
return () => {
|
||||
const prio = m.getPowerPriority();
|
||||
const newPrio = Math.max(0, prio + delta);
|
||||
if (0 <= newPrio) {
|
||||
m.setPowerPriority(newPrio);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -110,36 +134,35 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
_renderPowerRows(ship, translate, pwr, pct) {
|
||||
let powerRows = [];
|
||||
|
||||
for (let i = 0, l = ship.powerList.length; i < l; i++) {
|
||||
let slot = ship.powerList[i];
|
||||
|
||||
if (slot.m && slot.m.getPowerUsage() > 0) {
|
||||
let m = slot.m;
|
||||
let toggleEnabled = this._toggleEnabled.bind(this, slot);
|
||||
let retractedElem = null, deployedElem = null;
|
||||
|
||||
if (slot.enabled) {
|
||||
retractedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, false)]}</td>;
|
||||
deployedElem = <td className='ptr upp' onClick={toggleEnabled}>{POWER[ship.getSlotStatus(slot, true)]}</td>;
|
||||
} else {
|
||||
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={toggleEnabled}>{translate('disabled')}</td>;
|
||||
}
|
||||
|
||||
powerRows.push(<tr key={i} className={cn('highlight', { disabled: !slot.enabled })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={toggleEnabled}>{m.class + m.rating}</td>
|
||||
<td className='ptr le shorten cap' onClick={toggleEnabled}>{slotName(translate, slot)}</td>
|
||||
<td className='ptr' onClick={toggleEnabled}><u>{translate(slot.type)}</u></td>
|
||||
<td>
|
||||
<span className='flip ptr btn' onClick={this._priority.bind(this, slot, -1)}>►</span>
|
||||
{' ' + (slot.priority + 1) + ' '}
|
||||
<span className='ptr btn' onClick={this._priority.bind(this, slot, 1)}>►</span>
|
||||
</td>
|
||||
<td className='ri ptr' style={{ width: '3.25em' }} onClick={toggleEnabled}>{pwr(m.getPowerUsage())}</td>
|
||||
<td className='ri ptr' style={{ width: '3em' }} onClick={toggleEnabled}><u>{pct(m.getPowerUsage() / ship.powerAvailable)}</u></td>
|
||||
{retractedElem}
|
||||
{deployedElem}
|
||||
</tr>);
|
||||
let modules = this._sortAndFilter(ship.getModules());
|
||||
for (let m of modules) {
|
||||
let retractedElem = null, deployedElem = null;
|
||||
const flipEnabled = () => m.setEnabled();
|
||||
if (m.isEnabled()) {
|
||||
let powered = m.isPowered();
|
||||
retractedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.retracted)}</td>;
|
||||
deployedElem = <td className='ptr upp' onClick={flipEnabled}>{getPowerIcon(powered.deployed)}</td>;
|
||||
} else {
|
||||
retractedElem = <td className='ptr disabled upp' colSpan='2' onClick={flipEnabled}>{translate('disabled')}</td>;
|
||||
}
|
||||
|
||||
const slot = m.getSlot();
|
||||
powerRows.push(<tr key={slot} className={cn('highlight', { disabled: !m.isEnabled() })}>
|
||||
<td className='ptr' style={{ width: '1em' }} onClick={flipEnabled}>{String(m.getClass()) + m.getRating()}</td>
|
||||
<td className='ptr le shorten cap' onClick={flipEnabled}>{translate(m.readMeta('type'))}</td>
|
||||
{/* <td className='ptr' onClick={flipEnabled}><u>{translate(slot.type)}</u></td> */}
|
||||
<td>
|
||||
<span className='flip ptr btn' onClick={this._prioCb(m, -1)}>►</span>
|
||||
{' ' + (m.getPowerPriority() + 1) + ' '}
|
||||
<span className='ptr btn' onClick={this._prioCb(m, 1)}>►</span>
|
||||
</td>
|
||||
<td className='ri ptr' style={{ width: '3.25em' }} onClick={flipEnabled}>{pwr(m.get('powerdraw'))}</td>
|
||||
<td className='ri ptr' style={{ width: '3em' }} onClick={flipEnabled}>
|
||||
<u>{pct(m.get('powerdraw') / ship.getPowerPlant().get('powercapacity'))}</u>
|
||||
</td>
|
||||
{retractedElem}
|
||||
{deployedElem}
|
||||
</tr>);
|
||||
}
|
||||
return powerRows;
|
||||
}
|
||||
@@ -155,7 +178,6 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
* Add listeners when about to mount and sort power list
|
||||
*/
|
||||
componentWillMount() {
|
||||
this._sort(this.props.ship, this.state.predicate, this.state.desc);
|
||||
this.resizeListener = this.context.onWindowResize(this._updateWidth);
|
||||
}
|
||||
|
||||
@@ -166,17 +188,6 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
this._updateWidth();
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort power list if the ship instance has changed
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextState Incoming/Next state
|
||||
*/
|
||||
componentWillUpdate(nextProps, nextState) {
|
||||
if (this.props.ship != nextProps.ship) {
|
||||
this._sort(nextProps.ship, nextState.predicate, nextState.desc);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove listeners on unmount
|
||||
*/
|
||||
@@ -191,39 +202,38 @@ export default class PowerManagement extends TranslatedComponent {
|
||||
render() {
|
||||
let { ship, code } = this.props;
|
||||
let { translate, formats } = this.context.language;
|
||||
let pwr = formats.f2;
|
||||
let pp = ship.standard[0].m;
|
||||
let sortOrder = this._sortOrder;
|
||||
let pp = ship.getPowerPlant();
|
||||
|
||||
return (
|
||||
<div ref={node => this.node = node} className='group half' id='componentPriority'>
|
||||
<table style={{ width: '100%' }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th colSpan='2' className='sortable le' onClick={sortOrder.bind(this, 'n')} >{translate('module')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 't')} >{translate('type')}</th>
|
||||
<th style={{ width: '4em' }} className='sortable' onClick={sortOrder.bind(this, 'pri')} >{translate('pri')}</th>
|
||||
<th colSpan='2' className='sortable' onClick={sortOrder.bind(this, 'pwr')} >{translate('PWR')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'r')} >{translate('ret')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={sortOrder.bind(this, 'd')} >{translate('dep')}</th>
|
||||
<th colSpan='2' className='sortable le' onClick={() => this._sortOrder('n')} >{translate('module')}</th>
|
||||
{/* <th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('t')} >{translate('type')}</th> */}
|
||||
<th style={{ width: '4em' }} className='sortable' onClick={() => this._sortOrder('pri')} >{translate('pri')}</th>
|
||||
<th colSpan='2' className='sortable' onClick={() => this._sortOrder('pwr')} >{translate('PWR')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('r')} >{translate('ret')}</th>
|
||||
<th style={{ width: '3em' }} className='sortable' onClick={() => this._sortOrder('d')} >{translate('dep')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{pp.class + pp.rating}</td>
|
||||
<td>{String(pp.getClass()) + pp.getRating()}</td>
|
||||
<td className='le shorten cap' >{translate('pp')}</td>
|
||||
<td><u >{translate('SYS')}</u></td>
|
||||
<td>1</td>
|
||||
<td className='ri'>{pwr(pp.getPowerGeneration())}</td>
|
||||
<td className='ri'>{formats.f2(pp.get('powercapacity'))}</td>
|
||||
<td className='ri'><u>100%</u></td>
|
||||
<td></td>
|
||||
<td></td>
|
||||
</tr>
|
||||
<tr><td style={{ lineHeight:0 }} colSpan='8'><hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} /></td></tr>
|
||||
{this._renderPowerRows(ship, translate, pwr, formats.pct1)}
|
||||
<tr><td style={{ lineHeight:0 }} colSpan='8'>
|
||||
<hr style={{ margin: '0 0 3px', background: '#ff8c0d', border: 0, height: 1 }} />
|
||||
</td></tr>
|
||||
{this._renderPowerRows(ship, translate, formats.f2, formats.pct1)}
|
||||
</tbody>
|
||||
</table>
|
||||
<PowerBands width={this.state.width} code={code} available={pp.getPowerGeneration()} bands={ship.priorityBands} />
|
||||
<PowerBands width={this.state.width} ship={ship} code={code} />
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,11 +1,11 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { Rocket } from './SvgIcons';
|
||||
import Persist from '../stores/Persist';
|
||||
import cn from 'classnames';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Ship picker
|
||||
@@ -27,13 +27,9 @@ export default class ShipPicker extends TranslatedComponent {
|
||||
* @param {object} props Properties react
|
||||
* @param {object} context react context
|
||||
*/
|
||||
constructor(props, context) { // eslint-disable-line
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
|
||||
this.shipOrder = Object.keys(Ships).sort();
|
||||
this._toggleMenu = this._toggleMenu.bind(this);
|
||||
this._closeMenu = this._closeMenu.bind(this);
|
||||
|
||||
autoBind(this);
|
||||
this.state = { menuOpen: false };
|
||||
}
|
||||
|
||||
@@ -115,11 +111,11 @@ export default class ShipPicker extends TranslatedComponent {
|
||||
<span className='menu-item-label'>{shipString}</span>
|
||||
</div>
|
||||
{ menuOpen ?
|
||||
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
|
||||
<div className='quad'>
|
||||
{this._renderPickerMenu()}
|
||||
</div>
|
||||
</div> : null }
|
||||
<div className='menu-list' onClick={ (e) => e.stopPropagation() }>
|
||||
<div className='quad'>
|
||||
{this._renderPickerMenu()}
|
||||
</div>
|
||||
</div> : null }
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
|
||||
@@ -1,103 +1,285 @@
|
||||
import autoBind from 'auto-bind';
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import { Warning } from './SvgIcons';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const {
|
||||
SPEED, BOOST_SPEED, DAMAGE_METRICS, JUMP_METRICS, SHIELD_METRICS,
|
||||
ARMOUR_METRICS, CARGO_CAPACITY, FUEL_CAPACITY, UNLADEN_MASS, MAXIMUM_MASS,
|
||||
MODULE_PROTECTION_METRICS, PASSENGER_CAPACITY
|
||||
} = ShipProps;
|
||||
|
||||
/**
|
||||
* Ship Summary Table / Stats
|
||||
*/
|
||||
export default class ShipSummaryTable extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
cargo: PropTypes.number.isRequired,
|
||||
fuel: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired,
|
||||
code: PropTypes.string.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* The ShipSummaryTable constructor
|
||||
* @param {Object} props The props
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
autoBind(this);
|
||||
this.state = {
|
||||
shieldColour: 'blue'
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the table
|
||||
* @return {React.Component} Summary table
|
||||
*/
|
||||
render() {
|
||||
const { ship, cargo, fuel } = this.props;
|
||||
const { ship } = this.props;
|
||||
let { language, tooltip, termtip } = this.context;
|
||||
let translate = language.translate;
|
||||
let u = language.units;
|
||||
let formats = language.formats;
|
||||
let { time, int, round, f1, f2 } = formats;
|
||||
let { time, int, f1, f2 } = formats;
|
||||
let hide = tooltip.bind(null, null);
|
||||
|
||||
const shieldGenerator = ship.findInternalByGroup('sg');
|
||||
const sgClassNames = cn({ warning: shieldGenerator && !ship.shield, muted: !shieldGenerator });
|
||||
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
|
||||
const timeToDrain = Calc.timeToDrainWep(ship, 4);
|
||||
const canThrust = ship.canThrust(cargo, ship.fuelCapacity);
|
||||
const speed = ship.get(SPEED);
|
||||
const shipBoost = ship.get(BOOST_SPEED);
|
||||
const canThrust = 0 < speed;
|
||||
const canBoost = canThrust && !isNaN(shipBoost);
|
||||
const speedTooltip = canThrust ? 'TT_SUMMARY_SPEED' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
|
||||
const canBoost = ship.canBoost(cargo, ship.fuelCapacity);
|
||||
const boostTooltip = canBoost ? 'TT_SUMMARY_BOOST' : canThrust ? 'TT_SUMMARY_BOOST_NONFUNCTIONAL' : 'TT_SUMMARY_SPEED_NONFUNCTIONAL';
|
||||
|
||||
const sgMetrics = ship.get(SHIELD_METRICS);
|
||||
const armourMetrics = ship.get(ARMOUR_METRICS);
|
||||
const damageMetrics = ship.get(DAMAGE_METRICS);
|
||||
const moduleProtectionMetrics = ship.get(MODULE_PROTECTION_METRICS);
|
||||
const timeToDrain = damageMetrics.timeToDrain[8];
|
||||
|
||||
const shieldGenerator = ship.getShieldGenerator();
|
||||
const sgClassNames = cn({
|
||||
warning: shieldGenerator && !shieldGenerator.isEnabled(),
|
||||
muted: !shieldGenerator,
|
||||
});
|
||||
const sgTooltip = shieldGenerator ? 'TT_SUMMARY_SHIELDS' : 'TT_SUMMARY_SHIELDS_NONFUNCTIONAL';
|
||||
const sgType = shieldGenerator ? shieldGenerator.readMeta('type') : undefined;
|
||||
let shieldColour = 'blue';
|
||||
switch (sgType) {
|
||||
case 'biweaveshieldgen': shieldColour = 'purple'; break;
|
||||
case 'prismaticshieldgen': shieldColour = 'green'; break;
|
||||
}
|
||||
this.state = { shieldColour };
|
||||
|
||||
const jumpRangeMetrics = ship.getMetrics(JUMP_METRICS);
|
||||
// TODO:
|
||||
const canJump = true;
|
||||
|
||||
return <div id='summary'>
|
||||
<table id='summaryTable'>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canThrust }) }>{translate('speed')}</th>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
|
||||
<th colSpan={5}>{translate('jump range')}</th>
|
||||
<th rowSpan={2}>{translate('shield')}</th>
|
||||
<th rowSpan={2}>{translate('integrity')}</th>
|
||||
<th rowSpan={2}>{translate('DPS')}</th>
|
||||
<th rowSpan={2}>{translate('EPS')}</th>
|
||||
<th rowSpan={2}>{translate('TTD')}</th>
|
||||
{/* <th onMouseEnter={termtip.bind(null, 'heat per second')} onMouseLeave={hide} rowSpan={2}>{translate('HPS')}</th> */}
|
||||
<th rowSpan={2}>{translate('cargo')}</th>
|
||||
<th rowSpan={2}>{translate('pax')}</th>
|
||||
<th rowSpan={2}>{translate('fuel')}</th>
|
||||
<th colSpan={3}>{translate('mass')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'hull hardness', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('hrd')}</th>
|
||||
<th rowSpan={2}>{translate('crew')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='lft'>{translate('max')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
<th>{translate('total unladen')}</th>
|
||||
<th>{translate('total laden')}</th>
|
||||
<th className='lft'>{translate('hull')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })} onMouseLeave={hide}>{ canThrust ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, false))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })} onMouseLeave={hide}>{ canBoost ? <span>{int(ship.calcSpeed(4, ship.fuelCapacity, 0, true))}{u['m/s']}</span> : <span className='warning'>0 <Warning/></span> }</td>
|
||||
<td><span onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{f2(Calc.jumpRange(ship.unladenMass + ship.standard[2].m.getMaxFuelPerJump(), ship.standard[2].m, ship.standard[2].m.getMaxFuelPerJump()))}{u.LY}</span></td>
|
||||
<td><span onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity))}{u.LY}</span></td>
|
||||
<td><span onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })} onMouseLeave={hide}>{f2(Calc.jumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity))}{u.LY}</span></td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity, ship.standard[2].m, ship.fuelCapacity))}{u.LY}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })} onMouseLeave={hide}>{f2(Calc.totalJumpRange(ship.unladenMass + ship.fuelCapacity + ship.cargoCapacity, ship.standard[2].m, ship.fuelCapacity))}{u.LY}</td>
|
||||
<td className={sgClassNames} onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })} onMouseLeave={hide}>{int(ship.shield)}{u.MJ}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })} onMouseLeave={hide}>{int(ship.armour)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalDps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })} onMouseLeave={hide}>{f1(ship.totalEps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })} onMouseLeave={hide}>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
|
||||
{/* <td>{f1(ship.totalHps)}</td> */}
|
||||
<td>{round(ship.cargoCapacity)}{u.T}</td>
|
||||
<td>{ship.passengerCapacity}</td>
|
||||
<td>{round(ship.fuelCapacity)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })} onMouseLeave={hide}>{ship.hullMass}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.unladenMass)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })} onMouseLeave={hide}>{int(ship.ladenMass)}{u.T}</td>
|
||||
<td>{int(ship.hardness)}</td>
|
||||
<td>{ship.crew}</td>
|
||||
<td>{ship.masslock}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<div style={{ display: 'table', width: '100%' }}>
|
||||
<div style={{ display: 'table-row' }}>
|
||||
<table className={'summaryTable'}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': speed == 0 }) }>{translate('speed')}</th>
|
||||
<th rowSpan={2} className={ cn({ 'bg-warning-disabled': !canBoost }) }>{translate('boost')}</th>
|
||||
<th colSpan={5} className={ cn({ 'bg-warning-disabled': jumpRangeMetrics.jumpRange == 0 }) }>{translate('jump range')}</th>
|
||||
<th rowSpan={2}>{translate('shield')}</th>
|
||||
<th rowSpan={2}>{translate('integrity')}</th>
|
||||
<th rowSpan={2}>{translate('DPS')}</th>
|
||||
<th rowSpan={2}>{translate('EPS')}</th>
|
||||
<th rowSpan={2}>{translate('TTD')}</th>
|
||||
{/* <th onMouseEnter={termtip.bind(null, 'heat per second')} onMouseLeave={hide} rowSpan={2}>{translate('HPS')}</th> */}
|
||||
<th rowSpan={2}>{translate('cargo')}</th>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'passenger capacity', { cap: 0 })} onMouseLeave={hide}>{translate('pax')}</th>
|
||||
<th rowSpan={2}>{translate('fuel')}</th>
|
||||
<th colSpan={3}>{translate('mass')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'hull hardness', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('hrd')}</th>
|
||||
<th rowSpan={2}>{translate('crew')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'mass lock factor', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('MLF')}</th>
|
||||
<th onMouseEnter={termtip.bind(null, 'TT_SUMMARY_BOOST_INTERVAL', { cap: 0 })} onMouseLeave={hide} rowSpan={2}>{translate('boost interval')}</th>
|
||||
<th rowSpan={2}>{translate('resting heat (Beta)')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className="lft">{translate('max')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
<th>{translate('total unladen')}</th>
|
||||
<th>{translate('total laden')}</th>
|
||||
<th className='lft'>{translate('hull')}</th>
|
||||
<th>{translate('unladen')}</th>
|
||||
<th>{translate('laden')}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td onMouseEnter={termtip.bind(null, speedTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canThrust ?
|
||||
<span>{int(speed)}{u['m/s']}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, boostTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canBoost ?
|
||||
<span>{int(shipBoost)}{u['m/s']}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_MAX_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canJump ?
|
||||
// TODO:
|
||||
<span>{NaN}{u.LY}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canJump ?
|
||||
// TODO:
|
||||
<span>{NaN}{u.LY}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_SINGLE_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canJump ?
|
||||
<span>{f2(jumpRangeMetrics.jumpRange)}{u.LY}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_TOTAL_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canJump ?
|
||||
// TODO:
|
||||
<span>{NaN}{u.LY}</span> :
|
||||
<span className='warning'>0 <Warning/></span>
|
||||
}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_TOTAL_JUMP', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{canJump ?
|
||||
<span>{f2(jumpRangeMetrics.totalRange)}{u.LY}</span> :
|
||||
<span className='warning'>0<Warning/></span>
|
||||
}</td>
|
||||
<td className={sgClassNames}
|
||||
onMouseEnter={termtip.bind(null, sgTooltip, { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(sgMetrics.shieldStrength)}{u.MJ}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_INTEGRITY', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(armourMetrics.armour)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_DPS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{f1(damageMetrics.dps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_EPS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{f1(damageMetrics.eps)}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_TTD', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{timeToDrain === Infinity ? '∞' : time(timeToDrain)}</td>
|
||||
{/* <td>{f1(ship.totalHps)}</td> */}
|
||||
<td>{ship.get(CARGO_CAPACITY)}{u.T}</td>
|
||||
<td>{ship.get(PASSENGER_CAPACITY)}</td>
|
||||
<td>{ship.get(FUEL_CAPACITY)}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_HULL_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{ship.readProp('hullmass')}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_UNLADEN_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(ship.get(UNLADEN_MASS))}{u.T}</td>
|
||||
<td onMouseEnter={termtip.bind(null, 'TT_SUMMARY_LADEN_MASS', { cap: 0 })}
|
||||
onMouseLeave={hide}
|
||||
>{int(ship.get(MAXIMUM_MASS))}{u.T}</td>
|
||||
<td>{int(ship.readProp('hardness'))}</td>
|
||||
<td>{ship.readMeta('crew')}</td>
|
||||
<td>{ship.readProp('masslock')}</td>
|
||||
{/* TODO: boost intervall */}
|
||||
<td>{NaN}</td>
|
||||
{/* TODO: resting heat */}
|
||||
<td>{NaN}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<table className={'summaryTable'}>
|
||||
<thead className={this.state.shieldColour}>
|
||||
<tr>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'shield', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('shield')}</th>
|
||||
<th colSpan={4} className='lft'>{translate('resistance')}</th>
|
||||
|
||||
<th colSpan={5} onMouseEnter={termtip.bind(null, 'TT_SUMMARY_SHIELDS_SCB', { cap: 0 })} onMouseLeave={hide} className='lft'>{`${translate('HP')}`}</th>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'PHRASE_SG_RECOVER', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('recovery')}</th>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'PHRASE_SG_RECHARGE', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('recharge')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th>{`${translate('explosive')}`}</th>
|
||||
<th>{`${translate('kinetic')}`}</th>
|
||||
<th>{`${translate('thermal')}`}</th>
|
||||
<th></th>
|
||||
|
||||
<th className={'bordered'}>{`${translate('absolute')}`}</th>
|
||||
<th>{`${translate('explosive')}`}</th>
|
||||
<th>{`${translate('kinetic')}`}</th>
|
||||
<th>{`${translate('thermal')}`}</th>
|
||||
<th></th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{translate(sgType || 'No Shield')}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - sgMetrics.thermal.damageMultiplier)}</td>
|
||||
<td></td>
|
||||
|
||||
<td>{int(sgMetrics.shieldStrength || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.explosive.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.kinetic.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td>{int(sgMetrics.shieldStrength / sgMetrics.thermal.damageMultiplier || 0)}{u.MJ}</td>
|
||||
<td></td>
|
||||
<td>{formats.time(sgMetrics.recover) || translate('Never')}</td>
|
||||
<td>{formats.time(sgMetrics.recharge) || translate('Never')}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
<thead>
|
||||
<tr>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'armour', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('armour')}</th>
|
||||
<th colSpan={4} className='lft'>{translate('resistance')}</th>
|
||||
|
||||
<th colSpan={5} onMouseEnter={termtip.bind(null, 'PHRASE_EFFECTIVE_ARMOUR', { cap: 0 })} onMouseLeave={hide} className='lft'>{`${translate('HP')}`}</th>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_ARMOUR', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('raw module armour')}</th>
|
||||
<th rowSpan={2} onMouseEnter={termtip.bind(null, 'TT_MODULE_PROTECTION_INTERNAL', { cap: 0 })} onMouseLeave={hide} className='lft'>{translate('internal protection')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th>{`${translate('explosive')}`}</th>
|
||||
<th>{`${translate('kinetic')}`}</th>
|
||||
<th>{`${translate('thermal')}`}</th>
|
||||
<th>{`${translate('caustic')}`}</th>
|
||||
|
||||
<th className={'bordered'}>{`${translate('absolute')}`}</th>
|
||||
<th>{`${translate('explosive')}`}</th>
|
||||
<th>{`${translate('kinetic')}`}</th>
|
||||
<th>{`${translate('thermal')}`}</th>
|
||||
<th>{`${translate('caustic')}`}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<tr>
|
||||
<td>{translate(ship.getAlloys().readMeta('type') || 'No Armour')}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.thermal.damageMultiplier)}</td>
|
||||
<td>{formats.pct1(1 - armourMetrics.caustic.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.explosive.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.kinetic.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.thermal.damageMultiplier)}</td>
|
||||
<td>{int(armourMetrics.armour / armourMetrics.caustic.damageMultiplier)}</td>
|
||||
<td>{int(moduleProtectionMetrics.moduleArmour)}</td>
|
||||
<td>{formats.pct1(1 - moduleProtectionMetrics.moduleProtection)}</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
</div>
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -17,12 +17,12 @@ export default class Slider extends React.Component {
|
||||
|
||||
static propTypes = {
|
||||
axis: PropTypes.bool,
|
||||
axisUnit: PropTypes.string,
|
||||
axisUnit: PropTypes.string,// units (T, M, etc.)
|
||||
max: PropTypes.number,
|
||||
min: PropTypes.number,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
onChange: PropTypes.func.isRequired,// function which determins percent value
|
||||
onResize: PropTypes.func,
|
||||
percent: PropTypes.number.isRequired,
|
||||
percent: PropTypes.number.isRequired,// value of slider
|
||||
scale: PropTypes.number
|
||||
};
|
||||
|
||||
@@ -35,6 +35,11 @@ export default class Slider extends React.Component {
|
||||
this._down = this._down.bind(this);
|
||||
this._move = this._move.bind(this);
|
||||
this._up = this._up.bind(this);
|
||||
this._keyup = this._keyup.bind(this);
|
||||
this._keydown = this._keydown.bind(this);
|
||||
this._touchstart = this._touchstart.bind(this);
|
||||
this._touchend = this._touchend.bind(this);
|
||||
|
||||
this._updatePercent = this._updatePercent.bind(this);
|
||||
this._updateDimensions = this._updateDimensions.bind(this);
|
||||
|
||||
@@ -50,6 +55,7 @@ export default class Slider extends React.Component {
|
||||
this.left = rect.left;
|
||||
this.width = rect.width;
|
||||
this._move(event);
|
||||
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -69,11 +75,70 @@ export default class Slider extends React.Component {
|
||||
* @param {Event} event DOM Event
|
||||
*/
|
||||
_up(event) {
|
||||
this.sliderInputBox.sliderVal.focus();
|
||||
clearTimeout(this.touchStartTimer);
|
||||
event.preventDefault();
|
||||
this.left = null;
|
||||
this.width = null;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Key up handler for keyboard.
|
||||
* display the number field then set focus to it
|
||||
* when "Enter" key is pressed
|
||||
* @param {Event} event Keyboard event
|
||||
*/
|
||||
_keyup(event) {
|
||||
switch (event.key) {
|
||||
case 'Enter':
|
||||
event.preventDefault();
|
||||
this.sliderInputBox._setDisplay('block');
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Key down handler
|
||||
* increment slider position by +/- 1 when right/left arrow key is pressed or held
|
||||
* @param {Event} event Keyboard even
|
||||
*/
|
||||
_keydown(event) {
|
||||
let newVal = this.props.percent * this.props.max;
|
||||
switch (event.key) {
|
||||
case 'ArrowRight':
|
||||
newVal += 1;
|
||||
if (newVal <= this.props.max) this.props.onChange(newVal / this.props.max);
|
||||
return;
|
||||
case 'ArrowLeft':
|
||||
newVal -= 1;
|
||||
if (newVal >= 0) this.props.onChange(newVal / this.props.max);
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Touch start handler
|
||||
* @param {Event} event DOM Event
|
||||
*
|
||||
*/
|
||||
_touchstart(event) {
|
||||
this.touchStartTimer = setTimeout(() => this.sliderInputBox._setDisplay('block'), 1500);
|
||||
}
|
||||
|
||||
/**
|
||||
* Touch end handler
|
||||
* @param {Event} event DOM Event
|
||||
*
|
||||
*/
|
||||
_touchend(event) {
|
||||
this.sliderInputBox.sliderVal.focus();
|
||||
clearTimeout(this.touchStartTimer);
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if the user is still dragging
|
||||
* @param {SyntheticEvent} event Event
|
||||
@@ -136,31 +201,186 @@ export default class Slider extends React.Component {
|
||||
render() {
|
||||
let outerWidth = this.state.outerWidth;
|
||||
let { axis, axisUnit, min, max, scale } = this.props;
|
||||
|
||||
let style = {
|
||||
width: '100%',
|
||||
height: axis ? '2.5em' : '1.5em',
|
||||
boxSizing: 'border-box'
|
||||
};
|
||||
|
||||
if (!outerWidth) {
|
||||
return <svg style={style} ref={node => this.node = node} />;
|
||||
}
|
||||
|
||||
let margin = MARGIN_LR * scale;
|
||||
let width = outerWidth - (margin * 2);
|
||||
let pctPos = width * this.props.percent;
|
||||
|
||||
return <svg onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onTouchEnd={this._up} style={style} ref={node => this.node = node}>
|
||||
return <div><svg
|
||||
onMouseUp={this._up} onMouseEnter={this._enter.bind(this)} onMouseMove={this._move} onKeyUp={this._keyup} onKeyDown={this._keydown} style={style} ref={node => this.node = node} tabIndex="0">
|
||||
<rect className='primary' style={{ opacity: 0.3 }} x={margin} y='0.25em' rx='0.3em' ry='0.3em' width={width} height='0.7em' />
|
||||
<rect className='primary-disabled' x={margin} y='0.45em' rx='0.15em' ry='0.15em' width={pctPos} height='0.3em' />
|
||||
<circle className='primary' r={margin} cy='0.6em' cx={pctPos + margin} />
|
||||
<rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} />
|
||||
<rect x={margin} width={width} height='100%' fillOpacity='0' style={{ cursor: 'col-resize' }} onMouseDown={this._down} onTouchMove={this._move} onTouchStart={this._down} onTouchEnd={this._touchend} />
|
||||
{axis && <g style={{ fontSize: '.7em' }}>
|
||||
<text className='primary-disabled' y='3em' x={margin} style={{ textAnchor: 'middle' }}>{min + axisUnit}</text>
|
||||
<text className='primary-disabled' y='3em' x='50%' style={{ textAnchor: 'middle' }}>{(min + max / 2) + axisUnit}</text>
|
||||
<text className='primary-disabled' y='3em' x='100%' style={{ textAnchor: 'end' }}>{max + axisUnit}</text>
|
||||
</g>}
|
||||
</svg>;
|
||||
</svg>
|
||||
<TextInputBox ref={(tb) => this.sliderInputBox = tb}
|
||||
onChange={this.props.onChange}
|
||||
percent={this.props.percent}
|
||||
axisUnit={this.props.axisUnit}
|
||||
scale={this.props.scale}
|
||||
max={this.props.max}
|
||||
/>
|
||||
</div>;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* New component to add keyboard support for sliders - works on all devices (desktop, iOS, Android)
|
||||
**/
|
||||
class TextInputBox extends React.Component {
|
||||
static propTypes = {
|
||||
axisUnit: PropTypes.string,// units (T, M, etc.)
|
||||
max: PropTypes.number,
|
||||
onChange: PropTypes.func.isRequired,// function which determins percent value
|
||||
percent: PropTypes.number.isRequired,// value of slider
|
||||
scale: PropTypes.number
|
||||
};
|
||||
/**
|
||||
* Determine if the user is still dragging
|
||||
* @param {Object} props React Component properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._handleFocus = this._handleFocus.bind(this);
|
||||
this._handleBlur = this._handleBlur.bind(this);
|
||||
this._handleChange = this._handleChange.bind(this);
|
||||
this._keyup = this._keyup.bind(this);
|
||||
this.state = this._getInitialState();
|
||||
}
|
||||
/**
|
||||
* Update input value if slider changes will change props/state
|
||||
* @param {Object} nextProps React Component properites
|
||||
* @param {Object} nextState React Component state values
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextState) {
|
||||
let nextValue = nextProps.percent * nextProps.max;
|
||||
// See https://stackoverflow.com/questions/32414308/updating-state-on-props-change-in-react-form
|
||||
if (nextValue !== this.state.inputValue && nextValue <= nextProps.max) {
|
||||
this.setState({ inputValue: nextValue });
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Update slider textbox visibility/values if changes are made to slider
|
||||
* @param {Object} prevProps React Component properites
|
||||
* @param {Object} prevState React Component state values
|
||||
*/
|
||||
componentDidUpdate(prevProps, prevState) {
|
||||
if (prevState.divStyle.display == 'none' && this.state.divStyle.display == 'block') {
|
||||
this.enterTimer = setTimeout(() => this.sliderVal.focus(), 10);
|
||||
}
|
||||
if (prevProps.max !== this.props.max && this.state.inputValue > this.props.max) {
|
||||
// they chose a different module
|
||||
this.setState({ inputValue: this.props.max });
|
||||
}
|
||||
if (this.state.inputValue != prevState.inputValue && prevProps.max == this.props.max) {
|
||||
this.props.onChange(this.state.inputValue / this.props.max);
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Set initial state for the textbox.
|
||||
* We may want to rethink this to
|
||||
* try and make it a stateless component
|
||||
* @returns {object} React state object with initial values set
|
||||
*/
|
||||
_getInitialState() {
|
||||
return {
|
||||
divStyle: { display:'none' },
|
||||
inputStyle: { width:'4em' },
|
||||
labelStyle: { marginLeft: '.1em' },
|
||||
maxLength:5,
|
||||
size:5,
|
||||
min:0,
|
||||
tabIndex:-1,
|
||||
type:'number',
|
||||
readOnly: true,
|
||||
inputValue: this.props.percent * this.props.max
|
||||
};
|
||||
}
|
||||
/**
|
||||
*
|
||||
* @param {string} val block or none
|
||||
*/
|
||||
_setDisplay(val) {
|
||||
this.setState({
|
||||
divStyle: { display:val }
|
||||
});
|
||||
}
|
||||
/**
|
||||
* Update the input value
|
||||
* when textbox gets focus
|
||||
*/
|
||||
_handleFocus() {
|
||||
this.setState({
|
||||
inputValue:this._getValue()
|
||||
});
|
||||
}
|
||||
/**
|
||||
* Update inputValue when textbox loses focus
|
||||
*/
|
||||
_handleBlur() {
|
||||
this._setDisplay('none');
|
||||
if (this.state.inputValue !== '') {
|
||||
this.props.onChange(this.state.inputValue / this.props.max);
|
||||
} else {
|
||||
this.setState({
|
||||
inputValue: this.props.percent * this.props.max
|
||||
});
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Get the value in the text box
|
||||
* @returns {number} inputValue Value of the input box
|
||||
*/
|
||||
_getValue() {
|
||||
return this.state.inputValue;
|
||||
}
|
||||
/**
|
||||
* Update and set limits on input box
|
||||
* values depending on what user
|
||||
* has selected
|
||||
*
|
||||
* @param {SyntheticEvent} event ReactJs onChange event
|
||||
*/
|
||||
_handleChange(event) {
|
||||
if (event.target.value < 0) {
|
||||
this.setState({ inputValue: 0 });
|
||||
} else if (event.target.value <= this.props.max) {
|
||||
this.setState({ inputValue: event.target.value });
|
||||
} else {
|
||||
this.setState({ inputValue: this.props.max });
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Key up handler for input field.
|
||||
* If user hits Enter key, blur/close the input field
|
||||
* @param {Event} event Keyboard event
|
||||
*/
|
||||
_keyup(event) {
|
||||
switch (event.key) {
|
||||
case 'Enter':
|
||||
this.sliderVal.blur();
|
||||
return;
|
||||
default:
|
||||
return;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Get the value in the text box
|
||||
* @return {React.Component} Text Input component for Slider
|
||||
*/
|
||||
render() {
|
||||
let { axisUnit, onChange, percent, scale } = this.props;
|
||||
return <div style={this.state.divStyle}><input style={this.state.inputStyle} value={this._getValue()} min={this.state.min} max={this.props.max} onChange={this._handleChange} onKeyUp={this._keyup} tabIndex={this.state.tabIndex} maxLength={this.state.maxLength} size={this.state.size} onBlur={() => {this._handleBlur();}} onFocus={() => {this._handleFocus();}} type={this.state.type} ref={(ip) => this.sliderVal = ip}/><text className="primary upp" style={this.state.labelStyle}>{this.props.axisUnit}</text></div>;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -2,31 +2,38 @@ import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import cn from 'classnames';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import AvailableModulesMenu from './AvailableModulesMenu';
|
||||
import ModificationsMenu from './ModificationsMenu';
|
||||
import { diffDetails } from '../utils/SlotFunctions';
|
||||
import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { stopCtxPropagation, wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
import { Module } from 'ed-forge';
|
||||
import { REG_MILITARY_SLOT, REG_HARDPOINT_SLOT } from 'ed-forge/lib/data/slots';
|
||||
import autoBind from 'auto-bind';
|
||||
import { toPairs } from 'lodash';
|
||||
|
||||
const HARDPOINT_SLOT_LABELS = {
|
||||
1: 'S',
|
||||
2: 'M',
|
||||
3: 'L',
|
||||
4: 'H',
|
||||
};
|
||||
|
||||
/**
|
||||
* Abstract Slot
|
||||
*/
|
||||
export default class Slot extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
availableModules: PropTypes.func.isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
onOpen: PropTypes.func.isRequired,
|
||||
maxClass: PropTypes.number.isRequired,
|
||||
selected: PropTypes.bool,
|
||||
m: PropTypes.object,
|
||||
enabled: PropTypes.bool.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
eligible: PropTypes.object,
|
||||
currentMenu: PropTypes.any,
|
||||
hideSearch: PropTypes.bool,
|
||||
m: PropTypes.instanceOf(Module),
|
||||
warning: PropTypes.func,
|
||||
drag: PropTypes.func,
|
||||
drop: PropTypes.func,
|
||||
dropClass: PropTypes.string
|
||||
dropClass: PropTypes.string,
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
@@ -35,23 +42,122 @@ export default class Slot extends TranslatedComponent {
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
|
||||
this._modificationsSelected = false;
|
||||
|
||||
this._contextMenu = wrapCtxMenu(this._contextMenu.bind(this));
|
||||
this._getMaxClassLabel = this._getMaxClassLabel.bind(this);
|
||||
autoBind(this);
|
||||
this.state = { menuIndex: 0 };
|
||||
}
|
||||
|
||||
// Must be implemented by subclasses:
|
||||
// _getSlotDetails()
|
||||
/**
|
||||
* Opens a menu while setting state.
|
||||
* @param {Object} newMenuIndex New menu index
|
||||
* @param {Event} event Event object
|
||||
*/
|
||||
_openMenu(newMenuIndex, event) {
|
||||
const slotName = this.props.m.getSlot();
|
||||
if (
|
||||
this.props.currentMenu === slotName &&
|
||||
newMenuIndex === this.state.menuIndex
|
||||
) {
|
||||
this.context.closeMenu();
|
||||
} {
|
||||
this.setState({ menuIndex: newMenuIndex });
|
||||
this.context.openMenu(slotName);
|
||||
}
|
||||
// If we don't stop event propagation, the underlying divs also might
|
||||
// get clicked which would open up other menus
|
||||
event.stopPropagation();
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the CSS class name for the slot. Can/should be overriden
|
||||
* as necessary.
|
||||
* @return {string} CSS Class name
|
||||
* Generate the slot contents
|
||||
* @return {React.Component} Slot contents
|
||||
*/
|
||||
_getClassNames() {
|
||||
return null;
|
||||
_getSlotDetails() {
|
||||
const { m, propsToShow } = this.props;
|
||||
let { termtip, tooltip, language } = this.context;
|
||||
const { translate, units, formats } = language;
|
||||
|
||||
if (m.isEmpty()) {
|
||||
return <div className="empty">
|
||||
{translate(
|
||||
m.getSlot().match(REG_MILITARY_SLOT) ? 'emptyrestricted' : 'empty'
|
||||
)}
|
||||
</div>;
|
||||
} else {
|
||||
let classRating = m.getClassRating();
|
||||
let { drag, drop } = this.props;
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
const blueprint = m.getBlueprint();
|
||||
const experimental = m.getExperimental();
|
||||
const grade = m.getBlueprintGrade();
|
||||
if (blueprint) {
|
||||
modTT = `${translate(blueprint)} ${translate('grade')}: ${grade}`;
|
||||
if (experimental) {
|
||||
modTT += `, ${translate(experimental)}`;
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(language, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
let mass = m.get('mass') || m.get('cargo') || m.get('fuel') || 0;
|
||||
return (
|
||||
<div
|
||||
className={cn('details', { disabled: !m.isEnabled() })}
|
||||
draggable="true"
|
||||
onDragStart={drag}
|
||||
onDragEnd={drop}
|
||||
>
|
||||
<div className={'cb'}>
|
||||
<div className={'l'}>
|
||||
{classRating} {translate(m.readMeta('type'))}
|
||||
{blueprint && (
|
||||
<span
|
||||
onMouseOver={termtip.bind(null, modTT)}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<Modified />
|
||||
</span>
|
||||
)}
|
||||
</div>
|
||||
{propsToShow.mass ?
|
||||
<div className={'r'}>
|
||||
{formats.round(mass)}
|
||||
{units.T}
|
||||
</div> : null}
|
||||
</div>
|
||||
<div className={'cb'}>
|
||||
{toPairs(propsToShow).sort().map(([prop, show]) => {
|
||||
const { unit, value } = m.getFormatted(prop, true);
|
||||
// Don't show mass again; it's already shown on the top right
|
||||
// corner of a slot
|
||||
if (!show || isNaN(value) || prop == 'mass') {
|
||||
return null;
|
||||
} else {
|
||||
return (<div className='l'>
|
||||
{translate(prop)}: {formats.round(value)}{unit}
|
||||
</div>);
|
||||
}
|
||||
})}
|
||||
{(m.getApplicableBlueprints() || []).length > 0 ? (
|
||||
<div className="r">
|
||||
<button onClick={this._openMenu.bind(this, 1)}
|
||||
onContextMenu={stopCtxPropagation}
|
||||
onMouseOver={termtip.bind(null, translate('modifications'))}
|
||||
onMouseOut={tooltip.bind(null, null)}
|
||||
>
|
||||
<ListModifications />
|
||||
</button>
|
||||
</div>
|
||||
) : null}
|
||||
</div>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -60,7 +166,19 @@ export default class Slot extends TranslatedComponent {
|
||||
* @return {string} label
|
||||
*/
|
||||
_getMaxClassLabel() {
|
||||
return this.props.maxClass;
|
||||
const { m } = this.props;
|
||||
let size = m.getSize();
|
||||
switch (true) {
|
||||
case m.getSlot() === 'armour':
|
||||
return '';
|
||||
case size === 0:
|
||||
// This can also happen for armour but that case was handled above
|
||||
return 'U';
|
||||
case Boolean(m.getSlot().match(REG_HARDPOINT_SLOT)):
|
||||
return HARDPOINT_SLOT_LABELS[size];
|
||||
default:
|
||||
return size;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -70,7 +188,13 @@ export default class Slot extends TranslatedComponent {
|
||||
_contextMenu(event) {
|
||||
event.stopPropagation();
|
||||
event.preventDefault();
|
||||
this.props.onSelect(null,null);
|
||||
const { m } = this.props;
|
||||
m.reset();
|
||||
if (this.props.currentMenu === m.getSlot()) {
|
||||
this.context.closeMenu();
|
||||
} else {
|
||||
this.forceUpdate();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -80,61 +204,42 @@ export default class Slot extends TranslatedComponent {
|
||||
render() {
|
||||
let language = this.context.language;
|
||||
let translate = language.translate;
|
||||
let { ship, m, enabled, dropClass, dragOver, onOpen, onChange, selected, eligible, onSelect, warning, availableModules } = this.props;
|
||||
let slotDetails, modificationsMarker, menu;
|
||||
|
||||
if (!selected) {
|
||||
// If not selected then sure that modifications flag is unset
|
||||
this._modificationsSelected = false;
|
||||
}
|
||||
|
||||
if (m) {
|
||||
slotDetails = this._getSlotDetails(m, enabled, translate, language.formats, language.units); // Must be implemented by sub classes
|
||||
modificationsMarker = JSON.stringify(m);
|
||||
} else {
|
||||
slotDetails = <div className={'empty'}>{translate(eligible ? 'emptyrestricted' : 'empty')}</div>;
|
||||
modificationsMarker = '';
|
||||
}
|
||||
|
||||
if (selected) {
|
||||
if (this._modificationsSelected) {
|
||||
menu = <ModificationsMenu
|
||||
className={this._getClassNames()}
|
||||
onChange={onChange}
|
||||
ship={ship}
|
||||
m={m}
|
||||
marker={modificationsMarker}
|
||||
/>;
|
||||
} else {
|
||||
menu = <AvailableModulesMenu
|
||||
className={this._getClassNames()}
|
||||
modules={availableModules()}
|
||||
shipMass={ship.hullMass}
|
||||
m={m}
|
||||
onSelect={onSelect}
|
||||
warning={warning}
|
||||
diffDetails={diffDetails.bind(ship, this.context.language)}
|
||||
/>;
|
||||
}
|
||||
}
|
||||
let {
|
||||
currentMenu, m, dropClass, dragOver, warning, hideSearch, propsToShow,
|
||||
onPropToggle,
|
||||
} = this.props;
|
||||
const { menuIndex } = this.state;
|
||||
|
||||
// TODO: implement touch dragging
|
||||
|
||||
const selected = currentMenu === m.getSlot();
|
||||
return (
|
||||
<div className={cn('slot', dropClass, { selected })} onClick={onOpen} onContextMenu={this._contextMenu} onDragOver={dragOver}>
|
||||
<div className='details-container'>
|
||||
<div className='sz'>{this._getMaxClassLabel(translate)}</div>
|
||||
{slotDetails}
|
||||
</div>
|
||||
{menu}
|
||||
<div
|
||||
className={cn('slot', dropClass, { selected })}
|
||||
onContextMenu={this._contextMenu}
|
||||
onDragOver={dragOver} tabIndex="0"
|
||||
onClick={this._openMenu.bind(this, 0)}
|
||||
>
|
||||
<div className={cn(
|
||||
'details-container',
|
||||
{ warning: warning && warning(m) },
|
||||
)}>
|
||||
<div className="sz">{this._getMaxClassLabel(translate)}</div>
|
||||
{this._getSlotDetails()}
|
||||
</div>
|
||||
{selected && menuIndex === 0 &&
|
||||
<AvailableModulesMenu
|
||||
m={m} hideSearch={hideSearch}
|
||||
onSelect={(item) => {
|
||||
m.setItem(item);
|
||||
this.context.closeMenu();
|
||||
}}
|
||||
warning={warning}
|
||||
// diffDetails={diffDetails.bind(ship, this.context.language)}
|
||||
/>}
|
||||
{selected && menuIndex === 1 &&
|
||||
<ModificationsMenu m={m} propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle} />}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the modifications flag when selecting the modifications icon
|
||||
*/
|
||||
_toggleModifications() {
|
||||
this._modificationsSelected = !this._modificationsSelected;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -5,41 +5,33 @@ import { wrapCtxMenu } from '../utils/UtilityFunctions';
|
||||
import { canMount } from '../utils/SlotFunctions';
|
||||
import { Equalizer } from '../components/SvgIcons';
|
||||
import cn from 'classnames';
|
||||
import { Ship } from 'ed-forge';
|
||||
import autoBind from 'auto-bind';
|
||||
const browser = require('detect-browser');
|
||||
|
||||
/**
|
||||
* Abstract Slot Section
|
||||
*/
|
||||
export default class SlotSection extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
ship: PropTypes.object.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
onCargoChange: PropTypes.func.isRequired,
|
||||
onFuelChange: PropTypes.func.isRequired,
|
||||
ship: PropTypes.instanceOf(Ship),
|
||||
code: PropTypes.string.isRequired,
|
||||
togglePwr: PropTypes.func
|
||||
togglePwr: PropTypes.func,
|
||||
propsToShow: PropTypes.object.isRequired,
|
||||
onPropToggle: PropTypes.func.isRequired,
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
* @param {string} sectionId Section DOM Id
|
||||
* @param {string} sectionName Section name
|
||||
*/
|
||||
constructor(props, context, sectionId, sectionName) {
|
||||
constructor(props, sectionName) {
|
||||
super(props);
|
||||
this.sectionId = sectionId;
|
||||
autoBind(this);
|
||||
|
||||
this.sectionName = sectionName;
|
||||
|
||||
this._getSlots = this._getSlots.bind(this);
|
||||
this._selectModule = this._selectModule.bind(this);
|
||||
this._getSectionMenu = this._getSectionMenu.bind(this);
|
||||
this._contextMenu = this._contextMenu.bind(this);
|
||||
this._drop = this._drop.bind(this);
|
||||
this._dragOverNone = this._dragOverNone.bind(this);
|
||||
this._close = this._close.bind(this);
|
||||
this.state = {};
|
||||
}
|
||||
|
||||
@@ -47,31 +39,7 @@ export default class SlotSection extends TranslatedComponent {
|
||||
// _getSlots()
|
||||
// _getSectionMenu()
|
||||
// _contextMenu()
|
||||
|
||||
/**
|
||||
* Open a menu
|
||||
* @param {string} menu Menu name
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
_openMenu(menu, event) {
|
||||
event.preventDefault();
|
||||
event.stopPropagation();
|
||||
if (this.props.currentMenu === menu) {
|
||||
menu = null;
|
||||
}
|
||||
this.context.openMenu(menu);
|
||||
}
|
||||
|
||||
/**
|
||||
* Mount/Use the specified module in the slot
|
||||
* @param {Object} slot Slot
|
||||
* @param {Object} m Selected module
|
||||
*/
|
||||
_selectModule(slot, m) {
|
||||
this.props.ship.use(slot, m, false);
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
// componentDidUpdate(prevProps)
|
||||
|
||||
/**
|
||||
* Slot Drag Handler
|
||||
@@ -137,10 +105,18 @@ export default class SlotSection extends TranslatedComponent {
|
||||
if (targetSlot && canMount(this.props.ship, targetSlot, m.grp, m.class)) {
|
||||
const mCopy = m.clone();
|
||||
this.props.ship.use(targetSlot, mCopy, false);
|
||||
let experimentalNum = this.props.ship.hardpoints
|
||||
.filter(s => s.m && s.m.experimental).length;
|
||||
// Remove the module on the last slot if we now exceed the number of
|
||||
// experimentals allowed
|
||||
if (m.experimental && 4 < experimentalNum) {
|
||||
this.props.ship.updateStats(originSlot, null, originSlot.m);
|
||||
originSlot.m = null; // Empty the slot
|
||||
originSlot.discountedCost = 0;
|
||||
}
|
||||
// Copy power info
|
||||
targetSlot.enabled = originSlot.enabled;
|
||||
targetSlot.priority = originSlot.priority;
|
||||
this.props.onChange();
|
||||
}
|
||||
} else {
|
||||
// Store power info
|
||||
@@ -169,7 +145,18 @@ export default class SlotSection extends TranslatedComponent {
|
||||
targetSlot.enabled = targetEnabled;
|
||||
targetSlot.priority = targetPriority;
|
||||
}
|
||||
this.props.onChange();
|
||||
this.props.ship
|
||||
.updatePowerGenerated()
|
||||
.updatePowerUsed()
|
||||
.recalculateMass()
|
||||
.updateJumpStats()
|
||||
.recalculateShield()
|
||||
.recalculateShieldCells()
|
||||
.recalculateArmour()
|
||||
.recalculateDps()
|
||||
.recalculateEps()
|
||||
.recalculateHps()
|
||||
.updateMovement();
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -203,6 +190,17 @@ export default class SlotSection extends TranslatedComponent {
|
||||
return 'ineligible'; // Cannot be dropped / invalid drop slot
|
||||
}
|
||||
|
||||
_open(newMenu, event) {
|
||||
event.preventDefault();
|
||||
event.stopPropagation();
|
||||
const { currentMenu } = this.props;
|
||||
if (currentMenu === newMenu) {
|
||||
this.context.closeMenu();
|
||||
} else {
|
||||
this.context.openMenu(newMenu);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Close current menu
|
||||
*/
|
||||
@@ -219,14 +217,13 @@ export default class SlotSection extends TranslatedComponent {
|
||||
render() {
|
||||
let translate = this.context.language.translate;
|
||||
let sectionMenuOpened = this.props.currentMenu === this.sectionName;
|
||||
let open = this._openMenu.bind(this, this.sectionName);
|
||||
let ctx = wrapCtxMenu(this._contextMenu);
|
||||
|
||||
return (
|
||||
<div id={this.sectionId} className={'group'} onDragLeave={this._dragOverNone}>
|
||||
<div className={cn('section-menu', { selected: sectionMenuOpened })} onClick={open} onContextMenu={ctx}>
|
||||
<h1>{translate(this.sectionName)} <Equalizer/></h1>
|
||||
{sectionMenuOpened ? this._getSectionMenu(translate, this.props.ship) : null }
|
||||
<div className="group" onDragLeave={this._dragOverNone}>
|
||||
<div className={cn('section-menu', { selected: sectionMenuOpened })}
|
||||
onContextMenu={wrapCtxMenu(this._contextMenu)} onClick={this._open.bind(this, this.sectionName)}>
|
||||
<h1 tabIndex="0">{translate(this.sectionName)}<Equalizer/></h1>
|
||||
{sectionMenuOpened && this._getSectionMenu()}
|
||||
</div>
|
||||
{this._getSlots()}
|
||||
</div>
|
||||
|
||||
@@ -1,139 +0,0 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import cn from 'classnames';
|
||||
import Persist from '../stores/Persist';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { diffDetails } from '../utils/SlotFunctions';
|
||||
import AvailableModulesMenu from './AvailableModulesMenu';
|
||||
import ModificationsMenu from './ModificationsMenu';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { ListModifications, Modified } from './SvgIcons';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import { blueprintTooltip } from '../utils/BlueprintFunctions';
|
||||
|
||||
/**
|
||||
* Standard Slot
|
||||
*/
|
||||
export default class StandardSlot extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
slot: PropTypes.object,
|
||||
modules: PropTypes.array.isRequired,
|
||||
onSelect: PropTypes.func.isRequired,
|
||||
onOpen: PropTypes.func.isRequired,
|
||||
onChange: PropTypes.func.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
selected: PropTypes.bool,
|
||||
warning: PropTypes.func,
|
||||
};
|
||||
|
||||
/**
|
||||
* Construct the slot
|
||||
* @param {object} props Object properties
|
||||
*/
|
||||
constructor(props) {
|
||||
super(props);
|
||||
this._modificationsSelected = false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render the slot
|
||||
* @return {React.Component} Slot component
|
||||
*/
|
||||
render() {
|
||||
let { termtip, tooltip } = this.context;
|
||||
let { translate, formats, units } = this.context.language;
|
||||
let { modules, slot, selected, warning, onSelect, onChange, ship } = this.props;
|
||||
let m = slot.m;
|
||||
let classRating = m.class + m.rating;
|
||||
let menu;
|
||||
let validMods = m == null || !Modifications.modules[m.grp] ? [] : (Modifications.modules[m.grp].modifications || []);
|
||||
let showModuleResistances = Persist.showModuleResistances();
|
||||
let mass = m.getMass() || m.cargo || m.fuel || 0;
|
||||
|
||||
// Modifications tooltip shows blueprint and grade, if available
|
||||
let modTT = translate('modified');
|
||||
if (m && m.blueprint && m.blueprint.name) {
|
||||
modTT = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id >= 0) {
|
||||
modTT += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
modTT = (
|
||||
<div>
|
||||
<div>{modTT}</div>
|
||||
{blueprintTooltip(translate, m.blueprint.grades[m.blueprint.grade], null, m.grp, m)}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
if (!selected) {
|
||||
// If not selected then sure that modifications flag is unset
|
||||
this._modificationsSelected = false;
|
||||
}
|
||||
|
||||
const modificationsMarker = JSON.stringify(m);
|
||||
|
||||
if (selected) {
|
||||
if (this._modificationsSelected) {
|
||||
menu = <ModificationsMenu
|
||||
className='standard'
|
||||
onChange={onChange}
|
||||
ship={ship}
|
||||
m={m}
|
||||
marker={modificationsMarker}
|
||||
/>;
|
||||
} else {
|
||||
menu = <AvailableModulesMenu
|
||||
className='standard'
|
||||
modules={modules}
|
||||
shipMass={ModuleUtils.isShieldGenerator(m.grp) ? ship.hullMass : ship.unladenMass}
|
||||
m={m}
|
||||
onSelect={onSelect}
|
||||
warning={warning}
|
||||
diffDetails={diffDetails.bind(ship, this.context.language)}
|
||||
/>;
|
||||
}
|
||||
}
|
||||
|
||||
return (
|
||||
<div className={cn('slot', { selected: this.props.selected })} onClick={this.props.onOpen} onContextMenu={stopCtxPropagation}>
|
||||
<div className={cn('details-container', { warning: warning && warning(slot.m), disabled: m.grp !== 'bh' && !slot.enabled })}>
|
||||
<div className={'sz'}>{m.grp == 'bh' ? m.name.charAt(0) : slot.maxClass}</div>
|
||||
<div>
|
||||
<div className={'l'}>{classRating} {translate(m.name || m.grp)}{m.mods && Object.keys(m.mods).length > 0 ? <span className='r' onMouseOver={termtip.bind(null, modTT)} onMouseOut={tooltip.bind(null, null)}><Modified /></span> : null }</div>
|
||||
<div className={'r'}>{formats.round(mass)}{units.T}</div>
|
||||
<div/>
|
||||
<div className={'cb'}>
|
||||
{ m.getMinMass() ? <div className='l'>{translate('minimum mass')}: {formats.int(m.getMinMass())}{units.T}</div> : null }
|
||||
{ m.getOptMass() ? <div className='l'>{translate('optimal mass')}: {formats.int(m.getOptMass())}{units.T}</div> : null }
|
||||
{ m.getMaxMass() ? <div className='l'>{translate('max mass')}: {formats.int(m.getMaxMass())}{units.T}</div> : null }
|
||||
{ m.getOptMul() ? <div className='l'>{translate('optimal multiplier')}: {formats.rPct(m.getOptMul())}</div> : null }
|
||||
{ m.getRange() ? <div className='l'>{translate('range', m.grp)}: {formats.f2(m.getRange())}{units.km}</div> : null }
|
||||
{ m.time ? <div className='l'>{translate('time')}: {formats.time(m.time)}</div> : null }
|
||||
{ m.getThermalEfficiency() ? <div className='l'>{translate('efficiency')}: {formats.f2(m.getThermalEfficiency())}</div> : null }
|
||||
{ m.getPowerGeneration() > 0 ? <div className='l'>{translate('pgen')}: {formats.f1(m.getPowerGeneration())}{units.MW}</div> : null }
|
||||
{ m.getMaxFuelPerJump() ? <div className='l'>{translate('max')} {translate('fuel')}: {formats.f1(m.getMaxFuelPerJump())}{units.T}</div> : null }
|
||||
{ m.getWeaponsCapacity() ? <div className='l'>{translate('WEP')}: {formats.f1(m.getWeaponsCapacity())}{units.MJ} / {formats.f1(m.getWeaponsRechargeRate())}{units.MW}</div> : null }
|
||||
{ m.getSystemsCapacity() ? <div className='l'>{translate('SYS')}: {formats.f1(m.getSystemsCapacity())}{units.MJ} / {formats.f1(m.getSystemsRechargeRate())}{units.MW}</div> : null }
|
||||
{ m.getEnginesCapacity() ? <div className='l'>{translate('ENG')}: {formats.f1(m.getEnginesCapacity())}{units.MJ} / {formats.f1(m.getEnginesRechargeRate())}{units.MW}</div> : null }
|
||||
{ showModuleResistances && m.getExplosiveResistance() ? <div className='l'>{translate('explres')}: {formats.pct(m.getExplosiveResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getKineticResistance() ? <div className='l'>{translate('kinres')}: {formats.pct(m.getKineticResistance())}</div> : null }
|
||||
{ showModuleResistances && m.getThermalResistance() ? <div className='l'>{translate('thermres')}: {formats.pct(m.getThermalResistance())}</div> : null }
|
||||
{ m.getIntegrity() ? <div className='l'>{translate('integrity')}: {formats.int(m.getIntegrity())}</div> : null }
|
||||
{ validMods.length > 0 ? <div className='r' ><button onClick={this._toggleModifications.bind(this)} onContextMenu={stopCtxPropagation} onMouseOver={termtip.bind(null, 'modifications')} onMouseOut={tooltip.bind(null, null)}><ListModifications /></button></div> : null }
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
{menu}
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle the modifications flag when selecting the modifications icon
|
||||
*/
|
||||
_toggleModifications() {
|
||||
this._modificationsSelected = !this._modificationsSelected;
|
||||
}
|
||||
}
|
||||
@@ -1,25 +1,26 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import SlotSection from './SlotSection';
|
||||
import StandardSlot from './StandardSlot';
|
||||
import Slot from './Slot';
|
||||
import Module from '../shipyard/Module';
|
||||
import * as ShipRoles from '../shipyard/ShipRoles';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
import { stopCtxPropagation, moduleGet } from '../utils/UtilityFunctions';
|
||||
import { ShipProps } from 'ed-forge';
|
||||
const { CONSUMED_RETR, LADEN_MASS } = ShipProps;
|
||||
|
||||
/**
|
||||
* Standard Slot section
|
||||
*/
|
||||
export default class StandardSlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'standard', 'core internal');
|
||||
this._optimizeStandard = this._optimizeStandard.bind(this);
|
||||
this._selectBulkhead = this._selectBulkhead.bind(this);
|
||||
constructor(props) {
|
||||
super(props, 'core internal');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -27,9 +28,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_optimizeStandard() {
|
||||
this.props.ship.useLightestStandard();
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -40,9 +38,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_multiPurpose(shielded, bulkheadIndex) {
|
||||
ShipRoles.multiPurpose(this.props.ship, shielded, bulkheadIndex);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -52,9 +47,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_optimizeCargo(shielded) {
|
||||
ShipRoles.trader(this.props.ship, shielded);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -64,9 +56,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_optimizeMiner(shielded) {
|
||||
ShipRoles.miner(this.props.ship, shielded);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -76,9 +65,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_optimizeExplorer(planetary) {
|
||||
ShipRoles.explorer(this.props.ship, planetary);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -87,20 +73,6 @@ export default class StandardSlotSection extends SlotSection {
|
||||
*/
|
||||
_optimizeRacer() {
|
||||
ShipRoles.racer(this.props.ship);
|
||||
this.props.onChange();
|
||||
this.props.onCargoChange(this.props.ship.cargoCapacity);
|
||||
this.props.onFuelChange(this.props.ship.fuelCapacity);
|
||||
this._close();
|
||||
}
|
||||
|
||||
/**
|
||||
* Use the specified bulkhead
|
||||
* @param {Object} bulkhead Bulkhead module details
|
||||
*/
|
||||
_selectBulkhead(bulkhead) {
|
||||
this.props.ship.useBulkhead(bulkhead.index);
|
||||
this.context.tooltip();
|
||||
this.props.onChange();
|
||||
this._close();
|
||||
}
|
||||
|
||||
@@ -111,113 +83,48 @@ export default class StandardSlotSection extends SlotSection {
|
||||
this._optimizeStandard();
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a new slot for a given module.
|
||||
* @param {Module} m Module to create the slot for
|
||||
* @param {function} warning Warning callback
|
||||
* @return {React.Component} Slot component
|
||||
*/
|
||||
_mkSlot(m, warning) {
|
||||
const { currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
return <Slot key={m.getSlot()} m={m} warning={warning} hideSearch={true}
|
||||
currentMenu={currentMenu} propsToShow={propsToShow} onPropToggle={onPropToggle}
|
||||
/>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the slot React Components
|
||||
* @return {Array} Array of Slots
|
||||
*/
|
||||
_getSlots() {
|
||||
let { ship, currentMenu, cargo, fuel } = this.props;
|
||||
let slots = new Array(8);
|
||||
let open = this._openMenu;
|
||||
let select = this._selectModule;
|
||||
let st = ship.standard;
|
||||
let avail = ship.getAvailableModules().standard;
|
||||
let bh = ship.bulkheads;
|
||||
|
||||
slots[0] = <StandardSlot
|
||||
key='bh'
|
||||
slot={bh}
|
||||
modules={ship.getAvailableModules().bulkheads}
|
||||
onOpen={open.bind(this, bh)}
|
||||
onSelect={this._selectBulkhead}
|
||||
selected={currentMenu == bh}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
/>;
|
||||
|
||||
slots[1] = <StandardSlot
|
||||
key='pp'
|
||||
slot={st[0]}
|
||||
modules={avail[0]}
|
||||
onOpen={open.bind(this, st[0])}
|
||||
onSelect={select.bind(this, st[0])}
|
||||
selected={currentMenu == st[0]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getPowerGeneration() < ship.powerRetracted : m.pgen < ship.powerRetracted}
|
||||
/>;
|
||||
|
||||
slots[2] = <StandardSlot
|
||||
key='th'
|
||||
slot={st[1]}
|
||||
modules={avail[1]}
|
||||
onOpen={open.bind(this, st[1])}
|
||||
onSelect={select.bind(this, st[1])}
|
||||
selected={currentMenu == st[1]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getMaxMass() < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass) : m.maxmass < (ship.unladenMass + cargo + fuel - st[1].m.mass + m.mass)}
|
||||
/>;
|
||||
|
||||
|
||||
slots[3] = <StandardSlot
|
||||
key='fsd'
|
||||
slot={st[2]}
|
||||
modules={avail[2]}
|
||||
onOpen={open.bind(this, st[2])}
|
||||
onSelect={select.bind(this, st[2])}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
selected={currentMenu == st[2]}
|
||||
/>;
|
||||
|
||||
slots[4] = <StandardSlot
|
||||
key='ls'
|
||||
slot={st[3]}
|
||||
modules={avail[3]}
|
||||
onOpen={open.bind(this, st[3])}
|
||||
onSelect={select.bind(this, st[3])}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
selected={currentMenu == st[3]}
|
||||
/>;
|
||||
|
||||
slots[5] = <StandardSlot
|
||||
key='pd'
|
||||
slot={st[4]}
|
||||
modules={avail[4]}
|
||||
onOpen={open.bind(this, st[4])}
|
||||
onSelect={select.bind(this, st[4])}
|
||||
selected={currentMenu == st[4]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning={m => m instanceof Module ? m.getEnginesCapacity() <= ship.boostEnergy : m.engcap <= ship.boostEnergy}
|
||||
/>;
|
||||
|
||||
slots[6] = <StandardSlot
|
||||
key='ss'
|
||||
slot={st[5]}
|
||||
modules={avail[5]}
|
||||
onOpen={open.bind(this, st[5])}
|
||||
onSelect={select.bind(this, st[5])}
|
||||
selected={currentMenu == st[5]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
/>;
|
||||
|
||||
slots[7] = <StandardSlot
|
||||
key='ft'
|
||||
slot={st[6]}
|
||||
modules={avail[6]}
|
||||
onOpen={open.bind(this, st[6])}
|
||||
onSelect={select.bind(this, st[6])}
|
||||
selected={currentMenu == st[6]}
|
||||
onChange={this.props.onChange}
|
||||
ship={ship}
|
||||
warning= {m => m.fuel < st[2].m.maxfuel} // Show warning when fuel tank is smaller than FSD Max Fuel
|
||||
/>;
|
||||
|
||||
return slots;
|
||||
const { ship } = this.props;
|
||||
const fsd = ship.getFSD();
|
||||
return [
|
||||
this._mkSlot(ship.getAlloys()),
|
||||
this._mkSlot(
|
||||
ship.getPowerPlant(),
|
||||
(m) => moduleGet(m, 'powercapacity') < ship.get(CONSUMED_RETR),
|
||||
),
|
||||
this._mkSlot(
|
||||
ship.getThrusters(),
|
||||
(m) => moduleGet(m, 'enginemaximalmass') < ship.get(LADEN_MASS),
|
||||
),
|
||||
this._mkSlot(fsd),
|
||||
this._mkSlot(
|
||||
ship.getPowerDistributor(),
|
||||
(m) => moduleGet(m, 'enginescapacity') <= ship.readProp('boostenergy'),
|
||||
),
|
||||
this._mkSlot(ship.getLifeSupport()),
|
||||
this._mkSlot(ship.getSensors()),
|
||||
this._mkSlot(
|
||||
ship.getCoreFuelTank(),
|
||||
(m) => moduleGet(m, 'fuel') < fsd.get('maxfuel')
|
||||
),
|
||||
];
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -225,23 +132,22 @@ export default class StandardSlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
let planetaryDisabled = this.props.ship.internal.length < 4;
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' onClick={this._optimizeStandard}>{translate('Maximize Jump Range')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeStandard}>{translate('Maximize Jump Range')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('roles')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={this._multiPurpose.bind(this, false, 0)}>{translate('Multi-purpose')}</li>
|
||||
<li className='lc' onClick={this._multiPurpose.bind(this, true, 2)}>{translate('Combat')}</li>
|
||||
<li className='lc' onClick={this._optimizeCargo.bind(this, true)}>{translate('Trader')}</li>
|
||||
<li className='lc' onClick={this._optimizeExplorer.bind(this, false)}>{translate('Explorer')}</li>
|
||||
<li className={cn('lc', { disabled: planetaryDisabled })} onClick={!planetaryDisabled && this._optimizeExplorer.bind(this, true)}>{translate('Planetary Explorer')}</li>
|
||||
<li className='lc' onClick={this._optimizeMiner.bind(this, true)}>{translate('Miner')}</li>
|
||||
<li className='lc' onClick={this._optimizeRacer.bind(this)}>{translate('Racer')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, false, 0)}>{translate('Multi-purpose')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._multiPurpose.bind(this, true, 2)}>{translate('Combat')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeCargo.bind(this, true)}>{translate('Trader')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, false)}>{translate('Explorer')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeExplorer.bind(this, true)}>{translate('Planetary Explorer')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeMiner.bind(this, true)}>{translate('Miner')}</li>
|
||||
<li className='lc' tabIndex="0" onClick={this._optimizeRacer.bind(this)}>{translate('Racer')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -228,6 +228,96 @@ export class LinkIcon extends SvgIcon {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Link / Permalink / Chain
|
||||
*/
|
||||
export class OrbisIcon extends SvgIcon {
|
||||
/**
|
||||
* Generate the SVG
|
||||
* @return {React.Component} SVG Contents
|
||||
*/
|
||||
svg() {
|
||||
return (
|
||||
<g transform="scale(.037296)">
|
||||
<path d="m429 319c60.75 0 110 49.248 110 110 0 60.75-49.247 110-110 110s-110-49.247-110-110c0-60.749 49.248-110 110-110m0-20c-34.724 0-67.369 13.522-91.922 38.075s-38.075 57.198-38.075 91.922 13.522 67.369 38.075 91.922c24.553 24.554 57.198 38.075 91.922 38.075s67.369-13.521 91.922-38.075c24.554-24.553 38.075-57.198 38.075-91.922s-13.521-67.369-38.075-91.922c-24.553-24.553-57.198-38.075-91.922-38.075z" />
|
||||
<path d="m429 235c107.14 0 194 86.855 194 194s-86.855 194-194 194-194-86.855-194-194 86.855-194 194-194m0-20c-28.881 0-56.908 5.661-83.304 16.825-25.485 10.779-48.368 26.207-68.016 45.853-19.646 19.647-35.074 42.53-45.853 68.015-11.163 26.396-16.824 54.423-16.824 83.304s5.661 56.908 16.825 83.304c10.779 25.484 26.207 48.368 45.853 68.016 19.647 19.646 42.53 35.073 68.015 45.854 26.396 11.164 54.423 16.825 83.304 16.825s56.908-5.661 83.304-16.825c25.484-10.779 48.368-26.206 68.016-45.854 19.646-19.646 35.073-42.53 45.854-68.016 11.164-26.396 16.825-54.423 16.825-83.304s-5.661-56.908-16.825-83.304c-10.779-25.485-26.206-48.368-45.854-68.015-19.646-19.646-42.53-35.074-68.016-45.853-26.396-11.164-54.423-16.825-83.304-16.825z" />
|
||||
<path d="m429 63c202.14 0 366 163.86 366 366s-163.86 366-366 366-366-163.86-366-366 163.86-366 366-366m0-20c-52.101 0-102.65 10.208-150.25 30.342-45.966 19.442-87.244 47.271-122.69 82.714s-63.272 76.721-82.714 122.69c-20.134 47.601-30.342 98.153-30.342 150.25s10.208 102.65 30.342 150.25c19.442 45.967 47.271 87.244 82.714 122.69 35.443 35.442 76.721 63.271 122.69 82.715 47.601 20.133 98.153 30.342 150.25 30.342s102.65-10.209 150.25-30.342c45.967-19.442 87.244-47.271 122.69-82.715 35.441-35.442 63.271-76.721 82.714-122.69 20.133-47.601 30.342-98.153 30.342-150.25s-10.209-102.65-30.342-150.25c-19.442-45.966-47.271-87.244-82.714-122.69s-76.722-63.272-122.69-82.714c-47.601-20.134-98.153-30.342-150.25-30.342z"/>
|
||||
<path d="m429 63c202.14 0 366 163.86 366 366s-163.86 366-366 366-366-163.86-366-366 163.86-366 366-366m0-20c-52.101 0-102.65 10.208-150.25 30.342-45.966 19.442-87.244 47.271-122.69 82.714s-63.272 76.721-82.714 122.69c-20.134 47.601-30.342 98.153-30.342 150.25s10.208 102.65 30.342 150.25c19.442 45.967 47.271 87.244 82.714 122.69 35.443 35.442 76.721 63.271 122.69 82.715 47.601 20.133 98.153 30.342 150.25 30.342s102.65-10.209 150.25-30.342c45.967-19.442 87.244-47.271 122.69-82.715 35.441-35.442 63.271-76.721 82.714-122.69 20.133-47.601 30.342-98.153 30.342-150.25s-10.209-102.65-30.342-150.25c-19.442-45.966-47.271-87.244-82.714-122.69s-76.722-63.272-122.69-82.714c-47.601-20.134-98.153-30.342-150.25-30.342z" />
|
||||
<path d="m429 20c225.88 0 409 183.11 409 409s-183.11 409-409 409-409-183.11-409-409 183.11-409 409-409m0-20c-57.905 0-114.09 11.345-166.99 33.721-51.087 21.608-96.963 52.538-136.36 91.93s-70.321 85.269-91.93 136.36c-22.376 52.902-33.721 109.09-33.721 166.99s11.345 114.09 33.721 166.99c21.608 51.087 52.538 96.964 91.93 136.35 39.392 39.392 85.269 70.321 136.36 91.931 52.902 22.375 109.09 33.721 166.99 33.721s114.09-11.346 166.99-33.721c51.087-21.608 96.964-52.538 136.35-91.931 39.392-39.392 70.321-85.269 91.931-136.35 22.375-52.902 33.721-109.09 33.721-166.99s-11.346-114.09-33.721-166.99c-21.608-51.087-52.538-96.963-91.931-136.36-39.392-39.392-85.269-70.321-136.35-91.93-52.902-22.376-109.09-33.721-166.99-33.721z"/>
|
||||
<path d="m155.34 679.12 173.25-190.21-15.626-13.721-170.9 190.4zm31.01 31.714 202.41-169.1-16.418-14.417-198.76 170.43z"/>
|
||||
<path d="m702.66 178.87-173.25 190.21 15.625 13.721 170.9-190.4zm-31.01-31.714-202.41 169.1 16.418 14.417 198.76-170.43z" />
|
||||
<rect transform="matrix(-.7071 -.7071 .7071 -.7071 429.34 1036.2)" x="387.09" y="420.77" width="84.379" height="16.859" />
|
||||
</g>);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Material
|
||||
*/
|
||||
export class MatIcon extends SvgIcon {
|
||||
/**
|
||||
* Generate the SVG
|
||||
* @return {React.Component} SVG Contents
|
||||
*/
|
||||
svg() {
|
||||
return<g xmlns="http://www.w3.org/2000/svg">
|
||||
<path fill="#FF7100" d="M 24.86,4.18
|
||||
C 24.86,4.18 17.17,7.82 17.17,7.82
|
||||
17.17,7.82 15.35,14.55 15.35,14.55
|
||||
15.35,14.55 24.70,9.75 24.70,9.75
|
||||
24.70,9.75 24.86,4.18 24.86,4.18 Z
|
||||
M 32.21,17.45
|
||||
C 32.21,17.45 26.41,11.18 26.41,11.18
|
||||
26.41,11.18 19.51,11.51 19.51,11.51
|
||||
19.51,11.51 26.92,19.01 26.92,19.01
|
||||
26.92,19.01 32.21,17.45 32.21,17.45 Z
|
||||
M 21.99,28.62
|
||||
C 21.99,28.62 26.10,21.10 26.10,21.10
|
||||
26.10,21.10 23.66,14.57 23.66,14.57
|
||||
23.66,14.57 18.89,24.01 18.89,24.01
|
||||
18.89,24.01 21.99,28.62 21.99,28.62 Z
|
||||
M 8.33,22.24
|
||||
C 8.33,22.24 16.67,23.87 16.67,23.87
|
||||
16.67,23.87 22.06,19.51 22.06,19.51
|
||||
22.06,19.51 11.70,17.84 11.70,17.84
|
||||
11.70,17.84 8.33,22.24 8.33,22.24 Z
|
||||
M 10.11,7.14
|
||||
C 10.11,7.14 11.15,15.66 11.15,15.66
|
||||
11.15,15.66 16.92,19.49 16.92,19.49
|
||||
16.92,19.49 15.29,9.02 15.29,9.02
|
||||
15.29,9.02 10.11,7.14 10.11,7.14 Z
|
||||
M 27.69,2.67
|
||||
C 27.69,2.67 35.89,16.00 35.89,16.00
|
||||
35.89,16.00 27.69,29.33 27.69,29.33
|
||||
27.69,29.33 11.31,29.33 11.31,29.33
|
||||
11.31,29.33 3.11,16.00 3.11,16.00
|
||||
3.11,16.00 11.31,2.67 11.31,2.67
|
||||
11.31,2.67 27.67,2.67 27.67,2.67M 29.16,0.00
|
||||
C 29.16,0.00 27.69,0.00 27.69,0.00
|
||||
27.69,0.00 11.31,0.00 11.31,0.00
|
||||
11.31,0.00 9.84,0.00 9.84,0.00
|
||||
9.84,0.00 9.06,1.25 9.06,1.25
|
||||
9.06,1.25 0.87,14.57 0.87,14.57
|
||||
0.87,14.57 0.00,15.98 0.00,15.98
|
||||
0.00,15.98 0.87,17.39 0.87,17.39
|
||||
0.87,17.39 9.06,30.73 9.06,30.73
|
||||
9.06,30.73 9.84,32.00 9.84,32.00
|
||||
9.84,32.00 11.31,32.00 11.31,32.00
|
||||
11.31,32.00 27.69,32.00 27.69,32.00
|
||||
27.69,32.00 29.16,32.00 29.16,32.00
|
||||
29.16,32.00 29.94,30.73 29.94,30.73
|
||||
29.94,30.73 38.13,17.39 38.13,17.39
|
||||
38.13,17.39 39.00,15.98 39.00,15.98
|
||||
39.00,15.98 38.13,14.57 38.13,14.57
|
||||
38.13,14.57 29.94,1.25 29.94,1.25
|
||||
29.94,1.25 29.16,0.00 29.16,0.00
|
||||
29.16,0.00 29.16,0.00 29.16,0.00 Z" />
|
||||
</g>;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Shopping icon (dollar sign)
|
||||
*/
|
||||
@@ -651,9 +741,9 @@ export class Modified extends SvgIcon {
|
||||
*/
|
||||
svg() {
|
||||
return <g>
|
||||
<path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/>
|
||||
<path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/>
|
||||
</g>;
|
||||
<path d="M100,5L18,52.5L18,147.5L100,195L182,147.5L182,52.5L100,5Z"/>
|
||||
<path d="M100,70L74,85L74,115L100,130L126,115L126,85L100,70Z"/>
|
||||
</g>;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -6,7 +6,6 @@ import TranslatedComponent from './TranslatedComponent';
|
||||
* Document Root Tooltip
|
||||
*/
|
||||
export default class Tooltip extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
rect: PropTypes.object.isRequired,
|
||||
options: PropTypes.object
|
||||
@@ -127,5 +126,4 @@ export default class Tooltip extends TranslatedComponent {
|
||||
</div>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -6,7 +6,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Abstract Translated Component
|
||||
*/
|
||||
export default class TranslatedComponent extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
language: PropTypes.object.isRequired,
|
||||
sizeRatio: PropTypes.number.isRequired,
|
||||
|
||||
@@ -1,22 +1,20 @@
|
||||
import React from 'react';
|
||||
import cn from 'classnames';
|
||||
import SlotSection from './SlotSection';
|
||||
import HardpointSlot from './HardpointSlot';
|
||||
import Slot from './Slot';
|
||||
import { stopCtxPropagation } from '../utils/UtilityFunctions';
|
||||
import autoBind from 'auto-bind';
|
||||
|
||||
/**
|
||||
* Utility Slot Section
|
||||
*/
|
||||
export default class UtilitySlotSection extends SlotSection {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props, context, 'utility', 'utility mounts');
|
||||
this._empty = this._empty.bind(this);
|
||||
constructor(props) {
|
||||
super(props, 'utility mounts');
|
||||
autoBind(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -54,31 +52,24 @@ export default class UtilitySlotSection extends SlotSection {
|
||||
*/
|
||||
_getSlots() {
|
||||
let slots = [];
|
||||
let { ship, currentMenu } = this.props;
|
||||
let hardpoints = ship.hardpoints;
|
||||
let { ship, currentMenu, propsToShow, onPropToggle } = this.props;
|
||||
let { originSlot, targetSlot } = this.state;
|
||||
let availableModules = ship.getAvailableModules();
|
||||
|
||||
for (let i = 0, l = hardpoints.length; i < l; i++) {
|
||||
let h = hardpoints[i];
|
||||
if (h.maxClass === 0) {
|
||||
slots.push(<HardpointSlot
|
||||
key={i}
|
||||
maxClass={h.maxClass}
|
||||
availableModules={() => availableModules.getHps(h.maxClass)}
|
||||
onOpen={this._openMenu.bind(this,h)}
|
||||
onSelect={this._selectModule.bind(this, h)}
|
||||
onChange={this.props.onChange}
|
||||
selected={currentMenu == h}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
ship={ship}
|
||||
m={h.m}
|
||||
enabled={h.enabled ? true : false}
|
||||
/>);
|
||||
}
|
||||
for (let h of ship.getUtilities(undefined, true)) {
|
||||
slots.push(<Slot
|
||||
key={h.object.Slot}
|
||||
maxClass={h.getSize()}
|
||||
onChange={this.props.onChange}
|
||||
currentMenu={currentMenu}
|
||||
drag={this._drag.bind(this, h)}
|
||||
dragOver={this._dragOverSlot.bind(this, h)}
|
||||
drop={this._drop}
|
||||
dropClass={this._dropClass(h, originSlot, targetSlot)}
|
||||
m={h}
|
||||
enabled={h.enabled ? true : false}
|
||||
propsToShow={propsToShow}
|
||||
onPropToggle={onPropToggle}
|
||||
/>);
|
||||
}
|
||||
|
||||
return slots;
|
||||
@@ -89,35 +80,35 @@ export default class UtilitySlotSection extends SlotSection {
|
||||
* @param {Function} translate Translate function
|
||||
* @return {React.Component} Section menu
|
||||
*/
|
||||
_getSectionMenu(translate) {
|
||||
_getSectionMenu() {
|
||||
const { translate } = this.context.language;
|
||||
let _use = this._use;
|
||||
|
||||
return <div className='select' onClick={(e) => e.stopPropagation()} onContextMenu={stopCtxPropagation}>
|
||||
<ul>
|
||||
<li className='lc' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={this._empty}>{translate('empty all')}</li>
|
||||
<li className='optional-hide' style={{ textAlign: 'center', marginTop: '1em' }}>{translate('PHRASE_ALT_ALL')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('sb')}</div>
|
||||
<ul>
|
||||
<li className='c' onClick={_use.bind(this, 'sb', 'A', null)}>A</li>
|
||||
<li className='c' onClick={_use.bind(this, 'sb', 'B', null)}>B</li>
|
||||
<li className='c' onClick={_use.bind(this, 'sb', 'C', null)}>C</li>
|
||||
<li className='c' onClick={_use.bind(this, 'sb', 'D', null)}>D</li>
|
||||
<li className='c' onClick={_use.bind(this, 'sb', 'E', null)}>E</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'A', null)}>A</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'B', null)}>B</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'C', null)}>C</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'D', null)}>D</li>
|
||||
<li className='c' tabIndex='0' onClick={_use.bind(this, 'sb', 'E', null)}>E</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('hs')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')}>{translate('Heat Sink Launcher')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'hs', null, 'Heat Sink Launcher')}>{translate('Heat Sink Launcher')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('ch')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')}>{translate('Chaff Launcher')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'ch', null, 'Chaff Launcher')}>{translate('Chaff Launcher')}</li>
|
||||
</ul>
|
||||
<div className='select-group cap'>{translate('po')}</div>
|
||||
<ul>
|
||||
<li className='lc' onClick={_use.bind(this, 'po', null, 'Point Defence')}>{translate('Point Defence')}</li>
|
||||
<li className='lc' tabIndex='0' onClick={_use.bind(this, 'po', null, 'Point Defence')}>{translate('Point Defence')}</li>
|
||||
</ul>
|
||||
</div>;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import React, { PropTypes } from 'react';
|
||||
import Measure from 'react-measure';
|
||||
import { BarChart, Bar, XAxis, YAxis } from 'recharts';
|
||||
import ContainerDimensions from 'react-container-dimensions';
|
||||
import { BarChart, Bar, XAxis, YAxis, LabelList } from 'recharts';
|
||||
|
||||
const CORIOLIS_COLOURS = ['#FF8C0D', '#1FB0FF', '#71A052', '#D5D54D'];
|
||||
const LABEL_COLOUR = '#000000';
|
||||
@@ -17,7 +17,6 @@ const merge = function(one, two) {
|
||||
* A vertical bar chart
|
||||
*/
|
||||
export default class VerticalBarChart extends TranslatedComponent {
|
||||
|
||||
static propTypes = {
|
||||
data : PropTypes.array.isRequired,
|
||||
yMax : PropTypes.number
|
||||
@@ -32,13 +31,6 @@ export default class VerticalBarChart extends TranslatedComponent {
|
||||
super(props);
|
||||
|
||||
this._termtip = this._termtip.bind(this);
|
||||
|
||||
this.state = {
|
||||
dimensions: {
|
||||
width: 300,
|
||||
height: 300
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -46,7 +38,6 @@ export default class VerticalBarChart extends TranslatedComponent {
|
||||
* @returns {Object} the markup
|
||||
*/
|
||||
render() {
|
||||
const { width, height } = this.state.dimensions;
|
||||
const { tooltip, termtip } = this.context;
|
||||
|
||||
// Calculate maximum for Y
|
||||
@@ -56,15 +47,19 @@ export default class VerticalBarChart extends TranslatedComponent {
|
||||
const localMax = Math.max(dataMax, yMax);
|
||||
|
||||
return (
|
||||
<Measure whitelist={['width', 'top']} onMeasure={ (dimensions) => this.setState({ dimensions }) }>
|
||||
<div width='100%'>
|
||||
<BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}>
|
||||
<XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' />
|
||||
<YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/>
|
||||
<Bar dataKey='value' label={<ValueLabel />} fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}/>
|
||||
</BarChart>
|
||||
</div>
|
||||
</Measure>
|
||||
<ContainerDimensions>
|
||||
{ ({ width }) => (
|
||||
<div width='100%'>
|
||||
<BarChart width={width} height={width * ASPECT} data={this.props.data} margin={{ top: 5, right: 5, left: 5, bottom: 5 }}>
|
||||
<XAxis interval={0} fontSize='0.8em' stroke={AXIS_COLOUR} dataKey='label' />
|
||||
<YAxis interval={'preserveStart'} tickCount={11} fontSize='0.8em' stroke={AXIS_COLOUR} type='number' domain={[0, localMax]}/>
|
||||
<Bar dataKey='value' fill={CORIOLIS_COLOURS[0]} isAnimationActive={false} onMouseOver={this._termtip} onMouseOut={tooltip.bind(null, null)}>
|
||||
<LabelList dataKey='value' position='insideTop'/>
|
||||
</Bar>
|
||||
</BarChart>
|
||||
</div>
|
||||
)}
|
||||
</ContainerDimensions>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -83,29 +78,3 @@ export default class VerticalBarChart extends TranslatedComponent {
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A label that displays the value within the bar of the chart
|
||||
*/
|
||||
class ValueLabel extends React.Component {
|
||||
static propTypes = {
|
||||
x: PropTypes.number,
|
||||
y: PropTypes.number,
|
||||
payload: PropTypes.object,
|
||||
value: PropTypes.number
|
||||
};
|
||||
|
||||
/**
|
||||
* Render offence
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { x, y, payload, value } = this.props;
|
||||
|
||||
const em = value < 1000 ? '1em' : value < 1000 ? '0.8em' : '0.7em';
|
||||
|
||||
return (
|
||||
<text x={x} y={y} fill="#000000" textAnchor="middle" dy={20} style={{ fontSize: em }}>{value}</text>
|
||||
);
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,204 +1,105 @@
|
||||
import React from 'react';
|
||||
import PropTypes from 'prop-types';
|
||||
import TranslatedComponent from './TranslatedComponent';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import { nameComparator } from '../utils/SlotFunctions';
|
||||
import { CollapseSection, ExpandSection, MountFixed, MountGimballed, MountTurret } from './SvgIcons';
|
||||
import LineChart from '../components/LineChart';
|
||||
import Slider from '../components/Slider';
|
||||
import * as Calc from '../shipyard/Calculations';
|
||||
import Module from '../shipyard/Module';
|
||||
import { moduleReduce } from 'ed-forge/lib/helper';
|
||||
import { chain, keys, mapValues, values } from 'lodash';
|
||||
|
||||
const DAMAGE_DEALT_COLORS = ['#FFFFFF', '#FF0000', '#00FF00', '#7777FF', '#FFFF00', '#FF00FF', '#00FFFF', '#777777'];
|
||||
const PORTION_MAPPINGS = {
|
||||
'absolute': 'absolutedamageportion',
|
||||
'explosive': 'explosivedamageportion',
|
||||
'kinetic': 'kineticdamageportion',
|
||||
'thermal': 'thermicdamageportion',
|
||||
};
|
||||
const MULTS = keys(PORTION_MAPPINGS);
|
||||
|
||||
// TODO: help with this in ed-forge
|
||||
/**
|
||||
* .
|
||||
* @param {Object} opponentDefence .
|
||||
* @returns {Object} .
|
||||
*/
|
||||
function defenceToMults(opponentDefence) {
|
||||
return chain(opponentDefence)
|
||||
.pick(MULTS)
|
||||
.mapKeys((v, k) => PORTION_MAPPINGS[k])
|
||||
.mapValues((resistanceProfile) => resistanceProfile.damageMultiplier)
|
||||
.value();
|
||||
}
|
||||
|
||||
/**
|
||||
* Weapon damage chart
|
||||
*/
|
||||
export default class WeaponDamageChart extends TranslatedComponent {
|
||||
static propTypes = {
|
||||
code: PropTypes.string.isRequired,
|
||||
ship: PropTypes.object.isRequired,
|
||||
opponent: PropTypes.object.isRequired,
|
||||
hull: PropTypes.bool.isRequired,
|
||||
opponentDefence: PropTypes.object.isRequired,
|
||||
engagementRange: PropTypes.number.isRequired,
|
||||
opponentSys: PropTypes.number.isRequired,
|
||||
marker: PropTypes.string.isRequired
|
||||
};
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
* @param {Object} context React Component context
|
||||
*/
|
||||
constructor(props, context) {
|
||||
super(props);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the initial weapons state
|
||||
*/
|
||||
componentWillMount() {
|
||||
const weaponNames = this._weaponNames(this.props.ship, this.context);
|
||||
const opponentShields = Calc.shieldMetrics(this.props.opponent, this.props.opponentSys);
|
||||
const opponentArmour = Calc.armourMetrics(this.props.opponent);
|
||||
const maxRange = this._calcMaxRange(this.props.ship);
|
||||
const maxDps = this._calcMaxSDps(this.props.ship, this.props.opponent, opponentShields, opponentArmour);
|
||||
|
||||
this.setState({ maxRange, maxDps, weaponNames, opponentShields, opponentArmour, calcSDpsFunc: this._calcSDps.bind(this, this.props.ship, weaponNames, this.props.opponent, opponentShields, opponentArmour, this.props.hull) });
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the updated weapons state if our ship changes
|
||||
* @param {Object} nextProps Incoming/Next properties
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
* @return {boolean} Returns true if the component should be rerendered
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (nextProps.marker != this.props.marker) {
|
||||
const weaponNames = this._weaponNames(nextProps.ship, nextContext);
|
||||
const opponentShields = Calc.shieldMetrics(nextProps.opponent, nextProps.opponentSys);
|
||||
const opponentArmour = Calc.armourMetrics(nextProps.opponent);
|
||||
const maxRange = this._calcMaxRange(nextProps.ship);
|
||||
const maxDps = this._calcMaxSDps(nextProps.ship, nextProps.opponent, opponentShields, opponentArmour);
|
||||
this.setState({ weaponNames,
|
||||
opponentShields,
|
||||
opponentArmour,
|
||||
maxRange,
|
||||
maxDps,
|
||||
calcSDpsFunc: this._calcSDps.bind(this, nextProps.ship, weaponNames, nextProps.opponent, opponentShields, opponentArmour, nextProps.hull)
|
||||
});
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum range of a ship's weapons
|
||||
* @param {Object} ship The ship
|
||||
* @returns {int} The maximum range, in metres
|
||||
*/
|
||||
_calcMaxRange(ship) {
|
||||
let maxRange = 1000; // Minimum
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const thisRange = ship.hardpoints[i].m.getRange();
|
||||
if (thisRange > maxRange) {
|
||||
maxRange = thisRange;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return maxRange;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the maximum sustained single-weapon DPS for this ship
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} opponent The opponent ship
|
||||
* @param {Object} opponentShields The opponent's shields
|
||||
* @param {Object} opponentArmour The opponent's armour
|
||||
* @return {number} The maximum sustained single-weapon DPS
|
||||
*/
|
||||
_calcMaxSDps(ship, opponent, opponentShields, opponentArmour) {
|
||||
// Additional information to allow effectiveness calculations
|
||||
let maxSDps = 0;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
|
||||
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, 0);
|
||||
const thisSDps = sustainedDps.damage.armour.total > sustainedDps.damage.shields.total ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
|
||||
if (thisSDps > maxSDps) {
|
||||
maxSDps = thisSDps;
|
||||
}
|
||||
}
|
||||
}
|
||||
return maxSDps;
|
||||
}
|
||||
|
||||
/**
|
||||
* Obtain the weapon names for this ship
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} context The context
|
||||
* @return {array} The weapon names
|
||||
*/
|
||||
_weaponNames(ship, context) {
|
||||
const translate = context.language.translate;
|
||||
let names = [];
|
||||
let num = 1;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
let name = '' + num++ + ': ' + m.class + m.rating + (m.missile ? '/' + m.missile : '') + ' ' + translate(m.name || m.grp);
|
||||
let engineering;
|
||||
if (m.blueprint && m.blueprint.name) {
|
||||
engineering = translate(m.blueprint.name) + ' ' + translate('grade') + ' ' + m.blueprint.grade;
|
||||
if (m.blueprint.special && m.blueprint.special.id) {
|
||||
engineering += ', ' + translate(m.blueprint.special.name);
|
||||
}
|
||||
}
|
||||
if (engineering) {
|
||||
name = name + ' (' + engineering + ')';
|
||||
}
|
||||
names.push(name);
|
||||
}
|
||||
}
|
||||
return names;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate the per-weapon sustained DPS for this ship against another ship at a given range
|
||||
* @param {Object} ship The ship
|
||||
* @param {Object} weaponNames The names of the weapons for which to calculate DPS
|
||||
* @param {Object} opponent The target
|
||||
* @param {Object} opponentShields The opponent's shields
|
||||
* @param {Object} opponentArmour The opponent's armour
|
||||
* @param {bool} hull true if to calculate against hull, false if to calculate against shields
|
||||
* @param {Object} engagementRange The engagement range
|
||||
* @return {array} The array of weapon DPS
|
||||
*/
|
||||
_calcSDps(ship, weaponNames, opponent, opponentShields, opponentArmour, hull, engagementRange) {
|
||||
let results = {};
|
||||
let weaponNum = 0;
|
||||
for (let i = 0; i < ship.hardpoints.length; i++) {
|
||||
if (ship.hardpoints[i].maxClass > 0 && ship.hardpoints[i].m && ship.hardpoints[i].enabled) {
|
||||
const m = ship.hardpoints[i].m;
|
||||
const sustainedDps = Calc._weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementRange);
|
||||
results[weaponNames[weaponNum++]] = hull ? sustainedDps.damage.armour.total : sustainedDps.damage.shields.total;
|
||||
}
|
||||
}
|
||||
return results;
|
||||
}
|
||||
|
||||
/**
|
||||
* Render damage dealt
|
||||
* @return {React.Component} contents
|
||||
*/
|
||||
render() {
|
||||
const { language, onWindowResize, sizeRatio, tooltip, termtip } = this.context;
|
||||
const { formats, translate, units } = language;
|
||||
const { maxRange } = this.state;
|
||||
const { ship, opponent, engagementRange } = this.props;
|
||||
const { language } = this.context;
|
||||
const { translate } = language;
|
||||
const { code, ship, opponentDefence, engagementRange } = this.props;
|
||||
|
||||
const sortOrder = this._sortOrder;
|
||||
const onCollapseExpand = this._onCollapseExpand;
|
||||
|
||||
const code = `${ship.toString()}:${opponent.toString()}`;
|
||||
const hardpoints = ship.getHardpoints();
|
||||
const hardpointsMap = chain(hardpoints)
|
||||
.map((m) => [m.getSlot(), m])
|
||||
.fromPairs()
|
||||
.value();
|
||||
const mults = defenceToMults(opponentDefence);
|
||||
const cb = (range) => {
|
||||
return mapValues(
|
||||
hardpointsMap,
|
||||
(m) => {
|
||||
const sdps = m.get('sustaineddamagepersecond', true);
|
||||
const resistanceMul = chain(mults)
|
||||
.toPairs()
|
||||
.map((pair) => {
|
||||
const [k, mul] = pair;
|
||||
return m.get(k, true) * mul;
|
||||
})
|
||||
.sum()
|
||||
.value();
|
||||
|
||||
const falloff = m.get('damagefalloffrange', true);
|
||||
const rangeMul = Math.min(1, Math.max(0,
|
||||
1 - (range - falloff) / (m.get('maximumrange', true) - falloff)
|
||||
));
|
||||
return sdps * resistanceMul * rangeMul;
|
||||
}
|
||||
);
|
||||
};
|
||||
return (
|
||||
<span>
|
||||
<div>
|
||||
<LineChart
|
||||
xMax={maxRange}
|
||||
yMax={this.state.maxDps}
|
||||
xMin={0}
|
||||
xMax={moduleReduce(
|
||||
hardpoints, 'maximumrange', true, (a, v) => Math.max(a, v), 1000,
|
||||
)}
|
||||
yMin={0}
|
||||
// Factor in highest damage multiplier to get a safe upper bound
|
||||
yMax={Math.max(1, ...values(mults)) * moduleReduce(
|
||||
hardpoints, 'sustaineddamagepersecond', true, (a, v) => Math.max(a, v), 0,
|
||||
)}
|
||||
xLabel={translate('range')}
|
||||
xUnit={translate('m')}
|
||||
yLabel={translate('sdps')}
|
||||
series={this.state.weaponNames}
|
||||
xMark={this.props.engagementRange}
|
||||
yLabel={translate('sustaineddamagepersecond')}
|
||||
series={hardpoints.map((m) => m.getSlot())}
|
||||
xMark={engagementRange}
|
||||
colors={DAMAGE_DEALT_COLORS}
|
||||
func={this.state.calcSDpsFunc}
|
||||
func={cb}
|
||||
points={200}
|
||||
code={code}
|
||||
/>
|
||||
</span>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -7,6 +7,7 @@ import * as IT from './it';
|
||||
import * as RU from './ru';
|
||||
import * as PL from './pl';
|
||||
import * as PT from './pt';
|
||||
import * as CN from './cn';
|
||||
import * as d3 from 'd3';
|
||||
|
||||
let fallbackTerms = EN.terms;
|
||||
@@ -27,6 +28,7 @@ export function getLanguage(langCode) {
|
||||
case 'ru': lang = RU; break;
|
||||
case 'pl': lang = PL; break;
|
||||
case 'pt': lang = PT; break;
|
||||
case 'cn': lang = CN; break;
|
||||
default:
|
||||
lang = EN;
|
||||
}
|
||||
@@ -60,17 +62,20 @@ export function getLanguage(langCode) {
|
||||
},
|
||||
translate,
|
||||
units: {
|
||||
ang: '°', // Angle
|
||||
CR: <u>{translate('CR')}</u>, // Credits
|
||||
kg: <u>{translate('kg')}</u>, // Kilograms
|
||||
kgs: <u>{translate('kg/s')}</u>, // Kilograms per second
|
||||
km: <u>{translate('km')}</u>, // Kilometers
|
||||
Ls: <u>{translate('Ls')}</u>, // Light Seconds
|
||||
LY: <u>{translate('LY')}</u>, // Light Years
|
||||
m: <u>{translate('m')}</u>, // Meters
|
||||
MJ: <u>{translate('MJ')}</u>, // Mega Joules
|
||||
'm/s': <u>{translate('m/s')}</u>, // Meters per second
|
||||
'°/s': <u>{translate('°/s')}</u>, // Degrees per second
|
||||
MW: <u>{translate('MW')}</u>, // Mega Watts (same as Mega Joules per second)
|
||||
mps: <u>{translate('m/s')}</u>, // Metres per second
|
||||
pct: '%', // Percent
|
||||
ps: <u>{translate('/s')}</u>, // per second
|
||||
pm: <u>{translate('/min')}</u>, // per minute
|
||||
s: <u>{translate('secs')}</u>, // Seconds
|
||||
@@ -91,5 +96,6 @@ export const Languages = {
|
||||
fr: 'Français',
|
||||
ru: 'ру́сский',
|
||||
pl: 'polski',
|
||||
pt: 'português'
|
||||
pt: 'português',
|
||||
cn: '中文'
|
||||
};
|
||||
|
||||
16
src/app/i18n/cn.js
Normal file
16
src/app/i18n/cn.js
Normal file
@@ -0,0 +1,16 @@
|
||||
export const formats = {
|
||||
decimal: '.',
|
||||
thousands: ',',
|
||||
grouping: [3],
|
||||
currency: ['¥', ''],
|
||||
dateTime: '%a %b %e %X %Y',
|
||||
date: '%Y年%m月%d日',
|
||||
time: '%H:%M:%S',
|
||||
periods: ['AM', 'PM'],
|
||||
days: ['星期日', '星期一', '星期二', '星期三', '星期四', '星期五', '星期六'],
|
||||
shortDays: ['周日', '周一', '周二', '周三', '周四', '周五', '周六'],
|
||||
months: ['一月', '二月', '三月', '四月', '五月', '六月', '七月', '八月', '九月', '十月', '十一月', '十二月'],
|
||||
shortMonths: ['一月', '二月', '三月', '四月', '五月', '六月', '七月', '八月', '九月', '十月', '十一月', '十二月']
|
||||
};
|
||||
|
||||
export { default as terms } from './cn.json';
|
||||
405
src/app/i18n/cn.json
Normal file
405
src/app/i18n/cn.json
Normal file
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
File diff suppressed because one or more lines are too long
@@ -59,7 +59,7 @@
|
||||
"empty all": "vide tout",
|
||||
"Enter Name": "Entrer nom",
|
||||
"Explorer": "explorateur",
|
||||
"fastest range": "gamme la plus rapide",
|
||||
"farthest range": "gamme la plus rapide",
|
||||
"fuel": "carburant",
|
||||
"fuel level": "niveau de carburant",
|
||||
"full tank": "Réservoir plein",
|
||||
|
||||
@@ -20,11 +20,11 @@
|
||||
"PHRASE_BLUEPRINT_BEST": "Лучшие основные значения для чертежа",
|
||||
"PHRASE_BLUEPRINT_EXTREME": "Лучшие положительные и худшие отрицательные основные значения для чертежа",
|
||||
"PHRASE_BLUEPRINT_RESET": "Убрать все изменения и чертёж",
|
||||
"PHRASE_SELECT_SPECIAL": "Нажмите чтобы выбрать экспериментальный эффект",
|
||||
"PHRASE_SELECT_SPECIAL": "Нажмите, чтобы выбрать экспериментальный эффект",
|
||||
"PHRASE_NO_SPECIAL": "Без экспериментального эффекта",
|
||||
"PHRASE_SHOPPING_LIST": "Станции что продают эту сборку",
|
||||
"PHRASE_REFIT_SHOPPING_LIST": "Станции что продают необходимые модули",
|
||||
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Общий урон что может быть нанесён в каждым типе, если используются все щитонакопители",
|
||||
"PHRASE_SHOPPING_LIST": "Станции, что продают эту сборку",
|
||||
"PHRASE_REFIT_SHOPPING_LIST": "Станции, что продают необходимые модули",
|
||||
"PHRASE_TOTAL_EFFECTIVE_SHIELD": "Общий урон, что может быть нанесён в каждым типе, если используются все щитонакопители",
|
||||
"PHRASE_TIME_TO_LOSE_SHIELDS": "Щиты продержатся",
|
||||
"PHRASE_TIME_TO_RECOVER_SHIELDS": "Щиты восстановятся за",
|
||||
"PHRASE_TIME_TO_RECHARGE_SHIELDS": "Щиты будут заряжены за",
|
||||
@@ -43,12 +43,12 @@
|
||||
"PHRASE_TIME_TO_REMOVE_ARMOUR": "Снимет броню за",
|
||||
"TT_TIME_TO_REMOVE_ARMOUR": "Непрерывным огнём из всех орудий",
|
||||
"PHRASE_TIME_TO_DRAIN_WEP": "Опустошит ОРУЖ за",
|
||||
"TT_TIME_TO_DRAIN_WEP": "Время за которое опустошится аккумулятор ОРУЖ при стрельбе из всех орудий",
|
||||
"TT_TIME_TO_DRAIN_WEP": "Время, за которое опустошится аккумулятор ОРУЖ при стрельбе из всех орудий",
|
||||
"TT_TIME_TO_LOSE_SHIELDS": "Против поддерживаемой стрельбы из всех орудий противника",
|
||||
"TT_TIME_TO_LOSE_ARMOUR": "Против поддерживаемой стрельбы из всех орудий противника",
|
||||
"TT_MODULE_ARMOUR": "Броня защищаюшае модули от урона",
|
||||
"TT_MODULE_PROTECTION_EXTERNAL": "Процент урона перенаправленного от гнёзд на наборы для усиления модулей",
|
||||
"TT_MODULE_PROTECTION_INTERNAL": "Процент урона перенаправленного от модулей вне гнёзд на наборы для усиления модулей",
|
||||
"TT_MODULE_ARMOUR": "Броня, защищающая модули от урона",
|
||||
"TT_MODULE_PROTECTION_EXTERNAL": "Процент урона, перенаправленного от гнёзд на наборы для усиления модулей",
|
||||
"TT_MODULE_PROTECTION_INTERNAL": "Процент урона, перенаправленного от модулей вне гнёзд на наборы для усиления модулей",
|
||||
"TT_EFFECTIVE_SDPS_SHIELDS": "Реальный поддерживаемый ДПС пока аккумулятор ОРУЖ не пуст",
|
||||
"TT_EFFECTIVENESS_SHIELDS": "Эффективность в сравнении с попаданием по цели с 0-сопротивляемостью без пунктов в СИС на 0 метрах",
|
||||
"TT_EFFECTIVE_SDPS_ARMOUR": "Реальный поддерживаемый ДПС пока аккумулятор ОРУЖ не пуст",
|
||||
@@ -56,7 +56,7 @@
|
||||
"PHRASE_EFFECTIVE_SDPS_SHIELDS": "ПДПС против щитов",
|
||||
"PHRASE_EFFECTIVE_SDPS_ARMOUR": "ПДПС против брони",
|
||||
"TT_SUMMARY_SPEED": "С полным топливным баком и 4 пунктами в ДВИ",
|
||||
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "маневровые двигатели выключены или превышена максимальная масса с топливом и грузом",
|
||||
"TT_SUMMARY_SPEED_NONFUNCTIONAL": "Маневровые двигатели выключены или превышена максимальная масса с топливом и грузом",
|
||||
"TT_SUMMARY_BOOST": "С полным топливным баком и 4 пунктами в ДВИ",
|
||||
"TT_SUMMARY_BOOST_NONFUNCTIONAL": "Распределитель питания не может обеспечить достаточно энергии для форсажа",
|
||||
"TT_SUMMARY_SHIELDS": "Чистая сила щита, включая усилители",
|
||||
@@ -68,16 +68,16 @@
|
||||
"TT_SUMMARY_DPS": "Урон в секунду при стрельбе из всех орудий",
|
||||
"TT_SUMMARY_EPS": "Расход аккумулятора ОРУЖ в секунду при стрельбе из всех орудий",
|
||||
"TT_SUMMARY_TTD": "Время расхода аккумулятора ОРУЖ при стрельбе из всех орудий и с 4 пунктами в ОРУЖ",
|
||||
"TT_SUMMARY_MAX_SINGLE_JUMP": "Самый дальний возможный прыжок без груза и с топливом достаточным только на сам прыжок",
|
||||
"TT_SUMMARY_MAX_SINGLE_JUMP": "Самый дальний возможный прыжок без груза и с топливом, достаточным только на сам прыжок",
|
||||
"TT_SUMMARY_UNLADEN_SINGLE_JUMP": "Самый дальний возможный прыжок без груза и с полным топливным баком",
|
||||
"TT_SUMMARY_LADEN_SINGLE_JUMP": "Самый дальний возможный прыжок с полным грузовым отсеком и с полным топливным баком",
|
||||
"TT_SUMMARY_UNLADEN_TOTAL_JUMP": "Самая дальняя общая дистанция без груза, с полным топливным баком и при прыжках на максимальное расстояние",
|
||||
"TT_SUMMARY_LADEN_TOTAL_JUMP": "Самая дальняя общая дистанция с полным грузовым отсеком, с полным топливным баком и при прыжках на максимальное расстояние",
|
||||
"HELP_MODIFICATIONS_MENU": "Ткните на номер чтобы ввести новое значение, или потяните вдоль полосы для малых изменений",
|
||||
"HELP_MODIFICATIONS_MENU": "Нажмите на номер, чтобы ввести новое значение, или потяните вдоль полосы для малых изменений",
|
||||
"am": "Блок Автом. Полевого Ремонта",
|
||||
"bh": "Переборки",
|
||||
"bl": "Пучковый Лазер",
|
||||
"bsg": "Двухпоточный Щитогенератор",
|
||||
"bl": "Пучковый лазер",
|
||||
"bsg": "Двухпоточный щитогенератор",
|
||||
"c": "Орудие",
|
||||
"cc": "Контроллер магнитного снаряда для сбора",
|
||||
"ch": "Разбрасыватель дипольных отражателей",
|
||||
@@ -89,7 +89,7 @@
|
||||
"fh": "Ангар для истребителя",
|
||||
"fi": "FSD-перехватчик",
|
||||
"fs": "Топливозаборник",
|
||||
"fsd": "Рамочно Сместительный двигатель",
|
||||
"fsd": "Рамочно-сместительный двигатель",
|
||||
"ft": "Топливный бак",
|
||||
"fx": "Контроллер магнитного снаряда для топлива",
|
||||
"hb": "Контроллер магнитного снаряда для взлома трюма",
|
||||
@@ -110,7 +110,7 @@
|
||||
"pcm": "Каюта пассажира первого класса",
|
||||
"pcq": "Каюта пассажира класса люкс",
|
||||
"pd": "Распределитель питания",
|
||||
"pl": "Ипмульсный лазер",
|
||||
"pl": "Импульсный лазер",
|
||||
"po": "Точечная оборона",
|
||||
"pp": "Силовая установка",
|
||||
"psg": "Призматический щитогенератор",
|
||||
@@ -122,7 +122,7 @@
|
||||
"sc": "Сканер обнаружения",
|
||||
"scb": "Щитонакопитель",
|
||||
"sg": "Щитогенератор",
|
||||
"ss": "Сканер Поверхностей",
|
||||
"ss": "Сканер поверхностей",
|
||||
"t": "Маневровые двигатели",
|
||||
"tp": "Торпедная стойка",
|
||||
"ul": "Пульсирующие лазеры",
|
||||
@@ -130,7 +130,7 @@
|
||||
"emptyrestricted": "пусто (ограниченно)",
|
||||
"damage dealt to": "Урон нанесён",
|
||||
"damage received from": "Урон получен от",
|
||||
"against shields": "Против шитов",
|
||||
"against shields": "Против щитов",
|
||||
"against hull": "Против корпуса",
|
||||
"total effective shield": "Общие эффективные щиты",
|
||||
"ammunition": "Припасы",
|
||||
@@ -149,7 +149,7 @@
|
||||
"eps": "Энергия в секунду",
|
||||
"epsseps": "Энергия в секунду (поддерживаемая энергия в секунду)",
|
||||
"hps": "Нагрев в секунду",
|
||||
"hpsshps": "Heat per second (sustained heat per second)",
|
||||
"hpsshps": "Нагрев в секунду (поддерживаемый нагрев в секунду)",
|
||||
"damage by": "Урон",
|
||||
"damage from": "Урон от",
|
||||
"shield cells": "Щитонакопители",
|
||||
@@ -183,7 +183,7 @@
|
||||
"hullreinforcement": "Укрепление корпуса",
|
||||
"integrity": "Целостность",
|
||||
"jitter": "Дрожание",
|
||||
"kinres": "Сопротивление китетическому урону",
|
||||
"kinres": "Сопротивление кинетическому урону",
|
||||
"maxfuel": "Макс. топлива на прыжок",
|
||||
"mass": "Масса",
|
||||
"optmass": "Оптимизированная масса",
|
||||
@@ -299,7 +299,7 @@
|
||||
"edit data": "Редактирование",
|
||||
"empty all": "пусто все",
|
||||
"Enter Name": "Введите имя",
|
||||
"fastest range": "быстрый диапазон",
|
||||
"farthest range": "быстрый диапазон",
|
||||
"fuel level": "уровень топлива",
|
||||
"full tank": "Полный бак",
|
||||
"internal compartments": "внутренние отсеки",
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
import 'babel-polyfill';
|
||||
import '@babel/polyfill';
|
||||
import React from 'react';
|
||||
import { render } from 'react-dom';
|
||||
import '../less/app.less';
|
||||
|
||||
@@ -6,7 +6,6 @@ import { CoriolisLogo, GitHub } from '../components/SvgIcons';
|
||||
* About Page
|
||||
*/
|
||||
export default class AboutPage extends Page {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
@@ -23,27 +22,112 @@ export default class AboutPage extends Page {
|
||||
* @return {React.Component} The page contents
|
||||
*/
|
||||
renderPage() {
|
||||
return <div className={'page'} style={{ textAlign: 'left', maxWidth: 800, margin: '0 auto' }}>
|
||||
<h1><CoriolisLogo style={{ marginRight: '0.4em' }} className='xl'/><span className='warning'>Coriolis EDCD Edition</span></h1>
|
||||
return (
|
||||
<div
|
||||
className={'page'}
|
||||
style={{ textAlign: 'left', maxWidth: 800, margin: '0 auto' }}
|
||||
>
|
||||
<h1>
|
||||
<CoriolisLogo style={{ marginRight: '0.4em' }} className="xl" />
|
||||
<span className="warning">Coriolis EDCD Edition</span>
|
||||
</h1>
|
||||
|
||||
<p>This is a clone of the Coriolis project, whose original author is currently unable to maintain it. This clone is maintained by the <a href="http://edcd.github.io/">EDCD community</a>.</p>
|
||||
<p>To recover your builds, go to <a href='https://coriolis.io/' target='_blank'>https://coriolis.io/</a>, backup your builds (Settings / Backup), copy the text, return here and import (Settings / Import).</p>
|
||||
<p>The Coriolis project was inspired by <a href='http://www.edshipyard.com/' target='_blank'>E:D Shipyard</a> and, of course, <a href='http://www.elitedangerous.com' target='_blank'>Elite Dangerous</a>. The ultimate goal of Coriolis is to provide rich features to support in-game play and planning while engaging the E:D community to support its development.</p>
|
||||
<p>Coriolis was created using assets and imagery from Elite: Dangerous, with the permission of Frontier Developments plc, for non-commercial purposes. It is not endorsed by nor reflects the views or opinions of Frontier Developments. A number of assets were sourced from <a href='http://edassets.org' target='_blank'>ED Assets</a></p>
|
||||
<p>
|
||||
This is a clone of the Coriolis project, whose original author is
|
||||
currently unable to maintain it. This clone is maintained by the{' '}
|
||||
<a href="http://edcd.github.io/">EDCD community</a>.
|
||||
</p>
|
||||
<p>
|
||||
To recover your builds, go to{' '}
|
||||
<a href="https://coriolis.io/" target="_blank">
|
||||
https://coriolis.io/
|
||||
</a>
|
||||
, backup your builds (Settings / Backup), copy the text, return here
|
||||
and import (Settings / Import).
|
||||
</p>
|
||||
<p>
|
||||
The Coriolis project was inspired by{' '}
|
||||
<a href="http://www.edshipyard.com/" target="_blank">
|
||||
E:D Shipyard
|
||||
</a>{' '}
|
||||
and, of course,{' '}
|
||||
<a href="http://www.elitedangerous.com" target="_blank">
|
||||
Elite Dangerous
|
||||
</a>
|
||||
. The ultimate goal of Coriolis is to provide rich features to support
|
||||
in-game play and planning while engaging the E:D community to support
|
||||
its development.
|
||||
</p>
|
||||
<p>
|
||||
Coriolis was created using assets and imagery from Elite: Dangerous,
|
||||
with the permission of Frontier Developments plc, for non-commercial
|
||||
purposes. It is not endorsed by nor reflects the views or opinions of
|
||||
Frontier Developments. A number of assets were sourced from{' '}
|
||||
<a href="http://edassets.org" target="_blank">
|
||||
ED Assets
|
||||
</a>
|
||||
</p>
|
||||
|
||||
<a style={{ display: 'block', textDecoration: 'none' }} href='https://github.com/EDCD/coriolis' target='_blank' title='Coriolis Github Project'>
|
||||
<GitHub style={{ margin: '0.4em' }} className='l fg xl'/>
|
||||
<h2 style={{ margin: 0, textDecoration: 'none' }}>Github</h2>
|
||||
github.com/EDCD/coriolis
|
||||
</a>
|
||||
<a
|
||||
style={{ display: 'block', textDecoration: 'none' }}
|
||||
href="https://github.com/EDCD/coriolis"
|
||||
target="_blank"
|
||||
title="Coriolis Github Project"
|
||||
>
|
||||
<GitHub style={{ margin: '0.4em' }} className="l fg xl" />
|
||||
<h2 style={{ margin: 0, textDecoration: 'none' }}>Github</h2>
|
||||
github.com/EDCD/coriolis
|
||||
</a>
|
||||
|
||||
<p>Coriolis is an open source project. Checkout the list of upcoming features and to-do list on github. Any and all contributions and feedback are welcome. If you encounter any bugs please report them and provide as much detail as possible.</p>
|
||||
<p>
|
||||
Coriolis is an open source project. Checkout the list of upcoming
|
||||
features and to-do list on github. Any and all contributions and
|
||||
feedback are welcome. If you encounter any bugs please report them and
|
||||
provide as much detail as possible.
|
||||
</p>
|
||||
|
||||
<h3>Chat</h3>
|
||||
<p>You can chat to us on our <a href='https://discord.gg/0uwCh6R62aPRjk9w' target='_blank'>EDCD Discord server</a>.</p>
|
||||
<h3>Chat</h3>
|
||||
<p>
|
||||
You can chat to us on our{' '}
|
||||
<a href="https://discord.gg/0uwCh6R62aPRjk9w" target="_blank">
|
||||
EDCD Discord server
|
||||
</a>
|
||||
.
|
||||
</p>
|
||||
|
||||
<h3>Supporting Coriolis</h3>
|
||||
<p>Coriolis is an open source project, and I work on it in my free time. I have set up a patreon at <a href='https://www.patreon.com/coriolis_elite'>patreon.com/coriolis_elite</a>, which will be used to keep Coriolis up to date and the servers running.</p>
|
||||
</div>;
|
||||
<h3>Supporting Coriolis</h3>
|
||||
<p>
|
||||
Coriolis is an open source project, and I work on it in my free time.
|
||||
I have set up a patreon at{' '}
|
||||
<a href="https://www.patreon.com/coriolis_elite">
|
||||
patreon.com/coriolis_elite
|
||||
</a>
|
||||
, which will be used to keep Coriolis up to date and the servers
|
||||
running.
|
||||
</p>
|
||||
<form
|
||||
action="https://www.paypal.com/cgi-bin/webscr"
|
||||
method="post"
|
||||
target="_top"
|
||||
>
|
||||
<input type="hidden" name="cmd" value="_s-xclick" />
|
||||
<input type="hidden" name="hosted_button_id" value="SJBKT2SWEEU68" />
|
||||
<input
|
||||
type="image"
|
||||
src="https://www.paypalobjects.com/en_AU/i/btn/btn_donate_SM.gif"
|
||||
border="0"
|
||||
name="submit"
|
||||
alt="PayPal – The safer, easier way to pay online!"
|
||||
/>
|
||||
<img
|
||||
alt=""
|
||||
border="0"
|
||||
src="https://www.paypalobjects.com/en_AU/i/scr/pixel.gif"
|
||||
width="1"
|
||||
height="1"
|
||||
/>
|
||||
</form>
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -13,7 +13,14 @@ import ModalCompare from '../components/ModalCompare';
|
||||
import ModalExport from '../components/ModalExport';
|
||||
import ModalPermalink from '../components/ModalPermalink';
|
||||
import ModalImport from '../components/ModalImport';
|
||||
import { FloppyDisk, Bin, Download, Embed, Rocket, LinkIcon } from '../components/SvgIcons';
|
||||
import {
|
||||
FloppyDisk,
|
||||
Bin,
|
||||
Download,
|
||||
Embed,
|
||||
Rocket,
|
||||
LinkIcon
|
||||
} from '../components/SvgIcons';
|
||||
import ShortenUrl from '../utils/ShortenUrl';
|
||||
import { comparisonBBCode } from '../utils/BBCode';
|
||||
const browser = require('detect-browser');
|
||||
@@ -42,7 +49,6 @@ function sortBy(predicate) {
|
||||
* Comparison Page
|
||||
*/
|
||||
export default class ComparisonPage extends Page {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
@@ -81,7 +87,13 @@ export default class ComparisonPage extends Page {
|
||||
for (let shipId in allBuilds) {
|
||||
for (let buildName in allBuilds[shipId]) {
|
||||
if (buildName && allBuilds[shipId][buildName]) {
|
||||
builds.push(this._createBuild(shipId, buildName, allBuilds[shipId][buildName]));
|
||||
builds.push(
|
||||
this._createBuild(
|
||||
shipId,
|
||||
buildName,
|
||||
allBuilds[shipId][buildName]
|
||||
)
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -89,7 +101,9 @@ export default class ComparisonPage extends Page {
|
||||
let comparisonData = Persist.getComparison(name);
|
||||
if (comparisonData) {
|
||||
defaultFacets = comparisonData.facets;
|
||||
comparisonData.builds.forEach((b) => builds.push(this._createBuild(b.shipId, b.buildName)));
|
||||
comparisonData.builds.forEach(b =>
|
||||
builds.push(this._createBuild(b.shipId, b.buildName))
|
||||
);
|
||||
saved = true;
|
||||
newName = name;
|
||||
}
|
||||
@@ -101,7 +115,7 @@ export default class ComparisonPage extends Page {
|
||||
newName = name = comparisonData.n;
|
||||
predicate = comparisonData.p;
|
||||
desc = comparisonData.d;
|
||||
comparisonData.b.forEach((build) => {
|
||||
comparisonData.b.forEach(build => {
|
||||
builds.push(this._createBuild(build.s, build.n, build.c));
|
||||
if (!importObj[build.s]) {
|
||||
importObj[build.s] = {};
|
||||
@@ -118,9 +132,9 @@ export default class ComparisonPage extends Page {
|
||||
let selectedFacets = new Array(selectedLength);
|
||||
|
||||
for (let i = 0; i < ShipFacets.length; i++) {
|
||||
let facet = Object.assign({ }, ShipFacets[i]);
|
||||
let facet = Object.assign({}, ShipFacets[i]);
|
||||
let defaultIndex = defaultFacets.indexOf(facet.i);
|
||||
if(defaultIndex == -1) {
|
||||
if (defaultIndex == -1) {
|
||||
facets.push(facet);
|
||||
} else {
|
||||
facet.active = true;
|
||||
@@ -155,17 +169,18 @@ export default class ComparisonPage extends Page {
|
||||
_createBuild(id, name, code) {
|
||||
code = code ? code : Persist.getBuild(id, name); // Retrieve build code if not passed
|
||||
|
||||
if (!code) { // No build found
|
||||
if (!code) {
|
||||
// No build found
|
||||
return;
|
||||
}
|
||||
|
||||
let data = Ships[id]; // Get ship properties
|
||||
let data = Ships[id]; // Get ship properties
|
||||
let b = new Ship(id, data.properties, data.slots); // Create a new Ship instance
|
||||
b.buildFrom(code); // Populate components from code
|
||||
b.buildFrom(code); // Populate components from code
|
||||
b.buildName = name;
|
||||
b.applyDiscounts(Persist.getShipDiscount(), Persist.getModuleDiscount());
|
||||
return b;
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state with the specified sort predicates
|
||||
@@ -184,13 +199,18 @@ export default class ComparisonPage extends Page {
|
||||
}
|
||||
|
||||
this.setState({ predicate, desc });
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Show selected builds modal
|
||||
*/
|
||||
_selectBuilds() {
|
||||
this.context.showModal(<ModalCompare onSelect={this._buildsSelected} builds={this.state.builds} />);
|
||||
this.context.showModal(
|
||||
<ModalCompare
|
||||
onSelect={this._buildsSelected}
|
||||
builds={this.state.builds}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -224,7 +244,7 @@ export default class ComparisonPage extends Page {
|
||||
_facetDrag(e) {
|
||||
this.nodeAfter = false;
|
||||
this.dragged = e.currentTarget;
|
||||
let placeholder = this.placeholder = document.createElement('li');
|
||||
let placeholder = (this.placeholder = document.createElement('li'));
|
||||
placeholder.style.width = Math.round(this.dragged.offsetWidth) + 'px';
|
||||
placeholder.className = 'facet-placeholder';
|
||||
if (!browser || (browser.name !== 'edge' && browser.name !== 'ie')) {
|
||||
@@ -262,7 +282,7 @@ export default class ComparisonPage extends Page {
|
||||
_facetDragOver(e) {
|
||||
e.preventDefault();
|
||||
|
||||
if(e.target.className == 'facet-placeholder') {
|
||||
if (e.target.className == 'facet-placeholder') {
|
||||
return;
|
||||
} else if (e.target != e.currentTarget) {
|
||||
this.over = e.target;
|
||||
@@ -272,7 +292,7 @@ export default class ComparisonPage extends Page {
|
||||
let parent = e.target.parentNode;
|
||||
|
||||
if (parent == e.currentTarget) {
|
||||
if(relX > width && this.dragged != e.target) {
|
||||
if (relX > width && this.dragged != e.target) {
|
||||
this.nodeAfter = true;
|
||||
parent.insertBefore(this.placeholder, e.target.nextElementSibling);
|
||||
} else {
|
||||
@@ -321,7 +341,7 @@ export default class ComparisonPage extends Page {
|
||||
let { newName, builds, facets } = this.state;
|
||||
let selectedFacets = [];
|
||||
|
||||
facets.forEach((f) => {
|
||||
facets.forEach(f => {
|
||||
if (f.active) {
|
||||
selectedFacets.unshift(f.i);
|
||||
}
|
||||
@@ -348,14 +368,20 @@ export default class ComparisonPage extends Page {
|
||||
|
||||
let code = fromComparison(name, builds, selectedFacets, predicate, desc);
|
||||
let loc = window.location;
|
||||
return loc.protocol + '//' + loc.host + '/comparison?code=' + encodeURIComponent(code);
|
||||
return (
|
||||
loc.protocol +
|
||||
'//' +
|
||||
loc.host +
|
||||
'/comparison?code=' +
|
||||
encodeURIComponent(code)
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Generates the long permalink URL
|
||||
*/
|
||||
_genPermalink() {
|
||||
this.context.showModal(<ModalPermalink url={this._buildUrl()}/>);
|
||||
this.context.showModal(<ModalPermalink url={this._buildUrl()} />);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -365,18 +391,25 @@ export default class ComparisonPage extends Page {
|
||||
let { translate, formats } = this.context.language;
|
||||
let { facets, builds } = this.state;
|
||||
|
||||
let generator = (callback) => {
|
||||
let generator = callback => {
|
||||
let url = this._buildUrl();
|
||||
ShortenUrl(url,
|
||||
(shortenedUrl) => callback(comparisonBBCode(translate, formats, facets, builds, shortenedUrl)),
|
||||
(error) => callback(comparisonBBCode(translate, formats, facets, builds, url))
|
||||
ShortenUrl(
|
||||
url,
|
||||
shortenedUrl =>
|
||||
callback(
|
||||
comparisonBBCode(translate, formats, facets, builds, shortenedUrl)
|
||||
),
|
||||
error =>
|
||||
callback(comparisonBBCode(translate, formats, facets, builds, url))
|
||||
);
|
||||
};
|
||||
|
||||
this.context.showModal(<ModalExport
|
||||
title={translate('forum') + ' BBCode'}
|
||||
generator={generator}
|
||||
/>);
|
||||
this.context.showModal(
|
||||
<ModalExport
|
||||
title={translate('forum') + ' BBCode'}
|
||||
generator={generator}
|
||||
/>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -409,7 +442,8 @@ export default class ComparisonPage extends Page {
|
||||
* @param {Object} nextContext Incoming/Next conext
|
||||
*/
|
||||
componentWillReceiveProps(nextProps, nextContext) {
|
||||
if (this.context.route !== nextContext.route) { // Only reinit state if the route has changed
|
||||
if (this.context.route !== nextContext.route) {
|
||||
// Only reinit state if the route has changed
|
||||
this.setState(this._initState(nextContext));
|
||||
}
|
||||
}
|
||||
@@ -419,7 +453,10 @@ export default class ComparisonPage extends Page {
|
||||
*/
|
||||
componentWillMount() {
|
||||
this.resizeListener = this.context.onWindowResize(this._updateDimensions);
|
||||
this.persistListener = Persist.addListener('discounts', this._updateDiscounts);
|
||||
this.persistListener = Persist.addListener(
|
||||
'discounts',
|
||||
this._updateDiscounts
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -444,65 +481,132 @@ export default class ComparisonPage extends Page {
|
||||
renderPage() {
|
||||
let translate = this.context.language.translate;
|
||||
let compareHeader;
|
||||
let { newName, name, saved, builds, facets, predicate, desc, chartWidth } = this.state;
|
||||
let {
|
||||
newName,
|
||||
name,
|
||||
saved,
|
||||
builds,
|
||||
facets,
|
||||
predicate,
|
||||
desc,
|
||||
chartWidth
|
||||
} = this.state;
|
||||
|
||||
if (this.state.compareMode) {
|
||||
compareHeader = <tr>
|
||||
<td className='head'>{translate('comparison')}</td>
|
||||
<td>
|
||||
<input value={newName} onChange={this._onNameChange} placeholder={translate('Enter Name')} maxLength='50' />
|
||||
<button onClick={this._save} disabled={!newName || newName == 'all' || saved}>
|
||||
<FloppyDisk className='lg'/><span className='button-lbl'>{translate('save')}</span>
|
||||
</button>
|
||||
<button onClick={this._delete} disabled={name == 'all' || !saved}><Bin className='lg warning'/></button>
|
||||
<button onClick={this._selectBuilds}>
|
||||
<Rocket className='lg'/><span className='button-lbl'>{translate('builds')}</span>
|
||||
</button>
|
||||
<button className='r' onClick={this._genPermalink} disabled={builds.length == 0}>
|
||||
<LinkIcon className='lg'/><span className='button-lbl'>{translate('permalink')}</span>
|
||||
</button>
|
||||
<button className='r' onClick={this._genBBcode} disabled={builds.length == 0}>
|
||||
<Embed className='lg'/><span className='button-lbl'>{translate('forum')}</span>
|
||||
</button>
|
||||
</td>
|
||||
</tr>;
|
||||
compareHeader = (
|
||||
<tr>
|
||||
<td className="head">{translate('comparison')}</td>
|
||||
<td>
|
||||
<input
|
||||
value={newName}
|
||||
onChange={this._onNameChange}
|
||||
placeholder={translate('Enter Name')}
|
||||
maxLength="50"
|
||||
/>
|
||||
<button
|
||||
onClick={this._save}
|
||||
disabled={!newName || newName == 'all' || saved}
|
||||
>
|
||||
<FloppyDisk className="lg" />
|
||||
<span className="button-lbl">{translate('save')}</span>
|
||||
</button>
|
||||
<button onClick={this._delete} disabled={name == 'all' || !saved}>
|
||||
<Bin className="lg warning" />
|
||||
</button>
|
||||
<button onClick={this._selectBuilds}>
|
||||
<Rocket className="lg" />
|
||||
<span className="button-lbl">{translate('builds')}</span>
|
||||
</button>
|
||||
<button
|
||||
className="r"
|
||||
onClick={this._genPermalink}
|
||||
disabled={builds.length == 0}
|
||||
>
|
||||
<LinkIcon className="lg" />
|
||||
<span className="button-lbl">{translate('permalink')}</span>
|
||||
</button>
|
||||
<button
|
||||
className="r"
|
||||
onClick={this._genBBcode}
|
||||
disabled={builds.length == 0}
|
||||
>
|
||||
<Embed className="lg" />
|
||||
<span className="button-lbl">{translate('forum')}</span>
|
||||
</button>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
} else {
|
||||
compareHeader = <tr>
|
||||
<td className='head'>{translate('comparison')}</td>
|
||||
<td>
|
||||
<h3>{name}</h3>
|
||||
<button className='r' onClick={this._import}><Download className='lg'/>{translate('import')}</button>
|
||||
</td>
|
||||
</tr>;
|
||||
compareHeader = (
|
||||
<tr>
|
||||
<td className="head">{translate('comparison')}</td>
|
||||
<td>
|
||||
<h3>{name}</h3>
|
||||
<button className="r" onClick={this._import}>
|
||||
<Download className="lg" />
|
||||
{translate('import')}
|
||||
</button>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
|
||||
return (
|
||||
<div className={'page'} style={{ fontSize: this.context.sizeRatio + 'em' }}>
|
||||
<table id='comparison'>
|
||||
<div
|
||||
className={'page'}
|
||||
style={{ fontSize: this.context.sizeRatio + 'em' }}
|
||||
>
|
||||
<table id="comparison">
|
||||
<tbody>
|
||||
{compareHeader}
|
||||
<tr key='facets'>
|
||||
<td className='head'>{translate('compare')}</td>
|
||||
<tr key="facets">
|
||||
<td className="head">{translate('compare')}</td>
|
||||
<td>
|
||||
<ul id='facet-container' onDragOver={this._facetDragOver}>
|
||||
{facets.map((f, i) =>
|
||||
<li key={f.title} data-i={i} draggable='true' onDragStart={this._facetDrag} onDragEnd={this._facetDrop} className={cn('facet', { active: f.active })} onClick={this._toggleFacet.bind(this, f)}>
|
||||
<ul id="facet-container" onDragOver={this._facetDragOver}>
|
||||
{facets.map((f, i) => (
|
||||
<li
|
||||
key={f.title}
|
||||
data-i={i}
|
||||
draggable="true"
|
||||
onDragStart={this._facetDrag}
|
||||
onDragEnd={this._facetDrop}
|
||||
className={cn('facet', { active: f.active })}
|
||||
onClick={this._toggleFacet.bind(this, f)}
|
||||
>
|
||||
{'↔ ' + translate(f.title)}
|
||||
</li>
|
||||
)}
|
||||
))}
|
||||
</ul>
|
||||
</td>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
<ComparisonTable builds={builds} facets={facets} onSort={this._sortShips} predicate={predicate} desc={desc} />
|
||||
<ComparisonTable
|
||||
builds={builds}
|
||||
facets={facets}
|
||||
onSort={this._sortShips}
|
||||
predicate={predicate}
|
||||
desc={desc}
|
||||
/>
|
||||
|
||||
{!builds.length ?
|
||||
<div className='chart' ref={node => this.chartRef = node}>{translate('PHRASE_NO_BUILDS')}</div> :
|
||||
facets.filter((f) => f.active).map((f, i) =>
|
||||
<div key={f.title} className='chart' ref={ i == 0 ? node => this.chartRef = node : null}>
|
||||
<h3 className='ptr' onClick={this._sortShips.bind(this, f.props[0])}>{translate(f.title)}</h3>
|
||||
{!builds.length ? (
|
||||
<div className="chart" ref={node => (this.chartRef = node)}>
|
||||
{translate('PHRASE_NO_BUILDS')}
|
||||
</div>
|
||||
) : (
|
||||
facets.filter(f => f.active).map((f, i) => (
|
||||
<div
|
||||
key={f.title}
|
||||
className="chart"
|
||||
ref={i == 0 ? node => (this.chartRef = node) : null}
|
||||
>
|
||||
<h3
|
||||
className="ptr"
|
||||
onClick={this._sortShips.bind(this, f.props[0])}
|
||||
>
|
||||
{translate(f.title)}
|
||||
</h3>
|
||||
<BarChart
|
||||
width={chartWidth}
|
||||
data={builds}
|
||||
@@ -515,8 +619,8 @@ export default class ComparisonPage extends Page {
|
||||
desc={desc}
|
||||
/>
|
||||
</div>
|
||||
))
|
||||
)}
|
||||
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
@@ -5,7 +5,6 @@ import PropTypes from 'prop-types';
|
||||
* Unexpected Error page / block
|
||||
*/
|
||||
export default class ErrorDetails extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
route: PropTypes.object.isRequired,
|
||||
language: PropTypes.object.isRequired
|
||||
@@ -46,7 +45,7 @@ export default class ErrorDetails extends React.Component {
|
||||
<h1>Jameson, we have a problem..</h1>
|
||||
<h1><small>{error.message}</small></h1>
|
||||
<br/>
|
||||
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
|
||||
{importerror ? <div>If you are attempting to import a ship from EDDI or EDMC and are seeing a 'Z_BUF_ERROR' it means that the URL has not been provided correctly. This is a common problem when using Microsoft Internet Explorer or Microsoft Edge, and you should use another browser instead.</div> : null }
|
||||
<br/>
|
||||
<div>Please note that this site uses Google Analytics to track performance and usage. If you are blocking cookies, for example using Ghostery, please disable blocking for this site and try again.</div>
|
||||
<br/>
|
||||
|
||||
@@ -5,7 +5,6 @@ import Page from './Page';
|
||||
* 404 Page
|
||||
*/
|
||||
export default class NotFoundPage extends Page {
|
||||
|
||||
/**
|
||||
* Constructor
|
||||
* @param {Object} props React Component properties
|
||||
@@ -22,6 +21,10 @@ export default class NotFoundPage extends Page {
|
||||
* @return {React.Component} The page contents
|
||||
*/
|
||||
renderPage() {
|
||||
return <div className='page' style={{ marginTop: 30 }}>Page <small>{this.context.route.path}</small> Not Found</div>;
|
||||
return (
|
||||
<div className="page" style={{ marginTop: 30 }}>
|
||||
Page <small>{this.context.route.path}</small> Not Found
|
||||
</div>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -7,7 +7,6 @@ import { shallowEqual } from '../utils/UtilityFunctions';
|
||||
* Abstract/Base Page
|
||||
*/
|
||||
export default class Page extends React.Component {
|
||||
|
||||
static contextTypes = {
|
||||
closeMenu: PropTypes.func.isRequired,
|
||||
hideModal: PropTypes.func.isRequired,
|
||||
@@ -51,22 +50,16 @@ export default class Page extends React.Component {
|
||||
}
|
||||
|
||||
/**
|
||||
* Pages are 'pure' components that only render when props, state, or context changes.
|
||||
* This method performs a shallow comparison to determine change.
|
||||
*
|
||||
* @param {Object} np Next/Incoming properties
|
||||
* @param {Object} ns Next/Incoming state
|
||||
* @param {Object} nc Next/Incoming context
|
||||
* @return {Boolean} True if props, state, or context has changed
|
||||
* Update the window title upon mount
|
||||
*/
|
||||
shouldComponentUpdate(np, ns, nc) {
|
||||
return !shallowEqual(this.props, np) || !shallowEqual(this.state, ns) || !shallowEqual(this.context, nc);
|
||||
componentWillMount() {
|
||||
document.title = this.state.title || 'Coriolis';
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the window title upon mount
|
||||
*/
|
||||
componentWillMount() {
|
||||
componentDidMount() {
|
||||
document.title = this.state.title || 'Coriolis';
|
||||
}
|
||||
|
||||
@@ -90,5 +83,4 @@ export default class Page extends React.Component {
|
||||
}
|
||||
return this.renderPage();
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,94 +1,80 @@
|
||||
import React from 'react';
|
||||
import Page from './Page';
|
||||
import { Ships } from 'coriolis-data/dist';
|
||||
import cn from 'classnames';
|
||||
import Ship from '../shipyard/Ship';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
import { Factory } from 'ed-forge';
|
||||
import { SizeMap } from '../shipyard/Constants';
|
||||
import Link from '../components/Link';
|
||||
|
||||
/**
|
||||
* Counts the hardpoints by class/size
|
||||
* @param {Object} slot Hardpoint Slot model
|
||||
*/
|
||||
function countHp(slot) {
|
||||
this.hp[slot.maxClass]++;
|
||||
this.hpCount++;
|
||||
}
|
||||
|
||||
/**
|
||||
* Counts the internal slots and aggregated properties
|
||||
* @param {Object} slot Internal Slots
|
||||
*/
|
||||
function countInt(slot) {
|
||||
let crEligible = !slot.eligible || slot.eligible.cr;
|
||||
this.int[slot.maxClass - 1]++; // Subtract 1 since there is no Class 0 Internal compartment
|
||||
this.intCount++;
|
||||
this.maxCargo += crEligible ? ModuleUtils.findInternal('cr', slot.maxClass, 'E').cargo : 0;
|
||||
|
||||
// if no eligiblity, then assume pce
|
||||
let passSlotType = null;
|
||||
let passSlotRating = null;
|
||||
if (!slot.eligible || slot.eligible.pce) {
|
||||
passSlotType = 'pce';
|
||||
passSlotRating = 'E';
|
||||
} else if (slot.eligible.pci) {
|
||||
passSlotType = 'pci';
|
||||
passSlotRating = 'D';
|
||||
} else if (slot.eligible.pcm) {
|
||||
passSlotType = 'pcm';
|
||||
passSlotRating = 'C';
|
||||
} else if (slot.eligible.pcq) {
|
||||
passSlotType = 'pcq';
|
||||
passSlotRating = 'B';
|
||||
}
|
||||
let passengerBay = passSlotType ? ModuleUtils.findMaxInternal(passSlotType, slot.maxClass, passSlotRating) : null;
|
||||
this.maxPassengers += passengerBay ? passengerBay.passengers : 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate Ship summary and aggregated properties
|
||||
* @param {String} shipId Ship Id
|
||||
* @param {Object} shipData Ship Default Data
|
||||
* @return {Object} Ship summary and aggregated properties
|
||||
*/
|
||||
function shipSummary(shipId, shipData) {
|
||||
function shipSummary(shipId) {
|
||||
// Build Ship
|
||||
let ship = Factory.newShip(shipId);
|
||||
|
||||
let coreSizes = ship.readMeta('coreSizes');
|
||||
let summary = {
|
||||
baseArmour: ship.readProp('basearmour'),
|
||||
baseShieldStrength: ship.readProp('baseshieldstrength'),
|
||||
boost: ship.readProp('boost'),
|
||||
class: ship.readMeta('class'),
|
||||
crew: ship.readMeta('crew'),
|
||||
id: shipId,
|
||||
hardness: ship.readProp('hardness'),
|
||||
hpCount: 0,
|
||||
hullMass: ship.readProp('hullmass'),
|
||||
intCount: 0,
|
||||
manufacturer: ship.readMeta('manufacturer'),
|
||||
masslock: ship.readProp('masslock'),
|
||||
maxCargo: 0,
|
||||
maxPassengers: 0,
|
||||
hp: [0, 0, 0, 0, 0], // Utility, Small, Medium, Large, Huge
|
||||
int: [0, 0, 0, 0, 0, 0, 0, 0], // Sizes 1 - 8
|
||||
standard: shipData.slots.standard,
|
||||
agility: shipData.properties.pitch + shipData.properties.yaw + shipData.properties.roll
|
||||
retailCost: ship.readMeta('retailCost'),
|
||||
speed: ship.readProp('speed'),
|
||||
standard: [
|
||||
'powerplant',
|
||||
'mainengines',
|
||||
'frameshiftdrive',
|
||||
'lifesupport',
|
||||
'powerdistributor',
|
||||
'radar',
|
||||
'fueltank'
|
||||
].map(k => coreSizes[k]),
|
||||
agility:
|
||||
ship.readProp('pitch') +
|
||||
ship.readProp('yaw') +
|
||||
ship.readProp('roll')
|
||||
};
|
||||
Object.assign(summary, shipData.properties);
|
||||
let ship = new Ship(shipId, shipData.properties, shipData.slots);
|
||||
|
||||
// Build Ship
|
||||
ship.buildWith(shipData.defaults); // Populate with stock/default components
|
||||
ship.hardpoints.forEach(countHp.bind(summary)); // Count Hardpoints by class
|
||||
ship.internal.forEach(countInt.bind(summary)); // Count Internal Compartments by class
|
||||
summary.retailCost = ship.totalCost; // Record Stock/Default/retail cost
|
||||
ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range
|
||||
summary.maxJumpRange = ship.unladenRange; // Record Jump Range
|
||||
// Count Hardpoints by class
|
||||
ship.getHardpoints(undefined, true).forEach(hardpoint => {
|
||||
summary.hp[hardpoint.getSize()]++;
|
||||
summary.hpCount++;
|
||||
});
|
||||
// Count Internal Compartments by class
|
||||
ship.getInternals(undefined, true).forEach(internal => {
|
||||
summary.int[internal.getSize()]++;
|
||||
summary.intCount++;
|
||||
});
|
||||
// ship.optimizeMass({ pd: '1D' }); // Optimize Mass with 1D PD for maximum possible jump range
|
||||
summary.maxJumpRange = -1; // ship.unladenRange; // Record Jump Range
|
||||
|
||||
// Best thrusters
|
||||
let th;
|
||||
if (ship.standard[1].maxClass === 3) {
|
||||
th = 'tz';
|
||||
} else if (ship.standard[1].maxClass === 2) {
|
||||
th = 'u0';
|
||||
} else {
|
||||
th = ship.standard[1].maxClass + 'A';
|
||||
}
|
||||
// let th;
|
||||
// if (ship.standard[1].maxClass === 3) {
|
||||
// th = 'tz';
|
||||
// } else if (ship.standard[1].maxClass === 2) {
|
||||
// th = 'u0';
|
||||
// } else {
|
||||
// th = ship.standard[1].maxClass + 'A';
|
||||
// }
|
||||
|
||||
ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters
|
||||
summary.topSpeed = ship.topSpeed;
|
||||
summary.topBoost = ship.topBoost;
|
||||
summary.baseArmour = ship.armour;
|
||||
// ship.optimizeMass({ th, fsd: '2D', ft: '1C' }); // Optmize mass with Max Thrusters
|
||||
summary.topSpeed = -1; // ship.topSpeed;
|
||||
summary.topBoost = -1; // ship.topBoost;
|
||||
|
||||
return summary;
|
||||
}
|
||||
@@ -97,7 +83,6 @@ function shipSummary(shipId, shipData) {
|
||||
* The Shipyard summary page
|
||||
*/
|
||||
export default class ShipyardPage extends Page {
|
||||
|
||||
static cachedShipSummaries = null;
|
||||
|
||||
/**
|
||||
@@ -110,21 +95,23 @@ export default class ShipyardPage extends Page {
|
||||
|
||||
if (!ShipyardPage.cachedShipSummaries) {
|
||||
ShipyardPage.cachedShipSummaries = [];
|
||||
for (let s in Ships) {
|
||||
ShipyardPage.cachedShipSummaries.push(shipSummary(s, Ships[s]));
|
||||
for (let s of Factory.getAllShipTypes()) {
|
||||
ShipyardPage.cachedShipSummaries.push(shipSummary(s));
|
||||
}
|
||||
}
|
||||
|
||||
this.state = {
|
||||
title: 'Coriolis EDCD Edition - Shipyard',
|
||||
shipPredicate: 'name',
|
||||
shipPredicate: 'id',
|
||||
shipDesc: true,
|
||||
shipSummaries: ShipyardPage.cachedShipSummaries
|
||||
shipSummaries: ShipyardPage.cachedShipSummaries,
|
||||
compare: {},
|
||||
groupCompared: false,
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Higlight the current ship in the table
|
||||
* Higlight the current ship in the table on mouse over
|
||||
* @param {String} shipId Ship Id
|
||||
* @param {SyntheticEvent} event Event
|
||||
*/
|
||||
@@ -133,6 +120,24 @@ export default class ShipyardPage extends Page {
|
||||
this.setState({ shipId });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle compare highlighting for ships in the table
|
||||
* @param {String} shipId Ship Id
|
||||
*/
|
||||
_toggleCompare(shipId) {
|
||||
let compare = this.state.compare;
|
||||
compare[shipId] = !compare[shipId];
|
||||
this.setState({ compare });
|
||||
}
|
||||
|
||||
/**
|
||||
* Toggle grouping of compared ships in the table
|
||||
* @private
|
||||
*/
|
||||
_toggleGroupCompared() {
|
||||
this.setState({ groupCompared: !this.state.groupCompared });
|
||||
}
|
||||
|
||||
/**
|
||||
* Update state with the specified sort predicates
|
||||
* @param {String} shipPredicate Sort predicate - property name
|
||||
@@ -145,12 +150,15 @@ export default class ShipyardPage extends Page {
|
||||
shipPredicateIndex = undefined;
|
||||
}
|
||||
|
||||
if (this.state.shipPredicate == shipPredicate && this.state.shipPredicateIndex == shipPredicateIndex) {
|
||||
if (
|
||||
this.state.shipPredicate == shipPredicate &&
|
||||
this.state.shipPredicateIndex == shipPredicateIndex
|
||||
) {
|
||||
shipDesc = !shipDesc;
|
||||
}
|
||||
|
||||
this.setState({ shipPredicate, shipDesc, shipPredicateIndex });
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate the table row summary for the ship
|
||||
@@ -159,56 +167,61 @@ export default class ShipyardPage extends Page {
|
||||
* @param {Object} u Localized unit map
|
||||
* @param {Function} fInt Localized integer formatter
|
||||
* @param {Function} fRound Localized round formatter
|
||||
* @param {Boolean} highlight Should this row be highlighted
|
||||
* @return {React.Component} Table Row
|
||||
*/
|
||||
_shipRowElement(s, translate, u, fInt, fRound, highlight) {
|
||||
_shipRowElement(s, translate, u, fInt, fRound) {
|
||||
let noTouch = this.context.noTouch;
|
||||
|
||||
return <tr
|
||||
return (
|
||||
<tr
|
||||
key={s.id}
|
||||
style={{ height: '1.5em' }}
|
||||
className={cn({ highlighted: noTouch && this.state.shipId === s.id, alt: highlight })}
|
||||
className={cn({
|
||||
highlighted: noTouch && this.state.shipId === s.id,
|
||||
comparehighlight: this.state.compare[s.id],
|
||||
})}
|
||||
onMouseEnter={noTouch && this._highlightShip.bind(this, s.id)}
|
||||
onClick={() => this._toggleCompare(s.id)}
|
||||
>
|
||||
<td className='ri'>{s.manufacturer}</td>
|
||||
<td className='ri'>{fInt(s.retailCost)}</td>
|
||||
<td className='ri cap'>{translate(SizeMap[s.class])}</td>
|
||||
<td className='ri'>{fInt(s.crew)}</td>
|
||||
<td className='ri'>{s.masslock}</td>
|
||||
<td className='ri'>{fInt(s.agility)}</td>
|
||||
<td className='ri'>{fInt(s.hardness)}</td>
|
||||
<td className='ri'>{fInt(s.hullMass)}</td>
|
||||
<td className='ri'>{fInt(s.speed)}</td>
|
||||
<td className='ri'>{fInt(s.boost)}</td>
|
||||
<td className='ri'>{fInt(s.baseArmour)}</td>
|
||||
<td className='ri'>{fInt(s.baseShieldStrength)}</td>
|
||||
<td className='ri'>{fInt(s.topSpeed)}</td>
|
||||
<td className='ri'>{fInt(s.topBoost)}</td>
|
||||
<td className='ri'>{fRound(s.maxJumpRange)}</td>
|
||||
<td className='ri'>{fInt(s.maxCargo)}</td>
|
||||
<td className='ri'>{fInt(s.maxPassengers)}</td>
|
||||
<td className='cn'>{s.standard[0]}</td>
|
||||
<td className='cn'>{s.standard[1]}</td>
|
||||
<td className='cn'>{s.standard[2]}</td>
|
||||
<td className='cn'>{s.standard[3]}</td>
|
||||
<td className='cn'>{s.standard[4]}</td>
|
||||
<td className='cn'>{s.standard[5]}</td>
|
||||
<td className='cn'>{s.standard[6]}</td>
|
||||
<td className={cn({ disabled: !s.hp[1] })}>{s.hp[1]}</td>
|
||||
<td className={cn({ disabled: !s.hp[2] })}>{s.hp[2]}</td>
|
||||
<td className={cn({ disabled: !s.hp[3] })}>{s.hp[3]}</td>
|
||||
<td className={cn({ disabled: !s.hp[4] })}>{s.hp[4]}</td>
|
||||
<td className={cn({ disabled: !s.hp[0] })}>{s.hp[0]}</td>
|
||||
<td className={cn({ disabled: !s.int[0] })}>{s.int[0]}</td>
|
||||
<td className={cn({ disabled: !s.int[1] })}>{s.int[1]}</td>
|
||||
<td className={cn({ disabled: !s.int[2] })}>{s.int[2]}</td>
|
||||
<td className={cn({ disabled: !s.int[3] })}>{s.int[3]}</td>
|
||||
<td className={cn({ disabled: !s.int[4] })}>{s.int[4]}</td>
|
||||
<td className={cn({ disabled: !s.int[5] })}>{s.int[5]}</td>
|
||||
<td className={cn({ disabled: !s.int[6] })}>{s.int[6]}</td>
|
||||
<td className={cn({ disabled: !s.int[7] })}>{s.int[7]}</td>
|
||||
</tr>;
|
||||
<td className="ri">{s.manufacturer}</td>
|
||||
<td className="ri">{fInt(s.retailCost)}</td>
|
||||
<td className="ri cap">{translate(SizeMap[s.class])}</td>
|
||||
<td className="ri">{fInt(s.crew)}</td>
|
||||
<td className="ri">{s.masslock}</td>
|
||||
<td className="ri">{fInt(s.agility)}</td>
|
||||
<td className="ri">{fInt(s.hardness)}</td>
|
||||
<td className="ri">{fInt(s.hullMass)}</td>
|
||||
<td className="ri">{fInt(s.speed)}</td>
|
||||
<td className="ri">{fInt(s.boost)}</td>
|
||||
<td className="ri">{fInt(s.baseArmour)}</td>
|
||||
<td className="ri">{fInt(s.baseShieldStrength)}</td>
|
||||
<td className="ri">{fInt(s.topSpeed)}</td>
|
||||
<td className="ri">{fInt(s.topBoost)}</td>
|
||||
<td className="ri">{fRound(s.maxJumpRange)}</td>
|
||||
<td className="ri">{fInt(s.maxCargo)}</td>
|
||||
<td className="ri">{fInt(s.maxPassengers)}</td>
|
||||
<td className="cn">{s.standard[0]}</td>
|
||||
<td className="cn">{s.standard[1]}</td>
|
||||
<td className="cn">{s.standard[2]}</td>
|
||||
<td className="cn">{s.standard[3]}</td>
|
||||
<td className="cn">{s.standard[4]}</td>
|
||||
<td className="cn">{s.standard[5]}</td>
|
||||
<td className="cn">{s.standard[6]}</td>
|
||||
<td className={cn({ disabled: !s.hp[1] })}>{s.hp[1]}</td>
|
||||
<td className={cn({ disabled: !s.hp[2] })}>{s.hp[2]}</td>
|
||||
<td className={cn({ disabled: !s.hp[3] })}>{s.hp[3]}</td>
|
||||
<td className={cn({ disabled: !s.hp[4] })}>{s.hp[4]}</td>
|
||||
<td className={cn({ disabled: !s.hp[0] })}>{s.hp[0]}</td>
|
||||
<td className={cn({ disabled: !s.int[0] })}>{s.int[0]}</td>
|
||||
<td className={cn({ disabled: !s.int[1] })}>{s.int[1]}</td>
|
||||
<td className={cn({ disabled: !s.int[2] })}>{s.int[2]}</td>
|
||||
<td className={cn({ disabled: !s.int[3] })}>{s.int[3]}</td>
|
||||
<td className={cn({ disabled: !s.int[4] })}>{s.int[4]}</td>
|
||||
<td className={cn({ disabled: !s.int[5] })}>{s.int[5]}</td>
|
||||
<td className={cn({ disabled: !s.int[6] })}>{s.int[6]}</td>
|
||||
<td className={cn({ disabled: !s.int[7] })}>{s.int[7]}</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -220,9 +233,9 @@ export default class ShipyardPage extends Page {
|
||||
let { translate, formats, units } = language;
|
||||
let hide = this.context.tooltip.bind(null, null);
|
||||
let fInt = formats.int;
|
||||
let fRound = formats.round;
|
||||
let { shipSummaries, shipPredicate, shipPredicateIndex } = this.state;
|
||||
let sortShips = (predicate, index) => this._sortShips.bind(this, predicate, index);
|
||||
let { shipSummaries, shipPredicate, shipPredicateIndex, compare, groupCompared } = this.state;
|
||||
let sortShips = (predicate, index) =>
|
||||
this._sortShips.bind(this, predicate, index);
|
||||
|
||||
let filters = {
|
||||
// 'class': { 1: 1, 2: 1}
|
||||
@@ -239,7 +252,8 @@ export default class ShipyardPage extends Page {
|
||||
|
||||
// Sort shipsOverview
|
||||
shipSummaries.sort((a, b) => {
|
||||
let valA = a[shipPredicate], valB = b[shipPredicate];
|
||||
let valA = a[shipPredicate],
|
||||
valB = b[shipPredicate];
|
||||
|
||||
if (shipPredicateIndex != undefined) {
|
||||
valA = valA[shipPredicateIndex];
|
||||
@@ -252,8 +266,17 @@ export default class ShipyardPage extends Page {
|
||||
valB = val;
|
||||
}
|
||||
|
||||
if(valA == valB) {
|
||||
if (a.name > b.name) {
|
||||
if (groupCompared) {
|
||||
if (compare[a.id] && !compare[b.id]) {
|
||||
return -1;
|
||||
}
|
||||
if (!compare[a.id] && compare[b.id]) {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
|
||||
if (valA == valB) {
|
||||
if (a.id > b.id) {
|
||||
return 1;
|
||||
} else {
|
||||
return -1;
|
||||
@@ -269,128 +292,315 @@ export default class ShipyardPage extends Page {
|
||||
let shipRows = new Array(shipSummaries.length);
|
||||
let detailRows = new Array(shipSummaries.length);
|
||||
|
||||
let lastShipSortValue = null;
|
||||
let backgroundHighlight = false;
|
||||
|
||||
for (let s of shipSummaries) {
|
||||
let shipSortValue = s[shipPredicate];
|
||||
if( shipPredicateIndex != undefined ) {
|
||||
shipSortValue = shipSortValue[shipPredicateIndex];
|
||||
}
|
||||
|
||||
if( shipSortValue != lastShipSortValue ) {
|
||||
backgroundHighlight = !backgroundHighlight;
|
||||
lastShipSortValue = shipSortValue;
|
||||
}
|
||||
|
||||
detailRows[i] = this._shipRowElement(s, translate, units, fInt, formats.f1, backgroundHighlight);
|
||||
detailRows[i] = this._shipRowElement(
|
||||
s,
|
||||
translate,
|
||||
units,
|
||||
fInt,
|
||||
formats.f1,
|
||||
);
|
||||
shipRows[i] = (
|
||||
<tr
|
||||
key={i}
|
||||
style={{ height: '1.5em' }}
|
||||
className={cn({ highlighted: noTouch && this.state.shipId === s.id, alt: backgroundHighlight })}
|
||||
className={cn({
|
||||
highlighted: noTouch && this.state.shipId === s.id,
|
||||
comparehighlight: this.state.compare[s.id],
|
||||
})}
|
||||
onMouseEnter={noTouch && this._highlightShip.bind(this, s.id)}
|
||||
onClick={() => this._toggleCompare(s.id)}
|
||||
>
|
||||
<td className='le'><Link href={'/outfit/' + s.id}>{s.name}</Link></td>
|
||||
<td className="le">
|
||||
<Link href={'/outfit/' + s.id}>{s.id} {s.beta === true ? '(Beta)' : null}</Link>
|
||||
</td>
|
||||
</tr>
|
||||
);
|
||||
i++;
|
||||
}
|
||||
|
||||
return (
|
||||
<div className='page' style={{ fontSize: sizeRatio + 'em' }}>
|
||||
<div style={{ whiteSpace: 'nowrap', margin: '0 auto', fontSize: '0.8em', position: 'relative', display: 'inline-block', maxWidth: '100%' }}>
|
||||
<table style={{ width: '12em', position: 'absolute', zIndex: 1 }}>
|
||||
<thead>
|
||||
<tr>
|
||||
<th className='le rgt'> </th>
|
||||
</tr>
|
||||
<tr className='main'>
|
||||
<th className='sortable le rgt' onClick={sortShips('name')}>{translate('ship')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='le rgt invisible'>{units['m/s']}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
|
||||
{shipRows}
|
||||
</tbody>
|
||||
</table>
|
||||
<div style={{ overflowX: 'scroll', maxWidth: '100%' }}>
|
||||
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }}>
|
||||
<thead>
|
||||
<tr className='main'>
|
||||
<th rowSpan={3} className='sortable' onClick={sortShips('manufacturer')}>{translate('manufacturer')}</th>
|
||||
<th> </th>
|
||||
<th rowSpan={3} className='sortable' onClick={sortShips('class')}>{translate('size')}</th>
|
||||
<th rowSpan={3} className='sortable' onClick={sortShips('crew')}>{translate('crew')}</th>
|
||||
<th rowSpan={3} className='sortable' onMouseEnter={termtip.bind(null, 'mass lock factor')} onMouseLeave={hide} onClick={sortShips('masslock')} >{translate('MLF')}</th>
|
||||
<th rowSpan={3} className='sortable' onClick={sortShips('agility')}>{translate('agility')}</th>
|
||||
<th rowSpan={3} className='sortable' onMouseEnter={termtip.bind(null, 'hardness')} onMouseLeave={hide} onClick={sortShips('hardness')}>{translate('hrd')}</th>
|
||||
<th> </th>
|
||||
<th colSpan={4}>{translate('base')}</th>
|
||||
<th colSpan={5}>{translate('max')}</th>
|
||||
<th className='lft' colSpan={7}></th>
|
||||
<th className='lft' colSpan={5}></th>
|
||||
<th className='lft' colSpan={8}></th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='sortable lft' onClick={sortShips('retailCost')}>{translate('cost')}</th>
|
||||
<th className='sortable lft' onClick={sortShips('hullMass')}>{translate('hull')}</th>
|
||||
<th className='sortable lft' onClick={sortShips('speed')}>{translate('speed')}</th>
|
||||
<th className='sortable' onClick={sortShips('boost')}>{translate('boost')}</th>
|
||||
<th className='sortable' onClick={sortShips('baseArmour')}>{translate('armour')}</th>
|
||||
<th className='sortable' onClick={sortShips('baseShieldStrength')}>{translate('shields')}</th>
|
||||
<div className="page" style={{ fontSize: sizeRatio + 'em' }}>
|
||||
<div className="content-wrapper">
|
||||
<div className="shipyard-table-wrapper">
|
||||
<table style={{ width: '12em', position: 'absolute', zIndex: 1 }} className="shipyard-table">
|
||||
<thead>
|
||||
<tr>
|
||||
<th className="le rgt"> </th>
|
||||
</tr>
|
||||
<tr className="main">
|
||||
<th className="sortable le rgt" onClick={sortShips('id')}>
|
||||
{translate('ship')}
|
||||
</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className="le rgt invisible">{units['m/s']}</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
|
||||
{shipRows}
|
||||
</tbody>
|
||||
</table>
|
||||
<div style={{ overflowX: 'auto', maxWidth: '100%' }}>
|
||||
<table style={{ marginLeft: 'calc(12em - 1px)', zIndex: 0 }} className="shipyard-table">
|
||||
<thead>
|
||||
<tr className="main">
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('manufacturer')}
|
||||
>
|
||||
{translate('manufacturer')}
|
||||
</th>
|
||||
<th> </th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('class')}
|
||||
>
|
||||
{translate('size')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('crew')}
|
||||
>
|
||||
{translate('crew')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'mass lock factor')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('masslock')}
|
||||
>
|
||||
{translate('MLF')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onClick={sortShips('agility')}
|
||||
>
|
||||
{translate('agility')}
|
||||
</th>
|
||||
<th
|
||||
rowSpan={3}
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'hardness')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('hardness')}
|
||||
>
|
||||
{translate('hrd')}
|
||||
</th>
|
||||
<th> </th>
|
||||
<th colSpan={4}>{translate('base')}</th>
|
||||
<th colSpan={5}>{translate('max')}</th>
|
||||
<th className="lft" colSpan={7} />
|
||||
<th className="lft" colSpan={5} />
|
||||
<th className="lft" colSpan={8} />
|
||||
</tr>
|
||||
<tr>
|
||||
<th
|
||||
className="sortable lft"
|
||||
onClick={sortShips('retailCost')}
|
||||
>
|
||||
{translate('cost')}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('hullMass')}>
|
||||
{translate('hull')}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('speed')}>
|
||||
{translate('speed')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('boost')}>
|
||||
{translate('boost')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('baseArmour')}>
|
||||
{translate('armour')}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onClick={sortShips('baseShieldStrength')}
|
||||
>
|
||||
{translate('shields')}
|
||||
</th>
|
||||
|
||||
<th className='sortable lft' onClick={sortShips('topSpeed')}>{translate('speed')}</th>
|
||||
<th className='sortable' onClick={sortShips('topBoost')}>{translate('boost')}</th>
|
||||
<th className='sortable' onClick={sortShips('maxJumpRange')}>{translate('jump')}</th>
|
||||
<th className='sortable' onClick={sortShips('maxCargo')}>{translate('cargo')}</th>
|
||||
<th className='sortable' onClick={sortShips('maxPassengers')}>{translate('pax')}</th>
|
||||
<th className="sortable lft" onClick={sortShips('topSpeed')}>
|
||||
{translate('speed')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('topBoost')}>
|
||||
{translate('boost')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxJumpRange')}>
|
||||
{translate('jump')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxCargo')}>
|
||||
{translate('cargo')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxPassengers')} onMouseEnter={termtip.bind(null, 'passenger capacity')}
|
||||
onMouseLeave={hide}>
|
||||
{translate('pax')}
|
||||
</th>
|
||||
<th className="lft" colSpan={7}>
|
||||
{translate('core module classes')}
|
||||
</th>
|
||||
<th
|
||||
colSpan={5}
|
||||
className="sortable lft"
|
||||
onClick={sortShips('hpCount')}
|
||||
>
|
||||
{translate('hardpoints')}
|
||||
</th>
|
||||
<th
|
||||
colSpan={8}
|
||||
className="sortable lft"
|
||||
onClick={sortShips('intCount')}
|
||||
>
|
||||
{translate('internal compartments')}
|
||||
</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th
|
||||
className="sortable lft"
|
||||
onClick={sortShips('retailCost')}
|
||||
>
|
||||
{units.CR}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('hullMass')}>
|
||||
{units.T}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('speed')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('boost')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th> </th>
|
||||
<th
|
||||
className="sortable"
|
||||
onClick={sortShips('baseShieldStrength')}
|
||||
>
|
||||
{units.MJ}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('topSpeed')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('topBoost')}>
|
||||
{units['m/s']}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxJumpRange')}>
|
||||
{units.LY}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('maxCargo')}>
|
||||
{units.T}
|
||||
</th>
|
||||
<th> </th>
|
||||
<th
|
||||
className="sortable lft"
|
||||
onMouseEnter={termtip.bind(null, 'power plant')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 0)}
|
||||
>
|
||||
{'pp'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'thrusters')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 1)}
|
||||
>
|
||||
{'th'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'frame shift drive')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 2)}
|
||||
>
|
||||
{'fsd'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'life support')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 3)}
|
||||
>
|
||||
{'ls'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'power distriubtor')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 4)}
|
||||
>
|
||||
{'pd'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'sensors')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 5)}
|
||||
>
|
||||
{'s'}
|
||||
</th>
|
||||
<th
|
||||
className="sortable"
|
||||
onMouseEnter={termtip.bind(null, 'fuel tank')}
|
||||
onMouseLeave={hide}
|
||||
onClick={sortShips('standard', 6)}
|
||||
>
|
||||
{'ft'}
|
||||
</th>
|
||||
<th className="sortable lft" onClick={sortShips('hp', 1)}>
|
||||
{translate('S')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('hp', 2)}>
|
||||
{translate('M')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('hp', 3)}>
|
||||
{translate('L')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('hp', 4)}>
|
||||
{translate('H')}
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('hp', 0)}>
|
||||
{translate('U')}
|
||||
</th>
|
||||
|
||||
<th className='lft' colSpan={7}>{translate('core module classes')}</th>
|
||||
<th colSpan={5} className='sortable lft' onClick={sortShips('hpCount')}>{translate('hardpoints')}</th>
|
||||
<th colSpan={8} className='sortable lft' onClick={sortShips('intCount')}>{translate('internal compartments')}</th>
|
||||
</tr>
|
||||
<tr>
|
||||
<th className='sortable lft' onClick={sortShips('retailCost')}>{units.CR}</th>
|
||||
<th className='sortable lft' onClick={sortShips('hullMass')}>{units.T}</th>
|
||||
<th className='sortable lft' onClick={sortShips('speed')}>{units['m/s']}</th>
|
||||
<th className='sortable' onClick={sortShips('boost')}>{units['m/s']}</th>
|
||||
<th> </th>
|
||||
<th className='sortable' onClick={sortShips('baseShieldStrength')}>{units.MJ}</th>
|
||||
<th className='sortable lft' onClick={sortShips('topSpeed')}>{units['m/s']}</th>
|
||||
<th className='sortable' onClick={sortShips('topBoost')}>{units['m/s']}</th>
|
||||
<th className='sortable' onClick={sortShips('maxJumpRange')}>{units.LY}</th>
|
||||
<th className='sortable' onClick={sortShips('maxCargo')}>{units.T}</th>
|
||||
<th> </th>
|
||||
<th className='sortable lft' onMouseEnter={termtip.bind(null, 'power plant')} onMouseLeave={hide} onClick={sortShips('standard', 0)}>{'pp'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'thrusters')} onMouseLeave={hide} onClick={sortShips('standard', 1)}>{'th'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'frame shift drive')} onMouseLeave={hide} onClick={sortShips('standard', 2)}>{'fsd'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'life support')} onMouseLeave={hide} onClick={sortShips('standard', 3)}>{'ls'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'power distriubtor')} onMouseLeave={hide} onClick={sortShips('standard', 4)}>{'pd'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'sensors')} onMouseLeave={hide} onClick={sortShips('standard', 5)}>{'s'}</th>
|
||||
<th className='sortable' onMouseEnter={termtip.bind(null, 'fuel tank')} onMouseLeave={hide} onClick={sortShips('standard', 6)}>{'ft'}</th>
|
||||
<th className='sortable lft' onClick={sortShips('hp',1)}>{translate('S')}</th>
|
||||
<th className='sortable' onClick={sortShips('hp', 2)}>{translate('M')}</th>
|
||||
<th className='sortable' onClick={sortShips('hp', 3)}>{translate('L')}</th>
|
||||
<th className='sortable' onClick={sortShips('hp', 4)}>{translate('H')}</th>
|
||||
<th className='sortable' onClick={sortShips('hp', 0)}>{translate('U')}</th>
|
||||
|
||||
<th className='sortable lft' onClick={sortShips('int', 0)} >1</th>
|
||||
<th className='sortable' onClick={sortShips('int', 1)} >2</th>
|
||||
<th className='sortable' onClick={sortShips('int', 2)} >3</th>
|
||||
<th className='sortable' onClick={sortShips('int', 3)} >4</th>
|
||||
<th className='sortable' onClick={sortShips('int', 4)} >5</th>
|
||||
<th className='sortable' onClick={sortShips('int', 5)} >6</th>
|
||||
<th className='sortable' onClick={sortShips('int', 6)} >7</th>
|
||||
<th className='sortable' onClick={sortShips('int', 7)} >8</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
|
||||
{detailRows}
|
||||
</tbody>
|
||||
</table>
|
||||
<th className="sortable lft" onClick={sortShips('int', 0)}>
|
||||
1
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 1)}>
|
||||
2
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 2)}>
|
||||
3
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 3)}>
|
||||
4
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 4)}>
|
||||
5
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 5)}>
|
||||
6
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 6)}>
|
||||
7
|
||||
</th>
|
||||
<th className="sortable" onClick={sortShips('int', 7)}>
|
||||
8
|
||||
</th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody onMouseLeave={this._highlightShip.bind(this, null)}>
|
||||
{detailRows}
|
||||
</tbody>
|
||||
</table>
|
||||
</div>
|
||||
</div>
|
||||
<div className="table-tools" >
|
||||
<label><input type="checkbox" checked={this.state.groupCompared} onClick={() => this._toggleGroupCompared()}/>Group highlighted ships</label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
@@ -7,11 +7,20 @@ import Module from './Module';
|
||||
* @param {object} fsd The FDS object/component with maxfuel, fuelmul, fuelpower, optmass
|
||||
* @param {number} fuel Optional - The fuel consumed during the jump
|
||||
* @return {number} Distance in Light Years
|
||||
* @param {object} ship Ship instance
|
||||
*/
|
||||
export function jumpRange(mass, fsd, fuel) {
|
||||
export function jumpRange(mass, fsd, fuel, ship) {
|
||||
const fsdMaxFuelPerJump = fsd instanceof Module ? fsd.getMaxFuelPerJump() : fsd.maxfuel;
|
||||
const fsdOptimalMass = fsd instanceof Module ? fsd.getOptMass() : fsd.optmass;
|
||||
return Math.pow(Math.min(fuel === undefined ? fsdMaxFuelPerJump : fuel, fsdMaxFuelPerJump) / fsd.fuelmul, 1 / fsd.fuelpower) * fsdOptimalMass / mass;
|
||||
let jumpAddition = 0;
|
||||
if (ship) {
|
||||
for (const module of ship.internal) {
|
||||
if (module && module.m && module.m.grp === 'gfsb' && ship.getSlotStatus(module) == 3) {
|
||||
jumpAddition += module.m.getJumpBoost();
|
||||
}
|
||||
}
|
||||
}
|
||||
return (Math.pow(Math.min(fuel === undefined ? fsdMaxFuelPerJump : fuel, fsdMaxFuelPerJump) / fsd.fuelmul, 1 / fsd.fuelpower) * fsdOptimalMass / mass) + jumpAddition;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -21,8 +30,9 @@ export function jumpRange(mass, fsd, fuel) {
|
||||
* @param {object} fsd The FDS object/component with maxfuel, fuelmul, fuelpower, optmass
|
||||
* @param {number} fuel The total fuel available
|
||||
* @return {number} Distance in Light Years
|
||||
* @param {object} ship Ship instance
|
||||
*/
|
||||
export function totalJumpRange(mass, fsd, fuel) {
|
||||
export function totalJumpRange(mass, fsd, fuel, ship) {
|
||||
const fsdMaxFuelPerJump = fsd instanceof Module ? fsd.getMaxFuelPerJump() : fsd.maxfuel;
|
||||
const fsdOptimalMass = fsd instanceof Module ? fsd.getOptMass() : fsd.optmass;
|
||||
|
||||
@@ -30,7 +40,7 @@ export function totalJumpRange(mass, fsd, fuel) {
|
||||
let totalRange = 0;
|
||||
while (fuelRemaining > 0) {
|
||||
const fuelForThisJump = Math.min(fuelRemaining, fsdMaxFuelPerJump);
|
||||
totalRange += this.jumpRange(mass, fsd, fuelForThisJump);
|
||||
totalRange += this.jumpRange(mass, fsd, fuelForThisJump, ship);
|
||||
// Mass is reduced
|
||||
mass -= fuelForThisJump;
|
||||
fuelRemaining -= fuelForThisJump;
|
||||
@@ -45,7 +55,7 @@ export function totalJumpRange(mass, fsd, fuel) {
|
||||
* @param {number} baseShield Base Shield strength MJ for ship
|
||||
* @param {object} sg The shield generator used
|
||||
* @param {number} multiplier Shield multiplier for ship (1 + shield boosters if any)
|
||||
* @return {number} Approximate shield strengh in MJ
|
||||
* @return {number} Approximate shield strengh in MJ
|
||||
*/
|
||||
export function shieldStrength(mass, baseShield, sg, multiplier) {
|
||||
// sg might be a module or a template; handle either here
|
||||
@@ -55,13 +65,12 @@ export function shieldStrength(mass, baseShield, sg, multiplier) {
|
||||
let minMul = sg instanceof Module ? sg.getMinMul() : sg.minmul;
|
||||
let optMul = sg instanceof Module ? sg.getOptMul() : sg.optmul;
|
||||
let maxMul = sg instanceof Module ? sg.getMaxMul() : sg.maxmul;
|
||||
|
||||
let xnorm = Math.min(1, (maxMass - mass) / (maxMass - minMass));
|
||||
let exponent = Math.log((optMul - minMul) / (maxMul - minMul)) / Math.log(Math.min(1, (maxMass - optMass) / (maxMass - minMass)));
|
||||
let ynorm = Math.pow(xnorm, exponent);
|
||||
let mul = minMul + ynorm * (maxMul - minMul);
|
||||
|
||||
return baseShield * mul * multiplier;
|
||||
return (baseShield * mul * multiplier);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -87,6 +96,16 @@ export function speed(mass, baseSpeed, thrusters, engpip) {
|
||||
return results;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate pip multiplier for speed.
|
||||
* @param {number} baseSpeed The base speed of ship in data
|
||||
* @param {number} topSpeed The top speed of ship in data
|
||||
* @return {number} The multiplier that pips affect speed.
|
||||
*/
|
||||
export function calcPipSpeed(baseSpeed, topSpeed) {
|
||||
return (topSpeed - baseSpeed) / (4 * topSpeed);
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate pitch of a ship based on mass and thrusters
|
||||
* @param {number} mass the mass of the ship
|
||||
@@ -202,7 +221,7 @@ function calcValue(minMass, optMass, maxMass, minMul, optMul, maxMul, mass, base
|
||||
* Calculate speed for a given setup
|
||||
* @param {number} mass the mass of the ship
|
||||
* @param {number} baseSpeed the base speed of the ship
|
||||
* @param {ojbect} thrusters the thrusters of the ship
|
||||
* @param {object} thrusters the thrusters of the ship
|
||||
* @param {number} engpip the multiplier per pip to engines
|
||||
* @param {number} eng the pips to engines
|
||||
* @param {number} boostFactor the boost factor for ths ship
|
||||
@@ -230,7 +249,7 @@ export function calcSpeed(mass, baseSpeed, thrusters, engpip, eng, boostFactor,
|
||||
* Calculate pitch for a given setup
|
||||
* @param {number} mass the mass of the ship
|
||||
* @param {number} basePitch the base pitch of the ship
|
||||
* @param {ojbect} thrusters the thrusters of the ship
|
||||
* @param {object} thrusters the thrusters of the ship
|
||||
* @param {number} engpip the multiplier per pip to engines
|
||||
* @param {number} eng the pips to engines
|
||||
* @param {number} boostFactor the boost factor for ths ship
|
||||
@@ -321,41 +340,76 @@ export function shieldMetrics(ship, sys) {
|
||||
const maxSysResistance = this.sysResistance(4);
|
||||
|
||||
let shield = {};
|
||||
const dimReturnLine = (res) => 1 - (1 - res) * 0.7;
|
||||
|
||||
const shieldGeneratorSlot = ship.findInternalByGroup('sg');
|
||||
if (shieldGeneratorSlot && shieldGeneratorSlot.enabled && shieldGeneratorSlot.m) {
|
||||
const shieldGenerator = shieldGeneratorSlot.m;
|
||||
|
||||
let res = {
|
||||
kin: shieldGenerator.kinres,
|
||||
therm: shieldGenerator.thermres,
|
||||
expl: shieldGenerator.explres
|
||||
};
|
||||
// Boosters
|
||||
let boost = 1;
|
||||
let boosterExplDmg = 1;
|
||||
let boosterKinDmg = 1;
|
||||
let boosterThermDmg = 1;
|
||||
// const explDim = dimReturnLine(shieldGenerator.explres);
|
||||
// const thermDim = dimReturnLine(shieldGenerator.thermres);
|
||||
// const kinDim = dimReturnLine(shieldGenerator.kinres);
|
||||
for (let slot of ship.hardpoints) {
|
||||
if (slot.enabled && slot.m && slot.m.grp == 'sb') {
|
||||
boost += slot.m.getShieldBoost();
|
||||
res.expl += slot.m.getExplosiveResistance();
|
||||
res.kin += slot.m.getKineticResistance();
|
||||
res.therm += slot.m.getThermalResistance();
|
||||
boosterExplDmg = boosterExplDmg * (1 - slot.m.getExplosiveResistance());
|
||||
boosterKinDmg = boosterKinDmg * (1 - slot.m.getKineticResistance());
|
||||
boosterThermDmg = boosterThermDmg * (1 - slot.m.getThermalResistance());
|
||||
}
|
||||
}
|
||||
if (slot.m && slot.m.grp == 'gsrp') {
|
||||
|
||||
}
|
||||
}
|
||||
// Calculate diminishing returns for boosters
|
||||
// Diminishing returns not currently in-game
|
||||
// boost = Math.min(boost, (1 - Math.pow(Math.E, -0.7 * boost)) * 2.5);
|
||||
|
||||
|
||||
// Remove base shield generator strength
|
||||
boost -= 1;
|
||||
// Apply diminishing returns
|
||||
boosterExplDmg = boosterExplDmg > 0.7 ? boosterExplDmg : 0.7 - (0.7 - boosterExplDmg) / 2;
|
||||
boosterKinDmg = boosterKinDmg > 0.7 ? boosterKinDmg : 0.7 - (0.7 - boosterKinDmg) / 2;
|
||||
boosterThermDmg = boosterThermDmg > 0.7 ? boosterThermDmg : 0.7 - (0.7 - boosterThermDmg) / 2;
|
||||
|
||||
const generatorStrength = this.shieldStrength(ship.hullMass, ship.baseShieldStrength, shieldGenerator, 1);
|
||||
// if (res.expl > explDim) {
|
||||
// const overage = (res.expl - explDim) * 0.5;
|
||||
// res.expl = explDim + overage;
|
||||
// boosterExplDmg = explDim + overage;
|
||||
// }
|
||||
//
|
||||
// if (res.therm > thermDim) {
|
||||
// const overage = (res.therm - thermDim) * 0.5;
|
||||
// res.therm = thermDim + overage;
|
||||
// boosterThermDmg = thermDim + overage;
|
||||
// }
|
||||
//
|
||||
// if (res.kin > kinDim) {
|
||||
// const overage = (res.kin - kinDim) * 0.5;
|
||||
// res.kin = kinDim + overage;
|
||||
// boosterKinDmg = kinDim + overage;
|
||||
// }
|
||||
let shieldAddition = 0;
|
||||
if (ship) {
|
||||
for (const module of ship.internal) {
|
||||
if (module && module.m && module.m.grp === 'gsrp' && module.enabled) {
|
||||
shieldAddition += module.m.getShieldAddition();
|
||||
}
|
||||
}
|
||||
}
|
||||
let generatorStrength = this.shieldStrength(ship.hullMass, ship.baseShieldStrength, shieldGenerator, 1);
|
||||
const boostersStrength = generatorStrength * boost;
|
||||
|
||||
// Recover time is the time taken to go from 0 to 50%. It includes a 16-second wait before shields start to recover
|
||||
const shieldToRecover = (generatorStrength + boostersStrength) / 2;
|
||||
const shieldToRecover = (generatorStrength + boostersStrength + shieldAddition) / 2;
|
||||
const powerDistributor = ship.standard[4].m;
|
||||
const sysRechargeRate = this.sysRechargeRate(powerDistributor, sys);
|
||||
|
||||
@@ -374,7 +428,7 @@ export function shieldMetrics(ship, sys) {
|
||||
const remainingShieldToRecover = shieldToRecover - capacitorLifetime * shieldGenerator.getBrokenRegenerationRate();
|
||||
if (sys === 0) {
|
||||
// No system pips so will never recover shields
|
||||
recover = Math.Inf;
|
||||
recover = Math.Infinity;
|
||||
} else {
|
||||
// Recover remaining shields at the rate of the power distributor's recharge
|
||||
recover += remainingShieldToRecover / (sysRechargeRate / 0.6);
|
||||
@@ -382,7 +436,7 @@ export function shieldMetrics(ship, sys) {
|
||||
}
|
||||
|
||||
// Recharge time is the time taken to go from 50% to 100%
|
||||
const shieldToRecharge = (generatorStrength + boostersStrength) / 2;
|
||||
const shieldToRecharge = (generatorStrength + boostersStrength + shieldAddition) / 2;
|
||||
|
||||
// Our initial regeneration comes from the SYS capacitor store, which is replenished as it goes
|
||||
// 0.6 is a magic number from FD: each 0.6 MW of energy from the power distributor recharges 1 MJ/s of regeneration
|
||||
@@ -409,8 +463,10 @@ export function shieldMetrics(ship, sys) {
|
||||
shield = {
|
||||
generator: generatorStrength,
|
||||
boosters: boostersStrength,
|
||||
addition: shieldAddition,
|
||||
cells: ship.shieldCells,
|
||||
total: generatorStrength + boostersStrength + ship.shieldCells,
|
||||
summary: generatorStrength + boostersStrength + shieldAddition,
|
||||
total: generatorStrength + boostersStrength + ship.shieldCells + shieldAddition,
|
||||
recover,
|
||||
recharge,
|
||||
};
|
||||
@@ -425,34 +481,74 @@ export function shieldMetrics(ship, sys) {
|
||||
max: 1 - maxSysResistance
|
||||
};
|
||||
|
||||
/**
|
||||
* An object that stores a selection of difference damage multipliers that
|
||||
* deal with a ship's shield strength.
|
||||
* @typedef {Object} ShieldDamageMults
|
||||
* @property {number} generator Base damage multiplier of the shield
|
||||
* contributing it's base resistance.
|
||||
* @property {number} boosters Damage multiplier contributed by all
|
||||
* boosters, i.e. `rawMj / (generator * boosters)` equals shield strength
|
||||
* with 0 pips to sys.
|
||||
* @property {number} sys Damage multiplier contributed by pips to sys.
|
||||
* @property {number} base Damage multiplier with 0 pips to sys; just
|
||||
* boosters and shield generator. Equals `generator * boosters`.
|
||||
* @property {number} total Damage multiplier with current pip settings.
|
||||
* @property {number} max Damage multiplier with 4 pips to sys.
|
||||
*/
|
||||
|
||||
let sgExplosiveDmg = 1 - shieldGenerator.getExplosiveResistance();
|
||||
let sgSbExplosiveDmg = diminishDamageMult(sgExplosiveDmg * 0.7, (1 - shieldGenerator.getExplosiveResistance()) * boosterExplDmg);
|
||||
/** @type {ShieldDamageMults} */
|
||||
shield.explosive = {
|
||||
generator: 1 - shieldGenerator.getExplosiveResistance(),
|
||||
boosters: boosterExplDmg,
|
||||
generator: sgExplosiveDmg,
|
||||
boosters: sgSbExplosiveDmg / sgExplosiveDmg,
|
||||
sys: (1 - sysResistance),
|
||||
total: (1 - shieldGenerator.getExplosiveResistance()) * boosterExplDmg * (1 - sysResistance),
|
||||
max: (1 - shieldGenerator.getExplosiveResistance()) * boosterExplDmg * (1 - maxSysResistance)
|
||||
base: sgSbExplosiveDmg,
|
||||
total: sgSbExplosiveDmg * (1 - sysResistance),
|
||||
max: sgSbExplosiveDmg * (1 - maxSysResistance),
|
||||
};
|
||||
|
||||
let sgKineticDmg = 1 - shieldGenerator.getKineticResistance();
|
||||
let sgSbKineticDmg = diminishDamageMult(sgKineticDmg * 0.7, (1 - shieldGenerator.getKineticResistance()) * boosterKinDmg);
|
||||
/** @type {ShieldDamageMults} */
|
||||
shield.kinetic = {
|
||||
generator: 1 - shieldGenerator.getKineticResistance(),
|
||||
boosters: boosterKinDmg,
|
||||
generator: sgKineticDmg,
|
||||
boosters: sgSbKineticDmg / sgKineticDmg,
|
||||
sys: (1 - sysResistance),
|
||||
total: (1 - shieldGenerator.getKineticResistance()) * boosterKinDmg * (1 - sysResistance),
|
||||
max: (1 - shieldGenerator.getKineticResistance()) * boosterKinDmg * (1 - maxSysResistance)
|
||||
base: sgSbKineticDmg,
|
||||
total: sgSbKineticDmg * (1 - sysResistance),
|
||||
max: sgSbKineticDmg * (1 - maxSysResistance),
|
||||
};
|
||||
|
||||
let sgThermalDmg = 1 - shieldGenerator.getThermalResistance();
|
||||
let sgSbThermalDmg = diminishDamageMult(sgThermalDmg * 0.7, (1 - shieldGenerator.getThermalResistance()) * boosterThermDmg);
|
||||
/** @type {ShieldDamageMults} */
|
||||
shield.thermal = {
|
||||
generator: 1 - shieldGenerator.getThermalResistance(),
|
||||
boosters: boosterThermDmg,
|
||||
generator: sgThermalDmg,
|
||||
boosters: sgSbThermalDmg / sgThermalDmg,
|
||||
sys: (1 - sysResistance),
|
||||
total: (1 - shieldGenerator.getThermalResistance()) * boosterThermDmg * (1 - sysResistance),
|
||||
max: (1 - shieldGenerator.getThermalResistance()) * boosterThermDmg * (1 - maxSysResistance)
|
||||
base: sgSbThermalDmg,
|
||||
total: sgSbThermalDmg * (1 - sysResistance),
|
||||
max: sgSbThermalDmg * (1 - maxSysResistance),
|
||||
};
|
||||
}
|
||||
|
||||
return shield;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate time from one boost to another
|
||||
* @return {number} Boost frequency in seconds
|
||||
* @param {Ship} ship Ship object
|
||||
*/
|
||||
export function calcBoost(ship) {
|
||||
if (!ship.boostEnergy || !ship.standard[4] || !ship.standard[4].m) {
|
||||
return undefined;
|
||||
}
|
||||
return ship.boostEnergy / ship.standard[4].m.getEnginesRechargeRate();
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Calculate armour metrics
|
||||
* @param {Object} ship The ship
|
||||
@@ -465,33 +561,58 @@ export function armourMetrics(ship) {
|
||||
|
||||
let moduleArmour = 0;
|
||||
let moduleProtection = 1;
|
||||
|
||||
const bulkheads = ship.bulkheads.m;
|
||||
let hullExplDmg = 1;
|
||||
let hullKinDmg = 1;
|
||||
let hullThermDmg = 1;
|
||||
|
||||
let hullCausDmg = 1;
|
||||
// const dimReturnLine = (res) => 1 - (1 - res) * 0.7;
|
||||
// let res = {
|
||||
// kin: 0,
|
||||
// therm: 0,
|
||||
// expl: 0
|
||||
// };
|
||||
// Armour from HRPs and module armour from MRPs
|
||||
for (let slot of ship.internal) {
|
||||
if (slot.m && slot.m.grp == 'hr') {
|
||||
if (slot.m && slot.enabled && (slot.m.grp === 'hr' || slot.m.grp === 'ghrp' || slot.m.grp == 'mahr')) {
|
||||
armourReinforcement += slot.m.getHullReinforcement();
|
||||
// Hull boost for HRPs is applied against the ship's base armour
|
||||
armourReinforcement += ship.baseArmour * slot.m.getModValue('hullboost') / 10000;
|
||||
|
||||
// res.expl += slot.m.getExplosiveResistance();
|
||||
// res.kin += slot.m.getKineticResistance();
|
||||
// res.therm += slot.m.getThermalResistance();
|
||||
hullExplDmg = hullExplDmg * (1 - slot.m.getExplosiveResistance());
|
||||
hullKinDmg = hullKinDmg * (1 - slot.m.getKineticResistance());
|
||||
hullThermDmg = hullThermDmg * (1 - slot.m.getThermalResistance());
|
||||
hullCausDmg = hullCausDmg * (1 - slot.m.getCausticResistance());
|
||||
}
|
||||
if (slot.m && slot.m.grp == 'mrp') {
|
||||
if (slot.m && slot.enabled && (slot.m.grp == 'mrp' || slot.m.grp == 'gmrp')) {
|
||||
moduleArmour += slot.m.getIntegrity();
|
||||
moduleProtection = moduleProtection * (1 - slot.m.getProtection());
|
||||
}
|
||||
}
|
||||
moduleProtection = 1 - moduleProtection;
|
||||
|
||||
// Apply diminishing returns
|
||||
hullExplDmg = hullExplDmg > 0.7 ? hullExplDmg : 0.7 - (0.7 - hullExplDmg) / 2;
|
||||
hullKinDmg = hullKinDmg > 0.7 ? hullKinDmg : 0.7 - (0.7 - hullKinDmg) / 2;
|
||||
hullThermDmg = hullThermDmg > 0.7 ? hullThermDmg : 0.7 - (0.7 - hullThermDmg) / 2;
|
||||
// const explDim = dimReturnLine(bulkheads.explres);
|
||||
// const thermDim = dimReturnLine(bulkheads.thermres);
|
||||
// const kinDim = dimReturnLine(bulkheads.kinres);
|
||||
// if (res.expl > explDim) {
|
||||
// const overage = (res.expl - explDim) * 0.5;
|
||||
// res.expl = explDim + overage;
|
||||
// hullExplDmg = explDim + overage;
|
||||
// }
|
||||
//
|
||||
// if (res.therm > thermDim) {
|
||||
// const overage = (res.therm - thermDim) * 0.5;
|
||||
// res.therm = thermDim + overage;
|
||||
// hullThermDmg = thermDim + overage;
|
||||
// }
|
||||
//
|
||||
// if (res.kin > kinDim) {
|
||||
// const overage = (res.kin - kinDim) * 0.5;
|
||||
// res.kin = kinDim + overage;
|
||||
// hullKinDmg = kinDim + overage;
|
||||
// }
|
||||
|
||||
const armour = {
|
||||
bulkheads: armourBulkheads,
|
||||
@@ -509,24 +630,41 @@ export function armourMetrics(ship) {
|
||||
total: 1
|
||||
};
|
||||
|
||||
let armourExplDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getExplosiveResistance());
|
||||
let armourReinforcedExplDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getExplosiveResistance()) * hullExplDmg);
|
||||
armour.explosive = {
|
||||
bulkheads: 1 - ship.bulkheads.m.getExplosiveResistance(),
|
||||
reinforcement: hullExplDmg,
|
||||
total: (1 - ship.bulkheads.m.getExplosiveResistance()) * hullExplDmg
|
||||
bulkheads: armourExplDmg,
|
||||
reinforcement: armourReinforcedExplDmg / armourExplDmg,
|
||||
total: armourReinforcedExplDmg,
|
||||
res: 1 - armourReinforcedExplDmg
|
||||
};
|
||||
|
||||
let armourKinDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getKineticResistance());
|
||||
let armourReinforcedKinDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getKineticResistance()) * hullKinDmg);
|
||||
armour.kinetic = {
|
||||
bulkheads: 1 - ship.bulkheads.m.getKineticResistance(),
|
||||
reinforcement: hullKinDmg,
|
||||
total: (1 - ship.bulkheads.m.getKineticResistance()) * hullKinDmg
|
||||
bulkheads: armourKinDmg,
|
||||
reinforcement: armourReinforcedKinDmg / armourKinDmg,
|
||||
total: armourReinforcedKinDmg,
|
||||
res: 1 - armourReinforcedKinDmg
|
||||
};
|
||||
|
||||
let armourThermDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getThermalResistance());
|
||||
let armourReinforcedThermDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getThermalResistance()) * hullThermDmg);
|
||||
armour.thermal = {
|
||||
bulkheads: 1 - ship.bulkheads.m.getThermalResistance(),
|
||||
reinforcement: hullThermDmg,
|
||||
total: (1 - ship.bulkheads.m.getThermalResistance()) * hullThermDmg
|
||||
bulkheads: armourThermDmg,
|
||||
reinforcement: armourReinforcedThermDmg / armourThermDmg,
|
||||
total: armourReinforcedThermDmg,
|
||||
res: 1 - armourReinforcedThermDmg
|
||||
};
|
||||
|
||||
let armourCausDmg = diminishDamageMult(0.7, 1 - ship.bulkheads.m.getCausticResistance());
|
||||
let armourReinforcedCausDmg = diminishDamageMult(0.7, (1 - ship.bulkheads.m.getCausticResistance()) * hullCausDmg);
|
||||
armour.caustic = {
|
||||
bulkheads: armourCausDmg,
|
||||
reinforcement: armourReinforcedCausDmg / armourCausDmg,
|
||||
total: armourReinforcedCausDmg,
|
||||
res: 1 - armourReinforcedCausDmg,
|
||||
};
|
||||
return armour;
|
||||
}
|
||||
|
||||
@@ -698,20 +836,55 @@ export function _sustainedDps(ship, opponent, opponentShields, opponentArmour, e
|
||||
return { shieldsdps, armoursdps, eps };
|
||||
}
|
||||
|
||||
/**
|
||||
* Stores SDPS split up by type.
|
||||
* @typedef {Object} SDps
|
||||
* @property {number} absolute Damage of type absolute
|
||||
* @property {number} explosive Damage of type explosive
|
||||
* @property {number} kinetic Damage of type kinetic
|
||||
* @property {number} thermal Damage of type thermal
|
||||
* @property {number} [total] Sum of all damage types
|
||||
*/
|
||||
|
||||
/**
|
||||
* An object that holds information about SDPS for a given weapon and opponent.
|
||||
* @typedef {Object} WeaponDamage
|
||||
* @property {number} eps Energy per second
|
||||
* @property {Object} damage An object that stores damage inflicted by
|
||||
* the weapon.
|
||||
* @property {Object} effectiveness An object that stores the effectiveness of
|
||||
* the weapon against the opponent given.
|
||||
*/
|
||||
|
||||
/**
|
||||
* Stores overall SDPS and against a given opponent's shields and armour.
|
||||
* @typedef {Object} WeaponDamage~damage
|
||||
* @property {SDps} base Overall SDPS.
|
||||
* @property {SDps} shields SDPS against the given opponent's shields.
|
||||
* @property {SDps} armour SDPS against the given opponent's armour.
|
||||
*/
|
||||
|
||||
/**
|
||||
* Calculate the sustained DPS for a weapon at a given range
|
||||
* @param {Object} m The weapon
|
||||
* @param {Object} opponent The opponent ship
|
||||
* @param {Object} opponent The opponent ship
|
||||
* @param {Object} opponentShields The opponent's shield resistances
|
||||
* @param {Object} opponentArmour The opponent's armour resistances
|
||||
* @param {int} engagementrange The range between the ship and opponent
|
||||
* @returns {Object} Sustained DPS for shield and armour
|
||||
* @returns {WeaponDamage} Sustained DPS for shield and armour
|
||||
*/
|
||||
export function _weaponSustainedDps(m, opponent, opponentShields, opponentArmour, engagementrange) {
|
||||
const opponentHasShields = opponentShields.generator ? true : false;
|
||||
const weapon = {
|
||||
eps: 0,
|
||||
damage: {
|
||||
base: {
|
||||
absolute: 0,
|
||||
explosive: 0,
|
||||
kinetic: 0,
|
||||
thermal: 0,
|
||||
total: 0,
|
||||
},
|
||||
shields: {
|
||||
absolute: 0,
|
||||
explosive: 0,
|
||||
@@ -745,7 +918,7 @@ export function _weaponSustainedDps(m, opponent, opponentShields, opponentArmour
|
||||
weapon.eps = m.getClip() ? (m.getClip() * m.getEps() / m.getRoF()) / ((m.getClip() / m.getRoF()) + m.getReload()) : m.getEps();
|
||||
|
||||
// Initial sustained DPS
|
||||
let sDps = m.getClip() ? (m.getClip() * m.getDps() / m.getRoF()) / ((m.getClip() / m.getRoF()) + m.getReload()) : m.getDps();
|
||||
let sDps = m.getSDps();
|
||||
|
||||
// Take fall-off in to account
|
||||
const falloff = m.getFalloff();
|
||||
@@ -756,6 +929,12 @@ export function _weaponSustainedDps(m, opponent, opponentShields, opponentArmour
|
||||
sDps *= dropoff;
|
||||
}
|
||||
|
||||
weapon.damage.base.absolute = sDps * m.getDamageDist().A;
|
||||
weapon.damage.base.explosive = sDps * m.getDamageDist().E;
|
||||
weapon.damage.base.kinetic = sDps * m.getDamageDist().K;
|
||||
weapon.damage.base.thermal = sDps * m.getDamageDist().T;
|
||||
weapon.damage.base.total = sDps;
|
||||
|
||||
// Piercing/hardness modifier (for armour only)
|
||||
const armourMultiple = m.getPiercing() >= opponent.hardness ? 1 : m.getPiercing() / opponent.hardness;
|
||||
weapon.effectiveness.armour.hardness = armourMultiple;
|
||||
@@ -836,7 +1015,10 @@ export function timeToDrainWep(ship, wep) {
|
||||
*/
|
||||
export function timeToDeplete(amount, dps, eps, capacity, recharge) {
|
||||
const drainPerSecond = eps - recharge;
|
||||
if (drainPerSecond <= 0) {
|
||||
// If there is nothing to remove, we're don instantly
|
||||
if (!amount) {
|
||||
return 0;
|
||||
} if (drainPerSecond <= 0) {
|
||||
// Simple result
|
||||
return amount / dps;
|
||||
} else {
|
||||
@@ -853,3 +1035,17 @@ export function timeToDeplete(amount, dps, eps, capacity, recharge) {
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Applies diminishing returns to resistances.
|
||||
* @param {number} diminishFrom The base resistance up to which no diminishing returns are applied.
|
||||
* @param {number} damageMult Resistance as damage multiplier
|
||||
* @returns {number} Actual damage multiplier
|
||||
*/
|
||||
export function diminishDamageMult(diminishFrom, damageMult) {
|
||||
if (damageMult > diminishFrom) {
|
||||
return damageMult;
|
||||
} else {
|
||||
return (diminishFrom / 2) + 0.5 * damageMult;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -18,7 +18,7 @@ export const ModuleGroupToName = {
|
||||
// Standard
|
||||
pp: 'Power Plant',
|
||||
gpp: 'Guardian Hybrid Power Plant',
|
||||
gpd: 'Guardian Hybrid Power Distributor',
|
||||
gpd: 'Guardian Power Distributor',
|
||||
t: 'Thrusters',
|
||||
fsd: 'Frame Shift Drive',
|
||||
ls: 'Life Support',
|
||||
@@ -52,6 +52,12 @@ export const ModuleGroupToName = {
|
||||
pcq: 'Luxury Passenger Cabin',
|
||||
cc: 'Collector Limpet Controller',
|
||||
ss: 'Surface Scanner',
|
||||
gsrp: 'Guardian Shield Reinforcement Packages',
|
||||
gfsb: 'Guardian Frame Shift Drive Booster',
|
||||
ghrp: 'Guardian Hull Reinforcement Package',
|
||||
gmrp: 'Guardian Module Reinforcement Package',
|
||||
mahr: 'Meta Alloy Hull Reinforcement Package',
|
||||
sua: 'Supercruise Assist',
|
||||
|
||||
// Hard Points
|
||||
bl: 'Beam Laser',
|
||||
@@ -81,8 +87,18 @@ export const ModuleGroupToName = {
|
||||
sfn: 'Shutdown Field Neutraliser',
|
||||
xs: 'Xeno Scanner',
|
||||
rcpl: 'Recon Limpet Controller',
|
||||
rsl: 'Research Limpet Controller',
|
||||
dtl: 'Decontamination Limpet Controller',
|
||||
gpc: 'Guardian Plasma Charger',
|
||||
ggc: 'Guardian Gauss Cannon',
|
||||
tbsc: 'Shock Cannon',
|
||||
gsc: 'Guardian Shard Cannon',
|
||||
tbem: 'Enzyme Missile Rack',
|
||||
tbrfl: 'Remote Release Flechette Launcher',
|
||||
pwa: 'Pulse Wave Analyser',
|
||||
abl: 'Abrasion Blaster',
|
||||
scl: 'Seismic Charge Launcher',
|
||||
sdm: 'Sub-Surface Displacement Missile',
|
||||
};
|
||||
|
||||
let GrpNameToCodeMap = {};
|
||||
@@ -191,7 +207,7 @@ export const ShipFacets = [
|
||||
i: 9
|
||||
},
|
||||
{ // 10
|
||||
title: 'fastest range',
|
||||
title: 'farthest range',
|
||||
props: ['unladenFastestRange', 'ladenFastestRange'],
|
||||
lbls: ['unladen', 'laden'],
|
||||
unit: 'LY',
|
||||
|
||||
@@ -2,7 +2,6 @@
|
||||
* Modification - a modification and its value
|
||||
*/
|
||||
export default class Modification {
|
||||
|
||||
/**
|
||||
* @param {String} id Unique modification ID
|
||||
* @param {Number} value Value of the modification
|
||||
@@ -11,5 +10,4 @@ export default class Modification {
|
||||
this.id = id;
|
||||
this.value = value;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -17,7 +17,6 @@ function filter(arr, maxClass, minClass, mass) {
|
||||
* The available module set for a specific ship
|
||||
*/
|
||||
export default class ModuleSet {
|
||||
|
||||
/**
|
||||
* Instantiate the module set
|
||||
* @param {Object} modules All Modules
|
||||
|
||||
@@ -63,7 +63,10 @@ export function standard(type, id) {
|
||||
if (!isNaN(type)) {
|
||||
type = StandardArray[type];
|
||||
}
|
||||
let s = Modules.standard[type].find(e => e.id == id || (e.class == id.charAt(0) && e.rating == id.charAt(1)));
|
||||
let s = Modules.standard[type].find(e => e.id === id);
|
||||
if (!s) {
|
||||
s = Modules.standard[type].find(e => (e.class == id.charAt(0) && e.rating == id.charAt(1)));
|
||||
}
|
||||
if (s) {
|
||||
s = new Module({ template: s });
|
||||
}
|
||||
|
||||
@@ -85,12 +85,12 @@ export function toDetailedBuild(buildName, ship) {
|
||||
code = ship.toString();
|
||||
|
||||
let data = {
|
||||
$schema: 'https://coriolis.edcd.io/schemas/ship-loadout/4.json#',
|
||||
$schema: 'https://coriolis.io/schemas/ship-loadout/4.json#',
|
||||
name: buildName,
|
||||
ship: ship.name,
|
||||
references: [{
|
||||
name: 'Coriolis.io',
|
||||
url: 'https://coriolis.edcd.io' + outfitURL(ship.id, code, buildName),
|
||||
url: 'https://coriolis.io' + outfitURL(ship.id, code, buildName),
|
||||
code,
|
||||
shipId: ship.id
|
||||
}],
|
||||
|
||||
@@ -7,9 +7,10 @@ import LZString from 'lz-string';
|
||||
import * as _ from 'lodash';
|
||||
import isEqual from 'lodash/lang';
|
||||
import { Ships, Modifications } from 'coriolis-data/dist';
|
||||
import { chain } from 'lodash';
|
||||
const zlib = require('zlib');
|
||||
|
||||
const UNIQUE_MODULES = ['psg', 'sg', 'bsg', 'rf', 'fs', 'fh'];
|
||||
const UNIQUE_MODULES = ['psg', 'sg', 'bsg', 'rf', 'fs', 'fh', 'gfsb', 'dc'];
|
||||
|
||||
// Constants for modifications struct
|
||||
const SLOT_ID_DONE = -1;
|
||||
@@ -70,7 +71,6 @@ function reduceToIDs(idArray, slot, slotIndex) {
|
||||
* Ship Model - Encapsulates and models in-game ship behavior
|
||||
*/
|
||||
export default class Ship {
|
||||
|
||||
/**
|
||||
* @param {String} id Unique ship Id / Key
|
||||
* @param {Object} properties Basic ship properties such as name, manufacturer, mass, etc
|
||||
@@ -151,7 +151,7 @@ export default class Ship {
|
||||
* @return {Number} Jump range in Light Years
|
||||
*/
|
||||
calcLadenRange(massDelta, fuel, fsd) {
|
||||
return Calc.jumpRange(this.ladenMass + (massDelta || 0), fsd || this.standard[2].m, fuel);
|
||||
return Calc.jumpRange(this.ladenMass + (massDelta || 0), fsd || this.standard[2].m, fuel, this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -164,7 +164,7 @@ export default class Ship {
|
||||
calcUnladenRange(massDelta, fuel, fsd) {
|
||||
fsd = fsd || this.standard[2].m;
|
||||
let fsdMaxFuelPerJump = fsd instanceof Module ? fsd.getMaxFuelPerJump() : fsd.maxfuel;
|
||||
return Calc.jumpRange(this.unladenMass + (massDelta || 0) + Math.min(fsdMaxFuelPerJump, fuel || this.fuelCapacity), fsd || this.standard[2].m, fuel);
|
||||
return Calc.jumpRange(this.unladenMass + (massDelta || 0) + Math.min(fsdMaxFuelPerJump, fuel || this.fuelCapacity), fsd || this.standard[2].m, fuel, this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -239,7 +239,6 @@ export default class Ship {
|
||||
}
|
||||
sg = sgSlot.m;
|
||||
}
|
||||
|
||||
// TODO Not accurate if the ship has modified shield boosters
|
||||
return Calc.shieldStrength(this.hullMass, this.baseShieldStrength, sg, 1 + (multiplierDelta || 0));
|
||||
}
|
||||
@@ -416,16 +415,16 @@ export default class Ship {
|
||||
clearModifications(m) {
|
||||
m.mods = {};
|
||||
this.updatePowerGenerated()
|
||||
.updatePowerUsed()
|
||||
.recalculateMass()
|
||||
.updateJumpStats()
|
||||
.recalculateShield()
|
||||
.recalculateShieldCells()
|
||||
.recalculateArmour()
|
||||
.recalculateDps()
|
||||
.recalculateEps()
|
||||
.recalculateHps()
|
||||
.updateMovement();
|
||||
.updatePowerUsed()
|
||||
.recalculateMass()
|
||||
.updateJumpStats()
|
||||
.recalculateShield()
|
||||
.recalculateShieldCells()
|
||||
.recalculateArmour()
|
||||
.recalculateDps()
|
||||
.recalculateEps()
|
||||
.recalculateHps()
|
||||
.updateMovement();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -437,12 +436,15 @@ export default class Ship {
|
||||
m.blueprint = bp;
|
||||
this.clearModifications(m);
|
||||
// Set any hidden items for the blueprint now
|
||||
const features = m.blueprint.grades[m.blueprint.grade].features;
|
||||
for (const featureName in features) {
|
||||
if (Modifications.modifications[featureName].hidden) {
|
||||
this.setModification(m, featureName, bp.grades[bp.grade].features[featureName][0]);
|
||||
if (m.blueprint.grades[m.blueprint.grade] && m.blueprint.grades[m.blueprint.grade].features) {
|
||||
const features = m.blueprint.grades[m.blueprint.grade].features;
|
||||
for (const featureName in features) {
|
||||
if (Modifications.modifications[featureName].hidden) {
|
||||
this.setModification(m, featureName, bp.grades[bp.grade].features[featureName][0]);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
this.updateModificationsString();
|
||||
}
|
||||
|
||||
@@ -482,10 +484,7 @@ export default class Ship {
|
||||
* @param {Object} m The module for which to clear the blueprint
|
||||
*/
|
||||
clearModuleSpecial(m) {
|
||||
if (m.blueprint) {
|
||||
m.blueprint.special = null;
|
||||
}
|
||||
this.recalculateDps().recalculateHps().recalculateEps();
|
||||
this.setModuleSpecial(m, null);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -494,68 +493,67 @@ export default class Ship {
|
||||
* @param {Object} name The name of the modification to change
|
||||
* @param {Number} value The new value of the modification. The value of the modification is scaled to provide two decimal places of precision in an integer. For example 1.23% is stored as 123
|
||||
* @param {bool} sentfromui True if this update was sent from the UI
|
||||
* @param {bool} isAbsolute True if value is an absolute value and not a
|
||||
* modification value
|
||||
*/
|
||||
setModification(m, name, value, sentfromui) {
|
||||
setModification(m, name, value, sentfromui, isAbsolute) {
|
||||
if (isNaN(value)) {
|
||||
// Value passed is invalid; reset it to 0
|
||||
value = 0;
|
||||
}
|
||||
|
||||
if (isAbsolute) {
|
||||
m.setPretty(name, value, sentfromui);
|
||||
} else {
|
||||
// Resistance modifiers scale with the base value
|
||||
if (name == 'kinres' || name == 'thermres' || name == 'causres' || name == 'explres') {
|
||||
let baseValue = m.get(name, false);
|
||||
value = (1 - baseValue) * value;
|
||||
}
|
||||
m.setModValue(name, value, sentfromui);
|
||||
}
|
||||
|
||||
// Handle special cases
|
||||
if (name === 'pgen') {
|
||||
// Power generation
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.updatePowerGenerated();
|
||||
} else if (name === 'power') {
|
||||
// Power usage
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.updatePowerUsed();
|
||||
} else if (name === 'mass') {
|
||||
// Mass
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.recalculateMass();
|
||||
this.updateMovement();
|
||||
this.updateJumpStats();
|
||||
} else if (name === 'maxfuel') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.updateJumpStats();
|
||||
} else if (name === 'optmass') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
// Could be for any of thrusters, FSD or shield
|
||||
this.updateMovement();
|
||||
this.updateJumpStats();
|
||||
this.recalculateShield();
|
||||
} else if (name === 'optmul') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
// Could be for any of thrusters, FSD or shield
|
||||
this.updateMovement();
|
||||
this.updateJumpStats();
|
||||
this.recalculateShield();
|
||||
} else if (name === 'shieldboost') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.recalculateShield();
|
||||
} else if (name === 'hullboost' || name === 'hullreinforcement' || name === 'modulereinforcement') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.recalculateArmour();
|
||||
} else if (name === 'shieldreinforcement') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.recalculateShieldCells();
|
||||
} else if (name === 'burst' || name == 'burstrof' || name === 'clip' || name === 'damage' || name === 'distdraw' || name === 'jitter' || name === 'piercing' || name === 'range' || name === 'reload' || name === 'rof' || name === 'thermload') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
this.recalculateDps();
|
||||
this.recalculateHps();
|
||||
this.recalculateEps();
|
||||
} else if (name === 'explres' || name === 'kinres' || name === 'thermres') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
// Could be for shields or armour
|
||||
this.recalculateArmour();
|
||||
this.recalculateShield();
|
||||
} else if (name === 'engcap') {
|
||||
m.setModValue(name, value, sentfromui);
|
||||
// Might have resulted in a change in boostability
|
||||
this.updateMovement();
|
||||
} else {
|
||||
// Generic
|
||||
m.setModValue(name, value, sentfromui);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -702,16 +700,16 @@ export default class Ship {
|
||||
// Update aggragated stats
|
||||
if (comps) {
|
||||
this.updatePowerGenerated()
|
||||
.updatePowerUsed()
|
||||
.recalculateMass()
|
||||
.updateJumpStats()
|
||||
.recalculateShield()
|
||||
.recalculateShieldCells()
|
||||
.recalculateArmour()
|
||||
.recalculateDps()
|
||||
.recalculateEps()
|
||||
.recalculateHps()
|
||||
.updateMovement();
|
||||
.updatePowerUsed()
|
||||
.recalculateMass()
|
||||
.updateJumpStats()
|
||||
.recalculateShield()
|
||||
.recalculateShieldCells()
|
||||
.recalculateArmour()
|
||||
.recalculateDps()
|
||||
.recalculateEps()
|
||||
.recalculateHps()
|
||||
.updateMovement();
|
||||
}
|
||||
|
||||
return this.updatePowerPrioritesString().updatePowerEnabledString().updateModificationsString();
|
||||
@@ -938,9 +936,14 @@ export default class Ship {
|
||||
let epsChanged = n && n.getEps() || old && old.getEps();
|
||||
let hpsChanged = n && n.getHps() || old && old.getHps();
|
||||
|
||||
let armourChange = (slot === this.bulkheads) || (n && n.grp === 'hr') || (old && old.grp === 'hr') || (n && n.grp === 'mrp') || (old && old.grp === 'mrp');
|
||||
let armourChange = (slot === this.bulkheads) ||
|
||||
(n && n.grp === 'hr') || (old && old.grp === 'hr') ||
|
||||
(n && n.grp === 'ghrp') || (old && old.grp === 'ghrp') ||
|
||||
(n && n.grp == 'mahr') || (old && old.grp == 'mahr') ||
|
||||
(n && n.grp === 'mrp') || (old && old.grp === 'mrp') ||
|
||||
(n && n.grp === 'gmrp') || (old && old.grp == 'gmrp');
|
||||
|
||||
let shieldChange = (n && n.grp === 'bsg') || (old && old.grp === 'bsg') || (n && n.grp === 'psg') || (old && old.grp === 'psg') || (n && n.grp === 'sg') || (old && old.grp === 'sg') || (n && n.grp === 'sb') || (old && old.grp === 'sb');
|
||||
let shieldChange = (n && n.grp === 'bsg') || (old && old.grp === 'bsg') || (n && n.grp === 'psg') || (old && old.grp === 'psg') || (n && n.grp === 'sg') || (old && old.grp === 'sg') || (n && n.grp === 'sb') || (old && old.grp === 'sb') || (old && old.grp === 'gsrp') || (n && n.grp === 'gsrp');
|
||||
|
||||
let shieldCellsChange = (n && n.grp === 'scb') || (old && old.grp === 'scb');
|
||||
|
||||
@@ -997,25 +1000,6 @@ export default class Ship {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate diminishing returns value, where values below a given limit are returned
|
||||
* as-is, and values between the lower and upper limit of the diminishing returns are
|
||||
* given at half value.
|
||||
* Commonly used for resistances.
|
||||
* @param {Number} val The value
|
||||
* @param {Number} drll The lower limit for diminishing returns
|
||||
* @param {Number} drul The upper limit for diminishing returns
|
||||
* @return {this} The ship instance (for chaining operations)
|
||||
*/
|
||||
diminishingReturns(val, drll, drul) {
|
||||
if (val < drll) {
|
||||
val = drll;
|
||||
} else if (val < drul) {
|
||||
val = drul - (drul - val) / 2;
|
||||
}
|
||||
return val;
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculate damage per second and related items for weapons
|
||||
* @return {this} The ship instance (for chaining operations)
|
||||
@@ -1202,38 +1186,35 @@ export default class Ship {
|
||||
|
||||
unladenMass += this.bulkheads.m.getMass();
|
||||
|
||||
for (let slotNum in this.standard) {
|
||||
const slot = this.standard[slotNum];
|
||||
if (slot.m) {
|
||||
unladenMass += slot.m.getMass();
|
||||
if (slot.m.grp === 'ft') {
|
||||
fuelCapacity += slot.m.fuel;
|
||||
}
|
||||
}
|
||||
}
|
||||
let slots = this.standard.concat(this.internal, this.hardpoints);
|
||||
// TODO: create class for slot and also add slot.get
|
||||
// handle unladen mass
|
||||
unladenMass += chain(slots)
|
||||
.map(slot => slot.m ? slot.m.get('mass') : null)
|
||||
.map(mass => mass || 0)
|
||||
.reduce((sum, mass) => sum + mass)
|
||||
.value();
|
||||
|
||||
for (let slotNum in this.internal) {
|
||||
const slot = this.internal[slotNum];
|
||||
if (slot.m) {
|
||||
unladenMass += slot.m.getMass();
|
||||
if (slot.m.grp === 'ft') {
|
||||
fuelCapacity += slot.m.fuel;
|
||||
} else if (slot.m.grp === 'cr') {
|
||||
cargoCapacity += slot.m.cargo;
|
||||
} else if (slot.m.grp.slice(0,2) === 'pc') {
|
||||
if (slot.m.passengers) {
|
||||
passengerCapacity += slot.m.passengers;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
// handle fuel capacity
|
||||
fuelCapacity += chain(slots)
|
||||
.map(slot => slot.m ? slot.m.get('fuel') : null)
|
||||
.map(fuel => fuel || 0)
|
||||
.reduce((sum, fuel) => sum + fuel)
|
||||
.value();
|
||||
|
||||
for (let slotNum in this.hardpoints) {
|
||||
const slot = this.hardpoints[slotNum];
|
||||
if (slot.m) {
|
||||
unladenMass += slot.m.getMass();
|
||||
}
|
||||
}
|
||||
// handle cargo capacity
|
||||
cargoCapacity += chain(slots)
|
||||
.map(slot => slot.m ? slot.m.get('cargo') : null)
|
||||
.map(cargo => cargo || 0)
|
||||
.reduce((sum, cargo) => sum + cargo)
|
||||
.value();
|
||||
|
||||
// handle passenger capacity
|
||||
passengerCapacity += chain(slots)
|
||||
.map(slot => slot.m ? slot.m.get('passengers') : null)
|
||||
.map(passengers => passengers || 0)
|
||||
.reduce((sum, passengers) => sum + passengers)
|
||||
.value();
|
||||
|
||||
// Update global stats
|
||||
this.unladenMass = unladenMass;
|
||||
@@ -1274,7 +1255,7 @@ export default class Ship {
|
||||
// Obtain shield metrics with 0 pips to sys (parts affected by SYS aren't used here)
|
||||
const metrics = Calc.shieldMetrics(this, 0);
|
||||
|
||||
this.shield = metrics.generator ? metrics.generator + metrics.boosters : 0;
|
||||
this.shield = metrics.generator ? metrics.generator + metrics.boosters + metrics.addition : 0;
|
||||
this.shieldExplRes = this.shield > 0 ? 1 - metrics.explosive.total : null;
|
||||
this.shieldKinRes = this.shield > 0 ? 1 - metrics.kinetic.total : null;
|
||||
this.shieldThermRes = this.shield > 0 ? 1 - metrics.thermal.total : null;
|
||||
@@ -1307,45 +1288,15 @@ export default class Ship {
|
||||
*/
|
||||
recalculateArmour() {
|
||||
// Armour from bulkheads
|
||||
let bulkhead = this.bulkheads.m;
|
||||
let armour = this.baseArmour + (this.baseArmour * bulkhead.getHullBoost());
|
||||
let modulearmour = 0;
|
||||
let moduleprotection = 1;
|
||||
let hullExplRes = 1 - bulkhead.getExplosiveResistance();
|
||||
const hullExplResDRStart = hullExplRes * 0.7;
|
||||
const hullExplResDREnd = hullExplRes * 0;
|
||||
let hullKinRes = 1 - bulkhead.getKineticResistance();
|
||||
const hullKinResDRStart = hullKinRes * 0.7;
|
||||
const hullKinResDREnd = hullKinRes * 0;
|
||||
let hullThermRes = 1 - bulkhead.getThermalResistance();
|
||||
const hullThermResDRStart = hullThermRes * 0.7;
|
||||
const hullThermResDREnd = hullThermRes * 0;
|
||||
|
||||
// Armour from HRPs and module armour from MRPs
|
||||
for (let slot of this.internal) {
|
||||
if (slot.m && slot.m.grp == 'hr') {
|
||||
armour += slot.m.getHullReinforcement();
|
||||
// Hull boost for HRPs is applied against the ship's base armour
|
||||
armour += this.baseArmour * slot.m.getModValue('hullboost') / 10000;
|
||||
|
||||
hullExplRes *= (1 - slot.m.getExplosiveResistance());
|
||||
hullKinRes *= (1 - slot.m.getKineticResistance());
|
||||
hullThermRes *= (1 - slot.m.getThermalResistance());
|
||||
}
|
||||
if (slot.m && slot.m.grp == 'mrp') {
|
||||
modulearmour += slot.m.getIntegrity();
|
||||
moduleprotection = moduleprotection * (1 - slot.m.getProtection());
|
||||
}
|
||||
}
|
||||
moduleprotection = 1 - moduleprotection;
|
||||
|
||||
this.armour = armour;
|
||||
this.modulearmour = modulearmour;
|
||||
this.moduleprotection = moduleprotection;
|
||||
this.hullExplRes = 1 - this.diminishingReturns(hullExplRes, hullExplResDREnd, hullExplResDRStart);
|
||||
this.hullKinRes = 1 - this.diminishingReturns(hullKinRes, hullKinResDREnd, hullKinResDRStart);
|
||||
this.hullThermRes = 1 - this.diminishingReturns(hullThermRes, hullThermResDREnd, hullThermResDRStart);
|
||||
let metrics = Calc.armourMetrics(this);
|
||||
|
||||
this.armour = metrics.total ? metrics.total : 0;
|
||||
this.modulearmour = metrics.modulearmour;
|
||||
this.moduleprotection = metrics.moduleprotection;
|
||||
this.hullExplRes = 1 - metrics.explosive.total;
|
||||
this.hullKinRes = 1 - metrics.kinetic.total;
|
||||
this.hullThermRes = 1 - metrics.thermal.total;
|
||||
this.hullCausRes = 1 - metrics.caustic.total;
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -1357,10 +1308,10 @@ export default class Ship {
|
||||
let fsd = this.standard[2].m; // Frame Shift Drive;
|
||||
let { unladenMass, fuelCapacity } = this;
|
||||
this.unladenRange = this.calcUnladenRange(); // Includes fuel weight for jump
|
||||
this.fullTankRange = Calc.jumpRange(unladenMass + fuelCapacity, fsd); // Full Tank
|
||||
this.fullTankRange = Calc.jumpRange(unladenMass + fuelCapacity, fsd, fuelCapacity, this); // Full Tank
|
||||
this.ladenRange = this.calcLadenRange(); // Includes full tank and caro
|
||||
this.unladenFastestRange = Calc.totalJumpRange(unladenMass + this.fuelCapacity, fsd, fuelCapacity);
|
||||
this.ladenFastestRange = Calc.totalJumpRange(unladenMass + this.fuelCapacity + this.cargoCapacity, fsd, fuelCapacity);
|
||||
this.unladenFastestRange = Calc.totalJumpRange(unladenMass + this.fuelCapacity, fsd, fuelCapacity, this);
|
||||
this.ladenFastestRange = Calc.totalJumpRange(unladenMass + this.fuelCapacity + this.cargoCapacity, fsd, fuelCapacity, this);
|
||||
this.maxJumpCount = Math.ceil(fuelCapacity / fsd.getMaxFuelPerJump());
|
||||
return this;
|
||||
}
|
||||
@@ -1555,7 +1506,7 @@ export default class Ship {
|
||||
} else {
|
||||
buffer.writeInt32LE(slotMod.value, curpos);
|
||||
}
|
||||
// const modification = _.find(Modifications.modifications, function(o) { return o.id === slotMod.id; });
|
||||
const modification = _.find(Modifications.modifications, function(o) { return o.id === slotMod.id; });
|
||||
// console.log('ENCODE Slot ' + i + ': ' + modification.name + ' = ' + slotMod.value);
|
||||
curpos += 4;
|
||||
}
|
||||
@@ -1568,6 +1519,7 @@ export default class Ship {
|
||||
}
|
||||
|
||||
this.serialized.modifications = zlib.gzipSync(buffer).toString('base64');
|
||||
// console.log(this.serialized.modifications)
|
||||
} else {
|
||||
this.serialized.modifications = null;
|
||||
}
|
||||
@@ -1736,11 +1688,11 @@ export default class Ship {
|
||||
updated;
|
||||
|
||||
this.useBulkhead(0)
|
||||
.use(standard[2], fsd) // FSD
|
||||
.use(standard[3], ls) // Life Support
|
||||
.use(standard[5], s) // Sensors
|
||||
.use(standard[4], pd) // Power Distributor
|
||||
.use(standard[6], ft); // Fuel Tank
|
||||
.use(standard[2], fsd) // FSD
|
||||
.use(standard[3], ls) // Life Support
|
||||
.use(standard[5], s) // Sensors
|
||||
.use(standard[4], pd) // Power Distributor
|
||||
.use(standard[6], ft); // Fuel Tank
|
||||
|
||||
// Turn off nearly everything
|
||||
if (m.fsdDisabled) this.setSlotEnabled(this.standard[2], false);
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
import * as ModuleUtils from './ModuleUtils'
|
||||
import { canMount } from '../utils/SlotFunctions'
|
||||
import * as ModuleUtils from './ModuleUtils';
|
||||
import { canMount } from '../utils/SlotFunctions';
|
||||
|
||||
/**
|
||||
* Standard / typical role for multi-purpose or combat (if shielded with better bulkheads)
|
||||
@@ -7,20 +7,20 @@ import { canMount } from '../utils/SlotFunctions'
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
* @param {integer} bulkheadIndex Bulkhead to use see Constants.BulkheadNames
|
||||
*/
|
||||
export function multiPurpose (ship, shielded, bulkheadIndex) {
|
||||
export function multiPurpose(ship, shielded, bulkheadIndex) {
|
||||
ship.useStandard('A')
|
||||
.use(ship.standard[3], ModuleUtils.standard(3, ship.standard[3].maxClass + 'D')) // D Life Support
|
||||
.use(ship.standard[5], ModuleUtils.standard(5, ship.standard[5].maxClass + 'D')) // D Sensors
|
||||
.useBulkhead(bulkheadIndex)
|
||||
.useBulkhead(bulkheadIndex);
|
||||
|
||||
if (shielded) {
|
||||
ship.internal.some(function (slot) {
|
||||
ship.internal.some(function(slot) {
|
||||
if (canMount(ship, slot, 'sg')) { // Assuming largest slot can hold an eligible shield
|
||||
ship.use(slot, ModuleUtils.findInternal('sg', slot.maxClass, 'A'))
|
||||
ship.setSlotEnabled(slot, true)
|
||||
return true
|
||||
ship.use(slot, ModuleUtils.findInternal('sg', slot.maxClass, 'A'));
|
||||
ship.setSlotEnabled(slot, true);
|
||||
return true;
|
||||
}
|
||||
})
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -30,52 +30,51 @@ export function multiPurpose (ship, shielded, bulkheadIndex) {
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
* @param {Object} standardOpts [Optional] Standard module optional overrides
|
||||
*/
|
||||
export function trader (ship, shielded, standardOpts) {
|
||||
let usedSlots = []
|
||||
let bstCount = 2
|
||||
let sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass)
|
||||
export function trader(ship, shielded, standardOpts) {
|
||||
let usedSlots = [];
|
||||
let bstCount = 2;
|
||||
let sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
|
||||
ship.useStandard('A')
|
||||
.use(ship.standard[3], ModuleUtils.standard(3, ship.standard[3].maxClass + 'D')) // D Life Support
|
||||
.use(ship.standard[1], ModuleUtils.standard(1, ship.standard[1].maxClass + 'D')) // D Life Support
|
||||
.use(ship.standard[4], ModuleUtils.standard(4, ship.standard[4].maxClass + 'D')) // D Life Support
|
||||
.use(ship.standard[5], ModuleUtils.standard(5, ship.standard[5].maxClass + 'D')) // D Sensors
|
||||
.use(ship.standard[5], ModuleUtils.standard(5, ship.standard[5].maxClass + 'D')); // D Sensors
|
||||
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sg)
|
||||
.filter(a => a.maxClass >= sg.class)
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass))
|
||||
shieldInternals.some(function (slot) {
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
|
||||
shieldInternals.some(function(slot) {
|
||||
if (canMount(ship, slot, 'sg')) { // Assuming largest slot can hold an eligible shield
|
||||
const shield = ModuleUtils.findInternal('sg', slot.maxClass, 'A')
|
||||
const shield = ModuleUtils.findInternal('sg', slot.maxClass, 'A');
|
||||
if (shield && shield.maxmass > ship.hullMass) {
|
||||
console.log(shield)
|
||||
ship.use(slot, shield)
|
||||
ship.setSlotEnabled(slot, true)
|
||||
usedSlots.push(slot)
|
||||
return true
|
||||
ship.use(slot, shield);
|
||||
ship.setSlotEnabled(slot, true);
|
||||
usedSlots.push(slot);
|
||||
return true;
|
||||
}
|
||||
}
|
||||
})
|
||||
});
|
||||
|
||||
// Fill the empty internals with cargo racks
|
||||
for (let i = ship.internal.length; i--;) {
|
||||
let slot = ship.internal[i]
|
||||
let slot = ship.internal[i];
|
||||
if (usedSlots.indexOf(slot) == -1 && canMount(ship, slot, 'cr')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'))
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
|
||||
}
|
||||
}
|
||||
|
||||
// Empty the hardpoints
|
||||
for (let s of ship.hardpoints) {
|
||||
ship.use(s, null)
|
||||
ship.use(s, null);
|
||||
}
|
||||
for (let s of ship.hardpoints) {
|
||||
if (s.maxClass == 0 && bstCount) { // Mount up to 2 boosters
|
||||
ship.use(s, ModuleUtils.hardpoints('04'))
|
||||
bstCount--
|
||||
ship.use(s, ModuleUtils.hardpoints('04'));
|
||||
bstCount--;
|
||||
} else {
|
||||
ship.use(s, null)
|
||||
ship.use(s, null);
|
||||
}
|
||||
}
|
||||
// ship.useLightestStandard(standardOpts);
|
||||
@@ -86,127 +85,127 @@ export function trader (ship, shielded, standardOpts) {
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {Boolean} planetary True if Planetary Vehicle Hangar (PVH) should be included
|
||||
*/
|
||||
export function explorer (ship, planetary) {
|
||||
let standardOpts = {ppRating: 'A'},
|
||||
heatSinkCount = 2, // Fit 2 heat sinks if possible
|
||||
usedSlots = [],
|
||||
sgSlot,
|
||||
fuelScoopSlot,
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass)
|
||||
export function explorer(ship, planetary) {
|
||||
let standardOpts = { ppRating: 'A' },
|
||||
heatSinkCount = 2, // Fit 2 heat sinks if possible
|
||||
usedSlots = [],
|
||||
sgSlot,
|
||||
fuelScoopSlot,
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
|
||||
|
||||
if (!planetary) { // Non-planetary explorers don't really need to boost
|
||||
standardOpts.pd = '1D'
|
||||
standardOpts.pd = '1D';
|
||||
}
|
||||
|
||||
// Cargo hatch can be disabled
|
||||
ship.setSlotEnabled(ship.cargoHatch, false)
|
||||
ship.setSlotEnabled(ship.cargoHatch, false);
|
||||
|
||||
// Advanced Discovery Scanner - class 1 or higher
|
||||
const adsOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const adsOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const adsInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sc)
|
||||
.sort((a, b) => adsOrder.indexOf(a.maxClass) - adsOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => adsOrder.indexOf(a.maxClass) - adsOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < adsInternals.length; i++) {
|
||||
if (canMount(ship, adsInternals[i], 'sc')) {
|
||||
ship.use(adsInternals[i], ModuleUtils.internal('2f'))
|
||||
usedSlots.push(adsInternals[i])
|
||||
break
|
||||
ship.use(adsInternals[i], ModuleUtils.internal('2f'));
|
||||
usedSlots.push(adsInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if (planetary) {
|
||||
// Planetary Vehicle Hangar - class 2 or higher
|
||||
const pvhOrder = [2, 3, 4, 5, 6, 7, 8, 1]
|
||||
const pvhOrder = [2, 3, 4, 5, 6, 7, 8, 1];
|
||||
const pvhInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.pv)
|
||||
.sort((a, b) => pvhOrder.indexOf(a.maxClass) - pvhOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => pvhOrder.indexOf(a.maxClass) - pvhOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < pvhInternals.length; i++) {
|
||||
if (canMount(ship, pvhInternals[i], 'pv')) {
|
||||
// Planetary Vehical Hangar only has even classes
|
||||
const pvhClass = pvhInternals[i].maxClass % 2 === 1 ? pvhInternals[i].maxClass - 1 : pvhInternals[i].maxClass
|
||||
ship.use(pvhInternals[i], ModuleUtils.findInternal('pv', pvhClass, 'G')) // G is lower mass
|
||||
ship.setSlotEnabled(pvhInternals[i], false) // Disable power for Planetary Vehical Hangar
|
||||
usedSlots.push(pvhInternals[i])
|
||||
break
|
||||
const pvhClass = pvhInternals[i].maxClass % 2 === 1 ? pvhInternals[i].maxClass - 1 : pvhInternals[i].maxClass;
|
||||
ship.use(pvhInternals[i], ModuleUtils.findInternal('pv', pvhClass, 'G')); // G is lower mass
|
||||
ship.setSlotEnabled(pvhInternals[i], false); // Disable power for Planetary Vehical Hangar
|
||||
usedSlots.push(pvhInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Shield generator
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sg)
|
||||
.filter(a => a.maxClass >= sg.class)
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < shieldInternals.length; i++) {
|
||||
if (canMount(ship, shieldInternals[i], 'sg')) {
|
||||
ship.use(shieldInternals[i], sg)
|
||||
usedSlots.push(shieldInternals[i])
|
||||
sgSlot = shieldInternals[i]
|
||||
break
|
||||
ship.use(shieldInternals[i], sg);
|
||||
usedSlots.push(shieldInternals[i]);
|
||||
sgSlot = shieldInternals[i];
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Detailed Surface Scanner
|
||||
const dssOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const dssOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const dssInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sc)
|
||||
.sort((a, b) => dssOrder.indexOf(a.maxClass) - dssOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => dssOrder.indexOf(a.maxClass) - dssOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < dssInternals.length; i++) {
|
||||
if (canMount(ship, dssInternals[i], 'sc')) {
|
||||
ship.use(dssInternals[i], ModuleUtils.internal('2i'))
|
||||
usedSlots.push(dssInternals[i])
|
||||
break
|
||||
ship.use(dssInternals[i], ModuleUtils.internal('2i'));
|
||||
usedSlots.push(dssInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Fuel scoop - best possible
|
||||
const fuelScoopOrder = [8, 7, 6, 5, 4, 3, 2, 1]
|
||||
const fuelScoopOrder = [8, 7, 6, 5, 4, 3, 2, 1];
|
||||
const fuelScoopInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.fs)
|
||||
.sort((a, b) => fuelScoopOrder.indexOf(a.maxClass) - fuelScoopOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => fuelScoopOrder.indexOf(a.maxClass) - fuelScoopOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < fuelScoopInternals.length; i++) {
|
||||
if (canMount(ship, fuelScoopInternals[i], 'fs')) {
|
||||
ship.use(fuelScoopInternals[i], ModuleUtils.findInternal('fs', fuelScoopInternals[i].maxClass, 'A'))
|
||||
usedSlots.push(fuelScoopInternals[i])
|
||||
fuelScoopSlot = fuelScoopInternals[i]
|
||||
break
|
||||
ship.use(fuelScoopInternals[i], ModuleUtils.findInternal('fs', fuelScoopInternals[i].maxClass, 'A'));
|
||||
usedSlots.push(fuelScoopInternals[i]);
|
||||
fuelScoopSlot = fuelScoopInternals[i];
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// AFMUs - fill as they are 0-weight
|
||||
const afmuOrder = [8, 7, 6, 5, 4, 3, 2, 1]
|
||||
const afmuOrder = [8, 7, 6, 5, 4, 3, 2, 1];
|
||||
const afmuInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.pc)
|
||||
.sort((a, b) => afmuOrder.indexOf(a.maxClass) - afmuOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => afmuOrder.indexOf(a.maxClass) - afmuOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < afmuInternals.length; i++) {
|
||||
if (canMount(ship, afmuInternals[i], 'am')) {
|
||||
ship.use(afmuInternals[i], ModuleUtils.findInternal('am', afmuInternals[i].maxClass, 'A'))
|
||||
usedSlots.push(afmuInternals[i])
|
||||
ship.setSlotEnabled(afmuInternals[i], false) // Disable power for AFM Unit
|
||||
ship.use(afmuInternals[i], ModuleUtils.findInternal('am', afmuInternals[i].maxClass, 'A'));
|
||||
usedSlots.push(afmuInternals[i]);
|
||||
ship.setSlotEnabled(afmuInternals[i], false); // Disable power for AFM Unit
|
||||
}
|
||||
}
|
||||
|
||||
for (let s of ship.hardpoints) {
|
||||
if (s.maxClass == 0 && heatSinkCount) { // Mount up to 2 heatsinks
|
||||
ship.use(s, ModuleUtils.hardpoints('02'))
|
||||
ship.setSlotEnabled(s, heatSinkCount == 2) // Only enable a single Heatsink
|
||||
heatSinkCount--
|
||||
ship.use(s, ModuleUtils.hardpoints('02'));
|
||||
ship.setSlotEnabled(s, heatSinkCount == 2); // Only enable a single Heatsink
|
||||
heatSinkCount--;
|
||||
} else {
|
||||
ship.use(s, null)
|
||||
ship.use(s, null);
|
||||
}
|
||||
}
|
||||
|
||||
if (sgSlot && fuelScoopSlot) {
|
||||
// The SG and Fuel scoop to not need to be powered at the same time
|
||||
if (sgSlot.m.getPowerUsage() > fuelScoopSlot.m.getPowerUsage()) { // The Shield generator uses the most power
|
||||
ship.setSlotEnabled(fuelScoopSlot, false)
|
||||
ship.setSlotEnabled(fuelScoopSlot, false);
|
||||
} else { // The Fuel scoop uses the most power
|
||||
ship.setSlotEnabled(sgSlot, false)
|
||||
ship.setSlotEnabled(sgSlot, false);
|
||||
}
|
||||
}
|
||||
|
||||
ship.useLightestStandard(standardOpts)
|
||||
ship.useLightestStandard(standardOpts);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -214,188 +213,188 @@ export function explorer (ship, planetary) {
|
||||
* @param {Ship} ship Ship instance
|
||||
* @param {Boolean} shielded True if shield generator should be included
|
||||
*/
|
||||
export function miner (ship, shielded) {
|
||||
shielded = true
|
||||
let standardOpts = {ppRating: 'A'},
|
||||
miningLaserCount = 2,
|
||||
usedSlots = [],
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass)
|
||||
export function miner(ship, shielded) {
|
||||
shielded = true;
|
||||
let standardOpts = { ppRating: 'A' },
|
||||
miningLaserCount = 2,
|
||||
usedSlots = [],
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
|
||||
|
||||
// Cargo hatch should be enabled
|
||||
ship.setSlotEnabled(ship.cargoHatch, true)
|
||||
ship.setSlotEnabled(ship.cargoHatch, true);
|
||||
|
||||
// Largest possible refinery
|
||||
const refineryOrder = [4, 5, 6, 7, 8, 3, 2, 1]
|
||||
const refineryOrder = [4, 5, 6, 7, 8, 3, 2, 1];
|
||||
const refineryInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.rf)
|
||||
.sort((a, b) => refineryOrder.indexOf(a.maxClass) - refineryOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => refineryOrder.indexOf(a.maxClass) - refineryOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < refineryInternals.length; i++) {
|
||||
if (canMount(ship, refineryInternals[i], 'rf')) {
|
||||
ship.use(refineryInternals[i], ModuleUtils.findInternal('rf', Math.min(refineryInternals[i].maxClass, 4), 'A'))
|
||||
usedSlots.push(refineryInternals[i])
|
||||
break
|
||||
ship.use(refineryInternals[i], ModuleUtils.findInternal('rf', Math.min(refineryInternals[i].maxClass, 4), 'A'));
|
||||
usedSlots.push(refineryInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Prospector limpet controller - 3A if possible
|
||||
const prospectorOrder = [3, 4, 5, 6, 7, 8, 2, 1]
|
||||
const prospectorOrder = [3, 4, 5, 6, 7, 8, 2, 1];
|
||||
const prospectorInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.pc)
|
||||
.sort((a, b) => prospectorOrder.indexOf(a.maxClass) - prospectorOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => prospectorOrder.indexOf(a.maxClass) - prospectorOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < prospectorInternals.length; i++) {
|
||||
if (canMount(ship, prospectorInternals[i], 'pc')) {
|
||||
// Prospector only has odd classes
|
||||
const prospectorClass = prospectorInternals[i].maxClass % 2 === 0 ? prospectorInternals[i].maxClass - 1 : prospectorInternals[i].maxClass
|
||||
ship.use(prospectorInternals[i], ModuleUtils.findInternal('pc', prospectorClass, 'A'))
|
||||
usedSlots.push(prospectorInternals[i])
|
||||
break
|
||||
const prospectorClass = prospectorInternals[i].maxClass % 2 === 0 ? prospectorInternals[i].maxClass - 1 : prospectorInternals[i].maxClass;
|
||||
ship.use(prospectorInternals[i], ModuleUtils.findInternal('pc', prospectorClass, 'A'));
|
||||
usedSlots.push(prospectorInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Shield generator if required
|
||||
if (shielded) {
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sg)
|
||||
.filter(a => a.maxClass >= sg.class)
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < shieldInternals.length; i++) {
|
||||
if (canMount(ship, shieldInternals[i], 'sg')) {
|
||||
ship.use(shieldInternals[i], sg)
|
||||
usedSlots.push(shieldInternals[i])
|
||||
break
|
||||
ship.use(shieldInternals[i], sg);
|
||||
usedSlots.push(shieldInternals[i]);
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Dual mining lasers of highest possible class; remove anything else
|
||||
const miningLaserOrder = [2, 3, 4, 1, 0]
|
||||
const miningLaserHardpoints = ship.hardpoints.concat().sort(function (a, b) {
|
||||
return miningLaserOrder.indexOf(a.maxClass) - miningLaserOrder.indexOf(b.maxClass)
|
||||
})
|
||||
const miningLaserOrder = [2, 3, 4, 1, 0];
|
||||
const miningLaserHardpoints = ship.hardpoints.concat().sort(function(a, b) {
|
||||
return miningLaserOrder.indexOf(a.maxClass) - miningLaserOrder.indexOf(b.maxClass);
|
||||
});
|
||||
for (let s of miningLaserHardpoints) {
|
||||
if (s.maxClass >= 1 && miningLaserCount) {
|
||||
ship.use(s, ModuleUtils.hardpoints(s.maxClass >= 2 ? '2m' : '2l'))
|
||||
miningLaserCount--
|
||||
ship.use(s, ModuleUtils.hardpoints(s.maxClass >= 2 ? '2m' : '2l'));
|
||||
miningLaserCount--;
|
||||
} else {
|
||||
ship.use(s, null)
|
||||
ship.use(s, null);
|
||||
}
|
||||
}
|
||||
|
||||
// Number of collector limpets required to be active is a function of the size of the ship and the power of the lasers
|
||||
const miningLaserDps = ship.hardpoints.filter(h => h.m != null)
|
||||
.reduce(function (a, b) {
|
||||
return a + b.m.getDps()
|
||||
}, 0)
|
||||
.reduce(function(a, b) {
|
||||
return a + b.m.getDps();
|
||||
}, 0);
|
||||
// Find out how many internal slots we have, and their potential cargo size
|
||||
const potentialCargo = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.cr)
|
||||
.map(b => Math.pow(2, b.maxClass))
|
||||
.map(b => Math.pow(2, b.maxClass));
|
||||
// One collector for each 1.25 DPS, multiply by 1.25 for medium ships and 1.5 for large ships as they have further to travel
|
||||
// 0 if we only have 1 cargo slot, otherwise minium of 1 and maximum of 6 (excluding size modifier)
|
||||
const sizeModifier = ship.class == 2 ? 1.2 : ship.class == 3 ? 1.5 : 1
|
||||
let collectorLimpetsRequired = potentialCargo.length == 1 ? 0 : Math.ceil(sizeModifier * Math.min(6, Math.floor(miningLaserDps / 1.25)))
|
||||
const sizeModifier = ship.class == 2 ? 1.2 : ship.class == 3 ? 1.5 : 1;
|
||||
let collectorLimpetsRequired = potentialCargo.length == 1 ? 0 : Math.ceil(sizeModifier * Math.min(6, Math.floor(miningLaserDps / 1.25)));
|
||||
|
||||
if (collectorLimpetsRequired > 0) {
|
||||
const collectorOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const collectorOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const collectorInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.cc)
|
||||
.sort((a, b) => collectorOrder.indexOf(a.maxClass) - collectorOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => collectorOrder.indexOf(a.maxClass) - collectorOrder.indexOf(b.maxClass));
|
||||
// Always keep at least 2 slots free for cargo racks (1 for shielded)
|
||||
for (let i = 0; i < collectorInternals.length - (shielded ? 1 : 2) && collectorLimpetsRequired > 0; i++) {
|
||||
if (canMount(ship, collectorInternals[i], 'cc')) {
|
||||
// Collector only has odd classes
|
||||
const collectorClass = collectorInternals[i].maxClass % 2 === 0 ? collectorInternals[i].maxClass - 1 : collectorInternals[i].maxClass
|
||||
ship.use(collectorInternals[i], ModuleUtils.findInternal('cc', collectorClass, 'D'))
|
||||
usedSlots.push(collectorInternals[i])
|
||||
collectorLimpetsRequired -= collectorInternals[i].m.maximum
|
||||
const collectorClass = collectorInternals[i].maxClass % 2 === 0 ? collectorInternals[i].maxClass - 1 : collectorInternals[i].maxClass;
|
||||
ship.use(collectorInternals[i], ModuleUtils.findInternal('cc', collectorClass, 'D'));
|
||||
usedSlots.push(collectorInternals[i]);
|
||||
collectorLimpetsRequired -= collectorInternals[i].m.maximum;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Power distributor to power the mining lasers indefinitely
|
||||
const wepRateRequired = ship.hardpoints.filter(h => h.m != null)
|
||||
.reduce(function (a, b) {
|
||||
return a + b.m.getEps()
|
||||
}, 0)
|
||||
standardOpts.pd = ship.getAvailableModules().matchingPowerDist({weprate: wepRateRequired}).id
|
||||
.reduce(function(a, b) {
|
||||
return a + b.m.getEps();
|
||||
}, 0);
|
||||
standardOpts.pd = ship.getAvailableModules().matchingPowerDist({ weprate: wepRateRequired }).id;
|
||||
|
||||
// Fill the empty internals with cargo racks
|
||||
for (let i = ship.internal.length; i--;) {
|
||||
let slot = ship.internal[i]
|
||||
let slot = ship.internal[i];
|
||||
if (usedSlots.indexOf(slot) == -1 && canMount(ship, slot, 'cr')) {
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'))
|
||||
ship.use(slot, ModuleUtils.findInternal('cr', slot.maxClass, 'E'));
|
||||
}
|
||||
}
|
||||
|
||||
ship.useLightestStandard(standardOpts)
|
||||
ship.useLightestStandard(standardOpts);
|
||||
}
|
||||
|
||||
/**
|
||||
* Racer Role
|
||||
* @param {Ship} ship Ship instance
|
||||
*/
|
||||
export function racer (ship) {
|
||||
export function racer(ship) {
|
||||
let standardOpts = {},
|
||||
usedSlots = [],
|
||||
sgSlot,
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass)
|
||||
usedSlots = [],
|
||||
sgSlot,
|
||||
sg = ship.getAvailableModules().lightestShieldGenerator(ship.hullMass);
|
||||
|
||||
// Cargo hatch can be disabled
|
||||
ship.setSlotEnabled(ship.cargoHatch, false)
|
||||
ship.setSlotEnabled(ship.cargoHatch, false);
|
||||
|
||||
// Shield generator
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8]
|
||||
const shieldOrder = [1, 2, 3, 4, 5, 6, 7, 8];
|
||||
const shieldInternals = ship.internal.filter(a => usedSlots.indexOf(a) == -1)
|
||||
.filter(a => (!a.eligible) || a.eligible.sg)
|
||||
.filter(a => a.maxClass >= sg.class)
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass))
|
||||
.sort((a, b) => shieldOrder.indexOf(a.maxClass) - shieldOrder.indexOf(b.maxClass));
|
||||
for (let i = 0; i < shieldInternals.length; i++) {
|
||||
if (canMount(ship, shieldInternals[i], 'sg')) {
|
||||
ship.use(shieldInternals[i], sg)
|
||||
usedSlots.push(shieldInternals[i])
|
||||
sgSlot = shieldInternals[i]
|
||||
break
|
||||
ship.use(shieldInternals[i], sg);
|
||||
usedSlots.push(shieldInternals[i]);
|
||||
sgSlot = shieldInternals[i];
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Empty the hardpoints
|
||||
for (let s of ship.hardpoints) {
|
||||
ship.use(s, null)
|
||||
ship.use(s, null);
|
||||
}
|
||||
|
||||
// Empty the internals
|
||||
for (let i = ship.internal.length; i--;) {
|
||||
let slot = ship.internal[i]
|
||||
let slot = ship.internal[i];
|
||||
if (usedSlots.indexOf(slot) == -1) {
|
||||
ship.use(slot, null)
|
||||
ship.use(slot, null);
|
||||
}
|
||||
}
|
||||
|
||||
// Best thrusters
|
||||
if (ship.standard[1].maxClass === 3) {
|
||||
standardOpts.th = 'tz'
|
||||
standardOpts.th = 'tz';
|
||||
} else if (ship.standard[1].maxClass === 2) {
|
||||
standardOpts.th = 'u0'
|
||||
standardOpts.th = 'u0';
|
||||
} else {
|
||||
standardOpts.th = ship.standard[1].maxClass + 'A'
|
||||
standardOpts.th = ship.standard[1].maxClass + 'A';
|
||||
}
|
||||
|
||||
// Best power distributor for more boosting
|
||||
standardOpts.pd = ship.standard[4].maxClass + 'A'
|
||||
standardOpts.pd = ship.standard[4].maxClass + 'A';
|
||||
|
||||
// Smallest possible FSD drive
|
||||
standardOpts.fsd = '2D'
|
||||
standardOpts.fsd = '2D';
|
||||
// Minimal fuel tank
|
||||
standardOpts.ft = '1C'
|
||||
standardOpts.ft = '1C';
|
||||
|
||||
// Disable nearly everything
|
||||
standardOpts.fsdDisabled = true
|
||||
standardOpts.sDisabled = true
|
||||
standardOpts.pdDisabled = true
|
||||
standardOpts.lsDisabled = true
|
||||
standardOpts.fsdDisabled = true;
|
||||
standardOpts.sDisabled = true;
|
||||
standardOpts.pdDisabled = true;
|
||||
standardOpts.lsDisabled = true;
|
||||
|
||||
ship.useLightestStandard(standardOpts)
|
||||
ship.useLightestStandard(standardOpts);
|
||||
|
||||
// Apply engineering to each module
|
||||
// ship.standard[1].m.blueprint = getBlueprint('Engine_Dirty', ship.standard[0]);
|
||||
@@ -414,4 +413,3 @@ export function racer (ship) {
|
||||
// ship.standard[5].m.blueprint.grade = 5;
|
||||
// setBest(ship, ship.standard[5].m);
|
||||
}
|
||||
|
||||
|
||||
83
src/app/shipyard/StatsFormatting.js
Normal file
83
src/app/shipyard/StatsFormatting.js
Normal file
@@ -0,0 +1,83 @@
|
||||
export const SI_PREFIXES = {
|
||||
'Y': 1e+24, // Yotta
|
||||
'Z': 1e+21, // Zetta
|
||||
'E': 1e+18, // Peta
|
||||
'P': 1e+15, // Peta
|
||||
'T': 1e+12, // Tera
|
||||
'G': 1e+9, // Giga
|
||||
'M': 1e+6, // Mega
|
||||
'k': 1e+3, // Kilo
|
||||
'h': 1e+2, // Hekto
|
||||
'da': 1e+1, // Deka
|
||||
'': 1,
|
||||
'd': 1e-1, // Dezi
|
||||
'c': 1e-2, // Zenti
|
||||
'm': 1e-3, // Milli
|
||||
'μ': 1e-6, // mikro not supported due to charset
|
||||
'n': 10e-9, // Nano
|
||||
'p': 1e-12, // Nano
|
||||
'f': 1e-15, // Femto
|
||||
'a': 1e-18, // Atto
|
||||
'z': 1e-21, // Zepto
|
||||
'y': 1e-24 // Yokto
|
||||
};
|
||||
|
||||
export const STATS_FORMATTING = {
|
||||
'ammo': { 'format': 'int', },
|
||||
'boot': { 'format': 'int', 'unit': 'secs' },
|
||||
'brokenregen': { 'format': 'round1', 'unit': 'ps' },
|
||||
'burst': { 'format': 'int', 'change': 'additive' },
|
||||
'burstrof': { 'format': 'round1', 'unit': 'ps', 'change': 'additive' },
|
||||
'causres': { 'format': 'pct' },
|
||||
'clip': { 'format': 'int' },
|
||||
'damage': { 'format': 'round' },
|
||||
'dps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getDps' },
|
||||
'dpe': { 'format': 'round', 'units': 'ps', 'synthetic': 'getDpe' },
|
||||
'distdraw': { 'format': 'round', 'unit': 'MW' },
|
||||
'duration': { 'format': 'round1', 'unit': 's' },
|
||||
'eff': { 'format': 'round2' },
|
||||
'engcap': { 'format': 'round1', 'unit': 'MJ' },
|
||||
'engrate': { 'format': 'round1', 'unit': 'MW' },
|
||||
'eps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getEps' },
|
||||
'explres': { 'format': 'pct' },
|
||||
'facinglimit': { 'format': 'round1', 'unit': 'ang' },
|
||||
'falloff': { 'format': 'round', 'unit': 'km', 'storedUnit': 'm' },
|
||||
'fallofffromrange': { 'format': 'round', 'unit': 'km', 'storedUnit': 'm', 'synthetic': 'getFalloff' },
|
||||
'hps': { 'format': 'round', 'units': 'ps', 'synthetic': 'getHps' },
|
||||
'hullboost': { 'format': 'pct1', 'change': 'additive' },
|
||||
'hullreinforcement': { 'format': 'int' },
|
||||
'integrity': { 'format': 'round1' },
|
||||
'jitter': { 'format': 'round', 'unit': 'ang' },
|
||||
'kinres': { 'format': 'pct' },
|
||||
'mass': { 'format': 'round1', 'unit': 'T' },
|
||||
'maxfuel': { 'format': 'round1', 'unit': 'T' },
|
||||
'optmass': { 'format': 'int', 'unit': 'T' },
|
||||
'optmul': { 'format': 'pct', 'change': 'additive' },
|
||||
'pgen': { 'format': 'round1', 'unit': 'MW' },
|
||||
'piercing': { 'format': 'int' },
|
||||
'power': { 'format': 'round', 'unit': 'MW' },
|
||||
'protection': { 'format': 'pct' },
|
||||
'range': { 'format': 'f2', 'unit': 'km', 'storedUnit': 'm' },
|
||||
'ranget': { 'format': 'f1', 'unit': 's' },
|
||||
'regen': { 'format': 'round1', 'unit': 'ps' },
|
||||
'reload': { 'format': 'int', 'unit': 's' },
|
||||
'rof': { 'format': 'round1', 'unit': 'ps', 'synthetic': 'getRoF', 'higherbetter': true },
|
||||
'angle': { 'format': 'round1', 'unit': 'ang' },
|
||||
'scanrate': { 'format': 'int' },
|
||||
'scantime': { 'format': 'round1', 'unit': 's' },
|
||||
'sdps': { 'format': 'round1', 'units': 'ps', 'synthetic': 'getSDps' },
|
||||
'shield': { 'format': 'int', 'unit': 'MJ' },
|
||||
'shieldaddition': { 'format': 'round1', 'unit': 'MJ' },
|
||||
'shieldboost': { 'format': 'pct1', 'change': 'additive' },
|
||||
'shieldreinforcement': { 'format': 'round1', 'unit': 'MJ' },
|
||||
'shotspeed': { 'format': 'int', 'unit': 'm/s' },
|
||||
'spinup': { 'format': 'round1', 'unit': 's' },
|
||||
'syscap': { 'format': 'round1', 'unit': 'MJ' },
|
||||
'sysrate': { 'format': 'round1', 'unit': 'MW' },
|
||||
'thermload': { 'format': 'round1' },
|
||||
'thermres': { 'format': 'pct' },
|
||||
'wepcap': { 'format': 'round1', 'unit': 'MJ' },
|
||||
'weprate': { 'format': 'round1', 'unit': 'MW' },
|
||||
'jumpboost': { 'format': 'round1', 'unit': 'LY' },
|
||||
'proberadius': { 'format': 'pct1', 'unit': 'pct' },
|
||||
};
|
||||
33
src/app/shipyard/StatsMapping.js
Normal file
33
src/app/shipyard/StatsMapping.js
Normal file
@@ -0,0 +1,33 @@
|
||||
import { Module } from 'ed-forge';
|
||||
|
||||
/**
|
||||
* Sets a resistance value of a module as
|
||||
* @param {Module} module Module to set the property
|
||||
* @param {string} prop Property name; must end with 'resistance'
|
||||
* @param {number} val Resistance value to set
|
||||
*/
|
||||
function setterResToEff(module, prop, val) {
|
||||
module.set(
|
||||
prop.replace('resistance', 'effectiveness'),
|
||||
1 - val / 100,
|
||||
);
|
||||
}
|
||||
|
||||
export const SHOW = {
|
||||
causticeffectiveness: {
|
||||
as: 'causticresistance',
|
||||
setter: setterResToEff,
|
||||
},
|
||||
explosiveeffectiveness: {
|
||||
as: 'explosiveresistance',
|
||||
setter: setterResToEff,
|
||||
},
|
||||
kineticeffectiveness: {
|
||||
as: 'kineticresistance',
|
||||
setter: setterResToEff,
|
||||
},
|
||||
thermiceffectiveness: {
|
||||
as: 'thermicresistance',
|
||||
setter: setterResToEff,
|
||||
},
|
||||
};
|
||||
@@ -5,6 +5,7 @@ const LS_KEY_BUILDS = 'builds';
|
||||
const LS_KEY_COMPARISONS = 'comparisons';
|
||||
const LS_KEY_LANG = 'NG_TRANSLATE_LANG_KEY';
|
||||
const LS_KEY_COST_TAB = 'costTab';
|
||||
const LS_KEY_CMDR_NAME = 'cmdrName';
|
||||
const LS_KEY_OUTFITTING_TAB = 'outfittingTab';
|
||||
const LS_KEY_INSURANCE = 'insurance';
|
||||
const LS_KEY_SHIP_DISCOUNT = 'shipDiscount';
|
||||
@@ -13,6 +14,8 @@ const LS_KEY_STATE = 'state';
|
||||
const LS_KEY_SIZE_RATIO = 'sizeRatio';
|
||||
const LS_KEY_TOOLTIPS = 'tooltips';
|
||||
const LS_KEY_MODULE_RESISTANCES = 'moduleResistances';
|
||||
const LS_KEY_ROLLS = 'matsPerGrade';
|
||||
const LS_KEY_ORBIS = 'orbis';
|
||||
|
||||
let LS;
|
||||
|
||||
@@ -67,7 +70,6 @@ function _delete(key) {
|
||||
* export is an instance (see end of this file).
|
||||
*/
|
||||
export class Persist extends EventEmitter {
|
||||
|
||||
/**
|
||||
* Create an instance
|
||||
*/
|
||||
@@ -84,6 +86,8 @@ export class Persist extends EventEmitter {
|
||||
}
|
||||
|
||||
let moduleResistances = _get(LS_KEY_MODULE_RESISTANCES);
|
||||
let matsPerGrade = _get(LS_KEY_ROLLS);
|
||||
let cmdrName = _get(LS_KEY_CMDR_NAME);
|
||||
let tips = _get(LS_KEY_TOOLTIPS);
|
||||
let insurance = _getString(LS_KEY_INSURANCE);
|
||||
let shipDiscount = _get(LS_KEY_SHIP_DISCOUNT);
|
||||
@@ -91,6 +95,7 @@ export class Persist extends EventEmitter {
|
||||
let buildJson = _get(LS_KEY_BUILDS);
|
||||
let comparisonJson = _get(LS_KEY_COMPARISONS);
|
||||
|
||||
this.orbisCreds = _get(LS_KEY_ORBIS) || { email: '', password: '' };
|
||||
this.onStorageChange = this.onStorageChange.bind(this);
|
||||
this.langCode = _getString(LS_KEY_LANG) || 'en';
|
||||
this.insurance = insurance && Insurance[insurance.toLowerCase()] !== undefined ? insurance : 'standard';
|
||||
@@ -102,6 +107,14 @@ export class Persist extends EventEmitter {
|
||||
this.outfittingTab = _getString(LS_KEY_OUTFITTING_TAB);
|
||||
this.state = _get(LS_KEY_STATE);
|
||||
this.sizeRatio = _get(LS_KEY_SIZE_RATIO) || 1;
|
||||
this.matsPerGrade = matsPerGrade || {
|
||||
1: 2,
|
||||
2: 2,
|
||||
3: 4,
|
||||
4: 4,
|
||||
5: 10
|
||||
};
|
||||
this.cmdrName = cmdrName || { selected: '', cmdrs: [] };
|
||||
this.tooltipsEnabled = tips === null ? true : tips;
|
||||
this.moduleResistancesEnabled = moduleResistances === null ? true : moduleResistances;
|
||||
|
||||
@@ -152,6 +165,14 @@ export class Persist extends EventEmitter {
|
||||
this.moduleResistancesEnabled = !!newValue && newValue.toLowerCase() == 'true';
|
||||
this.emit('moduleresistances', this.moduleResistancesEnabled);
|
||||
break;
|
||||
case LS_KEY_ROLLS:
|
||||
this.matsPerGrade = JSON.parse(newValue);
|
||||
this.emit('matsPerGrade', this.matsPerGrade);
|
||||
break;
|
||||
case LS_KEY_ORBIS:
|
||||
this.orbisCreds = JSON.parse(newValue);
|
||||
this.emit('orbis', this.orbisCreds);
|
||||
break;
|
||||
}
|
||||
} catch (e) {
|
||||
// On JSON.Parse Error - don't sync or do anything
|
||||
@@ -177,6 +198,24 @@ export class Persist extends EventEmitter {
|
||||
this.emit('language', langCode);
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the current orbis.zone credentials
|
||||
* @return {String} language code
|
||||
*/
|
||||
getOrbisCreds() {
|
||||
return this.orbisCreds;
|
||||
};
|
||||
|
||||
/**
|
||||
* Update and save the orbis.zone credentials
|
||||
* @param {Object} creds object with username and password properties.
|
||||
*/
|
||||
setOrbisCreds(creds) {
|
||||
this.langCode = creds;
|
||||
_put(LS_KEY_ORBIS, creds);
|
||||
this.emit('orbis', creds);
|
||||
}
|
||||
|
||||
/**
|
||||
* Show tooltips setting
|
||||
* @param {boolean} show Optional - update setting
|
||||
@@ -457,6 +496,31 @@ export class Persist extends EventEmitter {
|
||||
return this.moduleDiscount;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the saved ship discount
|
||||
* @param {Object} matsPerGrade # of rolls per grade
|
||||
*/
|
||||
setRolls(matsPerGrade) {
|
||||
this.matsPerGrade = matsPerGrade;
|
||||
_put(LS_KEY_ROLLS, this.matsPerGrade);
|
||||
this.emit('matsPerGrade');
|
||||
}
|
||||
/**
|
||||
* Get the saved Mats per grade
|
||||
* @return {Object} # of rolls per grade
|
||||
*/
|
||||
getRolls() {
|
||||
return this.matsPerGrade;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the saved Mats per grade
|
||||
* @return {Object} # of rolls per grade
|
||||
*/
|
||||
getCmdr() {
|
||||
return this.cmdrName;
|
||||
}
|
||||
|
||||
/**
|
||||
* Persist selected cost tab
|
||||
* @param {number} tabName Cost tab name
|
||||
@@ -466,6 +530,16 @@ export class Persist extends EventEmitter {
|
||||
_put(LS_KEY_COST_TAB, tabName);
|
||||
}
|
||||
|
||||
/**
|
||||
* Persist cmdr name
|
||||
* @param {Object} cmdrName Commander name for EDEngineer
|
||||
*/
|
||||
setCmdr(cmdrName) {
|
||||
this.cmdrName = cmdrName;
|
||||
_put(LS_KEY_CMDR_NAME, cmdrName);
|
||||
this.emit('cmdr');
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the saved discount
|
||||
* @return {number} val Discount value/amount
|
||||
|
||||
@@ -1,61 +1,43 @@
|
||||
import React from 'react';
|
||||
import { Modifications } from 'coriolis-data/dist';
|
||||
import { Module } from 'ed-forge';
|
||||
import { getBlueprintInfo, getExperimentalInfo } from 'ed-forge/lib/data/blueprints';
|
||||
import { entries, keys, uniq } from 'lodash';
|
||||
|
||||
/**
|
||||
* Generate a tooltip with details of a blueprint's specials
|
||||
* @param {Object} translate The translate object
|
||||
* @param {Object} blueprint The blueprint at the required grade
|
||||
* @param {string} grp The group of the module
|
||||
* @param {Object} m The module to compare with
|
||||
* @param specialName
|
||||
* @param {Object} language The translate object
|
||||
* @param {Module} m The module to compare with
|
||||
* @param {string} specialName The name of the special
|
||||
* @returns {Object} The react components
|
||||
*/
|
||||
export function specialToolTip(translate, blueprint, grp, m, specialName) {
|
||||
const effects = [];
|
||||
if (!blueprint || !blueprint.features) {
|
||||
return undefined;
|
||||
}
|
||||
if (m) {
|
||||
// We also add in any benefits from specials that aren't covered above
|
||||
if (m.blueprint) {
|
||||
for (const feature in Modifications.modifierActions[specialName]) {
|
||||
// if (!blueprint.features[feature] && !m.mods.feature) {
|
||||
const featureDef = Modifications.modifications[feature];
|
||||
if (featureDef && !featureDef.hidden) {
|
||||
let symbol = '';
|
||||
if (feature === 'jitter') {
|
||||
symbol = '°';
|
||||
} else if (featureDef.type === 'percentage') {
|
||||
symbol = '%';
|
||||
}
|
||||
let current = m.getModValue(feature) - m.getModValue(feature, true);
|
||||
if (featureDef.type === 'percentage') {
|
||||
current = Math.round(current / 10) / 10;
|
||||
} else if (featureDef.type === 'numeric') {
|
||||
current /= 100;
|
||||
}
|
||||
const currentIsBeneficial = isValueBeneficial(feature, current);
|
||||
|
||||
effects.push(
|
||||
<tr key={feature + '_specialTT'}>
|
||||
<td style={{textAlign: 'left'}}>{translate(feature, grp)}</td>
|
||||
<td> </td>
|
||||
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'}
|
||||
style={{textAlign: 'right'}}>{current}{symbol}</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
export function specialToolTip(language, m, specialName) {
|
||||
const { formats, translate } = language;
|
||||
return (
|
||||
<div>
|
||||
<table width='100%'>
|
||||
<tbody>
|
||||
{effects}
|
||||
{entries(getExperimentalInfo(specialName).features).map(
|
||||
([prop, feats]) => {
|
||||
const { max, only } = feats;
|
||||
if (only && !m.getItem().match(only)) {
|
||||
return null;
|
||||
}
|
||||
|
||||
const { value, unit, beneficial } = m.getModifierFormatted(prop);
|
||||
// If the product of value and min/max is positive, both values
|
||||
// point into the same direction, i.e. positive/negative.
|
||||
const specialBeneficial = (value * max) > 0 === beneficial;
|
||||
|
||||
return <tr key={prop + '_specialTT'}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
|
||||
<td> </td>
|
||||
<td className={specialBeneficial ? 'secondary' : 'warning'}
|
||||
style={{ textAlign: 'right' }}>{formats.round(max * 100)}{unit}</td>
|
||||
<td> </td>
|
||||
</tr>;
|
||||
}
|
||||
)}
|
||||
</tbody>
|
||||
</table>
|
||||
</div>
|
||||
@@ -63,224 +45,70 @@ export function specialToolTip(translate, blueprint, grp, m, specialName) {
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate a tooltip with details of a blueprint's effects
|
||||
* @param {Object} translate The translate object
|
||||
* @param {Object} blueprint The blueprint at the required grade
|
||||
* @param {Array} engineers The engineers supplying this blueprint
|
||||
* @param {string} grp The group of the module
|
||||
* @param {Object} m The module to compare with
|
||||
* @returns {Object} The react components
|
||||
* Generate a tooltip with details and preview of a blueprint's effects
|
||||
* @param {Object} language The language object
|
||||
* @param {Module} m The module to compare with
|
||||
* @param {string} previewBP Blueprint to preview
|
||||
* @param {number} previewGrade Grade to preview
|
||||
* @returns {Object} The react components
|
||||
*/
|
||||
export function blueprintTooltip(translate, blueprint, engineers, grp, m) {
|
||||
const effects = [];
|
||||
if (!blueprint || !blueprint.features) {
|
||||
return undefined;
|
||||
}
|
||||
for (const feature in blueprint.features) {
|
||||
const featureIsBeneficial = isBeneficial(feature, blueprint.features[feature]);
|
||||
const featureDef = Modifications.modifications[feature];
|
||||
if (!featureDef.hidden) {
|
||||
let symbol = '';
|
||||
if (feature === 'jitter') {
|
||||
symbol = '°';
|
||||
} else if (featureDef.type === 'percentage') {
|
||||
symbol = '%';
|
||||
}
|
||||
let lowerBound = blueprint.features[feature][0];
|
||||
let upperBound = blueprint.features[feature][1];
|
||||
if (featureDef.type === 'percentage') {
|
||||
lowerBound = Math.round(lowerBound * 1000) / 10;
|
||||
upperBound = Math.round(upperBound * 1000) / 10;
|
||||
}
|
||||
const lowerIsBeneficial = isValueBeneficial(feature, lowerBound);
|
||||
const upperIsBeneficial = isValueBeneficial(feature, upperBound);
|
||||
if (m) {
|
||||
// We have a module - add in the current value
|
||||
let current = m.getModValue(feature);
|
||||
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
|
||||
current = Math.round(current / 10) / 10;
|
||||
} else if (featureDef.type === 'numeric') {
|
||||
current /= 100;
|
||||
}
|
||||
const currentIsBeneficial = isValueBeneficial(feature, current);
|
||||
effects.push(
|
||||
<tr key={feature}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
|
||||
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
|
||||
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
|
||||
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
|
||||
</tr>
|
||||
);
|
||||
} else {
|
||||
// We do not have a module, no value
|
||||
effects.push(
|
||||
<tr key={feature}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
|
||||
<td className={lowerBound === 0 ? '' : lowerIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{lowerBound}{symbol}</td>
|
||||
<td className={upperBound === 0 ? '' : upperIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{upperBound}{symbol}</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (m) {
|
||||
// Because we have a module add in any benefits that aren't part of the primary blueprint
|
||||
for (const feature in m.mods) {
|
||||
if (!blueprint.features[feature]) {
|
||||
const featureDef = Modifications.modifications[feature];
|
||||
if (featureDef && !featureDef.hidden) {
|
||||
let symbol = '';
|
||||
if (feature === 'jitter') {
|
||||
symbol = '°';
|
||||
} else if (featureDef.type === 'percentage') {
|
||||
symbol = '%';
|
||||
}
|
||||
let current = m.getModValue(feature);
|
||||
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
|
||||
current = Math.round(current / 10) / 10;
|
||||
} else if (featureDef.type === 'numeric') {
|
||||
current /= 100;
|
||||
}
|
||||
const currentIsBeneficial = isValueBeneficial(feature, current);
|
||||
effects.push(
|
||||
<tr key={feature}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
|
||||
<td> </td>
|
||||
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// We also add in any benefits from specials that aren't covered above
|
||||
if (m.blueprint && m.blueprint.special) {
|
||||
for (const feature in Modifications.modifierActions[m.blueprint.special.edname]) {
|
||||
if (!blueprint.features[feature] && !m.mods.feature) {
|
||||
const featureDef = Modifications.modifications[feature];
|
||||
if (featureDef && !featureDef.hidden) {
|
||||
let symbol = '';
|
||||
if (feature === 'jitter') {
|
||||
symbol = '°';
|
||||
} else if (featureDef.type === 'percentage') {
|
||||
symbol = '%';
|
||||
}
|
||||
let current = m.getModValue(feature);
|
||||
if (featureDef.type === 'percentage' || featureDef.name === 'burst' || featureDef.name === 'burstrof') {
|
||||
current = Math.round(current / 10) / 10;
|
||||
} else if (featureDef.type === 'numeric') {
|
||||
current /= 100;
|
||||
}
|
||||
const currentIsBeneficial = isValueBeneficial(feature, current);
|
||||
effects.push(
|
||||
<tr key={feature}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(feature, grp)}</td>
|
||||
<td> </td>
|
||||
<td className={current === 0 ? '' : currentIsBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>{current}{symbol}</td>
|
||||
<td> </td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
export function blueprintTooltip(language, m, previewBP, previewGrade) {
|
||||
const { translate, formats } = language;
|
||||
const blueprint = previewBP || m.getBlueprint();
|
||||
const grade = previewGrade || m.getBlueprintGrade();
|
||||
if (!blueprint) {
|
||||
return null;
|
||||
}
|
||||
|
||||
let components;
|
||||
if (!m) {
|
||||
components = [];
|
||||
for (const component in blueprint.components) {
|
||||
components.push(
|
||||
<tr key={component}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(component)}</td>
|
||||
<td style={{ textAlign: 'right' }}>{blueprint.components[component]}</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
let engineersList;
|
||||
if (engineers) {
|
||||
engineersList = [];
|
||||
for (const engineer of engineers) {
|
||||
engineersList.push(
|
||||
<tr key={engineer}>
|
||||
<td style={{ textAlign: 'left' }}>{engineer}</td>
|
||||
</tr>
|
||||
);
|
||||
}
|
||||
}
|
||||
const bpFeatures = getBlueprintInfo(blueprint).features[grade];
|
||||
const features = uniq(m.getModifiedProperties().concat(keys(bpFeatures)));
|
||||
|
||||
return (
|
||||
<div>
|
||||
<table width='100%'>
|
||||
<thead>
|
||||
<tr>
|
||||
<td>{translate('feature')}</td>
|
||||
<td>{translate('worst')}</td>
|
||||
{m ? <td>{translate('current')}</td> : null }
|
||||
<td>{translate('best')}</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td>{translate('feature')}</td>
|
||||
<td>{translate('worst')}</td>
|
||||
<td>{translate('current')}</td>
|
||||
<td>{translate('best')}</td>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{effects}
|
||||
{features.map((prop) => {
|
||||
const { min, max, only } = bpFeatures[prop] || {};
|
||||
// Skip this property if it doesn't apply to this module
|
||||
if (only && !m.getItem().match(only)) {
|
||||
return null;
|
||||
}
|
||||
const { value, unit, beneficial } = m.getModifierFormatted(prop);
|
||||
if (!bpFeatures[prop] && !value) {
|
||||
// Can happen for exported synthetics
|
||||
return null;
|
||||
}
|
||||
// If the product of value and min/max is positive, both values
|
||||
// point into the same direction, i.e. positive/negative.
|
||||
const minBeneficial = (value * min) > 0 === beneficial;
|
||||
const maxBeneficial = (value * max) > 0 === beneficial;
|
||||
return (<tr key={prop}>
|
||||
<td style={{ textAlign: 'left' }}>{translate(prop)}</td>
|
||||
<td className={!min ? '' : minBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
|
||||
{!isNaN(min) && formats.round(min * 100)}{!isNaN(min) && unit}
|
||||
</td>
|
||||
<td className={!value ? '' : beneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
|
||||
{formats.round(value || 0)}{unit}
|
||||
</td>
|
||||
<td className={!max ? '' : maxBeneficial ? 'secondary' : 'warning'} style={{ textAlign: 'right' }}>
|
||||
{!isNaN(max) && formats.round(max * 100)}{!isNaN(max) && unit}
|
||||
</td>
|
||||
</tr>);
|
||||
})}
|
||||
</tbody>
|
||||
</table>
|
||||
{ components ? <table width='100%'>
|
||||
<thead>
|
||||
<tr>
|
||||
<td>{translate('component')}</td>
|
||||
<td>{translate('amount')}</td>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{components}
|
||||
</tbody>
|
||||
</table> : null }
|
||||
{ engineersList ? <table width='100%'>
|
||||
<thead>
|
||||
<tr>
|
||||
<td>{translate('engineers')}</td>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
{engineersList}
|
||||
</tbody>
|
||||
</table> : null }
|
||||
</div>
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Is this blueprint feature beneficial?
|
||||
* @param {string} feature The name of the feature
|
||||
* @param {array} values The value of the feature
|
||||
* @returns {boolean} True if this feature is beneficial
|
||||
*/
|
||||
export function isBeneficial(feature, values) {
|
||||
const fact = (values[0] < 0 || (values[0] === 0 && values[1] < 0));
|
||||
if (Modifications.modifications[feature].higherbetter) {
|
||||
return !fact;
|
||||
} else {
|
||||
return fact;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Is this feature value beneficial?
|
||||
* @param {string} feature The name of the feature
|
||||
* @param {number} value The value of the feature
|
||||
* @returns {boolean} True if this value is beneficial
|
||||
*/
|
||||
export function isValueBeneficial(feature, value) {
|
||||
if (Modifications.modifications[feature].higherbetter) {
|
||||
return value > 0;
|
||||
} else {
|
||||
return value < 0;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Get a blueprint with a given name and an optional module
|
||||
* @param {string} name The name of the blueprint
|
||||
@@ -289,143 +117,11 @@ export function isValueBeneficial(feature, value) {
|
||||
*/
|
||||
export function getBlueprint(name, module) {
|
||||
// Start with a copy of the blueprint
|
||||
const findMod = val => Object.keys(Modifications.blueprints).find(elem => elem.toString().toLowerCase().search(val.toString().toLowerCase().replace(/(OutfittingFieldType_|persecond)/igm, '')) >= 0)
|
||||
const findMod = val => Object.keys(Modifications.blueprints).find(elem => elem.toString().toLowerCase().search(val.toString().toLowerCase().replace(/(OutfittingFieldType_|persecond)/igm, '')) >= 0);
|
||||
const found = Modifications.blueprints[findMod(name)];
|
||||
if (!found || !found.fdname) {
|
||||
return {};
|
||||
}
|
||||
const blueprint = JSON.parse(JSON.stringify(found));
|
||||
if (module) {
|
||||
if (module.grp === 'sb') {
|
||||
// Shield boosters are treated internally as straight modifiers, so rather than (for example)
|
||||
// being a 4% boost they are a 104% multiplier. We need to fix the values here so that they look
|
||||
// accurate as per the information in Elite
|
||||
for (const grade in blueprint.grades) {
|
||||
for (const feature in blueprint.grades[grade].features) {
|
||||
if (feature === 'shieldboost') {
|
||||
blueprint.grades[grade].features[feature][0] = ((1 + blueprint.grades[grade].features[feature][0]) * (1 + module.shieldboost) - 1) / module.shieldboost - 1;
|
||||
blueprint.grades[grade].features[feature][1] = ((1 + blueprint.grades[grade].features[feature][1]) * (1 + module.shieldboost) - 1) / module.shieldboost - 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return blueprint;
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide 'percent' primary modifications
|
||||
* @param {Object} ship The ship for which to perform the modifications
|
||||
* @param {Object} m The module for which to perform the modifications
|
||||
* @param {Number} percent The percent to set values to of full.
|
||||
*/
|
||||
export function setPercent(ship, m, percent) {
|
||||
ship.clearModifications(m);
|
||||
// Pick given value as multiplier
|
||||
const mult = percent / 100;
|
||||
const features = m.blueprint.grades[m.blueprint.grade].features;
|
||||
for (const featureName in features) {
|
||||
let value;
|
||||
if (Modifications.modifications[featureName].higherbetter) {
|
||||
// Higher is better, but is this making it better or worse?
|
||||
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
|
||||
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
|
||||
} else {
|
||||
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
|
||||
}
|
||||
} else {
|
||||
// Higher is worse, but is this making it better or worse?
|
||||
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
|
||||
value = features[featureName][0] + ((features[featureName][1] - features[featureName][0]) * mult);
|
||||
} else {
|
||||
value = features[featureName][1] + ((features[featureName][0] - features[featureName][1]) * mult);
|
||||
}
|
||||
}
|
||||
|
||||
_setValue(ship, m, featureName, value);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide 'random' primary modifications
|
||||
* @param {Object} ship The ship for which to perform the modifications
|
||||
* @param {Object} m The module for which to perform the modifications
|
||||
*/
|
||||
export function setRandom(ship, m) {
|
||||
// Pick a single value for our randomness
|
||||
setPercent(ship, m, Math.random() * 100);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set a modification feature value
|
||||
* @param {Object} ship The ship for which to perform the modifications
|
||||
* @param {Object} m The module for which to perform the modifications
|
||||
* @param {string} featureName The feature being set
|
||||
* @param {number} value The value being set for the feature
|
||||
*/
|
||||
function _setValue(ship, m, featureName, value) {
|
||||
if (Modifications.modifications[featureName].type == 'percentage') {
|
||||
ship.setModification(m, featureName, value * 10000);
|
||||
} else if (Modifications.modifications[featureName].type == 'numeric') {
|
||||
ship.setModification(m, featureName, value * 100);
|
||||
} else {
|
||||
ship.setModification(m, featureName, value);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Provide 'percent' primary query
|
||||
* @param {Object} m The module for which to perform the query
|
||||
* @returns {Number} percent The percentage indicator of current applied values.
|
||||
*/
|
||||
export function getPercent(m) {
|
||||
let result = null;
|
||||
const features = m.blueprint.grades[m.blueprint.grade].features;
|
||||
for (const featureName in features) {
|
||||
|
||||
if (features[featureName][0] === features[featureName][1]) {
|
||||
continue;
|
||||
}
|
||||
|
||||
let value = _getValue(m, featureName);
|
||||
let mult;
|
||||
if (Modifications.modifications[featureName].higherbetter) {
|
||||
// Higher is better, but is this making it better or worse?
|
||||
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
|
||||
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
|
||||
} else {
|
||||
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
|
||||
}
|
||||
} else {
|
||||
// Higher is worse, but is this making it better or worse?
|
||||
if (features[featureName][0] < 0 || (features[featureName][0] === 0 && features[featureName][1] < 0)) {
|
||||
mult = Math.round((value - features[featureName][0]) / (features[featureName][1] - features[featureName][0]) * 100);
|
||||
} else {
|
||||
mult = Math.round((value - features[featureName][1]) / (features[featureName][0] - features[featureName][1]) * 100);
|
||||
}
|
||||
}
|
||||
|
||||
if (result && result != mult) {
|
||||
return null;
|
||||
} else if (result != mult) {
|
||||
result = mult;
|
||||
}
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Query a feature value
|
||||
* @param {Object} m The module for which to perform the query
|
||||
* @param {string} featureName The feature being queried
|
||||
*/
|
||||
function _getValue(m, featureName) {
|
||||
if (Modifications.modifications[featureName].type == 'percentage') {
|
||||
return m.getModValue(featureName, true) / 10000;
|
||||
} else if (Modifications.modifications[featureName].type == 'numeric') {
|
||||
return m.getModValue(featureName, true) / 100;
|
||||
} else {
|
||||
return m.getModValue(featureName, true);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -6,7 +6,7 @@ import { getBlueprint } from '../utils/BlueprintFunctions';
|
||||
import * as ModuleUtils from '../shipyard/ModuleUtils';
|
||||
|
||||
// mapping from fd's ship model names to coriolis'
|
||||
const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
|
||||
export const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
|
||||
'Adder': 'adder',
|
||||
'Anaconda': 'anaconda',
|
||||
'Asp': 'asp',
|
||||
@@ -29,6 +29,9 @@ const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
|
||||
'FerDeLance': 'fer_de_lance',
|
||||
'Hauler': 'hauler',
|
||||
'Independant_Trader': 'keelback',
|
||||
'Krait_MkII': 'krait_mkii',
|
||||
'Mamba': 'mamba',
|
||||
'Krait_Light': 'krait_phantom',
|
||||
'Orca': 'orca',
|
||||
'Python': 'python',
|
||||
'SideWinder': 'sidewinder',
|
||||
@@ -37,6 +40,8 @@ const SHIP_FD_NAME_TO_CORIOLIS_NAME = {
|
||||
'Type9': 'type_9_heavy',
|
||||
'Type9_Military': 'type_10_defender',
|
||||
'TypeX': 'alliance_chieftain',
|
||||
'TypeX_2': 'alliance_crusader',
|
||||
'TypeX_3': 'alliance_challenger',
|
||||
'Viper': 'viper',
|
||||
'Viper_MkIV': 'viper_mk_iv',
|
||||
'Vulture': 'vulture'
|
||||
@@ -318,7 +323,7 @@ function _addModifications(module, modifiers, blueprint, grade, specialModificat
|
||||
if (!modifiers) return;
|
||||
let special;
|
||||
if (specialModifications) {
|
||||
special = Modifications.specials[Object.keys(specialModifications)[0]]
|
||||
special = Modifications.specials[Object.keys(specialModifications)[0]];
|
||||
}
|
||||
for (const i in modifiers) {
|
||||
// Some special modifications
|
||||
@@ -345,7 +350,7 @@ function _addModifications(module, modifiers, blueprint, grade, specialModificat
|
||||
let value;
|
||||
if (i === 'OutfittingFieldType_DefenceModifierShieldMultiplier') {
|
||||
value = modifiers[i].value - 1;
|
||||
} else if (i === 'OutfittingFieldType_DefenceModifierHealthMultiplier' && blueprint.startsWith('Armour_')) {
|
||||
} else if (i === 'OutfittingFieldType_DefenceModifierHealthMultiplier' && blueprint.startsWith('Armour_')) {
|
||||
value = (modifiers[i].value - module.hullboost) / module.hullboost;
|
||||
} else if (i === 'OutfittingFieldType_DefenceModifierHealthMultiplier') {
|
||||
value = modifiers[i].value / module.hullboost;
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user